diff --git a/.gitignore b/.gitignore index 198e80139..599b52b9e 100644 --- a/.gitignore +++ b/.gitignore @@ -5,6 +5,7 @@ /*.ez /test/uploads /.elixir_ls +/test/fixtures/DSCN0010_tmp.jpg /test/fixtures/test_tmp.txt /test/fixtures/image_tmp.jpg /test/tmp/ diff --git a/.gitlab-ci.yml b/.gitlab-ci.yml index 685106969..29eb8d6b9 100644 --- a/.gitlab-ci.yml +++ b/.gitlab-ci.yml @@ -1,4 +1,4 @@ -image: elixir:1.8.1 +image: elixir:1.9.4 variables: &global_variables POSTGRES_DB: pleroma_test @@ -22,6 +22,7 @@ stages: - docker before_script: + - apt-get update && apt-get install -y cmake - mix local.hex --force - mix local.rebar --force - apt-get -qq update @@ -60,6 +61,7 @@ unit-testing: alias: postgres command: ["postgres", "-c", "fsync=off", "-c", "synchronous_commit=off", "-c", "full_page_writes=off"] script: + - apt-get update && apt-get install -y libimage-exiftool-perl - mix deps.get - mix ecto.create - mix ecto.migrate @@ -93,6 +95,7 @@ unit-testing-rum: <<: *global_variables RUM_ENABLED: "true" script: + - apt-get update && apt-get install -y libimage-exiftool-perl - mix deps.get - mix ecto.create - mix ecto.migrate @@ -172,8 +175,7 @@ stop_review_app: amd64: stage: release - # TODO: Replace with upstream image when 1.9.0 comes out - image: rinpatch/elixir:1.9.0-rc.0 + image: elixir:1.10.3 only: &release-only - stable@pleroma/pleroma - develop@pleroma/pleroma @@ -196,6 +198,7 @@ amd64: variables: &release-variables MIX_ENV: prod before_script: &before-release + - apt-get update && apt-get install -y cmake - echo "import Mix.Config" > config/prod.secret.exs - mix local.hex --force - mix local.rebar --force @@ -210,12 +213,11 @@ amd64-musl: stage: release artifacts: *release-artifacts only: *release-only - # TODO: Replace with upstream image when 1.9.0 comes out - image: rinpatch/elixir:1.9.0-rc.0-alpine + image: elixir:1.10.3-alpine cache: *release-cache variables: *release-variables before_script: &before-release-musl - - apk add git gcc g++ musl-dev make + - apk add git gcc g++ musl-dev make cmake - echo "import Mix.Config" > config/prod.secret.exs - mix local.hex --force - mix local.rebar --force @@ -227,8 +229,7 @@ arm: only: *release-only tags: - arm32 - # TODO: Replace with upstream image when 1.9.0 comes out - image: rinpatch/elixir:1.9.0-rc.0-arm + image: elixir:1.10.3 cache: *release-cache variables: *release-variables before_script: *before-release @@ -240,8 +241,7 @@ arm-musl: only: *release-only tags: - arm32 - # TODO: Replace with upstream image when 1.9.0 comes out - image: rinpatch/elixir:1.9.0-rc.0-arm-alpine + image: elixir:1.10.3-alpine cache: *release-cache variables: *release-variables before_script: *before-release-musl @@ -253,8 +253,7 @@ arm64: only: *release-only tags: - arm - # TODO: Replace with upstream image when 1.9.0 comes out - image: rinpatch/elixir:1.9.0-rc.0-arm64 + image: elixir:1.10.3 cache: *release-cache variables: *release-variables before_script: *before-release @@ -267,7 +266,7 @@ arm64-musl: tags: - arm # TODO: Replace with upstream image when 1.9.0 comes out - image: rinpatch/elixir:1.9.0-rc.0-arm64-alpine + image: elixir:1.10.3-alpine cache: *release-cache variables: *release-variables before_script: *before-release-musl @@ -285,6 +284,8 @@ docker: IMAGE_TAG_SLUG: $CI_REGISTRY_IMAGE:$CI_COMMIT_REF_SLUG IMAGE_TAG_LATEST: $CI_REGISTRY_IMAGE:latest IMAGE_TAG_LATEST_STABLE: $CI_REGISTRY_IMAGE:latest-stable + DOCKER_BUILDX_URL: https://github.com/docker/buildx/releases/download/v0.4.1/buildx-v0.4.1.linux-amd64 + DOCKER_BUILDX_HASH: 71a7d01439aa8c165a25b59c44d3f016fddbd98b before_script: &before-docker - docker login -u $CI_REGISTRY_USER -p $CI_REGISTRY_PASSWORD $CI_REGISTRY - docker pull $IMAGE_TAG_SLUG || true @@ -292,10 +293,14 @@ docker: - export CI_VCS_REF=$CI_COMMIT_SHORT_SHA allow_failure: true script: - - docker build --cache-from $IMAGE_TAG_SLUG --build-arg VCS_REF=$CI_VCS_REF --build-arg BUILD_DATE=$CI_JOB_TIMESTAMP -t $IMAGE_TAG -t $IMAGE_TAG_SLUG -t $IMAGE_TAG_LATEST . - - docker push $IMAGE_TAG - - docker push $IMAGE_TAG_SLUG - - docker push $IMAGE_TAG_LATEST + - mkdir -p /root/.docker/cli-plugins + - wget "${DOCKER_BUILDX_URL}" -O ~/.docker/cli-plugins/docker-buildx + - echo "${DOCKER_BUILDX_HASH} /root/.docker/cli-plugins/docker-buildx" | sha1sum -c + - chmod +x ~/.docker/cli-plugins/docker-buildx + - docker run --rm --privileged multiarch/qemu-user-static --reset -p yes + - docker buildx create --name mbuilder --driver docker-container --use + - docker buildx inspect --bootstrap + - docker buildx build --platform linux/amd64,linux/arm/v7,linux/arm64/v8 --push --cache-from $IMAGE_TAG_SLUG --build-arg VCS_REF=$CI_VCS_REF --build-arg BUILD_DATE=$CI_JOB_TIMESTAMP -t $IMAGE_TAG -t $IMAGE_TAG_SLUG -t $IMAGE_TAG_LATEST . tags: - dind only: @@ -310,10 +315,14 @@ docker-stable: before_script: *before-docker allow_failure: true script: - - docker build --cache-from $IMAGE_TAG_SLUG --build-arg VCS_REF=$CI_VCS_REF --build-arg BUILD_DATE=$CI_JOB_TIMESTAMP -t $IMAGE_TAG -t $IMAGE_TAG_SLUG -t $IMAGE_TAG_LATEST_STABLE . - - docker push $IMAGE_TAG - - docker push $IMAGE_TAG_SLUG - - docker push $IMAGE_TAG_LATEST_STABLE + - mkdir -p /root/.docker/cli-plugins + - wget "${DOCKER_BUILDX_URL}" -O ~/.docker/cli-plugins/docker-buildx + - echo "${DOCKER_BUILDX_HASH} /root/.docker/cli-plugins/docker-buildx" | sha1sum -c + - chmod +x ~/.docker/cli-plugins/docker-buildx + - docker run --rm --privileged multiarch/qemu-user-static --reset -p yes + - docker buildx create --name mbuilder --driver docker-container --use + - docker buildx inspect --bootstrap + - docker buildx build --platform linux/amd64,linux/arm/v7,linux/arm64/v8 --push --cache-from $IMAGE_TAG_SLUG --build-arg VCS_REF=$CI_VCS_REF --build-arg BUILD_DATE=$CI_JOB_TIMESTAMP -t $IMAGE_TAG -t $IMAGE_TAG_SLUG -t $IMAGE_TAG_LATEST_STABLE . tags: - dind only: @@ -328,9 +337,15 @@ docker-release: before_script: *before-docker allow_failure: true script: - - docker build --cache-from $IMAGE_TAG_SLUG --build-arg VCS_REF=$CI_VCS_REF --build-arg BUILD_DATE=$CI_JOB_TIMESTAMP -t $IMAGE_TAG -t $IMAGE_TAG_SLUG . - - docker push $IMAGE_TAG - - docker push $IMAGE_TAG_SLUG + script: + - mkdir -p /root/.docker/cli-plugins + - wget "${DOCKER_BUILDX_URL}" -O ~/.docker/cli-plugins/docker-buildx + - echo "${DOCKER_BUILDX_HASH} /root/.docker/cli-plugins/docker-buildx" | sha1sum -c + - chmod +x ~/.docker/cli-plugins/docker-buildx + - docker run --rm --privileged multiarch/qemu-user-static --reset -p yes + - docker buildx create --name mbuilder --driver docker-container --use + - docker buildx inspect --bootstrap + - docker buildx build --platform linux/amd64,linux/arm/v7,linux/arm64/v8 --push --cache-from $IMAGE_TAG_SLUG --build-arg VCS_REF=$CI_VCS_REF --build-arg BUILD_DATE=$CI_JOB_TIMESTAMP -t $IMAGE_TAG -t $IMAGE_TAG_SLUG . tags: - dind only: diff --git a/.gitlab/issue_templates/Bug.md b/.gitlab/issue_templates/Bug.md index 66fbc510e..dd0d6eb24 100644 --- a/.gitlab/issue_templates/Bug.md +++ b/.gitlab/issue_templates/Bug.md @@ -8,13 +8,11 @@ ### Environment -* Installation type: - - [ ] OTP - - [ ] From source +* Installation type (OTP or From Source): * Pleroma version (could be found in the "Version" tab of settings in Pleroma-FE): * Elixir version (`elixir -v` for from source installations, N/A for OTP): * Operating system: -* PostgreSQL version (`postgres -V`): +* PostgreSQL version (`psql -V`): ### Bug description diff --git a/.gitlab/merge_request_templates/Release.md b/.gitlab/merge_request_templates/Release.md index 237f74e00..b2c772696 100644 --- a/.gitlab/merge_request_templates/Release.md +++ b/.gitlab/merge_request_templates/Release.md @@ -3,3 +3,4 @@ * [ ] Compile a changelog * [ ] Create an MR with an announcement to pleroma.social * [ ] Tag the release +* [ ] Merge `stable` into `develop` (in case the fixes are already in develop, use `git merge -s ours --no-commit` and manually merge the changelogs) diff --git a/CC-BY-4.0 b/CC-BY-4.0 new file mode 100644 index 000000000..4ea99c213 --- /dev/null +++ b/CC-BY-4.0 @@ -0,0 +1,395 @@ +Attribution 4.0 International + +======================================================================= + +Creative Commons Corporation ("Creative Commons") is not a law firm and +does not provide legal services or legal advice. Distribution of +Creative Commons public licenses does not create a lawyer-client or +other relationship. Creative Commons makes its licenses and related +information available on an "as-is" basis. Creative Commons gives no +warranties regarding its licenses, any material licensed under their +terms and conditions, or any related information. Creative Commons +disclaims all liability for damages resulting from their use to the +fullest extent possible. + +Using Creative Commons Public Licenses + +Creative Commons public licenses provide a standard set of terms and +conditions that creators and other rights holders may use to share +original works of authorship and other material subject to copyright +and certain other rights specified in the public license below. The +following considerations are for informational purposes only, are not +exhaustive, and do not form part of our licenses. + + Considerations for licensors: Our public licenses are + intended for use by those authorized to give the public + permission to use material in ways otherwise restricted by + copyright and certain other rights. Our licenses are + irrevocable. Licensors should read and understand the terms + and conditions of the license they choose before applying it. + Licensors should also secure all rights necessary before + applying our licenses so that the public can reuse the + material as expected. Licensors should clearly mark any + material not subject to the license. This includes other CC- + licensed material, or material used under an exception or + limitation to copyright. More considerations for licensors: + wiki.creativecommons.org/Considerations_for_licensors + + Considerations for the public: By using one of our public + licenses, a licensor grants the public permission to use the + licensed material under specified terms and conditions. If + the licensor's permission is not necessary for any reason--for + example, because of any applicable exception or limitation to + copyright--then that use is not regulated by the license. Our + licenses grant only permissions under copyright and certain + other rights that a licensor has authority to grant. Use of + the licensed material may still be restricted for other + reasons, including because others have copyright or other + rights in the material. A licensor may make special requests, + such as asking that all changes be marked or described. + Although not required by our licenses, you are encouraged to + respect those requests where reasonable. More considerations + for the public: + wiki.creativecommons.org/Considerations_for_licensees + +======================================================================= + +Creative Commons Attribution 4.0 International Public License + +By exercising the Licensed Rights (defined below), You accept and agree +to be bound by the terms and conditions of this Creative Commons +Attribution 4.0 International Public License ("Public License"). To the +extent this Public License may be interpreted as a contract, You are +granted the Licensed Rights in consideration of Your acceptance of +these terms and conditions, and the Licensor grants You such rights in +consideration of benefits the Licensor receives from making the +Licensed Material available under these terms and conditions. + + +Section 1 -- Definitions. + + a. Adapted Material means material subject to Copyright and Similar + Rights that is derived from or based upon the Licensed Material + and in which the Licensed Material is translated, altered, + arranged, transformed, or otherwise modified in a manner requiring + permission under the Copyright and Similar Rights held by the + Licensor. For purposes of this Public License, where the Licensed + Material is a musical work, performance, or sound recording, + Adapted Material is always produced where the Licensed Material is + synched in timed relation with a moving image. + + b. Adapter's License means the license You apply to Your Copyright + and Similar Rights in Your contributions to Adapted Material in + accordance with the terms and conditions of this Public License. + + c. Copyright and Similar Rights means copyright and/or similar rights + closely related to copyright including, without limitation, + performance, broadcast, sound recording, and Sui Generis Database + Rights, without regard to how the rights are labeled or + categorized. For purposes of this Public License, the rights + specified in Section 2(b)(1)-(2) are not Copyright and Similar + Rights. + + d. Effective Technological Measures means those measures that, in the + absence of proper authority, may not be circumvented under laws + fulfilling obligations under Article 11 of the WIPO Copyright + Treaty adopted on December 20, 1996, and/or similar international + agreements. + + e. Exceptions and Limitations means fair use, fair dealing, and/or + any other exception or limitation to Copyright and Similar Rights + that applies to Your use of the Licensed Material. + + f. Licensed Material means the artistic or literary work, database, + or other material to which the Licensor applied this Public + License. + + g. Licensed Rights means the rights granted to You subject to the + terms and conditions of this Public License, which are limited to + all Copyright and Similar Rights that apply to Your use of the + Licensed Material and that the Licensor has authority to license. + + h. Licensor means the individual(s) or entity(ies) granting rights + under this Public License. + + i. Share means to provide material to the public by any means or + process that requires permission under the Licensed Rights, such + as reproduction, public display, public performance, distribution, + dissemination, communication, or importation, and to make material + available to the public including in ways that members of the + public may access the material from a place and at a time + individually chosen by them. + + j. Sui Generis Database Rights means rights other than copyright + resulting from Directive 96/9/EC of the European Parliament and of + the Council of 11 March 1996 on the legal protection of databases, + as amended and/or succeeded, as well as other essentially + equivalent rights anywhere in the world. + + k. You means the individual or entity exercising the Licensed Rights + under this Public License. Your has a corresponding meaning. + + +Section 2 -- Scope. + + a. License grant. + + 1. Subject to the terms and conditions of this Public License, + the Licensor hereby grants You a worldwide, royalty-free, + non-sublicensable, non-exclusive, irrevocable license to + exercise the Licensed Rights in the Licensed Material to: + + a. reproduce and Share the Licensed Material, in whole or + in part; and + + b. produce, reproduce, and Share Adapted Material. + + 2. Exceptions and Limitations. For the avoidance of doubt, where + Exceptions and Limitations apply to Your use, this Public + License does not apply, and You do not need to comply with + its terms and conditions. + + 3. Term. The term of this Public License is specified in Section + 6(a). + + 4. Media and formats; technical modifications allowed. The + Licensor authorizes You to exercise the Licensed Rights in + all media and formats whether now known or hereafter created, + and to make technical modifications necessary to do so. The + Licensor waives and/or agrees not to assert any right or + authority to forbid You from making technical modifications + necessary to exercise the Licensed Rights, including + technical modifications necessary to circumvent Effective + Technological Measures. For purposes of this Public License, + simply making modifications authorized by this Section 2(a) + (4) never produces Adapted Material. + + 5. Downstream recipients. + + a. Offer from the Licensor -- Licensed Material. Every + recipient of the Licensed Material automatically + receives an offer from the Licensor to exercise the + Licensed Rights under the terms and conditions of this + Public License. + + b. No downstream restrictions. You may not offer or impose + any additional or different terms or conditions on, or + apply any Effective Technological Measures to, the + Licensed Material if doing so restricts exercise of the + Licensed Rights by any recipient of the Licensed + Material. + + 6. No endorsement. Nothing in this Public License constitutes or + may be construed as permission to assert or imply that You + are, or that Your use of the Licensed Material is, connected + with, or sponsored, endorsed, or granted official status by, + the Licensor or others designated to receive attribution as + provided in Section 3(a)(1)(A)(i). + + b. Other rights. + + 1. Moral rights, such as the right of integrity, are not + licensed under this Public License, nor are publicity, + privacy, and/or other similar personality rights; however, to + the extent possible, the Licensor waives and/or agrees not to + assert any such rights held by the Licensor to the limited + extent necessary to allow You to exercise the Licensed + Rights, but not otherwise. + + 2. Patent and trademark rights are not licensed under this + Public License. + + 3. To the extent possible, the Licensor waives any right to + collect royalties from You for the exercise of the Licensed + Rights, whether directly or through a collecting society + under any voluntary or waivable statutory or compulsory + licensing scheme. In all other cases the Licensor expressly + reserves any right to collect such royalties. + + +Section 3 -- License Conditions. + +Your exercise of the Licensed Rights is expressly made subject to the +following conditions. + + a. Attribution. + + 1. If You Share the Licensed Material (including in modified + form), You must: + + a. retain the following if it is supplied by the Licensor + with the Licensed Material: + + i. identification of the creator(s) of the Licensed + Material and any others designated to receive + attribution, in any reasonable manner requested by + the Licensor (including by pseudonym if + designated); + + ii. a copyright notice; + + iii. a notice that refers to this Public License; + + iv. a notice that refers to the disclaimer of + warranties; + + v. a URI or hyperlink to the Licensed Material to the + extent reasonably practicable; + + b. indicate if You modified the Licensed Material and + retain an indication of any previous modifications; and + + c. indicate the Licensed Material is licensed under this + Public License, and include the text of, or the URI or + hyperlink to, this Public License. + + 2. You may satisfy the conditions in Section 3(a)(1) in any + reasonable manner based on the medium, means, and context in + which You Share the Licensed Material. For example, it may be + reasonable to satisfy the conditions by providing a URI or + hyperlink to a resource that includes the required + information. + + 3. If requested by the Licensor, You must remove any of the + information required by Section 3(a)(1)(A) to the extent + reasonably practicable. + + 4. If You Share Adapted Material You produce, the Adapter's + License You apply must not prevent recipients of the Adapted + Material from complying with this Public License. + + +Section 4 -- Sui Generis Database Rights. + +Where the Licensed Rights include Sui Generis Database Rights that +apply to Your use of the Licensed Material: + + a. for the avoidance of doubt, Section 2(a)(1) grants You the right + to extract, reuse, reproduce, and Share all or a substantial + portion of the contents of the database; + + b. if You include all or a substantial portion of the database + contents in a database in which You have Sui Generis Database + Rights, then the database in which You have Sui Generis Database + Rights (but not its individual contents) is Adapted Material; and + + c. You must comply with the conditions in Section 3(a) if You Share + all or a substantial portion of the contents of the database. + +For the avoidance of doubt, this Section 4 supplements and does not +replace Your obligations under this Public License where the Licensed +Rights include other Copyright and Similar Rights. + + +Section 5 -- Disclaimer of Warranties and Limitation of Liability. + + a. UNLESS OTHERWISE SEPARATELY UNDERTAKEN BY THE LICENSOR, TO THE + EXTENT POSSIBLE, THE LICENSOR OFFERS THE LICENSED MATERIAL AS-IS + AND AS-AVAILABLE, AND MAKES NO REPRESENTATIONS OR WARRANTIES OF + ANY KIND CONCERNING THE LICENSED MATERIAL, WHETHER EXPRESS, + IMPLIED, STATUTORY, OR OTHER. THIS INCLUDES, WITHOUT LIMITATION, + WARRANTIES OF TITLE, MERCHANTABILITY, FITNESS FOR A PARTICULAR + PURPOSE, NON-INFRINGEMENT, ABSENCE OF LATENT OR OTHER DEFECTS, + ACCURACY, OR THE PRESENCE OR ABSENCE OF ERRORS, WHETHER OR NOT + KNOWN OR DISCOVERABLE. WHERE DISCLAIMERS OF WARRANTIES ARE NOT + ALLOWED IN FULL OR IN PART, THIS DISCLAIMER MAY NOT APPLY TO YOU. + + b. TO THE EXTENT POSSIBLE, IN NO EVENT WILL THE LICENSOR BE LIABLE + TO YOU ON ANY LEGAL THEORY (INCLUDING, WITHOUT LIMITATION, + NEGLIGENCE) OR OTHERWISE FOR ANY DIRECT, SPECIAL, INDIRECT, + INCIDENTAL, CONSEQUENTIAL, PUNITIVE, EXEMPLARY, OR OTHER LOSSES, + COSTS, EXPENSES, OR DAMAGES ARISING OUT OF THIS PUBLIC LICENSE OR + USE OF THE LICENSED MATERIAL, EVEN IF THE LICENSOR HAS BEEN + ADVISED OF THE POSSIBILITY OF SUCH LOSSES, COSTS, EXPENSES, OR + DAMAGES. WHERE A LIMITATION OF LIABILITY IS NOT ALLOWED IN FULL OR + IN PART, THIS LIMITATION MAY NOT APPLY TO YOU. + + c. The disclaimer of warranties and limitation of liability provided + above shall be interpreted in a manner that, to the extent + possible, most closely approximates an absolute disclaimer and + waiver of all liability. + + +Section 6 -- Term and Termination. + + a. This Public License applies for the term of the Copyright and + Similar Rights licensed here. However, if You fail to comply with + this Public License, then Your rights under this Public License + terminate automatically. + + b. Where Your right to use the Licensed Material has terminated under + Section 6(a), it reinstates: + + 1. automatically as of the date the violation is cured, provided + it is cured within 30 days of Your discovery of the + violation; or + + 2. upon express reinstatement by the Licensor. + + For the avoidance of doubt, this Section 6(b) does not affect any + right the Licensor may have to seek remedies for Your violations + of this Public License. + + c. For the avoidance of doubt, the Licensor may also offer the + Licensed Material under separate terms or conditions or stop + distributing the Licensed Material at any time; however, doing so + will not terminate this Public License. + + d. Sections 1, 5, 6, 7, and 8 survive termination of this Public + License. + + +Section 7 -- Other Terms and Conditions. + + a. The Licensor shall not be bound by any additional or different + terms or conditions communicated by You unless expressly agreed. + + b. Any arrangements, understandings, or agreements regarding the + Licensed Material not stated herein are separate from and + independent of the terms and conditions of this Public License. + + +Section 8 -- Interpretation. + + a. For the avoidance of doubt, this Public License does not, and + shall not be interpreted to, reduce, limit, restrict, or impose + conditions on any use of the Licensed Material that could lawfully + be made without permission under this Public License. + + b. To the extent possible, if any provision of this Public License is + deemed unenforceable, it shall be automatically reformed to the + minimum extent necessary to make it enforceable. If the provision + cannot be reformed, it shall be severed from this Public License + without affecting the enforceability of the remaining terms and + conditions. + + c. No term or condition of this Public License will be waived and no + failure to comply consented to unless expressly agreed to by the + Licensor. + + d. Nothing in this Public License constitutes or may be interpreted + as a limitation upon, or waiver of, any privileges and immunities + that apply to the Licensor or You, including from the legal + processes of any jurisdiction or authority. + + +======================================================================= + +Creative Commons is not a party to its public +licenses. Notwithstanding, Creative Commons may elect to apply one of +its public licenses to material it publishes and in those instances +will be considered the “Licensor.” The text of the Creative Commons +public licenses is dedicated to the public domain under the CC0 Public +Domain Dedication. Except for the limited purpose of indicating that +material is shared under a Creative Commons public license or as +otherwise permitted by the Creative Commons policies published at +creativecommons.org/policies, Creative Commons does not authorize the +use of the trademark "Creative Commons" or any other trademark or logo +of Creative Commons without its prior written consent including, +without limitation, in connection with any unauthorized modifications +to any of its public licenses or any other arrangements, +understandings, or agreements concerning use of licensed material. For +the avoidance of doubt, this paragraph does not form part of the +public licenses. + +Creative Commons may be contacted at creativecommons.org. diff --git a/CHANGELOG.md b/CHANGELOG.md index 8925f31f6..a5c75bd4f 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -3,21 +3,105 @@ All notable changes to this project will be documented in this file. The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). -## [unreleased] +## Unreleased ### Changed + +- **Breaking** Requires `libmagic` (or `file`) to guess file types. +- Renamed `:await_up_timeout` in `:connections_pool` namespace to `:connect_timeout`, old name is deprecated. +- Renamed `:timeout` in `pools` namespace to `:recv_timeout`, old name is deprecated. + +### Removed + +- **Breaking:** `Pleroma.Workers.Cron.StatsWorker` setting from Oban `:crontab` (moved to a simpler implementation). +- **Breaking:** `Pleroma.Workers.Cron.ClearOauthTokenWorker` setting from Oban `:crontab` (moved to scheduled jobs). +- **Breaking:** `Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker` setting from Oban `:crontab` (moved to scheduled jobs). + +### Changed +- Minimum lifetime for ephmeral activities changed to 10 minutes and made configurable (`:min_lifetime` option). + +## [2.1.1] - 2020-09-08 + +### Security +- Fix possible DoS in Mastodon API user search due to an error in match clauses, leading to an infinite recursion and subsequent OOM with certain inputs. +- Fix metadata leak for accounts and statuses on private instances. +- Fix possible DoS in Admin API search using an atom leak vulnerability. Authentication with admin rights was required to exploit. + +### Changed + +- **Breaking:** The metadata providers RelMe and Feed are no longer configurable. RelMe should always be activated and Feed only provides a header tag for the actual RSS/Atom feed when the instance is public. +- Improved error message when cmake is not available at build stage. + +### Added +- Rich media failure tracking (along with `:failure_backoff` option). + +### Fixed +- Default HTTP adapter not respecting pool setting, leading to possible OOM. +- Fixed uploading webp images when the Exiftool Upload Filter is enabled by skipping them +- Mastodon API: Search parameter `following` now correctly returns the followings rather than the followers +- Mastodon API: Timelines hanging for (`number of posts with links * rich media timeout`) in the worst case. + Reduced to just rich media timeout. +- Mastodon API: Cards being wrong for preview statuses due to cache key collision. +- Password resets no longer processed for deactivated accounts. +- Favicon scraper raising exceptions on URLs longer than 255 characters. + +## [2.1.0] - 2020-08-28 + +### Changed + +- **Breaking:** The default descriptions on uploads are now empty. The old behavior (filename as default) can be configured, see the cheat sheet. +- **Breaking:** Added the ObjectAgePolicy to the default set of MRFs. This will delist and strip the follower collection of any message received that is older than 7 days. This will stop users from seeing very old messages in the timelines. The messages can still be viewed on the user's page and in conversations. They also still trigger notifications. +- **Breaking:** Elixir >=1.9 is now required (was >= 1.8) +- **Breaking:** Configuration: `:auto_linker, :opts` moved to `:pleroma, Pleroma.Formatter`. Old config namespace is deprecated. +- **Breaking:** Configuration: `:instance, welcome_user_nickname` moved to `:welcome, :direct_message, :sender_nickname`, `:instance, :welcome_message` moved to `:welcome, :direct_message, :message`. Old config namespace is deprecated. +- **Breaking:** LDAP: Fallback to local database authentication has been removed for security reasons and lack of a mechanism to ensure the passwords are synchronized when LDAP passwords are updated. +- **Breaking** Changed defaults for `:restrict_unauthenticated` so that when `:instance, :public` is set to `false` then all `:restrict_unauthenticated` items be effectively set to `true`. If you'd like to allow unauthenticated access to specific API endpoints on a private instance, please explicitly set `:restrict_unauthenticated` to non-default value in `config/prod.secret.exs`. +- In Conversations, return only direct messages as `last_status` +- Using the `only_media` filter on timelines will now exclude reblog media - MFR policy to set global expiration for all local Create activities - OGP rich media parser merged with TwitterCard -- **Breaking** Requires `libmagic` (or `file`) to guess file types. +- Configuration: `:instance, rewrite_policy` moved to `:mrf, policies`, `:instance, :mrf_transparency` moved to `:mrf, :transparency`, `:instance, :mrf_transparency_exclusions` moved to `:mrf, :transparency_exclusions`. Old config namespace is deprecated. +- Configuration: `:media_proxy, whitelist` format changed to host with scheme (e.g. `http://example.com` instead of `example.com`). Domain format is deprecated. +
API Changes + +- **Breaking:** Pleroma API: The routes to update avatar, banner and background have been removed. +- **Breaking:** Image description length is limited now. - **Breaking:** Emoji API: changed methods and renamed routes. +- **Breaking:** Notification Settings API for suppressing notifications has been simplified down to `block_from_strangers`. +- **Breaking:** Notification Settings API option for hiding push notification contents has been renamed to `hide_notification_contents`. +- MastodonAPI: Allow removal of avatar, banner and background. +- Streaming: Repeats of a user's posts will no longer be pushed to the user's stream. +- Mastodon API: Added `pleroma.metadata.fields_limits` to /api/v1/instance +- Mastodon API: On deletion, returns the original post text. +- Mastodon API: Add `pleroma.unread_count` to the Marker entity. +- Mastodon API: Added `pleroma.metadata.post_formats` to /api/v1/instance +- Mastodon API (legacy): Allow query parameters for `/api/v1/domain_blocks`, e.g. `/api/v1/domain_blocks?domain=badposters.zone` +- Mastodon API: Make notifications about statuses from muted users and threads read automatically +- Pleroma API: `/api/pleroma/captcha` responses now include `seconds_valid` with an integer value. + +
+ +
+ Admin API Changes + +- **Breaking** Changed relay `/api/pleroma/admin/relay` endpoints response format. +- Status visibility stats: now can return stats per instance. +- Mix task to refresh counter cache (`mix pleroma.refresh_counter_cache`) +
### Removed + - **Breaking:** removed `with_move` parameter from notifications timeline. ### Added + +- Frontends: Add mix task to install frontends. +- Frontends: Add configurable frontends for primary and admin fe. +- Configuration: Added a blacklist for email servers. +- Chats: Added `accepts_chat_messages` field to user, exposed in APIs and federation. - Chats: Added support for federated chats. For details, see the docs. - ActivityPub: Added support for existing AP ids for instances migrated from Mastodon. - Instance: Add `background_image` to configuration and `/api/v1/instance` @@ -33,18 +117,31 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). - Notifications: Added `follow_request` notification type. - Added `:reject_deletes` group to SimplePolicy - MRF (`EmojiStealPolicy`): New MRF Policy which allows to automatically download emojis from remote instances +- Support pagination in emoji packs API (for packs and for files in pack) +- Support for viewing instances favicons next to posts and accounts +- Added Pleroma.Upload.Filter.Exiftool as an alternate EXIF stripping mechanism targeting GPS/location metadata. +- "By approval" registrations mode. +- Configuration: Added `:welcome` settings for the welcome message to newly registered users. You can send a welcome message as a direct message, chat or email. +- Ability to hide favourites and emoji reactions in the API with `[:instance, :show_reactions]` config. +
API Changes + +- Mastodon API: Add pleroma.parent_visible field to statuses. - Mastodon API: Extended `/api/v1/instance`. - Mastodon API: Support for `include_types` in `/api/v1/notifications`. - Mastodon API: Added `/api/v1/notifications/:id/dismiss` endpoint. -- Mastodon API: Add support for filtering replies in public and home timelines +- Mastodon API: Add support for filtering replies in public and home timelines. +- Mastodon API: Support for `bot` field in `/api/v1/accounts/update_credentials`. +- Mastodon API: Support irreversible property for filters. +- Mastodon API: Add pleroma.favicon field to accounts. - Admin API: endpoints for create/update/delete OAuth Apps. - Admin API: endpoint for status view. - OTP: Add command to reload emoji packs
### Fixed +- Fix list pagination and other list issues. - Support pagination in conversations API - **Breaking**: SimplePolicy `:reject` and `:accept` allow deletions again - Fix follower/blocks import when nicknames starts with @ @@ -52,12 +149,87 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). - Resolving Peertube accounts with Webfinger - `blob:` urls not being allowed by connect-src CSP - Mastodon API: fix `GET /api/v1/notifications` not returning the full result set +- Rich Media Previews for Twitter links +- Admin API: fix `GET /api/pleroma/admin/users/:nickname/credentials` returning 404 when getting the credentials of a remote user while `:instance, :limit_to_local_content` is set to `:unauthenticated` +- Fix CSP policy generation to include remote Captcha services +- Fix edge case where MediaProxy truncates media, usually caused when Caddy is serving content for the other Federated instance. +- Emoji Packs could not be listed when instance was set to `public: false` +- Fix whole_word always returning false on filter get requests +- Migrations not working on OTP releases if the database was connected over ssl +- Fix relay following -## [Unreleased (patch)] +## [2.0.7] - 2020-06-13 + +### Security +- Fix potential DoSes exploiting atom leaks in rich media parser and the `UserAllowListPolicy` MRF policy ### Fixed +- CSP: not allowing images/media from every host when mediaproxy is disabled +- CSP: not adding mediaproxy base url to image/media hosts +- StaticFE missing the CSS file + +### Upgrade notes + +1. Restart Pleroma + +## [2.0.6] - 2020-06-09 + +### Security +- CSP: harden `image-src` and `media-src` when MediaProxy is used + +### Fixed +- AP C2S: Fix pagination in inbox/outbox +- Various compilation errors on OTP 23 +- Mastodon API streaming: Repeats from muted threads not being filtered + +### Changed +- Various database performance improvements + +### Upgrade notes +1. Run database migrations (inside Pleroma directory): + - OTP: `./bin/pleroma_ctl migrate` + - From Source: `mix ecto.migrate` +2. Restart Pleroma + +## [2.0.5] - 2020-05-13 + +### Security +- Fix possible private status leaks in Mastodon Streaming API + +### Fixed +- Crashes when trying to block a user if block federation is disabled +- Not being able to start the instance without `erlang-eldap` installed +- Users with bios over the limit getting rejected +- Follower counters not being updated on incoming follow accepts + +### Upgrade notes + +1. Restart Pleroma + +## [2.0.4] - 2020-05-10 + +### Security +- AP C2S: Fix a potential DoS by creating nonsensical objects that break timelines + +### Fixed +- Peertube user lookups not working +- `InsertSkeletonsForDeletedUsers` migration failing on some instances - Healthcheck reporting the number of memory currently used, rather than allocated in total -- `InsertSkeletonsForDeletedUsers` failing on some instances +- LDAP not being usable in OTP releases +- Default apache configuration having tls chain issues + +### Upgrade notes + +#### Apache only + +1. Remove the following line from your config: +``` + SSLCertificateFile /etc/letsencrypt/live/${servername}/cert.pem +``` + +#### Everyone + +1. Restart Pleroma ## [2.0.3] - 2020-05-02 @@ -90,6 +262,9 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). 2. Run database migrations (inside Pleroma directory): - OTP: `./bin/pleroma_ctl migrate` - From Source: `mix ecto.migrate` +3. Reset status visibility counters (inside Pleroma directory): + - OTP: `./bin/pleroma_ctl refresh_counter_cache` + - From Source: `mix pleroma.refresh_counter_cache` ## [2.0.2] - 2020-04-08 @@ -112,6 +287,8 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). - Static-FE: Fix remote posts not being sanitized ### Fixed +======= +- Rate limiter crashes when there is no explicitly specified ip in the config - 500 errors when no `Accept` header is present if Static-FE is enabled - Instance panel not being updated immediately due to wrong `Cache-Control` headers - Statuses posted with BBCode/Markdown having unncessary newlines in Pleroma-FE @@ -145,6 +322,7 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). - **Breaking**: Using third party engines for user recommendation
API Changes + - **Breaking**: AdminAPI: migrate_from_db endpoint
@@ -190,7 +368,6 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/). - Mastodon API: `pleroma.thread_muted` to the Status entity - Mastodon API: Mark the direct conversation as read for the author when they send a new direct message - Mastodon API, streaming: Add `pleroma.direct_conversation_id` to the `conversation` stream event payload. -- Mastodon API: Add `pleroma.unread_count` to the Marker entity - Admin API: Render whole status in grouped reports - Mastodon API: User timelines will now respect blocks, unless you are getting the user timeline of somebody you blocked (which would be empty otherwise). - Mastodon API: Favoriting / Repeating a post multiple times will now return the identical response every time. Before, executing that action twice would return an error ("already favorited") on the second try. diff --git a/Dockerfile b/Dockerfile index 29931a5e3..c210cf79c 100644 --- a/Dockerfile +++ b/Dockerfile @@ -4,7 +4,7 @@ COPY . . ENV MIX_ENV=prod -RUN apk add git gcc g++ musl-dev make &&\ +RUN apk add git gcc g++ musl-dev make cmake &&\ echo "import Mix.Config" > config/prod.secret.exs &&\ mix local.hex --force &&\ mix local.rebar --force &&\ @@ -31,9 +31,9 @@ LABEL maintainer="ops@pleroma.social" \ ARG HOME=/opt/pleroma ARG DATA=/var/lib/pleroma -RUN echo "http://nl.alpinelinux.org/alpine/latest-stable/community" >> /etc/apk/repositories &&\ +RUN echo "https://nl.alpinelinux.org/alpine/latest-stable/community" >> /etc/apk/repositories &&\ apk update &&\ - apk add imagemagick ncurses postgresql-client &&\ + apk add exiftool imagemagick ncurses postgresql-client &&\ adduser --system --shell /bin/false --home ${HOME} pleroma &&\ mkdir -p ${DATA}/uploads &&\ mkdir -p ${DATA}/static &&\ diff --git a/README.md b/README.md index 7fc1fd381..6ca3118fb 100644 --- a/README.md +++ b/README.md @@ -34,6 +34,16 @@ Currently Pleroma is not packaged by any OS/Distros, but if you want to package ### Docker While we don’t provide docker files, other people have written very good ones. Take a look at or . +### Compilation Troubleshooting +If you ever encounter compilation issues during the updating of Pleroma, you can try these commands and see if they fix things: + +- `mix deps.clean --all` +- `mix local.rebar` +- `mix local.hex` +- `rm -r _build` + +If you are not developing Pleroma, it is better to use the OTP release, which comes with everything precompiled. + ## Documentation - Latest Released revision: - Latest Git revision: diff --git a/SECURITY.md b/SECURITY.md new file mode 100644 index 000000000..8617c1434 --- /dev/null +++ b/SECURITY.md @@ -0,0 +1,16 @@ +# Pleroma backend security policy + +## Supported versions + +Currently, Pleroma offers bugfixes and security patches only for the latest minor release. + +| Version | Support +|---------| -------- +| 2.1 | Bugfixes and security patches + +## Reporting a vulnerability + +Please use confidential issues (tick the "This issue is confidential and should only be visible to team members with at least Reporter access." box when submitting) at our [bugtracker](https://git.pleroma.social/pleroma/pleroma/-/issues/new) for reporting vulnerabilities. +## Announcements + +New releases are announced at [pleroma.social](https://pleroma.social/announcements/). All security releases are tagged with ["Security"](https://pleroma.social/announcements/tags/security/). You can be notified of them by subscribing to an Atom feed at . diff --git a/benchmarks/load_testing/activities.ex b/benchmarks/load_testing/activities.ex index 074ded457..f5c7bfce8 100644 --- a/benchmarks/load_testing/activities.ex +++ b/benchmarks/load_testing/activities.ex @@ -24,6 +24,7 @@ defmodule Pleroma.LoadTesting.Activities do @visibility ~w(public private direct unlisted) @types [ :simple, + :simple_filtered, :emoji, :mentions, :hell_thread, @@ -242,6 +243,15 @@ defp insert_activity(:simple, visibility, group, users, _opts) do insert_local_activity(visibility, group, users, "Simple status") end + defp insert_activity(:simple_filtered, visibility, group, users, _opts) + when group in @remote_groups do + insert_remote_activity(visibility, group, users, "Remote status which must be filtered") + end + + defp insert_activity(:simple_filtered, visibility, group, users, _opts) do + insert_local_activity(visibility, group, users, "Simple status which must be filtered") + end + defp insert_activity(:emoji, visibility, group, users, _opts) when group in @remote_groups do insert_remote_activity(visibility, group, users, "Remote status with emoji :firefox:") diff --git a/benchmarks/load_testing/fetcher.ex b/benchmarks/load_testing/fetcher.ex index 15fd06c3d..dfbd916be 100644 --- a/benchmarks/load_testing/fetcher.ex +++ b/benchmarks/load_testing/fetcher.ex @@ -32,10 +32,22 @@ defp fetch_user(user) do ) end + defp create_filter(user) do + Pleroma.Filter.create(%Pleroma.Filter{ + user_id: user.id, + phrase: "must be filtered", + hide: true + }) + end + + defp delete_filter(filter), do: Repo.delete(filter) + defp fetch_timelines(user) do fetch_home_timeline(user) + fetch_home_timeline_with_filter(user) fetch_direct_timeline(user) fetch_public_timeline(user) + fetch_public_timeline_with_filter(user) fetch_public_timeline(user, :with_blocks) fetch_public_timeline(user, :local) fetch_public_timeline(user, :tag) @@ -61,7 +73,7 @@ defp opts_for_home_timeline(user) do } end - defp fetch_home_timeline(user) do + defp fetch_home_timeline(user, title_end \\ "") do opts = opts_for_home_timeline(user) recipients = [user.ap_id | User.following(user)] @@ -84,9 +96,11 @@ defp fetch_home_timeline(user) do |> Enum.reverse() |> List.last() + title = "home timeline " <> title_end + Benchee.run( %{ - "home timeline" => fn opts -> ActivityPub.fetch_activities(recipients, opts) end + title => fn opts -> ActivityPub.fetch_activities(recipients, opts) end }, inputs: %{ "1 page" => opts, @@ -108,6 +122,14 @@ defp fetch_home_timeline(user) do ) end + defp fetch_home_timeline_with_filter(user) do + {:ok, filter} = create_filter(user) + + fetch_home_timeline(user, "with filters") + + delete_filter(filter) + end + defp opts_for_direct_timeline(user) do %{ visibility: "direct", @@ -210,6 +232,14 @@ defp fetch_public_timeline(user) do fetch_public_timeline(opts, "public timeline") end + defp fetch_public_timeline_with_filter(user) do + {:ok, filter} = create_filter(user) + opts = opts_for_public_timeline(user) + + fetch_public_timeline(opts, "public timeline with filters") + delete_filter(filter) + end + defp fetch_public_timeline(user, :local) do opts = opts_for_public_timeline(user, :local) diff --git a/config/config.exs b/config/config.exs index f58b99faa..46a649b73 100644 --- a/config/config.exs +++ b/config/config.exs @@ -72,7 +72,8 @@ pool: :upload ] ], - filename_display_max_length: 30 + filename_display_max_length: 30, + default_description: nil config :pleroma, Pleroma.Uploaders.Local, uploads: "uploads" @@ -97,6 +98,7 @@ "dat", "dweb", "gopher", + "hyper", "ipfs", "ipns", "irc", @@ -186,7 +188,9 @@ notify_email: "noreply@example.com", description: "Pleroma: An efficient and flexible fediverse server", background_image: "/images/city.jpg", + instance_thumbnail: "/instance/thumbnail.jpeg", limit: 5_000, + description_limit: 5_000, chat_limit: 5_000, remote_limit: 100_000, upload_limit: 16_000_000, @@ -202,6 +206,7 @@ registrations_open: true, invites_enabled: false, account_activation_required: false, + account_approval_required: false, federating: true, federation_incoming_replies_max_depth: 100, federation_reachability_timeout_days: 7, @@ -209,7 +214,6 @@ Pleroma.Web.ActivityPub.Publisher ], allow_relay: true, - rewrite_policy: Pleroma.Web.ActivityPub.MRF.NoOpPolicy, public: true, quarantined_instances: [], managed_config: true, @@ -220,13 +224,9 @@ "text/markdown", "text/bbcode" ], - mrf_transparency: true, - mrf_transparency_exclusions: [], autofollowed_nicknames: [], max_pinned_statuses: 1, attachment_links: false, - welcome_user_nickname: nil, - welcome_message: nil, max_report_comment_size: 1000, safe_dm_mentions: false, healthcheck: false, @@ -239,6 +239,7 @@ max_remote_account_fields: 20, account_field_name_length: 512, account_field_value_length: 2048, + registration_reason_length: 500, external_user_synchronization: true, extended_nickname_format: true, cleanup_attachments: false, @@ -252,6 +253,26 @@ number: 5, length: 16 ] + ], + show_reactions: true + +config :pleroma, :welcome, + direct_message: [ + enabled: false, + sender_nickname: nil, + message: nil + ], + chat_message: [ + enabled: false, + sender_nickname: nil, + message: nil + ], + email: [ + enabled: false, + sender: nil, + subject: "Welcome to <%= instance_name %>", + html: "Welcome to <%= instance_name %>", + text: "Welcome to <%= instance_name %>" ] config :pleroma, :feed, @@ -359,6 +380,7 @@ federated_timeline_removal: [], report_removal: [], reject: [], + followers_only: [], accept: [], avatar_removal: [], banner_removal: [], @@ -377,8 +399,9 @@ accept: [], reject: [] +# threshold of 7 days config :pleroma, :mrf_object_age, - threshold: 172_800, + threshold: 604_800, actions: [:delist, :strip_followers] config :pleroma, :rich_media, @@ -389,6 +412,7 @@ Pleroma.Web.RichMedia.Parsers.TwitterCard, Pleroma.Web.RichMedia.Parsers.OEmbed ], + failure_backoff: 60_000, ttl_setters: [Pleroma.Web.RichMedia.Parser.TTL.AwsSignedUrl] config :pleroma, :media_proxy, @@ -407,6 +431,13 @@ ], whitelist: [] +config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Http, + method: :purge, + headers: [], + options: [] + +config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Script, script_path: nil + config :pleroma, :chat, enabled: true config :phoenix, :format_encoders, json: Jason @@ -423,12 +454,15 @@ config :pleroma, Pleroma.Web.Metadata, providers: [ Pleroma.Web.Metadata.Providers.OpenGraph, - Pleroma.Web.Metadata.Providers.TwitterCard, - Pleroma.Web.Metadata.Providers.RelMe, - Pleroma.Web.Metadata.Providers.Feed + Pleroma.Web.Metadata.Providers.TwitterCard ], unfurl_nsfw: false +config :pleroma, Pleroma.Web.Preload, + providers: [ + Pleroma.Web.Preload.Providers.Instance + ] + config :pleroma, :http_security, enabled: true, sts: false, @@ -481,15 +515,22 @@ "user-search", "user_exists", "users", - "web" - ] + "web", + "verify_credentials", + "update_credentials", + "relationships", + "search", + "confirmation_resend", + "mfa" + ], + email_blacklist: [] config :pleroma, Oban, repo: Pleroma.Repo, - verbose: false, - prune: {:maxlen, 1500}, + log: false, queues: [ activity_expiration: 10, + token_expiration: 5, federator_incoming: 50, federator_outgoing: 50, web_push: 50, @@ -501,10 +542,8 @@ attachments_cleanup: 5, new_users_digest: 1 ], + plugins: [Oban.Plugins.Pruner], crontab: [ - {"0 0 * * *", Pleroma.Workers.Cron.ClearOauthTokenWorker}, - {"0 * * * *", Pleroma.Workers.Cron.StatsWorker}, - {"* * * * *", Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker}, {"0 0 * * 0", Pleroma.Workers.Cron.DigestEmailsWorker}, {"0 0 * * *", Pleroma.Workers.Cron.NewUsersDigestWorker} ] @@ -515,16 +554,14 @@ federator_outgoing: 5 ] -config :auto_linker, - opts: [ - extra: true, - # TODO: Set to :no_scheme when it works properly - validate_tld: true, - class: false, - strip_prefix: false, - new_window: false, - rel: "ugc" - ] +config :pleroma, Pleroma.Formatter, + class: false, + rel: "ugc", + new_window: false, + truncate: false, + strip_prefix: false, + extra: true, + validate_tld: :no_scheme config :pleroma, :ldap, enabled: System.get_env("LDAP_ENABLED") == "true", @@ -617,12 +654,65 @@ account_confirmation_resend: {8_640_000, 5}, ap_routes: {60_000, 15} -config :pleroma, Pleroma.ActivityExpiration, enabled: true +config :pleroma, Pleroma.Workers.PurgeExpiredActivity, enabled: true, min_lifetime: 600 config :pleroma, Pleroma.Plugs.RemoteIp, enabled: true config :pleroma, :static_fe, enabled: false +# Example of frontend configuration +# This example will make us serve the primary frontend from the +# frontends directory within your `:pleroma, :instance, static_dir`. +# e.g., instance/static/frontends/pleroma/develop/ +# +# With no frontend configuration, the bundled files from the `static` directory will +# be used. +# +# config :pleroma, :frontends, +# primary: %{"name" => "pleroma-fe", "ref" => "develop"}, +# admin: %{"name" => "admin-fe", "ref" => "stable"}, +# available: %{...} + +config :pleroma, :frontends, + available: %{ + "kenoma" => %{ + "name" => "kenoma", + "git" => "https://git.pleroma.social/lambadalambda/kenoma", + "build_url" => + "https://git.pleroma.social/lambadalambda/kenoma/-/jobs/artifacts/${ref}/download?job=build", + "ref" => "master" + }, + "pleroma-fe" => %{ + "name" => "pleroma-fe", + "git" => "https://git.pleroma.social/pleroma/pleroma-fe", + "build_url" => + "https://git.pleroma.social/pleroma/pleroma-fe/-/jobs/artifacts/${ref}/download?job=build", + "ref" => "develop" + }, + "fedi-fe" => %{ + "name" => "fedi-fe", + "git" => "https://git.pleroma.social/pleroma/fedi-fe", + "build_url" => + "https://git.pleroma.social/pleroma/fedi-fe/-/jobs/artifacts/${ref}/download?job=build", + "ref" => "master" + }, + "admin-fe" => %{ + "name" => "admin-fe", + "git" => "https://git.pleroma.social/pleroma/admin-fe", + "build_url" => + "https://git.pleroma.social/pleroma/admin-fe/-/jobs/artifacts/${ref}/download?job=build", + "ref" => "develop" + }, + "soapbox-fe" => %{ + "name" => "soapbox-fe", + "git" => "https://gitlab.com/soapbox-pub/soapbox-fe", + "build_url" => + "https://gitlab.com/soapbox-pub/soapbox-fe/-/jobs/artifacts/${ref}/download?job=build-production", + "ref" => "v1.0.0", + "build_dir" => "static" + } + } + config :pleroma, :web_cache_ttl, activity_pub: nil, activity_pub_question: 30_000 @@ -636,32 +726,34 @@ prepare: :unnamed config :pleroma, :connections_pool, - checkin_timeout: 250, + reclaim_multiplier: 0.1, + connection_acquisition_wait: 250, + connection_acquisition_retries: 5, max_connections: 250, - retry: 1, - retry_timeout: 1000, - await_up_timeout: 5_000 + max_idle_time: 30_000, + retry: 0, + connect_timeout: 5_000 config :pleroma, :pools, federation: [ size: 50, - max_overflow: 10, - timeout: 150_000 + max_waiting: 10, + recv_timeout: 10_000 ], media: [ size: 50, - max_overflow: 10, - timeout: 150_000 + max_waiting: 10, + recv_timeout: 10_000 ], upload: [ size: 25, - max_overflow: 5, - timeout: 300_000 + max_waiting: 5, + recv_timeout: 15_000 ], default: [ size: 10, - max_overflow: 2, - timeout: 10_000 + max_waiting: 2, + recv_timeout: 5_000 ] config :pleroma, :hackney_pools, @@ -680,13 +772,30 @@ config :pleroma, :majic_pool, size: 2 +private_instance? = :if_instance_is_private + config :pleroma, :restrict_unauthenticated, - timelines: %{local: false, federated: false}, - profiles: %{local: false, remote: false}, - activities: %{local: false, remote: false} + timelines: %{local: private_instance?, federated: private_instance?}, + profiles: %{local: private_instance?, remote: private_instance?}, + activities: %{local: private_instance?, remote: private_instance?} config :pleroma, Pleroma.Web.ApiSpec.CastAndValidate, strict: false +config :pleroma, :mrf, + policies: Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy, + transparency: true, + transparency_exclusions: [] + +config :tzdata, :http_client, Pleroma.HTTP.Tzdata + +config :ex_aws, http_client: Pleroma.HTTP.ExAws + +config :pleroma, :instances_favicons, enabled: false + +config :floki, :html_parser, Floki.HTMLParser.FastHtml + +config :pleroma, Pleroma.Web.Auth.Authenticator, Pleroma.Web.Auth.PleromaAuthenticator + # Import environment specific config. This must remain at the bottom # of this file so it overrides the configuration defined above. import_config "#{Mix.env()}.exs" diff --git a/config/description.exs b/config/description.exs index 2afc5e366..d05adf88b 100644 --- a/config/description.exs +++ b/config/description.exs @@ -12,6 +12,55 @@ compress: false ] +installed_frontend_options = [ + %{ + key: "name", + label: "Name", + type: :string, + description: + "Name of the installed frontend. Valid config must include both `Name` and `Reference` values." + }, + %{ + key: "ref", + label: "Reference", + type: :string, + description: + "Reference of the installed frontend to be used. Valid config must include both `Name` and `Reference` values." + } +] + +frontend_options = [ + %{ + key: "name", + label: "Name", + type: :string, + description: "Name of the frontend." + }, + %{ + key: "ref", + label: "Reference", + type: :string, + description: "Reference of the frontend to be used." + }, + %{ + key: "git", + type: :string, + description: "URL of the git repository of the frontend" + }, + %{ + key: "build_url", + type: :string, + description: + "Either an url to a zip file containing the frontend or a template to build it by inserting the `ref`. The string `${ref}` will be replaced by the configured `ref`.", + example: "https://some.url/builds/${ref}.zip" + }, + %{ + key: "build_dir", + type: :string, + description: "The directory inside the zip file " + } +] + config :pleroma, :config_description, [ %{ group: :pleroma, @@ -23,29 +72,26 @@ key: :uploader, type: :module, description: "Module which will be used for uploads", - suggestions: [Pleroma.Uploaders.Local, Pleroma.Uploaders.S3] + suggestions: {:list_behaviour_implementations, Pleroma.Uploaders.Uploader} }, %{ key: :filters, type: {:list, :module}, description: "List of filter modules for uploads. Module names are shortened (removed leading `Pleroma.Upload.Filter.` part), but on adding custom module you need to use full name.", - suggestions: - Generator.list_modules_in_dir( - "lib/pleroma/upload/filter", - "Elixir.Pleroma.Upload.Filter." - ) + suggestions: {:list_behaviour_implementations, Pleroma.Upload.Filter} }, %{ key: :link_name, type: :boolean, description: - "If enabled, a name parameter will be added to the url of the upload. For example `https://instance.tld/media/imagehash.png?name=realname.png`." + "If enabled, a name parameter will be added to the URL of the upload. For example `https://instance.tld/media/imagehash.png?name=realname.png`." }, %{ key: :base_url, + label: "Base URL", type: :string, - description: "Base url for the uploads, needed if you use CDN", + description: "Base URL for the uploads, needed if you use CDN", suggestions: [ "https://cdn-host.com" ] @@ -58,6 +104,7 @@ }, %{ key: :proxy_opts, + label: "Proxy Options", type: :keyword, description: "Options for Pleroma.ReverseProxy", suggestions: [ @@ -85,6 +132,7 @@ }, %{ key: :http, + label: "HTTP", type: :keyword, description: "HTTP options", children: [ @@ -193,7 +241,9 @@ %{ key: :args, type: [:string, {:list, :string}, {:list, :tuple}], - description: "List of actions for the mogrify command", + description: + "List of actions for the mogrify command. It's possible to add self-written settings as string. " <> + "For example `auto-orient, strip, {\"resize\", \"3840x1080>\"}` value will be parsed into valid list of the settings.", suggestions: [ "strip", "auto-orient", @@ -479,6 +529,7 @@ %{ group: :pleroma, key: :uri_schemes, + label: "URI Schemes", type: :group, description: "URI schemes related settings", children: [ @@ -492,6 +543,7 @@ "dat", "dweb", "gopher", + "hyper", "ipfs", "ipns", "irc", @@ -651,17 +703,22 @@ key: :invites_enabled, type: :boolean, description: - "Enable user invitations for admins (depends on `registrations_open` being disabled)." + "Enable user invitations for admins (depends on `registrations_open` being disabled)" }, %{ key: :account_activation_required, type: :boolean, - description: "Require users to confirm their emails before signing in." + description: "Require users to confirm their emails before signing in" + }, + %{ + key: :account_approval_required, + type: :boolean, + description: "Require users to be manually approved by an admin before signing in" }, %{ key: :federating, type: :boolean, - description: "Enable federation with other instances." + description: "Enable federation with other instances" }, %{ key: :federation_incoming_replies_max_depth, @@ -679,7 +736,7 @@ label: "Fed. reachability timeout days", type: :integer, description: - "Timeout (in days) of each external federation target being unreachable prior to pausing federating to it.", + "Timeout (in days) of each external federation target being unreachable prior to pausing federating to it", suggestions: [ 7 ] @@ -689,23 +746,13 @@ type: :boolean, description: "Enable Pleroma's Relay, which makes it possible to follow a whole instance" }, - %{ - key: :rewrite_policy, - type: [:module, {:list, :module}], - description: - "A list of enabled MRF policies. Module names are shortened (removed leading `Pleroma.Web.ActivityPub.MRF.` part), but on adding custom module you need to use full name.", - suggestions: - Generator.list_modules_in_dir( - "lib/pleroma/web/activity_pub/mrf", - "Elixir.Pleroma.Web.ActivityPub.MRF." - ) - }, %{ key: :public, type: :boolean, description: - "Makes the client API in authentificated mode-only except for user-profiles." <> - " Useful for disabling the Local Timeline and The Whole Known Network." + "Makes the client API in authenticated mode-only except for user-profiles." <> + " Useful for disabling the Local Timeline and The Whole Known Network. " <> + " Note: when setting to `false`, please also check `:restrict_unauthenticated` setting." }, %{ key: :quarantined_instances, @@ -742,23 +789,6 @@ "text/bbcode" ] }, - %{ - key: :mrf_transparency, - label: "MRF transparency", - type: :boolean, - description: - "Make the content of your Message Rewrite Facility settings public (via nodeinfo)" - }, - %{ - key: :mrf_transparency_exclusions, - label: "MRF transparency exclusions", - type: {:list, :string}, - description: - "Exclude specific instance names from MRF transparency. The use of the exclusions feature will be disclosed in nodeinfo as a boolean value.", - suggestions: [ - "exclusion.com" - ] - }, %{ key: :extended_nickname_format, type: :boolean, @@ -802,23 +832,6 @@ type: :boolean, description: "Enable to automatically add attachment link text to statuses" }, - %{ - key: :welcome_message, - type: :string, - description: - "A message that will be sent to a newly registered users as a direct message", - suggestions: [ - "Hi, @username! Welcome on board!" - ] - }, - %{ - key: :welcome_user_nickname, - type: :string, - description: "The nickname of the local user that sends the welcome message", - suggestions: [ - "lain" - ] - }, %{ key: :max_report_comment_size, type: :integer, @@ -829,6 +842,7 @@ }, %{ key: :safe_dm_mentions, + label: "Safe DM mentions", type: :boolean, description: "If enabled, only mentions at the beginning of a post will be used to address people in direct messages." <> @@ -868,7 +882,7 @@ %{ key: :skip_thread_containment, type: :boolean, - description: "Skip filtering out broken threads. Default: enabled" + description: "Skip filtering out broken threads. Default: enabled." }, %{ key: :limit_to_local_content, @@ -914,6 +928,14 @@ 2048 ] }, + %{ + key: :registration_reason_length, + type: :integer, + description: "Maximum registration reason length. Default: 500.", + suggestions: [ + 500 + ] + }, %{ key: :external_user_synchronization, type: :boolean, @@ -932,6 +954,7 @@ children: [ %{ key: :totp, + label: "TOTP settings", type: :keyword, description: "TOTP settings", suggestions: [digits: 6, period: 30], @@ -948,7 +971,7 @@ type: :integer, suggestions: [30], description: - "a period for which the TOTP code will be valid, in seconds. Defaults to 30 seconds." + "A period for which the TOTP code will be valid, in seconds. Defaults to 30 seconds." } ] }, @@ -962,7 +985,7 @@ key: :number, type: :integer, suggestions: [5], - description: "number of backup codes to generate." + description: "Number of backup codes to generate." }, %{ key: :length, @@ -977,10 +1000,122 @@ }, %{ key: :instance_thumbnail, - type: :string, + type: {:string, :image}, description: - "The instance thumbnail image. It will appear in [Pleroma Instances](http://distsn.org/pleroma-instances.html)", + "The instance thumbnail can be any image that represents your instance and is used by some apps or services when they display information about your instance.", suggestions: ["/instance/thumbnail.jpeg"] + }, + %{ + key: :show_reactions, + type: :boolean, + description: "Let favourites and emoji reactions be viewed through the API." + } + ] + }, + %{ + group: :pleroma, + key: :welcome, + type: :group, + description: "Welcome messages settings", + children: [ + %{ + key: :direct_message, + type: :keyword, + descpiption: "Direct message settings", + children: [ + %{ + key: :enabled, + type: :boolean, + description: "Enables sending a direct message to newly registered users" + }, + %{ + key: :message, + type: :string, + description: "A message that will be sent to newly registered users", + suggestions: [ + "Hi, @username! Welcome on board!" + ] + }, + %{ + key: :sender_nickname, + type: :string, + description: "The nickname of the local user that sends a welcome message", + suggestions: [ + "lain" + ] + } + ] + }, + %{ + key: :chat_message, + type: :keyword, + descpiption: "Chat message settings", + children: [ + %{ + key: :enabled, + type: :boolean, + description: "Enables sending a chat message to newly registered users" + }, + %{ + key: :message, + type: :string, + description: + "A message that will be sent to newly registered users as a chat message", + suggestions: [ + "Hello, welcome on board!" + ] + }, + %{ + key: :sender_nickname, + type: :string, + description: "The nickname of the local user that sends a welcome chat message", + suggestions: [ + "lain" + ] + } + ] + }, + %{ + key: :email, + type: :keyword, + descpiption: "Email message settings", + children: [ + %{ + key: :enabled, + type: :boolean, + description: "Enables sending an email to newly registered users" + }, + %{ + key: :sender, + type: [:string, :tuple], + description: + "Email address and/or nickname that will be used to send the welcome email.", + suggestions: [ + {"Pleroma App", "welcome@pleroma.app"} + ] + }, + %{ + key: :subject, + type: :string, + description: + "Subject of the welcome email. EEX template with user and instance_name variables can be used.", + suggestions: ["Welcome to <%= instance_name%>"] + }, + %{ + key: :html, + type: :string, + description: + "HTML content of the welcome email. EEX template with user and instance_name variables can be used.", + suggestions: ["

Hello <%= user.name%>. Welcome to <%= instance_name%>

"] + }, + %{ + key: :text, + type: :string, + description: + "Text content of the welcome email. EEX template with user and instance_name variables can be used.", + suggestions: ["Hello <%= user.name%>. \n Welcome to <%= instance_name%>\n"] + } + ] } ] }, @@ -1002,6 +1137,7 @@ group: :logger, type: :group, key: :ex_syslogger, + label: "ExSyslogger", description: "ExSyslogger-related settings", children: [ %{ @@ -1020,7 +1156,7 @@ %{ key: :format, type: :string, - description: "Default: \"$date $time [$level] $levelpad$node $metadata $message\".", + description: "Default: \"$date $time [$level] $levelpad$node $metadata $message\"", suggestions: ["$metadata[$level] $message"] }, %{ @@ -1034,6 +1170,7 @@ group: :logger, type: :group, key: :console, + label: "Console Logger", description: "Console logger settings", children: [ %{ @@ -1045,7 +1182,7 @@ %{ key: :format, type: :string, - description: "Default: \"$date $time [$level] $levelpad$node $metadata $message\".", + description: "Default: \"$date $time [$level] $levelpad$node $metadata $message\"", suggestions: ["$metadata[$level] $message"] }, %{ @@ -1058,6 +1195,7 @@ %{ group: :quack, type: :group, + label: "Quack Logger", description: "Quack-related settings", children: [ %{ @@ -1086,6 +1224,7 @@ }, %{ key: :webhook_url, + label: "Webhook URL", type: :string, description: "Configure the Slack incoming webhook", suggestions: ["https://hooks.slack.com/services/YOUR-KEY-HERE"] @@ -1146,7 +1285,7 @@ }, %{ key: :background, - type: :string, + type: {:string, :image}, description: "URL of the background, unless viewing a user profile with a background that is set", suggestions: ["/images/city.jpg"] @@ -1168,19 +1307,19 @@ key: :greentext, label: "Greentext", type: :boolean, - description: "Enables green text on lines prefixed with the > character." + description: "Enables green text on lines prefixed with the > character" }, %{ key: :hideFilteredStatuses, label: "Hide Filtered Statuses", type: :boolean, - description: "Hides filtered statuses from timelines." + description: "Hides filtered statuses from timelines" }, %{ key: :hideMutedPosts, label: "Hide Muted Posts", type: :boolean, - description: "Hides muted statuses from timelines." + description: "Hides muted statuses from timelines" }, %{ key: :hidePostStats, @@ -1192,7 +1331,7 @@ key: :hideSitename, label: "Hide Sitename", type: :boolean, - description: "Hides instance name from PleromaFE banner." + description: "Hides instance name from PleromaFE banner" }, %{ key: :hideUserStats, @@ -1203,7 +1342,7 @@ }, %{ key: :logo, - type: :string, + type: {:string, :image}, description: "URL of the logo, defaults to Pleroma's logo", suggestions: ["/static/logo.png"] }, @@ -1235,16 +1374,16 @@ %{ key: :nsfwCensorImage, label: "NSFW Censor Image", - type: :string, + type: {:string, :image}, description: - "URL of the image to use for hiding NSFW media attachments in the timeline.", + "URL of the image to use for hiding NSFW media attachments in the timeline", suggestions: ["/static/img/nsfw.74818f9.png"] }, %{ key: :postContentType, label: "Post Content Type", type: {:dropdown, :atom}, - description: "Default post formatting option.", + description: "Default post formatting option", suggestions: ["text/plain", "text/html", "text/markdown", "text/bbcode"] }, %{ @@ -1273,14 +1412,14 @@ key: :sidebarRight, label: "Sidebar on Right", type: :boolean, - description: "Change alignment of sidebar and panels to the right." + description: "Change alignment of sidebar and panels to the right" }, %{ key: :showFeaturesPanel, label: "Show instance features panel", type: :boolean, description: - "Enables panel displaying functionality of the instance on the About page." + "Enables panel displaying functionality of the instance on the About page" }, %{ key: :showInstanceSpecificPanel, @@ -1338,7 +1477,7 @@ key: :mascots, type: {:keyword, :map}, description: - "Keyword of mascots, each element must contain both an url and a mime_type key", + "Keyword of mascots, each element must contain both an URL and a mime_type key", suggestions: [ pleroma_fox_tan: %{ url: "/images/pleroma-fox-tan-smol.png", @@ -1361,8 +1500,8 @@ }, %{ key: :default_user_avatar, - type: :string, - description: "URL of the default user avatar.", + type: {:string, :image}, + description: "URL of the default user avatar", suggestions: ["/images/avi.png"] } ] @@ -1372,7 +1511,7 @@ key: :manifest, type: :group, description: - "This section describe PWA manifest instance-specific values. Currently this option relate only for MastoFE", + "This section describe PWA manifest instance-specific values. Currently this option relate only for MastoFE.", children: [ %{ key: :icons, @@ -1408,10 +1547,46 @@ }, %{ group: :pleroma, - key: :mrf_simple, - label: "MRF simple", + key: :mrf, + tab: :mrf, + label: "MRF", type: :group, - description: "Message Rewrite Facility", + description: "General MRF settings", + children: [ + %{ + key: :policies, + type: [:module, {:list, :module}], + description: + "A list of MRF policies enabled. Module names are shortened (removed leading `Pleroma.Web.ActivityPub.MRF.` part), but on adding custom module you need to use full name.", + suggestions: {:list_behaviour_implementations, Pleroma.Web.ActivityPub.MRF} + }, + %{ + key: :transparency, + label: "MRF transparency", + type: :boolean, + description: + "Make the content of your Message Rewrite Facility settings public (via nodeinfo)" + }, + %{ + key: :transparency_exclusions, + label: "MRF transparency exclusions", + type: {:list, :string}, + description: + "Exclude specific instance names from MRF transparency. The use of the exclusions feature will be disclosed in nodeinfo as a boolean value.", + suggestions: [ + "exclusion.com" + ] + } + ] + }, + %{ + group: :pleroma, + key: :mrf_simple, + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.SimplePolicy", + label: "MRF Simple", + type: :group, + description: "Simple ingress policies", children: [ %{ key: :media_removal, @@ -1430,7 +1605,7 @@ key: :federated_timeline_removal, type: {:list, :string}, description: - "List of instances to remove from Federated (aka The Whole Known Network) Timeline", + "List of instances to remove from the Federated (aka The Whole Known Network) Timeline", suggestions: ["example.com", "*.example.com"] }, %{ @@ -1445,6 +1620,12 @@ description: "List of instances to only accept activities from (except deletes)", suggestions: ["example.com", "*.example.com"] }, + %{ + key: :followers_only, + type: {:list, :string}, + description: "Force posts from the given instances to be visible by followers only", + suggestions: ["example.com", "*.example.com"] + }, %{ key: :report_removal, type: {:list, :string}, @@ -1474,14 +1655,16 @@ %{ group: :pleroma, key: :mrf_activity_expiration, + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicy", label: "MRF Activity Expiration Policy", type: :group, - description: "Adds expiration to all local Create Note activities", + description: "Adds automatic expiration to all local activities", children: [ %{ key: :days, type: :integer, - description: "Default global expiration time for all local Create activities (in days)", + description: "Default global expiration time for all local activities (in days)", suggestions: [90, 365] } ] @@ -1489,7 +1672,9 @@ %{ group: :pleroma, key: :mrf_subchain, - label: "MRF subchain", + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.SubchainPolicy", + label: "MRF Subchain", type: :group, description: "This policy processes messages through an alternate pipeline when a given message matches certain criteria." <> @@ -1497,7 +1682,7 @@ children: [ %{ key: :match_actor, - type: :map, + type: {:map, {:list, :string}}, description: "Matches a series of regular expressions against the actor field", suggestions: [ %{ @@ -1510,9 +1695,10 @@ %{ group: :pleroma, key: :mrf_rejectnonpublic, - description: - "MRF RejectNonPublic settings. RejectNonPublic drops posts with non-public visibility settings.", - label: "MRF reject non public", + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.RejectNonPublic", + description: "RejectNonPublic drops posts with non-public visibility settings.", + label: "MRF Reject Non Public", type: :group, children: [ %{ @@ -1531,16 +1717,18 @@ %{ group: :pleroma, key: :mrf_hellthread, - label: "MRF hellthread", + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.HellthreadPolicy", + label: "MRF Hellthread", type: :group, - description: "Block messages with too much mentions", + description: "Block messages with excessive user mentions", children: [ %{ key: :delist_threshold, type: :integer, description: - "Number of mentioned users after which the message gets delisted (the message can still be seen, " <> - " but it will not show up in public timelines and mentioned users won't get notifications about it). Set to 0 to disable.", + "Number of mentioned users after which the message gets removed from timelines and" <> + "disables notifications. Set to 0 to disable.", suggestions: [10] }, %{ @@ -1555,27 +1743,29 @@ %{ group: :pleroma, key: :mrf_keyword, - label: "MRF keyword", + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.KeywordPolicy", + label: "MRF Keyword", type: :group, description: "Reject or Word-Replace messages with a keyword or regex", children: [ %{ key: :reject, - type: [:string, :regex], + type: {:list, :string}, description: "A list of patterns which result in message being rejected. Each pattern can be a string or a regular expression.", suggestions: ["foo", ~r/foo/iu] }, %{ key: :federated_timeline_removal, - type: [:string, :regex], + type: {:list, :string}, description: "A list of patterns which result in message being removed from federated timelines (a.k.a unlisted). Each pattern can be a string or a regular expression.", suggestions: ["foo", ~r/foo/iu] }, %{ key: :replace, - type: [{:tuple, :string, :string}, {:tuple, :regex, :string}], + type: {:list, :tuple}, description: "A list of tuples containing {pattern, replacement}. Each pattern can be a string or a regular expression.", suggestions: [{"foo", "bar"}, {~r/foo/iu, "bar"}] @@ -1585,14 +1775,16 @@ %{ group: :pleroma, key: :mrf_mention, - label: "MRF mention", + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.MentionPolicy", + label: "MRF Mention", type: :group, - description: "Block messages which mention a user", + description: "Block messages which mention a specific user", children: [ %{ key: :actors, type: {:list, :string}, - description: "A list of actors for which any post mentioning them will be dropped.", + description: "A list of actors for which any post mentioning them will be dropped", suggestions: ["actor1", "actor2"] } ] @@ -1600,7 +1792,9 @@ %{ group: :pleroma, key: :mrf_vocabulary, - label: "MRF vocabulary", + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.VocabularyPolicy", + label: "MRF Vocabulary", type: :group, description: "Filter messages which belong to certain activity vocabularies", children: [ @@ -1608,14 +1802,14 @@ key: :accept, type: {:list, :string}, description: - "A list of ActivityStreams terms to accept. If empty, all supported messages are accepted", + "A list of ActivityStreams terms to accept. If empty, all supported messages are accepted.", suggestions: ["Create", "Follow", "Mention", "Announce", "Like"] }, %{ key: :reject, type: {:list, :string}, description: - "A list of ActivityStreams terms to reject. If empty, no messages are rejected", + "A list of ActivityStreams terms to reject. If empty, no messages are rejected.", suggestions: ["Create", "Follow", "Mention", "Announce", "Like"] } ] @@ -1623,6 +1817,8 @@ # %{ # group: :pleroma, # key: :mrf_user_allowlist, + # tab: :mrf, + # related_policy: "Pleroma.Web.ActivityPub.MRF.UserAllowListPolicy", # type: :map, # description: # "The keys in this section are the domain names that the policy should apply to." <> @@ -1645,13 +1841,40 @@ }, %{ key: :base_url, + label: "Base URL", type: :string, description: "The base URL to access a user-uploaded file. Useful when you want to proxy the media files via another host/CDN fronts.", suggestions: ["https://example.com"] }, + %{ + key: :invalidation, + type: :keyword, + descpiption: "", + suggestions: [ + enabled: true, + provider: Pleroma.Web.MediaProxy.Invalidation.Script + ], + children: [ + %{ + key: :enabled, + type: :boolean, + description: "Enables media cache object invalidation." + }, + %{ + key: :provider, + type: :module, + description: "Module which will be used to purge objects from the cache.", + suggestions: [ + Pleroma.Web.MediaProxy.Invalidation.Script, + Pleroma.Web.MediaProxy.Invalidation.Http + ] + } + ] + }, %{ key: :proxy_opts, + label: "Proxy Options", type: :keyword, description: "Options for Pleroma.ReverseProxy", suggestions: [ @@ -1679,6 +1902,7 @@ }, %{ key: :http, + label: "HTTP", type: :keyword, description: "HTTP options", children: [ @@ -1717,8 +1941,52 @@ %{ key: :whitelist, type: {:list, :string}, - description: "List of domains to bypass the mediaproxy", - suggestions: ["example.com"] + description: "List of hosts with scheme to bypass the mediaproxy", + suggestions: ["http://example.com"] + } + ] + }, + %{ + group: :pleroma, + key: Pleroma.Web.MediaProxy.Invalidation.Http, + type: :group, + description: "HTTP invalidate settings", + children: [ + %{ + key: :method, + type: :atom, + description: "HTTP method of request. Default: :purge" + }, + %{ + key: :headers, + type: {:keyword, :string}, + description: "HTTP headers of request", + suggestions: [{"x-refresh", 1}] + }, + %{ + key: :options, + type: :keyword, + description: "Request options", + children: [ + %{ + key: :params, + type: {:map, :string} + } + ] + } + ] + }, + %{ + group: :pleroma, + key: Pleroma.Web.MediaProxy.Invalidation.Script, + type: :group, + description: "Script invalidate settings", + children: [ + %{ + key: :script_path, + type: :string, + description: "Path to shell script. Which will run purge cache.", + suggestions: ["./installation/nginx-cache-purge.sh.example"] } ] }, @@ -1735,6 +2003,7 @@ }, %{ key: :ip, + label: "IP", type: :tuple, description: "IP address to bind to", suggestions: [{0, 0, 0, 0}] @@ -1748,7 +2017,7 @@ %{ key: :dstport, type: :integer, - description: "Port advertised in urls (optional, defaults to port)", + description: "Port advertised in URLs (optional, defaults to port)", suggestions: [9999] } ] @@ -1756,6 +2025,7 @@ %{ group: :pleroma, key: :activitypub, + label: "ActivityPub", type: :group, description: "ActivityPub-related settings", children: [ @@ -1778,7 +2048,7 @@ key: :note_replies_output_limit, type: :integer, description: - "The number of Note replies' URIs to be included with outgoing federation (`5` to match Mastodon hardcoded value, `0` to disable the output)." + "The number of Note replies' URIs to be included with outgoing federation (`5` to match Mastodon hardcoded value, `0` to disable the output)" }, %{ key: :follow_handshake_timeout, @@ -1791,6 +2061,7 @@ %{ group: :pleroma, key: :http_security, + label: "HTTP security", type: :group, description: "HTTP security settings", children: [ @@ -1829,7 +2100,7 @@ key: :report_uri, label: "Report URI", type: :string, - description: "Adds the specified url to report-uri and report-to group in CSP header", + description: "Adds the specified URL to report-uri and report-to group in CSP header", suggestions: ["https://example.com/report-uri"] } ] @@ -1837,9 +2108,10 @@ %{ group: :web_push_encryption, key: :vapid_details, + label: "Vapid Details", type: :group, description: - "Web Push Notifications configuration. You can use the mix task mix web_push.gen.keypair to generate it", + "Web Push Notifications configuration. You can use the mix task mix web_push.gen.keypair to generate it.", children: [ %{ key: :subject, @@ -1906,15 +2178,18 @@ }, %{ group: :pleroma, + label: "Pleroma Admin Token", type: :group, description: - "Allows to set a token that can be used to authenticate with the admin api without using an actual user by giving it as the `admin_token` parameter", + "Allows setting a token that can be used to authenticate requests with admin privileges without a normal user account token. Append the `admin_token` parameter to requests to utilize it. (Please reconsider using HTTP Basic Auth or OAuth-based authentication if possible)", children: [ %{ key: :admin_token, type: :string, - description: "Token", - suggestions: ["We recommend a secure random string or UUID"] + description: "Admin token", + suggestions: [ + "Please use a high entropy string or UUID" + ] } ] }, @@ -1932,18 +2207,11 @@ """, children: [ %{ - key: :verbose, + key: :log, type: {:dropdown, :atom}, description: "Logs verbose mode", suggestions: [false, :error, :warn, :info, :debug] }, - %{ - key: :prune, - type: [:atom, :tuple], - description: - "Non-retryable jobs [pruning settings](https://github.com/sorentwo/oban#pruning)", - suggestions: [:disabled, {:maxlen, 1500}, {:maxage, 60 * 60}] - }, %{ key: :queues, type: {:keyword, :integer}, @@ -2022,9 +2290,6 @@ type: {:list, :tuple}, description: "Settings for cron background jobs", suggestions: [ - {"0 0 * * *", Pleroma.Workers.Cron.ClearOauthTokenWorker}, - {"0 * * * *", Pleroma.Workers.Cron.StatsWorker}, - {"* * * * *", Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker}, {"0 0 * * 0", Pleroma.Workers.Cron.DigestEmailsWorker}, {"0 0 * * *", Pleroma.Workers.Cron.NewUsersDigestWorker} ] @@ -2078,24 +2343,24 @@ key: :rich_media, type: :group, description: - "If enabled the instance will parse metadata from attached links to generate link previews.", + "If enabled the instance will parse metadata from attached links to generate link previews", children: [ %{ key: :enabled, type: :boolean, - description: "Enables RichMedia parsing of URLs." + description: "Enables RichMedia parsing of URLs" }, %{ key: :ignore_hosts, type: {:list, :string}, - description: "List of hosts which will be ignored by the metadata parser.", + description: "List of hosts which will be ignored by the metadata parser", suggestions: ["accounts.google.com", "xss.website"] }, %{ key: :ignore_tld, label: "Ignore TLD", type: {:list, :string}, - description: "List TLDs (top-level domains) which will ignore for parse metadata.", + description: "List TLDs (top-level domains) which will ignore for parse metadata", suggestions: ["local", "localdomain", "lan"] }, %{ @@ -2117,48 +2382,64 @@ suggestions: [ Pleroma.Web.RichMedia.Parser.TTL.AwsSignedUrl ] + }, + %{ + key: :failure_backoff, + type: :integer, + description: + "Amount of milliseconds after request failure, during which the request will not be retried.", + suggestions: [60_000] } ] }, %{ - group: :auto_linker, - key: :opts, + group: :pleroma, + key: Pleroma.Formatter, + label: "Auto Linker", type: :group, - description: "Configuration for the auto_linker library", + description: + "Configuration for Pleroma's link formatter which parses mentions, hashtags, and URLs.", children: [ %{ key: :class, - type: [:string, false], - description: "Specify the class to be added to the generated link. Disable to clear", + type: [:string, :boolean], + description: "Specify the class to be added to the generated link. Disable to clear.", suggestions: ["auto-linker", false] }, %{ key: :rel, - type: [:string, false], - description: "Override the rel attribute. Disable to clear", + type: [:string, :boolean], + description: "Override the rel attribute. Disable to clear.", suggestions: ["ugc", "noopener noreferrer", false] }, %{ key: :new_window, type: :boolean, - description: "Link urls will open in new window/tab" + description: "Link URLs will open in a new window/tab." }, %{ key: :truncate, - type: [:integer, false], + type: [:integer, :boolean], description: - "Set to a number to truncate urls longer then the number. Truncated urls will end in `..`", + "Set to a number to truncate URLs longer than the number. Truncated URLs will end in `...`", suggestions: [15, false] }, %{ key: :strip_prefix, type: :boolean, - description: "Strip the scheme prefix" + description: "Strip the scheme prefix." }, %{ key: :extra, type: :boolean, - description: "Link urls with rarely used schemes (magnet, ipfs, irc, etc.)" + description: "Link URLs with rarely used schemes (magnet, ipfs, irc, etc.)" + }, + %{ + key: :validate_tld, + type: [:atom, :boolean], + description: + "Set to false to disable TLD validation for URLs/emails. Can be set to :no_scheme to validate TLDs only for URLs without a scheme (e.g `example.com` will be validated, but `http://example.loki` won't)", + suggestions: [:no_scheme, true] } ] }, @@ -2191,19 +2472,26 @@ }, %{ group: :pleroma, - key: Pleroma.ActivityExpiration, + key: Pleroma.Workers.PurgeExpiredActivity, type: :group, - description: "Expired activity settings", + description: "Expired activities settings", children: [ %{ key: :enabled, type: :boolean, - description: "Whether expired activities will be sent to the job queue to be deleted" + description: "Enables expired activities addition & deletion" + }, + %{ + key: :min_lifetime, + type: :integer, + description: "Minimum lifetime for ephemeral activity (in seconds)", + suggestions: [600] } ] }, %{ group: :pleroma, + label: "Pleroma Authenticator", type: :group, description: "Authenticator", children: [ @@ -2217,6 +2505,7 @@ %{ group: :pleroma, key: :ldap, + label: "LDAP", type: :group, description: "Use LDAP for user authentication. When a user logs in to the Pleroma instance, the name and password" <> @@ -2303,6 +2592,7 @@ }, %{ key: :uid, + label: "UID", type: :string, description: "LDAP attribute name to authenticate the user, e.g. when \"cn\", the filter will be \"cn=username,base\"", @@ -2318,11 +2608,12 @@ children: [ %{ key: :enforce_oauth_admin_scope_usage, + label: "Enforce OAuth admin scope usage", type: :boolean, description: "OAuth admin scope requirement toggle. " <> "If enabled, admin actions explicitly demand admin OAuth scope(s) presence in OAuth token " <> - "(client app must support admin scopes). If disabled and token doesn't have admin scope(s)," <> + "(client app must support admin scopes). If disabled and token doesn't have admin scope(s), " <> "`is_admin` user flag grants access to admin-specific actions." }, %{ @@ -2334,6 +2625,7 @@ }, %{ key: :oauth_consumer_template, + label: "OAuth consumer template", type: :string, description: "OAuth consumer mode authentication form template. By default it's `consumer.html` which corresponds to" <> @@ -2342,6 +2634,7 @@ }, %{ key: :oauth_consumer_strategies, + label: "OAuth consumer strategies", type: {:list, :string}, description: "The list of enabled OAuth consumer strategies. By default it's set by OAUTH_CONSUMER_STRATEGIES environment variable." <> @@ -2408,14 +2701,14 @@ children: [ %{ key: :logo, - type: :string, + type: {:string, :image}, description: "A path to a custom logo. Set it to `nil` to use the default Pleroma logo.", suggestions: ["some/path/logo.png"] }, %{ key: :styling, type: :map, - description: "a map with color settings for email templates.", + description: "A map with color settings for email templates.", suggestions: [ %{ link_color: "#d8a070", @@ -2470,14 +2763,14 @@ %{ key: :enabled, type: :boolean, - description: "enables new users admin digest email when `true`", - suggestions: [false] + description: "Enables new users admin digest email when `true`" } ] }, %{ group: :pleroma, key: :oauth2, + label: "OAuth2", type: :group, description: "Configure OAuth 2 provider capabilities", children: [ @@ -2496,7 +2789,7 @@ %{ key: :clean_expired_tokens, type: :boolean, - description: "Enable a background job to clean expired oauth tokens. Default: disabled." + description: "Enable a background job to clean expired OAuth tokens. Default: disabled." } ] }, @@ -2520,7 +2813,7 @@ }, %{ key: :groups, - type: {:keyword, :string, {:list, :string}}, + type: {:keyword, {:list, :string}}, description: "Emojis are ordered in groups (tags). This is an array of key-value pairs where the key is the group name" <> " and the value is the location or array of locations. * can be used as a wildcard.", @@ -2580,6 +2873,7 @@ }, %{ key: :relation_id_action, + label: "Relation ID action", type: [:tuple, {:list, :tuple}], description: "For actions on relation with a specific user (follow, unfollow)", suggestions: [{1000, 10}, [{10_000, 10}, {10_000, 50}]] @@ -2593,6 +2887,7 @@ }, %{ key: :status_id_action, + label: "Status ID action", type: [:tuple, {:list, :tuple}], description: "For fav / unfav or reblog / unreblog actions on the same status by the same user", @@ -2608,6 +2903,7 @@ }, %{ group: :esshd, + label: "ESSHD", type: :group, description: "Before enabling this you must add :esshd to mix.exs as one of the extra_applications " <> @@ -2646,8 +2942,9 @@ }, %{ group: :mime, + label: "Mime Types", type: :group, - description: "Mime types", + description: "Mime Types settings", children: [ %{ key: :types, @@ -2706,6 +3003,7 @@ %{ group: :pleroma, key: :http, + label: "HTTP", type: :group, description: "HTTP settings", children: [ @@ -2754,6 +3052,7 @@ %{ group: :pleroma, key: :markup, + label: "Markup Settings", type: :group, children: [ %{ @@ -2795,7 +3094,9 @@ %{ group: :pleroma, key: :mrf_normalize_markup, - label: "MRF normalize markup", + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.NormalizeMarkup", + label: "MRF Normalize Markup", description: "MRF NormalizeMarkup settings. Scrub configured hypertext markup.", type: :group, children: [ @@ -2814,6 +3115,7 @@ %{ key: :restricted_nicknames, type: {:list, :string}, + description: "List of nicknames users may not register with.", suggestions: [ ".well-known", "~", @@ -2846,11 +3148,18 @@ "users", "web" ] + }, + %{ + key: :email_blacklist, + type: {:list, :string}, + description: "List of email domains users may not register with.", + suggestions: ["mailinator.com", "maildrop.cc"] } ] }, %{ group: :cors_plug, + label: "CORS plug config", type: :group, children: [ %{ @@ -2923,6 +3232,7 @@ %{ group: :pleroma, key: :web_cache_ttl, + label: "Web cache TTL", type: :group, description: "The expiration time for the web responses cache. Values should be in milliseconds or `nil` to disable expiration.", @@ -2945,9 +3255,10 @@ %{ group: :pleroma, key: :static_fe, + label: "Static FE", type: :group, description: - "Render profiles and posts using server-generated HTML that is viewable without using JavaScript.", + "Render profiles and posts using server-generated HTML that is viewable without using JavaScript", children: [ %{ key: :enabled, @@ -2965,18 +3276,18 @@ %{ key: :post_title, type: :map, - description: "Configure title rendering.", + description: "Configure title rendering", children: [ %{ key: :max_length, type: :integer, - description: "Maximum number of characters before truncating title.", + description: "Maximum number of characters before truncating title", suggestions: [100] }, %{ key: :omission, type: :string, - description: "Replacement which will be used after truncating string.", + description: "Replacement which will be used after truncating string", suggestions: ["..."] } ] @@ -2986,8 +3297,12 @@ %{ group: :pleroma, key: :mrf_object_age, + tab: :mrf, + related_policy: "Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy", + label: "MRF Object Age", type: :group, - description: "Rejects or delists posts based on their age when received.", + description: + "Rejects or delists posts based on their timestamp deviance from your server's clock.", children: [ %{ key: :threshold, @@ -3000,7 +3315,7 @@ type: {:list, :atom}, description: "A list of actions to apply to the post. `:delist` removes the post from public timelines; " <> - "`:strip_followers` removes followers from the ActivityPub recipient list, ensuring they won't be delivered to home timelines; " <> + "`:strip_followers` removes followers from the ActivityPub recipient list ensuring they won't be delivered to home timelines; " <> "`:reject` rejects the message entirely", suggestions: [:delist, :strip_followers, :reject] } @@ -3028,13 +3343,13 @@ %{ key: :workers, type: :integer, - description: "Number of workers to send notifications.", + description: "Number of workers to send notifications", suggestions: [3] }, %{ key: :overflow_workers, type: :integer, - description: "Maximum number of workers created if pool is empty.", + description: "Maximum number of workers created if pool is empty", suggestions: [2] } ] @@ -3043,14 +3358,22 @@ group: :pleroma, key: :connections_pool, type: :group, - description: "Advanced settings for `gun` connections pool", + description: "Advanced settings for `Gun` connections pool", children: [ %{ - key: :checkin_timeout, + key: :connection_acquisition_wait, type: :integer, - description: "Timeout to checkin connection from pool. Default: 250ms.", + description: + "Timeout to acquire a connection from pool. The total max time is this value multiplied by the number of retries. Default: 250ms.", suggestions: [250] }, + %{ + key: :connection_acquisition_retries, + type: :integer, + description: + "Number of attempts to acquire the connection from the pool if it is overloaded. Default: 5", + suggestions: [5] + }, %{ key: :max_connections, type: :integer, @@ -3058,24 +3381,17 @@ suggestions: [250] }, %{ - key: :retry, - type: :integer, - description: - "Number of retries, while `gun` will try to reconnect if connection goes down. Default: 1.", - suggestions: [1] - }, - %{ - key: :retry_timeout, - type: :integer, - description: - "Time between retries when `gun` will try to reconnect in milliseconds. Default: 1000ms.", - suggestions: [1000] - }, - %{ - key: :await_up_timeout, + key: :connect_timeout, type: :integer, description: "Timeout while `gun` will wait until connection is up. Default: 5000ms.", suggestions: [5000] + }, + %{ + key: :reclaim_multiplier, + type: :integer, + description: + "Multiplier for the number of idle connection to be reclaimed if the pool is full. For example if the pool maxes out at 250 connections and this setting is set to 0.3, the pool will reclaim at most 75 idle connections if it's overloaded. Default: 0.1", + suggestions: [0.1] } ] }, @@ -3083,115 +3399,42 @@ group: :pleroma, key: :pools, type: :group, - description: "Advanced settings for `gun` workers pools", - children: [ - %{ - key: :federation, - type: :keyword, - description: "Settings for federation pool.", - children: [ - %{ - key: :size, - type: :integer, - description: "Number workers in the pool.", - suggestions: [50] - }, - %{ - key: :max_overflow, - type: :integer, - description: "Number of additional workers if pool is under load.", - suggestions: [10] - }, - %{ - key: :timeout, - type: :integer, - description: "Timeout while `gun` will wait for response.", - suggestions: [150_000] - } - ] - }, - %{ - key: :media, - type: :keyword, - description: "Settings for media pool.", - children: [ - %{ - key: :size, - type: :integer, - description: "Number workers in the pool.", - suggestions: [50] - }, - %{ - key: :max_overflow, - type: :integer, - description: "Number of additional workers if pool is under load.", - suggestions: [10] - }, - %{ - key: :timeout, - type: :integer, - description: "Timeout while `gun` will wait for response.", - suggestions: [150_000] - } - ] - }, - %{ - key: :upload, - type: :keyword, - description: "Settings for upload pool.", - children: [ - %{ - key: :size, - type: :integer, - description: "Number workers in the pool.", - suggestions: [25] - }, - %{ - key: :max_overflow, - type: :integer, - description: "Number of additional workers if pool is under load.", - suggestions: [5] - }, - %{ - key: :timeout, - type: :integer, - description: "Timeout while `gun` will wait for response.", - suggestions: [300_000] - } - ] - }, - %{ - key: :default, - type: :keyword, - description: "Settings for default pool.", - children: [ - %{ - key: :size, - type: :integer, - description: "Number workers in the pool.", - suggestions: [10] - }, - %{ - key: :max_overflow, - type: :integer, - description: "Number of additional workers if pool is under load.", - suggestions: [2] - }, - %{ - key: :timeout, - type: :integer, - description: "Timeout while `gun` will wait for response.", - suggestions: [10_000] - } - ] - } - ] + description: "Advanced settings for `Gun` workers pools", + children: + Enum.map([:federation, :media, :upload, :default], fn pool_name -> + %{ + key: pool_name, + type: :keyword, + description: "Settings for #{pool_name} pool.", + children: [ + %{ + key: :size, + type: :integer, + description: "Maximum number of concurrent requests in the pool.", + suggestions: [50] + }, + %{ + key: :max_waiting, + type: :integer, + description: + "Maximum number of requests waiting for other requests to finish. After this number is reached, the pool will start returning errrors when a new request is made", + suggestions: [10] + }, + %{ + key: :recv_timeout, + type: :integer, + description: "Timeout for the pool while gun will wait for response", + suggestions: [10_000] + } + ] + } + end) }, %{ group: :pleroma, key: :hackney_pools, type: :group, - description: "Advanced settings for `hackney` connections pools", + description: "Advanced settings for `Hackney` connections pools", children: [ %{ key: :federation, @@ -3255,6 +3498,7 @@ %{ group: :pleroma, key: :restrict_unauthenticated, + label: "Restrict Unauthenticated", type: :group, description: "Disallow viewing timelines, user profiles and statuses for unauthenticated users.", @@ -3321,8 +3565,94 @@ key: :strict, type: :boolean, description: - "Enables strict input validation (useful in development, not recommended in production)", - suggestions: [false] + "Enables strict input validation (useful in development, not recommended in production)" + } + ] + }, + %{ + group: :pleroma, + key: :instances_favicons, + type: :group, + description: "Control favicons for instances", + children: [ + %{ + key: :enabled, + type: :boolean, + description: "Allow/disallow displaying and getting instances favicons" + } + ] + }, + %{ + group: :ex_aws, + key: :s3, + type: :group, + descriptions: "S3 service related settings", + children: [ + %{ + key: :access_key_id, + type: :string, + description: "S3 access key ID", + suggestions: ["AKIAQ8UKHTGIYN7DMWWJ"] + }, + %{ + key: :secret_access_key, + type: :string, + description: "Secret access key", + suggestions: ["JFGt+fgH1UQ7vLUQjpW+WvjTdV/UNzVxcwn7DkaeFKtBS5LvoXvIiME4NQBsT6ZZ"] + }, + %{ + key: :host, + type: :string, + description: "S3 host", + suggestions: ["s3.eu-central-1.amazonaws.com"] + } + ] + }, + %{ + group: :pleroma, + key: :frontends, + type: :group, + description: "Installed frontends management", + children: [ + %{ + key: :primary, + type: :map, + description: "Primary frontend, the one that is served for all pages by default", + children: installed_frontend_options + }, + %{ + key: :admin, + type: :map, + description: "Admin frontend", + children: installed_frontend_options + }, + %{ + key: :available, + type: :map, + description: + "A map containing available frontends and parameters for their installation.", + children: [ + frontend_options + ] + } + ] + }, + %{ + group: :pleroma, + key: Pleroma.Web.Preload, + type: :group, + description: "Preload-related settings", + children: [ + %{ + key: :providers, + type: {:list, :module}, + description: "List of preload providers to enable", + suggestions: [ + Pleroma.Web.Preload.Providers.Instance, + Pleroma.Web.Preload.Providers.User, + Pleroma.Web.Preload.Providers.Timelines, + Pleroma.Web.Preload.Providers.StatusNet + ] } ] }, diff --git a/config/test.exs b/config/test.exs index e38b9967d..0ee6f1b7f 100644 --- a/config/test.exs +++ b/config/test.exs @@ -21,7 +21,10 @@ config :pleroma, :auth, oauth_consumer_strategies: [] -config :pleroma, Pleroma.Upload, filters: [], link_name: false +config :pleroma, Pleroma.Upload, + filters: [], + link_name: false, + default_description: :filename config :pleroma, Pleroma.Uploaders.Local, uploads: "test/uploads" @@ -79,8 +82,8 @@ config :pleroma, Oban, queues: false, - prune: :disabled, - crontab: false + crontab: false, + plugins: false config :pleroma, Pleroma.ScheduledActivity, daily_user_limit: 2, @@ -111,6 +114,15 @@ config :pleroma, Pleroma.Web.ApiSpec.CastAndValidate, strict: true +config :pleroma, Pleroma.Uploaders.S3, + bucket: nil, + streaming_enabled: true, + public_endpoint: nil + +config :tzdata, :autoupdate, :disabled + +config :pleroma, :mrf, policies: [] + if File.exists?("./config/test.secret.exs") do import_config "test.secret.exs" else diff --git a/docs/API/admin_api.md b/docs/API/admin_api.md index 92816baf9..c0ea074f0 100644 --- a/docs/API/admin_api.md +++ b/docs/API/admin_api.md @@ -19,6 +19,7 @@ Configuration options: - `local`: only local users - `external`: only external users - `active`: only active users + - `need_approval`: only unapproved users - `deactivated`: only deactivated users - `is_admin`: users with admin role - `is_moderator`: users with moderator role @@ -46,7 +47,10 @@ Configuration options: "local": bool, "tags": array, "avatar": string, - "display_name": string + "display_name": string, + "confirmation_pending": bool, + "approval_pending": bool, + "registration_reason": string, }, ... ] @@ -242,6 +246,24 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret } ``` +## `PATCH /api/pleroma/admin/users/approve` + +### Approve user + +- Params: + - `nicknames`: nicknames array +- Response: + +```json +{ + users: [ + { + // user object + } + ] +} +``` + ## `GET /api/pleroma/admin/users/:nickname_or_id` ### Retrive the details of a user @@ -291,31 +313,53 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret - On failure: `Not found` - On success: JSON array of user's latest statuses +## `GET /api/pleroma/admin/relay` + +### List Relays + +Params: none +Response: + +* On success: JSON array of relays + +```json +[ + {"actor": "https://example.com/relay", "followed_back": true}, + {"actor": "https://example2.com/relay", "followed_back": false} +] +``` + ## `POST /api/pleroma/admin/relay` ### Follow a Relay -- Params: - - `relay_url` -- Response: - - On success: URL of the followed relay +Params: + +* `relay_url` + +Response: + +* On success: relay json object + +```json +{"actor": "https://example.com/relay", "followed_back": true} +``` ## `DELETE /api/pleroma/admin/relay` ### Unfollow a Relay -- Params: - - `relay_url` -- Response: - - On success: URL of the unfollowed relay +Params: -## `GET /api/pleroma/admin/relay` +* `relay_url` -### List Relays +Response: -- Params: none -- Response: - - On success: JSON array of relays +* On success: URL of the unfollowed relay + +```json +{"https://example.com/relay"} +``` ## `POST /api/pleroma/admin/users/invite_token` @@ -488,35 +532,39 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret ### Change the user's email, password, display and settings-related fields -- Params: - - `email` - - `password` - - `name` - - `bio` - - `avatar` - - `locked` - - `no_rich_text` - - `default_scope` - - `banner` - - `hide_follows` - - `hide_followers` - - `hide_followers_count` - - `hide_follows_count` - - `hide_favorites` - - `allow_following_move` - - `background` - - `show_role` - - `skip_thread_containment` - - `fields` - - `discoverable` - - `actor_type` +* Params: + * `email` + * `password` + * `name` + * `bio` + * `avatar` + * `locked` + * `no_rich_text` + * `default_scope` + * `banner` + * `hide_follows` + * `hide_followers` + * `hide_followers_count` + * `hide_follows_count` + * `hide_favorites` + * `allow_following_move` + * `background` + * `show_role` + * `skip_thread_containment` + * `fields` + * `discoverable` + * `actor_type` -- Response: +* Responses: + +Status: 200 ```json {"status": "success"} ``` +Status: 400 + ```json {"errors": {"actor_type": "is invalid"}, @@ -525,8 +573,10 @@ Note: Available `:permission_group` is currently moderator and admin. 404 is ret } ``` +Status: 404 + ```json -{"error": "Unable to update user."} +{"error": "Not found"} ``` ## `GET /api/pleroma/admin/reports` @@ -1112,6 +1162,10 @@ Loads json generated from `config/descriptions.exs`. ### Stats +- Query Params: + - *optional* `instance`: **string** instance hostname (without protocol) to get stats for +- Example: `https://mypleroma.org/api/pleroma/admin/stats?instance=lain.com` + - Response: ```json @@ -1224,4 +1278,59 @@ Loads json generated from `config/descriptions.exs`. - Response: - On success: `204`, empty response - On failure: - - 400 Bad Request `"Invalid parameters"` when `status` is missing \ No newline at end of file + - 400 Bad Request `"Invalid parameters"` when `status` is missing + +## `GET /api/pleroma/admin/media_proxy_caches` + +### Get a list of all banned MediaProxy URLs in Cachex + +- Authentication: required +- Params: +- *optional* `page`: **integer** page number +- *optional* `page_size`: **integer** number of log entries per page (default is `50`) +- *optional* `query`: **string** search term + +- Response: + +``` json +{ + "page_size": integer, + "count": integer, + "urls": [ + "http://example.com/media/a688346.jpg", + "http://example.com/media/fb1f4d.jpg" + ] +} + +``` + +## `POST /api/pleroma/admin/media_proxy_caches/delete` + +### Remove a banned MediaProxy URL from Cachex + +- Authentication: required +- Params: + - `urls` (array) + +- Response: + +``` json +{ } + +``` + +## `POST /api/pleroma/admin/media_proxy_caches/purge` + +### Purge a MediaProxy URL + +- Authentication: required +- Params: + - `urls` (array) + - `ban` (boolean) + +- Response: + +``` json +{ } + +``` diff --git a/docs/API/differences_in_mastoapi_responses.md b/docs/API/differences_in_mastoapi_responses.md index be3c802af..38865dc68 100644 --- a/docs/API/differences_in_mastoapi_responses.md +++ b/docs/API/differences_in_mastoapi_responses.md @@ -27,6 +27,7 @@ Has these additional fields under the `pleroma` object: - `expires_at`: a datetime (iso8601) that states when the post will expire (be deleted automatically), or empty if the post won't expire - `thread_muted`: true if the thread the post belongs to is muted - `emoji_reactions`: A list with emoji / reaction maps. The format is `{name: "☕", count: 1, me: true}`. Contains no information about the reacting users, for that use the `/statuses/:id/reactions` endpoint. +- `parent_visible`: If the parent of this post is visible to the user or not. ## Media Attachments @@ -51,21 +52,27 @@ The `id` parameter can also be the `nickname` of the user. This only works in th Has these additional fields under the `pleroma` object: +- `ap_id`: nullable URL string, ActivityPub id of the user +- `background_image`: nullable URL string, background image of the user - `tags`: Lists an array of tags for the user -- `relationship{}`: Includes fields as documented for Mastodon API https://docs.joinmastodon.org/entities/relationship/ +- `relationship` (object): Includes fields as documented for Mastodon API https://docs.joinmastodon.org/entities/relationship/ - `is_moderator`: boolean, nullable, true if user is a moderator - `is_admin`: boolean, nullable, true if user is an admin - `confirmation_pending`: boolean, true if a new user account is waiting on email confirmation to be activated +- `hide_favorites`: boolean, true when the user has hiding favorites enabled - `hide_followers`: boolean, true when the user has follower hiding enabled - `hide_follows`: boolean, true when the user has follow hiding enabled - `hide_followers_count`: boolean, true when the user has follower stat hiding enabled - `hide_follows_count`: boolean, true when the user has follow stat hiding enabled -- `settings_store`: A generic map of settings for frontends. Opaque to the backend. Only returned in `verify_credentials` and `update_credentials` -- `chat_token`: The token needed for Pleroma chat. Only returned in `verify_credentials` +- `settings_store`: A generic map of settings for frontends. Opaque to the backend. Only returned in `/api/v1/accounts/verify_credentials` and `/api/v1/accounts/update_credentials` +- `chat_token`: The token needed for Pleroma chat. Only returned in `/api/v1/accounts/verify_credentials` - `deactivated`: boolean, true when the user is deactivated - `allow_following_move`: boolean, true when the user allows automatically follow moved following accounts - `unread_conversation_count`: The count of unread conversations. Only returned to the account owner. - `unread_notifications_count`: The count of unread notifications. Only returned to the account owner. +- `notification_settings`: object, can be absent. See `/api/pleroma/notification_settings` for the parameters/keys returned. +- `accepts_chat_messages`: boolean, but can be null if we don't have that information about a user +- `favicon`: nullable URL string, Favicon image of the user's instance ### Source @@ -162,7 +169,7 @@ Returns: array of Status. The maximum number of statuses is limited to 100 per request. -## PATCH `/api/v1/update_credentials` +## PATCH `/api/v1/accounts/update_credentials` Additional parameters can be added to the JSON body/Form data: @@ -177,9 +184,12 @@ Additional parameters can be added to the JSON body/Form data: - `pleroma_settings_store` - Opaque user settings to be saved on the backend. - `skip_thread_containment` - if true, skip filtering out broken threads - `allow_following_move` - if true, allows automatically follow moved following accounts -- `pleroma_background_image` - sets the background image of the user. +- `pleroma_background_image` - sets the background image of the user. Can be set to "" (an empty string) to reset. - `discoverable` - if true, discovery of this account in search results and other services is allowed. - `actor_type` - the type of this account. +- `accepts_chat_messages` - if false, this account will reject all chat messages. + +All images (avatar, banner and background) can be reset to the default by sending an empty string ("") instead of a file. ### Pleroma Settings Store @@ -187,7 +197,7 @@ Pleroma has mechanism that allows frontends to save blobs of json for each user The parameter should have a form of `{frontend_name: {...}}`, with `frontend_name` identifying your type of client, e.g. `pleroma_fe`. It will overwrite everything under this property, but will not overwrite other frontend's settings. -This information is returned in the `verify_credentials` endpoint. +This information is returned in the `/api/v1/accounts/verify_credentials` endpoint. ## Authentication @@ -215,6 +225,8 @@ Has theses additional parameters (which are the same as in Pleroma-API): `GET /api/v1/instance` has additional fields - `max_toot_chars`: The maximum characters per post +- `chat_limit`: The maximum characters per chat message +- `description_limit`: The maximum characters per image description - `poll_limits`: The limits of polls - `upload_limit`: The maximum upload file size - `avatar_upload_limit`: The same for avatars @@ -223,6 +235,8 @@ Has theses additional parameters (which are the same as in Pleroma-API): - `background_image`: A background image that frontends can use - `pleroma.metadata.features`: A list of supported features - `pleroma.metadata.federation`: The federation restrictions of this instance +- `pleroma.metadata.fields_limits`: A list of values detailing the length and count limitation for various instance-configurable fields. +- `pleroma.metadata.post_formats`: A list of the allowed post format types - `vapid_public_key`: The public key needed for push messages ## Markers @@ -234,3 +248,43 @@ Has these additional fields under the `pleroma` object: ## Streaming There is an additional `user:pleroma_chat` stream. Incoming chat messages will make the current chat be sent to this `user` stream. The `event` of an incoming chat message is `pleroma:chat_update`. The payload is the updated chat with the incoming chat message in the `last_message` field. + +## Not implemented + +Pleroma is generally compatible with the Mastodon 2.7.2 API, but some newer features and non-essential features are omitted. These features usually return an HTTP 200 status code, but with an empty response. While they may be added in the future, they are considered low priority. + +### Suggestions + +*Added in Mastodon 2.4.3* + +- `GET /api/v1/suggestions`: Returns an empty array, `[]` + +### Trends + +*Added in Mastodon 3.0.0* + +- `GET /api/v1/trends`: Returns an empty array, `[]` + +### Identity proofs + +*Added in Mastodon 2.8.0* + +- `GET /api/v1/identity_proofs`: Returns an empty array, `[]` + +### Endorsements + +*Added in Mastodon 2.5.0* + +- `GET /api/v1/endorsements`: Returns an empty array, `[]` + +### Profile directory + +*Added in Mastodon 3.0.0* + +- `GET /api/v1/directory`: Returns HTTP 404 + +### Featured tags + +*Added in Mastodon 3.0.0* + +- `GET /api/v1/featured_tags`: Returns HTTP 404 diff --git a/docs/API/pleroma_api.md b/docs/API/pleroma_api.md index 70d4755b7..4e97d26c0 100644 --- a/docs/API/pleroma_api.md +++ b/docs/API/pleroma_api.md @@ -50,7 +50,7 @@ Request parameters can be passed via [query strings](https://en.wikipedia.org/wi * Authentication: not required * Params: none * Response: Provider specific JSON, the only guaranteed parameter is `type` -* Example response: `{"type": "kocaptcha", "token": "whatever", "url": "https://captcha.kotobank.ch/endpoint"}` +* Example response: `{"type": "kocaptcha", "token": "whatever", "url": "https://captcha.kotobank.ch/endpoint", "seconds_valid": 300}` ## `/api/pleroma/delete_account` ### Delete an account @@ -287,11 +287,8 @@ See [Admin-API](admin_api.md) * Method `PUT` * Authentication: required * Params: - * `followers`: BOOLEAN field, receives notifications from followers - * `follows`: BOOLEAN field, receives notifications from people the user follows - * `remote`: BOOLEAN field, receives notifications from people on remote instances - * `local`: BOOLEAN field, receives notifications from people on the local instance - * `privacy_option`: BOOLEAN field. When set to true, it removes the contents of a message from the push notification. + * `block_from_strangers`: BOOLEAN field, blocks notifications from accounts you do not follow + * `hide_notification_contents`: BOOLEAN field. When set to true, it removes the contents of a message from the push notification. * Response: JSON. Returns `{"status": "success"}` if the update was successful, otherwise returns `{"error": "error_msg"}` ## `/api/pleroma/healthcheck` @@ -450,18 +447,44 @@ The status posting endpoint takes an additional parameter, `in_reply_to_conversa * Response: JSON, list with updated files for updated pack (hashmap -> shortcode => filename) with status 200, either error status with error message. ## `GET /api/pleroma/emoji/packs` + ### Lists local custom emoji packs + * Method `GET` * Authentication: not required -* Params: None -* Response: JSON, "ok" and 200 status and the JSON hashmap of pack name to pack contents +* Params: + * `page`: page number for packs (default 1) + * `page_size`: page size for packs (default 50) +* Response: `packs` key with JSON hashmap of pack name to pack contents and `count` key for count of packs. + +```json +{ + "packs": { + "pack_name": {...}, // pack contents + ... + }, + "count": 0 // packs count +} +``` ## `GET /api/pleroma/emoji/packs/:name` + ### Get pack.json for the pack + * Method `GET` * Authentication: not required -* Params: None -* Response: JSON, pack json with `files` and `pack` keys with 200 status or 404 if the pack does not exist +* Params: + * `page`: page number for files (default 1) + * `page_size`: page size for files (default 30) +* Response: JSON, pack json with `files`, `files_count` and `pack` keys with 200 status or 404 if the pack does not exist. + +```json +{ + "files": {...}, + "files_count": 0, // emoji count in pack + "pack": {...} +} +``` ## `GET /api/pleroma/emoji/packs/:name/archive` ### Requests a local pack archive from the instance diff --git a/docs/administration/CLI_tasks/config.md b/docs/administration/CLI_tasks/config.md index cc32bf859..0923004b5 100644 --- a/docs/administration/CLI_tasks/config.md +++ b/docs/administration/CLI_tasks/config.md @@ -11,14 +11,17 @@ config :pleroma, configurable_from_database: true ``` -```sh tab="OTP" - ./bin/pleroma_ctl config migrate_to_db -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.config migrate_to_db -``` + ```sh + ./bin/pleroma_ctl config migrate_to_db + ``` +=== "From Source" + + ```sh + mix pleroma.config migrate_to_db + ``` ## Transfer config from DB to `config/env.exported_from_db.secret.exs` @@ -31,10 +34,12 @@ mix pleroma.config migrate_to_db To delete transfered settings from database optional flag `-d` can be used. `` is `prod` by default. -```sh tab="OTP" - ./bin/pleroma_ctl config migrate_from_db [--env=] [-d] -``` +=== "OTP" + ```sh + ./bin/pleroma_ctl config migrate_from_db [--env=] [-d] + ``` -```sh tab="From Source" -mix pleroma.config migrate_from_db [--env=] [-d] -``` +=== "From Source" + ```sh + mix pleroma.config migrate_from_db [--env=] [-d] + ``` diff --git a/docs/administration/CLI_tasks/database.md b/docs/administration/CLI_tasks/database.md index 647f6f274..6dca83167 100644 --- a/docs/administration/CLI_tasks/database.md +++ b/docs/administration/CLI_tasks/database.md @@ -9,13 +9,18 @@ Replaces embedded objects with references to them in the `objects` table. Only needs to be ran once if the instance was created before Pleroma 1.0.5. The reason why this is not a migration is because it could significantly increase the database size after being ran, however after this `VACUUM FULL` will be able to reclaim about 20% (really depends on what is in the database, your mileage may vary) of the db size before the migration. -```sh tab="OTP" -./bin/pleroma_ctl database remove_embedded_objects [option ...] -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl database remove_embedded_objects [option ...] + ``` + +=== "From Source" + + ```sh + mix pleroma.database remove_embedded_objects [option ...] + ``` -```sh tab="From Source" -mix pleroma.database remove_embedded_objects [option ...] -``` ### Options - `--vacuum` - run `VACUUM FULL` after the embedded objects are replaced with their references @@ -27,13 +32,17 @@ This will prune remote posts older than 90 days (configurable with [`config :ple !!! danger The disk space will only be reclaimed after `VACUUM FULL`. You may run out of disk space during the execution of the task or vacuuming if you don't have about 1/3rds of the database size free. -```sh tab="OTP" -./bin/pleroma_ctl database prune_objects [option ...] -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.database prune_objects [option ...] -``` + ```sh + ./bin/pleroma_ctl database prune_objects [option ...] + ``` + +=== "From Source" + + ```sh + mix pleroma.database prune_objects [option ...] + ``` ### Options - `--vacuum` - run `VACUUM FULL` after the objects are pruned @@ -42,33 +51,45 @@ mix pleroma.database prune_objects [option ...] Can be safely re-run -```sh tab="OTP" -./bin/pleroma_ctl database bump_all_conversations -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.database bump_all_conversations -``` + ```sh + ./bin/pleroma_ctl database bump_all_conversations + ``` + +=== "From Source" + + ```sh + mix pleroma.database bump_all_conversations + ``` ## Remove duplicated items from following and update followers count for all users -```sh tab="OTP" -./bin/pleroma_ctl database update_users_following_followers_counts -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.database update_users_following_followers_counts -``` + ```sh + ./bin/pleroma_ctl database update_users_following_followers_counts + ``` + +=== "From Source" + + ```sh + mix pleroma.database update_users_following_followers_counts + ``` ## Fix the pre-existing "likes" collections for all objects -```sh tab="OTP" -./bin/pleroma_ctl database fix_likes_collections -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.database fix_likes_collections -``` + ```sh + ./bin/pleroma_ctl database fix_likes_collections + ``` + +=== "From Source" + + ```sh + mix pleroma.database fix_likes_collections + ``` ## Vacuum the database @@ -76,13 +97,17 @@ mix pleroma.database fix_likes_collections Running an `analyze` vacuum job can improve performance by updating statistics used by the query planner. **It is safe to cancel this.** -```sh tab="OTP" -./bin/pleroma_ctl database vacuum analyze -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.database vacuum analyze -``` + ```sh + ./bin/pleroma_ctl database vacuum analyze + ``` + +=== "From Source" + + ```sh + mix pleroma.database vacuum analyze + ``` ### Full @@ -91,10 +116,28 @@ and more compact files with an optimized layout. This process will take a long t it builds the files side-by-side the existing database files. It can make your database faster and use less disk space, but should only be run if necessary. **It is safe to cancel this.** -```sh tab="OTP" -./bin/pleroma_ctl database vacuum full -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.database vacuum full -``` \ No newline at end of file + ```sh + ./bin/pleroma_ctl database vacuum full + ``` + +=== "From Source" + + ```sh + mix pleroma.database vacuum full + ``` + +## Add expiration to all local statuses + +=== "OTP" + + ```sh + ./bin/pleroma_ctl database ensure_expiration + ``` + +=== "From Source" + + ```sh + mix pleroma.database ensure_expiration + ``` diff --git a/docs/administration/CLI_tasks/digest.md b/docs/administration/CLI_tasks/digest.md index 2eb31379e..a590581e3 100644 --- a/docs/administration/CLI_tasks/digest.md +++ b/docs/administration/CLI_tasks/digest.md @@ -4,22 +4,30 @@ ## Send digest email since given date (user registration date by default) ignoring user activity status. -```sh tab="OTP" - ./bin/pleroma_ctl digest test [since_date] -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.digest test [since_date] -``` + ```sh + ./bin/pleroma_ctl digest test [since_date] + ``` + +=== "From Source" + + ```sh + mix pleroma.digest test [since_date] + ``` Example: -```sh tab="OTP" -./bin/pleroma_ctl digest test donaldtheduck 2019-05-20 -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.digest test donaldtheduck 2019-05-20 -``` + ```sh + ./bin/pleroma_ctl digest test donaldtheduck 2019-05-20 + ``` + +=== "From Source" + + ```sh + mix pleroma.digest test donaldtheduck 2019-05-20 + ``` diff --git a/docs/administration/CLI_tasks/email.md b/docs/administration/CLI_tasks/email.md index 7b7a8457a..00d2e74f8 100644 --- a/docs/administration/CLI_tasks/email.md +++ b/docs/administration/CLI_tasks/email.md @@ -4,21 +4,29 @@ ## Send test email (instance email by default) -```sh tab="OTP" - ./bin/pleroma_ctl email test [--to ] -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.email test [--to ] -``` + ```sh + ./bin/pleroma_ctl email test [--to ] + ``` + +=== "From Source" + + ```sh + mix pleroma.email test [--to ] + ``` Example: -```sh tab="OTP" -./bin/pleroma_ctl email test --to root@example.org -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.email test --to root@example.org -``` + ```sh + ./bin/pleroma_ctl email test --to root@example.org + ``` + +=== "From Source" + + ```sh + mix pleroma.email test --to root@example.org + ``` diff --git a/docs/administration/CLI_tasks/emoji.md b/docs/administration/CLI_tasks/emoji.md index ddcb7e62c..e3d1b210e 100644 --- a/docs/administration/CLI_tasks/emoji.md +++ b/docs/administration/CLI_tasks/emoji.md @@ -4,13 +4,15 @@ ## Lists emoji packs and metadata specified in the manifest -```sh tab="OTP" -./bin/pleroma_ctl emoji ls-packs [option ...] -``` +=== "OTP" + ```sh + ./bin/pleroma_ctl emoji ls-packs [option ...] + ``` -```sh tab="From Source" -mix pleroma.emoji ls-packs [option ...] -``` +=== "From Source" + ```sh + mix pleroma.emoji ls-packs [option ...] + ``` ### Options @@ -18,26 +20,30 @@ mix pleroma.emoji ls-packs [option ...] ## Fetch, verify and install the specified packs from the manifest into `STATIC-DIR/emoji/PACK-NAME` -```sh tab="OTP" -./bin/pleroma_ctl emoji get-packs [option ...] -``` +=== "OTP" + ```sh + ./bin/pleroma_ctl emoji get-packs [option ...] + ``` -```sh tab="From Source" -mix pleroma.emoji get-packs [option ...] -``` +=== "From Source" + ```sh + mix pleroma.emoji get-packs [option ...] + ``` ### Options - `-m, --manifest PATH/URL` - same as [`ls-packs`](#ls-packs) ## Create a new manifest entry and a file list from the specified remote pack file -```sh tab="OTP" -./bin/pleroma_ctl emoji gen-pack PACK-URL -``` +=== "OTP" + ```sh + ./bin/pleroma_ctl emoji gen-pack PACK-URL + ``` -```sh tab="From Source" -mix pleroma.emoji gen-pack PACK-URL -``` +=== "From Source" + ```sh + mix pleroma.emoji gen-pack PACK-URL + ``` Currently, only .zip archives are recognized as remote pack files and packs are therefore assumed to be zip archives. This command is intended to run interactively and will first ask you some basic questions about the pack, then download the remote file and generate an SHA256 checksum for it, then generate an emoji file list for you. @@ -47,8 +53,9 @@ Currently, only .zip archives are recognized as remote pack files and packs are ## Reload emoji packs -```sh tab="OTP" -./bin/pleroma_ctl emoji reload -``` +=== "OTP" + ```sh + ./bin/pleroma_ctl emoji reload + ``` This command only works with OTP releases. diff --git a/docs/administration/CLI_tasks/frontend.md b/docs/administration/CLI_tasks/frontend.md new file mode 100644 index 000000000..7d1c1e937 --- /dev/null +++ b/docs/administration/CLI_tasks/frontend.md @@ -0,0 +1,69 @@ +# Managing frontends + +`mix pleroma.frontend install [--ref ] [--file ] [--build-url ] [--path ] [--build-dir ]` + +Frontend can be installed either from local zip file, or automatically downloaded from the web. + +You can give all the options directly on the command like, but missing information will be filled out by looking at the data configured under `frontends.available` in the config files. + +Currently known `` values are: +- [admin-fe](https://git.pleroma.social/pleroma/admin-fe) +- [kenoma](http://git.pleroma.social/lambadalambda/kenoma) +- [pleroma-fe](http://git.pleroma.social/pleroma/pleroma-fe) +- [fedi-fe](https://git.pleroma.social/pleroma/fedi-fe) +- [soapbox-fe](https://gitlab.com/soapbox-pub/soapbox-fe) + +You can still install frontends that are not configured, see below. + +## Example installations for a known frontend + +For a frontend configured under the `available` key, it's enough to install it by name. + +```sh tab="OTP" +./bin/pleroma_ctl frontend install pleroma +``` + +```sh tab="From Source" +mix pleroma.frontend install pleroma +``` + +This will download the latest build for the the pre-configured `ref` and install it. It can then be configured as the one of the served frontends in the config file (see `primary` or `admin`). + +You can override any of the details. To install a pleroma build from a different url, you could do this: + +```sh tab="OPT" +./bin/pleroma_ctl frontend install pleroma --ref 2hu_edition --build-url https://example.org/raymoo.zip +``` + +```sh tab="From Source" +mix pleroma.frontend install pleroma --ref 2hu_edition --build-url https://example.org/raymoo.zip +``` + +Similarly, you can also install from a local zip file. + +```sh tab="OTP" +./bin/pleroma_ctl frontend install pleroma --ref mybuild --file ~/Downloads/doomfe.zip +``` + +```sh tab="From Source" +mix pleroma.frontend install pleroma --ref mybuild --file ~/Downloads/doomfe.zip +``` + +The resulting frontend will always be installed into a folder of this template: `${instance_static}/frontends/${name}/${ref}` + +Careful: This folder will be completely replaced on installation + +## Example installation for an unknown frontend + +The installation process is the same, but you will have to give all the needed options on the commond line. For example: + +```sh tab="OTP" +./bin/pleroma_ctl frontend install gensokyo --ref master --build-url https://gensokyo.2hu/builds/marisa.zip +``` + +```sh tab="From Source" +mix pleroma.frontend install gensokyo --ref master --build-url https://gensokyo.2hu/builds/marisa.zip +``` + +If you don't have a zip file but just want to install a frontend from a local path, you can simply copy the files over a folder of this template: `${instance_static}/frontends/${name}/${ref}` + diff --git a/docs/administration/CLI_tasks/instance.md b/docs/administration/CLI_tasks/instance.md index 52e264bb1..989ecc55d 100644 --- a/docs/administration/CLI_tasks/instance.md +++ b/docs/administration/CLI_tasks/instance.md @@ -3,13 +3,17 @@ {! backend/administration/CLI_tasks/general_cli_task_info.include !} ## Generate a new configuration file -```sh tab="OTP" - ./bin/pleroma_ctl instance gen [option ...] -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.instance gen [option ...] -``` + ```sh + ./bin/pleroma_ctl instance gen [option ...] + ``` + +=== "From Source" + + ```sh + mix pleroma.instance gen [option ...] + ``` If any of the options are left unspecified, you will be prompted interactively. diff --git a/docs/administration/CLI_tasks/oauth_app.md b/docs/administration/CLI_tasks/oauth_app.md index 4d6bfc25a..f0568491e 100644 --- a/docs/administration/CLI_tasks/oauth_app.md +++ b/docs/administration/CLI_tasks/oauth_app.md @@ -7,10 +7,14 @@ Optional params: * `-s SCOPES` - scopes for app, e.g. `read,write,follow,push`. -```sh tab="OTP" - ./bin/pleroma_ctl app create -n APP_NAME -r REDIRECT_URI -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.app create -n APP_NAME -r REDIRECT_URI -``` \ No newline at end of file + ```sh + ./bin/pleroma_ctl app create -n APP_NAME -r REDIRECT_URI + ``` + +=== "From Source" + + ```sh + mix pleroma.app create -n APP_NAME -r REDIRECT_URI + ``` \ No newline at end of file diff --git a/docs/administration/CLI_tasks/relay.md b/docs/administration/CLI_tasks/relay.md index c4f078f4d..bdd7e8be4 100644 --- a/docs/administration/CLI_tasks/relay.md +++ b/docs/administration/CLI_tasks/relay.md @@ -4,30 +4,42 @@ ## Follow a relay -```sh tab="OTP" -./bin/pleroma_ctl relay follow -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.relay follow -``` + ```sh + ./bin/pleroma_ctl relay follow + ``` + +=== "From Source" + + ```sh + mix pleroma.relay follow + ``` ## Unfollow a remote relay -```sh tab="OTP" -./bin/pleroma_ctl relay unfollow -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.relay unfollow -``` + ```sh + ./bin/pleroma_ctl relay unfollow + ``` + +=== "From Source" + + ```sh + mix pleroma.relay unfollow + ``` ## List relay subscriptions -```sh tab="OTP" -./bin/pleroma_ctl relay list -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.relay list -``` + ```sh + ./bin/pleroma_ctl relay list + ``` + +=== "From Source" + + ```sh + mix pleroma.relay list + ``` diff --git a/docs/administration/CLI_tasks/robots_txt.md b/docs/administration/CLI_tasks/robots_txt.md new file mode 100644 index 000000000..7eeedf571 --- /dev/null +++ b/docs/administration/CLI_tasks/robots_txt.md @@ -0,0 +1,21 @@ +# Managing robots.txt + +{! backend/administration/CLI_tasks/general_cli_task_info.include !} + +## Generate a new robots.txt file and add it to the static directory + +The `robots.txt` that ships by default is permissive. It allows well-behaved search engines to index all of your instance's URIs. + +If you want to generate a restrictive `robots.txt`, you can run the following mix task. The generated `robots.txt` will be written in your instance [static directory](../../../configuration/static_dir/). + +=== "OTP" + + ```sh + ./bin/pleroma_ctl robots_txt disallow_all + ``` + +=== "From Source" + + ```sh + mix pleroma.robots_txt disallow_all + ``` diff --git a/docs/administration/CLI_tasks/uploads.md b/docs/administration/CLI_tasks/uploads.md index 6a15d22f6..8585ec76b 100644 --- a/docs/administration/CLI_tasks/uploads.md +++ b/docs/administration/CLI_tasks/uploads.md @@ -3,13 +3,17 @@ {! backend/administration/CLI_tasks/general_cli_task_info.include !} ## Migrate uploads from local to remote storage -```sh tab="OTP" - ./bin/pleroma_ctl uploads migrate_local [option ...] -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.uploads migrate_local [option ...] -``` + ```sh + ./bin/pleroma_ctl uploads migrate_local [option ...] + ``` + +=== "From Source" + + ```sh + mix pleroma.uploads migrate_local [option ...] + ``` ### Options - `--delete` - delete local uploads after migrating them to the target uploader diff --git a/docs/administration/CLI_tasks/user.md b/docs/administration/CLI_tasks/user.md index 1e6f4a8b4..3e7f028ba 100644 --- a/docs/administration/CLI_tasks/user.md +++ b/docs/administration/CLI_tasks/user.md @@ -4,13 +4,17 @@ ## Create a user -```sh tab="OTP" -./bin/pleroma_ctl user new [option ...] -``` +=== "OTP" -```sh tab="From Source" -mix pleroma.user new [option ...] -``` + ```sh + ./bin/pleroma_ctl user new [option ...] + ``` + +=== "From Source" + + ```sh + mix pleroma.user new [option ...] + ``` ### Options @@ -22,23 +26,33 @@ mix pleroma.user new [option ...] - `-y`, `--assume-yes`/`--no-assume-yes` - whether to assume yes to all questions ## List local users -```sh tab="OTP" - ./bin/pleroma_ctl user list -``` -```sh tab="From Source" -mix pleroma.user list -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user list + ``` + +=== "From Source" + + ```sh + mix pleroma.user list + ``` ## Generate an invite link -```sh tab="OTP" - ./bin/pleroma_ctl user invite [option ...] -``` -```sh tab="From Source" -mix pleroma.user invite [option ...] -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user invite [option ...] + ``` + +=== "From Source" + + ```sh + mix pleroma.user invite [option ...] + ``` ### Options @@ -46,113 +60,168 @@ mix pleroma.user invite [option ...] - `--max-use NUMBER` - maximum numbers of token uses ## List generated invites -```sh tab="OTP" - ./bin/pleroma_ctl user invites -``` -```sh tab="From Source" -mix pleroma.user invites -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user invites + ``` + +=== "From Source" + + ```sh + mix pleroma.user invites + ``` ## Revoke invite -```sh tab="OTP" - ./bin/pleroma_ctl user revoke_invite -``` -```sh tab="From Source" -mix pleroma.user revoke_invite -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user revoke_invite + ``` + +=== "From Source" + + ```sh + mix pleroma.user revoke_invite + ``` ## Delete a user -```sh tab="OTP" - ./bin/pleroma_ctl user rm -``` -```sh tab="From Source" -mix pleroma.user rm -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user rm + ``` + +=== "From Source" + + ```sh + mix pleroma.user rm + ``` ## Delete user's posts and interactions -```sh tab="OTP" - ./bin/pleroma_ctl user delete_activities -``` -```sh tab="From Source" -mix pleroma.user delete_activities -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user delete_activities + ``` + +=== "From Source" + + ```sh + mix pleroma.user delete_activities + ``` ## Sign user out from all applications (delete user's OAuth tokens and authorizations) -```sh tab="OTP" - ./bin/pleroma_ctl user sign_out -``` -```sh tab="From Source" -mix pleroma.user sign_out -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user sign_out + ``` + +=== "From Source" + + ```sh + mix pleroma.user sign_out + ``` ## Deactivate or activate a user -```sh tab="OTP" - ./bin/pleroma_ctl user toggle_activated -``` -```sh tab="From Source" -mix pleroma.user toggle_activated -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user toggle_activated + ``` + +=== "From Source" + + ```sh + mix pleroma.user toggle_activated + ``` ## Deactivate a user and unsubscribes local users from the user -```sh tab="OTP" - ./bin/pleroma_ctl user deactivate NICKNAME -``` -```sh tab="From Source" -mix pleroma.user deactivate NICKNAME -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user deactivate NICKNAME + ``` + +=== "From Source" + + ```sh + mix pleroma.user deactivate NICKNAME + ``` ## Deactivate all accounts from an instance and unsubscribe local users on it -```sh tab="OTP" - ./bin/pleroma_ctl user deactivate_all_from_instance -``` -```sh tab="From Source" -mix pleroma.user deactivate_all_from_instance -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user deactivate_all_from_instance + ``` + +=== "From Source" + + ```sh + mix pleroma.user deactivate_all_from_instance + ``` ## Create a password reset link for user -```sh tab="OTP" - ./bin/pleroma_ctl user reset_password -``` -```sh tab="From Source" -mix pleroma.user reset_password -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user reset_password + ``` + +=== "From Source" + + ```sh + mix pleroma.user reset_password + ``` ## Disable Multi Factor Authentication (MFA/2FA) for a user -```sh tab="OTP" - ./bin/pleroma_ctl user reset_mfa -``` -```sh tab="From Source" -mix pleroma.user reset_mfa -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user reset_mfa + ``` + +=== "From Source" + + ```sh + mix pleroma.user reset_mfa + ``` ## Set the value of the given user's settings -```sh tab="OTP" - ./bin/pleroma_ctl user set [option ...] -``` -```sh tab="From Source" -mix pleroma.user set [option ...] -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user set [option ...] + ``` + +=== "From Source" + + ```sh + mix pleroma.user set [option ...] + ``` ### Options - `--locked`/`--no-locked` - whether the user should be locked @@ -160,30 +229,45 @@ mix pleroma.user set [option ...] - `--admin`/`--no-admin` - whether the user should be an admin ## Add tags to a user -```sh tab="OTP" - ./bin/pleroma_ctl user tag -``` -```sh tab="From Source" -mix pleroma.user tag -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user tag + ``` + +=== "From Source" + + ```sh + mix pleroma.user tag + ``` ## Delete tags from a user -```sh tab="OTP" - ./bin/pleroma_ctl user untag -``` -```sh tab="From Source" -mix pleroma.user untag -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user untag + ``` + +=== "From Source" + + ```sh + mix pleroma.user untag + ``` ## Toggle confirmation status of the user -```sh tab="OTP" - ./bin/pleroma_ctl user toggle_confirmed -``` -```sh tab="From Source" -mix pleroma.user toggle_confirmed -``` +=== "OTP" + + ```sh + ./bin/pleroma_ctl user toggle_confirmed + ``` + +=== "From Source" + + ```sh + mix pleroma.user toggle_confirmed + ``` diff --git a/docs/administration/updating.md b/docs/administration/updating.md index 2a08dac1f..ef2c9218c 100644 --- a/docs/administration/updating.md +++ b/docs/administration/updating.md @@ -1,6 +1,6 @@ # Updating your instance -You should **always check the release notes/changelog** in case there are config deprecations, special update special update steps, etc. +You should **always check the [release notes/changelog](https://git.pleroma.social/pleroma/pleroma/-/releases)** in case there are config deprecations, special update steps, etc. Besides that, doing the following is generally enough: @@ -18,9 +18,10 @@ su pleroma -s $SHELL -lc "./bin/pleroma_ctl migrate" 1. Go to the working directory of Pleroma (default is `/opt/pleroma`) 2. Run `git pull`. This pulls the latest changes from upstream. -3. Run `mix deps.get`. This pulls in any new dependencies. +3. Run `mix deps.get` [^1]. This pulls in any new dependencies. 4. Stop the Pleroma service. -5. Run `mix ecto.migrate`[^1]. This task performs database migrations, if there were any. +5. Run `mix ecto.migrate` [^1] [^2]. This task performs database migrations, if there were any. 6. Start the Pleroma service. -[^1]: Prefix with `MIX_ENV=prod` to run it using the production config file. +[^1]: Depending on which install guide you followed (for example on Debian/Ubuntu), you want to run `mix` tasks as `pleroma` user by adding `sudo -Hu pleroma` before the command. +[^2]: Prefix with `MIX_ENV=prod` to run it using the production config file. diff --git a/docs/clients.md b/docs/clients.md index ea751637e..f84295b1f 100644 --- a/docs/clients.md +++ b/docs/clients.md @@ -6,11 +6,11 @@ Feel free to contact us to be added to this list! ### Roma for Desktop - Homepage: - Source Code: -- Platforms: Windows, Mac, (Linux?) +- Platforms: Windows, Mac, Linux - Features: Streaming Ready ### Social -- Source Code: +- Source Code: - Contact: [@brainblasted@social.libre.fi](https://social.libre.fi/users/brainblasted) - Platforms: Linux (GNOME) - Note(2019-01-28): Not at a pre-alpha stage yet @@ -35,7 +35,7 @@ Feel free to contact us to be added to this list! - Source Code: - Contact: [@fedilab@framapiaf.org](https://framapiaf.org/users/fedilab) - Platforms: Android -- Features: Streaming Ready, Moderation, Text Formatting +- Features: Streaming Ready, Moderation, Text Formatting ### Kyclos - Source Code: @@ -48,16 +48,9 @@ Feel free to contact us to be added to this list! - Platforms: Android - Features: No Streaming, Emoji Reactions, Text Formatting, FE Stickers -### Nekonium -- Homepage: [F-Droid Repository](https://repo.gdgd.jp.net/), [Google Play](https://play.google.com/store/apps/details?id=com.apps.nekonium), [Amazon](https://www.amazon.co.jp/dp/B076FXPRBC/) -- Source: -- Contact: [@lin@pleroma.gdgd.jp.net](https://pleroma.gdgd.jp.net/users/lin) -- Platforms: Android -- Features: Streaming Ready - ### Fedi - Homepage: -- Source Code: Proprietary, but free +- Source Code: Proprietary, but gratis - Platforms: iOS, Android - Features: Pleroma-specific features like Reactions @@ -70,9 +63,16 @@ Feel free to contact us to be added to this list! ### Twidere - Homepage: -- Source Code: , +- Source Code: - Contact: -- Platform: Android, iOS +- Platform: Android +- Features: No Streaming + +### Indigenous +- Homepage: +- Source Code: +- Contact: [@realize.be@realize.be](@realize.be@realize.be) +- Platforms: Android - Features: No Streaming ## Alternative Web Interfaces @@ -82,11 +82,6 @@ Feel free to contact us to be added to this list! - Contact: [@gcupc@glitch.social](https://glitch.social/users/gcupc) - Features: No Streaming -### Feather -- Source Code: -- Contact: [@kaniini@pleroma.site](https://pleroma.site/kaniini) -- Features: No Streaming - ### Halcyon - Source Code: - Contact: [@halcyon@social.csswg.org](https://social.csswg.org/users/halcyon) @@ -100,6 +95,15 @@ Feel free to contact us to be added to this list! - Features: No Streaming ### Sengi +- Homepage: - Source Code: - Contact: [@sengi_app@mastodon.social](https://mastodon.social/users/sengi_app) -- Note(2019-01-28): The development is currently in a early stage. + +### DashFE +- Source Code: +- Contact: [@dashfe@stereophonic.space](https://stereophonic.space/users/dashfe) + +### BloatFE +- Source Code: +- Contact: [@r@freesoftwareextremist.com](https://freesoftwareextremist.com/users/r) +- Features: Does not requires JavaScript diff --git a/docs/configuration/cheatsheet.md b/docs/configuration/cheatsheet.md index fad67fc4d..7cf1d1ce7 100644 --- a/docs/configuration/cheatsheet.md +++ b/docs/configuration/cheatsheet.md @@ -18,6 +18,7 @@ To add configuration to your config file, you can copy it from the base config. * `notify_email`: Email used for notifications. * `description`: The instance’s description, can be seen in nodeinfo and ``/api/v1/instance``. * `limit`: Posts character limit (CW/Subject included in the counter). +* `discription_limit`: The character limit for image descriptions. * `chat_limit`: Character limit of the instance chat messages. * `remote_limit`: Hard character limit beyond which remote posts will be dropped. * `upload_limit`: File size limit of uploads (except for avatar, background, banner). @@ -32,37 +33,20 @@ To add configuration to your config file, you can copy it from the base config. * `registrations_open`: Enable registrations for anyone, invitations can be enabled when false. * `invites_enabled`: Enable user invitations for admins (depends on `registrations_open: false`). * `account_activation_required`: Require users to confirm their emails before signing in. +* `account_approval_required`: Require users to be manually approved by an admin before signing in. * `federating`: Enable federation with other instances. * `federation_incoming_replies_max_depth`: Max. depth of reply-to activities fetching on incoming federation, to prevent out-of-memory situations while fetching very long threads. If set to `nil`, threads of any depth will be fetched. Lower this value if you experience out-of-memory crashes. * `federation_reachability_timeout_days`: Timeout (in days) of each external federation target being unreachable prior to pausing federating to it. * `allow_relay`: Enable Pleroma’s Relay, which makes it possible to follow a whole instance. -* `rewrite_policy`: Message Rewrite Policy, either one or a list. Here are the ones available by default: - * `Pleroma.Web.ActivityPub.MRF.NoOpPolicy`: Doesn’t modify activities (default). - * `Pleroma.Web.ActivityPub.MRF.DropPolicy`: Drops all activities. It generally doesn’t makes sense to use in production. - * `Pleroma.Web.ActivityPub.MRF.SimplePolicy`: Restrict the visibility of activities from certain instances (See [`:mrf_simple`](#mrf_simple)). - * `Pleroma.Web.ActivityPub.MRF.TagPolicy`: Applies policies to individual users based on tags, which can be set using pleroma-fe/admin-fe/any other app that supports Pleroma Admin API. For example it allows marking posts from individual users nsfw (sensitive). - * `Pleroma.Web.ActivityPub.MRF.SubchainPolicy`: Selectively runs other MRF policies when messages match (See [`:mrf_subchain`](#mrf_subchain)). - * `Pleroma.Web.ActivityPub.MRF.RejectNonPublic`: Drops posts with non-public visibility settings (See [`:mrf_rejectnonpublic`](#mrf_rejectnonpublic)). - * `Pleroma.Web.ActivityPub.MRF.EnsureRePrepended`: Rewrites posts to ensure that replies to posts with subjects do not have an identical subject and instead begin with re:. - * `Pleroma.Web.ActivityPub.MRF.AntiLinkSpamPolicy`: Rejects posts from likely spambots by rejecting posts from new users that contain links. - * `Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy`: Crawls attachments using their MediaProxy URLs so that the MediaProxy cache is primed. - * `Pleroma.Web.ActivityPub.MRF.MentionPolicy`: Drops posts mentioning configurable users. (See [`:mrf_mention`](#mrf_mention)). - * `Pleroma.Web.ActivityPub.MRF.VocabularyPolicy`: Restricts activities to a configured set of vocabulary. (See [`:mrf_vocabulary`](#mrf_vocabulary)). - * `Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy`: Rejects or delists posts based on their age when received. (See [`:mrf_object_age`](#mrf_object_age)). - * `Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicy`: Adds expiration to all local Create activities (see [`:mrf_activity_expiration`](#mrf_activity_expiration)). -* `public`: Makes the client API in authenticated mode-only except for user-profiles. Useful for disabling the Local Timeline and The Whole Known Network. -* `quarantined_instances`: List of ActivityPub instances where private(DMs, followers-only) activities will not be send. +* `public`: Makes the client API in authenticated mode-only except for user-profiles. Useful for disabling the Local Timeline and The Whole Known Network. Note that there is a dependent setting restricting or allowing unauthenticated access to specific resources, see `restrict_unauthenticated` for more details. +* `quarantined_instances`: List of ActivityPub instances where private (DMs, followers-only) activities will not be send. * `managed_config`: Whenether the config for pleroma-fe is configured in [:frontend_configurations](#frontend_configurations) or in ``static/config.json``. * `allowed_post_formats`: MIME-type list of formats allowed to be posted (transformed into HTML). -* `mrf_transparency`: Make the content of your Message Rewrite Facility settings public (via nodeinfo). -* `mrf_transparency_exclusions`: Exclude specific instance names from MRF transparency. The use of the exclusions feature will be disclosed in nodeinfo as a boolean value. * `extended_nickname_format`: Set to `true` to use extended local nicknames format (allows underscores/dashes). This will break federation with older software for theses nicknames. * `max_pinned_statuses`: The maximum number of pinned statuses. `0` will disable the feature. * `autofollowed_nicknames`: Set to nicknames of (local) users that every new user should automatically follow. -* `no_attachment_links`: Set to true to disable automatically adding attachment link text to statuses. -* `welcome_message`: A message that will be send to a newly registered users as a direct message. -* `welcome_user_nickname`: The nickname of the local user that sends the welcome message. +* `attachment_links`: Set to true to enable automatically adding attachment link text to statuses. * `max_report_comment_size`: The maximum size of the report comment (Default: `1000`). * `safe_dm_mentions`: If set to true, only mentions at the beginning of a post will be used to address people in direct messages. This is to prevent accidental mentioning of people when talking about them (e.g. "@friend hey i really don't like @enemy"). Default: `false`. * `healthcheck`: If set to true, system data will be shown on ``/api/pleroma/healthcheck``. @@ -75,14 +59,71 @@ To add configuration to your config file, you can copy it from the base config. * `max_remote_account_fields`: The maximum number of custom fields in the remote user profile (default: `20`). * `account_field_name_length`: An account field name maximum length (default: `512`). * `account_field_value_length`: An account field value maximum length (default: `2048`). +* `registration_reason_length`: Maximum registration reason length (default: `500`). * `external_user_synchronization`: Enabling following/followers counters synchronization for external users. * `cleanup_attachments`: Remove attachments along with statuses. Does not affect duplicate files and attachments without status. Enabling this will increase load to database when deleting statuses on larger instances. +* `show_reactions`: Let favourites and emoji reactions be viewed through the API (default: `true`). + +## Welcome +* `direct_message`: - welcome message sent as a direct message. + * `enabled`: Enables the send a direct message to a newly registered user. Defaults to `false`. + * `sender_nickname`: The nickname of the local user that sends the welcome message. + * `message`: A message that will be send to a newly registered users as a direct message. +* `chat_message`: - welcome message sent as a chat message. + * `enabled`: Enables the send a chat message to a newly registered user. Defaults to `false`. + * `sender_nickname`: The nickname of the local user that sends the welcome message. + * `message`: A message that will be send to a newly registered users as a chat message. +* `email`: - welcome message sent as a email. + * `enabled`: Enables the send a welcome email to a newly registered user. Defaults to `false`. + * `sender`: The email address or tuple with `{nickname, email}` that will use as sender to the welcome email. + * `subject`: A subject of welcome email. + * `html`: A html that will be send to a newly registered users as a email. + * `text`: A text that will be send to a newly registered users as a email. + + Example: + + ```elixir + config :pleroma, :welcome, + direct_message: [ + enabled: true, + sender_nickname: "lain", + message: "Hi! Welcome on board!" + ], + email: [ + enabled: true, + sender: {"Pleroma App", "welcome@pleroma.app"}, + subject: "Welcome to <%= instance_name %>", + html: "Welcome to <%= instance_name %>", + text: "Welcome to <%= instance_name %>" + ] + ``` + +## Message rewrite facility + +### :mrf +* `policies`: Message Rewrite Policy, either one or a list. Here are the ones available by default: + * `Pleroma.Web.ActivityPub.MRF.NoOpPolicy`: Doesn’t modify activities (default). + * `Pleroma.Web.ActivityPub.MRF.DropPolicy`: Drops all activities. It generally doesn’t makes sense to use in production. + * `Pleroma.Web.ActivityPub.MRF.SimplePolicy`: Restrict the visibility of activities from certains instances (See [`:mrf_simple`](#mrf_simple)). + * `Pleroma.Web.ActivityPub.MRF.TagPolicy`: Applies policies to individual users based on tags, which can be set using pleroma-fe/admin-fe/any other app that supports Pleroma Admin API. For example it allows marking posts from individual users nsfw (sensitive). + * `Pleroma.Web.ActivityPub.MRF.SubchainPolicy`: Selectively runs other MRF policies when messages match (See [`:mrf_subchain`](#mrf_subchain)). + * `Pleroma.Web.ActivityPub.MRF.RejectNonPublic`: Drops posts with non-public visibility settings (See [`:mrf_rejectnonpublic`](#mrf_rejectnonpublic)). + * `Pleroma.Web.ActivityPub.MRF.EnsureRePrepended`: Rewrites posts to ensure that replies to posts with subjects do not have an identical subject and instead begin with re:. + * `Pleroma.Web.ActivityPub.MRF.AntiLinkSpamPolicy`: Rejects posts from likely spambots by rejecting posts from new users that contain links. + * `Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy`: Crawls attachments using their MediaProxy URLs so that the MediaProxy cache is primed. + * `Pleroma.Web.ActivityPub.MRF.MentionPolicy`: Drops posts mentioning configurable users. (See [`:mrf_mention`](#mrf_mention)). + * `Pleroma.Web.ActivityPub.MRF.VocabularyPolicy`: Restricts activities to a configured set of vocabulary. (See [`:mrf_vocabulary`](#mrf_vocabulary)). + * `Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy`: Rejects or delists posts based on their age when received. (See [`:mrf_object_age`](#mrf_object_age)). + * `Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicy`: Sets a default expiration on all posts made by users of the local instance. Requires `Pleroma.ActivityExpiration` to be enabled for processing the scheduled delections. + * `Pleroma.Web.ActivityPub.MRF.ForceBotUnlistedPolicy`: Makes all bot posts to disappear from public timelines. +* `transparency`: Make the content of your Message Rewrite Facility settings public (via nodeinfo). +* `transparency_exclusions`: Exclude specific instance names from MRF transparency. The use of the exclusions feature will be disclosed in nodeinfo as a boolean value. ## Federation ### MRF policies !!! note - Configuring MRF policies is not enough for them to take effect. You have to enable them by specifying their module in `rewrite_policy` under [:instance](#instance) section. + Configuring MRF policies is not enough for them to take effect. You have to enable them by specifying their module in `policies` under [:mrf](#mrf) section. #### :mrf_simple * `media_removal`: List of instances to remove media from. @@ -90,6 +131,7 @@ To add configuration to your config file, you can copy it from the base config. * `federated_timeline_removal`: List of instances to remove from Federated (aka The Whole Known Network) Timeline. * `reject`: List of instances to reject any activities from. * `accept`: List of instances to accept any activities from. +* `followers_only`: List of instances to decrease post visibility to only the followers, including for DM mentions. * `report_removal`: List of instances to reject reports from. * `avatar_removal`: List of instances to strip avatars from. * `banner_removal`: List of instances to strip banners from. @@ -151,7 +193,7 @@ config :pleroma, :mrf_user_allowlist, %{ * `:strip_followers` removes followers from the ActivityPub recipient list, ensuring they won't be delivered to home timelines * `:reject` rejects the message entirely -#### mrf_steal_emoji +#### :mrf_steal_emoji * `hosts`: List of hosts to steal emojis from * `rejected_shortcodes`: Regex-list of shortcodes to reject * `size_limit`: File size limit (in bytes), checked before an emoji is saved to the disk @@ -167,6 +209,11 @@ config :pleroma, :mrf_user_allowlist, %{ * `sign_object_fetches`: Sign object fetches with HTTP signatures * `authorized_fetch_mode`: Require HTTP signatures for AP fetches +## Pleroma.User + +* `restricted_nicknames`: List of nicknames users may not register with. +* `email_blacklist`: List of email domains users may not register with. + ## Pleroma.ScheduledActivity * `daily_user_limit`: the number of scheduled activities a user is allowed to create in a single day (Default: `25`) @@ -175,6 +222,8 @@ config :pleroma, :mrf_user_allowlist, %{ ## Pleroma.ActivityExpiration +Enables the worker which processes posts scheduled for deletion. Pinned posts are exempt from expiration. + * `enabled`: whether expired activities will be sent to the job queue to be deleted ## Frontends @@ -248,6 +297,7 @@ This section describe PWA manifest instance-specific values. Currently this opti * `background_color`: Describe the background color of the app. (Example: `"#191b22"`, `"aliceblue"`). ## :emoji + * `shortcode_globs`: Location of custom emoji files. `*` can be used as a wildcard. Example `["/emoji/custom/**/*.png"]` * `pack_extensions`: A list of file extensions for emojis, when no emoji.txt for a pack is present. Example `[".png", ".gif"]` * `groups`: Emojis are ordered in groups (tags). This is an array of key-value pairs where the key is the groupname and the value the location or array of locations. `*` can be used as a wildcard. Example `[Custom: ["/emoji/*.png", "/emoji/custom/*.png"]]` @@ -256,24 +306,26 @@ This section describe PWA manifest instance-specific values. Currently this opti memory for this amount of seconds multiplied by the number of files. ## :media_proxy + * `enabled`: Enables proxying of remote media to the instance’s proxy * `base_url`: The base URL to access a user-uploaded file. Useful when you want to proxy the media files via another host/CDN fronts. * `proxy_opts`: All options defined in `Pleroma.ReverseProxy` documentation, defaults to `[max_body_length: (25*1_048_576)]`. -* `whitelist`: List of domains to bypass the mediaproxy +* `whitelist`: List of hosts with scheme to bypass the mediaproxy (e.g. `https://example.com`) * `invalidation`: options for remove media from cache after delete object: - * `enabled`: Enables purge cache - * `provider`: Which one of the [purge cache strategy](#purge-cache-strategy) to use. + * `enabled`: Enables purge cache + * `provider`: Which one of the [purge cache strategy](#purge-cache-strategy) to use. ### Purge cache strategy #### Pleroma.Web.MediaProxy.Invalidation.Script -This strategy allow perform external bash script to purge cache. +This strategy allow perform external shell script to purge cache. Urls of attachments pass to script as arguments. * `script_path`: path to external script. Example: + ```elixir config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Script, script_path: "./installation/nginx-cache-purge.example" @@ -284,8 +336,8 @@ config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Script, This strategy allow perform custom http request to purge cache. * `method`: http method. default is `purge` -* `headers`: http headers. default is empty -* `options`: request options. default is empty +* `headers`: http headers. +* `options`: request options. Example: ```elixir @@ -301,8 +353,6 @@ config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Http, * `providers`: a list of metadata providers to enable. Providers available: * `Pleroma.Web.Metadata.Providers.OpenGraph` * `Pleroma.Web.Metadata.Providers.TwitterCard` - * `Pleroma.Web.Metadata.Providers.RelMe` - add links from user bio with rel=me into the `
` as ``. - * `Pleroma.Web.Metadata.Providers.Feed` - add a link to a user's Atom feed into the `
` as ``. * `unfurl_nsfw`: If set to `true` nsfw attachments will be shown in previews. ### :rich_media (consumer) @@ -310,6 +360,7 @@ config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Http, * `ignore_hosts`: list of hosts which will be ignored by the metadata parser. For example `["accounts.google.com", "xss.website"]`, defaults to `[]`. * `ignore_tld`: list TLDs (top-level domains) which will ignore for parse metadata. default is ["local", "localdomain", "lan"]. * `parsers`: list of Rich Media parsers. +* `failure_backoff`: Amount of milliseconds after request failure, during which the request will not be retried. ## HTTP server @@ -441,37 +492,32 @@ For each pool, the options are: *For `gun` adapter* -Advanced settings for connections pool. Pool with opened connections. These connections can be reused in worker pools. +Settings for HTTP connection pool. -For big instances it's recommended to increase `config :pleroma, :connections_pool, max_connections: 500` up to 500-1000. -It will increase memory usage, but federation would work faster. - -* `:checkin_timeout` - timeout to checkin connection from pool. Default: 250ms. -* `:max_connections` - maximum number of connections in the pool. Default: 250 connections. -* `:retry` - number of retries, while `gun` will try to reconnect if connection goes down. Default: 1. -* `:retry_timeout` - time between retries when `gun` will try to reconnect in milliseconds. Default: 1000ms. -* `:await_up_timeout` - timeout while `gun` will wait until connection is up. Default: 5000ms. +* `:connection_acquisition_wait` - Timeout to acquire a connection from pool.The total max time is this value multiplied by the number of retries. +* `connection_acquisition_retries` - Number of attempts to acquire the connection from the pool if it is overloaded. Each attempt is timed `:connection_acquisition_wait` apart. +* `:max_connections` - Maximum number of connections in the pool. +* `:connect_timeout` - Timeout to connect to the host. +* `:reclaim_multiplier` - Multiplied by `:max_connections` this will be the maximum number of idle connections that will be reclaimed in case the pool is overloaded. ### :pools *For `gun` adapter* -Advanced settings for workers pools. +Settings for request pools. These pools are limited on top of `:connections_pool`. There are four pools used: -* `:federation` for the federation jobs. - You may want this pool max_connections to be at least equal to the number of federator jobs + retry queue jobs. -* `:media` for rich media, media proxy -* `:upload` for uploaded media (if using a remote uploader and `proxy_remote: true`) -* `:default` for other requests +* `:federation` for the federation jobs. You may want this pool's max_connections to be at least equal to the number of federator jobs + retry queue jobs. +* `:media` - for rich media, media proxy. +* `:upload` - for proxying media when a remote uploader is used and `proxy_remote: true`. +* `:default` - for other requests. For each pool, the options are: -* `:size` - how much workers the pool can hold -* `:timeout` - timeout while `gun` will wait for response -* `:max_overflow` - additional workers if pool is under load - +* `:size` - limit to how much requests can be concurrently executed. +* `:recv_timeout` - timeout while `gun` will wait for response +* `:max_waiting` - limit to how much requests can be waiting for others to finish, after this is reached, subsequent requests will be dropped. ## Captcha @@ -490,7 +536,7 @@ A built-in captcha provider. Enabled by default. #### Pleroma.Captcha.Kocaptcha Kocaptcha is a very simple captcha service with a single API endpoint, -the source code is here: https://github.com/koto-bank/kocaptcha. The default endpoint +the source code is here: [kocaptcha](https://github.com/koto-bank/kocaptcha). The default endpoint `https://captcha.kotobank.ch` is hosted by the developer. * `endpoint`: the Kocaptcha endpoint to use. @@ -498,6 +544,7 @@ the source code is here: https://github.com/koto-bank/kocaptcha. The default end ## Uploads ### Pleroma.Upload + * `uploader`: Which one of the [uploaders](#uploaders) to use. * `filters`: List of [upload filters](#upload-filters) to use. * `link_name`: When enabled Pleroma will add a `name` parameter to the url of the upload, for example `https://instance.tld/media/corndog.png?name=corndog.png`. This is needed to provide the correct filename in Content-Disposition headers when using filters like `Pleroma.Upload.Filter.Dedupe` @@ -505,15 +552,21 @@ the source code is here: https://github.com/koto-bank/kocaptcha. The default end * `proxy_remote`: If you're using a remote uploader, Pleroma will proxy media requests instead of redirecting to it. * `proxy_opts`: Proxy options, see `Pleroma.ReverseProxy` documentation. * `filename_display_max_length`: Set max length of a filename to display. 0 = no limit. Default: 30. +* `default_description`: Sets which default description an image has if none is set explicitly. Options: nil (default) - Don't set a default, :filename - use the filename of the file, a string (e.g. "attachment") - Use this string !!! warning `strip_exif` has been replaced by `Pleroma.Upload.Filter.Mogrify`. ### Uploaders + #### Pleroma.Uploaders.Local + * `uploads`: Which directory to store the user-uploads in, relative to pleroma’s working directory. #### Pleroma.Uploaders.S3 + +Don't forget to configure [Ex AWS S3](#ex-aws-s3-settings) + * `bucket`: S3 bucket name. * `bucket_namespace`: S3 bucket namespace. * `public_endpoint`: S3 endpoint that the user finally accesses(ex. "https://s3.dualstack.ap-northeast-1.amazonaws.com") @@ -522,17 +575,23 @@ For example, when using CDN to S3 virtual host format, set "". At this time, write CNAME to CDN in public_endpoint. * `streaming_enabled`: Enable streaming uploads, when enabled the file will be sent to the server in chunks as it's being read. This may be unsupported by some providers, try disabling this if you have upload problems. +#### Ex AWS S3 settings + +* `access_key_id`: Access key ID +* `secret_access_key`: Secret access key +* `host`: S3 host + +Example: + +```elixir +config :ex_aws, :s3, + access_key_id: "xxxxxxxxxx", + secret_access_key: "yyyyyyyyyy", + host: "s3.eu-central-1.amazonaws.com" +``` ### Upload filters -#### Pleroma.Upload.Filter.Mogrify - -* `args`: List of actions for the `mogrify` command like `"strip"` or `["strip", "auto-orient", {"implode", "1"}]`. - -#### Pleroma.Upload.Filter.Dedupe - -No specific configuration. - #### Pleroma.Upload.Filter.AnonymizeFilename This filter replaces the filename (not the path) of an upload. For complete obfuscation, add @@ -540,6 +599,20 @@ This filter replaces the filename (not the path) of an upload. For complete obfu * `text`: Text to replace filenames in links. If empty, `{random}.extension` will be used. You can get the original filename extension by using `{extension}`, for example `custom-file-name.{extension}`. +#### Pleroma.Upload.Filter.Dedupe + +No specific configuration. + +#### Pleroma.Upload.Filter.Exiftool + +This filter only strips the GPS and location metadata with Exiftool leaving color profiles and attributes intact. + +No specific configuration. + +#### Pleroma.Upload.Filter.Mogrify + +* `args`: List of actions for the `mogrify` command like `"strip"` or `["strip", "auto-orient", {"implode", "1"}]`. + ## Email ### Pleroma.Emails.Mailer @@ -600,8 +673,7 @@ Email notifications settings. Configuration options described in [Oban readme](https://github.com/sorentwo/oban#usage): * `repo` - app's Ecto repo (`Pleroma.Repo`) -* `verbose` - logs verbosity -* `prune` - non-retryable jobs [pruning settings](https://github.com/sorentwo/oban#pruning) (`:disabled` / `{:maxlen, value}` / `{:maxage, value}`) +* `log` - logs verbosity * `queues` - job queues (see below) * `crontab` - periodic jobs, see [`Oban.Cron`](#obancron) @@ -619,9 +691,8 @@ Pleroma has the following queues: Pleroma has these periodic job workers: -`Pleroma.Workers.Cron.ClearOauthTokenWorker` - a job worker to cleanup expired oauth tokens. - -Example: +* `Pleroma.Workers.Cron.DigestEmailsWorker` - digest emails for users with new mentions and follows +* `Pleroma.Workers.Cron.NewUsersDigestWorker` - digest emails for admins with new registrations ```elixir config :pleroma, Oban, @@ -633,7 +704,8 @@ config :pleroma, Oban, federator_outgoing: 50 ], crontab: [ - {"0 0 * * *", Pleroma.Workers.Cron.ClearOauthTokenWorker} + {"0 0 * * 0", Pleroma.Workers.Cron.DigestEmailsWorker}, + {"0 0 * * *", Pleroma.Workers.Cron.NewUsersDigestWorker} ] ``` @@ -786,10 +858,9 @@ or curl -H "X-Admin-Token: somerandomtoken" "http://localhost:4000/api/pleroma/admin/users/invites" ``` -### :auth +Warning: it's discouraged to use this feature because of the associated security risk: static / rarely changed instance-wide token is much weaker compared to email-password pair of a real admin user; consider using HTTP Basic Auth or OAuth-based authentication instead. -* `Pleroma.Web.Auth.PleromaAuthenticator`: default database authenticator. -* `Pleroma.Web.Auth.LDAPAuthenticator`: LDAP authentication. +### :auth Authentication / authorization settings. @@ -820,6 +891,9 @@ Pleroma account will be created with the same name as the LDAP user name. * `base`: LDAP base, e.g. "dc=example,dc=com" * `uid`: LDAP attribute name to authenticate the user, e.g. when "cn", the filter will be "cn=username,base" +Note, if your LDAP server is an Active Directory server the correct value is commonly `uid: "cn"`, but if you use an +OpenLDAP server the value may be `uid: "uid"`. + ### OAuth consumer mode OAuth consumer mode allows sign in / sign up via external OAuth providers (e.g. Twitter, Facebook, Google, Microsoft, etc.). @@ -898,37 +972,36 @@ Configure OAuth 2 provider capabilities: * `token_expires_in` - The lifetime in seconds of the access token. * `issue_new_refresh_token` - Keeps old refresh token or generate new refresh token when to obtain an access token. -* `clean_expired_tokens` - Enable a background job to clean expired oauth tokens. Defaults to `false`. Interval settings sets in configuration periodic jobs [`Oban.Cron`](#obancron) +* `clean_expired_tokens` - Enable a background job to clean expired oauth tokens. Defaults to `false`. ## Link parsing ### :uri_schemes * `valid_schemes`: List of the scheme part that is considered valid to be an URL. -### :auto_linker +### Pleroma.Formatter -Configuration for the `auto_linker` library: +Configuration for Pleroma's link formatter which parses mentions, hashtags, and URLs. -* `class: "auto-linker"` - specify the class to be added to the generated link. false to clear. -* `rel: "noopener noreferrer"` - override the rel attribute. false to clear. -* `new_window: true` - set to false to remove `target='_blank'` attribute. -* `scheme: false` - Set to true to link urls with schema `http://google.com`. -* `truncate: false` - Set to a number to truncate urls longer then the number. Truncated urls will end in `..`. -* `strip_prefix: true` - Strip the scheme prefix. -* `extra: false` - link urls with rarely used schemes (magnet, ipfs, irc, etc.). +* `class` - specify the class to be added to the generated link (default: `false`) +* `rel` - specify the rel attribute (default: `ugc`) +* `new_window` - adds `target="_blank"` attribute (default: `false`) +* `truncate` - Set to a number to truncate URLs longer then the number. Truncated URLs will end in `...` (default: `false`) +* `strip_prefix` - Strip the scheme prefix (default: `false`) +* `extra` - link URLs with rarely used schemes (magnet, ipfs, irc, etc.) (default: `true`) +* `validate_tld` - Set to false to disable TLD validation for URLs/emails. Can be set to :no_scheme to validate TLDs only for urls without a scheme (e.g `example.com` will be validated, but `http://example.loki` won't) (default: `:no_scheme`) Example: ```elixir -config :auto_linker, - opts: [ - scheme: true, - extra: true, - class: false, - strip_prefix: false, - new_window: false, - rel: "ugc" - ] +config :pleroma, Pleroma.Formatter, + class: false, + rel: "ugc", + new_window: false, + truncate: false, + strip_prefix: false, + extra: true, + validate_tld: :no_scheme ``` ## Custom Runtime Modules (`:modules`) @@ -967,19 +1040,61 @@ config :pleroma, :database_config_whitelist, [ ### :restrict_unauthenticated -Restrict access for unauthenticated users to timelines (public and federate), user profiles and statuses. +Restrict access for unauthenticated users to timelines (public and federated), user profiles and statuses. -* `timelines` - public and federated timelines - * `local` - public timeline - * `federated` -* `profiles` - user profiles +* `timelines`: public and federated timelines + * `local`: public timeline + * `federated`: federated timeline (includes public timeline) +* `profiles`: user profiles * `local` * `remote` -* `activities` - statuses +* `activities`: statuses * `local` * `remote` +Note: when `:instance, :public` is set to `false`, all `:restrict_unauthenticated` items be effectively set to `true` by default. If you'd like to allow unauthenticated access to specific API endpoints on a private instance, please explicitly set `:restrict_unauthenticated` to non-default value in `config/prod.secret.exs`. + +Note: setting `restrict_unauthenticated/timelines/local` to `true` has no practical sense if `restrict_unauthenticated/timelines/federated` is set to `false` (since local public activities will still be delivered to unauthenticated users as part of federated timeline). ## Pleroma.Web.ApiSpec.CastAndValidate * `:strict` a boolean, enables strict input validation (useful in development, not recommended in production). Defaults to `false`. + +## :instances_favicons + +Control favicons for instances. + +* `enabled`: Allow/disallow displaying and getting instances favicons + +## Frontend management + +Frontends in Pleroma are swappable - you can specify which one to use here. + +You can set a frontends for the key `primary` and `admin` and the options of `name` and `ref`. This will then make Pleroma serve the frontend from a folder constructed by concatenating the instance static path, `frontends` and the name and ref. + +The key `primary` refers to the frontend that will be served by default for general requests. The key `admin` refers to the frontend that will be served at the `/pleroma/admin` path. + +If you don't set anything here, the bundled frontends will be used. + +Example: + +``` +config :pleroma, :frontends, + primary: %{ + "name" => "pleroma", + "ref" => "stable" + }, + admin: %{ + "name" => "admin", + "ref" => "develop" + } +``` + +This would serve the frontend from the the folder at `$instance_static/frontends/pleroma/stable`. You have to copy the frontend into this folder yourself. You can choose the name and ref any way you like, but they will be used by mix tasks to automate installation in the future, the name referring to the project and the ref referring to a commit. + +## Ephemeral activities (Pleroma.Workers.PurgeExpiredActivity) + +Settings to enable and configure expiration for ephemeral activities + +* `:enabled` - enables ephemeral activities creation +* `:min_lifetime` - minimum lifetime for ephemeral activities (in seconds). Default: 10 minutes. diff --git a/docs/configuration/howto_database_config.md b/docs/configuration/howto_database_config.md new file mode 100644 index 000000000..9ed4d6cdd --- /dev/null +++ b/docs/configuration/howto_database_config.md @@ -0,0 +1,153 @@ +# How to activate Pleroma in-database configuration +## Explanation + +The configuration of Pleroma has traditionally been managed with a config file, e.g. `config/prod.secret.exs`. This method requires a restart of the application for any configuration changes to take effect. We have made it possible to control most settings in the AdminFE interface after running a migration script. + +## Migration to database config + +1. Run the mix task to migrate to the database. You'll receive some debugging output and a few messages informing you of what happened. + + **Source:** + + ``` + $ mix pleroma.config migrate_to_db + ``` + + or + + **OTP:** + + *Note: OTP users need Pleroma to be running for `pleroma_ctl` commands to work* + + ``` + $ ./bin/pleroma_ctl config migrate_to_db + ``` + + ``` + 10:04:34.155 [debug] QUERY OK source="config" db=1.6ms decode=2.0ms queue=33.5ms idle=0.0ms + SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 [] + Migrating settings from file: /home/pleroma/config/dev.secret.exs + + 10:04:34.240 [debug] QUERY OK db=4.5ms queue=0.3ms idle=92.2ms + TRUNCATE config; [] + + 10:04:34.244 [debug] QUERY OK db=2.8ms queue=0.3ms idle=97.2ms + ALTER SEQUENCE config_id_seq RESTART; [] + + 10:04:34.256 [debug] QUERY OK source="config" db=0.8ms queue=1.4ms idle=109.8ms + SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 WHERE ((c0."group" = $1) AND (c0."key" = $2)) [":pleroma", ":instance"] + + 10:04:34.292 [debug] QUERY OK db=2.6ms queue=1.7ms idle=137.7ms + INSERT INTO "config" ("group","key","value","inserted_at","updated_at") VALUES ($1,$2,$3,$4,$5) RETURNING "id" [":pleroma", ":instance", <<131, 108, 0, 0, 0, 1, 104, 2, 100, 0, 4, 110, 97, 109, 101, 109, 0, 0, 0, 7, 66, 108, 101, 114, 111, 109, 97, 106>>, ~N[2020-07-12 15:04:34], ~N[2020-07-12 15:04:34]] + Settings for key instance migrated. + Settings for group :pleroma migrated. + ``` + +2. It is recommended to backup your config file now. + + ``` + cp config/dev.secret.exs config/dev.secret.exs.orig + ``` + +3. Edit your Pleroma config to enable database configuration: + + ``` + config :pleroma, configurable_from_database: true + ``` + +4. ⚠️ **THIS IS NOT REQUIRED** ⚠️ + + Now you can edit your config file and strip it down to the only settings which are not possible to control in the database. e.g., the Postgres (Repo) and webserver (Endpoint) settings cannot be controlled in the database because the application needs the settings to start up and access the database. + + Any settings in the database will override those in the config file, but you may find it less confusing if the setting is only declared in one place. + + A non-exhaustive list of settings that are only possible in the config file include the following: + + * config :pleroma, Pleroma.Web.Endpoint + * config :pleroma, Pleroma.Repo + * config :pleroma, configurable\_from\_database + * config :pleroma, :database, rum_enabled + * config :pleroma, :connections_pool + + Here is an example of a server config stripped down after migration: + + ``` + use Mix.Config + + config :pleroma, Pleroma.Web.Endpoint, + url: [host: "cool.pleroma.site", scheme: "https", port: 443] + + config :pleroma, Pleroma.Repo, + adapter: Ecto.Adapters.Postgres, + username: "pleroma", + password: "MySecretPassword", + database: "pleroma_prod", + hostname: "localhost" + + config :pleroma, configurable_from_database: true + ``` + +5. Restart your instance and you can now access the Settings tab in AdminFE. + + +## Reverting back from database config + +1. Run the mix task to migrate back from the database. You'll receive some debugging output and a few messages informing you of what happened. + + **Source:** + + ``` + $ mix pleroma.config migrate_from_db + ``` + + or + + **OTP:** + + ``` + $ ./bin/pleroma_ctl config migrate_from_db + ``` + + ``` + 10:26:30.593 [debug] QUERY OK source="config" db=9.8ms decode=1.2ms queue=26.0ms idle=0.0ms + SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 [] + + 10:26:30.659 [debug] QUERY OK source="config" db=1.1ms idle=80.7ms + SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 [] + Database configuration settings have been saved to config/dev.exported_from_db.secret.exs + ``` + +2. Remove `config :pleroma, configurable_from_database: true` from your config. The in-database configuration still exists, but it will not be used. Future migrations will erase the database config before importing your config file again. + +3. Restart your instance. + +## Debugging + +### Clearing database config +You can clear the database config by truncating the `config` table in the database. e.g., + +``` +psql -d pleroma_dev +pleroma_dev=# TRUNCATE config; +TRUNCATE TABLE +``` + +Additionally, every time you migrate the configuration to the database the config table is automatically truncated to ensure a clean migration. + +### Manually removing a setting +If you encounter a situation where the server cannot run properly because of an invalid setting in the database and this is preventing you from accessing AdminFE, you can manually remove the offending setting if you know which one it is. + +e.g., here is an example showing a minimal configuration in the database. Only the `config :pleroma, :instance` settings are in the table: + +``` +psql -d pleroma_dev +pleroma_dev=# select * from config; + id | key | value | inserted_at | updated_at | group +----+-----------+------------------------------------------------------------+---------------------+---------------------+---------- + 1 | :instance | \x836c0000000168026400046e616d656d00000007426c65726f6d616a | 2020-07-12 15:33:29 | 2020-07-12 15:33:29 | :pleroma +(1 row) +pleroma_dev=# delete from config where key = ':instance' and group = ':pleroma'; +DELETE 1 +``` + +Now the `config :pleroma, :instance` settings have been removed from the database. diff --git a/docs/configuration/howto_theming_your_instance.md b/docs/configuration/howto_theming_your_instance.md index d0daf5b25..cfa00f538 100644 --- a/docs/configuration/howto_theming_your_instance.md +++ b/docs/configuration/howto_theming_your_instance.md @@ -60,7 +60,7 @@ Example of `my-awesome-theme.json` where we add the name "My Awesome Theme" ### Set as default theme -Now we can set the new theme as default in the [Pleroma FE configuration](General-tips-for-customizing-Pleroma-FE.md). +Now we can set the new theme as default in the [Pleroma FE configuration](../../../frontend/CONFIGURATION). Example of adding the new theme in the back-end config files ```elixir diff --git a/docs/configuration/mrf.md b/docs/configuration/mrf.md index d48d0cc99..31c66e098 100644 --- a/docs/configuration/mrf.md +++ b/docs/configuration/mrf.md @@ -34,9 +34,9 @@ config :pleroma, :instance, To use `SimplePolicy`, you must enable it. Do so by adding the following to your `:instance` config object, so that it looks like this: ```elixir -config :pleroma, :instance, +config :pleroma, :mrf, [...] - rewrite_policy: Pleroma.Web.ActivityPub.MRF.SimplePolicy + policies: Pleroma.Web.ActivityPub.MRF.SimplePolicy ``` Once `SimplePolicy` is enabled, you can configure various groups in the `:mrf_simple` config object. These groups are: @@ -58,8 +58,8 @@ Servers should be configured as lists. This example will enable `SimplePolicy`, block media from `illegalporn.biz`, mark media as NSFW from `porn.biz` and `porn.business`, reject messages from `spam.com`, remove messages from `spam.university` from the federated timeline and block reports (flags) from `whiny.whiner`: ```elixir -config :pleroma, :instance, - rewrite_policy: [Pleroma.Web.ActivityPub.MRF.SimplePolicy] +config :pleroma, :mrf, + policies: [Pleroma.Web.ActivityPub.MRF.SimplePolicy] config :pleroma, :mrf_simple, media_removal: ["illegalporn.biz"], @@ -75,7 +75,7 @@ The effects of MRF policies can be very drastic. It is important to use this fun ## Writing your own MRF Policy -As discussed above, the MRF system is a modular system that supports pluggable policies. This means that an admin may write a custom MRF policy in Elixir or any other language that runs on the Erlang VM, by specifying the module name in the `rewrite_policy` config setting. +As discussed above, the MRF system is a modular system that supports pluggable policies. This means that an admin may write a custom MRF policy in Elixir or any other language that runs on the Erlang VM, by specifying the module name in the `policies` config setting. For example, here is a sample policy module which rewrites all messages to "new message content": @@ -125,8 +125,8 @@ end If you save this file as `lib/pleroma/web/activity_pub/mrf/rewrite_policy.ex`, it will be included when you next rebuild Pleroma. You can enable it in the configuration like so: ```elixir -config :pleroma, :instance, - rewrite_policy: [ +config :pleroma, :mrf, + policies: [ Pleroma.Web.ActivityPub.MRF.SimplePolicy, Pleroma.Web.ActivityPub.MRF.RewritePolicy ] diff --git a/docs/configuration/static_dir.md b/docs/configuration/static_dir.md index 5fb38c3de..8ac07b725 100644 --- a/docs/configuration/static_dir.md +++ b/docs/configuration/static_dir.md @@ -1,45 +1,61 @@ # Static Directory -Static frontend files are shipped in `priv/static/` and tracked by version control in this repository. If you want to overwrite or update these without the possibility of merge conflicts, you can write your custom versions to `instance/static/`. +Static frontend files are shipped with pleroma. If you want to overwrite or update these without problems during upgrades, you can write your custom versions to the static directory. -``` -config :pleroma, :instance, - static_dir: "instance/static/", -``` +You can find the location of the static directory in the [configuration](../cheatsheet/#instance). -For example, edit `instance/static/instance/panel.html` . +=== "OTP" + + ```elixir + config :pleroma, :instance, + static_dir: "/var/lib/pleroma/static/" + ``` + +=== "From Source" + + ```elixir + config :pleroma, :instance, + static_dir: "instance/static/" + ``` Alternatively, you can overwrite this value in your configuration to use a different static instance directory. -This document is written assuming `instance/static/`. +This document is written using `$static_dir` as the value of the `config :pleroma, :instance, static_dir` setting. -Or, if you want to manage your custom file in git repository, basically remove the `instance/` entry from `.gitignore`. +If you use a From Source installation and want to manage your custom files in the git repository, you can remove the `instance/` entry from `.gitignore`. ## robots.txt -By default, the `robots.txt` that ships in `priv/static/` is permissive. It allows well-behaved search engines to index all of your instance's URIs. +There's a mix tasks to [generate a new robot.txt](../../administration/CLI_tasks/robots_txt/). -If you want to generate a restrictive `robots.txt`, you can run the following mix task. The generated `robots.txt` will be written in your instance static directory. +For more complex things, you can write your own robots.txt to `$static_dir/robots.txt`. + +E.g. if you want to block all crawlers except for [fediverse.network](https://fediverse.network/about) you can use ``` -mix pleroma.robots_txt disallow_all +User-Agent: * +Disallow: / + +User-Agent: crawler-us-il-1.fediverse.network +Allow: / + +User-Agent: makhnovtchina.random.sh +Allow: / ``` ## Thumbnail -Put on `instance/static/instance/thumbnail.jpeg` with your selfie or other neat picture. It will appear in [Pleroma Instances](http://distsn.org/pleroma-instances.html). +Add `$static_dir/instance/thumbnail.jpeg` with your selfie or other neat picture. It will be available on `http://your-domain.tld/instance/thumbnail.jpeg` and can be used by external applications. ## Instance-specific panel -![instance-specific panel demo](/uploads/296b19ec806b130e0b49b16bfe29ce8a/image.png) - -Create and Edit your file on `instance/static/instance/panel.html`. +Create and Edit your file at `$static_dir/instance/panel.html`. ## Background -You can change the background of your Pleroma instance by uploading it to `instance/static/`, and then changing `background` in `config/prod.secret.exs` accordingly. +You can change the background of your Pleroma instance by uploading it to `$static_dir/`, and then changing `background` in [your configuration](../cheatsheet/#frontend_configurations) accordingly. -If you put `instance/static/images/background.jpg` +E.g. if you put `$static_dir/images/background.jpg` ``` config :pleroma, :frontend_configurations, @@ -50,12 +66,14 @@ config :pleroma, :frontend_configurations, ## Logo -![logo modification demo](/uploads/c70b14de60fa74245e7f0dcfa695ebff/image.png) +!!! important + Note the extra `static` folder for the default logo.png location -If you want to give a brand to your instance, You can change the logo of your instance by uploading it to `instance/static/`. +If you want to give a brand to your instance, You can change the logo of your instance by uploading it to the static directory `$static_dir/static/logo.png`. -Alternatively, you can specify the path with config. -If you put `instance/static/static/mylogo-file.png` +Alternatively, you can specify the path to your logo in [your configuration](../cheatsheet/#frontend_configurations). + +E.g. if you put `$static_dir/static/mylogo-file.png` ``` config :pleroma, :frontend_configurations, @@ -66,4 +84,7 @@ config :pleroma, :frontend_configurations, ## Terms of Service -Terms of Service will be shown to all users on the registration page. It's the best place where to write down the rules for your instance. You can modify the rules by changing `instance/static/static/terms-of-service.html`. +!!! important + Note the extra `static` folder for the terms-of-service.html + +Terms of Service will be shown to all users on the registration page. It's the best place where to write down the rules for your instance. You can modify the rules by adding and changing `$static_dir/static/terms-of-service.html`. diff --git a/docs/configuration/storing_remote_media.md b/docs/configuration/storing_remote_media.md index 7e91fe7d9..c01985d25 100644 --- a/docs/configuration/storing_remote_media.md +++ b/docs/configuration/storing_remote_media.md @@ -33,6 +33,6 @@ as soon as the post is received by your instance. Add to your `prod.secret.exs`: ``` -config :pleroma, :instance, - rewrite_policy: [Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy] +config :pleroma, :mrf, + policies: [Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy] ``` diff --git a/docs/dev.md b/docs/dev.md index f1b4cbf8b..9c749c17c 100644 --- a/docs/dev.md +++ b/docs/dev.md @@ -20,4 +20,4 @@ This document contains notes and guidelines for Pleroma developers. ## Auth-related configuration, OAuth consumer mode etc. -See `Authentication` section of [`docs/configuration/cheatsheet.md`](docs/configuration/cheatsheet.md#authentication). +See `Authentication` section of [the configuration cheatsheet](configuration/cheatsheet.md#authentication). diff --git a/docs/index.md b/docs/index.md new file mode 100644 index 000000000..1a90d0a8d --- /dev/null +++ b/docs/index.md @@ -0,0 +1,26 @@ +# Introduction to Pleroma +## What is Pleroma? +Pleroma is a federated social networking platform, compatible with Mastodon and other ActivityPub implementations. It is free software licensed under the AGPLv3. +It actually consists of two components: a backend, named simply Pleroma, and a user-facing frontend, named Pleroma-FE. It also includes the Mastodon frontend, if that's your thing. +It's part of what we call the fediverse, a federated network of instances which speak common protocols and can communicate with each other. +One account on an instance is enough to talk to the entire fediverse! + +## How can I use it? + +Pleroma instances are already widely deployed, a list can be found at and . + +If you don't feel like joining an existing instance, but instead prefer to deploy your own instance, that's easy too! +Installation instructions can be found in the installation section of these docs. + +## I got an account, now what? +Great! Now you can explore the fediverse! Open the login page for your Pleroma instance (e.g. ) and login with your username and password. (If you don't have an account yet, click on Register) + +### Pleroma-FE +The default front-end used by Pleroma is Pleroma-FE. You can find more information on what it is and how to use it in the [Introduction to Pleroma-FE](../frontend). + +### Mastodon interface +If the Pleroma interface isn't your thing, or you're just trying something new but you want to keep using the familiar Mastodon interface, we got that too! +Just add a "/web" after your instance url (e.g. ) and you'll end on the Mastodon web interface, but with a Pleroma backend! MAGIC! +The Mastodon interface is from the Glitch-soc fork. For more information on the Mastodon interface you can check the [Mastodon](https://docs.joinmastodon.org/) and [Glitch-soc](https://glitch-soc.github.io/docs/) documentation. + +Remember, what you see is only the frontend part of Mastodon, the backend is still Pleroma. diff --git a/docs/installation/alpine_linux_en.md b/docs/installation/alpine_linux_en.md index d3b3e8279..f393e4978 100644 --- a/docs/installation/alpine_linux_en.md +++ b/docs/installation/alpine_linux_en.md @@ -15,6 +15,7 @@ It assumes that you have administrative rights, either as root or a user with [s * `git` * `file-dev` * Development Tools +* `cmake` #### Optional packages used in this guide @@ -40,7 +41,7 @@ sudo apk upgrade * Install some tools, which are needed later: ```shell -sudo apk add git build-base file-dev +sudo apk add git build-base cmake file-dev ``` ### Install Elixir and Erlang @@ -226,10 +227,7 @@ sudo -Hu pleroma MIX_ENV=prod mix pleroma.user new > /home/pleroma/.profile +# su -l pleroma +``` + +Clone the repository: + +``` +$ cd $HOME # Should be the same as /home/pleroma +$ git clone -b stable https://git.pleroma.social/pleroma/pleroma.git +``` + +Configure Pleroma. Note that you need a domain name at this point: + +``` +$ cd /home/pleroma/pleroma +$ mix deps.get # Enter "y" when asked to install Hex +$ mix pleroma.instance gen # You will be asked a few questions here. +$ cp config/generated_config.exs config/prod.secret.exs +``` + +Since Postgres is configured, we can now initialize the database. There should +now be a file in `config/setup_db.psql` that makes this easier. Edit it, and +*change the password* to a password of your choice. Make sure it is secure, since +it'll be protecting your database. As root, you can now initialize the database: + +``` +# cd /home/pleroma/pleroma +# sudo -Hu postgres -g postgres psql -f config/setup_db.psql +``` + +Postgres allows connections from all users without a password by default. To +fix this, edit `/var/db/postgres/data12/pg_hba.conf`. Change every `trust` to +`password`. + +Once this is done, restart Postgres with: +``` +# service postgresql restart +``` + +Run the database migrations. + +Back as the pleroma user, run the following to implement any database migrations. + +``` +# su -l pleroma +$ cd /home/pleroma/pleroma +$ MIX_ENV=prod mix ecto.migrate +``` + +You will need to do this whenever you update with `git pull`: + +## Configuring acme.sh + +We'll be using acme.sh in Stateless Mode for TLS certificate renewal. + +First, as root, allow the user `acme` to have access to the acme log file, as follows: + +``` +# touch /var/log/acme.sh.log +# chown acme:acme /var/log/acme.sh.log +# chmod 600 /var/log/acme.sh.log +``` + +Next, obtain your account fingerprint: + +``` +# sudo -Hu acme -g acme acme.sh --register-account +``` + +You need to add the following to your nginx configuration for the server +running on port 80: + +``` + location ~ ^/\.well-known/acme-challenge/([-_a-zA-Z0-9]+)$ { + default_type text/plain; + return 200 "$1.6fXAG9VyG0IahirPEU2ZerUtItW2DHzDzD9wZaEKpqd"; + } +``` + +Replace the string after after `$1.` with your fingerprint. + +Start nginx: + +``` +# service nginx start +``` + +It should now be possible to issue a cert (replace `example.com` +with your domain name): + +``` +# sudo -Hu acme -g acme acme.sh --issue -d example.com --stateless +``` + +Let's add auto-renewal to `/etc/crontab` +(replace `example.com` with your domain): + +``` +/usr/local/bin/sudo -Hu acme -g acme /usr/local/sbin/acme.sh -r -d example.com --stateless +``` + +### Configuring nginx + +FreeBSD's default nginx configuration does not contain an include directive, which is +typically used for multiple sites. Therefore, you will need to first create the required +directory as follows: + + +``` +# mkdir -p /usr/local/etc/nginx/sites-available +``` + +Next, add an `include` directive to `/usr/local/etc/nginx/nginx.conf`, within the `http {}` +block, as follows: + + +``` +http { +... + include /usr/local/etc/nginx/sites-available/*; +} +``` + +As root, copy `/home/pleroma/pleroma/installation/pleroma.nginx` to +`/usr/local/etc/nginx/sites-available/pleroma.nginx`. + +Edit the defaults of `/usr/local/etc/nginx/sites-available/pleroma.nginx`: + +* Change `ssl_trusted_certificate` to `/var/db/acme/certs/example.tld/example.tld.cer`. +* Change `ssl_certificate` to `/var/db/acme/certs/example.tld/fullchain.cer`. +* Change `ssl_certificate_key` to `/var/db/acme/certs/example.tld/example.tld.key`. +* Change all references of `example.tld` to your instance's domain name. + +## Creating a startup script for Pleroma + +Pleroma will need to compile when it initially starts, which typically takes a longer +period of time. Therefore, it is good practice to initially run pleroma from the +command-line before utilizing the rc.d script. That is done as follows: + +``` +# su -l pleroma +$ cd $HOME/pleroma +$ MIX_ENV=prod mix phx.server +``` + +Copy the startup script to the correct location and make sure it's executable: + +``` +# cp /home/pleroma/pleroma/installation/freebsd/rc.d/pleroma /usr/local/etc/rc.d/pleroma +# chmod +x /usr/local/etc/rc.d/pleroma +``` + +Update the `/etc/rc.conf` and start pleroma with the following commands: + +``` +# sysrc pleroma_enable=YES +# service pleroma start +``` + +#### Create your first user + +If your instance is up and running, you can create your first user with administrative rights with the following task: + +```shell +sudo -Hu pleroma MIX_ENV=prod mix pleroma.user new --admin +``` +## Conclusion + +Restart nginx with `# service nginx restart` and you should be up and running. + +Make sure your time is in sync, or other instances will receive your posts with +incorrect timestamps. You should have ntpd running. + +## Questions + +Questions about the installation or didn’t it work as it should be, ask in [#pleroma:matrix.org](https://matrix.heldscal.la/#/room/#freenode_#pleroma:matrix.org) or IRC Channel **#pleroma** on **Freenode**. diff --git a/docs/installation/further_reading.include b/docs/installation/further_reading.include new file mode 100644 index 000000000..46752c722 --- /dev/null +++ b/docs/installation/further_reading.include @@ -0,0 +1,5 @@ +* [How Federation Works/Why is my Federated Timeline empty?](https://blog.soykaf.com/post/how-federation-works/) +* [Backup your instance](../administration/backup.md) +* [Updating your instance](../administration/updating.md) +* [Hardening your instance](../configuration/hardening.md) +* [How to activate mediaproxy](../configuration/howto_mediaproxy.md) diff --git a/docs/installation/gentoo_en.md b/docs/installation/gentoo_en.md index d143e068f..0f7ed9d47 100644 --- a/docs/installation/gentoo_en.md +++ b/docs/installation/gentoo_en.md @@ -28,6 +28,7 @@ Gentoo quite pointedly does not come with a cron daemon installed, and as such i * `dev-db/postgresql` * `dev-lang/elixir` * `dev-vcs/git` +* `dev-util/cmake` * `sys-apps/file` #### Optional ebuilds used in this guide @@ -47,7 +48,7 @@ Gentoo quite pointedly does not come with a cron daemon installed, and as such i * Emerge all required the required and suggested software in one go: ```shell - # emerge --ask dev-db/postgresql dev-lang/elixir dev-vcs/git www-servers/nginx app-crypt/certbot app-crypt/certbot-nginx sys-apps/file + # emerge --ask dev-db/postgresql dev-lang/elixir dev-vcs/git www-servers/nginx app-crypt/certbot app-crypt/certbot-nginx dev-util/cmake sys-apps/file ``` If you would not like to install the optional packages, remove them from this line. @@ -284,10 +285,7 @@ If you opted to allow sudo for the `pleroma` user but would like to remove the a #### Further reading -* [Backup your instance](../administration/backup.md) -* [Hardening your instance](../configuration/hardening.md) -* [How to activate mediaproxy](../configuration/howto_mediaproxy.md) -* [Updating your instance](../administration/updating.md) +{! backend/installation/further_reading.include !} ## Questions diff --git a/docs/installation/migrating_from_source_otp_en.md b/docs/installation/migrating_from_source_otp_en.md index 31c2f1294..d303a6daf 100644 --- a/docs/installation/migrating_from_source_otp_en.md +++ b/docs/installation/migrating_from_source_otp_en.md @@ -8,13 +8,15 @@ You will be running commands as root. If you aren't root already, please elevate The system needs to have `curl` and `unzip` installed for downloading and unpacking release builds. -```sh tab="Alpine" -apk add curl unzip -``` +=== "Alpine" + ```sh + apk add curl unzip + ``` -```sh tab="Debian/Ubuntu" -apt install curl unzip -``` +=== "Debian/Ubuntu" + ```sh + apt install curl unzip + ``` ## Moving content out of the application directory When using OTP releases the application directory changes with every version so it would be a bother to keep content there (and also dangerous unless `--no-rm` option is used when updating). Fortunately almost all paths in Pleroma are configurable, so it is possible to move them out of there. @@ -110,27 +112,29 @@ OTP releases have different service files than from-source installs so they need **Warning:** The service files assume pleroma user's home directory is `/opt/pleroma`, please make sure all paths fit your installation. -```sh tab="Alpine" -# Copy the service into a proper directory -cp -f ~pleroma/installation/init.d/pleroma /etc/init.d/pleroma +=== "Alpine" + ```sh + # Copy the service into a proper directory + cp -f ~pleroma/installation/init.d/pleroma /etc/init.d/pleroma -# Start pleroma -rc-service pleroma start -``` + # Start pleroma + rc-service pleroma start + ``` -```sh tab="Debian/Ubuntu" -# Copy the service into a proper directory -cp ~pleroma/installation/pleroma.service /etc/systemd/system/pleroma.service +=== "Debian/Ubuntu" + ```sh + # Copy the service into a proper directory + cp ~pleroma/installation/pleroma.service /etc/systemd/system/pleroma.service -# Reload service files -systemctl daemon-reload + # Reload service files + systemctl daemon-reload -# Reenable pleroma to start on boot -systemctl reenable pleroma + # Reenable pleroma to start on boot + systemctl reenable pleroma -# Start pleroma -systemctl start pleroma -``` + # Start pleroma + systemctl start pleroma + ``` ## Running mix tasks Refer to [Running mix tasks](otp_en.md#running-mix-tasks) section from OTP release installation guide. diff --git a/docs/installation/netbsd_en.md b/docs/installation/netbsd_en.md index 6a922a27e..6ad0de2f6 100644 --- a/docs/installation/netbsd_en.md +++ b/docs/installation/netbsd_en.md @@ -19,6 +19,7 @@ databases/postgresql11-client databases/postgresql11-server devel/git-base devel/git-docs +devel/cmake lang/elixir security/acmesh security/sudo @@ -196,3 +197,11 @@ incorrect timestamps. You should have ntpd running. ## Instances running NetBSD * + +#### Further reading + +{! backend/installation/further_reading.include !} + +## Questions + +Questions about the installation or didn’t it work as it should be, ask in [#pleroma:matrix.org](https://matrix.heldscal.la/#/room/#freenode_#pleroma:matrix.org) or IRC Channel **#pleroma** on **Freenode**. diff --git a/docs/installation/openbsd_en.md b/docs/installation/openbsd_en.md index e8c5d844c..eee452845 100644 --- a/docs/installation/openbsd_en.md +++ b/docs/installation/openbsd_en.md @@ -14,11 +14,12 @@ The following packages need to be installed: * git * postgresql-server * postgresql-contrib + * cmake To install them, run the following command (with doas or as root): ``` -pkg_add elixir gmake ImageMagick git postgresql-server postgresql-contrib +pkg_add elixir gmake ImageMagick git postgresql-server postgresql-contrib cmake ``` Pleroma requires a reverse proxy, OpenBSD has relayd in base (and is used in this guide) and packages/ports are available for nginx (www/nginx) and apache (www/apache-httpd). Independently of the reverse proxy, [acme-client(1)](https://man.openbsd.org/acme-client) can be used to get a certificate from Let's Encrypt. @@ -242,3 +243,11 @@ If your instance is up and running, you can create your first user with administ ``` LC_ALL=en_US.UTF-8 MIX_ENV=prod mix pleroma.user new --admin ``` + +#### Further reading + +{! backend/installation/further_reading.include !} + +## Questions + +Questions about the installation or didn’t it work as it should be, ask in [#pleroma:matrix.org](https://matrix.heldscal.la/#/room/#freenode_#pleroma:matrix.org) or IRC Channel **#pleroma** on **Freenode**. diff --git a/docs/installation/openbsd_fi.md b/docs/installation/openbsd_fi.md index 272273cff..b5b5056a9 100644 --- a/docs/installation/openbsd_fi.md +++ b/docs/installation/openbsd_fi.md @@ -16,7 +16,7 @@ Matrix-kanava #freenode_#pleroma:matrix.org ovat hyviä paikkoja löytää apua Asenna tarvittava ohjelmisto: -`# pkg_add git elixir gmake postgresql-server-10.3 postgresql-contrib-10.3` +`# pkg_add git elixir gmake postgresql-server-10.3 postgresql-contrib-10.3 cmake` Luo postgresql-tietokanta: diff --git a/docs/installation/otp_en.md b/docs/installation/otp_en.md index e086cc1c4..32f04a9c4 100644 --- a/docs/installation/otp_en.md +++ b/docs/installation/otp_en.md @@ -29,15 +29,17 @@ Other than things bundled in the OTP release Pleroma depends on: * certbot (for Let's Encrypt certificates, could be swapped with another ACME client, but this guide covers only it) * libmagic/file -```sh tab="Alpine" -echo "http://nl.alpinelinux.org/alpine/latest-stable/community" >> /etc/apk/repositories -apk update -apk add curl unzip ncurses postgresql postgresql-contrib nginx certbot file-dev -``` +=== "Alpine" + ``` + echo "http://nl.alpinelinux.org/alpine/latest-stable/community" >> /etc/apk/repositories + apk update + apk add curl unzip ncurses postgresql postgresql-contrib nginx certbot file-dev + ``` -```sh tab="Debian/Ubuntu" -apt install curl unzip libncurses5 postgresql postgresql-contrib nginx certbot libmagic-dev -``` +=== "Debian/Ubuntu" + ``` + apt install curl unzip libncurses5 postgresql postgresql-contrib nginx certbot libmagic-dev + ``` ## Setup ### Configuring PostgreSQL @@ -48,31 +50,35 @@ apt install curl unzip libncurses5 postgresql postgresql-contrib nginx certbot l RUM indexes are an alternative indexing scheme that is not included in PostgreSQL by default. You can read more about them on the [Configuration page](../configuration/cheatsheet.md#rum-indexing-for-full-text-search). They are completely optional and most of the time are not worth it, especially if you are running a single user instance (unless you absolutely need ordered search results). -```sh tab="Alpine" -apk add git build-base postgresql-dev -git clone https://github.com/postgrespro/rum /tmp/rum -cd /tmp/rum -make USE_PGXS=1 -make USE_PGXS=1 install -cd -rm -r /tmp/rum -``` +=== "Alpine" + ``` + apk add git build-base postgresql-dev + git clone https://github.com/postgrespro/rum /tmp/rum + cd /tmp/rum + make USE_PGXS=1 + make USE_PGXS=1 install + cd + rm -r /tmp/rum + ``` -```sh tab="Debian/Ubuntu" -# Available only on Buster/19.04 -apt install postgresql-11-rum -``` +=== "Debian/Ubuntu" + ``` + # Available only on Buster/19.04 + apt install postgresql-11-rum + ``` #### (Optional) Performance configuration It is encouraged to check [Optimizing your PostgreSQL performance](../configuration/postgresql.md) document, for tips on PostgreSQL tuning. -```sh tab="Alpine" -rc-service postgresql restart -``` +=== "Alpine" + ``` + rc-service postgresql restart + ``` -```sh tab="Debian/Ubuntu" -systemctl restart postgresql -``` +=== "Debian/Ubuntu" + ``` + systemctl restart postgresql + ``` If you are using PostgreSQL 12 or higher, add this to your Ecto database configuration @@ -152,14 +158,16 @@ certbot certonly --standalone --preferred-challenges http -d yourinstance.tld The location of nginx configs is dependent on the distro -```sh tab="Alpine" -cp /opt/pleroma/installation/pleroma.nginx /etc/nginx/conf.d/pleroma.conf -``` +=== "Alpine" + ``` + cp /opt/pleroma/installation/pleroma.nginx /etc/nginx/conf.d/pleroma.conf + ``` -```sh tab="Debian/Ubuntu" -cp /opt/pleroma/installation/pleroma.nginx /etc/nginx/sites-available/pleroma.conf -ln -s /etc/nginx/sites-available/pleroma.conf /etc/nginx/sites-enabled/pleroma.conf -``` +=== "Debian/Ubuntu" + ``` + cp /opt/pleroma/installation/pleroma.nginx /etc/nginx/sites-available/pleroma.conf + ln -s /etc/nginx/sites-available/pleroma.conf /etc/nginx/sites-enabled/pleroma.conf + ``` If your distro does not have either of those you can append `include /etc/nginx/pleroma.conf` to the end of the http section in /etc/nginx/nginx.conf and ```sh @@ -176,35 +184,39 @@ nginx -t ``` #### Start nginx -```sh tab="Alpine" -rc-service nginx start -``` +=== "Alpine" + ``` + rc-service nginx start + ``` -```sh tab="Debian/Ubuntu" -systemctl start nginx -``` +=== "Debian/Ubuntu" + ``` + systemctl start nginx + ``` At this point if you open your (sub)domain in a browser you should see a 502 error, that's because Pleroma is not started yet. ### Setting up a system service -```sh tab="Alpine" -# Copy the service into a proper directory -cp /opt/pleroma/installation/init.d/pleroma /etc/init.d/pleroma +=== "Alpine" + ``` + # Copy the service into a proper directory + cp /opt/pleroma/installation/init.d/pleroma /etc/init.d/pleroma -# Start pleroma and enable it on boot -rc-service pleroma start -rc-update add pleroma -``` + # Start pleroma and enable it on boot + rc-service pleroma start + rc-update add pleroma + ``` -```sh tab="Debian/Ubuntu" -# Copy the service into a proper directory -cp /opt/pleroma/installation/pleroma.service /etc/systemd/system/pleroma.service +=== "Debian/Ubuntu" + ``` + # Copy the service into a proper directory + cp /opt/pleroma/installation/pleroma.service /etc/systemd/system/pleroma.service -# Start pleroma and enable it on boot -systemctl start pleroma -systemctl enable pleroma -``` + # Start pleroma and enable it on boot + systemctl start pleroma + systemctl enable pleroma + ``` If everything worked, you should see Pleroma-FE when visiting your domain. If that didn't happen, try reviewing the installation steps, starting Pleroma in the foreground and seeing if there are any errrors. @@ -224,43 +236,45 @@ $EDITOR path-to-nginx-config nginx -t ``` -```sh tab="Alpine" -# Restart nginx -rc-service nginx restart +=== "Alpine" + ``` + # Restart nginx + rc-service nginx restart -# Start the cron daemon and make it start on boot -rc-service crond start -rc-update add crond + # Start the cron daemon and make it start on boot + rc-service crond start + rc-update add crond -# Ensure the webroot menthod and post hook is working -certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --dry-run --post-hook 'rc-service nginx reload' + # Ensure the webroot menthod and post hook is working + certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --dry-run --post-hook 'rc-service nginx reload' -# Add it to the daily cron -echo '#!/bin/sh -certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --post-hook "rc-service nginx reload" -' > /etc/periodic/daily/renew-pleroma-cert -chmod +x /etc/periodic/daily/renew-pleroma-cert + # Add it to the daily cron + echo '#!/bin/sh + certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --post-hook "rc-service nginx reload" + ' > /etc/periodic/daily/renew-pleroma-cert + chmod +x /etc/periodic/daily/renew-pleroma-cert -# If everything worked the output should contain /etc/cron.daily/renew-pleroma-cert -run-parts --test /etc/periodic/daily -``` + # If everything worked the output should contain /etc/cron.daily/renew-pleroma-cert + run-parts --test /etc/periodic/daily + ``` -```sh tab="Debian/Ubuntu" -# Restart nginx -systemctl restart nginx +=== "Debian/Ubuntu" + ``` + # Restart nginx + systemctl restart nginx -# Ensure the webroot menthod and post hook is working -certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --dry-run --post-hook 'systemctl reload nginx' + # Ensure the webroot menthod and post hook is working + certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --dry-run --post-hook 'systemctl reload nginx' -# Add it to the daily cron -echo '#!/bin/sh -certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --post-hook "systemctl reload nginx" -' > /etc/cron.daily/renew-pleroma-cert -chmod +x /etc/cron.daily/renew-pleroma-cert + # Add it to the daily cron + echo '#!/bin/sh + certbot renew --cert-name yourinstance.tld --webroot -w /var/lib/letsencrypt/ --post-hook "systemctl reload nginx" + ' > /etc/cron.daily/renew-pleroma-cert + chmod +x /etc/cron.daily/renew-pleroma-cert -# If everything worked the output should contain /etc/cron.daily/renew-pleroma-cert -run-parts --test /etc/cron.daily -``` + # If everything worked the output should contain /etc/cron.daily/renew-pleroma-cert + run-parts --test /etc/cron.daily + ``` ## Create your first user and set as admin ```sh @@ -271,10 +285,7 @@ This will create an account withe the username of 'joeuser' with the email addre ## Further reading -* [Backup your instance](../administration/backup.md) -* [Hardening your instance](../configuration/hardening.md) -* [How to activate mediaproxy](../configuration/howto_mediaproxy.md) -* [Updating your instance](../administration/updating.md) +{! backend/installation/further_reading.include !} ## Questions diff --git a/docs/introduction.md b/docs/introduction.md deleted file mode 100644 index a915c143c..000000000 --- a/docs/introduction.md +++ /dev/null @@ -1,65 +0,0 @@ -# Introduction to Pleroma -## What is Pleroma? -Pleroma is a federated social networking platform, compatible with GNU social, Mastodon and other OStatus and ActivityPub implementations. It is free software licensed under the AGPLv3. -It actually consists of two components: a backend, named simply Pleroma, and a user-facing frontend, named Pleroma-FE. It also includes the Mastodon frontend, if that's your thing. -It's part of what we call the fediverse, a federated network of instances which speak common protocols and can communicate with each other. -One account on an instance is enough to talk to the entire fediverse! - -## How can I use it? - -Pleroma instances are already widely deployed, a list can be found at . Information on all existing fediverse instances can be found at . - -If you don't feel like joining an existing instance, but instead prefer to deploy your own instance, that's easy too! -Installation instructions can be found in the installation section of these docs. - -## I got an account, now what? -Great! Now you can explore the fediverse! Open the login page for your Pleroma instance (e.g. ) and login with your username and password. (If you don't have an account yet, click on Register) - -At this point you will have two columns in front of you. - -### Left column - -- first block: here you can see your avatar, your nickname and statistics (Statuses, Following, Followers). Clicking your profile pic will open your profile. -Under that you have a text form which allows you to post new statuses. The number on the bottom of the text form is a character counter, every instance can have a different character limit (the default is 5000). -If you want to mention someone, type @ + name of the person. A drop-down menu will help you in finding the right person. -Under the text form there are also several visibility options and there is the option to use rich text. -Under that the icon on the left is for uploading media files and attach them to your post. There is also an emoji-picker and an option to post a poll. -To post your status, simply press Submit. -On the top right you will also see a wrench icon. This opens your personal settings. - -- second block: Here you can switch between the different timelines: - - Timeline: all the people that you follow - - Interactions: here you can switch between different timelines where there was interaction with your account. There is Mentions, Repeats and Favorites, and New follows - - Direct Messages: these are the Direct Messages sent to you - - Public Timeline: all the statutes from the local instance - - The Whole Known Network: all public posts the instance knows about, both local and remote! - - About: This isn't a Timeline but shows relevant info about the instance. You can find a list of the moderators and admins, Terms of Service, MRF policies and enabled features. -- Optional third block: This is the Instance panel that can be activated, but is deactivated by default. It's fully customisable and by default has links to the pleroma-fe and Mastodon-fe. -- fourth block: This is the Notifications block, here you will get notified whenever somebody mentions you, follows you, repeats or favorites one of your statuses. - -### Right column -This is where the interesting stuff happens! -Depending on the timeline you will see different statuses, but each status has a standard structure: - -- Profile pic, name and link to profile. An optional left-arrow if it's a reply to another status (hovering will reveal the reply-to status). Clicking on the profile pic will uncollapse the user's profile. -- A `+` button on the right allows you to Expand/Collapse an entire discussion thread. It also updates in realtime! -- An arrow icon allows you to open the status on the instance where it's originating from. -- The text of the status, including mentions and attachements. If you click on a mention, it will automatically open the profile page of that person. -- Three buttons (left to right): Reply, Repeat, Favorite. There is also a forth button, this is a dropdown menu for simple moderation like muting the conversation or, if you have moderation rights, delete the status from the server. - -### Top right - -- The magnifier icon opens the search screen where you can search for statuses, people and hashtags. It's also possible to import statusses from remote servers by pasting the url to the post in the search field. -- The gear icon gives you general settings -- If you have admin rights, you'll see an icon that opens the admin interface -- The last icon is to log out - -### Bottom right -On the bottom right you have a chatbox. Here you can communicate with people on the same instance in realtime. It is local-only, for now, but there are plans to make it extendable to the entire fediverse! - -### Mastodon interface -If the Pleroma interface isn't your thing, or you're just trying something new but you want to keep using the familiar Mastodon interface, we got that too! -Just add a "/web" after your instance url (e.g. ) and you'll end on the Mastodon web interface, but with a Pleroma backend! MAGIC! -The Mastodon interface is from the Glitch-soc fork. For more information on the Mastodon interface you can check the [Mastodon](https://docs.joinmastodon.org/) and [Glitch-soc](https://glitch-soc.github.io/docs/) documentation. - -Remember, what you see is only the frontend part of Mastodon, the backend is still Pleroma. diff --git a/elixir_buildpack.config b/elixir_buildpack.config index c23b08fb8..946408c12 100644 --- a/elixir_buildpack.config +++ b/elixir_buildpack.config @@ -1,2 +1,2 @@ -elixir_version=1.8.2 -erlang_version=21.3.7 +elixir_version=1.9.4 +erlang_version=22.3.4.1 diff --git a/installation/freebsd/rc.d/pleroma b/installation/freebsd/rc.d/pleroma new file mode 100755 index 000000000..f62aef18d --- /dev/null +++ b/installation/freebsd/rc.d/pleroma @@ -0,0 +1,27 @@ +#!/bin/sh +# $FreeBSD$ +# PROVIDE: pleroma +# REQUIRE: DAEMON postgresql +# KEYWORD: shutdown + +# sudo -u pleroma MIX_ENV=prod elixir --erl \"-detached\" -S mix phx.server + +. /etc/rc.subr + +name=pleroma +rcvar=pleroma_enable + +desc="Pleroma Social Media Platform" + +load_rc_config ${name} + +: ${pleroma_user:=pleroma} +: ${pleroma_home:=$(getent passwd ${pleroma_user} | awk -F: '{print $6}')} +: ${pleroma_chdir:="${pleroma_home}/pleroma"} +: ${pleroma_env:="HOME=${pleroma_home} MIX_ENV=prod"} + +command=/usr/local/bin/elixir +command_args="--erl \"-detached\" -S /usr/local/bin/mix phx.server" +procname="*beam.smp" + +run_rc_command "$1" diff --git a/installation/nginx-cache-purge.sh.example b/installation/nginx-cache-purge.sh.example index b2915321c..5f6cbb128 100755 --- a/installation/nginx-cache-purge.sh.example +++ b/installation/nginx-cache-purge.sh.example @@ -13,7 +13,7 @@ CACHE_DIRECTORY="/tmp/pleroma-media-cache" ## $3 - (optional) the number of parallel processes to run for grep. get_cache_files() { local max_parallel=${3-16} - find $2 -maxdepth 2 -type d | xargs -P $max_parallel -n 1 grep -E Rl "^KEY:.*$1" | sort -u + find $2 -maxdepth 2 -type d | xargs -P $max_parallel -n 1 grep -E -Rl "^KEY:.*$1" | sort -u } ## Removes an item from the given cache zone. @@ -37,4 +37,4 @@ purge() { } -purge $1 +purge $@ diff --git a/lib/mix/pleroma.ex b/lib/mix/pleroma.ex index 3ad6edbfb..49ba2aae4 100644 --- a/lib/mix/pleroma.ex +++ b/lib/mix/pleroma.ex @@ -3,15 +3,54 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Mix.Pleroma do + @apps [ + :restarter, + :ecto, + :ecto_sql, + :postgrex, + :db_connection, + :cachex, + :flake_id, + :swoosh, + :timex + ] + @cachex_children ["object", "user", "scrubber"] @doc "Common functions to be reused in mix tasks" def start_pleroma do + Pleroma.Config.Holder.save_default() + Pleroma.Config.Oban.warn() Application.put_env(:phoenix, :serve_endpoints, false, persistent: true) if Pleroma.Config.get(:env) != :test do Application.put_env(:logger, :console, level: :debug) end - {:ok, _} = Application.ensure_all_started(:pleroma) + adapter = Application.get_env(:tesla, :adapter) + + apps = + if adapter == Tesla.Adapter.Gun do + [:gun | @apps] + else + [:hackney | @apps] + end + + Enum.each(apps, &Application.ensure_all_started/1) + + children = + [ + Pleroma.Repo, + {Pleroma.Config.TransferTask, false}, + Pleroma.Web.Endpoint, + {Oban, Pleroma.Config.get(Oban)} + ] ++ + http_children(adapter) + + cachex_children = Enum.map(@cachex_children, &Pleroma.Application.build_cachex(&1, [])) + + Supervisor.start_link(children ++ cachex_children, + strategy: :one_for_one, + name: Pleroma.Supervisor + ) if Pleroma.Config.get(:env) not in [:test, :benchmark] do pleroma_rebooted?() @@ -82,4 +121,11 @@ def mix_shell?, do: :erlang.function_exported(Mix, :shell, 0) def escape_sh_path(path) do ~S(') <> String.replace(path, ~S('), ~S(\')) <> ~S(') end + + defp http_children(Tesla.Adapter.Gun) do + Pleroma.Gun.ConnectionPool.children() ++ + [{Task, &Pleroma.HTTP.AdapterHelper.Gun.limiter_setup/0}] + end + + defp http_children(_), do: [] end diff --git a/lib/mix/tasks/pleroma/benchmark.ex b/lib/mix/tasks/pleroma/benchmark.ex index dd2b9c8f2..a607d5d4f 100644 --- a/lib/mix/tasks/pleroma/benchmark.ex +++ b/lib/mix/tasks/pleroma/benchmark.ex @@ -91,20 +91,17 @@ def run(["adapters"]) do "Without conn and without pool" => fn -> {:ok, %Tesla.Env{}} = Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], - adapter: [pool: :no_pool, receive_conn: false] + pool: :no_pool, + receive_conn: false ) end, "Without conn and with pool" => fn -> {:ok, %Tesla.Env{}} = - Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], - adapter: [receive_conn: false] - ) + Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], receive_conn: false) end, "With reused conn and without pool" => fn -> {:ok, %Tesla.Env{}} = - Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], - adapter: [pool: :no_pool] - ) + Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [], pool: :no_pool) end, "With reused conn and with pool" => fn -> {:ok, %Tesla.Env{}} = Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500") diff --git a/lib/mix/tasks/pleroma/config.ex b/lib/mix/tasks/pleroma/config.ex index 5c9ef6904..904c5a74b 100644 --- a/lib/mix/tasks/pleroma/config.ex +++ b/lib/mix/tasks/pleroma/config.ex @@ -52,6 +52,7 @@ def migrate_to_db(file_path \\ nil) do defp do_migrate_to_db(config_file) do if File.exists?(config_file) do + shell_info("Migrating settings from file: #{Path.expand(config_file)}") Ecto.Adapters.SQL.query!(Repo, "TRUNCATE config;") Ecto.Adapters.SQL.query!(Repo, "ALTER SEQUENCE config_id_seq RESTART;") @@ -72,8 +73,7 @@ defp create(group, settings) do group |> Pleroma.Config.Loader.filter_group(settings) |> Enum.each(fn {key, value} -> - key = inspect(key) - {:ok, _} = ConfigDB.update_or_create(%{group: inspect(group), key: key, value: value}) + {:ok, _} = ConfigDB.update_or_create(%{group: group, key: key, value: value}) shell_info("Settings for key #{key} migrated.") end) @@ -83,7 +83,7 @@ defp create(group, settings) do defp migrate_from_db(opts) do if Pleroma.Config.get([:configurable_from_database]) do - env = opts[:env] || "prod" + env = opts[:env] || Pleroma.Config.get(:env) config_path = if Pleroma.Config.get(:release) do @@ -105,6 +105,10 @@ defp migrate_from_db(opts) do :ok = File.close(file) System.cmd("mix", ["format", config_path]) + + shell_info( + "Database configuration settings have been exported to config/#{env}.exported_from_db.secret.exs" + ) else migration_error() end @@ -112,7 +116,7 @@ defp migrate_from_db(opts) do defp migration_error do shell_error( - "Migration is not allowed in config. You can change this behavior by setting `configurable_from_database` to true." + "Migration is not allowed in config. You can change this behavior by setting `config :pleroma, configurable_from_database: true`" ) end @@ -131,12 +135,9 @@ defp write_and_delete(config, file, delete?) do end defp write(config, file) do - value = - config.value - |> ConfigDB.from_binary() - |> inspect(limit: :infinity) + value = inspect(config.value, limit: :infinity) - IO.write(file, "config #{config.group}, #{config.key}, #{value}\r\n\r\n") + IO.write(file, "config #{inspect(config.group)}, #{inspect(config.key)}, #{value}\r\n\r\n") config end diff --git a/lib/mix/tasks/pleroma/database.ex b/lib/mix/tasks/pleroma/database.ex index 82e2abdcb..7f1108dcf 100644 --- a/lib/mix/tasks/pleroma/database.ex +++ b/lib/mix/tasks/pleroma/database.ex @@ -10,6 +10,7 @@ defmodule Mix.Tasks.Pleroma.Database do alias Pleroma.User require Logger require Pleroma.Constants + import Ecto.Query import Mix.Pleroma use Mix.Task @@ -53,8 +54,6 @@ def run(["update_users_following_followers_counts"]) do end def run(["prune_objects" | args]) do - import Ecto.Query - {options, [], []} = OptionParser.parse( args, @@ -94,8 +93,6 @@ def run(["prune_objects" | args]) do end def run(["fix_likes_collections"]) do - import Ecto.Query - start_pleroma() from(object in Object, @@ -130,4 +127,38 @@ def run(["vacuum", args]) do Maintenance.vacuum(args) end + + def run(["ensure_expiration"]) do + start_pleroma() + days = Pleroma.Config.get([:mrf_activity_expiration, :days], 365) + + Pleroma.Activity + |> join(:inner, [a], o in Object, + on: + fragment( + "(?->>'id') = COALESCE((?)->'object'->> 'id', (?)->>'object')", + o.data, + a.data, + a.data + ) + ) + |> where(local: true) + |> where([a], fragment("(? ->> 'type'::text) = 'Create'", a.data)) + |> where([_a, o], fragment("?->>'type' = 'Note'", o.data)) + |> Pleroma.RepoStreamer.chunk_stream(100) + |> Stream.each(fn activities -> + Enum.each(activities, fn activity -> + expires_at = + activity.inserted_at + |> DateTime.from_naive!("Etc/UTC") + |> Timex.shift(days: days) + + Pleroma.Workers.PurgeExpiredActivity.enqueue(%{ + activity_id: activity.id, + expires_at: expires_at + }) + end) + end) + |> Stream.run() + end end diff --git a/lib/mix/tasks/pleroma/ecto/migrate.ex b/lib/mix/tasks/pleroma/ecto/migrate.ex index bc8ed29fb..e903bd171 100644 --- a/lib/mix/tasks/pleroma/ecto/migrate.ex +++ b/lib/mix/tasks/pleroma/ecto/migrate.ex @@ -41,6 +41,10 @@ def run(args \\ []) do load_pleroma() {opts, _} = OptionParser.parse!(args, strict: @switches, aliases: @aliases) + if Application.get_env(:pleroma, Pleroma.Repo)[:ssl] do + Application.ensure_all_started(:ssl) + end + opts = if opts[:to] || opts[:step] || opts[:all], do: opts, diff --git a/lib/mix/tasks/pleroma/ecto/rollback.ex b/lib/mix/tasks/pleroma/ecto/rollback.ex index f43bd0b98..3dba952cb 100644 --- a/lib/mix/tasks/pleroma/ecto/rollback.ex +++ b/lib/mix/tasks/pleroma/ecto/rollback.ex @@ -40,6 +40,10 @@ def run(args \\ []) do load_pleroma() {opts, _} = OptionParser.parse!(args, strict: @switches, aliases: @aliases) + if Application.get_env(:pleroma, Pleroma.Repo)[:ssl] do + Application.ensure_all_started(:ssl) + end + opts = if opts[:to] || opts[:step] || opts[:all], do: opts, diff --git a/lib/mix/tasks/pleroma/emoji.ex b/lib/mix/tasks/pleroma/emoji.ex index f4eaeac98..1750373f9 100644 --- a/lib/mix/tasks/pleroma/emoji.ex +++ b/lib/mix/tasks/pleroma/emoji.ex @@ -15,7 +15,7 @@ def run(["ls-packs" | args]) do {options, [], []} = parse_global_opts(args) url_or_path = options[:manifest] || default_manifest() - manifest = fetch_and_decode(url_or_path) + manifest = fetch_and_decode!(url_or_path) Enum.each(manifest, fn {name, info} -> to_print = [ @@ -42,7 +42,7 @@ def run(["get-packs" | args]) do url_or_path = options[:manifest] || default_manifest() - manifest = fetch_and_decode(url_or_path) + manifest = fetch_and_decode!(url_or_path) for pack_name <- pack_names do if Map.has_key?(manifest, pack_name) do @@ -92,7 +92,7 @@ def run(["get-packs" | args]) do ]) ) - files = fetch_and_decode(files_loc) + files = fetch_and_decode!(files_loc) IO.puts(IO.ANSI.format(["Unpacking ", :bright, pack_name])) @@ -183,7 +183,7 @@ def run(["gen-pack" | args]) do IO.puts("Downloading the pack and generating SHA256") - binary_archive = Tesla.get!(client(), src).body + {:ok, %{body: binary_archive}} = Pleroma.HTTP.get(src) archive_sha = :crypto.hash(:sha256, binary_archive) |> Base.encode16() IO.puts("SHA256 is #{archive_sha}") @@ -243,14 +243,16 @@ def run(["reload"]) do IO.puts("Emoji packs have been reloaded.") end - defp fetch_and_decode(from) do + defp fetch_and_decode!(from) do with {:ok, json} <- fetch(from) do Jason.decode!(json) + else + {:error, error} -> raise "#{from} cannot be fetched. Error: #{error} occur." end end defp fetch("http" <> _ = from) do - with {:ok, %{body: body}} <- Tesla.get(client(), from) do + with {:ok, %{body: body}} <- Pleroma.HTTP.get(from) do {:ok, body} end end @@ -269,13 +271,5 @@ defp parse_global_opts(args) do ) end - defp client do - middleware = [ - {Tesla.Middleware.FollowRedirects, [max_redirects: 3]} - ] - - Tesla.client(middleware) - end - defp default_manifest, do: Pleroma.Config.get!([:emoji, :default_manifest]) end diff --git a/lib/mix/tasks/pleroma/frontend.ex b/lib/mix/tasks/pleroma/frontend.ex new file mode 100644 index 000000000..cbce81ab9 --- /dev/null +++ b/lib/mix/tasks/pleroma/frontend.ex @@ -0,0 +1,141 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Mix.Tasks.Pleroma.Frontend do + use Mix.Task + + import Mix.Pleroma + + @shortdoc "Manages bundled Pleroma frontends" + + @moduledoc File.read!("docs/administration/CLI_tasks/frontend.md") + + def run(["install", "none" | _args]) do + shell_info("Skipping frontend installation because none was requested") + "none" + end + + def run(["install", frontend | args]) do + log_level = Logger.level() + Logger.configure(level: :warn) + start_pleroma() + + {options, [], []} = + OptionParser.parse( + args, + strict: [ + ref: :string, + static_dir: :string, + build_url: :string, + build_dir: :string, + file: :string + ] + ) + + instance_static_dir = + with nil <- options[:static_dir] do + Pleroma.Config.get!([:instance, :static_dir]) + end + + cmd_frontend_info = %{ + "name" => frontend, + "ref" => options[:ref], + "build_url" => options[:build_url], + "build_dir" => options[:build_dir] + } + + config_frontend_info = Pleroma.Config.get([:frontends, :available, frontend], %{}) + + frontend_info = + Map.merge(config_frontend_info, cmd_frontend_info, fn _key, config, cmd -> + # This only overrides things that are actually set + cmd || config + end) + + ref = frontend_info["ref"] + + unless ref do + raise "No ref given or configured" + end + + dest = + Path.join([ + instance_static_dir, + "frontends", + frontend, + ref + ]) + + fe_label = "#{frontend} (#{ref})" + + tmp_dir = Path.join([instance_static_dir, "frontends", "tmp"]) + + with {_, :ok} <- + {:download_or_unzip, download_or_unzip(frontend_info, tmp_dir, options[:file])}, + shell_info("Installing #{fe_label} to #{dest}"), + :ok <- install_frontend(frontend_info, tmp_dir, dest) do + File.rm_rf!(tmp_dir) + shell_info("Frontend #{fe_label} installed to #{dest}") + + Logger.configure(level: log_level) + else + {:download_or_unzip, _} -> + shell_info("Could not download or unzip the frontend") + + _e -> + shell_info("Could not install the frontend") + end + end + + defp download_or_unzip(frontend_info, temp_dir, file) do + if file do + with {:ok, zip} <- File.read(Path.expand(file)) do + unzip(zip, temp_dir) + end + else + download_build(frontend_info, temp_dir) + end + end + + def unzip(zip, dest) do + with {:ok, unzipped} <- :zip.unzip(zip, [:memory]) do + File.rm_rf!(dest) + File.mkdir_p!(dest) + + Enum.each(unzipped, fn {filename, data} -> + path = filename + + new_file_path = Path.join(dest, path) + + new_file_path + |> Path.dirname() + |> File.mkdir_p!() + + File.write!(new_file_path, data) + end) + + :ok + end + end + + defp download_build(frontend_info, dest) do + shell_info("Downloading pre-built bundle for #{frontend_info["name"]}") + url = String.replace(frontend_info["build_url"], "${ref}", frontend_info["ref"]) + + with {:ok, %{status: 200, body: zip_body}} <- + Pleroma.HTTP.get(url, [], pool: :media, recv_timeout: 120_000) do + unzip(zip_body, dest) + else + e -> {:error, e} + end + end + + defp install_frontend(frontend_info, source, dest) do + from = frontend_info["build_dir"] || "dist" + File.rm_rf!(dest) + File.mkdir_p!(dest) + File.cp_r!(Path.join([source, from]), dest) + :ok + end +end diff --git a/lib/mix/tasks/pleroma/instance.ex b/lib/mix/tasks/pleroma/instance.ex index 86409738a..91440b453 100644 --- a/lib/mix/tasks/pleroma/instance.ex +++ b/lib/mix/tasks/pleroma/instance.ex @@ -145,7 +145,7 @@ def run(["gen" | rest]) do options, :uploads_dir, "What directory should media uploads go in (when using the local uploader)?", - Pleroma.Config.get([Pleroma.Uploaders.Local, :uploads]) + Config.get([Pleroma.Uploaders.Local, :uploads]) ) |> Path.expand() @@ -154,7 +154,7 @@ def run(["gen" | rest]) do options, :static_dir, "What directory should custom public files be read from (custom emojis, frontend bundle overrides, robots.txt, etc.)?", - Pleroma.Config.get([:instance, :static_dir]) + Config.get([:instance, :static_dir]) ) |> Path.expand() diff --git a/lib/mix/tasks/pleroma/notification_settings.ex b/lib/mix/tasks/pleroma/notification_settings.ex index 7d65f0587..00f5ba7bf 100644 --- a/lib/mix/tasks/pleroma/notification_settings.ex +++ b/lib/mix/tasks/pleroma/notification_settings.ex @@ -3,8 +3,8 @@ defmodule Mix.Tasks.Pleroma.NotificationSettings do @moduledoc """ Example: - > mix pleroma.notification_settings --privacy-option=false --nickname-users="parallel588" # set false only for parallel588 user - > mix pleroma.notification_settings --privacy-option=true # set true for all users + > mix pleroma.notification_settings --hide-notification-contents=false --nickname-users="parallel588" # set false only for parallel588 user + > mix pleroma.notification_settings --hide-notification-contents=true # set true for all users """ @@ -19,16 +19,16 @@ def run(args) do OptionParser.parse( args, strict: [ - privacy_option: :boolean, + hide_notification_contents: :boolean, email_users: :string, nickname_users: :string ] ) - privacy_option = Keyword.get(options, :privacy_option) + hide_notification_contents = Keyword.get(options, :hide_notification_contents) - if not is_nil(privacy_option) do - privacy_option + if not is_nil(hide_notification_contents) do + hide_notification_contents |> build_query(options) |> Pleroma.Repo.update_all([]) end @@ -36,15 +36,15 @@ def run(args) do shell_info("Done") end - defp build_query(privacy_option, options) do + defp build_query(hide_notification_contents, options) do query = from(u in Pleroma.User, update: [ set: [ notification_settings: fragment( - "jsonb_set(notification_settings, '{privacy_option}', ?)", - ^privacy_option + "jsonb_set(notification_settings, '{hide_notification_contents}', ?)", + ^hide_notification_contents ) ] ] diff --git a/lib/mix/tasks/pleroma/refresh_counter_cache.ex b/lib/mix/tasks/pleroma/refresh_counter_cache.ex index 15b4dbfa6..efcbaa3b1 100644 --- a/lib/mix/tasks/pleroma/refresh_counter_cache.ex +++ b/lib/mix/tasks/pleroma/refresh_counter_cache.ex @@ -17,30 +17,53 @@ defmodule Mix.Tasks.Pleroma.RefreshCounterCache do def run([]) do Mix.Pleroma.start_pleroma() - ["public", "unlisted", "private", "direct"] - |> Enum.each(fn visibility -> - count = status_visibility_count_query(visibility) - name = "status_visibility_#{visibility}" - CounterCache.set(name, count) - Mix.Pleroma.shell_info("Set #{name} to #{count}") + instances = + Activity + |> distinct([a], true) + |> select([a], fragment("split_part(?, '/', 3)", a.actor)) + |> Repo.all() + + instances + |> Enum.with_index(1) + |> Enum.each(fn {instance, i} -> + counters = instance_counters(instance) + CounterCache.set(instance, counters) + + Mix.Pleroma.shell_info( + "[#{i}/#{length(instances)}] Setting #{instance} counters: #{inspect(counters)}" + ) end) Mix.Pleroma.shell_info("Done") end - defp status_visibility_count_query(visibility) do + defp instance_counters(instance) do + counters = %{"public" => 0, "unlisted" => 0, "private" => 0, "direct" => 0} + Activity - |> where( + |> where([a], fragment("(? ->> 'type'::text) = 'Create'", a.data)) + |> where([a], fragment("split_part(?, '/', 3) = ?", a.actor, ^instance)) + |> select( + [a], + {fragment( + "activity_visibility(?, ?, ?)", + a.actor, + a.recipients, + a.data + ), count(a.id)} + ) + |> group_by( [a], fragment( - "activity_visibility(?, ?, ?) = ?", + "activity_visibility(?, ?, ?)", a.actor, a.recipients, - a.data, - ^visibility + a.data ) ) - |> where([a], fragment("(? ->> 'type'::text) = 'Create'", a.data)) - |> Repo.aggregate(:count, :id, timeout: :timer.minutes(30)) + |> Repo.all(timeout: :timer.minutes(30)) + |> Enum.reduce(counters, fn {visibility, count}, acc -> + Map.put(acc, visibility, count) + end) end end diff --git a/lib/mix/tasks/pleroma/relay.ex b/lib/mix/tasks/pleroma/relay.ex index c3312507e..a6d8d6c1c 100644 --- a/lib/mix/tasks/pleroma/relay.ex +++ b/lib/mix/tasks/pleroma/relay.ex @@ -35,10 +35,16 @@ def run(["unfollow", target]) do def run(["list"]) do start_pleroma() - with {:ok, list} <- Relay.list(true) do - list |> Enum.each(&shell_info(&1)) + with {:ok, list} <- Relay.list() do + Enum.each(list, &print_relay_url/1) else {:error, e} -> shell_error("Error while fetching relay subscription list: #{inspect(e)}") end end + + defp print_relay_url(%{followed_back: false} = relay) do + shell_info("#{relay.actor} - no Accept received (relay didn't follow back)") + end + + defp print_relay_url(relay), do: shell_info(relay.actor) end diff --git a/lib/mix/tasks/pleroma/user.ex b/lib/mix/tasks/pleroma/user.ex index bca7e87bf..01824aa18 100644 --- a/lib/mix/tasks/pleroma/user.ex +++ b/lib/mix/tasks/pleroma/user.ex @@ -232,7 +232,7 @@ def run(["tag", nickname | tags]) do with %User{} = user <- User.get_cached_by_nickname(nickname) do user = user |> User.tag(tags) - shell_info("Tags of #{user.nickname}: #{inspect(tags)}") + shell_info("Tags of #{user.nickname}: #{inspect(user.tags)}") else _ -> shell_error("Could not change user tags for #{nickname}") @@ -245,7 +245,7 @@ def run(["untag", nickname | tags]) do with %User{} = user <- User.get_cached_by_nickname(nickname) do user = user |> User.untag(tags) - shell_info("Tags of #{user.nickname}: #{inspect(tags)}") + shell_info("Tags of #{user.nickname}: #{inspect(user.tags)}") else _ -> shell_error("Could not change user tags for #{nickname}") diff --git a/lib/pleroma/activity.ex b/lib/pleroma/activity.ex index c3cea8d2a..17af04257 100644 --- a/lib/pleroma/activity.ex +++ b/lib/pleroma/activity.ex @@ -7,7 +7,6 @@ defmodule Pleroma.Activity do alias Pleroma.Activity alias Pleroma.Activity.Queries - alias Pleroma.ActivityExpiration alias Pleroma.Bookmark alias Pleroma.Notification alias Pleroma.Object @@ -60,8 +59,6 @@ defmodule Pleroma.Activity do # typical case. has_one(:object, Object, on_delete: :nothing, foreign_key: :id) - has_one(:expiration, ActivityExpiration, on_delete: :delete_all) - timestamps() end @@ -304,14 +301,14 @@ def all_by_actor_and_id(actor, status_ids) do |> Repo.all() end - def follow_requests_for_actor(%Pleroma.User{ap_id: ap_id}) do + def follow_requests_for_actor(%User{ap_id: ap_id}) do ap_id |> Queries.by_object_id() |> Queries.by_type("Follow") |> where([a], fragment("? ->> 'state' = 'pending'", a.data)) end - def following_requests_for_actor(%Pleroma.User{ap_id: ap_id}) do + def following_requests_for_actor(%User{ap_id: ap_id}) do Queries.by_type("Follow") |> where([a], fragment("?->>'state' = 'pending'", a.data)) |> where([a], a.actor == ^ap_id) @@ -340,4 +337,10 @@ def direct_conversation_id(activity, for_user) do _ -> nil end end + + @spec pinned_by_actor?(Activity.t()) :: boolean() + def pinned_by_actor?(%Activity{} = activity) do + actor = user_actor(activity) + activity.id in actor.pinned_activities + end end diff --git a/lib/pleroma/activity_expiration.ex b/lib/pleroma/activity_expiration.ex deleted file mode 100644 index db9c88d84..000000000 --- a/lib/pleroma/activity_expiration.ex +++ /dev/null @@ -1,67 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.ActivityExpiration do - use Ecto.Schema - - alias Pleroma.Activity - alias Pleroma.ActivityExpiration - alias Pleroma.Repo - - import Ecto.Changeset - import Ecto.Query - - @type t :: %__MODULE__{} - @min_activity_lifetime :timer.hours(1) - - schema "activity_expirations" do - belongs_to(:activity, Activity, type: FlakeId.Ecto.CompatType) - field(:scheduled_at, :naive_datetime) - end - - def changeset(%ActivityExpiration{} = expiration, attrs) do - expiration - |> cast(attrs, [:scheduled_at]) - |> validate_required([:scheduled_at]) - |> validate_scheduled_at() - end - - def get_by_activity_id(activity_id) do - ActivityExpiration - |> where([exp], exp.activity_id == ^activity_id) - |> Repo.one() - end - - def create(%Activity{} = activity, scheduled_at) do - %ActivityExpiration{activity_id: activity.id} - |> changeset(%{scheduled_at: scheduled_at}) - |> Repo.insert() - end - - def due_expirations(offset \\ 0) do - naive_datetime = - NaiveDateTime.utc_now() - |> NaiveDateTime.add(offset, :millisecond) - - ActivityExpiration - |> where([exp], exp.scheduled_at < ^naive_datetime) - |> Repo.all() - end - - def validate_scheduled_at(changeset) do - validate_change(changeset, :scheduled_at, fn _, scheduled_at -> - if not expires_late_enough?(scheduled_at) do - [scheduled_at: "an ephemeral activity must live for at least one hour"] - else - [] - end - end) - end - - def expires_late_enough?(scheduled_at) do - now = NaiveDateTime.utc_now() - diff = NaiveDateTime.diff(scheduled_at, now, :millisecond) - diff > @min_activity_lifetime - end -end diff --git a/lib/pleroma/application.ex b/lib/pleroma/application.ex index 9c74fa00e..cd7a856d0 100644 --- a/lib/pleroma/application.ex +++ b/lib/pleroma/application.ex @@ -22,26 +22,42 @@ def named_version, do: @name <> " " <> @version def repository, do: @repository def user_agent do - case Config.get([:http, :user_agent], :default) do - :default -> - info = "#{Pleroma.Web.base_url()} <#{Config.get([:instance, :email], "")}>" - named_version() <> "; " <> info + if Process.whereis(Pleroma.Web.Endpoint) do + case Config.get([:http, :user_agent], :default) do + :default -> + info = "#{Pleroma.Web.base_url()} <#{Config.get([:instance, :email], "")}>" + named_version() <> "; " <> info - custom -> - custom + custom -> + custom + end + else + # fallback, if endpoint is not started yet + "Pleroma Data Loader" end end # See http://elixir-lang.org/docs/stable/elixir/Application.html # for more information on OTP Applications def start(_type, _args) do - Pleroma.Config.Holder.save_default() + # Scrubbers are compiled at runtime and therefore will cause a conflict + # every time the application is restarted, so we disable module + # conflicts at runtime + Code.compiler_options(ignore_module_conflict: true) + # Disable warnings_as_errors at runtime, it breaks Phoenix live reload + # due to protocol consolidation warnings + Code.compiler_options(warnings_as_errors: false) + Pleroma.Telemetry.Logger.attach() + Config.Holder.save_default() Pleroma.HTML.compile_scrubbers() + Pleroma.Config.Oban.warn() Config.DeprecationWarnings.warn() Pleroma.Plugs.HTTPSecurityPlug.warn_if_disabled() - Pleroma.Repo.check_migrations_applied!() + Pleroma.ApplicationRequirements.verify!() setup_instrumenters() load_custom_modules() + check_system_commands() + Pleroma.Docs.JSON.compile() adapter = Application.get_env(:tesla, :adapter) @@ -149,7 +165,8 @@ defp cachex_children do build_cachex("idempotency", expiration: idempotency_expiration(), limit: 2500), build_cachex("web_resp", limit: 2500), build_cachex("emoji_packs", expiration: emoji_packs_expiration(), limit: 10), - build_cachex("failed_proxy_url", limit: 2500) + build_cachex("failed_proxy_url", limit: 2500), + build_cachex("banned_urls", default_ttl: :timer.hours(24 * 30), limit: 5_000) ] end @@ -162,7 +179,8 @@ defp idempotency_expiration, defp seconds_valid_interval, do: :timer.seconds(Config.get!([Pleroma.Captcha, :seconds_valid])) - defp build_cachex(type, opts), + @spec build_cachex(String.t(), keyword()) :: map() + def build_cachex(type, opts), do: %{ id: String.to_atom("cachex_" <> type), start: {Cachex, :start_link, [String.to_atom(type <> "_cache"), opts]}, @@ -217,9 +235,7 @@ defp task_children(_) do # start hackney and gun pools in tests defp http_children(_, :test) do - hackney_options = Config.get([:hackney_pools, :federation]) - hackney_pool = :hackney_pool.child_spec(:federation, hackney_options) - [hackney_pool, Pleroma.Pool.Supervisor] + http_children(Tesla.Adapter.Hackney, nil) ++ http_children(Tesla.Adapter.Gun, nil) end defp http_children(Tesla.Adapter.Hackney, _) do @@ -238,7 +254,27 @@ defp http_children(Tesla.Adapter.Hackney, _) do end end - defp http_children(Tesla.Adapter.Gun, _), do: [Pleroma.Pool.Supervisor] + defp http_children(Tesla.Adapter.Gun, _) do + Pleroma.Gun.ConnectionPool.children() ++ + [{Task, &Pleroma.HTTP.AdapterHelper.Gun.limiter_setup/0}] + end defp http_children(_, _), do: [] + + defp check_system_commands do + filters = Config.get([Pleroma.Upload, :filters]) + + check_filter = fn filter, command_required -> + with true <- filter in filters, + false <- Pleroma.Utils.command_available?(command_required) do + Logger.error( + "#{filter} is specified in list of Pleroma.Upload filters, but the #{command_required} command is not found" + ) + end + end + + check_filter.(Pleroma.Upload.Filters.Exiftool, "exiftool") + check_filter.(Pleroma.Upload.Filters.Mogrify, "mogrify") + check_filter.(Pleroma.Upload.Filters.Mogrifun, "mogrify") + end end diff --git a/lib/pleroma/application_requirements.ex b/lib/pleroma/application_requirements.ex new file mode 100644 index 000000000..16f62b6f5 --- /dev/null +++ b/lib/pleroma/application_requirements.ex @@ -0,0 +1,143 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.ApplicationRequirements do + @moduledoc """ + The module represents the collection of validations to runs before start server. + """ + + defmodule VerifyError, do: defexception([:message]) + + import Ecto.Query + + require Logger + + @spec verify!() :: :ok | VerifyError.t() + def verify! do + :ok + |> check_confirmation_accounts! + |> check_migrations_applied!() + |> check_welcome_message_config!() + |> check_rum!() + |> handle_result() + end + + defp handle_result(:ok), do: :ok + defp handle_result({:error, message}), do: raise(VerifyError, message: message) + + defp check_welcome_message_config!(:ok) do + if Pleroma.Config.get([:welcome, :email, :enabled], false) and + not Pleroma.Emails.Mailer.enabled?() do + Logger.error(""" + To send welcome email do you need to enable mail. + \nconfig :pleroma, Pleroma.Emails.Mailer, enabled: true + """) + + {:error, "The mail disabled."} + else + :ok + end + end + + defp check_welcome_message_config!(result), do: result + + # Checks account confirmation email + # + def check_confirmation_accounts!(:ok) do + if Pleroma.Config.get([:instance, :account_activation_required]) && + not Pleroma.Config.get([Pleroma.Emails.Mailer, :enabled]) do + Logger.error( + "Account activation enabled, but no Mailer settings enabled.\nPlease set config :pleroma, :instance, account_activation_required: false\nOtherwise setup and enable Mailer." + ) + + {:error, + "Account activation enabled, but Mailer is disabled. Cannot send confirmation emails."} + else + :ok + end + end + + def check_confirmation_accounts!(result), do: result + + # Checks for pending migrations. + # + def check_migrations_applied!(:ok) do + unless Pleroma.Config.get( + [:i_am_aware_this_may_cause_data_loss, :disable_migration_check], + false + ) do + {_, res, _} = + Ecto.Migrator.with_repo(Pleroma.Repo, fn repo -> + down_migrations = + Ecto.Migrator.migrations(repo) + |> Enum.reject(fn + {:up, _, _} -> true + {:down, _, _} -> false + end) + + if length(down_migrations) > 0 do + down_migrations_text = + Enum.map(down_migrations, fn {:down, id, name} -> "- #{name} (#{id})\n" end) + + Logger.error( + "The following migrations were not applied:\n#{down_migrations_text}If you want to start Pleroma anyway, set\nconfig :pleroma, :i_am_aware_this_may_cause_data_loss, disable_migration_check: true" + ) + + {:error, "Unapplied Migrations detected"} + else + :ok + end + end) + + res + else + :ok + end + end + + def check_migrations_applied!(result), do: result + + # Checks for settings of RUM indexes. + # + defp check_rum!(:ok) do + {_, res, _} = + Ecto.Migrator.with_repo(Pleroma.Repo, fn repo -> + migrate = + from(o in "columns", + where: o.table_name == "objects", + where: o.column_name == "fts_content" + ) + |> repo.exists?(prefix: "information_schema") + + setting = Pleroma.Config.get([:database, :rum_enabled], false) + + do_check_rum!(setting, migrate) + end) + + res + end + + defp check_rum!(result), do: result + + defp do_check_rum!(setting, migrate) do + case {setting, migrate} do + {true, false} -> + Logger.error( + "Use `RUM` index is enabled, but were not applied migrations for it.\nIf you want to start Pleroma anyway, set\nconfig :pleroma, :database, rum_enabled: false\nOtherwise apply the following migrations:\n`mix ecto.migrate --migrations-path priv/repo/optional_migrations/rum_indexing/`" + ) + + {:error, "Unapplied RUM Migrations detected"} + + {false, true} -> + Logger.error( + "Detected applied migrations to use `RUM` index, but `RUM` isn't enable in settings.\nIf you want to use `RUM`, set\nconfig :pleroma, :database, rum_enabled: true\nOtherwise roll `RUM` migrations back.\n`mix ecto.rollback --migrations-path priv/repo/optional_migrations/rum_indexing/`" + ) + + {:error, "RUM Migrations detected"} + + _ -> + :ok + end + end +end diff --git a/lib/pleroma/captcha/kocaptcha.ex b/lib/pleroma/captcha/kocaptcha.ex index 6bc2fa158..337506647 100644 --- a/lib/pleroma/captcha/kocaptcha.ex +++ b/lib/pleroma/captcha/kocaptcha.ex @@ -21,7 +21,8 @@ def new do type: :kocaptcha, token: json_resp["token"], url: endpoint <> json_resp["url"], - answer_data: json_resp["md5"] + answer_data: json_resp["md5"], + seconds_valid: Pleroma.Config.get([Pleroma.Captcha, :seconds_valid]) } end end diff --git a/lib/pleroma/captcha/native.ex b/lib/pleroma/captcha/native.ex index a90631d61..8d604d2b2 100644 --- a/lib/pleroma/captcha/native.ex +++ b/lib/pleroma/captcha/native.ex @@ -17,7 +17,8 @@ def new do type: :native, token: token(), url: "data:image/png;base64," <> Base.encode64(img_binary), - answer_data: answer_data + answer_data: answer_data, + seconds_valid: Pleroma.Config.get([Pleroma.Captcha, :seconds_valid]) } end end diff --git a/lib/pleroma/config.ex b/lib/pleroma/config.ex index cc80deff5..97f877595 100644 --- a/lib/pleroma/config.ex +++ b/lib/pleroma/config.ex @@ -11,12 +11,10 @@ def get(key), do: get(key, nil) def get([key], default), do: get(key, default) - def get([parent_key | keys], default) do - case :pleroma - |> Application.get_env(parent_key) - |> get_in(keys) do - nil -> default - any -> any + def get([_ | _] = path, default) do + case fetch(path) do + {:ok, value} -> value + :error -> default end end @@ -34,6 +32,24 @@ def get!(key) do end end + def fetch(key) when is_atom(key), do: fetch([key]) + + def fetch([root_key | keys]) do + Enum.reduce_while(keys, Application.fetch_env(:pleroma, root_key), fn + key, {:ok, config} when is_map(config) or is_list(config) -> + case Access.fetch(config, key) do + :error -> + {:halt, :error} + + value -> + {:cont, value} + end + + _key, _config -> + {:halt, :error} + end) + end + def put([key], value), do: put(key, value) def put([parent_key | keys], value) do @@ -50,18 +66,31 @@ def put(key, value) do def delete([key]), do: delete(key) - def delete([parent_key | keys]) do - {_, parent} = - Application.get_env(:pleroma, parent_key) - |> get_and_update_in(keys, fn _ -> :pop end) + def delete([parent_key | keys] = path) do + with {:ok, _} <- fetch(path) do + {_, parent} = + parent_key + |> get() + |> get_and_update_in(keys, fn _ -> :pop end) - Application.put_env(:pleroma, parent_key, parent) + Application.put_env(:pleroma, parent_key, parent) + end end def delete(key) do Application.delete_env(:pleroma, key) end + def restrict_unauthenticated_access?(resource, kind) do + setting = get([:restrict_unauthenticated, resource, kind]) + + if setting in [nil, :if_instance_is_private] do + !get!([:instance, :public]) + else + setting + end + end + def oauth_consumer_strategies, do: get([:auth, :oauth_consumer_strategies], []) def oauth_consumer_enabled?, do: oauth_consumer_strategies() != [] diff --git a/lib/pleroma/config/config_db.ex b/lib/pleroma/config/config_db.ex index 2b43d4c36..e5b7811aa 100644 --- a/lib/pleroma/config/config_db.ex +++ b/lib/pleroma/config/config_db.ex @@ -6,7 +6,7 @@ defmodule Pleroma.ConfigDB do use Ecto.Schema import Ecto.Changeset - import Ecto.Query + import Ecto.Query, only: [select: 3] import Pleroma.Web.Gettext alias __MODULE__ @@ -14,16 +14,6 @@ defmodule Pleroma.ConfigDB do @type t :: %__MODULE__{} - @full_key_update [ - {:pleroma, :ecto_repos}, - {:quack, :meta}, - {:mime, :types}, - {:cors_plug, [:max_age, :methods, :expose, :headers]}, - {:auto_linker, :opts}, - {:swarm, :node_blacklist}, - {:logger, :backends} - ] - @full_subkey_update [ {:pleroma, :assets, :mascots}, {:pleroma, :emoji, :groups}, @@ -32,14 +22,10 @@ defmodule Pleroma.ConfigDB do {:pleroma, :mrf_keyword, :replace} ] - @regex ~r/^~r(?'delimiter'[\/|"'([{<]{1})(?'pattern'.+)[\/|"')\]}>]{1}(?'modifier'[uismxfU]*)/u - - @delimiters ["/", "|", "\"", "'", {"(", ")"}, {"[", "]"}, {"{", "}"}, {"<", ">"}] - schema "config" do - field(:key, :string) - field(:group, :string) - field(:value, :binary) + field(:key, Pleroma.EctoType.Config.Atom) + field(:group, Pleroma.EctoType.Config.Atom) + field(:value, Pleroma.EctoType.Config.BinaryValue) field(:db, {:array, :string}, virtual: true, default: []) timestamps() @@ -51,10 +37,6 @@ def get_all_as_keyword do |> select([c], {c.group, c.key, c.value}) |> Repo.all() |> Enum.reduce([], fn {group, key, value}, acc -> - group = ConfigDB.from_string(group) - key = ConfigDB.from_string(key) - value = from_binary(value) - Keyword.update(acc, group, [{key, value}], &Keyword.merge(&1, [{key, value}])) end) end @@ -64,50 +46,41 @@ def get_by_params(params), do: Repo.get_by(ConfigDB, params) @spec changeset(ConfigDB.t(), map()) :: Changeset.t() def changeset(config, params \\ %{}) do - params = Map.put(params, :value, transform(params[:value])) - config |> cast(params, [:key, :group, :value]) |> validate_required([:key, :group, :value]) |> unique_constraint(:key, name: :config_group_key_index) end - @spec create(map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()} - def create(params) do + defp create(params) do %ConfigDB{} |> changeset(params) |> Repo.insert() end - @spec update(ConfigDB.t(), map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()} - def update(%ConfigDB{} = config, %{value: value}) do + defp update(%ConfigDB{} = config, %{value: value}) do config |> changeset(%{value: value}) |> Repo.update() end - @spec get_db_keys(ConfigDB.t()) :: [String.t()] - def get_db_keys(%ConfigDB{} = config) do - config.value - |> ConfigDB.from_binary() - |> get_db_keys(config.key) - end - @spec get_db_keys(keyword(), any()) :: [String.t()] def get_db_keys(value, key) do - if Keyword.keyword?(value) do - value |> Keyword.keys() |> Enum.map(&convert(&1)) - else - [convert(key)] - end + keys = + if Keyword.keyword?(value) do + Keyword.keys(value) + else + [key] + end + + Enum.map(keys, &to_json_types(&1)) end @spec merge_group(atom(), atom(), keyword(), keyword()) :: keyword() def merge_group(group, key, old_value, new_value) do - new_keys = to_map_set(new_value) + new_keys = to_mapset(new_value) - intersect_keys = - old_value |> to_map_set() |> MapSet.intersection(new_keys) |> MapSet.to_list() + intersect_keys = old_value |> to_mapset() |> MapSet.intersection(new_keys) |> MapSet.to_list() merged_value = ConfigDB.merge(old_value, new_value) @@ -120,12 +93,10 @@ def merge_group(group, key, old_value, new_value) do [] end) |> List.flatten() - |> Enum.reduce(merged_value, fn subkey, acc -> - Keyword.put(acc, subkey, new_value[subkey]) - end) + |> Enum.reduce(merged_value, &Keyword.put(&2, &1, new_value[&1])) end - defp to_map_set(keyword) do + defp to_mapset(keyword) do keyword |> Keyword.keys() |> MapSet.new() @@ -159,57 +130,54 @@ defp deep_merge(_key, value1, value2) do @spec update_or_create(map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()} def update_or_create(params) do + params = Map.put(params, :value, to_elixir_types(params[:value])) search_opts = Map.take(params, [:group, :key]) with %ConfigDB{} = config <- ConfigDB.get_by_params(search_opts), - {:partial_update, true, config} <- - {:partial_update, can_be_partially_updated?(config), config}, - old_value <- from_binary(config.value), - transformed_value <- do_transform(params[:value]), - {:can_be_merged, true, config} <- {:can_be_merged, is_list(transformed_value), config}, - new_value <- - merge_group( - ConfigDB.from_string(config.group), - ConfigDB.from_string(config.key), - old_value, - transformed_value - ) do - ConfigDB.update(config, %{value: new_value}) + {_, true, config} <- {:partial_update, can_be_partially_updated?(config), config}, + {_, true, config} <- + {:can_be_merged, is_list(params[:value]) and is_list(config.value), config} do + new_value = merge_group(config.group, config.key, config.value, params[:value]) + update(config, %{value: new_value}) else {reason, false, config} when reason in [:partial_update, :can_be_merged] -> - ConfigDB.update(config, params) + update(config, params) nil -> - ConfigDB.create(params) + create(params) end end defp can_be_partially_updated?(%ConfigDB{} = config), do: not only_full_update?(config) - defp only_full_update?(%ConfigDB{} = config) do - config_group = ConfigDB.from_string(config.group) - config_key = ConfigDB.from_string(config.key) + defp only_full_update?(%ConfigDB{group: group, key: key}) do + full_key_update = [ + {:pleroma, :ecto_repos}, + {:quack, :meta}, + {:mime, :types}, + {:cors_plug, [:max_age, :methods, :expose, :headers]}, + {:swarm, :node_blacklist}, + {:logger, :backends} + ] - Enum.any?(@full_key_update, fn - {group, key} when is_list(key) -> - config_group == group and config_key in key - - {group, key} -> - config_group == group and config_key == key + Enum.any?(full_key_update, fn + {s_group, s_key} -> + group == s_group and ((is_list(s_key) and key in s_key) or key == s_key) end) end - @spec delete(map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()} + @spec delete(ConfigDB.t() | map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()} + def delete(%ConfigDB{} = config), do: Repo.delete(config) + def delete(params) do search_opts = Map.delete(params, :subkeys) with %ConfigDB{} = config <- ConfigDB.get_by_params(search_opts), {config, sub_keys} when is_list(sub_keys) <- {config, params[:subkeys]}, - old_value <- from_binary(config.value), - keys <- Enum.map(sub_keys, &do_transform_string(&1)), - {:partial_remove, config, new_value} when new_value != [] <- - {:partial_remove, config, Keyword.drop(old_value, keys)} do - ConfigDB.update(config, %{value: new_value}) + keys <- Enum.map(sub_keys, &string_to_elixir_types(&1)), + {_, config, new_value} when new_value != [] <- + {:partial_remove, config, Keyword.drop(config.value, keys)} do + update(config, %{value: new_value}) else {:partial_remove, config, []} -> Repo.delete(config) @@ -225,37 +193,32 @@ def delete(params) do end end - @spec from_binary(binary()) :: term() - def from_binary(binary), do: :erlang.binary_to_term(binary) - - @spec from_binary_with_convert(binary()) :: any() - def from_binary_with_convert(binary) do - binary - |> from_binary() - |> do_convert() + @spec to_json_types(term()) :: map() | list() | boolean() | String.t() + def to_json_types(entity) when is_list(entity) do + Enum.map(entity, &to_json_types/1) end - @spec from_string(String.t()) :: atom() | no_return() - def from_string(string), do: do_transform_string(string) + def to_json_types(%Regex{} = entity), do: inspect(entity) - @spec convert(any()) :: any() - def convert(entity), do: do_convert(entity) - - defp do_convert(entity) when is_list(entity) do - for v <- entity, into: [], do: do_convert(v) + def to_json_types(entity) when is_map(entity) do + Map.new(entity, fn {k, v} -> {to_json_types(k), to_json_types(v)} end) end - defp do_convert(%Regex{} = entity), do: inspect(entity) + def to_json_types({:args, args}) when is_list(args) do + arguments = + Enum.map(args, fn + arg when is_tuple(arg) -> inspect(arg) + arg -> to_json_types(arg) + end) - defp do_convert(entity) when is_map(entity) do - for {k, v} <- entity, into: %{}, do: {do_convert(k), do_convert(v)} + %{"tuple" => [":args", arguments]} end - defp do_convert({:proxy_url, {type, :localhost, port}}) do - %{"tuple" => [":proxy_url", %{"tuple" => [do_convert(type), "localhost", port]}]} + def to_json_types({:proxy_url, {type, :localhost, port}}) do + %{"tuple" => [":proxy_url", %{"tuple" => [to_json_types(type), "localhost", port]}]} end - defp do_convert({:proxy_url, {type, host, port}}) when is_tuple(host) do + def to_json_types({:proxy_url, {type, host, port}}) when is_tuple(host) do ip = host |> :inet_parse.ntoa() @@ -264,66 +227,64 @@ defp do_convert({:proxy_url, {type, host, port}}) when is_tuple(host) do %{ "tuple" => [ ":proxy_url", - %{"tuple" => [do_convert(type), ip, port]} + %{"tuple" => [to_json_types(type), ip, port]} ] } end - defp do_convert({:proxy_url, {type, host, port}}) do + def to_json_types({:proxy_url, {type, host, port}}) do %{ "tuple" => [ ":proxy_url", - %{"tuple" => [do_convert(type), to_string(host), port]} + %{"tuple" => [to_json_types(type), to_string(host), port]} ] } end - defp do_convert({:partial_chain, entity}), do: %{"tuple" => [":partial_chain", inspect(entity)]} + def to_json_types({:partial_chain, entity}), + do: %{"tuple" => [":partial_chain", inspect(entity)]} - defp do_convert(entity) when is_tuple(entity) do + def to_json_types(entity) when is_tuple(entity) do value = entity |> Tuple.to_list() - |> do_convert() + |> to_json_types() %{"tuple" => value} end - defp do_convert(entity) when is_boolean(entity) or is_number(entity) or is_nil(entity) do + def to_json_types(entity) when is_binary(entity), do: entity + + def to_json_types(entity) when is_boolean(entity) or is_number(entity) or is_nil(entity) do entity end - defp do_convert(entity) - when is_atom(entity) and entity in [:"tlsv1.1", :"tlsv1.2", :"tlsv1.3"] do + def to_json_types(entity) when entity in [:"tlsv1.1", :"tlsv1.2", :"tlsv1.3"] do ":#{entity}" end - defp do_convert(entity) when is_atom(entity), do: inspect(entity) + def to_json_types(entity) when is_atom(entity), do: inspect(entity) - defp do_convert(entity) when is_binary(entity), do: entity + @spec to_elixir_types(boolean() | String.t() | map() | list()) :: term() + def to_elixir_types(%{"tuple" => [":args", args]}) when is_list(args) do + arguments = + Enum.map(args, fn arg -> + if String.contains?(arg, ["{", "}"]) do + {elem, []} = Code.eval_string(arg) + elem + else + to_elixir_types(arg) + end + end) - @spec transform(any()) :: binary() | no_return() - def transform(entity) when is_binary(entity) or is_map(entity) or is_list(entity) do - entity - |> do_transform() - |> to_binary() + {:args, arguments} end - def transform(entity), do: to_binary(entity) - - @spec transform_with_out_binary(any()) :: any() - def transform_with_out_binary(entity), do: do_transform(entity) - - @spec to_binary(any()) :: binary() - def to_binary(entity), do: :erlang.term_to_binary(entity) - - defp do_transform(%Regex{} = entity), do: entity - - defp do_transform(%{"tuple" => [":proxy_url", %{"tuple" => [type, host, port]}]}) do - {:proxy_url, {do_transform_string(type), parse_host(host), port}} + def to_elixir_types(%{"tuple" => [":proxy_url", %{"tuple" => [type, host, port]}]}) do + {:proxy_url, {string_to_elixir_types(type), parse_host(host), port}} end - defp do_transform(%{"tuple" => [":partial_chain", entity]}) do + def to_elixir_types(%{"tuple" => [":partial_chain", entity]}) do {partial_chain, []} = entity |> String.replace(~r/[^\w|^{:,[|^,|^[|^\]^}|^\/|^\.|^"]^\s/, "") @@ -332,25 +293,51 @@ defp do_transform(%{"tuple" => [":partial_chain", entity]}) do {:partial_chain, partial_chain} end - defp do_transform(%{"tuple" => entity}) do - Enum.reduce(entity, {}, fn val, acc -> Tuple.append(acc, do_transform(val)) end) + def to_elixir_types(%{"tuple" => entity}) do + Enum.reduce(entity, {}, &Tuple.append(&2, to_elixir_types(&1))) end - defp do_transform(entity) when is_map(entity) do - for {k, v} <- entity, into: %{}, do: {do_transform(k), do_transform(v)} + def to_elixir_types(entity) when is_map(entity) do + Map.new(entity, fn {k, v} -> {to_elixir_types(k), to_elixir_types(v)} end) end - defp do_transform(entity) when is_list(entity) do - for v <- entity, into: [], do: do_transform(v) + def to_elixir_types(entity) when is_list(entity) do + Enum.map(entity, &to_elixir_types/1) end - defp do_transform(entity) when is_binary(entity) do + def to_elixir_types(entity) when is_binary(entity) do entity |> String.trim() - |> do_transform_string() + |> string_to_elixir_types() end - defp do_transform(entity), do: entity + def to_elixir_types(entity), do: entity + + @spec string_to_elixir_types(String.t()) :: + atom() | Regex.t() | module() | String.t() | no_return() + def string_to_elixir_types("~r" <> _pattern = regex) do + pattern = + ~r/^~r(?'delimiter'[\/|"'([{<]{1})(?'pattern'.+)[\/|"')\]}>]{1}(?'modifier'[uismxfU]*)/u + + delimiters = ["/", "|", "\"", "'", {"(", ")"}, {"[", "]"}, {"{", "}"}, {"<", ">"}] + + with %{"modifier" => modifier, "pattern" => pattern, "delimiter" => regex_delimiter} <- + Regex.named_captures(pattern, regex), + {:ok, {leading, closing}} <- find_valid_delimiter(delimiters, pattern, regex_delimiter), + {result, _} <- Code.eval_string("~r#{leading}#{pattern}#{closing}#{modifier}") do + result + end + end + + def string_to_elixir_types(":" <> atom), do: String.to_atom(atom) + + def string_to_elixir_types(value) do + if module_name?(value) do + String.to_existing_atom("Elixir." <> value) + else + value + end + end defp parse_host("localhost"), do: :localhost @@ -387,27 +374,8 @@ defp find_valid_delimiter([delimiter | others], pattern, regex_delimiter) do end end - defp do_transform_string("~r" <> _pattern = regex) do - with %{"modifier" => modifier, "pattern" => pattern, "delimiter" => regex_delimiter} <- - Regex.named_captures(@regex, regex), - {:ok, {leading, closing}} <- find_valid_delimiter(@delimiters, pattern, regex_delimiter), - {result, _} <- Code.eval_string("~r#{leading}#{pattern}#{closing}#{modifier}") do - result - end - end - - defp do_transform_string(":" <> atom), do: String.to_atom(atom) - - defp do_transform_string(value) do - if is_module_name?(value) do - String.to_existing_atom("Elixir." <> value) - else - value - end - end - - @spec is_module_name?(String.t()) :: boolean() - def is_module_name?(string) do + @spec module_name?(String.t()) :: boolean() + def module_name?(string) do Regex.match?(~r/^(Pleroma|Phoenix|Tesla|Quack|Ueberauth|Swoosh)\./, string) or string in ["Oban", "Ueberauth", "ExSyslogger"] end diff --git a/lib/pleroma/config/deprecation_warnings.ex b/lib/pleroma/config/deprecation_warnings.ex index b68ded01f..412d55a77 100644 --- a/lib/pleroma/config/deprecation_warnings.ex +++ b/lib/pleroma/config/deprecation_warnings.ex @@ -3,9 +3,23 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Config.DeprecationWarnings do + alias Pleroma.Config + require Logger alias Pleroma.Config + @type config_namespace() :: atom() | [atom()] + @type config_map() :: {config_namespace(), config_namespace(), String.t()} + + @mrf_config_map [ + {[:instance, :rewrite_policy], [:mrf, :policies], + "\n* `config :pleroma, :instance, rewrite_policy` is now `config :pleroma, :mrf, policies`"}, + {[:instance, :mrf_transparency], [:mrf, :transparency], + "\n* `config :pleroma, :instance, mrf_transparency` is now `config :pleroma, :mrf, transparency`"}, + {[:instance, :mrf_transparency_exclusions], [:mrf, :transparency_exclusions], + "\n* `config :pleroma, :instance, mrf_transparency_exclusions` is now `config :pleroma, :mrf, transparency_exclusions`"} + ] + def check_hellthread_threshold do if Config.get([:mrf_hellthread, :threshold]) do Logger.warn(""" @@ -39,5 +53,126 @@ def mrf_user_allowlist do def warn do check_hellthread_threshold() mrf_user_allowlist() + check_old_mrf_config() + check_media_proxy_whitelist_config() + check_welcome_message_config() + check_gun_pool_options() + check_activity_expiration_config() + end + + def check_welcome_message_config do + instance_config = Pleroma.Config.get([:instance]) + + use_old_config = + Keyword.has_key?(instance_config, :welcome_user_nickname) or + Keyword.has_key?(instance_config, :welcome_message) + + if use_old_config do + Logger.error(""" + !!!DEPRECATION WARNING!!! + Your config is using the old namespace for Welcome messages configuration. You need to change to the new namespace: + \n* `config :pleroma, :instance, welcome_user_nickname` is now `config :pleroma, :welcome, :direct_message, :sender_nickname` + \n* `config :pleroma, :instance, welcome_message` is now `config :pleroma, :welcome, :direct_message, :message` + """) + end + end + + def check_old_mrf_config do + warning_preface = """ + !!!DEPRECATION WARNING!!! + Your config is using old namespaces for MRF configuration. They should work for now, but you are advised to change to new namespaces to prevent possible issues later: + """ + + move_namespace_and_warn(@mrf_config_map, warning_preface) + end + + @spec move_namespace_and_warn([config_map()], String.t()) :: :ok | nil + def move_namespace_and_warn(config_map, warning_preface) do + warning = + Enum.reduce(config_map, "", fn + {old, new, err_msg}, acc -> + old_config = Config.get(old) + + if old_config do + Config.put(new, old_config) + acc <> err_msg + else + acc + end + end) + + if warning != "" do + Logger.warn(warning_preface <> warning) + end + end + + @spec check_media_proxy_whitelist_config() :: :ok | nil + def check_media_proxy_whitelist_config do + whitelist = Config.get([:media_proxy, :whitelist]) + + if Enum.any?(whitelist, &(not String.starts_with?(&1, "http"))) do + Logger.warn(""" + !!!DEPRECATION WARNING!!! + Your config is using old format (only domain) for MediaProxy whitelist option. Setting should work for now, but you are advised to change format to scheme with port to prevent possible issues later. + """) + end + end + + def check_gun_pool_options do + pool_config = Config.get(:connections_pool) + + if timeout = pool_config[:await_up_timeout] do + Logger.warn(""" + !!!DEPRECATION WARNING!!! + Your config is using old setting name `await_up_timeout` instead of `connect_timeout`. Setting should work for now, but you are advised to change format to scheme with port to prevent possible issues later. + """) + + Config.put(:connections_pool, Keyword.put_new(pool_config, :connect_timeout, timeout)) + end + + pools_configs = Config.get(:pools) + + warning_preface = """ + !!!DEPRECATION WARNING!!! + Your config is using old setting name `timeout` instead of `recv_timeout` in pool settings. Setting should work for now, but you are advised to change format to scheme with port to prevent possible issues later. + """ + + updated_config = + Enum.reduce(pools_configs, [], fn {pool_name, config}, acc -> + if timeout = config[:timeout] do + Keyword.put(acc, pool_name, Keyword.put_new(config, :recv_timeout, timeout)) + else + acc + end + end) + + if updated_config != [] do + pool_warnings = + updated_config + |> Keyword.keys() + |> Enum.map(fn pool_name -> + "\n* `:timeout` options in #{pool_name} pool is now `:recv_timeout`" + end) + + Logger.warn(Enum.join([warning_preface | pool_warnings])) + + Config.put(:pools, updated_config) + end + end + + @spec check_activity_expiration_config() :: :ok | nil + def check_activity_expiration_config do + warning_preface = """ + !!!DEPRECATION WARNING!!! + Your config is using old namespace for activity expiration configuration. Setting should work for now, but you are advised to change to new namespace to prevent possible issues later: + """ + + move_namespace_and_warn( + [ + {Pleroma.ActivityExpiration, Pleroma.Workers.PurgeExpiredActivity, + "\n* `config :pleroma, Pleroma.ActivityExpiration` is now `config :pleroma, Pleroma.Workers.PurgeExpiredActivity`"} + ], + warning_preface + ) end end diff --git a/lib/pleroma/config/helpers.ex b/lib/pleroma/config/helpers.ex new file mode 100644 index 000000000..3dce40ea0 --- /dev/null +++ b/lib/pleroma/config/helpers.ex @@ -0,0 +1,17 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Config.Helpers do + alias Pleroma.Config + + def instance_name, do: Config.get([:instance, :name]) + + defp instance_notify_email do + Config.get([:instance, :notify_email]) || Config.get([:instance, :email]) + end + + def sender do + {instance_name(), instance_notify_email()} + end +end diff --git a/lib/pleroma/config/loader.ex b/lib/pleroma/config/loader.ex index 0f3ecf1ed..64e7de6df 100644 --- a/lib/pleroma/config/loader.ex +++ b/lib/pleroma/config/loader.ex @@ -12,6 +12,11 @@ defmodule Pleroma.Config.Loader do :swarm ] + @reject_groups [ + :postgrex, + :tesla + ] + if Code.ensure_loaded?(Config.Reader) do @reader Config.Reader @@ -47,7 +52,8 @@ defp filter(configs) do @spec filter_group(atom(), keyword()) :: keyword() def filter_group(group, configs) do Enum.reject(configs[group], fn {key, _v} -> - key in @reject_keys or (group == :phoenix and key == :serve_endpoints) or group == :postgrex + key in @reject_keys or group in @reject_groups or + (group == :phoenix and key == :serve_endpoints) end) end end diff --git a/lib/pleroma/config/oban.ex b/lib/pleroma/config/oban.ex new file mode 100644 index 000000000..9f601b1a3 --- /dev/null +++ b/lib/pleroma/config/oban.ex @@ -0,0 +1,34 @@ +defmodule Pleroma.Config.Oban do + require Logger + + def warn do + oban_config = Pleroma.Config.get(Oban) + + crontab = + [ + Pleroma.Workers.Cron.StatsWorker, + Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker, + Pleroma.Workers.Cron.ClearOauthTokenWorker + ] + |> Enum.reduce(oban_config[:crontab], fn removed_worker, acc -> + with acc when is_list(acc) <- acc, + setting when is_tuple(setting) <- + Enum.find(acc, fn {_, worker} -> worker == removed_worker end) do + """ + !!!OBAN CONFIG WARNING!!! + You are using old workers in Oban crontab settings, which were removed. + Please, remove setting from crontab in your config file (prod.secret.exs): #{ + inspect(setting) + } + """ + |> Logger.warn() + + List.delete(acc, setting) + else + _ -> acc + end + end) + + Pleroma.Config.put(Oban, Keyword.put(oban_config, :crontab, crontab)) + end +end diff --git a/lib/pleroma/config/transfer_task.ex b/lib/pleroma/config/transfer_task.ex index c02b70e96..a0d7b7d71 100644 --- a/lib/pleroma/config/transfer_task.ex +++ b/lib/pleroma/config/transfer_task.ex @@ -28,15 +28,11 @@ defmodule Pleroma.Config.TransferTask do {:pleroma, Pleroma.Captcha, [:seconds_valid]}, {:pleroma, Pleroma.Upload, [:proxy_remote]}, {:pleroma, :instance, [:upload_limit]}, - {:pleroma, :email_notifications, [:digest]}, - {:pleroma, :oauth2, [:clean_expired_tokens]}, - {:pleroma, Pleroma.ActivityExpiration, [:enabled]}, - {:pleroma, Pleroma.ScheduledActivity, [:enabled]}, {:pleroma, :gopher, [:enabled]} ] - def start_link(_) do - load_and_update_env() + def start_link(restart_pleroma? \\ true) do + load_and_update_env([], restart_pleroma?) if Config.get(:env) == :test, do: Ecto.Adapters.SQL.Sandbox.checkin(Repo) :ignore end @@ -48,7 +44,7 @@ def load_and_update_env(deleted_settings \\ [], restart_pleroma? \\ true) do {logger, other} = (Repo.all(ConfigDB) ++ deleted_settings) - |> Enum.map(&transform_and_merge/1) + |> Enum.map(&merge_with_default/1) |> Enum.split_with(fn {group, _, _, _} -> group in [:logger, :quack] end) logger @@ -92,11 +88,7 @@ defp maybe_set_pleroma_last(apps) do end end - defp transform_and_merge(%{group: group, key: key, value: value} = setting) do - group = ConfigDB.from_string(group) - key = ConfigDB.from_string(key) - value = ConfigDB.from_binary(value) - + defp merge_with_default(%{group: group, key: key, value: value} = setting) do default = Config.Holder.default_config(group, key) merged = diff --git a/lib/pleroma/conversation/participation.ex b/lib/pleroma/conversation/participation.ex index ce7bd2396..8bc3e85d6 100644 --- a/lib/pleroma/conversation/participation.ex +++ b/lib/pleroma/conversation/participation.ex @@ -162,10 +162,13 @@ def for_user_with_last_activity_id(user, params \\ %{}) do for_user(user, params) |> Enum.map(fn participation -> activity_id = - ActivityPub.fetch_latest_activity_id_for_context(participation.conversation.ap_id, %{ - user: user, - blocking_user: user - }) + ActivityPub.fetch_latest_direct_activity_id_for_context( + participation.conversation.ap_id, + %{ + user: user, + blocking_user: user + } + ) %{ participation diff --git a/lib/pleroma/counter_cache.ex b/lib/pleroma/counter_cache.ex index 4d348a413..ebd1f603d 100644 --- a/lib/pleroma/counter_cache.ex +++ b/lib/pleroma/counter_cache.ex @@ -10,32 +10,70 @@ defmodule Pleroma.CounterCache do import Ecto.Query schema "counter_cache" do - field(:name, :string) - field(:count, :integer) + field(:instance, :string) + field(:public, :integer) + field(:unlisted, :integer) + field(:private, :integer) + field(:direct, :integer) end def changeset(struct, params) do struct - |> cast(params, [:name, :count]) - |> validate_required([:name]) - |> unique_constraint(:name) + |> cast(params, [:instance, :public, :unlisted, :private, :direct]) + |> validate_required([:instance]) + |> unique_constraint(:instance) end - def get_as_map(names) when is_list(names) do + def get_by_instance(instance) do CounterCache - |> where([cc], cc.name in ^names) - |> Repo.all() - |> Enum.group_by(& &1.name, & &1.count) - |> Map.new(fn {k, v} -> {k, hd(v)} end) + |> select([c], %{ + "public" => c.public, + "unlisted" => c.unlisted, + "private" => c.private, + "direct" => c.direct + }) + |> where([c], c.instance == ^instance) + |> Repo.one() + |> case do + nil -> %{"public" => 0, "unlisted" => 0, "private" => 0, "direct" => 0} + val -> val + end end - def set(name, count) do + def get_sum do + CounterCache + |> select([c], %{ + "public" => type(sum(c.public), :integer), + "unlisted" => type(sum(c.unlisted), :integer), + "private" => type(sum(c.private), :integer), + "direct" => type(sum(c.direct), :integer) + }) + |> Repo.one() + end + + def set(instance, values) do + params = + Enum.reduce( + ["public", "private", "unlisted", "direct"], + %{"instance" => instance}, + fn param, acc -> + Map.put_new(acc, param, Map.get(values, param, 0)) + end + ) + %CounterCache{} - |> changeset(%{"name" => name, "count" => count}) + |> changeset(params) |> Repo.insert( - on_conflict: [set: [count: count]], + on_conflict: [ + set: [ + public: params["public"], + private: params["private"], + unlisted: params["unlisted"], + direct: params["direct"] + ] + ], returning: true, - conflict_target: :name + conflict_target: :instance ) end end diff --git a/lib/pleroma/docs/generator.ex b/lib/pleroma/docs/generator.ex index e0fc8cd02..a671a6278 100644 --- a/lib/pleroma/docs/generator.ex +++ b/lib/pleroma/docs/generator.ex @@ -6,16 +6,21 @@ def process(implementation, descriptions) do implementation.process(descriptions) end - @spec list_modules_in_dir(String.t(), String.t()) :: [module()] - def list_modules_in_dir(dir, start) do - with {:ok, files} <- File.ls(dir) do - files - |> Enum.filter(&String.ends_with?(&1, ".ex")) - |> Enum.map(fn filename -> - module = filename |> String.trim_trailing(".ex") |> Macro.camelize() - String.to_atom(start <> module) - end) - end + @spec list_behaviour_implementations(behaviour :: module()) :: [module()] + def list_behaviour_implementations(behaviour) do + :code.all_loaded() + |> Enum.filter(fn {module, _} -> + # This shouldn't be needed as all modules are expected to have module_info/1, + # but in test enviroments some transient modules `:elixir_compiler_XX` + # are loaded for some reason (where XX is a random integer). + if function_exported?(module, :module_info, 1) do + module.module_info(:attributes) + |> Keyword.get_values(:behaviour) + |> List.flatten() + |> Enum.member?(behaviour) + end + end) + |> Enum.map(fn {module, _} -> module end) end @doc """ @@ -87,6 +92,12 @@ defp humanize(entity) do else: string end + defp format_suggestions({:list_behaviour_implementations, behaviour}) do + behaviour + |> list_behaviour_implementations() + |> format_suggestions() + end + defp format_suggestions([]), do: [] defp format_suggestions([suggestion | tail]) do diff --git a/lib/pleroma/docs/json.ex b/lib/pleroma/docs/json.ex index d1cf1f487..feeb4320e 100644 --- a/lib/pleroma/docs/json.ex +++ b/lib/pleroma/docs/json.ex @@ -1,5 +1,19 @@ defmodule Pleroma.Docs.JSON do @behaviour Pleroma.Docs.Generator + @external_resource "config/description.exs" + @raw_config Pleroma.Config.Loader.read("config/description.exs") + @raw_descriptions @raw_config[:pleroma][:config_description] + @term __MODULE__.Compiled + + @spec compile :: :ok + def compile do + :persistent_term.put(@term, Pleroma.Docs.Generator.convert_to_strings(@raw_descriptions)) + end + + @spec compiled_descriptions :: Map.t() + def compiled_descriptions do + :persistent_term.get(@term) + end @spec process(keyword()) :: {:ok, String.t()} def process(descriptions) do @@ -13,11 +27,4 @@ def process(descriptions) do {:ok, path} end end - - def compile do - with config <- Pleroma.Config.Loader.read("config/description.exs") do - config[:pleroma][:config_description] - |> Pleroma.Docs.Generator.convert_to_strings() - end - end end diff --git a/lib/pleroma/docs/markdown.ex b/lib/pleroma/docs/markdown.ex index 68b106499..da3f20f43 100644 --- a/lib/pleroma/docs/markdown.ex +++ b/lib/pleroma/docs/markdown.ex @@ -68,6 +68,11 @@ defp print_suggestion(file, suggestion, as_list \\ false) do IO.write(file, " #{list_mark}`#{inspect(suggestion)}`\n") end + defp print_suggestions(file, {:list_behaviour_implementations, behaviour}) do + suggestions = Pleroma.Docs.Generator.list_behaviour_implementations(behaviour) + print_suggestions(file, suggestions) + end + defp print_suggestions(_file, nil), do: nil defp print_suggestions(_file, ""), do: nil diff --git a/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex b/lib/pleroma/ecto_type/activity_pub/object_validators/date_time.ex similarity index 77% rename from lib/pleroma/web/activity_pub/object_validators/types/date_time.ex rename to lib/pleroma/ecto_type/activity_pub/object_validators/date_time.ex index 4f412fcde..d852c0abd 100644 --- a/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex +++ b/lib/pleroma/ecto_type/activity_pub/object_validators/date_time.ex @@ -1,4 +1,8 @@ -defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.DateTime do +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.EctoType.ActivityPub.ObjectValidators.DateTime do @moduledoc """ The AP standard defines the date fields in AP as xsd:DateTime. Elixir's DateTime can't parse this, but it can parse the related iso8601. This diff --git a/lib/pleroma/ecto_type/activity_pub/object_validators/emoji.ex b/lib/pleroma/ecto_type/activity_pub/object_validators/emoji.ex new file mode 100644 index 000000000..4aacc5c88 --- /dev/null +++ b/lib/pleroma/ecto_type/activity_pub/object_validators/emoji.ex @@ -0,0 +1,34 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.EctoType.ActivityPub.ObjectValidators.Emoji do + use Ecto.Type + + def type, do: :map + + def cast(data) when is_map(data) do + has_invalid_emoji? = + Enum.find(data, fn + {name, uri} when is_binary(name) and is_binary(uri) -> + # based on ObjectValidators.Uri.cast() + case URI.parse(uri) do + %URI{host: nil} -> true + %URI{host: ""} -> true + %URI{scheme: scheme} when scheme in ["https", "http"] -> false + _ -> true + end + + {_name, _uri} -> + true + end) + + if has_invalid_emoji?, do: :error, else: {:ok, data} + end + + def cast(_data), do: :error + + def dump(data), do: {:ok, data} + + def load(data), do: {:ok, data} +end diff --git a/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex b/lib/pleroma/ecto_type/activity_pub/object_validators/object_id.ex similarity index 69% rename from lib/pleroma/web/activity_pub/object_validators/types/object_id.ex rename to lib/pleroma/ecto_type/activity_pub/object_validators/object_id.ex index f71f76370..8034235b0 100644 --- a/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex +++ b/lib/pleroma/ecto_type/activity_pub/object_validators/object_id.ex @@ -1,4 +1,8 @@ -defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID do +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.EctoType.ActivityPub.ObjectValidators.ObjectID do use Ecto.Type def type, do: :string diff --git a/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex b/lib/pleroma/ecto_type/activity_pub/object_validators/recipients.ex similarity index 64% rename from lib/pleroma/web/activity_pub/object_validators/types/recipients.ex rename to lib/pleroma/ecto_type/activity_pub/object_validators/recipients.ex index 408e0f6ee..205527a96 100644 --- a/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex +++ b/lib/pleroma/ecto_type/activity_pub/object_validators/recipients.ex @@ -1,7 +1,11 @@ -defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.Recipients do +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.EctoType.ActivityPub.ObjectValidators.Recipients do use Ecto.Type - alias Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID + alias Pleroma.EctoType.ActivityPub.ObjectValidators.ObjectID def type, do: {:array, ObjectID} diff --git a/lib/pleroma/web/activity_pub/object_validators/types/safe_text.ex b/lib/pleroma/ecto_type/activity_pub/object_validators/safe_text.ex similarity index 85% rename from lib/pleroma/web/activity_pub/object_validators/types/safe_text.ex rename to lib/pleroma/ecto_type/activity_pub/object_validators/safe_text.ex index 95c948123..7f0405c7b 100644 --- a/lib/pleroma/web/activity_pub/object_validators/types/safe_text.ex +++ b/lib/pleroma/ecto_type/activity_pub/object_validators/safe_text.ex @@ -2,7 +2,7 @@ # Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only -defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.SafeText do +defmodule Pleroma.EctoType.ActivityPub.ObjectValidators.SafeText do use Ecto.Type alias Pleroma.HTML diff --git a/lib/pleroma/web/activity_pub/object_validators/types/uri.ex b/lib/pleroma/ecto_type/activity_pub/object_validators/uri.ex similarity index 63% rename from lib/pleroma/web/activity_pub/object_validators/types/uri.ex rename to lib/pleroma/ecto_type/activity_pub/object_validators/uri.ex index 24845bcc0..2054c26be 100644 --- a/lib/pleroma/web/activity_pub/object_validators/types/uri.ex +++ b/lib/pleroma/ecto_type/activity_pub/object_validators/uri.ex @@ -1,4 +1,8 @@ -defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.Uri do +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.EctoType.ActivityPub.ObjectValidators.Uri do use Ecto.Type def type, do: :string diff --git a/lib/pleroma/ecto_type/config/atom.ex b/lib/pleroma/ecto_type/config/atom.ex new file mode 100644 index 000000000..df565d432 --- /dev/null +++ b/lib/pleroma/ecto_type/config/atom.ex @@ -0,0 +1,26 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.EctoType.Config.Atom do + use Ecto.Type + + def type, do: :atom + + def cast(key) when is_atom(key) do + {:ok, key} + end + + def cast(key) when is_binary(key) do + {:ok, Pleroma.ConfigDB.string_to_elixir_types(key)} + end + + def cast(_), do: :error + + def load(key) do + {:ok, Pleroma.ConfigDB.string_to_elixir_types(key)} + end + + def dump(key) when is_atom(key), do: {:ok, inspect(key)} + def dump(_), do: :error +end diff --git a/lib/pleroma/ecto_type/config/binary_value.ex b/lib/pleroma/ecto_type/config/binary_value.ex new file mode 100644 index 000000000..bbd2608c5 --- /dev/null +++ b/lib/pleroma/ecto_type/config/binary_value.ex @@ -0,0 +1,27 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.EctoType.Config.BinaryValue do + use Ecto.Type + + def type, do: :term + + def cast(value) when is_binary(value) do + if String.valid?(value) do + {:ok, value} + else + {:ok, :erlang.binary_to_term(value)} + end + end + + def cast(value), do: {:ok, value} + + def load(value) when is_binary(value) do + {:ok, :erlang.binary_to_term(value)} + end + + def dump(value) do + {:ok, :erlang.term_to_binary(value)} + end +end diff --git a/lib/pleroma/emails/admin_email.ex b/lib/pleroma/emails/admin_email.ex index 55f61024e..c27ad1065 100644 --- a/lib/pleroma/emails/admin_email.ex +++ b/lib/pleroma/emails/admin_email.ex @@ -8,9 +8,10 @@ defmodule Pleroma.Emails.AdminEmail do import Swoosh.Email alias Pleroma.Config + alias Pleroma.HTML alias Pleroma.Web.Router.Helpers - defp instance_config, do: Pleroma.Config.get(:instance) + defp instance_config, do: Config.get(:instance) defp instance_name, do: instance_config()[:name] defp instance_notify_email do @@ -72,6 +73,8 @@ def report(to, reporter, account, statuses, comment) do

Reported Account: #{account.nickname}

#{comment_html} #{statuses_html} +

+ View Reports in AdminFE """ new() @@ -80,4 +83,18 @@ def report(to, reporter, account, statuses, comment) do |> subject("#{instance_name()} Report") |> html_body(html_body) end + + def new_unapproved_registration(to, account) do + html_body = """ +

New account for review: @#{account.nickname}

+
#{HTML.strip_tags(account.registration_reason)}
+ Visit AdminFE + """ + + new() + |> to({to.name, to.email}) + |> from({instance_name(), instance_notify_email()}) + |> subject("New account up for review on #{instance_name()} (@#{account.nickname})") + |> html_body(html_body) + end end diff --git a/lib/pleroma/emails/user_email.ex b/lib/pleroma/emails/user_email.ex index dfadc10b3..1d8c72ae9 100644 --- a/lib/pleroma/emails/user_email.ex +++ b/lib/pleroma/emails/user_email.ex @@ -12,17 +12,22 @@ defmodule Pleroma.Emails.UserEmail do alias Pleroma.Web.Endpoint alias Pleroma.Web.Router - defp instance_name, do: Config.get([:instance, :name]) - - defp sender do - email = Config.get([:instance, :notify_email]) || Config.get([:instance, :email]) - {instance_name(), email} - end + import Pleroma.Config.Helpers, only: [instance_name: 0, sender: 0] defp recipient(email, nil), do: email defp recipient(email, name), do: {name, email} defp recipient(%User{} = user), do: recipient(user.email, user.name) + @spec welcome(User.t(), map()) :: Swoosh.Email.t() + def welcome(user, opts \\ %{}) do + new() + |> to(recipient(user)) + |> from(Map.get(opts, :sender, sender())) + |> subject(Map.get(opts, :subject, "Welcome to #{instance_name()}!")) + |> html_body(Map.get(opts, :html, "Welcome to #{instance_name()}!")) + |> text_body(Map.get(opts, :text, "Welcome to #{instance_name()}!")) + end + def password_reset_email(user, token) when is_binary(token) do password_reset_url = Router.Helpers.reset_password_url(Endpoint, :reset, token) @@ -102,25 +107,34 @@ def digest_email(user) do |> Enum.filter(&(&1.activity.data["type"] == "Create")) |> Enum.map(fn notification -> object = Pleroma.Object.normalize(notification.activity) - object = update_in(object.data["content"], &format_links/1) - %{ - data: notification, - object: object, - from: User.get_by_ap_id(notification.activity.actor) - } + if not is_nil(object) do + object = update_in(object.data["content"], &format_links/1) + + %{ + data: notification, + object: object, + from: User.get_by_ap_id(notification.activity.actor) + } + end end) + |> Enum.filter(& &1) followers = notifications |> Enum.filter(&(&1.activity.data["type"] == "Follow")) |> Enum.map(fn notification -> - %{ - data: notification, - object: Pleroma.Object.normalize(notification.activity), - from: User.get_by_ap_id(notification.activity.actor) - } + from = User.get_by_ap_id(notification.activity.actor) + + if not is_nil(from) do + %{ + data: notification, + object: Pleroma.Object.normalize(notification.activity), + from: User.get_by_ap_id(notification.activity.actor) + } + end end) + |> Enum.filter(& &1) unless Enum.empty?(mentions) do styling = Config.get([__MODULE__, :styling]) diff --git a/lib/pleroma/emoji/loader.ex b/lib/pleroma/emoji/loader.ex index 3de2dc762..03a6bca0b 100644 --- a/lib/pleroma/emoji/loader.ex +++ b/lib/pleroma/emoji/loader.ex @@ -108,7 +108,7 @@ defp load_pack(pack_dir, emoji_groups) do if File.exists?(emoji_txt) do load_from_file(emoji_txt, emoji_groups) else - extensions = Pleroma.Config.get([:emoji, :pack_extensions]) + extensions = Config.get([:emoji, :pack_extensions]) Logger.info( "No emoji.txt found for pack \"#{pack_name}\", assuming all #{ diff --git a/lib/pleroma/emoji/pack.ex b/lib/pleroma/emoji/pack.ex index 14a5185be..d076ae312 100644 --- a/lib/pleroma/emoji/pack.ex +++ b/lib/pleroma/emoji/pack.ex @@ -1,6 +1,7 @@ defmodule Pleroma.Emoji.Pack do - @derive {Jason.Encoder, only: [:files, :pack]} + @derive {Jason.Encoder, only: [:files, :pack, :files_count]} defstruct files: %{}, + files_count: 0, pack_file: nil, path: nil, pack: %{}, @@ -8,6 +9,7 @@ defmodule Pleroma.Emoji.Pack do @type t() :: %__MODULE__{ files: %{String.t() => Path.t()}, + files_count: non_neg_integer(), pack_file: Path.t(), path: Path.t(), pack: map(), @@ -16,7 +18,7 @@ defmodule Pleroma.Emoji.Pack do alias Pleroma.Emoji - @spec create(String.t()) :: :ok | {:error, File.posix()} | {:error, :empty_values} + @spec create(String.t()) :: {:ok, t()} | {:error, File.posix()} | {:error, :empty_values} def create(name) do with :ok <- validate_not_empty([name]), dir <- Path.join(emoji_path(), name), @@ -26,10 +28,28 @@ def create(name) do end end - @spec show(String.t()) :: {:ok, t()} | {:error, atom()} - def show(name) do + defp paginate(entities, 1, page_size), do: Enum.take(entities, page_size) + + defp paginate(entities, page, page_size) do + entities + |> Enum.chunk_every(page_size) + |> Enum.at(page - 1) + end + + @spec show(keyword()) :: {:ok, t()} | {:error, atom()} + def show(opts) do + name = opts[:name] + with :ok <- validate_not_empty([name]), {:ok, pack} <- load_pack(name) do + shortcodes = + pack.files + |> Map.keys() + |> Enum.sort() + |> paginate(opts[:page], opts[:page_size]) + + pack = Map.put(pack, :files, Map.take(pack.files, shortcodes)) + {:ok, validate_pack(pack)} end end @@ -120,10 +140,10 @@ def list_remote(url) do end end - @spec list_local() :: {:ok, map()} - def list_local do + @spec list_local(keyword()) :: {:ok, map(), non_neg_integer()} + def list_local(opts) do with {:ok, results} <- list_packs_dir() do - packs = + all_packs = results |> Enum.map(fn name -> case load_pack(name) do @@ -132,9 +152,13 @@ def list_local do end end) |> Enum.reject(&is_nil/1) + + packs = + all_packs + |> paginate(opts[:page], opts[:page_size]) |> Map.new(fn pack -> {pack.name, validate_pack(pack)} end) - {:ok, packs} + {:ok, packs, length(all_packs)} end end @@ -146,7 +170,7 @@ def get_archive(name) do end end - @spec download(String.t(), String.t(), String.t()) :: :ok | {:error, atom()} + @spec download(String.t(), String.t(), String.t()) :: {:ok, t()} | {:error, atom()} def download(name, url, as) do uri = url |> String.trim() |> URI.parse() @@ -197,7 +221,12 @@ def load_pack(name) do |> Map.put(:path, Path.dirname(pack_file)) |> Map.put(:name, name) - {:ok, pack} + files_count = + pack.files + |> Map.keys() + |> length() + + {:ok, Map.put(pack, :files_count, files_count)} else {:error, :not_found} end @@ -296,7 +325,9 @@ defp downloadable?(pack) do # Otherwise, they'd have to download it from external-src pack.pack["share-files"] && Enum.all?(pack.files, fn {_, file} -> - File.exists?(Path.join(pack.path, file)) + pack.path + |> Path.join(file) + |> File.exists?() end) end @@ -440,7 +471,7 @@ defp list_packs_dir do # with the API so it should be sufficient with {:create_dir, :ok} <- {:create_dir, File.mkdir_p(emoji_path)}, {:ls, {:ok, results}} <- {:ls, File.ls(emoji_path)} do - {:ok, results} + {:ok, Enum.sort(results)} else {:create_dir, {:error, e}} -> {:error, :create_dir, e} {:ls, {:error, e}} -> {:error, :ls, e} diff --git a/lib/pleroma/filter.ex b/lib/pleroma/filter.ex index 4d61b3650..5d6df9530 100644 --- a/lib/pleroma/filter.ex +++ b/lib/pleroma/filter.ex @@ -34,10 +34,18 @@ def get(id, %{id: user_id} = _user) do Repo.one(query) end - def get_filters(%User{id: user_id} = _user) do + def get_active(query) do + from(f in query, where: is_nil(f.expires_at) or f.expires_at > ^NaiveDateTime.utc_now()) + end + + def get_irreversible(query) do + from(f in query, where: f.hide) + end + + def get_filters(query \\ __MODULE__, %User{id: user_id}) do query = from( - f in Pleroma.Filter, + f in query, where: f.user_id == ^user_id, order_by: [desc: :id] ) @@ -95,4 +103,34 @@ def update(%Pleroma.Filter{} = filter, params) do |> validate_required([:phrase, :context]) |> Repo.update() end + + def compose_regex(user_or_filters, format \\ :postgres) + + def compose_regex(%User{} = user, format) do + __MODULE__ + |> get_active() + |> get_irreversible() + |> get_filters(user) + |> compose_regex(format) + end + + def compose_regex([_ | _] = filters, format) do + phrases = + filters + |> Enum.map(& &1.phrase) + |> Enum.join("|") + + case format do + :postgres -> + "\\y(#{phrases})\\y" + + :re -> + ~r/\b#{phrases}\b/i + + _ -> + nil + end + end + + def compose_regex(_, _), do: nil end diff --git a/lib/pleroma/following_relationship.ex b/lib/pleroma/following_relationship.ex index 093b1f405..2039a259d 100644 --- a/lib/pleroma/following_relationship.ex +++ b/lib/pleroma/following_relationship.ex @@ -95,7 +95,11 @@ def followers_query(%User{} = user) do |> where([r], r.state == ^:follow_accept) end - def followers_ap_ids(%User{} = user, from_ap_ids \\ nil) do + def followers_ap_ids(user, from_ap_ids \\ nil) + + def followers_ap_ids(_, []), do: [] + + def followers_ap_ids(%User{} = user, from_ap_ids) do query = user |> followers_query() @@ -124,6 +128,7 @@ def get_follow_requests(%User{id: id}) do |> join(:inner, [r], f in assoc(r, :follower)) |> where([r], r.state == ^:follow_pending) |> where([r], r.following_id == ^id) + |> where([r, f], f.deactivated != true) |> select([r, f], f) |> Repo.all() end @@ -259,4 +264,12 @@ defp validate_following_id_follower_id_inequality(%Changeset{} = changeset) do end end) end + + @spec following_ap_ids(User.t()) :: [String.t()] + def following_ap_ids(%User{} = user) do + user + |> following_query() + |> select([r, u], u.ap_id) + |> Repo.all() + end end diff --git a/lib/pleroma/formatter.ex b/lib/pleroma/formatter.ex index 02a93a8dc..0c450eae4 100644 --- a/lib/pleroma/formatter.ex +++ b/lib/pleroma/formatter.ex @@ -10,11 +10,15 @@ defmodule Pleroma.Formatter do @link_regex ~r"((?:http(s)?:\/\/)?[\w.-]+(?:\.[\w\.-]+)+[\w\-\._~%:/?#[\]@!\$&'\(\)\*\+,;=.]+)|[0-9a-z+\-\.]+:[0-9a-z$-_.+!*'(),]+"ui @markdown_characters_regex ~r/(`|\*|_|{|}|[|]|\(|\)|#|\+|-|\.|!)/ - @auto_linker_config hashtag: true, - hashtag_handler: &Pleroma.Formatter.hashtag_handler/4, - mention: true, - mention_handler: &Pleroma.Formatter.mention_handler/4, - scheme: true + defp linkify_opts do + Pleroma.Config.get(Pleroma.Formatter) ++ + [ + hashtag: true, + hashtag_handler: &Pleroma.Formatter.hashtag_handler/4, + mention: true, + mention_handler: &Pleroma.Formatter.mention_handler/4 + ] + end def escape_mention_handler("@" <> nickname = mention, buffer, _, _) do case User.get_cached_by_nickname(nickname) do @@ -80,19 +84,19 @@ def hashtag_handler("#" <> tag = tag_text, _buffer, _opts, acc) do @spec linkify(String.t(), keyword()) :: {String.t(), [{String.t(), User.t()}], [{String.t(), String.t()}]} def linkify(text, options \\ []) do - options = options ++ @auto_linker_config + options = linkify_opts() ++ options if options[:safe_mention] && Regex.named_captures(@safe_mention_regex, text) do %{"mentions" => mentions, "rest" => rest} = Regex.named_captures(@safe_mention_regex, text) acc = %{mentions: MapSet.new(), tags: MapSet.new()} - {text_mentions, %{mentions: mentions}} = AutoLinker.link_map(mentions, acc, options) - {text_rest, %{tags: tags}} = AutoLinker.link_map(rest, acc, options) + {text_mentions, %{mentions: mentions}} = Linkify.link_map(mentions, acc, options) + {text_rest, %{tags: tags}} = Linkify.link_map(rest, acc, options) {text_mentions <> text_rest, MapSet.to_list(mentions), MapSet.to_list(tags)} else acc = %{mentions: MapSet.new(), tags: MapSet.new()} - {text, %{mentions: mentions, tags: tags}} = AutoLinker.link_map(text, acc, options) + {text, %{mentions: mentions, tags: tags}} = Linkify.link_map(text, acc, options) {text, MapSet.to_list(mentions), MapSet.to_list(tags)} end @@ -111,9 +115,9 @@ def mentions_escape(text, options \\ []) do if options[:safe_mention] && Regex.named_captures(@safe_mention_regex, text) do %{"mentions" => mentions, "rest" => rest} = Regex.named_captures(@safe_mention_regex, text) - AutoLinker.link(mentions, options) <> AutoLinker.link(rest, options) + Linkify.link(mentions, options) <> Linkify.link(rest, options) else - AutoLinker.link(text, options) + Linkify.link(text, options) end end diff --git a/lib/pleroma/gopher/server.ex b/lib/pleroma/gopher/server.ex index 3d56d50a9..e9f54c4c0 100644 --- a/lib/pleroma/gopher/server.ex +++ b/lib/pleroma/gopher/server.ex @@ -96,16 +96,18 @@ def response("") do def response("/main/public") do posts = - ActivityPub.fetch_public_activities(%{"type" => ["Create"], "local_only" => true}) - |> render_activities + %{type: ["Create"], local_only: true} + |> ActivityPub.fetch_public_activities() + |> render_activities() info("Welcome to the Public Timeline!") <> posts <> ".\r\n" end def response("/main/all") do posts = - ActivityPub.fetch_public_activities(%{"type" => ["Create"]}) - |> render_activities + %{type: ["Create"]} + |> ActivityPub.fetch_public_activities() + |> render_activities() info("Welcome to the Federated Timeline!") <> posts <> ".\r\n" end @@ -130,13 +132,14 @@ def response("/notices/" <> id) do def response("/users/" <> nickname) do with %User{} = user <- User.get_cached_by_nickname(nickname) do params = %{ - "type" => ["Create"], - "actor_id" => user.ap_id + type: ["Create"], + actor_id: user.ap_id } activities = - ActivityPub.fetch_public_activities(params) - |> render_activities + params + |> ActivityPub.fetch_public_activities() + |> render_activities() info("Posts by #{user.nickname}") <> activities <> ".\r\n" else diff --git a/lib/pleroma/gun/api.ex b/lib/pleroma/gun/api.ex index f51cd7db8..09be74392 100644 --- a/lib/pleroma/gun/api.ex +++ b/lib/pleroma/gun/api.ex @@ -19,7 +19,8 @@ defmodule Pleroma.Gun.API do :tls_opts, :tcp_opts, :socks_opts, - :ws_opts + :ws_opts, + :supervise ] @impl Gun diff --git a/lib/pleroma/gun/conn.ex b/lib/pleroma/gun/conn.ex index cd25a2e74..75b1ffc0a 100644 --- a/lib/pleroma/gun/conn.ex +++ b/lib/pleroma/gun/conn.ex @@ -3,85 +3,33 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Gun.Conn do - @moduledoc """ - Struct for gun connection data - """ alias Pleroma.Gun - alias Pleroma.Pool.Connections require Logger - @type gun_state :: :up | :down - @type conn_state :: :active | :idle - - @type t :: %__MODULE__{ - conn: pid(), - gun_state: gun_state(), - conn_state: conn_state(), - used_by: [pid()], - last_reference: pos_integer(), - crf: float(), - retries: pos_integer() - } - - defstruct conn: nil, - gun_state: :open, - conn_state: :init, - used_by: [], - last_reference: 0, - crf: 1, - retries: 0 - - @spec open(String.t() | URI.t(), atom(), keyword()) :: :ok | nil - def open(url, name, opts \\ []) - def open(url, name, opts) when is_binary(url), do: open(URI.parse(url), name, opts) - - def open(%URI{} = uri, name, opts) do + def open(%URI{} = uri, opts) do pool_opts = Pleroma.Config.get([:connections_pool], []) opts = opts |> Enum.into(%{}) - |> Map.put_new(:retry, pool_opts[:retry] || 1) - |> Map.put_new(:retry_timeout, pool_opts[:retry_timeout] || 1000) - |> Map.put_new(:await_up_timeout, pool_opts[:await_up_timeout] || 5_000) + |> Map.put_new(:connect_timeout, pool_opts[:connect_timeout] || 5_000) + |> Map.put_new(:supervise, false) |> maybe_add_tls_opts(uri) - key = "#{uri.scheme}:#{uri.host}:#{uri.port}" - - max_connections = pool_opts[:max_connections] || 250 - - conn_pid = - if Connections.count(name) < max_connections do - do_open(uri, opts) - else - close_least_used_and_do_open(name, uri, opts) - end - - if is_pid(conn_pid) do - conn = %Pleroma.Gun.Conn{ - conn: conn_pid, - gun_state: :up, - conn_state: :active, - last_reference: :os.system_time(:second) - } - - :ok = Gun.set_owner(conn_pid, Process.whereis(name)) - Connections.add_conn(name, key, conn) - end + do_open(uri, opts) end defp maybe_add_tls_opts(opts, %URI{scheme: "http"}), do: opts - defp maybe_add_tls_opts(opts, %URI{scheme: "https", host: host}) do + defp maybe_add_tls_opts(opts, %URI{scheme: "https"}) do tls_opts = [ verify: :verify_peer, cacertfile: CAStore.file_path(), depth: 20, reuse_sessions: false, - verify_fun: - {&:ssl_verify_hostname.verify_fun/3, - [check_hostname: Pleroma.HTTP.Connection.format_host(host)]} + log_level: :warning, + customize_hostname_check: [match_fun: :public_key.pkix_verify_hostname_match_fun(:https)] ] tls_opts = @@ -102,10 +50,10 @@ defp do_open(uri, %{proxy: {proxy_host, proxy_port}} = opts) do with open_opts <- Map.delete(opts, :tls_opts), {:ok, conn} <- Gun.open(proxy_host, proxy_port, open_opts), - {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]), + {:ok, _} <- Gun.await_up(conn, opts[:connect_timeout]), stream <- Gun.connect(conn, connect_opts), {:response, :fin, 200, _} <- Gun.await(conn, stream) do - conn + {:ok, conn} else error -> Logger.warn( @@ -140,8 +88,8 @@ defp do_open(uri, %{proxy: {proxy_type, proxy_host, proxy_port}} = opts) do |> Map.put(:socks_opts, socks_opts) with {:ok, conn} <- Gun.open(proxy_host, proxy_port, opts), - {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do - conn + {:ok, _} <- Gun.await_up(conn, opts[:connect_timeout]) do + {:ok, conn} else error -> Logger.warn( @@ -155,11 +103,11 @@ defp do_open(uri, %{proxy: {proxy_type, proxy_host, proxy_port}} = opts) do end defp do_open(%URI{host: host, port: port} = uri, opts) do - host = Pleroma.HTTP.Connection.parse_host(host) + host = Pleroma.HTTP.AdapterHelper.parse_host(host) with {:ok, conn} <- Gun.open(host, port, opts), - {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do - conn + {:ok, _} <- Gun.await_up(conn, opts[:connect_timeout]) do + {:ok, conn} else error -> Logger.warn( @@ -171,7 +119,7 @@ defp do_open(%URI{host: host, port: port} = uri, opts) do end defp destination_opts(%URI{host: host, port: port}) do - host = Pleroma.HTTP.Connection.parse_host(host) + host = Pleroma.HTTP.AdapterHelper.parse_host(host) %{host: host, port: port} end @@ -181,17 +129,6 @@ defp add_http2_opts(opts, "https", tls_opts) do defp add_http2_opts(opts, _, _), do: opts - defp close_least_used_and_do_open(name, uri, opts) do - with [{key, conn} | _conns] <- Connections.get_unused_conns(name), - :ok <- Gun.close(conn.conn) do - Connections.remove_conn(name, key) - - do_open(uri, opts) - else - [] -> {:error, :pool_overflowed} - end - end - def compose_uri_log(%URI{scheme: scheme, host: host, path: path}) do "#{scheme}://#{host}#{path}" end diff --git a/lib/pleroma/gun/connection_pool.ex b/lib/pleroma/gun/connection_pool.ex new file mode 100644 index 000000000..f34602b73 --- /dev/null +++ b/lib/pleroma/gun/connection_pool.ex @@ -0,0 +1,82 @@ +defmodule Pleroma.Gun.ConnectionPool do + @registry __MODULE__ + + alias Pleroma.Gun.ConnectionPool.WorkerSupervisor + + def children do + [ + {Registry, keys: :unique, name: @registry}, + Pleroma.Gun.ConnectionPool.WorkerSupervisor + ] + end + + @spec get_conn(URI.t(), keyword()) :: {:ok, pid()} | {:error, term()} + def get_conn(uri, opts) do + key = "#{uri.scheme}:#{uri.host}:#{uri.port}" + + case Registry.lookup(@registry, key) do + # The key has already been registered, but connection is not up yet + [{worker_pid, nil}] -> + get_gun_pid_from_worker(worker_pid, true) + + [{worker_pid, {gun_pid, _used_by, _crf, _last_reference}}] -> + GenServer.call(worker_pid, :add_client) + {:ok, gun_pid} + + [] -> + # :gun.set_owner fails in :connected state for whatevever reason, + # so we open the connection in the process directly and send it's pid back + # We trust gun to handle timeouts by itself + case WorkerSupervisor.start_worker([key, uri, opts, self()]) do + {:ok, worker_pid} -> + get_gun_pid_from_worker(worker_pid, false) + + {:error, {:already_started, worker_pid}} -> + get_gun_pid_from_worker(worker_pid, true) + + err -> + err + end + end + end + + defp get_gun_pid_from_worker(worker_pid, register) do + # GenServer.call will block the process for timeout length if + # the server crashes on startup (which will happen if gun fails to connect) + # so instead we use cast + monitor + + ref = Process.monitor(worker_pid) + if register, do: GenServer.cast(worker_pid, {:add_client, self()}) + + receive do + {:conn_pid, pid} -> + Process.demonitor(ref) + {:ok, pid} + + {:DOWN, ^ref, :process, ^worker_pid, reason} -> + case reason do + {:shutdown, {:error, _} = error} -> error + {:shutdown, error} -> {:error, error} + _ -> {:error, reason} + end + end + end + + @spec release_conn(pid()) :: :ok + def release_conn(conn_pid) do + # :ets.fun2ms(fn {_, {worker_pid, {gun_pid, _, _, _}}} when gun_pid == conn_pid -> + # worker_pid end) + query_result = + Registry.select(@registry, [ + {{:_, :"$1", {:"$2", :_, :_, :_}}, [{:==, :"$2", conn_pid}], [:"$1"]} + ]) + + case query_result do + [worker_pid] -> + GenServer.call(worker_pid, :remove_client) + + [] -> + :ok + end + end +end diff --git a/lib/pleroma/gun/connection_pool/reclaimer.ex b/lib/pleroma/gun/connection_pool/reclaimer.ex new file mode 100644 index 000000000..cea800882 --- /dev/null +++ b/lib/pleroma/gun/connection_pool/reclaimer.ex @@ -0,0 +1,85 @@ +defmodule Pleroma.Gun.ConnectionPool.Reclaimer do + use GenServer, restart: :temporary + + @registry Pleroma.Gun.ConnectionPool + + def start_monitor do + pid = + case :gen_server.start(__MODULE__, [], name: {:via, Registry, {@registry, "reclaimer"}}) do + {:ok, pid} -> + pid + + {:error, {:already_registered, pid}} -> + pid + end + + {pid, Process.monitor(pid)} + end + + @impl true + def init(_) do + {:ok, nil, {:continue, :reclaim}} + end + + @impl true + def handle_continue(:reclaim, _) do + max_connections = Pleroma.Config.get([:connections_pool, :max_connections]) + + reclaim_max = + [:connections_pool, :reclaim_multiplier] + |> Pleroma.Config.get() + |> Kernel.*(max_connections) + |> round + |> max(1) + + :telemetry.execute([:pleroma, :connection_pool, :reclaim, :start], %{}, %{ + max_connections: max_connections, + reclaim_max: reclaim_max + }) + + # :ets.fun2ms( + # fn {_, {worker_pid, {_, used_by, crf, last_reference}}} when used_by == [] -> + # {worker_pid, crf, last_reference} end) + unused_conns = + Registry.select( + @registry, + [ + {{:_, :"$1", {:_, :"$2", :"$3", :"$4"}}, [{:==, :"$2", []}], [{{:"$1", :"$3", :"$4"}}]} + ] + ) + + case unused_conns do + [] -> + :telemetry.execute( + [:pleroma, :connection_pool, :reclaim, :stop], + %{reclaimed_count: 0}, + %{ + max_connections: max_connections + } + ) + + {:stop, :no_unused_conns, nil} + + unused_conns -> + reclaimed = + unused_conns + |> Enum.sort(fn {_pid1, crf1, last_reference1}, {_pid2, crf2, last_reference2} -> + crf1 <= crf2 and last_reference1 <= last_reference2 + end) + |> Enum.take(reclaim_max) + + reclaimed + |> Enum.each(fn {pid, _, _} -> + DynamicSupervisor.terminate_child(Pleroma.Gun.ConnectionPool.WorkerSupervisor, pid) + end) + + :telemetry.execute( + [:pleroma, :connection_pool, :reclaim, :stop], + %{reclaimed_count: Enum.count(reclaimed)}, + %{max_connections: max_connections} + ) + + {:stop, :normal, nil} + end + end +end diff --git a/lib/pleroma/gun/connection_pool/worker.ex b/lib/pleroma/gun/connection_pool/worker.ex new file mode 100644 index 000000000..c36332817 --- /dev/null +++ b/lib/pleroma/gun/connection_pool/worker.ex @@ -0,0 +1,146 @@ +defmodule Pleroma.Gun.ConnectionPool.Worker do + alias Pleroma.Gun + use GenServer, restart: :temporary + + @registry Pleroma.Gun.ConnectionPool + + def start_link([key | _] = opts) do + GenServer.start_link(__MODULE__, opts, name: {:via, Registry, {@registry, key}}) + end + + @impl true + def init([_key, _uri, _opts, _client_pid] = opts) do + {:ok, nil, {:continue, {:connect, opts}}} + end + + @impl true + def handle_continue({:connect, [key, uri, opts, client_pid]}, _) do + with {:ok, conn_pid} <- Gun.Conn.open(uri, opts), + Process.link(conn_pid) do + time = :erlang.monotonic_time(:millisecond) + + {_, _} = + Registry.update_value(@registry, key, fn _ -> + {conn_pid, [client_pid], 1, time} + end) + + send(client_pid, {:conn_pid, conn_pid}) + + {:noreply, + %{key: key, timer: nil, client_monitors: %{client_pid => Process.monitor(client_pid)}}, + :hibernate} + else + err -> + {:stop, {:shutdown, err}, nil} + end + end + + @impl true + def handle_cast({:add_client, client_pid}, state) do + case handle_call(:add_client, {client_pid, nil}, state) do + {:reply, conn_pid, state, :hibernate} -> + send(client_pid, {:conn_pid, conn_pid}) + {:noreply, state, :hibernate} + end + end + + @impl true + def handle_cast({:remove_client, client_pid}, state) do + case handle_call(:remove_client, {client_pid, nil}, state) do + {:reply, _, state, :hibernate} -> + {:noreply, state, :hibernate} + end + end + + @impl true + def handle_call(:add_client, {client_pid, _}, %{key: key} = state) do + time = :erlang.monotonic_time(:millisecond) + + {{conn_pid, _, _, _}, _} = + Registry.update_value(@registry, key, fn {conn_pid, used_by, crf, last_reference} -> + {conn_pid, [client_pid | used_by], crf(time - last_reference, crf), time} + end) + + state = + if state.timer != nil do + Process.cancel_timer(state[:timer]) + %{state | timer: nil} + else + state + end + + ref = Process.monitor(client_pid) + + state = put_in(state.client_monitors[client_pid], ref) + {:reply, conn_pid, state, :hibernate} + end + + @impl true + def handle_call(:remove_client, {client_pid, _}, %{key: key} = state) do + {{_conn_pid, used_by, _crf, _last_reference}, _} = + Registry.update_value(@registry, key, fn {conn_pid, used_by, crf, last_reference} -> + {conn_pid, List.delete(used_by, client_pid), crf, last_reference} + end) + + {ref, state} = pop_in(state.client_monitors[client_pid]) + # DOWN message can receive right after `remove_client` call and cause worker to terminate + state = + if is_nil(ref) do + state + else + Process.demonitor(ref) + + timer = + if used_by == [] do + max_idle = Pleroma.Config.get([:connections_pool, :max_idle_time], 30_000) + Process.send_after(self(), :idle_close, max_idle) + else + nil + end + + %{state | timer: timer} + end + + {:reply, :ok, state, :hibernate} + end + + @impl true + def handle_info(:idle_close, state) do + # Gun monitors the owner process, and will close the connection automatically + # when it's terminated + {:stop, :normal, state} + end + + @impl true + def handle_info({:gun_up, _pid, _protocol}, state) do + {:noreply, state, :hibernate} + end + + # Gracefully shutdown if the connection got closed without any streams left + @impl true + def handle_info({:gun_down, _pid, _protocol, _reason, []}, state) do + {:stop, :normal, state} + end + + # Otherwise, wait for retry + @impl true + def handle_info({:gun_down, _pid, _protocol, _reason, _killed_streams}, state) do + {:noreply, state, :hibernate} + end + + @impl true + def handle_info({:DOWN, _ref, :process, pid, reason}, state) do + :telemetry.execute( + [:pleroma, :connection_pool, :client_death], + %{client_pid: pid, reason: reason}, + %{key: state.key} + ) + + handle_cast({:remove_client, pid}, state) + end + + # LRFU policy: https://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.55.1478 + defp crf(time_delta, prev_crf) do + 1 + :math.pow(0.5, 0.0001 * time_delta) * prev_crf + end +end diff --git a/lib/pleroma/gun/connection_pool/worker_supervisor.ex b/lib/pleroma/gun/connection_pool/worker_supervisor.ex new file mode 100644 index 000000000..39615c956 --- /dev/null +++ b/lib/pleroma/gun/connection_pool/worker_supervisor.ex @@ -0,0 +1,45 @@ +defmodule Pleroma.Gun.ConnectionPool.WorkerSupervisor do + @moduledoc "Supervisor for pool workers. Does not do anything except enforce max connection limit" + + use DynamicSupervisor + + def start_link(opts) do + DynamicSupervisor.start_link(__MODULE__, opts, name: __MODULE__) + end + + def init(_opts) do + DynamicSupervisor.init( + strategy: :one_for_one, + max_children: Pleroma.Config.get([:connections_pool, :max_connections]) + ) + end + + def start_worker(opts, retry \\ false) do + case DynamicSupervisor.start_child(__MODULE__, {Pleroma.Gun.ConnectionPool.Worker, opts}) do + {:error, :max_children} -> + if retry or free_pool() == :error do + :telemetry.execute([:pleroma, :connection_pool, :provision_failure], %{opts: opts}) + {:error, :pool_full} + else + start_worker(opts, true) + end + + res -> + res + end + end + + defp free_pool do + wait_for_reclaimer_finish(Pleroma.Gun.ConnectionPool.Reclaimer.start_monitor()) + end + + defp wait_for_reclaimer_finish({pid, mon}) do + receive do + {:DOWN, ^mon, :process, ^pid, :no_unused_conns} -> + :error + + {:DOWN, ^mon, :process, ^pid, :normal} -> + :ok + end + end +end diff --git a/lib/pleroma/html.ex b/lib/pleroma/html.ex index d78c5f202..43e9145be 100644 --- a/lib/pleroma/html.ex +++ b/lib/pleroma/html.ex @@ -100,20 +100,27 @@ defp generate_scrubber_signature(scrubbers) do end) end - def extract_first_external_url(_, nil), do: {:error, "No content"} + def extract_first_external_url_from_object(%{data: %{"content" => content}} = object) + when is_binary(content) do + unless object.data["fake"] do + key = "URL|#{object.id}" - def extract_first_external_url(object, content) do - key = "URL|#{object.id}" + Cachex.fetch!(:scrubber_cache, key, fn _key -> + {:commit, {:ok, extract_first_external_url(content)}} + end) + else + {:ok, extract_first_external_url(content)} + end + end - Cachex.fetch!(:scrubber_cache, key, fn _key -> - result = - content - |> Floki.parse_fragment!() - |> Floki.filter_out("a.mention,a.hashtag,a[rel~=\"tag\"]") - |> Floki.attribute("a", "href") - |> Enum.at(0) + def extract_first_external_url_from_object(_), do: {:error, :no_content} - {:commit, {:ok, result}} - end) + def extract_first_external_url(content) do + content + |> Floki.parse_fragment!() + |> Floki.find("a:not(.mention,.hashtag,.attachment,[rel~=\"tag\"])") + |> Enum.take(1) + |> Floki.attribute("href") + |> Enum.at(0) end end diff --git a/lib/pleroma/http/adapter_helper.ex b/lib/pleroma/http/adapter_helper.ex index 510722ff9..08b51578a 100644 --- a/lib/pleroma/http/adapter_helper.ex +++ b/lib/pleroma/http/adapter_helper.ex @@ -3,32 +3,28 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.HTTP.AdapterHelper do - alias Pleroma.HTTP.Connection + @moduledoc """ + Configure Tesla.Client with default and customized adapter options. + """ + @defaults [pool: :federation, connect_timeout: 5_000, recv_timeout: 5_000] + + @type proxy_type() :: :socks4 | :socks5 + @type host() :: charlist() | :inet.ip_address() + + alias Pleroma.HTTP.AdapterHelper + require Logger @type proxy :: {Connection.host(), pos_integer()} | {Connection.proxy_type(), Connection.host(), pos_integer()} @callback options(keyword(), URI.t()) :: keyword() - @callback after_request(keyword()) :: :ok - - @spec options(keyword(), URI.t()) :: keyword() - def options(opts, _uri) do - proxy = Pleroma.Config.get([:http, :proxy_url], nil) - maybe_add_proxy(opts, format_proxy(proxy)) - end - - @spec maybe_get_conn(URI.t(), keyword()) :: keyword() - def maybe_get_conn(_uri, opts), do: opts - - @spec after_request(keyword()) :: :ok - def after_request(_opts), do: :ok @spec format_proxy(String.t() | tuple() | nil) :: proxy() | nil def format_proxy(nil), do: nil def format_proxy(proxy_url) do - case Connection.parse_proxy(proxy_url) do + case parse_proxy(proxy_url) do {:ok, host, port} -> {host, port} {:ok, type, host, port} -> {type, host, port} _ -> nil @@ -38,4 +34,88 @@ def format_proxy(proxy_url) do @spec maybe_add_proxy(keyword(), proxy() | nil) :: keyword() def maybe_add_proxy(opts, nil), do: opts def maybe_add_proxy(opts, proxy), do: Keyword.put_new(opts, :proxy, proxy) + + @doc """ + Merge default connection & adapter options with received ones. + """ + + @spec options(URI.t(), keyword()) :: keyword() + def options(%URI{} = uri, opts \\ []) do + @defaults + |> Keyword.merge(opts) + |> adapter_helper().options(uri) + end + + defp adapter, do: Application.get_env(:tesla, :adapter) + + defp adapter_helper do + case adapter() do + Tesla.Adapter.Gun -> AdapterHelper.Gun + Tesla.Adapter.Hackney -> AdapterHelper.Hackney + _ -> AdapterHelper.Default + end + end + + @spec parse_proxy(String.t() | tuple() | nil) :: + {:ok, host(), pos_integer()} + | {:ok, proxy_type(), host(), pos_integer()} + | {:error, atom()} + | nil + + def parse_proxy(nil), do: nil + + def parse_proxy(proxy) when is_binary(proxy) do + with [host, port] <- String.split(proxy, ":"), + {port, ""} <- Integer.parse(port) do + {:ok, parse_host(host), port} + else + {_, _} -> + Logger.warn("Parsing port failed #{inspect(proxy)}") + {:error, :invalid_proxy_port} + + :error -> + Logger.warn("Parsing port failed #{inspect(proxy)}") + {:error, :invalid_proxy_port} + + _ -> + Logger.warn("Parsing proxy failed #{inspect(proxy)}") + {:error, :invalid_proxy} + end + end + + def parse_proxy(proxy) when is_tuple(proxy) do + with {type, host, port} <- proxy do + {:ok, type, parse_host(host), port} + else + _ -> + Logger.warn("Parsing proxy failed #{inspect(proxy)}") + {:error, :invalid_proxy} + end + end + + @spec parse_host(String.t() | atom() | charlist()) :: charlist() | :inet.ip_address() + def parse_host(host) when is_list(host), do: host + def parse_host(host) when is_atom(host), do: to_charlist(host) + + def parse_host(host) when is_binary(host) do + host = to_charlist(host) + + case :inet.parse_address(host) do + {:error, :einval} -> host + {:ok, ip} -> ip + end + end + + @spec format_host(String.t()) :: charlist() + def format_host(host) do + host_charlist = to_charlist(host) + + case :inet.parse_address(host_charlist) do + {:error, :einval} -> + :idna.encode(host_charlist) + + {:ok, _ip} -> + host_charlist + end + end end diff --git a/lib/pleroma/http/adapter_helper/default.ex b/lib/pleroma/http/adapter_helper/default.ex new file mode 100644 index 000000000..e13441316 --- /dev/null +++ b/lib/pleroma/http/adapter_helper/default.ex @@ -0,0 +1,14 @@ +defmodule Pleroma.HTTP.AdapterHelper.Default do + alias Pleroma.HTTP.AdapterHelper + + @behaviour Pleroma.HTTP.AdapterHelper + + @spec options(keyword(), URI.t()) :: keyword() + def options(opts, _uri) do + proxy = Pleroma.Config.get([:http, :proxy_url], nil) + AdapterHelper.maybe_add_proxy(opts, AdapterHelper.format_proxy(proxy)) + end + + @spec get_conn(URI.t(), keyword()) :: {:ok, keyword()} + def get_conn(_uri, opts), do: {:ok, opts} +end diff --git a/lib/pleroma/http/adapter_helper/gun.ex b/lib/pleroma/http/adapter_helper/gun.ex index ead7cdc6b..1dbb71362 100644 --- a/lib/pleroma/http/adapter_helper/gun.ex +++ b/lib/pleroma/http/adapter_helper/gun.ex @@ -5,73 +5,78 @@ defmodule Pleroma.HTTP.AdapterHelper.Gun do @behaviour Pleroma.HTTP.AdapterHelper + alias Pleroma.Config alias Pleroma.HTTP.AdapterHelper - alias Pleroma.Pool.Connections require Logger @defaults [ - connect_timeout: 5_000, - domain_lookup_timeout: 5_000, - tls_handshake_timeout: 5_000, retry: 1, - retry_timeout: 1000, - await_up_timeout: 5_000 + retry_timeout: 1_000 ] + @type pool() :: :federation | :upload | :media | :default + @spec options(keyword(), URI.t()) :: keyword() def options(incoming_opts \\ [], %URI{} = uri) do proxy = - Pleroma.Config.get([:http, :proxy_url]) + [:http, :proxy_url] + |> Config.get() |> AdapterHelper.format_proxy() - config_opts = Pleroma.Config.get([:http, :adapter], []) + config_opts = Config.get([:http, :adapter], []) @defaults |> Keyword.merge(config_opts) |> add_scheme_opts(uri) |> AdapterHelper.maybe_add_proxy(proxy) - |> maybe_get_conn(uri, incoming_opts) - end - - @spec after_request(keyword()) :: :ok - def after_request(opts) do - if opts[:conn] && opts[:body_as] != :chunks do - Connections.checkout(opts[:conn], self(), :gun_connections) - end - - :ok + |> Keyword.merge(incoming_opts) + |> put_timeout() end defp add_scheme_opts(opts, %{scheme: "http"}), do: opts defp add_scheme_opts(opts, %{scheme: "https"}) do - opts - |> Keyword.put(:certificates_verification, true) - |> Keyword.put(:tls_opts, log_level: :warning) + Keyword.put(opts, :certificates_verification, true) end - defp maybe_get_conn(adapter_opts, uri, incoming_opts) do - {receive_conn?, opts} = - adapter_opts - |> Keyword.merge(incoming_opts) - |> Keyword.pop(:receive_conn, true) - - if Connections.alive?(:gun_connections) and receive_conn? do - checkin_conn(uri, opts) - else - opts - end + defp put_timeout(opts) do + {recv_timeout, opts} = Keyword.pop(opts, :recv_timeout, pool_timeout(opts[:pool])) + # this is the timeout to receive a message from Gun + # `:timeout` key is used in Tesla + Keyword.put(opts, :timeout, recv_timeout) end - defp checkin_conn(uri, opts) do - case Connections.checkin(uri, :gun_connections) do - nil -> - Task.start(Pleroma.Gun.Conn, :open, [uri, :gun_connections, opts]) - opts + @spec pool_timeout(pool()) :: non_neg_integer() + def pool_timeout(pool) do + default = Config.get([:pools, :default, :recv_timeout], 5_000) - conn when is_pid(conn) -> - Keyword.merge(opts, conn: conn, close_conn: false) - end + Config.get([:pools, pool, :recv_timeout], default) + end + + @prefix Pleroma.Gun.ConnectionPool + def limiter_setup do + wait = Config.get([:connections_pool, :connection_acquisition_wait]) + retries = Config.get([:connections_pool, :connection_acquisition_retries]) + + :pools + |> Config.get([]) + |> Enum.each(fn {name, opts} -> + max_running = Keyword.get(opts, :size, 50) + max_waiting = Keyword.get(opts, :max_waiting, 10) + + result = + ConcurrentLimiter.new(:"#{@prefix}.#{name}", max_running, max_waiting, + wait: wait, + max_retries: retries + ) + + case result do + :ok -> :ok + {:error, :existing} -> :ok + end + end) + + :ok end end diff --git a/lib/pleroma/http/adapter_helper/hackney.ex b/lib/pleroma/http/adapter_helper/hackney.ex index 3972a03a9..ef84553c1 100644 --- a/lib/pleroma/http/adapter_helper/hackney.ex +++ b/lib/pleroma/http/adapter_helper/hackney.ex @@ -2,11 +2,8 @@ defmodule Pleroma.HTTP.AdapterHelper.Hackney do @behaviour Pleroma.HTTP.AdapterHelper @defaults [ - connect_timeout: 10_000, - recv_timeout: 20_000, follow_redirect: true, - force_redirect: true, - pool: :federation + force_redirect: true ] @spec options(keyword(), URI.t()) :: keyword() @@ -19,10 +16,21 @@ def options(connection_opts \\ [], %URI{} = uri) do |> Keyword.merge(config_opts) |> Keyword.merge(connection_opts) |> add_scheme_opts(uri) + |> maybe_add_with_body() |> Pleroma.HTTP.AdapterHelper.maybe_add_proxy(proxy) end + defp add_scheme_opts(opts, %URI{scheme: "https"}) do + Keyword.put(opts, :ssl_options, versions: [:"tlsv1.2", :"tlsv1.1", :tlsv1]) + end + defp add_scheme_opts(opts, _), do: opts - def after_request(_), do: :ok + defp maybe_add_with_body(opts) do + if opts[:max_body] do + Keyword.put(opts, :with_body, true) + else + opts + end + end end diff --git a/lib/pleroma/http/connection.ex b/lib/pleroma/http/connection.ex deleted file mode 100644 index ebacf7902..000000000 --- a/lib/pleroma/http/connection.ex +++ /dev/null @@ -1,124 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.HTTP.Connection do - @moduledoc """ - Configure Tesla.Client with default and customized adapter options. - """ - - alias Pleroma.Config - alias Pleroma.HTTP.AdapterHelper - - require Logger - - @defaults [pool: :federation] - - @type ip_address :: ipv4_address() | ipv6_address() - @type ipv4_address :: {0..255, 0..255, 0..255, 0..255} - @type ipv6_address :: - {0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535} - @type proxy_type() :: :socks4 | :socks5 - @type host() :: charlist() | ip_address() - - @doc """ - Merge default connection & adapter options with received ones. - """ - - @spec options(URI.t(), keyword()) :: keyword() - def options(%URI{} = uri, opts \\ []) do - @defaults - |> pool_timeout() - |> Keyword.merge(opts) - |> adapter_helper().options(uri) - end - - defp pool_timeout(opts) do - {config_key, default} = - if adapter() == Tesla.Adapter.Gun do - {:pools, Config.get([:pools, :default, :timeout])} - else - {:hackney_pools, 10_000} - end - - timeout = Config.get([config_key, opts[:pool], :timeout], default) - - Keyword.merge(opts, timeout: timeout) - end - - @spec after_request(keyword()) :: :ok - def after_request(opts), do: adapter_helper().after_request(opts) - - defp adapter, do: Application.get_env(:tesla, :adapter) - - defp adapter_helper do - case adapter() do - Tesla.Adapter.Gun -> AdapterHelper.Gun - Tesla.Adapter.Hackney -> AdapterHelper.Hackney - _ -> AdapterHelper - end - end - - @spec parse_proxy(String.t() | tuple() | nil) :: - {:ok, host(), pos_integer()} - | {:ok, proxy_type(), host(), pos_integer()} - | {:error, atom()} - | nil - - def parse_proxy(nil), do: nil - - def parse_proxy(proxy) when is_binary(proxy) do - with [host, port] <- String.split(proxy, ":"), - {port, ""} <- Integer.parse(port) do - {:ok, parse_host(host), port} - else - {_, _} -> - Logger.warn("Parsing port failed #{inspect(proxy)}") - {:error, :invalid_proxy_port} - - :error -> - Logger.warn("Parsing port failed #{inspect(proxy)}") - {:error, :invalid_proxy_port} - - _ -> - Logger.warn("Parsing proxy failed #{inspect(proxy)}") - {:error, :invalid_proxy} - end - end - - def parse_proxy(proxy) when is_tuple(proxy) do - with {type, host, port} <- proxy do - {:ok, type, parse_host(host), port} - else - _ -> - Logger.warn("Parsing proxy failed #{inspect(proxy)}") - {:error, :invalid_proxy} - end - end - - @spec parse_host(String.t() | atom() | charlist()) :: charlist() | ip_address() - def parse_host(host) when is_list(host), do: host - def parse_host(host) when is_atom(host), do: to_charlist(host) - - def parse_host(host) when is_binary(host) do - host = to_charlist(host) - - case :inet.parse_address(host) do - {:error, :einval} -> host - {:ok, ip} -> ip - end - end - - @spec format_host(String.t()) :: charlist() - def format_host(host) do - host_charlist = to_charlist(host) - - case :inet.parse_address(host_charlist) do - {:error, :einval} -> - :idna.encode(host_charlist) - - {:ok, _ip} -> - host_charlist - end - end -end diff --git a/lib/pleroma/http/ex_aws.ex b/lib/pleroma/http/ex_aws.ex new file mode 100644 index 000000000..5cac3532f --- /dev/null +++ b/lib/pleroma/http/ex_aws.ex @@ -0,0 +1,24 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.ExAws do + @moduledoc false + + @behaviour ExAws.Request.HttpClient + + alias Pleroma.HTTP + + @impl true + def request(method, url, body \\ "", headers \\ [], http_opts \\ []) do + http_opts = Keyword.put_new(http_opts, :pool, :upload) + + case HTTP.request(method, url, body, headers, http_opts) do + {:ok, env} -> + {:ok, %{status_code: env.status, headers: env.headers, body: env.body}} + + {:error, reason} -> + {:error, %{reason: reason}} + end + end +end diff --git a/lib/pleroma/http/http.ex b/lib/pleroma/http/http.ex index 583b56484..052597191 100644 --- a/lib/pleroma/http/http.ex +++ b/lib/pleroma/http/http.ex @@ -7,7 +7,7 @@ defmodule Pleroma.HTTP do Wrapper for `Tesla.request/2`. """ - alias Pleroma.HTTP.Connection + alias Pleroma.HTTP.AdapterHelper alias Pleroma.HTTP.Request alias Pleroma.HTTP.RequestBuilder, as: Builder alias Tesla.Client @@ -16,6 +16,7 @@ defmodule Pleroma.HTTP do require Logger @type t :: __MODULE__ + @type method() :: :get | :post | :put | :delete | :head @doc """ Performs GET request. @@ -28,6 +29,9 @@ def get(url, headers \\ [], options \\ []) def get(nil, _, _), do: nil def get(url, headers, options), do: request(:get, url, "", headers, options) + @spec head(Request.url(), Request.headers(), keyword()) :: {:ok, Env.t()} | {:error, any()} + def head(url, headers \\ [], options \\ []), do: request(:head, url, "", headers, options) + @doc """ Performs POST request. @@ -42,7 +46,7 @@ def post(url, body, headers \\ [], options \\ []), Builds and performs http request. # Arguments: - `method` - :get, :post, :put, :delete + `method` - :get, :post, :put, :delete, :head `url` - full url `body` - request body `headers` - a keyworld list of headers, e.g. `[{"content-type", "text/plain"}]` @@ -52,52 +56,26 @@ def post(url, body, headers \\ [], options \\ []), `{:ok, %Tesla.Env{}}` or `{:error, error}` """ - @spec request(atom(), Request.url(), String.t(), Request.headers(), keyword()) :: + @spec request(method(), Request.url(), String.t(), Request.headers(), keyword()) :: {:ok, Env.t()} | {:error, any()} def request(method, url, body, headers, options) when is_binary(url) do uri = URI.parse(url) - adapter_opts = Connection.options(uri, options[:adapter] || []) + adapter_opts = AdapterHelper.options(uri, options || []) + options = put_in(options[:adapter], adapter_opts) params = options[:params] || [] request = build_request(method, headers, options, url, body, params) adapter = Application.get_env(:tesla, :adapter) - client = Tesla.client([Tesla.Middleware.FollowRedirects], adapter) - pid = Process.whereis(adapter_opts[:pool]) + client = Tesla.client(adapter_middlewares(adapter), adapter) - pool_alive? = - if adapter == Tesla.Adapter.Gun && pid do - Process.alive?(pid) - else - false - end - - request_opts = + maybe_limit( + fn -> + request(client, request) + end, + adapter, adapter_opts - |> Enum.into(%{}) - |> Map.put(:env, Pleroma.Config.get([:env])) - |> Map.put(:pool_alive?, pool_alive?) - - response = request(client, request, request_opts) - - Connection.after_request(adapter_opts) - - response - end - - @spec request(Client.t(), keyword(), map()) :: {:ok, Env.t()} | {:error, any()} - def request(%Client{} = client, request, %{env: :test}), do: request(client, request) - - def request(%Client{} = client, request, %{body_as: :chunks}), do: request(client, request) - - def request(%Client{} = client, request, %{pool_alive?: false}), do: request(client, request) - - def request(%Client{} = client, request, %{pool: pool, timeout: timeout}) do - :poolboy.transaction( - pool, - &Pleroma.Pool.Request.execute(&1, client, request, timeout), - timeout ) end @@ -114,4 +92,19 @@ defp build_request(method, headers, options, url, body, params) do |> Builder.add_param(:query, :query, params) |> Builder.convert_to_keyword() end + + @prefix Pleroma.Gun.ConnectionPool + defp maybe_limit(fun, Tesla.Adapter.Gun, opts) do + ConcurrentLimiter.limit(:"#{@prefix}.#{opts[:pool] || :default}", fun) + end + + defp maybe_limit(fun, _, _) do + fun.() + end + + defp adapter_middlewares(Tesla.Adapter.Gun) do + [Tesla.Middleware.FollowRedirects, Pleroma.Tesla.Middleware.ConnectionPool] + end + + defp adapter_middlewares(_), do: [] end diff --git a/lib/pleroma/http/request_builder.ex b/lib/pleroma/http/request_builder.ex index 2fc876d92..8a44a001d 100644 --- a/lib/pleroma/http/request_builder.ex +++ b/lib/pleroma/http/request_builder.ex @@ -34,10 +34,12 @@ def url(request, u), do: %{request | url: u} @spec headers(Request.t(), Request.headers()) :: Request.t() def headers(request, headers) do headers_list = - if Pleroma.Config.get([:http, :send_user_agent]) do + with true <- Pleroma.Config.get([:http, :send_user_agent]), + nil <- Enum.find(headers, fn {key, _val} -> String.downcase(key) == "user-agent" end) do [{"user-agent", Pleroma.Application.user_agent()} | headers] else - headers + _ -> + headers end %{request | headers: headers_list} diff --git a/lib/pleroma/http/tzdata.ex b/lib/pleroma/http/tzdata.ex new file mode 100644 index 000000000..09cfdadf7 --- /dev/null +++ b/lib/pleroma/http/tzdata.ex @@ -0,0 +1,29 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.Tzdata do + @moduledoc false + + @behaviour Tzdata.HTTPClient + + alias Pleroma.HTTP + + @impl true + def get(url, headers, options) do + options = Keyword.put_new(options, :pool, :default) + + with {:ok, %Tesla.Env{} = env} <- HTTP.get(url, headers, options) do + {:ok, {env.status, env.headers, env.body}} + end + end + + @impl true + def head(url, headers, options) do + options = Keyword.put_new(options, :pool, :default) + + with {:ok, %Tesla.Env{} = env} <- HTTP.head(url, headers, options) do + {:ok, {env.status, env.headers}} + end + end +end diff --git a/lib/pleroma/instances/instance.ex b/lib/pleroma/instances/instance.ex index 74458c09a..8bf53c090 100644 --- a/lib/pleroma/instances/instance.ex +++ b/lib/pleroma/instances/instance.ex @@ -14,9 +14,13 @@ defmodule Pleroma.Instances.Instance do import Ecto.Query import Ecto.Changeset + require Logger + schema "instances" do field(:host, :string) field(:unreachable_since, :naive_datetime_usec) + field(:favicon, :string) + field(:favicon_updated_at, :naive_datetime) timestamps() end @@ -25,7 +29,7 @@ defmodule Pleroma.Instances.Instance do def changeset(struct, params \\ %{}) do struct - |> cast(params, [:host, :unreachable_since]) + |> cast(params, [:host, :unreachable_since, :favicon, :favicon_updated_at]) |> validate_required([:host]) |> unique_constraint(:host) end @@ -120,4 +124,59 @@ defp parse_datetime(datetime) when is_binary(datetime) do end defp parse_datetime(datetime), do: datetime + + def get_or_update_favicon(%URI{host: host} = instance_uri) do + existing_record = Repo.get_by(Instance, %{host: host}) + now = NaiveDateTime.utc_now() + + if existing_record && existing_record.favicon_updated_at && + NaiveDateTime.diff(now, existing_record.favicon_updated_at) < 86_400 do + existing_record.favicon + else + favicon = scrape_favicon(instance_uri) + + if existing_record do + existing_record + |> changeset(%{favicon: favicon, favicon_updated_at: now}) + |> Repo.update() + else + %Instance{} + |> changeset(%{host: host, favicon: favicon, favicon_updated_at: now}) + |> Repo.insert() + end + + favicon + end + rescue + e -> + Logger.warn("Instance.get_or_update_favicon(\"#{host}\") error: #{inspect(e)}") + nil + end + + defp scrape_favicon(%URI{} = instance_uri) do + try do + with {:ok, %Tesla.Env{body: html}} <- + Pleroma.HTTP.get(to_string(instance_uri), [{"accept", "text/html"}], + adapter: [pool: :media] + ), + favicon_rel <- + html + |> Floki.parse_document!() + |> Floki.attribute("link[rel=icon]", "href") + |> List.first(), + favicon <- URI.merge(instance_uri, favicon_rel) |> to_string(), + true <- is_binary(favicon) do + favicon + else + _ -> nil + end + rescue + e -> + Logger.warn( + "Instance.scrape_favicon(\"#{to_string(instance_uri)}\") error: #{inspect(e)}" + ) + + nil + end + end end diff --git a/lib/pleroma/job_queue_monitor.ex b/lib/pleroma/job_queue_monitor.ex index 2ecf261f3..c255a61ec 100644 --- a/lib/pleroma/job_queue_monitor.ex +++ b/lib/pleroma/job_queue_monitor.ex @@ -15,8 +15,8 @@ def start_link(_) do @impl true def init(state) do - :telemetry.attach("oban-monitor-failure", [:oban, :failure], &handle_event/4, nil) - :telemetry.attach("oban-monitor-success", [:oban, :success], &handle_event/4, nil) + :telemetry.attach("oban-monitor-failure", [:oban, :job, :exception], &handle_event/4, nil) + :telemetry.attach("oban-monitor-success", [:oban, :job, :stop], &handle_event/4, nil) {:ok, state} end @@ -25,8 +25,11 @@ def stats do GenServer.call(__MODULE__, :stats) end - def handle_event([:oban, status], %{duration: duration}, meta, _) do - GenServer.cast(__MODULE__, {:process_event, status, duration, meta}) + def handle_event([:oban, :job, event], %{duration: duration}, meta, _) do + GenServer.cast( + __MODULE__, + {:process_event, mapping_status(event), duration, meta} + ) end @impl true @@ -75,4 +78,7 @@ defp update_queue(queue, status, _meta, _duration) do |> Map.update!(:processed_jobs, &(&1 + 1)) |> Map.update!(status, &(&1 + 1)) end + + defp mapping_status(:stop), do: :success + defp mapping_status(:exception), do: :failure end diff --git a/lib/pleroma/mfa/token.ex b/lib/pleroma/mfa/token.ex index 0b2449971..69b64c0e8 100644 --- a/lib/pleroma/mfa/token.ex +++ b/lib/pleroma/mfa/token.ex @@ -10,10 +10,11 @@ defmodule Pleroma.MFA.Token do alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web.OAuth.Authorization - alias Pleroma.Web.OAuth.Token, as: OAuthToken @expires 300 + @type t() :: %__MODULE__{} + schema "mfa_tokens" do field(:token, :string) field(:valid_until, :naive_datetime_usec) @@ -24,6 +25,7 @@ defmodule Pleroma.MFA.Token do timestamps() end + @spec get_by_token(String.t()) :: {:ok, t()} | {:error, :not_found} def get_by_token(token) do from( t in __MODULE__, @@ -33,33 +35,40 @@ def get_by_token(token) do |> Repo.find_resource() end - def validate(token) do - with {:fetch_token, {:ok, token}} <- {:fetch_token, get_by_token(token)}, - {:expired, false} <- {:expired, is_expired?(token)} do + @spec validate(String.t()) :: {:ok, t()} | {:error, :not_found} | {:error, :expired_token} + def validate(token_str) do + with {:ok, token} <- get_by_token(token_str), + false <- expired?(token) do {:ok, token} - else - {:expired, _} -> {:error, :expired_token} - {:fetch_token, _} -> {:error, :not_found} - error -> {:error, error} end end - def create_token(%User{} = user) do - %__MODULE__{} - |> change - |> assign_user(user) - |> put_token - |> put_valid_until - |> Repo.insert() + defp expired?(%__MODULE__{valid_until: valid_until}) do + with true <- NaiveDateTime.diff(NaiveDateTime.utc_now(), valid_until) > 0 do + {:error, :expired_token} + end end - def create_token(user, authorization) do + @spec create(User.t(), Authorization.t() | nil) :: {:ok, t()} | {:error, Ecto.Changeset.t()} + def create(user, authorization \\ nil) do + with {:ok, token} <- do_create(user, authorization) do + Pleroma.Workers.PurgeExpiredToken.enqueue(%{ + token_id: token.id, + valid_until: DateTime.from_naive!(token.valid_until, "Etc/UTC"), + mod: __MODULE__ + }) + + {:ok, token} + end + end + + defp do_create(user, authorization) do %__MODULE__{} - |> change + |> change() |> assign_user(user) - |> assign_authorization(authorization) - |> put_token - |> put_valid_until + |> maybe_assign_authorization(authorization) + |> put_token() + |> put_valid_until() |> Repo.insert() end @@ -69,15 +78,19 @@ defp assign_user(changeset, user) do |> validate_required([:user]) end - defp assign_authorization(changeset, authorization) do + defp maybe_assign_authorization(changeset, %Authorization{} = authorization) do changeset |> put_assoc(:authorization, authorization) |> validate_required([:authorization]) end + defp maybe_assign_authorization(changeset, _), do: changeset + defp put_token(changeset) do + token = Pleroma.Web.OAuth.Token.Utils.generate_token() + changeset - |> change(%{token: OAuthToken.Utils.generate_token()}) + |> change(%{token: token}) |> validate_required([:token]) |> unique_constraint(:token) end @@ -89,18 +102,4 @@ defp put_valid_until(changeset) do |> change(%{valid_until: expires_in}) |> validate_required([:valid_until]) end - - def is_expired?(%__MODULE__{valid_until: valid_until}) do - NaiveDateTime.diff(NaiveDateTime.utc_now(), valid_until) > 0 - end - - def is_expired?(_), do: false - - def delete_expired_tokens do - from( - q in __MODULE__, - where: fragment("?", q.valid_until) < ^Timex.now() - ) - |> Repo.delete_all() - end end diff --git a/lib/pleroma/migration_helper/notification_backfill.ex b/lib/pleroma/migration_helper/notification_backfill.ex index 09647d12a..d260e62ca 100644 --- a/lib/pleroma/migration_helper/notification_backfill.ex +++ b/lib/pleroma/migration_helper/notification_backfill.ex @@ -3,7 +3,6 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.MigrationHelper.NotificationBackfill do - alias Pleroma.Notification alias Pleroma.Object alias Pleroma.Repo alias Pleroma.User @@ -18,25 +17,34 @@ def fill_in_notification_types do ) query - |> Repo.all() + |> Repo.chunk_stream(100) |> Enum.each(fn notification -> type = notification.activity |> type_from_activity() notification - |> Notification.changeset(%{type: type}) + |> Ecto.Changeset.change(%{type: type}) |> Repo.update() end) end + defp get_by_ap_id(ap_id) do + q = + from(u in User, + select: u.id + ) + + Repo.get_by(q, ap_id: ap_id) + end + # This is copied over from Notifications to keep this stable. defp type_from_activity(%{data: %{"type" => type}} = activity) do case type do "Follow" -> accepted_function = fn activity -> - with %User{} = follower <- User.get_by_ap_id(activity.data["actor"]), - %User{} = followed <- User.get_by_ap_id(activity.data["object"]) do + with %User{} = follower <- get_by_ap_id(activity.data["actor"]), + %User{} = followed <- get_by_ap_id(activity.data["object"]) do Pleroma.FollowingRelationship.following?(follower, followed) end end diff --git a/lib/pleroma/moderation_log.ex b/lib/pleroma/moderation_log.ex index 7aacd9d80..31c9afe2a 100644 --- a/lib/pleroma/moderation_log.ex +++ b/lib/pleroma/moderation_log.ex @@ -409,6 +409,17 @@ def get_log_entry_message(%ModerationLog{ "@#{actor_nickname} deactivated users: #{users_to_nicknames_string(users)}" end + @spec get_log_entry_message(ModerationLog) :: String.t() + def get_log_entry_message(%ModerationLog{ + data: %{ + "actor" => %{"nickname" => actor_nickname}, + "action" => "approve", + "subject" => users + } + }) do + "@#{actor_nickname} approved users: #{users_to_nicknames_string(users)}" + end + @spec get_log_entry_message(ModerationLog) :: String.t() def get_log_entry_message(%ModerationLog{ data: %{ diff --git a/lib/pleroma/notification.ex b/lib/pleroma/notification.ex index 9ee9606be..8868a910e 100644 --- a/lib/pleroma/notification.ex +++ b/lib/pleroma/notification.ex @@ -15,6 +15,7 @@ defmodule Pleroma.Notification do alias Pleroma.Repo alias Pleroma.ThreadMute alias Pleroma.User + alias Pleroma.Web.CommonAPI alias Pleroma.Web.CommonAPI.Utils alias Pleroma.Web.Push alias Pleroma.Web.Streamer @@ -130,6 +131,7 @@ def for_user_query(user, opts \\ %{}) do |> preload([n, a, o], activity: {a, object: o}) |> exclude_notification_muted(user, exclude_notification_muted_opts) |> exclude_blocked(user, exclude_blocked_opts) + |> exclude_filtered(user) |> exclude_visibility(opts) end @@ -158,6 +160,20 @@ defp exclude_notification_muted(query, user, opts) do |> where([n, a, o, tm], is_nil(tm.user_id)) end + defp exclude_filtered(query, user) do + case Pleroma.Filter.compose_regex(user) do + nil -> + query + + regex -> + from([_n, a, o] in query, + where: + fragment("not(?->>'content' ~* ?)", o.data, ^regex) or + fragment("?->>'actor' = ?", o.data, ^user.ap_id) + ) + end + end + @valid_visibilities ~w[direct unlisted public private] defp exclude_visibility(query, %{exclude_visibilities: visibility}) @@ -337,6 +353,7 @@ def dismiss(%{id: user_id} = _user, id) do end end + @spec create_notifications(Activity.t(), keyword()) :: {:ok, [Notification.t()] | []} def create_notifications(activity, options \\ []) def create_notifications(%Activity{data: %{"to" => _, "type" => "Create"}} = activity, options) do @@ -367,6 +384,7 @@ defp do_create_notifications(%Activity{} = activity, options) do do_send = do_send && user in enabled_receivers create_notification(activity, user, do_send) end) + |> Enum.reject(&is_nil/1) {:ok, notifications} end @@ -424,6 +442,7 @@ def create_notification(%Activity{} = activity, %User{} = user, do_send \\ true) |> Multi.insert(:notification, %Notification{ user_id: user.id, activity: activity, + seen: mark_as_read?(activity, user), type: type_from_activity(activity) }) |> Marker.multi_set_last_read_id(user, "notifications") @@ -480,6 +499,10 @@ def get_potential_receiver_ap_ids(%{data: %{"type" => type, "object" => object_i end end + def get_potential_receiver_ap_ids(%{data: %{"type" => "Follow", "object" => object_id}}) do + [object_id] + end + def get_potential_receiver_ap_ids(activity) do [] |> Utils.maybe_notify_to_recipients(activity) @@ -550,11 +573,9 @@ def skip?(%Activity{} = activity, %User{} = user) do [ :self, :invisible, - :followers, - :follows, - :non_followers, - :non_follows, - :recently_followed + :block_from_strangers, + :recently_followed, + :filtered ] |> Enum.find(&skip?(&1, activity, user)) end @@ -573,45 +594,15 @@ def skip?(:invisible, %Activity{} = activity, _) do end def skip?( - :followers, + :block_from_strangers, %Activity{} = activity, - %User{notification_settings: %{followers: false}} = user - ) do - actor = activity.data["actor"] - follower = User.get_cached_by_ap_id(actor) - User.following?(follower, user) - end - - def skip?( - :non_followers, - %Activity{} = activity, - %User{notification_settings: %{non_followers: false}} = user + %User{notification_settings: %{block_from_strangers: true}} = user ) do actor = activity.data["actor"] follower = User.get_cached_by_ap_id(actor) !User.following?(follower, user) end - def skip?( - :follows, - %Activity{} = activity, - %User{notification_settings: %{follows: false}} = user - ) do - actor = activity.data["actor"] - followed = User.get_cached_by_ap_id(actor) - User.following?(user, followed) - end - - def skip?( - :non_follows, - %Activity{} = activity, - %User{notification_settings: %{non_follows: false}} = user - ) do - actor = activity.data["actor"] - followed = User.get_cached_by_ap_id(actor) - !User.following?(user, followed) - end - # To do: consider defining recency in hours and checking FollowingRelationship with a single SQL def skip?(:recently_followed, %Activity{data: %{"type" => "Follow"}} = activity, %User{} = user) do actor = activity.data["actor"] @@ -623,8 +614,33 @@ def skip?(:recently_followed, %Activity{data: %{"type" => "Follow"}} = activity, end) end + def skip?(:filtered, %{data: %{"type" => type}}, _) when type in ["Follow", "Move"], do: false + + def skip?(:filtered, activity, user) do + object = Object.normalize(activity) + + cond do + is_nil(object) -> + false + + object.data["actor"] == user.ap_id -> + false + + not is_nil(regex = Pleroma.Filter.compose_regex(user, :re)) -> + Regex.match?(regex, object.data["content"]) + + true -> + false + end + end + def skip?(_, _, _), do: false + def mark_as_read?(activity, target_user) do + user = Activity.user_actor(activity) + User.mutes_user?(target_user, user) || CommonAPI.thread_muted?(target_user, activity) + end + def for_user_and_activity(user, activity) do from(n in __MODULE__, where: n.user_id == ^user.id, @@ -632,4 +648,16 @@ def for_user_and_activity(user, activity) do ) |> Repo.one() end + + @spec mark_context_as_read(User.t(), String.t()) :: {integer(), nil | [term()]} + def mark_context_as_read(%User{id: id}, context) do + from( + n in Notification, + join: a in assoc(n, :activity), + where: n.user_id == ^id, + where: n.seen == false, + where: fragment("?->>'context'", a.data) == ^context + ) + |> Repo.update_all(set: [seen: true]) + end end diff --git a/lib/pleroma/object.ex b/lib/pleroma/object.ex index 546c4ea01..052ad413b 100644 --- a/lib/pleroma/object.ex +++ b/lib/pleroma/object.ex @@ -255,6 +255,10 @@ def increase_replies_count(ap_id) do end end + defp poll_is_multiple?(%Object{data: %{"anyOf" => [_ | _]}}), do: true + + defp poll_is_multiple?(_), do: false + def decrease_replies_count(ap_id) do Object |> where([o], fragment("?->>'id' = ?::text", o.data, ^to_string(ap_id))) @@ -281,10 +285,10 @@ def decrease_replies_count(ap_id) do def increase_vote_count(ap_id, name, actor) do with %Object{} = object <- Object.normalize(ap_id), "Question" <- object.data["type"] do - multiple = Map.has_key?(object.data, "anyOf") + key = if poll_is_multiple?(object), do: "anyOf", else: "oneOf" options = - (object.data["anyOf"] || object.data["oneOf"] || []) + object.data[key] |> Enum.map(fn %{"name" => ^name} = option -> Kernel.update_in(option["replies"]["totalItems"], &(&1 + 1)) @@ -296,11 +300,8 @@ def increase_vote_count(ap_id, name, actor) do voters = [actor | object.data["voters"] || []] |> Enum.uniq() data = - if multiple do - Map.put(object.data, "anyOf", options) - else - Map.put(object.data, "oneOf", options) - end + object.data + |> Map.put(key, options) |> Map.put("voters", voters) object diff --git a/lib/pleroma/object/containment.ex b/lib/pleroma/object/containment.ex index 99608b8a5..29cb3d672 100644 --- a/lib/pleroma/object/containment.ex +++ b/lib/pleroma/object/containment.ex @@ -44,18 +44,11 @@ def get_object(_) do nil end - # TODO: We explicitly allow 'tag' URIs through, due to references to legacy OStatus - # objects being present in the test suite environment. Once these objects are - # removed, please also remove this. - if Mix.env() == :test do - defp compare_uris(_, %URI{scheme: "tag"}), do: :ok - end - defp compare_uris(%URI{host: host} = _id_uri, %URI{host: host} = _other_uri), do: :ok defp compare_uris(_id_uri, _other_uri), do: :error @doc """ - Checks that an imported AP object's actor matches the domain it came from. + Checks that an imported AP object's actor matches the host it came from. """ def contain_origin(_id, %{"actor" => nil}), do: :error diff --git a/lib/pleroma/object/fetcher.ex b/lib/pleroma/object/fetcher.ex index 263ded5dd..1de2ce6c3 100644 --- a/lib/pleroma/object/fetcher.ex +++ b/lib/pleroma/object/fetcher.ex @@ -9,6 +9,7 @@ defmodule Pleroma.Object.Fetcher do alias Pleroma.Repo alias Pleroma.Signature alias Pleroma.Web.ActivityPub.InternalFetchActor + alias Pleroma.Web.ActivityPub.ObjectValidator alias Pleroma.Web.ActivityPub.Transmogrifier alias Pleroma.Web.Federator @@ -23,21 +24,38 @@ defp touch_changeset(changeset) do Ecto.Changeset.put_change(changeset, :updated_at, updated_at) end - defp maybe_reinject_internal_fields(data, %{data: %{} = old_data}) do + defp maybe_reinject_internal_fields(%{data: %{} = old_data}, new_data) do internal_fields = Map.take(old_data, Pleroma.Constants.object_internal_fields()) - Map.merge(data, internal_fields) + Map.merge(new_data, internal_fields) end - defp maybe_reinject_internal_fields(data, _), do: data + defp maybe_reinject_internal_fields(_, new_data), do: new_data @spec reinject_object(struct(), map()) :: {:ok, Object.t()} | {:error, any()} - defp reinject_object(struct, data) do - Logger.debug("Reinjecting object #{data["id"]}") + defp reinject_object(%Object{data: %{"type" => "Question"}} = object, new_data) do + Logger.debug("Reinjecting object #{new_data["id"]}") - with data <- Transmogrifier.fix_object(data), - data <- maybe_reinject_internal_fields(data, struct), - changeset <- Object.change(struct, %{data: data}), + with data <- maybe_reinject_internal_fields(object, new_data), + {:ok, data, _} <- ObjectValidator.validate(data, %{}), + changeset <- Object.change(object, %{data: data}), + changeset <- touch_changeset(changeset), + {:ok, object} <- Repo.insert_or_update(changeset), + {:ok, object} <- Object.set_cache(object) do + {:ok, object} + else + e -> + Logger.error("Error while processing object: #{inspect(e)}") + {:error, e} + end + end + + defp reinject_object(%Object{} = object, new_data) do + Logger.debug("Reinjecting object #{new_data["id"]}") + + with new_data <- Transmogrifier.fix_object(new_data), + data <- maybe_reinject_internal_fields(object, new_data), + changeset <- Object.change(object, %{data: data}), changeset <- touch_changeset(changeset), {:ok, object} <- Repo.insert_or_update(changeset), {:ok, object} <- Object.set_cache(object) do @@ -51,8 +69,8 @@ defp reinject_object(struct, data) do def refetch_object(%Object{data: %{"id" => id}} = object) do with {:local, false} <- {:local, Object.local?(object)}, - {:ok, data} <- fetch_and_contain_remote_object_from_id(id), - {:ok, object} <- reinject_object(object, data) do + {:ok, new_data} <- fetch_and_contain_remote_object_from_id(id), + {:ok, object} <- reinject_object(object, new_data) do {:ok, object} else {:local, true} -> {:ok, object} @@ -83,8 +101,8 @@ def fetch_object_from_id(id, options \\ []) do {:transmogrifier, {:error, {:reject, nil}}} -> {:reject, nil} - {:transmogrifier, _} -> - {:error, "Transmogrifier failure."} + {:transmogrifier, _} = e -> + {:error, e} {:object, data, nil} -> reinject_object(%Object{}, data) @@ -106,8 +124,8 @@ def fetch_object_from_id(id, options \\ []) do defp prepare_activity_params(data) do %{ "type" => "Create", - "to" => data["to"], - "cc" => data["cc"], + "to" => data["to"] || [], + "cc" => data["cc"] || [], # Should we seriously keep this attributedTo thing? "actor" => data["actor"] || data["attributedTo"], "object" => data @@ -124,6 +142,10 @@ def fetch_object_from_id!(id, options \\ []) do {:error, "Object has been deleted"} -> nil + {:reject, reason} -> + Logger.info("Rejected #{id} while fetching: #{inspect(reason)}") + nil + e -> Logger.error("Error while fetching #{id}: #{inspect(e)}") nil @@ -141,12 +163,12 @@ defp make_signature(id, date) do date: date }) - [{"signature", signature}] + {"signature", signature} end defp sign_fetch(headers, id, date) do if Pleroma.Config.get([:activitypub, :sign_object_fetches]) do - headers ++ make_signature(id, date) + [make_signature(id, date) | headers] else headers end @@ -154,7 +176,7 @@ defp sign_fetch(headers, id, date) do defp maybe_date_fetch(headers, date) do if Pleroma.Config.get([:activitypub, :sign_object_fetches]) do - headers ++ [{"date", date}] + [{"date", date} | headers] else headers end diff --git a/lib/pleroma/pagination.ex b/lib/pleroma/pagination.ex index 1b99e44f9..9a3795769 100644 --- a/lib/pleroma/pagination.ex +++ b/lib/pleroma/pagination.ex @@ -64,6 +64,12 @@ def fetch_paginated(query, params, :offset, table_binding) do @spec paginate(Ecto.Query.t(), map(), type(), atom() | nil) :: [Ecto.Schema.t()] def paginate(query, options, method \\ :keyset, table_binding \\ nil) + def paginate(list, options, _method, _table_binding) when is_list(list) do + offset = options[:offset] || 0 + limit = options[:limit] || 0 + Enum.slice(list, offset, limit) + end + def paginate(query, options, :keyset, table_binding) do query |> restrict(:min_id, options, table_binding) diff --git a/lib/pleroma/plugs/admin_secret_authentication_plug.ex b/lib/pleroma/plugs/admin_secret_authentication_plug.ex index b4b47a31f..2e54df47a 100644 --- a/lib/pleroma/plugs/admin_secret_authentication_plug.ex +++ b/lib/pleroma/plugs/admin_secret_authentication_plug.ex @@ -4,6 +4,9 @@ defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do import Plug.Conn + + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.Plugs.RateLimiter alias Pleroma.User def init(options) do @@ -11,7 +14,10 @@ def init(options) do end def secret_token do - Pleroma.Config.get(:admin_token) + case Pleroma.Config.get(:admin_token) do + blank when blank in [nil, ""] -> nil + token -> token + end end def call(%{assigns: %{user: %User{}}} = conn, _), do: conn @@ -26,9 +32,9 @@ def call(conn, _) do def authenticate(%{params: %{"admin_token" => admin_token}} = conn) do if admin_token == secret_token() do - assign(conn, :user, %User{is_admin: true}) + assign_admin_user(conn) else - conn + handle_bad_token(conn) end end @@ -36,8 +42,19 @@ def authenticate(conn) do token = secret_token() case get_req_header(conn, "x-admin-token") do - [^token] -> assign(conn, :user, %User{is_admin: true}) - _ -> conn + blank when blank in [[], [""]] -> conn + [^token] -> assign_admin_user(conn) + _ -> handle_bad_token(conn) end end + + defp assign_admin_user(conn) do + conn + |> assign(:user, %User{is_admin: true}) + |> OAuthScopesPlug.skip_plug() + end + + defp handle_bad_token(conn) do + RateLimiter.call(conn, name: :authentication) + end end diff --git a/lib/pleroma/plugs/frontend_static.ex b/lib/pleroma/plugs/frontend_static.ex new file mode 100644 index 000000000..11a0d5382 --- /dev/null +++ b/lib/pleroma/plugs/frontend_static.ex @@ -0,0 +1,55 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Plugs.FrontendStatic do + require Pleroma.Constants + + @moduledoc """ + This is a shim to call `Plug.Static` but with runtime `from` configuration`. It dispatches to the different frontends. + """ + @behaviour Plug + + def file_path(path, frontend_type \\ :primary) do + if configuration = Pleroma.Config.get([:frontends, frontend_type]) do + instance_static_path = Pleroma.Config.get([:instance, :static_dir], "instance/static") + + Path.join([ + instance_static_path, + "frontends", + configuration["name"], + configuration["ref"], + path + ]) + else + nil + end + end + + def init(opts) do + opts + |> Keyword.put(:from, "__unconfigured_frontend_static_plug") + |> Plug.Static.init() + |> Map.put(:frontend_type, opts[:frontend_type]) + end + + def call(conn, opts) do + frontend_type = Map.get(opts, :frontend_type, :primary) + path = file_path("", frontend_type) + + if path do + conn + |> call_static(opts, path) + else + conn + end + end + + defp call_static(conn, opts, from) do + opts = + opts + |> Map.put(:from, from) + + Plug.Static.call(conn, opts) + end +end diff --git a/lib/pleroma/plugs/http_security_plug.ex b/lib/pleroma/plugs/http_security_plug.ex index 1420a9611..c363b193b 100644 --- a/lib/pleroma/plugs/http_security_plug.ex +++ b/lib/pleroma/plugs/http_security_plug.ex @@ -69,10 +69,11 @@ defp csp_string do img_src = "img-src 'self' data: blob:" media_src = "media-src 'self'" + # Strict multimedia CSP enforcement only when MediaProxy is enabled {img_src, media_src} = if Config.get([:media_proxy, :enabled]) && !Config.get([:media_proxy, :proxy_opts, :redirect_on_failure]) do - sources = get_proxy_and_attachment_sources() + sources = build_csp_multimedia_source_list() {[img_src, sources], [media_src, sources]} else {[img_src, " https:"], [media_src, " https:"]} @@ -81,14 +82,14 @@ defp csp_string do connect_src = ["connect-src 'self' blob: ", static_url, ?\s, websocket_url] connect_src = - if Pleroma.Config.get(:env) == :dev do + if Config.get(:env) == :dev do [connect_src, " http://localhost:3035/"] else connect_src end script_src = - if Pleroma.Config.get(:env) == :dev do + if Config.get(:env) == :dev do "script-src 'self' 'unsafe-eval'" else "script-src 'self'" @@ -107,38 +108,64 @@ defp csp_string do |> :erlang.iolist_to_binary() end - defp get_proxy_and_attachment_sources do + defp build_csp_from_whitelist([], acc), do: acc + + defp build_csp_from_whitelist([last], acc) do + [build_csp_param_from_whitelist(last) | acc] + end + + defp build_csp_from_whitelist([head | tail], acc) do + build_csp_from_whitelist(tail, [[?\s, build_csp_param_from_whitelist(head)] | acc]) + end + + # TODO: use `build_csp_param/1` after removing support bare domains for media proxy whitelist + defp build_csp_param_from_whitelist("http" <> _ = url) do + build_csp_param(url) + end + + defp build_csp_param_from_whitelist(url), do: url + + defp build_csp_multimedia_source_list do media_proxy_whitelist = - Enum.reduce(Config.get([:media_proxy, :whitelist]), [], fn host, acc -> - add_source(acc, host) - end) + [:media_proxy, :whitelist] + |> Config.get() + |> build_csp_from_whitelist([]) - media_proxy_base_url = - if Config.get([:media_proxy, :base_url]), - do: URI.parse(Config.get([:media_proxy, :base_url])).host + captcha_method = Config.get([Pleroma.Captcha, :method]) + captcha_endpoint = Config.get([captcha_method, :endpoint]) - upload_base_url = - if Config.get([Pleroma.Upload, :base_url]), - do: URI.parse(Config.get([Pleroma.Upload, :base_url])).host + base_endpoints = + [ + [:media_proxy, :base_url], + [Pleroma.Upload, :base_url], + [Pleroma.Uploaders.S3, :public_endpoint] + ] + |> Enum.map(&Config.get/1) - s3_endpoint = - if Config.get([Pleroma.Upload, :uploader]) == Pleroma.Uploaders.S3, - do: URI.parse(Config.get([Pleroma.Uploaders.S3, :public_endpoint])).host - - [] - |> add_source(media_proxy_base_url) - |> add_source(upload_base_url) - |> add_source(s3_endpoint) + [captcha_endpoint | base_endpoints] + |> Enum.map(&build_csp_param/1) + |> Enum.reduce([], &add_source(&2, &1)) |> add_source(media_proxy_whitelist) end defp add_source(iodata, nil), do: iodata + defp add_source(iodata, []), do: iodata defp add_source(iodata, source), do: [[?\s, source] | iodata] defp add_csp_param(csp_iodata, nil), do: csp_iodata defp add_csp_param(csp_iodata, param), do: [[param, ?;] | csp_iodata] + defp build_csp_param(nil), do: nil + + defp build_csp_param(url) when is_binary(url) do + %{host: host, scheme: scheme} = URI.parse(url) + + if scheme do + [scheme, "://", host] + end + end + def warn_if_disabled do unless Config.get([:http_security, :enabled]) do Logger.warn(" diff --git a/lib/pleroma/plugs/instance_static.ex b/lib/pleroma/plugs/instance_static.ex index 7516f75c3..0fb57e422 100644 --- a/lib/pleroma/plugs/instance_static.ex +++ b/lib/pleroma/plugs/instance_static.ex @@ -16,28 +16,24 @@ def file_path(path) do instance_path = Path.join(Pleroma.Config.get([:instance, :static_dir], "instance/static/"), path) - if File.exists?(instance_path) do - instance_path - else + frontend_path = Pleroma.Plugs.FrontendStatic.file_path(path, :primary) + + (File.exists?(instance_path) && instance_path) || + (frontend_path && File.exists?(frontend_path) && frontend_path) || Path.join(Application.app_dir(:pleroma, "priv/static/"), path) - end end def init(opts) do opts |> Keyword.put(:from, "__unconfigured_instance_static_plug") - |> Keyword.put(:at, "/__unconfigured_instance_static_plug") |> Plug.Static.init() end for only <- Pleroma.Constants.static_only_files() do - at = Plug.Router.Utils.split("/") - def call(%{request_path: "/" <> unquote(only) <> _} = conn, opts) do call_static( conn, opts, - unquote(at), Pleroma.Config.get([:instance, :static_dir], "instance/static") ) end @@ -47,11 +43,10 @@ def call(conn, _) do conn end - defp call_static(conn, opts, at, from) do + defp call_static(conn, opts, from) do opts = opts |> Map.put(:from, from) - |> Map.put(:at, at) Plug.Static.call(conn, opts) end diff --git a/lib/pleroma/plugs/remote_ip.ex b/lib/pleroma/plugs/remote_ip.ex index 2eca4f8f6..0ac9050d0 100644 --- a/lib/pleroma/plugs/remote_ip.ex +++ b/lib/pleroma/plugs/remote_ip.ex @@ -7,6 +7,8 @@ defmodule Pleroma.Plugs.RemoteIp do This is a shim to call [`RemoteIp`](https://git.pleroma.social/pleroma/remote_ip) but with runtime configuration. """ + import Plug.Conn + @behaviour Plug @headers ~w[ @@ -26,11 +28,12 @@ defmodule Pleroma.Plugs.RemoteIp do def init(_), do: nil - def call(conn, _) do + def call(%{remote_ip: original_remote_ip} = conn, _) do config = Pleroma.Config.get(__MODULE__, []) if Keyword.get(config, :enabled, false) do - RemoteIp.call(conn, remote_ip_opts(config)) + %{remote_ip: new_remote_ip} = conn = RemoteIp.call(conn, remote_ip_opts(config)) + assign(conn, :remote_ip_found, original_remote_ip != new_remote_ip) else conn end diff --git a/lib/pleroma/plugs/static_fe_plug.ex b/lib/pleroma/plugs/static_fe_plug.ex index 156e6788e..143665c71 100644 --- a/lib/pleroma/plugs/static_fe_plug.ex +++ b/lib/pleroma/plugs/static_fe_plug.ex @@ -9,7 +9,7 @@ defmodule Pleroma.Plugs.StaticFEPlug do def init(options), do: options def call(conn, _) do - if enabled?() and accepts_html?(conn) do + if enabled?() and requires_html?(conn) do conn |> StaticFEController.call(:show) |> halt() @@ -20,10 +20,7 @@ def call(conn, _) do defp enabled?, do: Pleroma.Config.get([:static_fe, :enabled], false) - defp accepts_html?(conn) do - case get_req_header(conn, "accept") do - [accept | _] -> String.contains?(accept, "text/html") - _ -> false - end + defp requires_html?(conn) do + Phoenix.Controller.get_format(conn) == "html" end end diff --git a/lib/pleroma/plugs/uploaded_media.ex b/lib/pleroma/plugs/uploaded_media.ex index 94147e0c4..40984cfc0 100644 --- a/lib/pleroma/plugs/uploaded_media.ex +++ b/lib/pleroma/plugs/uploaded_media.ex @@ -10,6 +10,8 @@ defmodule Pleroma.Plugs.UploadedMedia do import Pleroma.Web.Gettext require Logger + alias Pleroma.Web.MediaProxy + @behaviour Plug # no slashes @path "media" @@ -35,8 +37,7 @@ def call(%{request_path: <<"/", @path, "/", file::binary>>} = conn, opts) do %{query_params: %{"name" => name}} = conn -> name = String.replace(name, "\"", "\\\"") - conn - |> put_resp_header("content-disposition", "filename=\"#{name}\"") + put_resp_header(conn, "content-disposition", "filename=\"#{name}\"") conn -> conn @@ -47,7 +48,8 @@ def call(%{request_path: <<"/", @path, "/", file::binary>>} = conn, opts) do with uploader <- Keyword.fetch!(config, :uploader), proxy_remote = Keyword.get(config, :proxy_remote, false), - {:ok, get_method} <- uploader.get_file(file) do + {:ok, get_method} <- uploader.get_file(file), + false <- media_is_banned(conn, get_method) do get_media(conn, get_method, proxy_remote, opts) else _ -> @@ -59,6 +61,14 @@ def call(%{request_path: <<"/", @path, "/", file::binary>>} = conn, opts) do def call(conn, _opts), do: conn + defp media_is_banned(%{request_path: path} = _conn, {:static_dir, _}) do + MediaProxy.in_banned_urls(Pleroma.Web.base_url() <> path) + end + + defp media_is_banned(_, {:url, url}), do: MediaProxy.in_banned_urls(url) + + defp media_is_banned(_, _), do: false + defp get_media(conn, {:static_dir, directory}, _, opts) do static_opts = Map.get(opts, :static_plug_opts) diff --git a/lib/pleroma/plugs/user_is_admin_plug.ex b/lib/pleroma/plugs/user_is_admin_plug.ex index 2748102df..488a61d1d 100644 --- a/lib/pleroma/plugs/user_is_admin_plug.ex +++ b/lib/pleroma/plugs/user_is_admin_plug.ex @@ -7,37 +7,18 @@ defmodule Pleroma.Plugs.UserIsAdminPlug do import Plug.Conn alias Pleroma.User - alias Pleroma.Web.OAuth def init(options) do options end - def call(%{assigns: %{user: %User{is_admin: true}} = assigns} = conn, _) do - token = assigns[:token] - - cond do - not Pleroma.Config.enforce_oauth_admin_scope_usage?() -> - conn - - token && OAuth.Scopes.contains_admin_scopes?(token.scopes) -> - # Note: checking for _any_ admin scope presence, not necessarily fitting requested action. - # Thus, controller must explicitly invoke OAuthScopesPlug to verify scope requirements. - # Admin might opt out of admin scope for some apps to block any admin actions from them. - conn - - true -> - fail(conn) - end + def call(%{assigns: %{user: %User{is_admin: true}}} = conn, _) do + conn end def call(conn, _) do - fail(conn) - end - - defp fail(conn) do conn - |> render_error(:forbidden, "User is not an admin or OAuth admin scope is not granted.") + |> render_error(:forbidden, "User is not an admin.") |> halt() end end diff --git a/lib/pleroma/pool/connections.ex b/lib/pleroma/pool/connections.ex deleted file mode 100644 index acafe1bea..000000000 --- a/lib/pleroma/pool/connections.ex +++ /dev/null @@ -1,283 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Pool.Connections do - use GenServer - - alias Pleroma.Config - alias Pleroma.Gun - - require Logger - - @type domain :: String.t() - @type conn :: Pleroma.Gun.Conn.t() - - @type t :: %__MODULE__{ - conns: %{domain() => conn()}, - opts: keyword() - } - - defstruct conns: %{}, opts: [] - - @spec start_link({atom(), keyword()}) :: {:ok, pid()} - def start_link({name, opts}) do - GenServer.start_link(__MODULE__, opts, name: name) - end - - @impl true - def init(opts), do: {:ok, %__MODULE__{conns: %{}, opts: opts}} - - @spec checkin(String.t() | URI.t(), atom()) :: pid() | nil - def checkin(url, name) - def checkin(url, name) when is_binary(url), do: checkin(URI.parse(url), name) - - def checkin(%URI{} = uri, name) do - timeout = Config.get([:connections_pool, :checkin_timeout], 250) - - GenServer.call(name, {:checkin, uri}, timeout) - end - - @spec alive?(atom()) :: boolean() - def alive?(name) do - if pid = Process.whereis(name) do - Process.alive?(pid) - else - false - end - end - - @spec get_state(atom()) :: t() - def get_state(name) do - GenServer.call(name, :state) - end - - @spec count(atom()) :: pos_integer() - def count(name) do - GenServer.call(name, :count) - end - - @spec get_unused_conns(atom()) :: [{domain(), conn()}] - def get_unused_conns(name) do - GenServer.call(name, :unused_conns) - end - - @spec checkout(pid(), pid(), atom()) :: :ok - def checkout(conn, pid, name) do - GenServer.cast(name, {:checkout, conn, pid}) - end - - @spec add_conn(atom(), String.t(), Pleroma.Gun.Conn.t()) :: :ok - def add_conn(name, key, conn) do - GenServer.cast(name, {:add_conn, key, conn}) - end - - @spec remove_conn(atom(), String.t()) :: :ok - def remove_conn(name, key) do - GenServer.cast(name, {:remove_conn, key}) - end - - @impl true - def handle_cast({:add_conn, key, conn}, state) do - state = put_in(state.conns[key], conn) - - Process.monitor(conn.conn) - {:noreply, state} - end - - @impl true - def handle_cast({:checkout, conn_pid, pid}, state) do - state = - with true <- Process.alive?(conn_pid), - {key, conn} <- find_conn(state.conns, conn_pid), - used_by <- List.keydelete(conn.used_by, pid, 0) do - conn_state = if used_by == [], do: :idle, else: conn.conn_state - - put_in(state.conns[key], %{conn | conn_state: conn_state, used_by: used_by}) - else - false -> - Logger.debug("checkout for closed conn #{inspect(conn_pid)}") - state - - nil -> - Logger.debug("checkout for alive conn #{inspect(conn_pid)}, but is not in state") - state - end - - {:noreply, state} - end - - @impl true - def handle_cast({:remove_conn, key}, state) do - state = put_in(state.conns, Map.delete(state.conns, key)) - {:noreply, state} - end - - @impl true - def handle_call({:checkin, uri}, from, state) do - key = "#{uri.scheme}:#{uri.host}:#{uri.port}" - - case state.conns[key] do - %{conn: pid, gun_state: :up} = conn -> - time = :os.system_time(:second) - last_reference = time - conn.last_reference - crf = crf(last_reference, 100, conn.crf) - - state = - put_in(state.conns[key], %{ - conn - | last_reference: time, - crf: crf, - conn_state: :active, - used_by: [from | conn.used_by] - }) - - {:reply, pid, state} - - %{gun_state: :down} -> - {:reply, nil, state} - - nil -> - {:reply, nil, state} - end - end - - @impl true - def handle_call(:state, _from, state), do: {:reply, state, state} - - @impl true - def handle_call(:count, _from, state) do - {:reply, Enum.count(state.conns), state} - end - - @impl true - def handle_call(:unused_conns, _from, state) do - unused_conns = - state.conns - |> Enum.filter(&filter_conns/1) - |> Enum.sort(&sort_conns/2) - - {:reply, unused_conns, state} - end - - defp filter_conns({_, %{conn_state: :idle, used_by: []}}), do: true - defp filter_conns(_), do: false - - defp sort_conns({_, c1}, {_, c2}) do - c1.crf <= c2.crf and c1.last_reference <= c2.last_reference - end - - @impl true - def handle_info({:gun_up, conn_pid, _protocol}, state) do - %{origin_host: host, origin_scheme: scheme, origin_port: port} = Gun.info(conn_pid) - - host = - case :inet.ntoa(host) do - {:error, :einval} -> host - ip -> ip - end - - key = "#{scheme}:#{host}:#{port}" - - state = - with {key, conn} <- find_conn(state.conns, conn_pid, key), - {true, key} <- {Process.alive?(conn_pid), key} do - put_in(state.conns[key], %{ - conn - | gun_state: :up, - conn_state: :active, - retries: 0 - }) - else - {false, key} -> - put_in( - state.conns, - Map.delete(state.conns, key) - ) - - nil -> - :ok = Gun.close(conn_pid) - - state - end - - {:noreply, state} - end - - @impl true - def handle_info({:gun_down, conn_pid, _protocol, _reason, _killed}, state) do - retries = Config.get([:connections_pool, :retry], 1) - # we can't get info on this pid, because pid is dead - state = - with {key, conn} <- find_conn(state.conns, conn_pid), - {true, key} <- {Process.alive?(conn_pid), key} do - if conn.retries == retries do - :ok = Gun.close(conn.conn) - - put_in( - state.conns, - Map.delete(state.conns, key) - ) - else - put_in(state.conns[key], %{ - conn - | gun_state: :down, - retries: conn.retries + 1 - }) - end - else - {false, key} -> - put_in( - state.conns, - Map.delete(state.conns, key) - ) - - nil -> - Logger.debug(":gun_down for conn which isn't found in state") - - state - end - - {:noreply, state} - end - - @impl true - def handle_info({:DOWN, _ref, :process, conn_pid, reason}, state) do - Logger.debug("received DOWN message for #{inspect(conn_pid)} reason -> #{inspect(reason)}") - - state = - with {key, conn} <- find_conn(state.conns, conn_pid) do - Enum.each(conn.used_by, fn {pid, _ref} -> - Process.exit(pid, reason) - end) - - put_in( - state.conns, - Map.delete(state.conns, key) - ) - else - nil -> - Logger.debug(":DOWN for conn which isn't found in state") - - state - end - - {:noreply, state} - end - - defp find_conn(conns, conn_pid) do - Enum.find(conns, fn {_key, conn} -> - conn.conn == conn_pid - end) - end - - defp find_conn(conns, conn_pid, conn_key) do - Enum.find(conns, fn {key, conn} -> - key == conn_key and conn.conn == conn_pid - end) - end - - def crf(current, steps, crf) do - 1 + :math.pow(0.5, current / steps) * crf - end -end diff --git a/lib/pleroma/pool/pool.ex b/lib/pleroma/pool/pool.ex deleted file mode 100644 index 21a6fbbc5..000000000 --- a/lib/pleroma/pool/pool.ex +++ /dev/null @@ -1,22 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Pool do - def child_spec(opts) do - poolboy_opts = - opts - |> Keyword.put(:worker_module, Pleroma.Pool.Request) - |> Keyword.put(:name, {:local, opts[:name]}) - |> Keyword.put(:size, opts[:size]) - |> Keyword.put(:max_overflow, opts[:max_overflow]) - - %{ - id: opts[:id] || {__MODULE__, make_ref()}, - start: {:poolboy, :start_link, [poolboy_opts, [name: opts[:name]]]}, - restart: :permanent, - shutdown: 5000, - type: :worker - } - end -end diff --git a/lib/pleroma/pool/request.ex b/lib/pleroma/pool/request.ex deleted file mode 100644 index 3fb930db7..000000000 --- a/lib/pleroma/pool/request.ex +++ /dev/null @@ -1,65 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Pool.Request do - use GenServer - - require Logger - - def start_link(args) do - GenServer.start_link(__MODULE__, args) - end - - @impl true - def init(_), do: {:ok, []} - - @spec execute(pid() | atom(), Tesla.Client.t(), keyword(), pos_integer()) :: - {:ok, Tesla.Env.t()} | {:error, any()} - def execute(pid, client, request, timeout) do - GenServer.call(pid, {:execute, client, request}, timeout) - end - - @impl true - def handle_call({:execute, client, request}, _from, state) do - response = Pleroma.HTTP.request(client, request) - - {:reply, response, state} - end - - @impl true - def handle_info({:gun_data, _conn, _stream, _, _}, state) do - {:noreply, state} - end - - @impl true - def handle_info({:gun_up, _conn, _protocol}, state) do - {:noreply, state} - end - - @impl true - def handle_info({:gun_down, _conn, _protocol, _reason, _killed}, state) do - {:noreply, state} - end - - @impl true - def handle_info({:gun_error, _conn, _stream, _error}, state) do - {:noreply, state} - end - - @impl true - def handle_info({:gun_push, _conn, _stream, _new_stream, _method, _uri, _headers}, state) do - {:noreply, state} - end - - @impl true - def handle_info({:gun_response, _conn, _stream, _, _status, _headers}, state) do - {:noreply, state} - end - - @impl true - def handle_info(msg, state) do - Logger.warn("Received unexpected message #{inspect(__MODULE__)} #{inspect(msg)}") - {:noreply, state} - end -end diff --git a/lib/pleroma/pool/supervisor.ex b/lib/pleroma/pool/supervisor.ex deleted file mode 100644 index faf646cb2..000000000 --- a/lib/pleroma/pool/supervisor.ex +++ /dev/null @@ -1,42 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Pool.Supervisor do - use Supervisor - - alias Pleroma.Config - alias Pleroma.Pool - - def start_link(args) do - Supervisor.start_link(__MODULE__, args, name: __MODULE__) - end - - def init(_) do - conns_child = %{ - id: Pool.Connections, - start: - {Pool.Connections, :start_link, [{:gun_connections, Config.get([:connections_pool])}]} - } - - Supervisor.init([conns_child | pools()], strategy: :one_for_one) - end - - defp pools do - pools = Config.get(:pools) - - pools = - if Config.get([Pleroma.Upload, :proxy_remote]) == false do - Keyword.delete(pools, :upload) - else - pools - end - - for {pool_name, pool_opts} <- pools do - pool_opts - |> Keyword.put(:id, {Pool, pool_name}) - |> Keyword.put(:name, pool_name) - |> Pool.child_spec() - end - end -end diff --git a/lib/pleroma/repo.ex b/lib/pleroma/repo.ex index f62138466..f317e4d58 100644 --- a/lib/pleroma/repo.ex +++ b/lib/pleroma/repo.ex @@ -8,11 +8,10 @@ defmodule Pleroma.Repo do adapter: Ecto.Adapters.Postgres, migration_timestamps: [type: :naive_datetime_usec] + import Ecto.Query require Logger - defmodule Instrumenter do - use Prometheus.EctoInstrumenter - end + defmodule Instrumenter, do: use(Prometheus.EctoInstrumenter) @doc """ Dynamically loads the repository url from the @@ -50,36 +49,30 @@ def get_assoc(resource, association) do end end - def check_migrations_applied!() do - unless Pleroma.Config.get( - [:i_am_aware_this_may_cause_data_loss, :disable_migration_check], - false - ) do - Ecto.Migrator.with_repo(__MODULE__, fn repo -> - down_migrations = - Ecto.Migrator.migrations(repo) - |> Enum.reject(fn - {:up, _, _} -> true - {:down, _, _} -> false - end) + def chunk_stream(query, chunk_size) do + # We don't actually need start and end funcitons of resource streaming, + # but it seems to be the only way to not fetch records one-by-one and + # have individual records be the elements of the stream, instead of + # lists of records + Stream.resource( + fn -> 0 end, + fn + last_id -> + query + |> order_by(asc: :id) + |> where([r], r.id > ^last_id) + |> limit(^chunk_size) + |> all() + |> case do + [] -> + {:halt, last_id} - if length(down_migrations) > 0 do - down_migrations_text = - Enum.map(down_migrations, fn {:down, id, name} -> "- #{name} (#{id})\n" end) - - Logger.error( - "The following migrations were not applied:\n#{down_migrations_text}If you want to start Pleroma anyway, set\nconfig :pleroma, :i_am_aware_this_may_cause_data_loss, disable_migration_check: true" - ) - - raise Pleroma.Repo.UnappliedMigrationsError - end - end) - else - :ok - end + records -> + last_id = List.last(records).id + {records, last_id} + end + end, + fn _ -> :ok end + ) end end - -defmodule Pleroma.Repo.UnappliedMigrationsError do - defexception message: "Unapplied Migrations detected" -end diff --git a/lib/pleroma/reverse_proxy/client/hackney.ex b/lib/pleroma/reverse_proxy/client/hackney.ex index e84118a90..ad988fac3 100644 --- a/lib/pleroma/reverse_proxy/client/hackney.ex +++ b/lib/pleroma/reverse_proxy/client/hackney.ex @@ -7,6 +7,7 @@ defmodule Pleroma.ReverseProxy.Client.Hackney do @impl true def request(method, url, headers, body, opts \\ []) do + opts = Keyword.put(opts, :ssl_options, versions: [:"tlsv1.2", :"tlsv1.1", :tlsv1]) :hackney.request(method, url, headers, body, opts) end diff --git a/lib/pleroma/reverse_proxy/client/tesla.ex b/lib/pleroma/reverse_proxy/client/tesla.ex index e81ea8bde..4b118eec2 100644 --- a/lib/pleroma/reverse_proxy/client/tesla.ex +++ b/lib/pleroma/reverse_proxy/client/tesla.ex @@ -5,6 +5,8 @@ defmodule Pleroma.ReverseProxy.Client.Tesla do @behaviour Pleroma.ReverseProxy.Client + alias Pleroma.Gun.ConnectionPool + @type headers() :: [{String.t(), String.t()}] @type status() :: pos_integer() @@ -26,11 +28,13 @@ def request(method, url, headers, body, opts \\ []) do url, body, headers, - Keyword.put(opts, :adapter, opts) + opts ) do if is_map(response.body) and method != :head do {:ok, response.status, response.headers, response.body} else + conn_pid = response.opts[:adapter][:conn] + ConnectionPool.release_conn(conn_pid) {:ok, response.status, response.headers} end else @@ -41,15 +45,8 @@ def request(method, url, headers, body, opts \\ []) do @impl true @spec stream_body(map()) :: {:ok, binary(), map()} | {:error, atom() | String.t()} | :done | no_return() - def stream_body(%{pid: pid, opts: opts, fin: true}) do - # if connection was reused, but in tesla were redirects, - # tesla returns new opened connection, which must be closed manually - if opts[:old_conn], do: Tesla.Adapter.Gun.close(pid) - # if there were redirects we need to checkout old conn - conn = opts[:old_conn] || opts[:conn] - - if conn, do: :ok = Pleroma.Pool.Connections.checkout(conn, self(), :gun_connections) - + def stream_body(%{pid: pid, fin: true}) do + ConnectionPool.release_conn(pid) :done end @@ -74,8 +71,7 @@ defp read_chunk!(%{pid: pid, stream: stream, opts: opts}) do @impl true @spec close(map) :: :ok | no_return() def close(%{pid: pid}) do - adapter = check_adapter() - adapter.close(pid) + ConnectionPool.release_conn(pid) end defp check_adapter do diff --git a/lib/pleroma/reverse_proxy/reverse_proxy.ex b/lib/pleroma/reverse_proxy/reverse_proxy.ex index 4bbeb493c..0de4e2309 100644 --- a/lib/pleroma/reverse_proxy/reverse_proxy.ex +++ b/lib/pleroma/reverse_proxy/reverse_proxy.ex @@ -3,12 +3,13 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.ReverseProxy do + @range_headers ~w(range if-range) @keep_req_headers ~w(accept user-agent accept-encoding cache-control if-modified-since) ++ - ~w(if-unmodified-since if-none-match if-range range) + ~w(if-unmodified-since if-none-match) ++ @range_headers @resp_cache_headers ~w(etag date last-modified) @keep_resp_headers @resp_cache_headers ++ - ~w(content-type content-disposition content-encoding content-range) ++ - ~w(accept-ranges vary) + ~w(content-length content-type content-disposition content-encoding) ++ + ~w(content-range accept-ranges vary) @default_cache_control_header "public, max-age=1209600" @valid_resp_codes [200, 206, 304] @max_read_duration :timer.seconds(30) @@ -164,12 +165,17 @@ defp request(method, url, headers, opts) do {:ok, code, _, _} -> {:error, {:invalid_http_response, code}} + {:ok, code, _} -> + {:error, {:invalid_http_response, code}} + {:error, error} -> {:error, error} end end defp response(conn, client, url, status, headers, opts) do + Logger.debug("#{__MODULE__} #{status} #{url} #{inspect(headers)}") + result = conn |> put_resp_headers(build_resp_headers(headers, opts)) @@ -220,7 +226,9 @@ defp chunk_reply(conn, client, opts, sent_so_far, duration) do end end - defp head_response(conn, _url, code, headers, opts) do + defp head_response(conn, url, code, headers, opts) do + Logger.debug("#{__MODULE__} #{code} #{url} #{inspect(headers)}") + conn |> put_resp_headers(build_resp_headers(headers, opts)) |> send_resp(code, "") @@ -262,20 +270,33 @@ defp build_req_headers(headers, opts) do headers |> downcase_headers() |> Enum.filter(fn {k, _} -> k in @keep_req_headers end) - |> (fn headers -> - headers = headers ++ Keyword.get(opts, :req_headers, []) + |> build_req_range_or_encoding_header(opts) + |> build_req_user_agent_header(opts) + |> Keyword.merge(Keyword.get(opts, :req_headers, [])) + end - if Keyword.get(opts, :keep_user_agent, false) do - List.keystore( - headers, - "user-agent", - 0, - {"user-agent", Pleroma.Application.user_agent()} - ) - else - headers - end - end).() + # Disable content-encoding if any @range_headers are requested (see #1823). + defp build_req_range_or_encoding_header(headers, _opts) do + range? = Enum.any?(headers, fn {header, _} -> Enum.member?(@range_headers, header) end) + + if range? && List.keymember?(headers, "accept-encoding", 0) do + List.keydelete(headers, "accept-encoding", 0) + else + headers + end + end + + defp build_req_user_agent_header(headers, opts) do + if Keyword.get(opts, :keep_user_agent, false) do + List.keystore( + headers, + "user-agent", + 0, + {"user-agent", Pleroma.Application.user_agent()} + ) + else + headers + end end defp build_resp_headers(headers, opts) do @@ -283,7 +304,7 @@ defp build_resp_headers(headers, opts) do |> Enum.filter(fn {k, _} -> k in @keep_resp_headers end) |> build_resp_cache_headers(opts) |> build_resp_content_disposition_header(opts) - |> (fn headers -> headers ++ Keyword.get(opts, :resp_headers, []) end).() + |> Keyword.merge(Keyword.get(opts, :resp_headers, [])) end defp build_resp_cache_headers(headers, _opts) do diff --git a/lib/pleroma/signature.ex b/lib/pleroma/signature.ex index d01728361..3aa6909d2 100644 --- a/lib/pleroma/signature.ex +++ b/lib/pleroma/signature.ex @@ -5,10 +5,10 @@ defmodule Pleroma.Signature do @behaviour HTTPSignatures.Adapter + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Keys alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub - alias Pleroma.Web.ActivityPub.ObjectValidators.Types def key_id_to_actor_id(key_id) do uri = @@ -24,7 +24,7 @@ def key_id_to_actor_id(key_id) do maybe_ap_id = URI.to_string(uri) - case Types.ObjectID.cast(maybe_ap_id) do + case ObjectValidators.ObjectID.cast(maybe_ap_id) do {:ok, ap_id} -> {:ok, ap_id} diff --git a/lib/pleroma/stats.ex b/lib/pleroma/stats.ex index 6b3a8a41f..e5c9c668b 100644 --- a/lib/pleroma/stats.ex +++ b/lib/pleroma/stats.ex @@ -3,12 +3,15 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Stats do + use GenServer + import Ecto.Query + alias Pleroma.CounterCache alias Pleroma.Repo alias Pleroma.User - use GenServer + @interval :timer.seconds(60) def start_link(_) do GenServer.start_link( @@ -18,6 +21,12 @@ def start_link(_) do ) end + @impl true + def init(_args) do + if Pleroma.Config.get(:env) == :test, do: :ok = Ecto.Adapters.SQL.Sandbox.checkout(Repo) + {:ok, nil, {:continue, :calculate_stats}} + end + @doc "Performs update stats" def force_update do GenServer.call(__MODULE__, :force_update) @@ -29,7 +38,11 @@ def do_collect do end @doc "Returns stats data" - @spec get_stats() :: %{domain_count: integer(), status_count: integer(), user_count: integer()} + @spec get_stats() :: %{ + domain_count: non_neg_integer(), + status_count: non_neg_integer(), + user_count: non_neg_integer() + } def get_stats do %{stats: stats} = GenServer.call(__MODULE__, :get_state) @@ -44,25 +57,14 @@ def get_peers do peers end - def init(_args) do - {:ok, calculate_stat_data()} - end - - def handle_call(:force_update, _from, _state) do - new_stats = calculate_stat_data() - {:reply, new_stats, new_stats} - end - - def handle_call(:get_state, _from, state) do - {:reply, state, state} - end - - def handle_cast(:run_update, _state) do - new_stats = calculate_stat_data() - - {:noreply, new_stats} - end - + @spec calculate_stat_data() :: %{ + peers: list(), + stats: %{ + domain_count: non_neg_integer(), + status_count: non_neg_integer(), + user_count: non_neg_integer() + } + } def calculate_stat_data do peers = from( @@ -97,20 +99,44 @@ def calculate_stat_data do } end - def get_status_visibility_count do - counter_cache = - CounterCache.get_as_map([ - "status_visibility_public", - "status_visibility_private", - "status_visibility_unlisted", - "status_visibility_direct" - ]) + @spec get_status_visibility_count(String.t() | nil) :: map() + def get_status_visibility_count(instance \\ nil) do + if is_nil(instance) do + CounterCache.get_sum() + else + CounterCache.get_by_instance(instance) + end + end - %{ - public: counter_cache["status_visibility_public"] || 0, - unlisted: counter_cache["status_visibility_unlisted"] || 0, - private: counter_cache["status_visibility_private"] || 0, - direct: counter_cache["status_visibility_direct"] || 0 - } + @impl true + def handle_continue(:calculate_stats, _) do + stats = calculate_stat_data() + Process.send_after(self(), :run_update, @interval) + {:noreply, stats} + end + + @impl true + def handle_call(:force_update, _from, _state) do + new_stats = calculate_stat_data() + {:reply, new_stats, new_stats} + end + + @impl true + def handle_call(:get_state, _from, state) do + {:reply, state, state} + end + + @impl true + def handle_cast(:run_update, _state) do + new_stats = calculate_stat_data() + + {:noreply, new_stats} + end + + @impl true + def handle_info(:run_update, _) do + new_stats = calculate_stat_data() + Process.send_after(self(), :run_update, @interval) + {:noreply, new_stats} end end diff --git a/lib/pleroma/telemetry/logger.ex b/lib/pleroma/telemetry/logger.ex new file mode 100644 index 000000000..4cacae02f --- /dev/null +++ b/lib/pleroma/telemetry/logger.ex @@ -0,0 +1,76 @@ +defmodule Pleroma.Telemetry.Logger do + @moduledoc "Transforms Pleroma telemetry events to logs" + + require Logger + + @events [ + [:pleroma, :connection_pool, :reclaim, :start], + [:pleroma, :connection_pool, :reclaim, :stop], + [:pleroma, :connection_pool, :provision_failure], + [:pleroma, :connection_pool, :client_death] + ] + def attach do + :telemetry.attach_many("pleroma-logger", @events, &handle_event/4, []) + end + + # Passing anonymous functions instead of strings to logger is intentional, + # that way strings won't be concatenated if the message is going to be thrown + # out anyway due to higher log level configured + + def handle_event( + [:pleroma, :connection_pool, :reclaim, :start], + _, + %{max_connections: max_connections, reclaim_max: reclaim_max}, + _ + ) do + Logger.debug(fn -> + "Connection pool is exhausted (reached #{max_connections} connections). Starting idle connection cleanup to reclaim as much as #{ + reclaim_max + } connections" + end) + end + + def handle_event( + [:pleroma, :connection_pool, :reclaim, :stop], + %{reclaimed_count: 0}, + _, + _ + ) do + Logger.error(fn -> + "Connection pool failed to reclaim any connections due to all of them being in use. It will have to drop requests for opening connections to new hosts" + end) + end + + def handle_event( + [:pleroma, :connection_pool, :reclaim, :stop], + %{reclaimed_count: reclaimed_count}, + _, + _ + ) do + Logger.debug(fn -> "Connection pool cleaned up #{reclaimed_count} idle connections" end) + end + + def handle_event( + [:pleroma, :connection_pool, :provision_failure], + %{opts: [key | _]}, + _, + _ + ) do + Logger.error(fn -> + "Connection pool had to refuse opening a connection to #{key} due to connection limit exhaustion" + end) + end + + def handle_event( + [:pleroma, :connection_pool, :client_death], + %{client_pid: client_pid, reason: reason}, + %{key: key}, + _ + ) do + Logger.warn(fn -> + "Pool worker for #{key}: Client #{inspect(client_pid)} died before releasing the connection with #{ + inspect(reason) + }" + end) + end +end diff --git a/lib/pleroma/tesla/middleware/connection_pool.ex b/lib/pleroma/tesla/middleware/connection_pool.ex new file mode 100644 index 000000000..056e736ce --- /dev/null +++ b/lib/pleroma/tesla/middleware/connection_pool.ex @@ -0,0 +1,50 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Tesla.Middleware.ConnectionPool do + @moduledoc """ + Middleware to get/release connections from `Pleroma.Gun.ConnectionPool` + """ + + @behaviour Tesla.Middleware + + alias Pleroma.Gun.ConnectionPool + + @impl Tesla.Middleware + def call(%Tesla.Env{url: url, opts: opts} = env, next, _) do + uri = URI.parse(url) + + # Avoid leaking connections when the middleware is called twice + # with body_as: :chunks. We assume only the middleware can set + # opts[:adapter][:conn] + if opts[:adapter][:conn] do + ConnectionPool.release_conn(opts[:adapter][:conn]) + end + + case ConnectionPool.get_conn(uri, opts[:adapter]) do + {:ok, conn_pid} -> + adapter_opts = Keyword.merge(opts[:adapter], conn: conn_pid, close_conn: false) + opts = Keyword.put(opts, :adapter, adapter_opts) + env = %{env | opts: opts} + + case Tesla.run(env, next) do + {:ok, env} -> + unless opts[:adapter][:body_as] == :chunks do + ConnectionPool.release_conn(conn_pid) + {_, res} = pop_in(env.opts[:adapter][:conn]) + {:ok, res} + else + {:ok, env} + end + + err -> + ConnectionPool.release_conn(conn_pid) + err + end + + err -> + err + end + end +end diff --git a/lib/pleroma/upload.ex b/lib/pleroma/upload.ex index a0ba2f4c0..db2cc1dae 100644 --- a/lib/pleroma/upload.ex +++ b/lib/pleroma/upload.ex @@ -56,6 +56,15 @@ defmodule Pleroma.Upload do } defstruct [:id, :name, :tempfile, :content_type, :path] + defp get_description(opts, upload) do + case {opts[:description], Pleroma.Config.get([Pleroma.Upload, :default_description])} do + {description, _} when is_binary(description) -> description + {_, :filename} -> upload.name + {_, str} when is_binary(str) -> str + _ -> "" + end + end + @spec store(source, options :: [option()]) :: {:ok, Map.t()} | {:error, any()} @doc "Store a file. If using a `Plug.Upload{}` as the source, be sure to use `Majic.Plug` to ensure its content_type and filename is correct." def store(upload, opts \\ []) do @@ -64,6 +73,10 @@ def store(upload, opts \\ []) do with {:ok, upload} <- prepare_upload(upload, opts), upload = %__MODULE__{upload | path: upload.path || "#{upload.id}/#{upload.name}"}, {:ok, upload} <- Pleroma.Upload.Filter.filter(opts.filters, upload), + description = get_description(opts, upload), + {_, true} <- + {:description_limit, + String.length(description) <= Pleroma.Config.get([:instance, :description_limit])}, {:ok, url_spec} <- Pleroma.Uploaders.Uploader.put_file(opts.uploader, upload) do {:ok, %{ @@ -76,9 +89,12 @@ def store(upload, opts \\ []) do "href" => url_from_spec(upload, opts.base_url, url_spec) } ], - "name" => Map.get(opts, :description) || upload.name + "name" => description }} else + {:description_limit, _} -> + {:error, :description_too_long} + {:error, error} -> Logger.error( "#{__MODULE__} store (using #{inspect(opts.uploader)}) failed: #{inspect(error)}" diff --git a/lib/pleroma/upload/filter.ex b/lib/pleroma/upload/filter.ex index dbdadc97f..661135634 100644 --- a/lib/pleroma/upload/filter.ex +++ b/lib/pleroma/upload/filter.ex @@ -15,7 +15,11 @@ defmodule Pleroma.Upload.Filter do require Logger - @callback filter(Pleroma.Upload.t()) :: :ok | {:ok, Pleroma.Upload.t()} | {:error, any()} + @callback filter(Pleroma.Upload.t()) :: + {:ok, :filtered} + | {:ok, :noop} + | {:ok, :filtered, Pleroma.Upload.t()} + | {:error, any()} @spec filter([module()], Pleroma.Upload.t()) :: {:ok, Pleroma.Upload.t()} | {:error, any()} @@ -25,10 +29,13 @@ def filter([], upload) do def filter([filter | rest], upload) do case filter.filter(upload) do - :ok -> + {:ok, :filtered} -> filter(rest, upload) - {:ok, upload} -> + {:ok, :filtered, upload} -> + filter(rest, upload) + + {:ok, :noop} -> filter(rest, upload) error -> diff --git a/lib/pleroma/upload/filter/anonymize_filename.ex b/lib/pleroma/upload/filter/anonymize_filename.ex index 07ead8203..fc456e4f4 100644 --- a/lib/pleroma/upload/filter/anonymize_filename.ex +++ b/lib/pleroma/upload/filter/anonymize_filename.ex @@ -16,9 +16,11 @@ defmodule Pleroma.Upload.Filter.AnonymizeFilename do def filter(%Upload{name: name} = upload) do extension = List.last(String.split(name, ".")) name = predefined_name(extension) || random(extension) - {:ok, %Upload{upload | name: name}} + {:ok, :filtered, %Upload{upload | name: name}} end + def filter(_), do: {:ok, :noop} + @spec predefined_name(String.t()) :: String.t() | nil defp predefined_name(extension) do with name when not is_nil(name) <- Config.get([__MODULE__, :text]), diff --git a/lib/pleroma/upload/filter/dedupe.ex b/lib/pleroma/upload/filter/dedupe.ex index 41218a918..86cbc8996 100644 --- a/lib/pleroma/upload/filter/dedupe.ex +++ b/lib/pleroma/upload/filter/dedupe.ex @@ -17,8 +17,8 @@ def filter(%Upload{name: name, tempfile: tempfile} = upload) do |> Base.encode16(case: :lower) filename = shasum <> "." <> extension - {:ok, %Upload{upload | id: shasum, path: filename}} + {:ok, :filtered, %Upload{upload | id: shasum, path: filename}} end - def filter(_), do: :ok + def filter(_), do: {:ok, :noop} end diff --git a/lib/pleroma/upload/filter/exiftool.ex b/lib/pleroma/upload/filter/exiftool.ex new file mode 100644 index 000000000..1fd0cfdaa --- /dev/null +++ b/lib/pleroma/upload/filter/exiftool.ex @@ -0,0 +1,30 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Upload.Filter.Exiftool do + @moduledoc """ + Strips GPS related EXIF tags and overwrites the file in place. + Also strips or replaces filesystem metadata e.g., timestamps. + """ + @behaviour Pleroma.Upload.Filter + + @spec filter(Pleroma.Upload.t()) :: {:ok, any()} | {:error, String.t()} + + # webp is not compatible with exiftool at this time + def filter(%Pleroma.Upload{content_type: "image/webp"}), do: {:ok, :noop} + + def filter(%Pleroma.Upload{tempfile: file, content_type: "image" <> _}) do + try do + case System.cmd("exiftool", ["-overwrite_original", "-gps:all=", file], parallelism: true) do + {_response, 0} -> {:ok, :filtered} + {error, 1} -> {:error, error} + end + rescue + _e in ErlangError -> + {:error, "exiftool command not found"} + end + end + + def filter(_), do: {:ok, :noop} +end diff --git a/lib/pleroma/upload/filter/mogrifun.ex b/lib/pleroma/upload/filter/mogrifun.ex index 7d95577a4..363e5cf0f 100644 --- a/lib/pleroma/upload/filter/mogrifun.ex +++ b/lib/pleroma/upload/filter/mogrifun.ex @@ -6,6 +6,10 @@ defmodule Pleroma.Upload.Filter.Mogrifun do @behaviour Pleroma.Upload.Filter alias Pleroma.Upload.Filter + @moduledoc """ + This module is just an example of an Upload filter. It's not supposed to be used in production. + """ + @filters [ {"implode", "1"}, {"-raise", "20"}, @@ -34,11 +38,16 @@ defmodule Pleroma.Upload.Filter.Mogrifun do [{"fill", "yellow"}, {"tint", "40"}] ] + @spec filter(Pleroma.Upload.t()) :: {:ok, atom()} | {:error, String.t()} def filter(%Pleroma.Upload{tempfile: file, content_type: "image" <> _}) do - Filter.Mogrify.do_filter(file, [Enum.random(@filters)]) - - :ok + try do + Filter.Mogrify.do_filter(file, [Enum.random(@filters)]) + {:ok, :filtered} + rescue + _e in ErlangError -> + {:error, "mogrify command not found"} + end end - def filter(_), do: :ok + def filter(_), do: {:ok, :noop} end diff --git a/lib/pleroma/upload/filter/mogrify.ex b/lib/pleroma/upload/filter/mogrify.ex index 2eb758006..71968fd9c 100644 --- a/lib/pleroma/upload/filter/mogrify.ex +++ b/lib/pleroma/upload/filter/mogrify.ex @@ -8,14 +8,18 @@ defmodule Pleroma.Upload.Filter.Mogrify do @type conversion :: action :: String.t() | {action :: String.t(), opts :: String.t()} @type conversions :: conversion() | [conversion()] + @spec filter(Pleroma.Upload.t()) :: {:ok, :atom} | {:error, String.t()} def filter(%Pleroma.Upload{tempfile: file, content_type: "image" <> _}) do - filters = Pleroma.Config.get!([__MODULE__, :args]) - - do_filter(file, filters) - :ok + try do + do_filter(file, Pleroma.Config.get!([__MODULE__, :args])) + {:ok, :filtered} + rescue + _e in ErlangError -> + {:error, "mogrify command not found"} + end end - def filter(_), do: :ok + def filter(_), do: {:ok, :noop} def do_filter(file, filters) do file diff --git a/lib/pleroma/uploaders/s3.ex b/lib/pleroma/uploaders/s3.ex index a13ff23b6..6dbef9085 100644 --- a/lib/pleroma/uploaders/s3.ex +++ b/lib/pleroma/uploaders/s3.ex @@ -46,12 +46,23 @@ def put_file(%Pleroma.Upload{} = upload) do op = if streaming do - upload.tempfile - |> ExAws.S3.Upload.stream_file() - |> ExAws.S3.upload(bucket, s3_name, [ - {:acl, :public_read}, - {:content_type, upload.content_type} - ]) + op = + upload.tempfile + |> ExAws.S3.Upload.stream_file() + |> ExAws.S3.upload(bucket, s3_name, [ + {:acl, :public_read}, + {:content_type, upload.content_type} + ]) + + if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Gun do + # set s3 upload timeout to respect :upload pool timeout + # timeout should be slightly larger, so s3 can retry upload on fail + timeout = Pleroma.HTTP.AdapterHelper.Gun.pool_timeout(:upload) + 1_000 + opts = Keyword.put(op.opts, :timeout, timeout) + Map.put(op, :opts, opts) + else + op + end else {:ok, file_data} = File.read(upload.tempfile) diff --git a/lib/pleroma/user.ex b/lib/pleroma/user.ex index 52ac9052b..e73d19964 100644 --- a/lib/pleroma/user.ex +++ b/lib/pleroma/user.ex @@ -14,6 +14,7 @@ defmodule Pleroma.User do alias Pleroma.Config alias Pleroma.Conversation.Participation alias Pleroma.Delivery + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Emoji alias Pleroma.FollowingRelationship alias Pleroma.Formatter @@ -30,7 +31,6 @@ defmodule Pleroma.User do alias Pleroma.Web alias Pleroma.Web.ActivityPub.ActivityPub alias Pleroma.Web.ActivityPub.Builder - alias Pleroma.Web.ActivityPub.ObjectValidators.Types alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.CommonAPI @@ -42,7 +42,12 @@ defmodule Pleroma.User do require Logger @type t :: %__MODULE__{} - @type account_status :: :active | :deactivated | :password_reset_pending | :confirmation_pending + @type account_status :: + :active + | :deactivated + | :password_reset_pending + | :confirmation_pending + | :approval_pending @primary_key {:id, FlakeId.Ecto.CompatType, autogenerate: true} # credo:disable-for-next-line Credo.Check.Readability.MaxLineLength @@ -78,7 +83,8 @@ defmodule Pleroma.User do ] schema "users" do - field(:bio, :string) + field(:bio, :string, default: "") + field(:raw_bio, :string) field(:email, :string) field(:name, :string) field(:nickname, :string) @@ -88,7 +94,7 @@ defmodule Pleroma.User do field(:keys, :string) field(:public_key, :string) field(:ap_id, :string) - field(:avatar, :map) + field(:avatar, :map, default: %{}) field(:local, :boolean, default: true) field(:follower_address, :string) field(:following_address, :string) @@ -105,6 +111,8 @@ defmodule Pleroma.User do field(:locked, :boolean, default: false) field(:confirmation_pending, :boolean, default: false) field(:password_reset_pending, :boolean, default: false) + field(:approval_pending, :boolean, default: false) + field(:registration_reason, :string, default: nil) field(:confirmation_token, :string, default: nil) field(:default_scope, :string, default: "public") field(:domain_blocks, {:array, :string}, default: []) @@ -114,8 +122,8 @@ defmodule Pleroma.User do field(:is_moderator, :boolean, default: false) field(:is_admin, :boolean, default: false) field(:show_role, :boolean, default: true) - field(:settings, :map, default: nil) - field(:uri, Types.Uri, default: nil) + field(:mastofe_settings, :map, default: nil) + field(:uri, ObjectValidators.Uri, default: nil) field(:hide_followers_count, :boolean, default: false) field(:hide_follows_count, :boolean, default: false) field(:hide_followers, :boolean, default: false) @@ -137,6 +145,7 @@ defmodule Pleroma.User do field(:also_known_as, {:array, :string}, default: []) field(:inbox, :string) field(:shared_inbox, :string) + field(:accepts_chat_messages, :boolean, default: nil) embeds_one( :notification_settings, @@ -238,6 +247,13 @@ def unquote(:"#{outgoing_relation_target}_ap_ids")(user, restrict_deactivated? \ end end + defdelegate following_count(user), to: FollowingRelationship + defdelegate following(user), to: FollowingRelationship + defdelegate following?(follower, followed), to: FollowingRelationship + defdelegate following_ap_ids(user), to: FollowingRelationship + defdelegate get_follow_requests(user), to: FollowingRelationship + defdelegate search(query, opts \\ []), to: User.Search + @doc """ Dumps Flake Id to SQL-compatible format (16-byte UUID). E.g. "9pQtDGXuq4p3VlcJEm" -> <<0, 0, 1, 110, 179, 218, 42, 92, 213, 41, 44, 227, 95, 213, 0, 0>> @@ -260,39 +276,65 @@ def binary_id(%User{} = user), do: binary_id(user.id) @spec account_status(User.t()) :: account_status() def account_status(%User{deactivated: true}), do: :deactivated def account_status(%User{password_reset_pending: true}), do: :password_reset_pending + def account_status(%User{approval_pending: true}), do: :approval_pending def account_status(%User{confirmation_pending: true}) do - case Config.get([:instance, :account_activation_required]) do - true -> :confirmation_pending - _ -> :active + if Config.get([:instance, :account_activation_required]) do + :confirmation_pending + else + :active end end def account_status(%User{}), do: :active - @spec visible_for?(User.t(), User.t() | nil) :: boolean() - def visible_for?(user, for_user \\ nil) + @spec visible_for(User.t(), User.t() | nil) :: + :visible + | :invisible + | :restricted_unauthenticated + | :deactivated + | :confirmation_pending + def visible_for(user, for_user \\ nil) - def visible_for?(%User{invisible: true}, _), do: false + def visible_for(%User{invisible: true}, _), do: :invisible - def visible_for?(%User{id: user_id}, %User{id: user_id}), do: true + def visible_for(%User{id: user_id}, %User{id: user_id}), do: :visible - def visible_for?(%User{local: local} = user, nil) do - cfg_key = - if local, - do: :local, - else: :remote - - if Config.get([:restrict_unauthenticated, :profiles, cfg_key]), - do: false, - else: account_status(user) == :active + def visible_for(%User{} = user, nil) do + if restrict_unauthenticated?(user) do + :restrict_unauthenticated + else + visible_account_status(user) + end end - def visible_for?(%User{} = user, for_user) do - account_status(user) == :active || superuser?(for_user) + def visible_for(%User{} = user, for_user) do + if superuser?(for_user) do + :visible + else + visible_account_status(user) + end end - def visible_for?(_, _), do: false + def visible_for(_, _), do: :invisible + + defp restrict_unauthenticated?(%User{local: true}) do + Config.restrict_unauthenticated_access?(:profiles, :local) + end + + defp restrict_unauthenticated?(%User{local: _}) do + Config.restrict_unauthenticated_access?(:profiles, :remote) + end + + defp visible_account_status(user) do + status = account_status(user) + + if status in [:active, :password_reset_pending] do + :visible + else + status + end + end @spec superuser?(User.t()) :: boolean() def superuser?(%User{local: true, is_admin: true}), do: true @@ -337,8 +379,6 @@ def restrict_deactivated(query) do from(u in query, where: u.deactivated != ^true) end - defdelegate following_count(user), to: FollowingRelationship - defp truncate_fields_param(params) do if Map.has_key?(params, :fields) do Map.put(params, :fields, Enum.map(params[:fields], &truncate_field/1)) @@ -364,8 +404,8 @@ defp fix_follower_address(%{nickname: nickname} = params), defp fix_follower_address(params), do: params def remote_user_changeset(struct \\ %User{local: false}, params) do - bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000) - name_limit = Pleroma.Config.get([:instance, :user_name_length], 100) + bio_limit = Config.get([:instance, :user_bio_length], 5000) + name_limit = Config.get([:instance, :user_name_length], 100) name = case params[:name] do @@ -412,7 +452,8 @@ def remote_user_changeset(struct \\ %User{local: false}, params) do :discoverable, :invisible, :actor_type, - :also_known_as + :also_known_as, + :accepts_chat_messages ] ) |> validate_required([:name, :ap_id]) @@ -424,14 +465,15 @@ def remote_user_changeset(struct \\ %User{local: false}, params) do end def update_changeset(struct, params \\ %{}) do - bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000) - name_limit = Pleroma.Config.get([:instance, :user_name_length], 100) + bio_limit = Config.get([:instance, :user_bio_length], 5000) + name_limit = Config.get([:instance, :user_name_length], 100) struct |> cast( params, [ :bio, + :raw_bio, :name, :emoji, :avatar, @@ -456,13 +498,15 @@ def update_changeset(struct, params \\ %{}) do :pleroma_settings_store, :discoverable, :actor_type, - :also_known_as + :also_known_as, + :accepts_chat_messages ] ) |> unique_constraint(:nickname) |> validate_format(:nickname, local_nickname_regex()) |> validate_length(:bio, max: bio_limit) |> validate_length(:name, min: 1, max: name_limit) + |> validate_inclusion(:actor_type, ["Person", "Service"]) |> put_fields() |> put_emoji() |> put_change_if_present(:bio, &{:ok, parse_bio(&1, struct)}) @@ -501,11 +545,21 @@ defp parse_fields(value) do end defp put_emoji(changeset) do - bio = get_change(changeset, :bio) - name = get_change(changeset, :name) + emojified_fields = [:bio, :name, :raw_fields] + + if Enum.any?(changeset.changes, fn {k, _} -> k in emojified_fields end) do + bio = Emoji.Formatter.get_emoji_map(get_field(changeset, :bio)) + name = Emoji.Formatter.get_emoji_map(get_field(changeset, :name)) + + emoji = Map.merge(bio, name) + + emoji = + changeset + |> get_field(:raw_fields) + |> Enum.reduce(emoji, fn x, acc -> + Map.merge(acc, Emoji.Formatter.get_emoji_map(x["name"] <> x["value"])) + end) - if bio || name do - emoji = Map.merge(Emoji.Formatter.get_emoji_map(bio), Emoji.Formatter.get_emoji_map(name)) put_change(changeset, :emoji, emoji) else changeset @@ -513,14 +567,11 @@ defp put_emoji(changeset) do end defp put_change_if_present(changeset, map_field, value_function) do - if value = get_change(changeset, map_field) do - with {:ok, new_value} <- value_function.(value) do - put_change(changeset, map_field, new_value) - else - _ -> changeset - end + with {:ok, value} <- fetch_change(changeset, map_field), + {:ok, new_value} <- value_function.(value) do + put_change(changeset, map_field, new_value) else - changeset + _ -> changeset end end @@ -594,29 +645,88 @@ def force_password_reset_async(user) do @spec force_password_reset(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()} def force_password_reset(user), do: update_password_reset_pending(user, true) + # Used to auto-register LDAP accounts which won't have a password hash stored locally + def register_changeset_ldap(struct, params = %{password: password}) + when is_nil(password) do + params = Map.put_new(params, :accepts_chat_messages, true) + + params = + if Map.has_key?(params, :email) do + Map.put_new(params, :email, params[:email]) + else + params + end + + struct + |> cast(params, [ + :name, + :nickname, + :email, + :accepts_chat_messages + ]) + |> validate_required([:name, :nickname]) + |> unique_constraint(:nickname) + |> validate_exclusion(:nickname, Config.get([User, :restricted_nicknames])) + |> validate_format(:nickname, local_nickname_regex()) + |> put_ap_id() + |> unique_constraint(:ap_id) + |> put_following_and_follower_address() + end + def register_changeset(struct, params \\ %{}, opts \\ []) do - bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000) - name_limit = Pleroma.Config.get([:instance, :user_name_length], 100) + bio_limit = Config.get([:instance, :user_bio_length], 5000) + name_limit = Config.get([:instance, :user_name_length], 100) + reason_limit = Config.get([:instance, :registration_reason_length], 500) + params = Map.put_new(params, :accepts_chat_messages, true) need_confirmation? = if is_nil(opts[:need_confirmation]) do - Pleroma.Config.get([:instance, :account_activation_required]) + Config.get([:instance, :account_activation_required]) else opts[:need_confirmation] end + need_approval? = + if is_nil(opts[:need_approval]) do + Config.get([:instance, :account_approval_required]) + else + opts[:need_approval] + end + struct |> confirmation_changeset(need_confirmation: need_confirmation?) - |> cast(params, [:bio, :email, :name, :nickname, :password, :password_confirmation, :emoji]) + |> approval_changeset(need_approval: need_approval?) + |> cast(params, [ + :bio, + :raw_bio, + :email, + :name, + :nickname, + :password, + :password_confirmation, + :emoji, + :accepts_chat_messages, + :registration_reason + ]) |> validate_required([:name, :nickname, :password, :password_confirmation]) |> validate_confirmation(:password) |> unique_constraint(:email) - |> unique_constraint(:nickname) - |> validate_exclusion(:nickname, Pleroma.Config.get([User, :restricted_nicknames])) - |> validate_format(:nickname, local_nickname_regex()) |> validate_format(:email, @email_regex) + |> validate_change(:email, fn :email, email -> + valid? = + Config.get([User, :email_blacklist]) + |> Enum.all?(fn blacklisted_domain -> + !String.ends_with?(email, ["@" <> blacklisted_domain, "." <> blacklisted_domain]) + end) + + if valid?, do: [], else: [email: "Invalid email"] + end) + |> unique_constraint(:nickname) + |> validate_exclusion(:nickname, Config.get([User, :restricted_nicknames])) + |> validate_format(:nickname, local_nickname_regex()) |> validate_length(:bio, max: bio_limit) |> validate_length(:name, min: 1, max: name_limit) + |> validate_length(:registration_reason, max: reason_limit) |> maybe_validate_required_email(opts[:external]) |> put_password_hash |> put_ap_id() @@ -627,7 +737,7 @@ def register_changeset(struct, params \\ %{}, opts \\ []) do def maybe_validate_required_email(changeset, true), do: changeset def maybe_validate_required_email(changeset, _) do - if Pleroma.Config.get([:instance, :account_activation_required]) do + if Config.get([:instance, :account_activation_required]) do validate_required(changeset, [:email]) else changeset @@ -647,7 +757,7 @@ defp put_following_and_follower_address(changeset) do end defp autofollow_users(user) do - candidates = Pleroma.Config.get([:instance, :autofollowed_nicknames]) + candidates = Config.get([:instance, :autofollowed_nicknames]) autofollowed_users = User.Query.build(%{nickname: candidates, local: true, deactivated: false}) @@ -666,27 +776,62 @@ def register(%Ecto.Changeset{} = changeset) do def post_register_action(%User{} = user) do with {:ok, user} <- autofollow_users(user), {:ok, user} <- set_cache(user), - {:ok, _} <- User.WelcomeMessage.post_welcome_message_to_user(user), + {:ok, _} <- send_welcome_email(user), + {:ok, _} <- send_welcome_message(user), + {:ok, _} <- send_welcome_chat_message(user), {:ok, _} <- try_send_confirmation_email(user) do {:ok, user} end end - def try_send_confirmation_email(%User{} = user) do - if user.confirmation_pending && - Pleroma.Config.get([:instance, :account_activation_required]) do - user - |> Pleroma.Emails.UserEmail.account_confirmation_email() - |> Pleroma.Emails.Mailer.deliver_async() - + def send_welcome_message(user) do + if User.WelcomeMessage.enabled?() do + User.WelcomeMessage.post_message(user) {:ok, :enqueued} else {:ok, :noop} end end - def try_send_confirmation_email(users) do - Enum.each(users, &try_send_confirmation_email/1) + def send_welcome_chat_message(user) do + if User.WelcomeChatMessage.enabled?() do + User.WelcomeChatMessage.post_message(user) + {:ok, :enqueued} + else + {:ok, :noop} + end + end + + def send_welcome_email(%User{email: email} = user) when is_binary(email) do + if User.WelcomeEmail.enabled?() do + User.WelcomeEmail.send_email(user) + {:ok, :enqueued} + else + {:ok, :noop} + end + end + + def send_welcome_email(_), do: {:ok, :noop} + + @spec try_send_confirmation_email(User.t()) :: {:ok, :enqueued | :noop} + def try_send_confirmation_email(%User{confirmation_pending: true} = user) do + if Config.get([:instance, :account_activation_required]) do + send_confirmation_email(user) + {:ok, :enqueued} + else + {:ok, :noop} + end + end + + def try_send_confirmation_email(_), do: {:ok, :noop} + + @spec send_confirmation_email(Uset.t()) :: User.t() + def send_confirmation_email(%User{} = user) do + user + |> Pleroma.Emails.UserEmail.account_confirmation_email() + |> Pleroma.Emails.Mailer.deliver_async() + + user end def needs_update?(%User{local: true}), do: false @@ -728,10 +873,8 @@ def follow_all(follower, followeds) do set_cache(follower) end - defdelegate following(user), to: FollowingRelationship - def follow(%User{} = follower, %User{} = followed, state \\ :follow_accept) do - deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked]) + deny_follow_blocked = Config.get([:user, :deny_follow_blocked]) cond do followed.deactivated -> @@ -747,7 +890,6 @@ def follow(%User{} = follower, %User{} = followed, state \\ :follow_accept) do follower |> update_following_count() - |> set_cache() end end @@ -776,7 +918,6 @@ defp do_unfollow(%User{} = follower, %User{} = followed) do {:ok, follower} = follower |> update_following_count() - |> set_cache() {:ok, follower, followed} @@ -785,8 +926,6 @@ defp do_unfollow(%User{} = follower, %User{} = followed) do end end - defdelegate following?(follower, followed), to: FollowingRelationship - @doc "Returns follow state as Pleroma.FollowingRelationship.State value" def get_follow_state(%User{} = follower, %User{} = following) do following_relationship = FollowingRelationship.get(follower, following) @@ -934,7 +1073,7 @@ def get_cached_by_nickname(nickname) do end def get_cached_by_nickname_or_id(nickname_or_id, opts \\ []) do - restrict_to_local = Pleroma.Config.get([:instance, :limit_to_local_content]) + restrict_to_local = Config.get([:instance, :limit_to_local_content]) cond do is_integer(nickname_or_id) or FlakeId.flake_id?(nickname_or_id) -> @@ -986,31 +1125,31 @@ def get_followers_query(%User{} = user, nil) do User.Query.build(%{followers: user, deactivated: false}) end - def get_followers_query(user, page) do + def get_followers_query(%User{} = user, page) do user |> get_followers_query(nil) |> User.Query.paginate(page, 20) end @spec get_followers_query(User.t()) :: Ecto.Query.t() - def get_followers_query(user), do: get_followers_query(user, nil) + def get_followers_query(%User{} = user), do: get_followers_query(user, nil) @spec get_followers(User.t(), pos_integer() | nil) :: {:ok, list(User.t())} - def get_followers(user, page \\ nil) do + def get_followers(%User{} = user, page \\ nil) do user |> get_followers_query(page) |> Repo.all() end @spec get_external_followers(User.t(), pos_integer() | nil) :: {:ok, list(User.t())} - def get_external_followers(user, page \\ nil) do + def get_external_followers(%User{} = user, page \\ nil) do user |> get_followers_query(page) |> User.Query.build(%{external: true}) |> Repo.all() end - def get_followers_ids(user, page \\ nil) do + def get_followers_ids(%User{} = user, page \\ nil) do user |> get_followers_query(page) |> select([u], u.id) @@ -1022,37 +1161,35 @@ def get_friends_query(%User{} = user, nil) do User.Query.build(%{friends: user, deactivated: false}) end - def get_friends_query(user, page) do + def get_friends_query(%User{} = user, page) do user |> get_friends_query(nil) |> User.Query.paginate(page, 20) end @spec get_friends_query(User.t()) :: Ecto.Query.t() - def get_friends_query(user), do: get_friends_query(user, nil) + def get_friends_query(%User{} = user), do: get_friends_query(user, nil) - def get_friends(user, page \\ nil) do + def get_friends(%User{} = user, page \\ nil) do user |> get_friends_query(page) |> Repo.all() end - def get_friends_ap_ids(user) do + def get_friends_ap_ids(%User{} = user) do user |> get_friends_query(nil) |> select([u], u.ap_id) |> Repo.all() end - def get_friends_ids(user, page \\ nil) do + def get_friends_ids(%User{} = user, page \\ nil) do user |> get_friends_query(page) |> select([u], u.id) |> Repo.all() end - defdelegate get_follow_requests(user), to: FollowingRelationship - def increase_note_count(%User{} = user) do User |> where(id: ^user.id) @@ -1128,35 +1265,25 @@ defp follow_information_changeset(user, params) do ]) end + @spec update_follower_count(User.t()) :: {:ok, User.t()} def update_follower_count(%User{} = user) do - if user.local or !Pleroma.Config.get([:instance, :external_user_synchronization]) do - follower_count_query = - User.Query.build(%{followers: user, deactivated: false}) - |> select([u], %{count: count(u.id)}) + if user.local or !Config.get([:instance, :external_user_synchronization]) do + follower_count = FollowingRelationship.follower_count(user) - User - |> where(id: ^user.id) - |> join(:inner, [u], s in subquery(follower_count_query)) - |> update([u, s], - set: [follower_count: s.count] - ) - |> select([u], u) - |> Repo.update_all([]) - |> case do - {1, [user]} -> set_cache(user) - _ -> {:error, user} - end + user + |> follow_information_changeset(%{follower_count: follower_count}) + |> update_and_set_cache else {:ok, maybe_fetch_follow_information(user)} end end - @spec update_following_count(User.t()) :: User.t() + @spec update_following_count(User.t()) :: {:ok, User.t()} def update_following_count(%User{local: false} = user) do - if Pleroma.Config.get([:instance, :external_user_synchronization]) do - maybe_fetch_follow_information(user) + if Config.get([:instance, :external_user_synchronization]) do + {:ok, maybe_fetch_follow_information(user)} else - user + {:ok, user} end end @@ -1165,7 +1292,7 @@ def update_following_count(%User{local: true} = user) do user |> follow_information_changeset(%{following_count: following_count}) - |> Repo.update!() + |> update_and_set_cache() end def set_unread_conversation_count(%User{local: true} = user) do @@ -1240,7 +1367,7 @@ def unmute(%User{} = muter, %User{} = mutee) do end def subscribe(%User{} = subscriber, %User{} = target) do - deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked]) + deny_follow_blocked = Config.get([:user, :deny_follow_blocked]) if blocks?(target, subscriber) and deny_follow_blocked do {:error, "Could not subscribe: #{target.nickname} is blocking you"} @@ -1286,7 +1413,8 @@ def block(%User{} = blocker, %User{} = blocked) do unsubscribe(blocked, blocker) - if following?(blocked, blocker), do: unfollow(blocked, blocker) + unfollowing_blocked = Config.get([:activitypub, :unfollow_blocked], true) + if unfollowing_blocked && following?(blocked, blocker), do: unfollow(blocked, blocker) {:ok, blocker} = update_follower_count(blocker) {:ok, blocker, _} = Participation.mark_all_as_read(blocker, blocked) @@ -1433,6 +1561,19 @@ def deactivate(%User{} = user, status) do end end + def approve(users) when is_list(users) do + Repo.transaction(fn -> + Enum.map(users, fn user -> + with {:ok, user} <- approve(user), do: user + end) + end) + end + + def approve(%User{} = user) do + change(user, approval_pending: false) + |> update_and_set_cache() + end + def update_notification_settings(%User{} = user, settings) do user |> cast(%{notification_settings: settings}, []) @@ -1441,6 +1582,49 @@ def update_notification_settings(%User{} = user, settings) do |> update_and_set_cache() end + @spec purge_user_changeset(User.t()) :: Changeset.t() + def purge_user_changeset(user) do + # "Right to be forgotten" + # https://gdpr.eu/right-to-be-forgotten/ + change(user, %{ + bio: "", + raw_bio: nil, + email: nil, + name: nil, + password_hash: nil, + keys: nil, + public_key: nil, + avatar: %{}, + tags: [], + last_refreshed_at: nil, + last_digest_emailed_at: nil, + banner: %{}, + background: %{}, + note_count: 0, + follower_count: 0, + following_count: 0, + locked: false, + confirmation_pending: false, + password_reset_pending: false, + approval_pending: false, + registration_reason: nil, + confirmation_token: nil, + domain_blocks: [], + deactivated: true, + ap_enabled: false, + is_moderator: false, + is_admin: false, + mastofe_settings: nil, + mascot: nil, + emoji: %{}, + pleroma_settings_store: %{}, + fields: [], + raw_fields: [], + discoverable: false, + also_known_as: [] + }) + end + def delete(users) when is_list(users) do for user <- users, do: delete(user) end @@ -1459,12 +1643,17 @@ defp delete_or_deactivate(%User{local: false} = user), do: delete_and_invalidate defp delete_or_deactivate(%User{local: true} = user) do status = account_status(user) - if status == :confirmation_pending do - delete_and_invalidate_cache(user) - else - user - |> change(%{deactivated: true, email: nil}) - |> update_and_set_cache() + case status do + :confirmation_pending -> + delete_and_invalidate_cache(user) + + :approval_pending -> + delete_and_invalidate_cache(user) + + _ -> + user + |> purge_user_changeset() + |> update_and_set_cache() end end @@ -1504,8 +1693,7 @@ def perform(:blocks_import, %User{} = blocker, blocked_identifiers) blocked_identifiers, fn blocked_identifier -> with {:ok, %User{} = blocked} <- get_or_fetch(blocked_identifier), - {:ok, _user_block} <- block(blocker, blocked), - {:ok, _} <- ActivityPub.block(blocker, blocked) do + {:ok, _block} <- CommonAPI.block(blocker, blocked) do blocked else err -> @@ -1523,7 +1711,7 @@ def perform(:follow_import, %User{} = follower, followed_identifiers) fn followed_identifier -> with {:ok, %User{} = followed} <- get_or_fetch(followed_identifier), {:ok, follower} <- maybe_direct_follow(follower, followed), - {:ok, _} <- ActivityPub.follow(follower, followed) do + {:ok, _, _, _} <- CommonAPI.follow(follower, followed) do followed else err -> @@ -1631,7 +1819,7 @@ def html_filter_policy(%User{no_rich_text: true}) do Pleroma.HTML.Scrubber.TwitterText end - def html_filter_policy(_), do: Pleroma.Config.get([:markup, :scrub_policy]) + def html_filter_policy(_), do: Config.get([:markup, :scrub_policy]) def fetch_by_ap_id(ap_id), do: ActivityPub.make_user_from_ap_id(ap_id) @@ -1813,7 +2001,7 @@ defp normalize_tags(tags) do end defp local_nickname_regex do - if Pleroma.Config.get([:instance, :extended_nickname_format]) do + if Config.get([:instance, :extended_nickname_format]) do @extended_local_nickname_regex else @strict_local_nickname_regex @@ -1941,8 +2129,8 @@ def get_mascot(%{mascot: %{} = mascot}) when not is_nil(mascot) do def get_mascot(%{mascot: mascot}) when is_nil(mascot) do # use instance-default - config = Pleroma.Config.get([:assets, :mascots]) - default_mascot = Pleroma.Config.get([:assets, :default_mascot]) + config = Config.get([:assets, :mascots]) + default_mascot = Config.get([:assets, :default_mascot]) mascot = Keyword.get(config, default_mascot) %{ @@ -1974,8 +2162,6 @@ def get_ap_ids_by_nicknames(nicknames) do |> Repo.all() end - defdelegate search(query, opts \\ []), to: User.Search - defp put_password_hash( %Ecto.Changeset{valid?: true, changes: %{password: password}} = changeset ) do @@ -2037,7 +2223,7 @@ def roles(%{is_moderator: is_moderator, is_admin: is_admin}) do def validate_fields(changeset, remote? \\ false) do limit_name = if remote?, do: :max_remote_account_fields, else: :max_account_fields - limit = Pleroma.Config.get([:instance, limit_name], 0) + limit = Config.get([:instance, limit_name], 0) changeset |> validate_length(:fields, max: limit) @@ -2051,8 +2237,8 @@ def validate_fields(changeset, remote? \\ false) do end defp valid_field?(%{"name" => name, "value" => value}) do - name_limit = Pleroma.Config.get([:instance, :account_field_name_length], 255) - value_limit = Pleroma.Config.get([:instance, :account_field_value_length], 255) + name_limit = Config.get([:instance, :account_field_name_length], 255) + value_limit = Config.get([:instance, :account_field_value_length], 255) is_binary(name) && is_binary(value) && String.length(name) <= name_limit && String.length(value) <= value_limit @@ -2062,10 +2248,10 @@ defp valid_field?(_), do: false defp truncate_field(%{"name" => name, "value" => value}) do {name, _chopped} = - String.split_at(name, Pleroma.Config.get([:instance, :account_field_name_length], 255)) + String.split_at(name, Config.get([:instance, :account_field_name_length], 255)) {value, _chopped} = - String.split_at(value, Pleroma.Config.get([:instance, :account_field_value_length], 255)) + String.split_at(value, Config.get([:instance, :account_field_value_length], 255)) %{"name" => name, "value" => value} end @@ -2095,8 +2281,8 @@ def mascot_update(user, url) do def mastodon_settings_update(user, settings) do user - |> cast(%{settings: settings}, [:settings]) - |> validate_required([:settings]) + |> cast(%{mastofe_settings: settings}, [:mastofe_settings]) + |> validate_required([:mastofe_settings]) |> update_and_set_cache() end @@ -2118,11 +2304,22 @@ def confirmation_changeset(user, need_confirmation: need_confirmation?) do cast(user, params, [:confirmation_pending, :confirmation_token]) end + @spec approval_changeset(User.t(), keyword()) :: Changeset.t() + def approval_changeset(user, need_approval: need_approval?) do + params = if need_approval?, do: %{approval_pending: true}, else: %{approval_pending: false} + cast(user, params, [:approval_pending]) + end + def add_pinnned_activity(user, %Pleroma.Activity{id: id}) do if id not in user.pinned_activities do - max_pinned_statuses = Pleroma.Config.get([:instance, :max_pinned_statuses], 0) + max_pinned_statuses = Config.get([:instance, :max_pinned_statuses], 0) params = %{pinned_activities: user.pinned_activities ++ [id]} + # if pinned activity was scheduled for deletion, we remove job + if expiration = Pleroma.Workers.PurgeExpiredActivity.get_expiration(id) do + Oban.cancel_job(expiration.id) + end + user |> cast(params, [:pinned_activities]) |> validate_length(:pinned_activities, @@ -2135,9 +2332,19 @@ def add_pinnned_activity(user, %Pleroma.Activity{id: id}) do |> update_and_set_cache() end - def remove_pinnned_activity(user, %Pleroma.Activity{id: id}) do + def remove_pinnned_activity(user, %Pleroma.Activity{id: id, data: data}) do params = %{pinned_activities: List.delete(user.pinned_activities, id)} + # if pinned activity was scheduled for deletion, we reschedule it for deletion + if data["expires_at"] do + {:ok, expires_at, _} = DateTime.from_iso8601(data["expires_at"]) + + Pleroma.Workers.PurgeExpiredActivity.enqueue(%{ + activity_id: id, + expires_at: expires_at + }) + end + user |> cast(params, [:pinned_activities]) |> update_and_set_cache() diff --git a/lib/pleroma/user/notification_setting.ex b/lib/pleroma/user/notification_setting.ex index 4bd55e139..7d9e8a000 100644 --- a/lib/pleroma/user/notification_setting.ex +++ b/lib/pleroma/user/notification_setting.ex @@ -10,21 +10,15 @@ defmodule Pleroma.User.NotificationSetting do @primary_key false embedded_schema do - field(:followers, :boolean, default: true) - field(:follows, :boolean, default: true) - field(:non_follows, :boolean, default: true) - field(:non_followers, :boolean, default: true) - field(:privacy_option, :boolean, default: false) + field(:block_from_strangers, :boolean, default: false) + field(:hide_notification_contents, :boolean, default: false) end def changeset(schema, params) do schema |> cast(prepare_attrs(params), [ - :followers, - :follows, - :non_follows, - :non_followers, - :privacy_option + :block_from_strangers, + :hide_notification_contents ]) end diff --git a/lib/pleroma/user/query.ex b/lib/pleroma/user/query.ex index 66ffe9090..d618432ff 100644 --- a/lib/pleroma/user/query.ex +++ b/lib/pleroma/user/query.ex @@ -42,6 +42,7 @@ defmodule Pleroma.User.Query do external: boolean(), active: boolean(), deactivated: boolean(), + need_approval: boolean(), is_admin: boolean(), is_moderator: boolean(), super_users: boolean(), @@ -129,6 +130,7 @@ defp compose_query({:external, _}, query), do: location_query(query, false) defp compose_query({:active, _}, query) do User.restrict_deactivated(query) |> where([u], not is_nil(u.nickname)) + |> where([u], u.approval_pending == false) end defp compose_query({:legacy_active, _}, query) do @@ -146,6 +148,10 @@ defp compose_query({:deactivated, true}, query) do |> where([u], not is_nil(u.nickname)) end + defp compose_query({:need_approval, _}, query) do + where(query, [u], u.approval_pending) + end + defp compose_query({:followers, %User{id: id}}, query) do query |> where([u], u.id != ^id) diff --git a/lib/pleroma/user/search.ex b/lib/pleroma/user/search.ex index cec59c372..7babd47ea 100644 --- a/lib/pleroma/user/search.ex +++ b/lib/pleroma/user/search.ex @@ -52,6 +52,7 @@ defp search_query(query_string, for_user, following) do |> base_query(following) |> filter_blocked_user(for_user) |> filter_invisible_users() + |> filter_internal_users() |> filter_blocked_domains(for_user) |> fts_search(query_string) |> trigram_rank(query_string) @@ -68,11 +69,15 @@ defp fts_search(query, query_string) do u in query, where: fragment( + # The fragment must _exactly_ match `users_fts_index`, otherwise the index won't work """ - (to_tsvector('simple', ?) || to_tsvector('simple', ?)) @@ to_tsquery('simple', ?) + ( + setweight(to_tsvector('simple', regexp_replace(?, '\\W', ' ', 'g')), 'A') || + setweight(to_tsvector('simple', regexp_replace(coalesce(?, ''), '\\W', ' ', 'g')), 'B') + ) @@ to_tsquery('simple', ?) """, - u.name, u.nickname, + u.name, ^query_string ) ) @@ -87,28 +92,40 @@ defp to_tsquery(query_string) do |> Enum.join(" | ") end + # Considers nickname match, localized nickname match, name match; preferences nickname match defp trigram_rank(query, query_string) do from( u in query, select_merge: %{ search_rank: fragment( - "similarity(?, trim(? || ' ' || coalesce(?, '')))", + """ + similarity(?, ?) + + similarity(?, regexp_replace(?, '@.+', '')) + + similarity(?, trim(coalesce(?, ''))) + """, ^query_string, u.nickname, + ^query_string, + u.nickname, + ^query_string, u.name ) } ) end - defp base_query(_user, false), do: User - defp base_query(user, true), do: User.get_followers_query(user) + defp base_query(%User{} = user, true), do: User.get_friends_query(user) + defp base_query(_user, _following), do: User defp filter_invisible_users(query) do from(q in query, where: q.invisible == false) end + defp filter_internal_users(query) do + from(q in query, where: q.actor_type != "Application") + end + defp filter_blocked_user(query, %User{} = blocker) do query |> join(:left, [u], b in Pleroma.UserRelationship, diff --git a/lib/pleroma/user/welcome_chat_message.ex b/lib/pleroma/user/welcome_chat_message.ex new file mode 100644 index 000000000..3e7d1f424 --- /dev/null +++ b/lib/pleroma/user/welcome_chat_message.ex @@ -0,0 +1,45 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.User.WelcomeChatMessage do + alias Pleroma.Config + alias Pleroma.User + alias Pleroma.Web.CommonAPI + + @spec enabled?() :: boolean() + def enabled?, do: Config.get([:welcome, :chat_message, :enabled], false) + + @spec post_message(User.t()) :: {:ok, Pleroma.Activity.t() | nil} + def post_message(user) do + [:welcome, :chat_message, :sender_nickname] + |> Config.get(nil) + |> fetch_sender() + |> do_post(user, welcome_message()) + end + + defp do_post(%User{} = sender, recipient, message) + when is_binary(message) do + CommonAPI.post_chat_message( + sender, + recipient, + message + ) + end + + defp do_post(_sender, _recipient, _message), do: {:ok, nil} + + defp fetch_sender(nickname) when is_binary(nickname) do + with %User{local: true} = user <- User.get_cached_by_nickname(nickname) do + user + else + _ -> nil + end + end + + defp fetch_sender(_), do: nil + + defp welcome_message do + Config.get([:welcome, :chat_message, :message], nil) + end +end diff --git a/lib/pleroma/user/welcome_email.ex b/lib/pleroma/user/welcome_email.ex new file mode 100644 index 000000000..5322000d4 --- /dev/null +++ b/lib/pleroma/user/welcome_email.ex @@ -0,0 +1,62 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.User.WelcomeEmail do + @moduledoc """ + The module represents the functions to send welcome email. + """ + + alias Pleroma.Config + alias Pleroma.Emails + alias Pleroma.User + + import Pleroma.Config.Helpers, only: [instance_name: 0] + + @spec enabled?() :: boolean() + def enabled?, do: Config.get([:welcome, :email, :enabled], false) + + @spec send_email(User.t()) :: {:ok, Oban.Job.t()} + def send_email(%User{} = user) do + user + |> Emails.UserEmail.welcome(email_options(user)) + |> Emails.Mailer.deliver_async() + end + + defp email_options(user) do + bindings = [user: user, instance_name: instance_name()] + + %{} + |> add_sender(Config.get([:welcome, :email, :sender], nil)) + |> add_option(:subject, bindings) + |> add_option(:html, bindings) + |> add_option(:text, bindings) + end + + defp add_option(opts, option, bindings) do + [:welcome, :email, option] + |> Config.get(nil) + |> eval_string(bindings) + |> merge_options(opts, option) + end + + defp add_sender(opts, {_name, _email} = sender) do + merge_options(sender, opts, :sender) + end + + defp add_sender(opts, sender) when is_binary(sender) do + add_sender(opts, {instance_name(), sender}) + end + + defp add_sender(opts, _), do: opts + + defp merge_options(nil, options, _option), do: options + + defp merge_options(value, options, option) do + Map.merge(options, %{option => value}) + end + + defp eval_string(nil, _), do: nil + defp eval_string("", _), do: nil + defp eval_string(str, bindings), do: EEx.eval_string(str, bindings) +end diff --git a/lib/pleroma/user/welcome_message.ex b/lib/pleroma/user/welcome_message.ex index f8f520285..86e1c0678 100644 --- a/lib/pleroma/user/welcome_message.ex +++ b/lib/pleroma/user/welcome_message.ex @@ -3,32 +3,45 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.User.WelcomeMessage do + alias Pleroma.Config alias Pleroma.User alias Pleroma.Web.CommonAPI - def post_welcome_message_to_user(user) do - with %User{} = sender_user <- welcome_user(), - message when is_binary(message) <- welcome_message() do - CommonAPI.post(sender_user, %{ - visibility: "direct", - status: "@#{user.nickname}\n#{message}" - }) - else - _ -> {:ok, nil} - end + @spec enabled?() :: boolean() + def enabled?, do: Config.get([:welcome, :direct_message, :enabled], false) + + @spec post_message(User.t()) :: {:ok, Pleroma.Activity.t() | nil} + def post_message(user) do + [:welcome, :direct_message, :sender_nickname] + |> Config.get(nil) + |> fetch_sender() + |> do_post(user, welcome_message()) end - defp welcome_user do - with nickname when is_binary(nickname) <- - Pleroma.Config.get([:instance, :welcome_user_nickname]), - %User{local: true} = user <- User.get_cached_by_nickname(nickname) do + defp do_post(%User{} = sender, %User{nickname: nickname}, message) + when is_binary(message) do + CommonAPI.post( + sender, + %{ + visibility: "direct", + status: "@#{nickname}\n#{message}" + } + ) + end + + defp do_post(_sender, _recipient, _message), do: {:ok, nil} + + defp fetch_sender(nickname) when is_binary(nickname) do + with %User{local: true} = user <- User.get_cached_by_nickname(nickname) do user else _ -> nil end end + defp fetch_sender(_), do: nil + defp welcome_message do - Pleroma.Config.get([:instance, :welcome_message]) + Config.get([:welcome, :direct_message, :message], nil) end end diff --git a/lib/pleroma/utils.ex b/lib/pleroma/utils.ex index 6b8e3accf..21d1159be 100644 --- a/lib/pleroma/utils.ex +++ b/lib/pleroma/utils.ex @@ -9,4 +9,19 @@ def compile_dir(dir) when is_binary(dir) do |> Enum.map(&Path.join(dir, &1)) |> Kernel.ParallelCompiler.compile() end + + @doc """ + POSIX-compliant check if command is available in the system + + ## Examples + iex> command_available?("git") + true + iex> command_available?("wrongcmd") + false + + """ + @spec command_available?(String.t()) :: boolean() + def command_available?(command) do + match?({_output, 0}, System.cmd("sh", ["-c", "command -v #{command}"])) + end end diff --git a/lib/pleroma/web/activity_pub/activity_pub.ex b/lib/pleroma/web/activity_pub/activity_pub.ex index c9dc6135c..66a9f78a3 100644 --- a/lib/pleroma/web/activity_pub/activity_pub.ex +++ b/lib/pleroma/web/activity_pub/activity_pub.ex @@ -5,11 +5,11 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do alias Pleroma.Activity alias Pleroma.Activity.Ir.Topics - alias Pleroma.ActivityExpiration alias Pleroma.Config alias Pleroma.Constants alias Pleroma.Conversation alias Pleroma.Conversation.Participation + alias Pleroma.Filter alias Pleroma.Maps alias Pleroma.Notification alias Pleroma.Object @@ -65,7 +65,7 @@ defp check_remote_limit(%{"object" => %{"content" => content}}) when not is_nil( defp check_remote_limit(_), do: true - defp increase_note_count_if_public(actor, object) do + def increase_note_count_if_public(actor, object) do if is_public?(object), do: User.increase_note_count(actor), else: {:ok, actor} end @@ -84,17 +84,7 @@ defp increase_replies_count_if_reply(%{ defp increase_replies_count_if_reply(_create_data), do: :noop - defp increase_poll_votes_if_vote(%{ - "object" => %{"inReplyTo" => reply_ap_id, "name" => name}, - "type" => "Create", - "actor" => actor - }) do - Object.increase_vote_count(reply_ap_id, name, actor) - end - - defp increase_poll_votes_if_vote(_create_data), do: :noop - - @object_types ["ChatMessage"] + @object_types ~w[ChatMessage Question Answer Audio Event] @spec persist(map(), keyword()) :: {:ok, Activity.t() | Object.t()} def persist(%{"type" => type} = object, meta) when type in @object_types do with {:ok, object} <- Object.create(object) do @@ -111,7 +101,9 @@ def persist(object, meta) do local: local, recipients: recipients, actor: object["actor"] - }) do + }), + # TODO: add tests for expired activities, when Note type will be supported in new pipeline + {:ok, _} <- maybe_create_activity_expiration(activity) do {:ok, activity, meta} end end @@ -120,23 +112,14 @@ def persist(object, meta) do def insert(map, local \\ true, fake \\ false, bypass_actor_check \\ false) when is_map(map) do with nil <- Activity.normalize(map), map <- lazy_put_activity_defaults(map, fake), - true <- bypass_actor_check || check_actor_is_active(map["actor"]), - {_, true} <- {:remote_limit_error, check_remote_limit(map)}, + {_, true} <- {:actor_check, bypass_actor_check || check_actor_is_active(map["actor"])}, + {_, true} <- {:remote_limit_pass, check_remote_limit(map)}, {:ok, map} <- MRF.filter(map), {recipients, _, _} = get_recipients(map), {:fake, false, map, recipients} <- {:fake, fake, map, recipients}, {:containment, :ok} <- {:containment, Containment.contain_child(map)}, - {:ok, map, object} <- insert_full_object(map) do - {:ok, activity} = - %Activity{ - data: map, - local: local, - actor: map["actor"], - recipients: recipients - } - |> Repo.insert() - |> maybe_create_activity_expiration() - + {:ok, map, object} <- insert_full_object(map), + {:ok, activity} <- insert_activity_with_expiration(map, local, recipients) do # Splice in the child object if we have one. activity = Maps.put_if_present(activity, :object, object) @@ -147,6 +130,15 @@ def insert(map, local \\ true, fake \\ false, bypass_actor_check \\ false) when %Activity{} = activity -> {:ok, activity} + {:actor_check, _} -> + {:error, false} + + {:containment, _} = error -> + error + + {:error, _} = error -> + error + {:fake, true, map, recipients} -> activity = %Activity{ data: map, @@ -159,8 +151,24 @@ def insert(map, local \\ true, fake \\ false, bypass_actor_check \\ false) when Pleroma.Web.RichMedia.Helpers.fetch_data_for_activity(activity) {:ok, activity} - error -> - {:error, error} + {:remote_limit_pass, _} -> + {:error, :remote_limit} + + {:reject, reason} -> + {:error, reason} + end + end + + defp insert_activity_with_expiration(data, local, recipients) do + struct = %Activity{ + data: data, + local: local, + actor: data["actor"], + recipients: recipients + } + + with {:ok, activity} <- Repo.insert(struct) do + maybe_create_activity_expiration(activity) end end @@ -173,13 +181,19 @@ def notify_and_stream(activity) do stream_out_participations(participations) end - defp maybe_create_activity_expiration({:ok, %{data: %{"expires_at" => expires_at}} = activity}) do - with {:ok, _} <- ActivityExpiration.create(activity, expires_at) do + defp maybe_create_activity_expiration( + %{data: %{"expires_at" => %DateTime{} = expires_at}} = activity + ) do + with {:ok, _job} <- + Pleroma.Workers.PurgeExpiredActivity.enqueue(%{ + activity_id: activity.id, + expires_at: expires_at + }) do {:ok, activity} end end - defp maybe_create_activity_expiration(result), do: result + defp maybe_create_activity_expiration(activity), do: {:ok, activity} defp create_or_bump_conversation(activity, actor) do with {:ok, conversation} <- Conversation.create_or_bump_for(activity), @@ -210,7 +224,7 @@ def stream_out_participations(%Object{data: %{"context" => context}}, user) do conversation = Repo.preload(conversation, :participations) last_activity_id = - fetch_latest_activity_id_for_context(conversation.ap_id, %{ + fetch_latest_direct_activity_id_for_context(conversation.ap_id, %{ user: user, blocking_user: user }) @@ -257,7 +271,6 @@ defp do_create(%{to: to, actor: actor, context: context, object: object} = param with {:ok, activity} <- insert(create_data, local, fake), {:fake, false, activity} <- {:fake, fake, activity}, _ <- increase_replies_count_if_reply(create_data), - _ <- increase_poll_votes_if_vote(create_data), {:quick_insert, false, activity} <- {:quick_insert, quick_insert?, activity}, {:ok, _actor} <- increase_note_count_if_public(actor, activity), _ <- notify_and_stream(activity), @@ -295,76 +308,6 @@ def listen(%{to: to, actor: actor, context: context, object: object} = params) d end end - @spec accept(map()) :: {:ok, Activity.t()} | {:error, any()} - def accept(params) do - accept_or_reject("Accept", params) - end - - @spec reject(map()) :: {:ok, Activity.t()} | {:error, any()} - def reject(params) do - accept_or_reject("Reject", params) - end - - @spec accept_or_reject(String.t(), map()) :: {:ok, Activity.t()} | {:error, any()} - defp accept_or_reject(type, %{to: to, actor: actor, object: object} = params) do - local = Map.get(params, :local, true) - activity_id = Map.get(params, :activity_id, nil) - - data = - %{"to" => to, "type" => type, "actor" => actor.ap_id, "object" => object} - |> Maps.put_if_present("id", activity_id) - - with {:ok, activity} <- insert(data, local), - _ <- notify_and_stream(activity), - :ok <- maybe_federate(activity) do - {:ok, activity} - end - end - - @spec update(map()) :: {:ok, Activity.t()} | {:error, any()} - def update(%{to: to, cc: cc, actor: actor, object: object} = params) do - local = !(params[:local] == false) - activity_id = params[:activity_id] - - data = - %{ - "to" => to, - "cc" => cc, - "type" => "Update", - "actor" => actor, - "object" => object - } - |> Maps.put_if_present("id", activity_id) - - with {:ok, activity} <- insert(data, local), - _ <- notify_and_stream(activity), - :ok <- maybe_federate(activity) do - {:ok, activity} - end - end - - @spec follow(User.t(), User.t(), String.t() | nil, boolean(), keyword()) :: - {:ok, Activity.t()} | {:error, any()} - def follow(follower, followed, activity_id \\ nil, local \\ true, opts \\ []) do - with {:ok, result} <- - Repo.transaction(fn -> do_follow(follower, followed, activity_id, local, opts) end) do - result - end - end - - defp do_follow(follower, followed, activity_id, local, opts) do - skip_notify_and_stream = Keyword.get(opts, :skip_notify_and_stream, false) - data = make_follow_data(follower, followed, activity_id) - - with {:ok, activity} <- insert(data, local), - _ <- skip_notify_and_stream || notify_and_stream(activity), - :ok <- maybe_federate(activity) do - {:ok, activity} - else - {:error, error} -> Repo.rollback(error) - end - end - @spec unfollow(User.t(), User.t(), String.t() | nil, boolean()) :: {:ok, Activity.t()} | nil | {:error, any()} def unfollow(follower, followed, activity_id \\ nil, local \\ true) do @@ -388,33 +331,6 @@ defp do_unfollow(follower, followed, activity_id, local) do end end - @spec block(User.t(), User.t(), String.t() | nil, boolean()) :: - {:ok, Activity.t()} | {:error, any()} - def block(blocker, blocked, activity_id \\ nil, local \\ true) do - with {:ok, result} <- - Repo.transaction(fn -> do_block(blocker, blocked, activity_id, local) end) do - result - end - end - - defp do_block(blocker, blocked, activity_id, local) do - unfollow_blocked = Config.get([:activitypub, :unfollow_blocked]) - - if unfollow_blocked and fetch_latest_follow(blocker, blocked) do - unfollow(blocker, blocked, nil, local) - end - - block_data = make_block_data(blocker, blocked, activity_id) - - with {:ok, activity} <- insert(block_data, local), - _ <- notify_and_stream(activity), - :ok <- maybe_federate(activity) do - {:ok, activity} - else - {:error, error} -> Repo.rollback(error) - end - end - @spec flag(map()) :: {:ok, Activity.t()} | {:error, any()} def flag( %{ @@ -495,6 +411,7 @@ def fetch_activities_for_context_query(context, opts) do |> maybe_set_thread_muted_field(opts) |> restrict_blocked(opts) |> restrict_recipients(recipients, opts[:user]) + |> restrict_filtered(opts) |> where( [activity], fragment( @@ -517,11 +434,12 @@ def fetch_activities_for_context(context, opts \\ %{}) do |> Repo.all() end - @spec fetch_latest_activity_id_for_context(String.t(), keyword() | map()) :: + @spec fetch_latest_direct_activity_id_for_context(String.t(), keyword() | map()) :: FlakeId.Ecto.CompatType.t() | nil - def fetch_latest_activity_id_for_context(context, opts \\ %{}) do + def fetch_latest_direct_activity_id_for_context(context, opts \\ %{}) do context |> fetch_activities_for_context_query(Map.merge(%{skip_preload: true}, opts)) + |> restrict_visibility(%{visibility: "direct"}) |> limit(1) |> select([a], a.id) |> Repo.one() @@ -833,7 +751,8 @@ defp restrict_media(_query, %{only_media: _val, skip_preload: true}) do defp restrict_media(query, %{only_media: true}) do from( - [_activity, object] in query, + [activity, object] in query, + where: fragment("(?)->>'type' = ?", activity.data, "Create"), where: fragment("not (?)->'attachment' = (?)", object.data, ^[]) ) end @@ -1008,6 +927,26 @@ defp restrict_instance(query, %{instance: instance}) do defp restrict_instance(query, _), do: query + defp restrict_filtered(query, %{user: %User{} = user}) do + case Filter.compose_regex(user) do + nil -> + query + + regex -> + from([activity, object] in query, + where: + fragment("not(?->>'content' ~* ?)", object.data, ^regex) or + activity.actor == ^user.ap_id + ) + end + end + + defp restrict_filtered(query, %{blocking_user: %User{} = user}) do + restrict_filtered(query, %{user: user}) + end + + defp restrict_filtered(query, _), do: query + defp exclude_poll_votes(query, %{include_poll_votes: true}), do: query defp exclude_poll_votes(query, _) do @@ -1138,6 +1077,7 @@ def fetch_activities_query(recipients, opts \\ %{}) do |> restrict_favorited_by(opts) |> restrict_blocked(restrict_blocked_opts) |> restrict_muted(restrict_muted_opts) + |> restrict_filtered(opts) |> restrict_media(opts) |> restrict_visibility(opts) |> restrict_thread_visibility(opts, config) @@ -1146,6 +1086,7 @@ def fetch_activities_query(recipients, opts \\ %{}) do |> restrict_muted_reblogs(restrict_muted_reblogs_opts) |> restrict_instance(opts) |> restrict_announce_object_actor(opts) + |> restrict_filtered(opts) |> Activity.restrict_deactivated_users() |> exclude_poll_votes(opts) |> exclude_chat_messages(opts) @@ -1271,6 +1212,8 @@ defp object_to_user_data(data) do end) locked = data["manuallyApprovesFollowers"] || false + capabilities = data["capabilities"] || %{} + accepts_chat_messages = capabilities["acceptsChatMessages"] data = Transmogrifier.maybe_fix_user_object(data) discoverable = data["discoverable"] || false invisible = data["invisible"] || false @@ -1304,12 +1247,13 @@ defp object_to_user_data(data) do name: data["name"], follower_address: data["followers"], following_address: data["following"], - bio: data["summary"], + bio: data["summary"] || "", actor_type: actor_type, also_known_as: Map.get(data, "alsoKnownAs", []), public_key: public_key, inbox: data["inbox"], - shared_inbox: shared_inbox + shared_inbox: shared_inbox, + accepts_chat_messages: accepts_chat_messages } # nickname can be nil because of virtual actors @@ -1412,12 +1356,40 @@ def fetch_and_prepare_user_from_ap_id(ap_id) do Logger.debug("Could not decode user at fetch #{ap_id}, #{inspect(e)}") {:error, e} + {:error, {:reject, reason} = e} -> + Logger.info("Rejected user #{ap_id}: #{inspect(reason)}") + {:error, e} + {:error, e} -> Logger.error("Could not decode user at fetch #{ap_id}, #{inspect(e)}") {:error, e} end end + def maybe_handle_clashing_nickname(data) do + with nickname when is_binary(nickname) <- data[:nickname], + %User{} = old_user <- User.get_by_nickname(nickname), + {_, false} <- {:ap_id_comparison, data[:ap_id] == old_user.ap_id} do + Logger.info( + "Found an old user for #{nickname}, the old ap id is #{old_user.ap_id}, new one is #{ + data[:ap_id] + }, renaming." + ) + + old_user + |> User.remote_user_changeset(%{nickname: "#{old_user.id}.#{old_user.nickname}"}) + |> User.update_and_set_cache() + else + {:ap_id_comparison, true} -> + Logger.info( + "Found an old user for #{data[:nickname]}, but the ap id #{data[:ap_id]} is the same as the new user. Race condition? Not changing anything." + ) + + _ -> + nil + end + end + def make_user_from_ap_id(ap_id) do user = User.get_cached_by_ap_id(ap_id) @@ -1430,6 +1402,8 @@ def make_user_from_ap_id(ap_id) do |> User.remote_user_changeset(data) |> User.update_and_set_cache() else + maybe_handle_clashing_nickname(data) + data |> User.remote_user_changeset() |> Repo.insert() diff --git a/lib/pleroma/web/activity_pub/activity_pub_controller.ex b/lib/pleroma/web/activity_pub/activity_pub_controller.ex index e2a5fb9e9..27bf6347d 100644 --- a/lib/pleroma/web/activity_pub/activity_pub_controller.ex +++ b/lib/pleroma/web/activity_pub/activity_pub_controller.ex @@ -401,21 +401,30 @@ def read_inbox(%{assigns: %{user: %User{nickname: as_nickname}}} = conn, %{ defp handle_user_activity( %User{} = user, - %{"type" => "Create", "object" => %{"type" => "Note"}} = params + %{"type" => "Create", "object" => %{"type" => "Note"} = object} = params ) do - object = - params["object"] - |> Map.merge(Map.take(params, ["to", "cc"])) - |> Map.put("attributedTo", user.ap_id()) - |> Transmogrifier.fix_object() + content = if is_binary(object["content"]), do: object["content"], else: "" + name = if is_binary(object["name"]), do: object["name"], else: "" + summary = if is_binary(object["summary"]), do: object["summary"], else: "" + length = String.length(content <> name <> summary) - ActivityPub.create(%{ - to: params["to"], - actor: user, - context: object["context"], - object: object, - additional: Map.take(params, ["cc"]) - }) + if length > Pleroma.Config.get([:instance, :limit]) do + {:error, dgettext("errors", "Note is over the character limit")} + else + object = + object + |> Map.merge(Map.take(params, ["to", "cc"])) + |> Map.put("attributedTo", user.ap_id()) + |> Transmogrifier.fix_object() + + ActivityPub.create(%{ + to: params["to"], + actor: user, + context: object["context"], + object: object, + additional: Map.take(params, ["cc"]) + }) + end end defp handle_user_activity(%User{} = user, %{"type" => "Delete"} = params) do @@ -516,7 +525,6 @@ defp ensure_user_keys_present_and_maybe_refresh_for_user(user, for_user) do {new_user, for_user} end - # TODO: Add support for "object" field @doc """ Endpoint based on @@ -527,6 +535,8 @@ defp ensure_user_keys_present_and_maybe_refresh_for_user(user, for_user) do Response: - HTTP Code: 201 Created - HTTP Body: ActivityPub object to be inserted into another's `attachment` field + + Note: Will not point to a URL with a `Location` header because no standalone Activity has been created. """ def upload_media(%{assigns: %{user: %User{} = user}} = conn, %{"file" => file} = data) do with {:ok, object} <- diff --git a/lib/pleroma/web/activity_pub/builder.ex b/lib/pleroma/web/activity_pub/builder.ex index 1aac62c69..9a7b7d9de 100644 --- a/lib/pleroma/web/activity_pub/builder.ex +++ b/lib/pleroma/web/activity_pub/builder.ex @@ -14,6 +14,41 @@ defmodule Pleroma.Web.ActivityPub.Builder do require Pleroma.Constants + def accept_or_reject(actor, activity, type) do + data = %{ + "id" => Utils.generate_activity_id(), + "actor" => actor.ap_id, + "type" => type, + "object" => activity.data["id"], + "to" => [activity.actor] + } + + {:ok, data, []} + end + + @spec reject(User.t(), Activity.t()) :: {:ok, map(), keyword()} + def reject(actor, rejected_activity) do + accept_or_reject(actor, rejected_activity, "Reject") + end + + @spec accept(User.t(), Activity.t()) :: {:ok, map(), keyword()} + def accept(actor, accepted_activity) do + accept_or_reject(actor, accepted_activity, "Accept") + end + + @spec follow(User.t(), User.t()) :: {:ok, map(), keyword()} + def follow(follower, followed) do + data = %{ + "id" => Utils.generate_activity_id(), + "actor" => follower.ap_id, + "type" => "Follow", + "object" => followed.ap_id, + "to" => [followed.ap_id] + } + + {:ok, data, []} + end + @spec emoji_react(User.t(), Object.t(), String.t()) :: {:ok, map(), keyword()} def emoji_react(actor, object, emoji) do with {:ok, data, meta} <- object_action(actor, object) do @@ -67,6 +102,13 @@ def delete(actor, object_id) do end def create(actor, object, recipients) do + context = + if is_map(object) do + object["context"] + else + nil + end + {:ok, %{ "id" => Utils.generate_activity_id(), @@ -75,7 +117,8 @@ def create(actor, object, recipients) do "object" => object, "type" => "Create", "published" => DateTime.utc_now() |> DateTime.to_iso8601() - }, []} + } + |> Pleroma.Maps.put_if_present("context", context), []} end def chat_message(actor, recipient, content, opts \\ []) do @@ -102,6 +145,22 @@ def chat_message(actor, recipient, content, opts \\ []) do end end + def answer(user, object, name) do + {:ok, + %{ + "type" => "Answer", + "actor" => user.ap_id, + "attributedTo" => user.ap_id, + "cc" => [object.data["actor"]], + "to" => [], + "name" => name, + "inReplyTo" => object.data["id"], + "context" => object.data["context"], + "published" => DateTime.utc_now() |> DateTime.to_iso8601(), + "id" => Utils.generate_object_id() + }, []} + end + @spec tombstone(String.t(), String.t()) :: {:ok, map(), keyword()} def tombstone(actor, id) do {:ok, @@ -123,13 +182,40 @@ def like(actor, object) do end end + # Retricted to user updates for now, always public + @spec update(User.t(), Object.t()) :: {:ok, map(), keyword()} + def update(actor, object) do + to = [Pleroma.Constants.as_public(), actor.follower_address] + + {:ok, + %{ + "id" => Utils.generate_activity_id(), + "type" => "Update", + "actor" => actor.ap_id, + "object" => object, + "to" => to + }, []} + end + + @spec block(User.t(), User.t()) :: {:ok, map(), keyword()} + def block(blocker, blocked) do + {:ok, + %{ + "id" => Utils.generate_activity_id(), + "type" => "Block", + "actor" => blocker.ap_id, + "object" => blocked.ap_id, + "to" => [blocked.ap_id] + }, []} + end + @spec announce(User.t(), Object.t(), keyword()) :: {:ok, map(), keyword()} def announce(actor, object, options \\ []) do public? = Keyword.get(options, :public, false) to = cond do - actor.ap_id == Relay.relay_ap_id() -> + actor.ap_id == Relay.ap_id() -> [actor.follower_address] public? -> diff --git a/lib/pleroma/web/activity_pub/mrf.ex b/lib/pleroma/web/activity_pub/mrf.ex index 5a4a76085..206d6af52 100644 --- a/lib/pleroma/web/activity_pub/mrf.ex +++ b/lib/pleroma/web/activity_pub/mrf.ex @@ -16,7 +16,7 @@ def filter(policies, %{} = object) do def filter(%{} = object), do: get_policies() |> filter(object) def get_policies do - Pleroma.Config.get([:instance, :rewrite_policy], []) |> get_policies() + Pleroma.Config.get([:mrf, :policies], []) |> get_policies() end defp get_policies(policy) when is_atom(policy), do: [policy] @@ -51,7 +51,7 @@ def describe(policies) do get_policies() |> Enum.map(fn policy -> to_string(policy) |> String.split(".") |> List.last() end) - exclusions = Pleroma.Config.get([:instance, :mrf_transparency_exclusions]) + exclusions = Pleroma.Config.get([:mrf, :transparency_exclusions]) base = %{ diff --git a/lib/pleroma/web/activity_pub/mrf/activity_expiration_policy.ex b/lib/pleroma/web/activity_pub/mrf/activity_expiration_policy.ex index 8e47f1e02..bee47b4ed 100644 --- a/lib/pleroma/web/activity_pub/mrf/activity_expiration_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/activity_expiration_policy.ex @@ -21,8 +21,8 @@ def filter(activity) do @impl true def describe, do: {:ok, %{}} - defp local?(%{"id" => id}) do - String.starts_with?(id, Pleroma.Web.Endpoint.url()) + defp local?(%{"actor" => actor}) do + String.starts_with?(actor, Pleroma.Web.Endpoint.url()) end defp note?(activity) do @@ -31,10 +31,10 @@ defp note?(activity) do defp maybe_add_expiration(activity) do days = Pleroma.Config.get([:mrf_activity_expiration, :days], 365) - expires_at = NaiveDateTime.utc_now() |> Timex.shift(days: days) + expires_at = DateTime.utc_now() |> Timex.shift(days: days) with %{"expires_at" => existing_expires_at} <- activity, - :lt <- NaiveDateTime.compare(existing_expires_at, expires_at) do + :lt <- DateTime.compare(existing_expires_at, expires_at) do activity else _ -> Map.put(activity, "expires_at", expires_at) diff --git a/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex b/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex index 0270b96ae..b96388489 100644 --- a/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex @@ -60,7 +60,7 @@ def filter(%{"type" => "Follow", "actor" => actor_id} = message) do if score < 0.8 do {:ok, message} else - {:reject, nil} + {:reject, "[AntiFollowbotPolicy] Scored #{actor_id} as #{score}"} end end diff --git a/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex b/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex index 9e7800997..b22464111 100644 --- a/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex @@ -27,23 +27,25 @@ defp contains_links?(_), do: false @impl true def filter(%{"type" => "Create", "actor" => actor, "object" => object} = message) do - with {:ok, %User{} = u} <- User.get_or_fetch_by_ap_id(actor), + with {:ok, %User{local: false} = u} <- User.get_or_fetch_by_ap_id(actor), {:contains_links, true} <- {:contains_links, contains_links?(object)}, {:old_user, true} <- {:old_user, old_user?(u)} do {:ok, message} else + {:ok, %User{local: true}} -> + {:ok, message} + {:contains_links, false} -> {:ok, message} {:old_user, false} -> - {:reject, nil} + {:reject, "[AntiLinkSpamPolicy] User has no posts nor followers"} {:error, _} -> - {:reject, nil} + {:reject, "[AntiLinkSpamPolicy] Failed to get or fetch user by ap_id"} e -> - Logger.warn("[MRF anti-link-spam] WTF: unhandled error #{inspect(e)}") - {:reject, nil} + {:reject, "[AntiLinkSpamPolicy] Unhandled error #{inspect(e)}"} end end diff --git a/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex b/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex index 2627a0007..3bf70b894 100644 --- a/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex +++ b/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex @@ -27,7 +27,8 @@ def filter_by_summary( def filter_by_summary(_in_reply_to, child), do: child - def filter(%{"type" => "Create", "object" => child_object} = object) do + def filter(%{"type" => "Create", "object" => child_object} = object) + when is_map(child_object) do child = child_object["inReplyTo"] |> Object.normalize(child_object["inReplyTo"]) diff --git a/lib/pleroma/web/activity_pub/mrf/force_bot_unlisted_policy.ex b/lib/pleroma/web/activity_pub/mrf/force_bot_unlisted_policy.ex new file mode 100644 index 000000000..ea9c3d3f5 --- /dev/null +++ b/lib/pleroma/web/activity_pub/mrf/force_bot_unlisted_policy.ex @@ -0,0 +1,56 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.MRF.ForceBotUnlistedPolicy do + alias Pleroma.User + @behaviour Pleroma.Web.ActivityPub.MRF + @moduledoc "Remove bot posts from federated timeline" + + require Pleroma.Constants + + defp check_by_actor_type(user), do: user.actor_type in ["Application", "Service"] + defp check_by_nickname(user), do: Regex.match?(~r/bot@|ebooks@/i, user.nickname) + + defp check_if_bot(user), do: check_by_actor_type(user) or check_by_nickname(user) + + @impl true + def filter( + %{ + "type" => "Create", + "to" => to, + "cc" => cc, + "actor" => actor, + "object" => object + } = message + ) do + user = User.get_cached_by_ap_id(actor) + isbot = check_if_bot(user) + + if isbot and Enum.member?(to, Pleroma.Constants.as_public()) do + to = List.delete(to, Pleroma.Constants.as_public()) ++ [user.follower_address] + cc = List.delete(cc, user.follower_address) ++ [Pleroma.Constants.as_public()] + + object = + object + |> Map.put("to", to) + |> Map.put("cc", cc) + + message = + message + |> Map.put("to", to) + |> Map.put("cc", cc) + |> Map.put("object", object) + + {:ok, message} + else + {:ok, message} + end + end + + @impl true + def filter(message), do: {:ok, message} + + @impl true + def describe, do: {:ok, %{}} +end diff --git a/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex b/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex index 1764bc789..9ba07b4e3 100644 --- a/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex @@ -13,8 +13,10 @@ defmodule Pleroma.Web.ActivityPub.MRF.HellthreadPolicy do defp delist_message(message, threshold) when threshold > 0 do follower_collection = User.get_cached_by_ap_id(message["actor"]).follower_address + to = message["to"] || [] + cc = message["cc"] || [] - follower_collection? = Enum.member?(message["to"] ++ message["cc"], follower_collection) + follower_collection? = Enum.member?(to ++ cc, follower_collection) message = case get_recipient_count(message) do @@ -41,7 +43,7 @@ defp delist_message(message, _threshold), do: {:ok, message} defp reject_message(message, threshold) when threshold > 0 do with {_, recipients} <- get_recipient_count(message) do if recipients > threshold do - {:reject, nil} + {:reject, "[HellthreadPolicy] #{recipients} recipients is over the limit of #{threshold}"} else {:ok, message} end @@ -71,7 +73,8 @@ defp get_recipient_count(message) do end @impl true - def filter(%{"type" => "Create"} = message) do + def filter(%{"type" => "Create", "object" => %{"type" => object_type}} = message) + when object_type in ~w{Note Article} do reject_threshold = Pleroma.Config.get( [:mrf_hellthread, :reject_threshold], @@ -84,7 +87,7 @@ def filter(%{"type" => "Create"} = message) do {:ok, message} <- delist_message(message, delist_threshold) do {:ok, message} else - _e -> {:reject, nil} + e -> e end end diff --git a/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex b/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex index 88b0d2b39..15e09dcf0 100644 --- a/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex @@ -24,7 +24,7 @@ defp check_reject(%{"object" => %{"content" => content, "summary" => summary}} = if Enum.any?(Pleroma.Config.get([:mrf_keyword, :reject]), fn pattern -> string_matches?(content, pattern) or string_matches?(summary, pattern) end) do - {:reject, nil} + {:reject, "[KeywordPolicy] Matches with rejected keyword"} else {:ok, message} end @@ -89,8 +89,9 @@ def filter(%{"type" => "Create", "object" => %{"content" => _content}} = message {:ok, message} <- check_replace(message) do {:ok, message} else - _e -> - {:reject, nil} + {:reject, nil} -> {:reject, "[KeywordPolicy] "} + {:reject, _} = e -> e + _e -> {:reject, "[KeywordPolicy] "} end end diff --git a/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex b/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex index dfab105a3..98d595469 100644 --- a/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex @@ -13,22 +13,16 @@ defmodule Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy do require Logger @options [ - pool: :media + pool: :media, + recv_timeout: 10_000 ] def perform(:prefetch, url) do Logger.debug("Prefetching #{inspect(url)}") - opts = - if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do - Keyword.put(@options, :recv_timeout, 10_000) - else - @options - end - url |> MediaProxy.url() - |> HTTP.get([], adapter: opts) + |> HTTP.get([], @options) end def perform(:preload, %{"object" => %{"attachment" => attachments}} = _message) do diff --git a/lib/pleroma/web/activity_pub/mrf/mention_policy.ex b/lib/pleroma/web/activity_pub/mrf/mention_policy.ex index 06f003921..7910ca131 100644 --- a/lib/pleroma/web/activity_pub/mrf/mention_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/mention_policy.ex @@ -12,8 +12,9 @@ def filter(%{"type" => "Create"} = message) do reject_actors = Pleroma.Config.get([:mrf_mention, :actors], []) recipients = (message["to"] || []) ++ (message["cc"] || []) - if Enum.any?(recipients, fn recipient -> Enum.member?(reject_actors, recipient) end) do - {:reject, nil} + if rejected_mention = + Enum.find(recipients, fn recipient -> Enum.member?(reject_actors, recipient) end) do + {:reject, "[MentionPolicy] Rejected for mention of #{rejected_mention}"} else {:ok, message} end diff --git a/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex b/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex index b0ccb63c8..d45d2d7e3 100644 --- a/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex @@ -28,7 +28,7 @@ defp check_date(%{"object" => %{"published" => published}} = message) do defp check_reject(message, actions) do if :reject in actions do - {:reject, nil} + {:reject, "[ObjectAgePolicy]"} else {:ok, message} end @@ -37,8 +37,13 @@ defp check_reject(message, actions) do defp check_delist(message, actions) do if :delist in actions do with %User{} = user <- User.get_cached_by_ap_id(message["actor"]) do - to = List.delete(message["to"], Pleroma.Constants.as_public()) ++ [user.follower_address] - cc = List.delete(message["cc"], user.follower_address) ++ [Pleroma.Constants.as_public()] + to = + List.delete(message["to"] || [], Pleroma.Constants.as_public()) ++ + [user.follower_address] + + cc = + List.delete(message["cc"] || [], user.follower_address) ++ + [Pleroma.Constants.as_public()] message = message @@ -47,9 +52,8 @@ defp check_delist(message, actions) do {:ok, message} else - # Unhandleable error: somebody is messing around, just drop the message. _e -> - {:reject, nil} + {:reject, "[ObjectAgePolicy] Unhandled error"} end else {:ok, message} @@ -59,8 +63,8 @@ defp check_delist(message, actions) do defp check_strip_followers(message, actions) do if :strip_followers in actions do with %User{} = user <- User.get_cached_by_ap_id(message["actor"]) do - to = List.delete(message["to"], user.follower_address) - cc = List.delete(message["cc"], user.follower_address) + to = List.delete(message["to"] || [], user.follower_address) + cc = List.delete(message["cc"] || [], user.follower_address) message = message @@ -69,9 +73,8 @@ defp check_strip_followers(message, actions) do {:ok, message} else - # Unhandleable error: somebody is messing around, just drop the message. _e -> - {:reject, nil} + {:reject, "[ObjectAgePolicy] Unhandled error"} end else {:ok, message} @@ -98,7 +101,7 @@ def filter(message), do: {:ok, message} @impl true def describe do mrf_object_age = - Pleroma.Config.get(:mrf_object_age) + Config.get(:mrf_object_age) |> Enum.into(%{}) {:ok, %{mrf_object_age: mrf_object_age}} diff --git a/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex b/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex index 3092f3272..0b9ed2224 100644 --- a/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex +++ b/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex @@ -38,7 +38,7 @@ def filter(%{"type" => "Create"} = object) do {:ok, object} true -> - {:reject, nil} + {:reject, "[RejectNonPublic] visibility: #{visibility}"} end end @@ -47,5 +47,5 @@ def filter(object), do: {:ok, object} @impl true def describe, - do: {:ok, %{mrf_rejectnonpublic: Pleroma.Config.get(:mrf_rejectnonpublic) |> Enum.into(%{})}} + do: {:ok, %{mrf_rejectnonpublic: Config.get(:mrf_rejectnonpublic) |> Enum.into(%{})}} end diff --git a/lib/pleroma/web/activity_pub/mrf/simple_policy.ex b/lib/pleroma/web/activity_pub/mrf/simple_policy.ex index b7dcb1b86..bb193475a 100644 --- a/lib/pleroma/web/activity_pub/mrf/simple_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/simple_policy.ex @@ -3,33 +3,36 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do - alias Pleroma.User - alias Pleroma.Web.ActivityPub.MRF @moduledoc "Filter activities depending on their origin instance" @behaviour Pleroma.Web.ActivityPub.MRF + alias Pleroma.Config + alias Pleroma.FollowingRelationship + alias Pleroma.User + alias Pleroma.Web.ActivityPub.MRF + require Pleroma.Constants defp check_accept(%{host: actor_host} = _actor_info, object) do accepts = - Pleroma.Config.get([:mrf_simple, :accept]) + Config.get([:mrf_simple, :accept]) |> MRF.subdomains_regex() cond do accepts == [] -> {:ok, object} - actor_host == Pleroma.Config.get([Pleroma.Web.Endpoint, :url, :host]) -> {:ok, object} + actor_host == Config.get([Pleroma.Web.Endpoint, :url, :host]) -> {:ok, object} MRF.subdomain_match?(accepts, actor_host) -> {:ok, object} - true -> {:reject, nil} + true -> {:reject, "[SimplePolicy] host not in accept list"} end end defp check_reject(%{host: actor_host} = _actor_info, object) do rejects = - Pleroma.Config.get([:mrf_simple, :reject]) + Config.get([:mrf_simple, :reject]) |> MRF.subdomains_regex() if MRF.subdomain_match?(rejects, actor_host) do - {:reject, nil} + {:reject, "[SimplePolicy] host in reject list"} else {:ok, object} end @@ -41,7 +44,7 @@ defp check_media_removal( ) when length(child_attachment) > 0 do media_removal = - Pleroma.Config.get([:mrf_simple, :media_removal]) + Config.get([:mrf_simple, :media_removal]) |> MRF.subdomains_regex() object = @@ -65,7 +68,7 @@ defp check_media_nsfw( } = object ) do media_nsfw = - Pleroma.Config.get([:mrf_simple, :media_nsfw]) + Config.get([:mrf_simple, :media_nsfw]) |> MRF.subdomains_regex() object = @@ -85,7 +88,7 @@ defp check_media_nsfw(_actor_info, object), do: {:ok, object} defp check_ftl_removal(%{host: actor_host} = _actor_info, object) do timeline_removal = - Pleroma.Config.get([:mrf_simple, :federated_timeline_removal]) + Config.get([:mrf_simple, :federated_timeline_removal]) |> MRF.subdomains_regex() object = @@ -106,13 +109,42 @@ defp check_ftl_removal(%{host: actor_host} = _actor_info, object) do {:ok, object} end + defp intersection(list1, list2) do + list1 -- list1 -- list2 + end + + defp check_followers_only(%{host: actor_host} = _actor_info, object) do + followers_only = + Config.get([:mrf_simple, :followers_only]) + |> MRF.subdomains_regex() + + object = + with true <- MRF.subdomain_match?(followers_only, actor_host), + user <- User.get_cached_by_ap_id(object["actor"]) do + # Don't use Map.get/3 intentionally, these must not be nil + fixed_to = object["to"] || [] + fixed_cc = object["cc"] || [] + + to = FollowingRelationship.followers_ap_ids(user, fixed_to) + cc = FollowingRelationship.followers_ap_ids(user, fixed_cc) + + object + |> Map.put("to", intersection([user.follower_address | to], fixed_to)) + |> Map.put("cc", intersection([user.follower_address | cc], fixed_cc)) + else + _ -> object + end + + {:ok, object} + end + defp check_report_removal(%{host: actor_host} = _actor_info, %{"type" => "Flag"} = object) do report_removal = - Pleroma.Config.get([:mrf_simple, :report_removal]) + Config.get([:mrf_simple, :report_removal]) |> MRF.subdomains_regex() if MRF.subdomain_match?(report_removal, actor_host) do - {:reject, nil} + {:reject, "[SimplePolicy] host in report_removal list"} else {:ok, object} end @@ -122,7 +154,7 @@ defp check_report_removal(_actor_info, object), do: {:ok, object} defp check_avatar_removal(%{host: actor_host} = _actor_info, %{"icon" => _icon} = object) do avatar_removal = - Pleroma.Config.get([:mrf_simple, :avatar_removal]) + Config.get([:mrf_simple, :avatar_removal]) |> MRF.subdomains_regex() if MRF.subdomain_match?(avatar_removal, actor_host) do @@ -136,7 +168,7 @@ defp check_avatar_removal(_actor_info, object), do: {:ok, object} defp check_banner_removal(%{host: actor_host} = _actor_info, %{"image" => _image} = object) do banner_removal = - Pleroma.Config.get([:mrf_simple, :banner_removal]) + Config.get([:mrf_simple, :banner_removal]) |> MRF.subdomains_regex() if MRF.subdomain_match?(banner_removal, actor_host) do @@ -153,11 +185,11 @@ def filter(%{"type" => "Delete", "actor" => actor} = object) do %{host: actor_host} = URI.parse(actor) reject_deletes = - Pleroma.Config.get([:mrf_simple, :reject_deletes]) + Config.get([:mrf_simple, :reject_deletes]) |> MRF.subdomains_regex() if MRF.subdomain_match?(reject_deletes, actor_host) do - {:reject, nil} + {:reject, "[SimplePolicy] host in reject_deletes list"} else {:ok, object} end @@ -172,10 +204,13 @@ def filter(%{"actor" => actor} = object) do {:ok, object} <- check_media_removal(actor_info, object), {:ok, object} <- check_media_nsfw(actor_info, object), {:ok, object} <- check_ftl_removal(actor_info, object), + {:ok, object} <- check_followers_only(actor_info, object), {:ok, object} <- check_report_removal(actor_info, object) do {:ok, object} else - _e -> {:reject, nil} + {:reject, nil} -> {:reject, "[SimplePolicy]"} + {:reject, _} = e -> e + _ -> {:reject, "[SimplePolicy]"} end end @@ -189,7 +224,9 @@ def filter(%{"id" => actor, "type" => obj_type} = object) {:ok, object} <- check_banner_removal(actor_info, object) do {:ok, object} else - _e -> {:reject, nil} + {:reject, nil} -> {:reject, "[SimplePolicy]"} + {:reject, _} = e -> e + _ -> {:reject, "[SimplePolicy]"} end end @@ -197,10 +234,10 @@ def filter(object), do: {:ok, object} @impl true def describe do - exclusions = Pleroma.Config.get([:instance, :mrf_transparency_exclusions]) + exclusions = Config.get([:mrf, :transparency_exclusions]) mrf_simple = - Pleroma.Config.get(:mrf_simple) + Config.get(:mrf_simple) |> Enum.map(fn {k, v} -> {k, Enum.reject(v, fn v -> v in exclusions end)} end) |> Enum.into(%{}) diff --git a/lib/pleroma/web/activity_pub/mrf/tag_policy.ex b/lib/pleroma/web/activity_pub/mrf/tag_policy.ex index c310462cb..febabda08 100644 --- a/lib/pleroma/web/activity_pub/mrf/tag_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/tag_policy.ex @@ -134,12 +134,13 @@ defp process_tag( if user.local == true do {:ok, message} else - {:reject, nil} + {:reject, + "[TagPolicy] Follow from #{actor} tagged with mrf_tag:disable-remote-subscription"} end end - defp process_tag("mrf_tag:disable-any-subscription", %{"type" => "Follow"}), - do: {:reject, nil} + defp process_tag("mrf_tag:disable-any-subscription", %{"type" => "Follow", "actor" => actor}), + do: {:reject, "[TagPolicy] Follow from #{actor} tagged with mrf_tag:disable-any-subscription"} defp process_tag(_, message), do: {:ok, message} diff --git a/lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex b/lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex index 651aed70f..1a28f2ba2 100644 --- a/lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex @@ -14,7 +14,7 @@ defp filter_by_list(%{"actor" => actor} = object, allow_list) do if actor in allow_list do {:ok, object} else - {:reject, nil} + {:reject, "[UserAllowListPolicy] #{actor} not in the list"} end end diff --git a/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex b/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex index 6167a74e2..a6c545570 100644 --- a/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex +++ b/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex @@ -11,22 +11,26 @@ def filter(%{"type" => "Undo", "object" => child_message} = message) do with {:ok, _} <- filter(child_message) do {:ok, message} else - {:reject, nil} -> - {:reject, nil} + {:reject, _} = e -> e end end def filter(%{"type" => message_type} = message) do with accepted_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :accept]), rejected_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :reject]), - true <- - Enum.empty?(accepted_vocabulary) || Enum.member?(accepted_vocabulary, message_type), - false <- - length(rejected_vocabulary) > 0 && Enum.member?(rejected_vocabulary, message_type), + {_, true} <- + {:accepted, + Enum.empty?(accepted_vocabulary) || Enum.member?(accepted_vocabulary, message_type)}, + {_, false} <- + {:rejected, + length(rejected_vocabulary) > 0 && Enum.member?(rejected_vocabulary, message_type)}, {:ok, _} <- filter(message["object"]) do {:ok, message} else - _ -> {:reject, nil} + {:reject, _} = e -> e + {:accepted, _} -> {:reject, "[VocabularyPolicy] #{message_type} not in accept list"} + {:rejected, _} -> {:reject, "[VocabularyPolicy] #{message_type} in reject list"} + _ -> {:reject, "[VocabularyPolicy]"} end end diff --git a/lib/pleroma/web/activity_pub/object_validator.ex b/lib/pleroma/web/activity_pub/object_validator.ex index c01c5f780..b77c06395 100644 --- a/lib/pleroma/web/activity_pub/object_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validator.ex @@ -9,26 +9,102 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidator do the system. """ + alias Pleroma.Activity + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Object alias Pleroma.User + alias Pleroma.Web.ActivityPub.ObjectValidators.AcceptRejectValidator alias Pleroma.Web.ActivityPub.ObjectValidators.AnnounceValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.AnswerValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.AudioValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.BlockValidator alias Pleroma.Web.ActivityPub.ObjectValidators.ChatMessageValidator alias Pleroma.Web.ActivityPub.ObjectValidators.CreateChatMessageValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.CreateGenericValidator alias Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator alias Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.EventValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.FollowValidator alias Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator - alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.Web.ActivityPub.ObjectValidators.QuestionValidator alias Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.UpdateValidator @spec validate(map(), keyword()) :: {:ok, map(), keyword()} | {:error, any()} def validate(object, meta) + def validate(%{"type" => type} = object, meta) + when type in ~w[Accept Reject] do + with {:ok, object} <- + object + |> AcceptRejectValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object) + {:ok, object, meta} + end + end + + def validate(%{"type" => "Event"} = object, meta) do + with {:ok, object} <- + object + |> EventValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object) + {:ok, object, meta} + end + end + + def validate(%{"type" => "Follow"} = object, meta) do + with {:ok, object} <- + object + |> FollowValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object) + {:ok, object, meta} + end + end + + def validate(%{"type" => "Block"} = block_activity, meta) do + with {:ok, block_activity} <- + block_activity + |> BlockValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + block_activity = stringify_keys(block_activity) + outgoing_blocks = Pleroma.Config.get([:activitypub, :outgoing_blocks]) + + meta = + if !outgoing_blocks do + Keyword.put(meta, :do_not_federate, true) + else + meta + end + + {:ok, block_activity, meta} + end + end + + def validate(%{"type" => "Update"} = update_activity, meta) do + with {:ok, update_activity} <- + update_activity + |> UpdateValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + update_activity = stringify_keys(update_activity) + {:ok, update_activity, meta} + end + end + def validate(%{"type" => "Undo"} = object, meta) do with {:ok, object} <- object |> UndoValidator.cast_and_validate() |> Ecto.Changeset.apply_action(:insert) do object = stringify_keys(object) + undone_object = Activity.get_by_ap_id(object["object"]) + + meta = + meta + |> Keyword.put(:object_data, undone_object.data) + {:ok, object, meta} end end @@ -63,17 +139,50 @@ def validate(%{"type" => "ChatMessage"} = object, meta) do end end + def validate(%{"type" => "Question"} = object, meta) do + with {:ok, object} <- + object + |> QuestionValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object) + {:ok, object, meta} + end + end + + def validate(%{"type" => "Audio"} = object, meta) do + with {:ok, object} <- + object + |> AudioValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object) + {:ok, object, meta} + end + end + + def validate(%{"type" => "Answer"} = object, meta) do + with {:ok, object} <- + object + |> AnswerValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) do + object = stringify_keys(object) + {:ok, object, meta} + end + end + def validate(%{"type" => "EmojiReact"} = object, meta) do with {:ok, object} <- object |> EmojiReactValidator.cast_and_validate() |> Ecto.Changeset.apply_action(:insert) do - object = stringify_keys(object |> Map.from_struct()) + object = stringify_keys(object) {:ok, object, meta} end end - def validate(%{"type" => "Create", "object" => object} = create_activity, meta) do + def validate( + %{"type" => "Create", "object" => %{"type" => "ChatMessage"} = object} = create_activity, + meta + ) do with {:ok, object_data} <- cast_and_apply(object), meta = Keyword.put(meta, :object_data, object_data |> stringify_keys), {:ok, create_activity} <- @@ -85,12 +194,28 @@ def validate(%{"type" => "Create", "object" => object} = create_activity, meta) end end + def validate( + %{"type" => "Create", "object" => %{"type" => objtype} = object} = create_activity, + meta + ) + when objtype in ~w[Question Answer Audio Event] do + with {:ok, object_data} <- cast_and_apply(object), + meta = Keyword.put(meta, :object_data, object_data |> stringify_keys), + {:ok, create_activity} <- + create_activity + |> CreateGenericValidator.cast_and_validate(meta) + |> Ecto.Changeset.apply_action(:insert) do + create_activity = stringify_keys(create_activity) + {:ok, create_activity, meta} + end + end + def validate(%{"type" => "Announce"} = object, meta) do with {:ok, object} <- object |> AnnounceValidator.cast_and_validate() |> Ecto.Changeset.apply_action(:insert) do - object = stringify_keys(object |> Map.from_struct()) + object = stringify_keys(object) {:ok, object, meta} end end @@ -99,8 +224,25 @@ def cast_and_apply(%{"type" => "ChatMessage"} = object) do ChatMessageValidator.cast_and_apply(object) end + def cast_and_apply(%{"type" => "Question"} = object) do + QuestionValidator.cast_and_apply(object) + end + + def cast_and_apply(%{"type" => "Answer"} = object) do + AnswerValidator.cast_and_apply(object) + end + + def cast_and_apply(%{"type" => "Audio"} = object) do + AudioValidator.cast_and_apply(object) + end + + def cast_and_apply(%{"type" => "Event"} = object) do + EventValidator.cast_and_apply(object) + end + def cast_and_apply(o), do: {:error, {:validator_not_set, o}} + # is_struct/1 isn't present in Elixir 1.8.x def stringify_keys(%{__struct__: _} = object) do object |> Map.from_struct() @@ -120,7 +262,7 @@ def stringify_keys(object) when is_list(object) do def stringify_keys(object), do: object def fetch_actor(object) do - with {:ok, actor} <- Types.ObjectID.cast(object["actor"]) do + with {:ok, actor} <- ObjectValidators.ObjectID.cast(object["actor"]) do User.get_or_fetch_by_ap_id(actor) end end diff --git a/lib/pleroma/web/activity_pub/object_validators/accept_reject_validator.ex b/lib/pleroma/web/activity_pub/object_validators/accept_reject_validator.ex new file mode 100644 index 000000000..179beda58 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/accept_reject_validator.ex @@ -0,0 +1,56 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.AcceptRejectValidator do + use Ecto.Schema + + alias Pleroma.Activity + alias Pleroma.EctoType.ActivityPub.ObjectValidators + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:type, :string) + field(:object, ObjectValidators.ObjectID) + field(:actor, ObjectValidators.ObjectID) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + end + + def cast_data(data) do + %__MODULE__{} + |> cast(data, __schema__(:fields)) + end + + def validate_data(cng) do + cng + |> validate_required([:id, :type, :actor, :to, :cc, :object]) + |> validate_inclusion(:type, ["Accept", "Reject"]) + |> validate_actor_presence() + |> validate_object_presence(allowed_types: ["Follow"]) + |> validate_accept_reject_rights() + end + + def cast_and_validate(data) do + data + |> cast_data + |> validate_data + end + + def validate_accept_reject_rights(cng) do + with object_id when is_binary(object_id) <- get_field(cng, :object), + %Activity{data: %{"object" => followed_actor}} <- Activity.get_by_ap_id(object_id), + true <- followed_actor == get_field(cng, :actor) do + cng + else + _e -> + cng + |> add_error(:actor, "can't accept or reject the given activity") + end + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/announce_validator.ex b/lib/pleroma/web/activity_pub/object_validators/announce_validator.ex index 40f861f47..6f757f49c 100644 --- a/lib/pleroma/web/activity_pub/object_validators/announce_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/announce_validator.ex @@ -5,9 +5,9 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.AnnounceValidator do use Ecto.Schema + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Object alias Pleroma.User - alias Pleroma.Web.ActivityPub.ObjectValidators.Types alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.ActivityPub.Visibility @@ -19,14 +19,14 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.AnnounceValidator do @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) + field(:id, ObjectValidators.ObjectID, primary_key: true) field(:type, :string) - field(:object, Types.ObjectID) - field(:actor, Types.ObjectID) + field(:object, ObjectValidators.ObjectID) + field(:actor, ObjectValidators.ObjectID) field(:context, :string, autogenerate: {Utils, :generate_context_id, []}) - field(:to, Types.Recipients, default: []) - field(:cc, Types.Recipients, default: []) - field(:published, Types.DateTime) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:published, ObjectValidators.DateTime) end def cast_and_validate(data) do diff --git a/lib/pleroma/web/activity_pub/object_validators/answer_validator.ex b/lib/pleroma/web/activity_pub/object_validators/answer_validator.ex new file mode 100644 index 000000000..b9fbaf4f6 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/answer_validator.ex @@ -0,0 +1,62 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.AnswerValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + alias Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + import Ecto.Changeset + + @primary_key false + @derive Jason.Encoder + + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:bto, ObjectValidators.Recipients, default: []) + field(:bcc, ObjectValidators.Recipients, default: []) + field(:type, :string) + field(:name, :string) + field(:inReplyTo, ObjectValidators.ObjectID) + field(:attributedTo, ObjectValidators.ObjectID) + + # TODO: Remove actor on objects + field(:actor, ObjectValidators.ObjectID) + end + + def cast_and_apply(data) do + data + |> cast_data() + |> apply_action(:insert) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> changeset(data) + end + + def changeset(struct, data) do + struct + |> cast(data, __schema__(:fields)) + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["Answer"]) + |> validate_required([:id, :inReplyTo, :name, :attributedTo, :actor]) + |> CommonValidations.validate_any_presence([:cc, :to]) + |> CommonValidations.validate_fields_match([:actor, :attributedTo]) + |> CommonValidations.validate_actor_presence() + |> CommonValidations.validate_host_match() + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/attachment_validator.ex b/lib/pleroma/web/activity_pub/object_validators/attachment_validator.ex index f53bb02be..c8b148280 100644 --- a/lib/pleroma/web/activity_pub/object_validators/attachment_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/attachment_validator.ex @@ -41,34 +41,34 @@ def changeset(struct, data) do end def fix_media_type(data) do - data = - data - |> Map.put_new("mediaType", data["mimeType"]) + data = Map.put_new(data, "mediaType", data["mimeType"]) if MIME.valid?(data["mediaType"]) do data else - data - |> Map.put("mediaType", "application/octet-stream") + Map.put(data, "mediaType", "application/octet-stream") end end - def fix_url(data) do - case data["url"] do - url when is_binary(url) -> - data - |> Map.put( - "url", - [ - %{ - "href" => url, - "type" => "Link", - "mediaType" => data["mediaType"] - } - ] - ) + defp handle_href(href, mediaType) do + [ + %{ + "href" => href, + "type" => "Link", + "mediaType" => mediaType + } + ] + end - _ -> + defp fix_url(data) do + cond do + is_binary(data["url"]) -> + Map.put(data, "url", handle_href(data["url"], data["mediaType"])) + + is_binary(data["href"]) and data["url"] == nil -> + Map.put(data, "url", handle_href(data["href"], data["mediaType"])) + + true -> data end end diff --git a/lib/pleroma/web/activity_pub/object_validators/audio_validator.ex b/lib/pleroma/web/activity_pub/object_validators/audio_validator.ex new file mode 100644 index 000000000..1a97c504a --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/audio_validator.ex @@ -0,0 +1,107 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.AudioValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + alias Pleroma.Web.ActivityPub.ObjectValidators.AttachmentValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.CommonFixes + alias Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + alias Pleroma.Web.ActivityPub.Transmogrifier + + import Ecto.Changeset + + @primary_key false + @derive Jason.Encoder + + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:bto, ObjectValidators.Recipients, default: []) + field(:bcc, ObjectValidators.Recipients, default: []) + # TODO: Write type + field(:tag, {:array, :map}, default: []) + field(:type, :string) + field(:content, :string) + field(:context, :string) + + # TODO: Remove actor on objects + field(:actor, ObjectValidators.ObjectID) + + field(:attributedTo, ObjectValidators.ObjectID) + field(:summary, :string) + field(:published, ObjectValidators.DateTime) + field(:emoji, ObjectValidators.Emoji, default: %{}) + field(:sensitive, :boolean, default: false) + embeds_many(:attachment, AttachmentValidator) + field(:replies_count, :integer, default: 0) + field(:like_count, :integer, default: 0) + field(:announcement_count, :integer, default: 0) + field(:inReplyTo, :string) + field(:url, ObjectValidators.Uri) + # short identifier for PleromaFE to group statuses by context + field(:context_id, :integer) + + field(:likes, {:array, :string}, default: []) + field(:announcements, {:array, :string}, default: []) + end + + def cast_and_apply(data) do + data + |> cast_data + |> apply_action(:insert) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> changeset(data) + end + + defp fix_url(%{"url" => url} = data) when is_list(url) do + attachment = + Enum.find(url, fn x -> is_map(x) and String.starts_with?(x["mimeType"], "audio/") end) + + link_element = Enum.find(url, fn x -> is_map(x) and x["mimeType"] == "text/html" end) + + data + |> Map.put("attachment", [attachment]) + |> Map.put("url", link_element["href"]) + end + + defp fix_url(data), do: data + + defp fix(data) do + data + |> CommonFixes.fix_defaults() + |> CommonFixes.fix_attribution() + |> Transmogrifier.fix_emoji() + |> fix_url() + end + + def changeset(struct, data) do + data = fix(data) + + struct + |> cast(data, __schema__(:fields) -- [:attachment]) + |> cast_embed(:attachment) + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["Audio"]) + |> validate_required([:id, :actor, :attributedTo, :type, :context, :attachment]) + |> CommonValidations.validate_any_presence([:cc, :to]) + |> CommonValidations.validate_fields_match([:actor, :attributedTo]) + |> CommonValidations.validate_actor_presence() + |> CommonValidations.validate_host_match() + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/block_validator.ex b/lib/pleroma/web/activity_pub/object_validators/block_validator.ex new file mode 100644 index 000000000..1dde77198 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/block_validator.ex @@ -0,0 +1,42 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.BlockValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:type, :string) + field(:actor, ObjectValidators.ObjectID) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:object, ObjectValidators.ObjectID) + end + + def cast_data(data) do + %__MODULE__{} + |> cast(data, __schema__(:fields)) + end + + def validate_data(cng) do + cng + |> validate_required([:id, :type, :actor, :to, :cc, :object]) + |> validate_inclusion(:type, ["Block"]) + |> validate_actor_presence() + |> validate_actor_presence(field_name: :object) + end + + def cast_and_validate(data) do + data + |> cast_data + |> validate_data + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/chat_message_validator.ex b/lib/pleroma/web/activity_pub/object_validators/chat_message_validator.ex index 138736f23..6acd4a771 100644 --- a/lib/pleroma/web/activity_pub/object_validators/chat_message_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/chat_message_validator.ex @@ -5,9 +5,9 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.ChatMessageValidator do use Ecto.Schema + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.User alias Pleroma.Web.ActivityPub.ObjectValidators.AttachmentValidator - alias Pleroma.Web.ActivityPub.ObjectValidators.Types import Ecto.Changeset import Pleroma.Web.ActivityPub.Transmogrifier, only: [fix_emoji: 1] @@ -16,13 +16,13 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.ChatMessageValidator do @derive Jason.Encoder embedded_schema do - field(:id, Types.ObjectID, primary_key: true) - field(:to, Types.Recipients, default: []) + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:to, ObjectValidators.Recipients, default: []) field(:type, :string) - field(:content, Types.SafeText) - field(:actor, Types.ObjectID) - field(:published, Types.DateTime) - field(:emoji, :map, default: %{}) + field(:content, ObjectValidators.SafeText) + field(:actor, ObjectValidators.ObjectID) + field(:published, ObjectValidators.DateTime) + field(:emoji, ObjectValidators.Emoji, default: %{}) embeds_one(:attachment, AttachmentValidator) end @@ -93,12 +93,14 @@ def validate_content_or_attachment(cng) do - If both users are in our system - If at least one of the users in this ChatMessage is a local user - If the recipient is not blocking the actor + - If the recipient is explicitly not accepting chat messages """ def validate_local_concern(cng) do with actor_ap <- get_field(cng, :actor), {_, %User{} = actor} <- {:find_actor, User.get_cached_by_ap_id(actor_ap)}, {_, %User{} = recipient} <- {:find_recipient, User.get_cached_by_ap_id(get_field(cng, :to) |> hd())}, + {_, false} <- {:not_accepting_chats?, recipient.accepts_chat_messages == false}, {_, false} <- {:blocking_actor?, User.blocks?(recipient, actor)}, {_, true} <- {:local?, Enum.any?([actor, recipient], & &1.local)} do cng @@ -107,6 +109,10 @@ def validate_local_concern(cng) do cng |> add_error(:actor, "actor is blocked by recipient") + {:not_accepting_chats?, true} -> + cng + |> add_error(:to, "recipient does not accept chat messages") + {:local?, false} -> cng |> add_error(:actor, "actor and recipient are both remote") diff --git a/lib/pleroma/web/activity_pub/object_validators/common_fixes.ex b/lib/pleroma/web/activity_pub/object_validators/common_fixes.ex new file mode 100644 index 000000000..720213d73 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/common_fixes.ex @@ -0,0 +1,22 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.CommonFixes do + alias Pleroma.Web.ActivityPub.Utils + + # based on Pleroma.Web.ActivityPub.Utils.lazy_put_objects_defaults + def fix_defaults(data) do + %{data: %{"id" => context}, id: context_id} = + Utils.create_context(data["context"] || data["conversation"]) + + data + |> Map.put("context", context) + |> Map.put("context_id", context_id) + end + + def fix_attribution(data) do + data + |> Map.put_new("actor", data["attributedTo"]) + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/common_validations.ex b/lib/pleroma/web/activity_pub/object_validators/common_validations.ex index aeef31945..603d87b8e 100644 --- a/lib/pleroma/web/activity_pub/object_validators/common_validations.ex +++ b/lib/pleroma/web/activity_pub/object_validators/common_validations.ex @@ -9,7 +9,7 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations do alias Pleroma.Object alias Pleroma.User - def validate_recipients_presence(cng, fields \\ [:to, :cc]) do + def validate_any_presence(cng, fields) do non_empty = fields |> Enum.map(fn field -> get_field(cng, field) end) @@ -24,7 +24,7 @@ def validate_recipients_presence(cng, fields \\ [:to, :cc]) do fields |> Enum.reduce(cng, fn field, cng -> cng - |> add_error(field, "no recipients in any field") + |> add_error(field, "none of #{inspect(fields)} present") end) end end @@ -34,10 +34,15 @@ def validate_actor_presence(cng, options \\ []) do cng |> validate_change(field_name, fn field_name, actor -> - if User.get_cached_by_ap_id(actor) do - [] - else - [{field_name, "can't find user"}] + case User.get_cached_by_ap_id(actor) do + %User{deactivated: true} -> + [{field_name, "user is deactivated"}] + + %User{} -> + [] + + _ -> + [{field_name, "can't find user"}] end end) end @@ -77,4 +82,60 @@ def validate_object_or_user_presence(cng, options \\ []) do if actor_cng.valid?, do: actor_cng, else: object_cng end + + def validate_host_match(cng, fields \\ [:id, :actor]) do + if same_domain?(cng, fields) do + cng + else + fields + |> Enum.reduce(cng, fn field, cng -> + cng + |> add_error(field, "hosts of #{inspect(fields)} aren't matching") + end) + end + end + + def validate_fields_match(cng, fields) do + if map_unique?(cng, fields) do + cng + else + fields + |> Enum.reduce(cng, fn field, cng -> + cng + |> add_error(field, "Fields #{inspect(fields)} aren't matching") + end) + end + end + + defp map_unique?(cng, fields, func \\ & &1) do + Enum.reduce_while(fields, nil, fn field, acc -> + value = + cng + |> get_field(field) + |> func.() + + case {value, acc} do + {value, nil} -> {:cont, value} + {value, value} -> {:cont, value} + _ -> {:halt, false} + end + end) + end + + def same_domain?(cng, fields \\ [:actor, :object]) do + map_unique?(cng, fields, fn value -> URI.parse(value).host end) + end + + # This figures out if a user is able to create, delete or modify something + # based on the domain and superuser status + def validate_modification_rights(cng) do + actor = User.get_cached_by_ap_id(get_field(cng, :actor)) + + if User.superuser?(actor) || same_domain?(cng) do + cng + else + cng + |> add_error(:actor, "is not allowed to modify object") + end + end end diff --git a/lib/pleroma/web/activity_pub/object_validators/create_chat_message_validator.ex b/lib/pleroma/web/activity_pub/object_validators/create_chat_message_validator.ex index fc582400b..7269f9ff0 100644 --- a/lib/pleroma/web/activity_pub/object_validators/create_chat_message_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/create_chat_message_validator.ex @@ -7,9 +7,9 @@ # - doesn't embed, will only get the object id defmodule Pleroma.Web.ActivityPub.ObjectValidators.CreateChatMessageValidator do use Ecto.Schema + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Object - alias Pleroma.Web.ActivityPub.ObjectValidators.Types import Ecto.Changeset import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations @@ -17,11 +17,11 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.CreateChatMessageValidator do @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) - field(:actor, Types.ObjectID) + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:actor, ObjectValidators.ObjectID) field(:type, :string) - field(:to, Types.Recipients, default: []) - field(:object, Types.ObjectID) + field(:to, ObjectValidators.Recipients, default: []) + field(:object, ObjectValidators.ObjectID) end def cast_and_apply(data) do diff --git a/lib/pleroma/web/activity_pub/object_validators/create_generic_validator.ex b/lib/pleroma/web/activity_pub/object_validators/create_generic_validator.ex new file mode 100644 index 000000000..b3dbeea57 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/create_generic_validator.ex @@ -0,0 +1,144 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +# Code based on CreateChatMessageValidator +# NOTES +# - doesn't embed, will only get the object id +defmodule Pleroma.Web.ActivityPub.ObjectValidators.CreateGenericValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + alias Pleroma.Object + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:actor, ObjectValidators.ObjectID) + field(:type, :string) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:object, ObjectValidators.ObjectID) + field(:expires_at, ObjectValidators.DateTime) + + # Should be moved to object, done for CommonAPI.Utils.make_context + field(:context, :string) + end + + def cast_data(data, meta \\ []) do + data = fix(data, meta) + + %__MODULE__{} + |> changeset(data) + end + + def cast_and_apply(data) do + data + |> cast_data + |> apply_action(:insert) + end + + def cast_and_validate(data, meta \\ []) do + data + |> cast_data(meta) + |> validate_data(meta) + end + + def changeset(struct, data) do + struct + |> cast(data, __schema__(:fields)) + end + + defp fix_context(data, meta) do + if object = meta[:object_data] do + Map.put_new(data, "context", object["context"]) + else + data + end + end + + defp fix_addressing(data, meta) do + if object = meta[:object_data] do + data + |> Map.put_new("to", object["to"] || []) + |> Map.put_new("cc", object["cc"] || []) + else + data + end + end + + defp fix(data, meta) do + data + |> fix_context(meta) + |> fix_addressing(meta) + end + + def validate_data(cng, meta \\ []) do + cng + |> validate_required([:actor, :type, :object]) + |> validate_inclusion(:type, ["Create"]) + |> validate_actor_presence() + |> validate_any_presence([:to, :cc]) + |> validate_actors_match(meta) + |> validate_context_match(meta) + |> validate_object_nonexistence() + |> validate_object_containment() + end + + def validate_object_containment(cng) do + actor = get_field(cng, :actor) + + cng + |> validate_change(:object, fn :object, object_id -> + %URI{host: object_id_host} = URI.parse(object_id) + %URI{host: actor_host} = URI.parse(actor) + + if object_id_host == actor_host do + [] + else + [{:object, "The host of the object id doesn't match with the host of the actor"}] + end + end) + end + + def validate_object_nonexistence(cng) do + cng + |> validate_change(:object, fn :object, object_id -> + if Object.get_cached_by_ap_id(object_id) do + [{:object, "The object to create already exists"}] + else + [] + end + end) + end + + def validate_actors_match(cng, meta) do + attributed_to = meta[:object_data]["attributedTo"] || meta[:object_data]["actor"] + + cng + |> validate_change(:actor, fn :actor, actor -> + if actor == attributed_to do + [] + else + [{:actor, "Actor doesn't match with object attributedTo"}] + end + end) + end + + def validate_context_match(cng, %{object_data: %{"context" => object_context}}) do + cng + |> validate_change(:context, fn :context, context -> + if context == object_context do + [] + else + [{:context, "context field not matching between Create and object (#{object_context})"}] + end + end) + end + + def validate_context_match(cng, _), do: cng +end diff --git a/lib/pleroma/web/activity_pub/object_validators/create_note_validator.ex b/lib/pleroma/web/activity_pub/object_validators/create_note_validator.ex index 926804ce7..9b9743c4a 100644 --- a/lib/pleroma/web/activity_pub/object_validators/create_note_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/create_note_validator.ex @@ -5,22 +5,21 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.CreateNoteValidator do use Ecto.Schema + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Web.ActivityPub.ObjectValidators.NoteValidator - alias Pleroma.Web.ActivityPub.ObjectValidators.Types import Ecto.Changeset @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) - field(:actor, Types.ObjectID) + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:actor, ObjectValidators.ObjectID) field(:type, :string) - field(:to, {:array, :string}) - field(:cc, {:array, :string}) - field(:bto, {:array, :string}, default: []) - field(:bcc, {:array, :string}, default: []) - + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:bto, ObjectValidators.Recipients, default: []) + field(:bcc, ObjectValidators.Recipients, default: []) embeds_one(:object, NoteValidator) end diff --git a/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex b/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex index e5d08eb5c..2634e8d4d 100644 --- a/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex @@ -6,8 +6,7 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator do use Ecto.Schema alias Pleroma.Activity - alias Pleroma.User - alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.EctoType.ActivityPub.ObjectValidators import Ecto.Changeset import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations @@ -15,13 +14,13 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator do @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) + field(:id, ObjectValidators.ObjectID, primary_key: true) field(:type, :string) - field(:actor, Types.ObjectID) - field(:to, Types.Recipients, default: []) - field(:cc, Types.Recipients, default: []) - field(:deleted_activity_id, Types.ObjectID) - field(:object, Types.ObjectID) + field(:actor, ObjectValidators.ObjectID) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:deleted_activity_id, ObjectValidators.ObjectID) + field(:object, ObjectValidators.ObjectID) end def cast_data(data) do @@ -59,7 +58,7 @@ def validate_data(cng) do |> validate_required([:id, :type, :actor, :to, :cc, :object]) |> validate_inclusion(:type, ["Delete"]) |> validate_actor_presence() - |> validate_deletion_rights() + |> validate_modification_rights() |> validate_object_or_user_presence(allowed_types: @deletable_types) |> add_deleted_activity_id() end @@ -68,31 +67,6 @@ def do_not_federate?(cng) do !same_domain?(cng) end - defp same_domain?(cng) do - actor_uri = - cng - |> get_field(:actor) - |> URI.parse() - - object_uri = - cng - |> get_field(:object) - |> URI.parse() - - object_uri.host == actor_uri.host - end - - def validate_deletion_rights(cng) do - actor = User.get_cached_by_ap_id(get_field(cng, :actor)) - - if User.superuser?(actor) || same_domain?(cng) do - cng - else - cng - |> add_error(:actor, "is not allowed to delete object") - end - end - def cast_and_validate(data) do data |> cast_data diff --git a/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex b/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex index e87519c59..336c92d35 100644 --- a/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex @@ -5,8 +5,8 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator do use Ecto.Schema + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Object - alias Pleroma.Web.ActivityPub.ObjectValidators.Types import Ecto.Changeset import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations @@ -14,14 +14,14 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator do @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) + field(:id, ObjectValidators.ObjectID, primary_key: true) field(:type, :string) - field(:object, Types.ObjectID) - field(:actor, Types.ObjectID) + field(:object, ObjectValidators.ObjectID) + field(:actor, ObjectValidators.ObjectID) field(:context, :string) field(:content, :string) - field(:to, {:array, :string}, default: []) - field(:cc, {:array, :string}, default: []) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) end def cast_and_validate(data) do diff --git a/lib/pleroma/web/activity_pub/object_validators/event_validator.ex b/lib/pleroma/web/activity_pub/object_validators/event_validator.ex new file mode 100644 index 000000000..0b4c99dc0 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/event_validator.ex @@ -0,0 +1,97 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.EventValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + alias Pleroma.Web.ActivityPub.ObjectValidators.AttachmentValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.CommonFixes + alias Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + alias Pleroma.Web.ActivityPub.Transmogrifier + + import Ecto.Changeset + + @primary_key false + @derive Jason.Encoder + + # Extends from NoteValidator + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:bto, ObjectValidators.Recipients, default: []) + field(:bcc, ObjectValidators.Recipients, default: []) + # TODO: Write type + field(:tag, {:array, :map}, default: []) + field(:type, :string) + + field(:name, :string) + field(:summary, :string) + field(:content, :string) + + field(:context, :string) + # short identifier for PleromaFE to group statuses by context + field(:context_id, :integer) + + # TODO: Remove actor on objects + field(:actor, ObjectValidators.ObjectID) + + field(:attributedTo, ObjectValidators.ObjectID) + field(:published, ObjectValidators.DateTime) + field(:emoji, ObjectValidators.Emoji, default: %{}) + field(:sensitive, :boolean, default: false) + embeds_many(:attachment, AttachmentValidator) + field(:replies_count, :integer, default: 0) + field(:like_count, :integer, default: 0) + field(:announcement_count, :integer, default: 0) + field(:inReplyTo, ObjectValidators.ObjectID) + field(:url, ObjectValidators.Uri) + + field(:likes, {:array, ObjectValidators.ObjectID}, default: []) + field(:announcements, {:array, ObjectValidators.ObjectID}, default: []) + end + + def cast_and_apply(data) do + data + |> cast_data + |> apply_action(:insert) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> changeset(data) + end + + defp fix(data) do + data + |> CommonFixes.fix_defaults() + |> CommonFixes.fix_attribution() + |> Transmogrifier.fix_emoji() + end + + def changeset(struct, data) do + data = fix(data) + + struct + |> cast(data, __schema__(:fields) -- [:attachment]) + |> cast_embed(:attachment) + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["Event"]) + |> validate_required([:id, :actor, :attributedTo, :type, :context, :context_id]) + |> CommonValidations.validate_any_presence([:cc, :to]) + |> CommonValidations.validate_fields_match([:actor, :attributedTo]) + |> CommonValidations.validate_actor_presence() + |> CommonValidations.validate_host_match() + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/follow_validator.ex b/lib/pleroma/web/activity_pub/object_validators/follow_validator.ex new file mode 100644 index 000000000..ca2724616 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/follow_validator.ex @@ -0,0 +1,44 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.FollowValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:type, :string) + field(:actor, ObjectValidators.ObjectID) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:object, ObjectValidators.ObjectID) + field(:state, :string, default: "pending") + end + + def cast_data(data) do + %__MODULE__{} + |> cast(data, __schema__(:fields)) + end + + def validate_data(cng) do + cng + |> validate_required([:id, :type, :actor, :to, :cc, :object]) + |> validate_inclusion(:type, ["Follow"]) + |> validate_inclusion(:state, ~w{pending reject accept}) + |> validate_actor_presence() + |> validate_actor_presence(field_name: :object) + end + + def cast_and_validate(data) do + data + |> cast_data + |> validate_data + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/like_validator.ex b/lib/pleroma/web/activity_pub/object_validators/like_validator.ex index 034f25492..493e4c247 100644 --- a/lib/pleroma/web/activity_pub/object_validators/like_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/like_validator.ex @@ -5,8 +5,8 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator do use Ecto.Schema + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Object - alias Pleroma.Web.ActivityPub.ObjectValidators.Types alias Pleroma.Web.ActivityPub.Utils import Ecto.Changeset @@ -15,13 +15,13 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator do @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) + field(:id, ObjectValidators.ObjectID, primary_key: true) field(:type, :string) - field(:object, Types.ObjectID) - field(:actor, Types.ObjectID) + field(:object, ObjectValidators.ObjectID) + field(:actor, ObjectValidators.ObjectID) field(:context, :string) - field(:to, Types.Recipients, default: []) - field(:cc, Types.Recipients, default: []) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) end def cast_and_validate(data) do @@ -67,7 +67,7 @@ def fix_recipients(cng) do with {[], []} <- {to, cc}, %Object{data: %{"actor" => actor}} <- Object.get_cached_by_ap_id(object), - {:ok, actor} <- Types.ObjectID.cast(actor) do + {:ok, actor} <- ObjectValidators.ObjectID.cast(actor) do cng |> put_change(:to, [actor]) else diff --git a/lib/pleroma/web/activity_pub/object_validators/note_validator.ex b/lib/pleroma/web/activity_pub/object_validators/note_validator.ex index 462a5620a..ab4469a59 100644 --- a/lib/pleroma/web/activity_pub/object_validators/note_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/note_validator.ex @@ -5,44 +5,46 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.NoteValidator do use Ecto.Schema - alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.EctoType.ActivityPub.ObjectValidators + alias Pleroma.Web.ActivityPub.Transmogrifier import Ecto.Changeset @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) - field(:to, {:array, :string}, default: []) - field(:cc, {:array, :string}, default: []) - field(:bto, {:array, :string}, default: []) - field(:bcc, {:array, :string}, default: []) + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:bto, ObjectValidators.Recipients, default: []) + field(:bcc, ObjectValidators.Recipients, default: []) # TODO: Write type field(:tag, {:array, :map}, default: []) field(:type, :string) - field(:content, :string) - field(:context, :string) - field(:actor, Types.ObjectID) - field(:attributedTo, Types.ObjectID) + + field(:name, :string) field(:summary, :string) - field(:published, Types.DateTime) - # TODO: Write type - field(:emoji, :map, default: %{}) + field(:content, :string) + + field(:context, :string) + # short identifier for PleromaFE to group statuses by context + field(:context_id, :integer) + + field(:actor, ObjectValidators.ObjectID) + field(:attributedTo, ObjectValidators.ObjectID) + field(:published, ObjectValidators.DateTime) + field(:emoji, ObjectValidators.Emoji, default: %{}) field(:sensitive, :boolean, default: false) # TODO: Write type field(:attachment, {:array, :map}, default: []) field(:replies_count, :integer, default: 0) field(:like_count, :integer, default: 0) field(:announcement_count, :integer, default: 0) - field(:inRepyTo, :string) - field(:uri, Types.Uri) + field(:inReplyTo, ObjectValidators.ObjectID) + field(:url, ObjectValidators.Uri) field(:likes, {:array, :string}, default: []) field(:announcements, {:array, :string}, default: []) - - # see if needed - field(:conversation, :string) - field(:context_id, :string) end def cast_and_validate(data) do @@ -51,7 +53,14 @@ def cast_and_validate(data) do |> validate_data() end + defp fix(data) do + data + |> Transmogrifier.fix_emoji() + end + def cast_data(data) do + data = fix(data) + %__MODULE__{} |> cast(data, __schema__(:fields)) end diff --git a/lib/pleroma/web/activity_pub/object_validators/question_options_validator.ex b/lib/pleroma/web/activity_pub/object_validators/question_options_validator.ex new file mode 100644 index 000000000..478b3b5cf --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/question_options_validator.ex @@ -0,0 +1,37 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.QuestionOptionsValidator do + use Ecto.Schema + + import Ecto.Changeset + + @primary_key false + + embedded_schema do + field(:name, :string) + + embeds_one :replies, Replies, primary_key: false do + field(:totalItems, :integer) + field(:type, :string) + end + + field(:type, :string) + end + + def changeset(struct, data) do + struct + |> cast(data, [:name, :type]) + |> cast_embed(:replies, with: &replies_changeset/2) + |> validate_inclusion(:type, ["Note"]) + |> validate_required([:name, :type]) + end + + def replies_changeset(struct, data) do + struct + |> cast(data, [:totalItems, :type]) + |> validate_inclusion(:type, ["Collection"]) + |> validate_required([:type]) + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/question_validator.ex b/lib/pleroma/web/activity_pub/object_validators/question_validator.ex new file mode 100644 index 000000000..934d3c1ea --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/question_validator.ex @@ -0,0 +1,112 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.QuestionValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + alias Pleroma.Web.ActivityPub.ObjectValidators.AttachmentValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.CommonFixes + alias Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + alias Pleroma.Web.ActivityPub.ObjectValidators.QuestionOptionsValidator + alias Pleroma.Web.ActivityPub.Transmogrifier + + import Ecto.Changeset + + @primary_key false + @derive Jason.Encoder + + # Extends from NoteValidator + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + field(:bto, ObjectValidators.Recipients, default: []) + field(:bcc, ObjectValidators.Recipients, default: []) + # TODO: Write type + field(:tag, {:array, :map}, default: []) + field(:type, :string) + field(:content, :string) + field(:context, :string) + + # TODO: Remove actor on objects + field(:actor, ObjectValidators.ObjectID) + + field(:attributedTo, ObjectValidators.ObjectID) + field(:summary, :string) + field(:published, ObjectValidators.DateTime) + field(:emoji, ObjectValidators.Emoji, default: %{}) + field(:sensitive, :boolean, default: false) + embeds_many(:attachment, AttachmentValidator) + field(:replies_count, :integer, default: 0) + field(:like_count, :integer, default: 0) + field(:announcement_count, :integer, default: 0) + field(:inReplyTo, ObjectValidators.ObjectID) + field(:url, ObjectValidators.Uri) + # short identifier for PleromaFE to group statuses by context + field(:context_id, :integer) + + field(:likes, {:array, :string}, default: []) + field(:announcements, {:array, :string}, default: []) + + field(:closed, ObjectValidators.DateTime) + field(:voters, {:array, ObjectValidators.ObjectID}, default: []) + embeds_many(:anyOf, QuestionOptionsValidator) + embeds_many(:oneOf, QuestionOptionsValidator) + end + + def cast_and_apply(data) do + data + |> cast_data + |> apply_action(:insert) + end + + def cast_and_validate(data) do + data + |> cast_data() + |> validate_data() + end + + def cast_data(data) do + %__MODULE__{} + |> changeset(data) + end + + defp fix_closed(data) do + cond do + is_binary(data["closed"]) -> data + is_binary(data["endTime"]) -> Map.put(data, "closed", data["endTime"]) + true -> Map.drop(data, ["closed"]) + end + end + + defp fix(data) do + data + |> CommonFixes.fix_defaults() + |> CommonFixes.fix_attribution() + |> Transmogrifier.fix_emoji() + |> fix_closed() + end + + def changeset(struct, data) do + data = fix(data) + + struct + |> cast(data, __schema__(:fields) -- [:anyOf, :oneOf, :attachment]) + |> cast_embed(:attachment) + |> cast_embed(:anyOf) + |> cast_embed(:oneOf) + end + + def validate_data(data_cng) do + data_cng + |> validate_inclusion(:type, ["Question"]) + |> validate_required([:id, :actor, :attributedTo, :type, :context, :context_id]) + |> CommonValidations.validate_any_presence([:cc, :to]) + |> CommonValidations.validate_fields_match([:actor, :attributedTo]) + |> CommonValidations.validate_actor_presence() + |> CommonValidations.validate_any_presence([:oneOf, :anyOf]) + |> CommonValidations.validate_host_match() + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex b/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex index d0ba418e8..8cae94467 100644 --- a/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex @@ -6,7 +6,7 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator do use Ecto.Schema alias Pleroma.Activity - alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.EctoType.ActivityPub.ObjectValidators import Ecto.Changeset import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations @@ -14,12 +14,12 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator do @primary_key false embedded_schema do - field(:id, Types.ObjectID, primary_key: true) + field(:id, ObjectValidators.ObjectID, primary_key: true) field(:type, :string) - field(:object, Types.ObjectID) - field(:actor, Types.ObjectID) - field(:to, {:array, :string}, default: []) - field(:cc, {:array, :string}, default: []) + field(:object, ObjectValidators.ObjectID) + field(:actor, ObjectValidators.ObjectID) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) end def cast_and_validate(data) do diff --git a/lib/pleroma/web/activity_pub/object_validators/update_validator.ex b/lib/pleroma/web/activity_pub/object_validators/update_validator.ex new file mode 100644 index 000000000..b4ba5ede0 --- /dev/null +++ b/lib/pleroma/web/activity_pub/object_validators/update_validator.ex @@ -0,0 +1,59 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.UpdateValidator do + use Ecto.Schema + + alias Pleroma.EctoType.ActivityPub.ObjectValidators + + import Ecto.Changeset + import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations + + @primary_key false + + embedded_schema do + field(:id, ObjectValidators.ObjectID, primary_key: true) + field(:type, :string) + field(:actor, ObjectValidators.ObjectID) + field(:to, ObjectValidators.Recipients, default: []) + field(:cc, ObjectValidators.Recipients, default: []) + # In this case, we save the full object in this activity instead of just a + # reference, so we can always see what was actually changed by this. + field(:object, :map) + end + + def cast_data(data) do + %__MODULE__{} + |> cast(data, __schema__(:fields)) + end + + def validate_data(cng) do + cng + |> validate_required([:id, :type, :actor, :to, :cc, :object]) + |> validate_inclusion(:type, ["Update"]) + |> validate_actor_presence() + |> validate_updating_rights() + end + + def cast_and_validate(data) do + data + |> cast_data + |> validate_data + end + + # For now we only support updating users, and here the rule is easy: + # object id == actor id + def validate_updating_rights(cng) do + with actor = get_field(cng, :actor), + object = get_field(cng, :object), + {:ok, object_id} <- ObjectValidators.ObjectID.cast(object), + true <- actor == object_id do + cng + else + _e -> + cng + |> add_error(:object, "Can't be updated by this actor") + end + end +end diff --git a/lib/pleroma/web/activity_pub/object_validators/url_object_validator.ex b/lib/pleroma/web/activity_pub/object_validators/url_object_validator.ex index 47e231150..881030f38 100644 --- a/lib/pleroma/web/activity_pub/object_validators/url_object_validator.ex +++ b/lib/pleroma/web/activity_pub/object_validators/url_object_validator.ex @@ -1,15 +1,19 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + defmodule Pleroma.Web.ActivityPub.ObjectValidators.UrlObjectValidator do use Ecto.Schema - alias Pleroma.Web.ActivityPub.ObjectValidators.Types + alias Pleroma.EctoType.ActivityPub.ObjectValidators import Ecto.Changeset @primary_key false embedded_schema do field(:type, :string) - field(:href, Types.Uri) - field(:mediaType, :string) + field(:href, ObjectValidators.Uri) + field(:mediaType, :string, default: "application/octet-stream") end def changeset(struct, data) do diff --git a/lib/pleroma/web/activity_pub/pipeline.ex b/lib/pleroma/web/activity_pub/pipeline.ex index 6875c47f6..36e325c37 100644 --- a/lib/pleroma/web/activity_pub/pipeline.ex +++ b/lib/pleroma/web/activity_pub/pipeline.ex @@ -52,6 +52,13 @@ defp maybe_federate(%Activity{} = activity, meta) do do_not_federate = meta[:do_not_federate] || !Config.get([:instance, :federating]) if !do_not_federate && local do + activity = + if object = Keyword.get(meta, :object_data) do + %{activity | data: Map.put(activity.data, "object", object)} + else + activity + end + Federator.publish(activity) {:ok, :federated} else diff --git a/lib/pleroma/web/activity_pub/publisher.ex b/lib/pleroma/web/activity_pub/publisher.ex index b70cbd043..d88f7f3ee 100644 --- a/lib/pleroma/web/activity_pub/publisher.ex +++ b/lib/pleroma/web/activity_pub/publisher.ex @@ -49,7 +49,8 @@ def is_representable?(%Activity{} = activity) do """ def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = params) do Logger.debug("Federating #{id} to #{inbox}") - %{host: host, path: path} = URI.parse(inbox) + + uri = URI.parse(inbox) digest = "SHA-256=" <> (:crypto.hash(:sha256, json) |> Base.encode64()) @@ -57,8 +58,8 @@ def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = pa signature = Pleroma.Signature.sign(actor, %{ - "(request-target)": "post #{path}", - host: host, + "(request-target)": "post #{uri.path}", + host: signature_host(uri), "content-length": byte_size(json), digest: digest, date: date @@ -76,8 +77,9 @@ def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = pa {"digest", digest} ] ) do - if !Map.has_key?(params, :unreachable_since) || params[:unreachable_since], - do: Instances.set_reachable(inbox) + if not Map.has_key?(params, :unreachable_since) || params[:unreachable_since] do + Instances.set_reachable(inbox) + end result else @@ -96,6 +98,14 @@ def publish_one(%{actor_id: actor_id} = params) do |> publish_one() end + defp signature_host(%URI{port: port, scheme: scheme, host: host}) do + if port == URI.default_port(scheme) do + host + else + "#{host}:#{port}" + end + end + defp should_federate?(inbox, public) do if public do true diff --git a/lib/pleroma/web/activity_pub/relay.ex b/lib/pleroma/web/activity_pub/relay.ex index 484178edd..b65710a94 100644 --- a/lib/pleroma/web/activity_pub/relay.ex +++ b/lib/pleroma/web/activity_pub/relay.ex @@ -10,25 +10,19 @@ defmodule Pleroma.Web.ActivityPub.Relay do alias Pleroma.Web.CommonAPI require Logger - @relay_nickname "relay" + @nickname "relay" - def get_actor do - actor = - relay_ap_id() - |> User.get_or_create_service_actor_by_ap_id(@relay_nickname) + @spec ap_id() :: String.t() + def ap_id, do: "#{Pleroma.Web.Endpoint.url()}/#{@nickname}" - actor - end - - def relay_ap_id do - "#{Pleroma.Web.Endpoint.url()}/relay" - end + @spec get_actor() :: User.t() | nil + def get_actor, do: User.get_or_create_service_actor_by_ap_id(ap_id(), @nickname) @spec follow(String.t()) :: {:ok, Activity.t()} | {:error, any()} def follow(target_instance) do with %User{} = local_user <- get_actor(), {:ok, %User{} = target_user} <- User.get_or_fetch_by_ap_id(target_instance), - {:ok, activity} <- ActivityPub.follow(local_user, target_user) do + {:ok, _, _, activity} <- CommonAPI.follow(local_user, target_user) do Logger.info("relay: followed instance: #{target_instance}; id=#{activity.data["id"]}") {:ok, activity} else @@ -61,34 +55,38 @@ def publish(%Activity{data: %{"type" => "Create"}} = activity) do def publish(_), do: {:error, "Not implemented"} - @spec list(boolean()) :: {:ok, [String.t()]} | {:error, any()} - def list(with_not_accepted \\ false) do + @spec list() :: {:ok, [%{actor: String.t(), followed_back: boolean()}]} | {:error, any()} + def list do with %User{} = user <- get_actor() do accepted = user - |> User.following() - |> Enum.map(fn entry -> URI.parse(entry).host end) + |> following() + |> Enum.map(fn actor -> %{actor: actor, followed_back: true} end) + + without_accept = + user + |> Pleroma.Activity.following_requests_for_actor() + |> Enum.map(fn activity -> %{actor: activity.data["object"], followed_back: false} end) |> Enum.uniq() - list = - if with_not_accepted do - without_accept = - user - |> Pleroma.Activity.following_requests_for_actor() - |> Enum.map(fn a -> URI.parse(a.data["object"]).host <> " (no Accept received)" end) - |> Enum.uniq() - - accepted ++ without_accept - else - accepted - end - - {:ok, list} + {:ok, accepted ++ without_accept} else error -> format_error(error) end end + @spec following() :: [String.t()] + def following do + get_actor() + |> following() + end + + defp following(user) do + user + |> User.following_ap_ids() + |> Enum.uniq() + end + defp format_error({:error, error}), do: format_error(error) defp format_error(error) do diff --git a/lib/pleroma/web/activity_pub/side_effects.ex b/lib/pleroma/web/activity_pub/side_effects.ex index 1a1cc675c..46a8be767 100644 --- a/lib/pleroma/web/activity_pub/side_effects.ex +++ b/lib/pleroma/web/activity_pub/side_effects.ex @@ -6,20 +6,157 @@ defmodule Pleroma.Web.ActivityPub.SideEffects do collection, and so on. """ alias Pleroma.Activity + alias Pleroma.Activity.Ir.Topics alias Pleroma.Chat alias Pleroma.Chat.MessageReference + alias Pleroma.FollowingRelationship alias Pleroma.Notification alias Pleroma.Object alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.Push alias Pleroma.Web.Streamer + alias Pleroma.Workers.BackgroundWorker + + require Logger def handle(object, meta \\ []) + # Task this handles + # - Follows + # - Sends a notification + def handle( + %{ + data: %{ + "actor" => actor, + "type" => "Accept", + "object" => follow_activity_id + } + } = object, + meta + ) do + with %Activity{actor: follower_id} = follow_activity <- + Activity.get_by_ap_id(follow_activity_id), + %User{} = followed <- User.get_cached_by_ap_id(actor), + %User{} = follower <- User.get_cached_by_ap_id(follower_id), + {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "accept"), + {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_accept) do + Notification.update_notification_type(followed, follow_activity) + User.update_follower_count(followed) + User.update_following_count(follower) + end + + {:ok, object, meta} + end + + # Task this handles + # - Rejects all existing follow activities for this person + # - Updates the follow state + # - Dismisses notification + def handle( + %{ + data: %{ + "actor" => actor, + "type" => "Reject", + "object" => follow_activity_id + } + } = object, + meta + ) do + with %Activity{actor: follower_id} = follow_activity <- + Activity.get_by_ap_id(follow_activity_id), + %User{} = followed <- User.get_cached_by_ap_id(actor), + %User{} = follower <- User.get_cached_by_ap_id(follower_id), + {:ok, _follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "reject") do + FollowingRelationship.update(follower, followed, :follow_reject) + Notification.dismiss(follow_activity) + end + + {:ok, object, meta} + end + + # Tasks this handle + # - Follows if possible + # - Sends a notification + # - Generates accept or reject if appropriate + def handle( + %{ + data: %{ + "id" => follow_id, + "type" => "Follow", + "object" => followed_user, + "actor" => following_user + } + } = object, + meta + ) do + with %User{} = follower <- User.get_cached_by_ap_id(following_user), + %User{} = followed <- User.get_cached_by_ap_id(followed_user), + {_, {:ok, _}, _, _} <- + {:following, User.follow(follower, followed, :follow_pending), follower, followed} do + if followed.local && !followed.locked do + {:ok, accept_data, _} = Builder.accept(followed, object) + {:ok, _activity, _} = Pipeline.common_pipeline(accept_data, local: true) + end + else + {:following, {:error, _}, _follower, followed} -> + {:ok, reject_data, _} = Builder.reject(followed, object) + {:ok, _activity, _} = Pipeline.common_pipeline(reject_data, local: true) + + _ -> + nil + end + + {:ok, notifications} = Notification.create_notifications(object, do_send: false) + + meta = + meta + |> add_notifications(notifications) + + updated_object = Activity.get_by_ap_id(follow_id) + + {:ok, updated_object, meta} + end + + # Tasks this handles: + # - Unfollow and block + def handle( + %{data: %{"type" => "Block", "object" => blocked_user, "actor" => blocking_user}} = + object, + meta + ) do + with %User{} = blocker <- User.get_cached_by_ap_id(blocking_user), + %User{} = blocked <- User.get_cached_by_ap_id(blocked_user) do + User.block(blocker, blocked) + end + + {:ok, object, meta} + end + + # Tasks this handles: + # - Update the user + # + # For a local user, we also get a changeset with the full information, so we + # can update non-federating, non-activitypub settings as well. + def handle(%{data: %{"type" => "Update", "object" => updated_object}} = object, meta) do + if changeset = Keyword.get(meta, :user_update_changeset) do + changeset + |> User.update_and_set_cache() + else + {:ok, new_user_data} = ActivityPub.user_data_from_user_object(updated_object) + + User.get_by_ap_id(updated_object["id"]) + |> User.remote_user_changeset(new_user_data) + |> User.update_and_set_cache() + end + + {:ok, object, meta} + end + # Tasks this handles: # - Add like to object # - Set up notification @@ -35,10 +172,22 @@ def handle(%{data: %{"type" => "Like"}} = object, meta) do # Tasks this handles # - Actually create object # - Rollback if we couldn't create it + # - Increase the user note count + # - Increase the reply count + # - Increase replies count + # - Set up ActivityExpiration # - Set up notifications def handle(%{data: %{"type" => "Create"}} = activity, meta) do - with {:ok, _object, meta} <- handle_object_creation(meta[:object_data], meta) do + with {:ok, object, meta} <- handle_object_creation(meta[:object_data], meta), + %User{} = user <- User.get_cached_by_ap_id(activity.data["actor"]) do {:ok, notifications} = Notification.create_notifications(activity, do_send: false) + {:ok, _user} = ActivityPub.increase_note_count_if_public(user, object) + + if in_reply_to = object.data["inReplyTo"] do + Object.increase_replies_count(in_reply_to) + end + + BackgroundWorker.enqueue("fetch_data_for_activity", %{"activity_id" => activity.id}) meta = meta @@ -62,7 +211,10 @@ def handle(%{data: %{"type" => "Announce"}} = object, meta) do if !User.is_internal_user?(user) do Notification.create_notifications(object) - ActivityPub.stream_out(object) + + object + |> Topics.get_activity_topics() + |> Streamer.stream(object) end {:ok, object, meta} @@ -96,13 +248,15 @@ def handle(%{data: %{"type" => "EmojiReact"}} = object, meta) do # - Stream out the activity def handle(%{data: %{"type" => "Delete", "object" => deleted_object}} = object, meta) do deleted_object = - Object.normalize(deleted_object, false) || User.get_cached_by_ap_id(deleted_object) + Object.normalize(deleted_object, false) || + User.get_cached_by_ap_id(deleted_object) result = case deleted_object do %Object{} -> with {:ok, deleted_object, activity} <- Object.delete(deleted_object), - %User{} = user <- User.get_cached_by_ap_id(deleted_object.data["actor"]) do + {_, actor} when is_binary(actor) <- {:actor, deleted_object.data["actor"]}, + %User{} = user <- User.get_cached_by_ap_id(actor) do User.remove_pinnned_activity(user, activity) {:ok, user} = ActivityPub.decrease_note_count_if_public(user, deleted_object) @@ -116,6 +270,10 @@ def handle(%{data: %{"type" => "Delete", "object" => deleted_object}} = object, ActivityPub.stream_out(object) ActivityPub.stream_out_participations(deleted_object, user) :ok + else + {:actor, _} -> + Logger.error("The object doesn't have an actor: #{inspect(deleted_object)}") + :no_object_actor end %User{} -> @@ -165,17 +323,42 @@ def handle_object_creation(%{"type" => "ChatMessage"} = object, meta) do end end + def handle_object_creation(%{"type" => "Answer"} = object_map, meta) do + with {:ok, object, meta} <- Pipeline.common_pipeline(object_map, meta) do + Object.increase_vote_count( + object.data["inReplyTo"], + object.data["name"], + object.data["actor"] + ) + + {:ok, object, meta} + end + end + + def handle_object_creation(%{"type" => objtype} = object, meta) + when objtype in ~w[Audio Question Event] do + with {:ok, object, meta} <- Pipeline.common_pipeline(object, meta) do + {:ok, object, meta} + end + end + # Nothing to do - def handle_object_creation(object) do - {:ok, object} + def handle_object_creation(object, meta) do + {:ok, object, meta} + end + + defp undo_like(nil, object), do: delete_object(object) + + defp undo_like(%Object{} = liked_object, object) do + with {:ok, _} <- Utils.remove_like_from_object(object, liked_object) do + delete_object(object) + end end def handle_undoing(%{data: %{"type" => "Like"}} = object) do - with %Object{} = liked_object <- Object.get_by_ap_id(object.data["object"]), - {:ok, _} <- Utils.remove_like_from_object(object, liked_object), - {:ok, _} <- Repo.delete(object) do - :ok - end + object.data["object"] + |> Object.get_by_ap_id() + |> undo_like(object) end def handle_undoing(%{data: %{"type" => "EmojiReact"}} = object) do @@ -207,6 +390,11 @@ def handle_undoing( def handle_undoing(object), do: {:error, ["don't know how to handle", object]} + @spec delete_object(Object.t()) :: :ok | {:error, Ecto.Changeset.t()} + defp delete_object(object) do + with {:ok, _} <- Repo.delete(object), do: :ok + end + defp send_notifications(meta) do Keyword.get(meta, :notifications, []) |> Enum.each(fn notification -> diff --git a/lib/pleroma/web/activity_pub/transmogrifier.ex b/lib/pleroma/web/activity_pub/transmogrifier.ex index 985921aa0..af4384213 100644 --- a/lib/pleroma/web/activity_pub/transmogrifier.ex +++ b/lib/pleroma/web/activity_pub/transmogrifier.ex @@ -8,9 +8,8 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do """ alias Pleroma.Activity alias Pleroma.EarmarkRenderer - alias Pleroma.FollowingRelationship + alias Pleroma.EctoType.ActivityPub.ObjectValidators alias Pleroma.Maps - alias Pleroma.Notification alias Pleroma.Object alias Pleroma.Object.Containment alias Pleroma.Repo @@ -18,7 +17,6 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do alias Pleroma.Web.ActivityPub.ActivityPub alias Pleroma.Web.ActivityPub.Builder alias Pleroma.Web.ActivityPub.ObjectValidator - alias Pleroma.Web.ActivityPub.ObjectValidators.Types alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.ActivityPub.Visibility @@ -62,15 +60,17 @@ def fix_summary(%{"summary" => _} = object) do def fix_summary(object), do: Map.put(object, "summary", "") def fix_addressing_list(map, field) do - cond do - is_binary(map[field]) -> - Map.put(map, field, [map[field]]) + addrs = map[field] - is_nil(map[field]) -> - Map.put(map, field, []) + cond do + is_list(addrs) -> + Map.put(map, field, Enum.filter(addrs, &is_binary/1)) + + is_binary(addrs) -> + Map.put(map, field, [addrs]) true -> - map + Map.put(map, field, []) end end @@ -155,7 +155,12 @@ def fix_addressing(object) do end def fix_actor(%{"attributedTo" => actor} = object) do - Map.put(object, "actor", Containment.get_actor(%{"actor" => actor})) + actor = Containment.get_actor(%{"actor" => actor}) + + # TODO: Remove actor field for Objects + object + |> Map.put("actor", actor) + |> Map.put("attributedTo", actor) end def fix_in_reply_to(object, options \\ []) @@ -163,7 +168,6 @@ def fix_in_reply_to(object, options \\ []) def fix_in_reply_to(%{"inReplyTo" => in_reply_to} = object, options) when not is_nil(in_reply_to) do in_reply_to_id = prepare_in_reply_to(in_reply_to) - object = Map.put(object, "inReplyToAtomUri", in_reply_to_id) depth = (options[:depth] || 0) + 1 if Federator.allowed_thread_distance?(depth) do @@ -171,12 +175,11 @@ def fix_in_reply_to(%{"inReplyTo" => in_reply_to} = object, options) %Activity{} <- Activity.get_create_by_object_ap_id(replied_object.data["id"]) do object |> Map.put("inReplyTo", replied_object.data["id"]) - |> Map.put("inReplyToAtomUri", object["inReplyToAtomUri"] || in_reply_to_id) - |> Map.put("conversation", replied_object.data["context"] || object["conversation"]) |> Map.put("context", replied_object.data["context"] || object["conversation"]) + |> Map.drop(["conversation", "inReplyToAtomUri"]) else e -> - Logger.error("Couldn't fetch #{inspect(in_reply_to_id)}, error: #{inspect(e)}") + Logger.warn("Couldn't fetch #{inspect(in_reply_to_id)}, error: #{inspect(e)}") object end else @@ -207,7 +210,7 @@ def fix_context(object) do object |> Map.put("context", context) - |> Map.put("conversation", context) + |> Map.drop(["conversation"]) end def fix_attachments(%{"attachment" => attachment} = object) when is_list(attachment) do @@ -233,18 +236,28 @@ def fix_attachments(%{"attachment" => attachment} = object) when is_list(attachm is_map(url) && is_binary(url["href"]) -> url["href"] is_binary(data["url"]) -> data["url"] is_binary(data["href"]) -> data["href"] + true -> nil end - attachment_url = - %{"href" => href} - |> Maps.put_if_present("mediaType", media_type) - |> Maps.put_if_present("type", Map.get(url || %{}, "type")) + if href do + attachment_url = + %{ + "href" => href, + "type" => Map.get(url || %{}, "type", "Link") + } + |> Maps.put_if_present("mediaType", media_type) - %{"url" => [attachment_url]} - |> Maps.put_if_present("mediaType", media_type) - |> Maps.put_if_present("type", data["type"]) - |> Maps.put_if_present("name", data["name"]) + %{ + "url" => [attachment_url], + "type" => data["type"] || "Document" + } + |> Maps.put_if_present("mediaType", media_type) + |> Maps.put_if_present("name", data["name"]) + else + nil + end end) + |> Enum.filter(& &1) Map.put(object, "attachment", attachments) end @@ -261,14 +274,19 @@ def fix_url(%{"url" => url} = object) when is_map(url) do Map.put(object, "url", url["href"]) end - def fix_url(%{"type" => object_type, "url" => url} = object) - when object_type in ["Video", "Audio"] and is_list(url) do - first_element = Enum.at(url, 0) + def fix_url(%{"type" => "Video", "url" => url} = object) when is_list(url) do + attachment = + Enum.find(url, fn x -> + media_type = x["mediaType"] || x["mimeType"] || "" - link_element = Enum.find(url, fn x -> is_map(x) and x["mimeType"] == "text/html" end) + is_map(x) and String.starts_with?(media_type, "video/") + end) + + link_element = + Enum.find(url, fn x -> is_map(x) and (x["mediaType"] || x["mimeType"]) == "text/html" end) object - |> Map.put("attachment", [first_element]) + |> Map.put("attachment", [attachment]) |> Map.put("url", link_element["href"]) end @@ -298,9 +316,6 @@ def fix_emoji(%{"tag" => tags} = object) when is_list(tags) do Map.put(mapping, name, data["icon"]["url"]) end) - # we merge mastodon and pleroma emoji into a single mapping, to allow for both wire formats - emoji = Map.merge(object["emoji"] || %{}, emoji) - Map.put(object, "emoji", emoji) end @@ -368,32 +383,6 @@ defp fix_content(%{"mediaType" => "text/markdown", "content" => content} = objec defp fix_content(object), do: object - defp mastodon_follow_hack(%{"id" => id, "actor" => follower_id}, followed) do - with true <- id =~ "follows", - %User{local: true} = follower <- User.get_cached_by_ap_id(follower_id), - %Activity{} = activity <- Utils.fetch_latest_follow(follower, followed) do - {:ok, activity} - else - _ -> {:error, nil} - end - end - - defp mastodon_follow_hack(_, _), do: {:error, nil} - - defp get_follow_activity(follow_object, followed) do - with object_id when not is_nil(object_id) <- Utils.get_ap_id(follow_object), - {_, %Activity{} = activity} <- {:activity, Activity.get_by_ap_id(object_id)} do - {:ok, activity} - else - # Can't find the activity. This might a Mastodon 2.3 "Accept" - {:activity, nil} -> - mastodon_follow_hack(follow_object, followed) - - _ -> - {:error, nil} - end - end - # Reduce the object list to find the reported user. defp get_reported(objects) do Enum.reduce_while(objects, nil, fn ap_id, _ -> @@ -405,6 +394,29 @@ defp get_reported(objects) do end) end + # Compatibility wrapper for Mastodon votes + defp handle_create(%{"object" => %{"type" => "Answer"}} = data, _user) do + handle_incoming(data) + end + + defp handle_create(%{"object" => object} = data, user) do + %{ + to: data["to"], + object: object, + actor: user, + context: object["context"], + local: false, + published: data["published"], + additional: + Map.take(data, [ + "cc", + "directMessage", + "id" + ]) + } + |> ActivityPub.create() + end + def handle_incoming(data, options \\ []) # Flag objects are placed ahead of the ID check because Mastodon 2.8 and earlier send them @@ -443,33 +455,18 @@ def handle_incoming( %{"type" => "Create", "object" => %{"type" => objtype} = object} = data, options ) - when objtype in ["Article", "Event", "Note", "Video", "Page", "Question", "Answer", "Audio"] do + when objtype in ~w{Article Note Video Page} do actor = Containment.get_actor(data) - data = - Map.put(data, "actor", actor) - |> fix_addressing - with nil <- Activity.get_create_by_object_ap_id(object["id"]), - {:ok, %User{} = user} <- User.get_or_fetch_by_ap_id(data["actor"]) do - object = fix_object(object, options) + {:ok, %User{} = user} <- User.get_or_fetch_by_ap_id(actor) do + data = + data + |> Map.put("object", fix_object(object, options)) + |> Map.put("actor", actor) + |> fix_addressing() - params = %{ - to: data["to"], - object: object, - actor: user, - context: object["conversation"], - local: false, - published: data["published"], - additional: - Map.take(data, [ - "cc", - "directMessage", - "id" - ]) - } - - with {:ok, created_activity} <- ActivityPub.create(params) do + with {:ok, created_activity} <- handle_create(data, user) do reply_depth = (options[:depth] || 0) + 1 if Federator.allowed_thread_distance?(reply_depth) do @@ -520,120 +517,6 @@ def handle_incoming( end end - def handle_incoming( - %{"type" => "Follow", "object" => followed, "actor" => follower, "id" => id} = data, - _options - ) do - with %User{local: true} = followed <- - User.get_cached_by_ap_id(Containment.get_actor(%{"actor" => followed})), - {:ok, %User{} = follower} <- - User.get_or_fetch_by_ap_id(Containment.get_actor(%{"actor" => follower})), - {:ok, activity} <- - ActivityPub.follow(follower, followed, id, false, skip_notify_and_stream: true) do - with deny_follow_blocked <- Pleroma.Config.get([:user, :deny_follow_blocked]), - {_, false} <- {:user_blocked, User.blocks?(followed, follower) && deny_follow_blocked}, - {_, false} <- {:user_locked, User.locked?(followed)}, - {_, {:ok, follower}} <- {:follow, User.follow(follower, followed)}, - {_, {:ok, _}} <- - {:follow_state_update, Utils.update_follow_state_for_all(activity, "accept")}, - {:ok, _relationship} <- - FollowingRelationship.update(follower, followed, :follow_accept) do - ActivityPub.accept(%{ - to: [follower.ap_id], - actor: followed, - object: data, - local: true - }) - else - {:user_blocked, true} -> - {:ok, _} = Utils.update_follow_state_for_all(activity, "reject") - {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject) - - ActivityPub.reject(%{ - to: [follower.ap_id], - actor: followed, - object: data, - local: true - }) - - {:follow, {:error, _}} -> - {:ok, _} = Utils.update_follow_state_for_all(activity, "reject") - {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject) - - ActivityPub.reject(%{ - to: [follower.ap_id], - actor: followed, - object: data, - local: true - }) - - {:user_locked, true} -> - {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_pending) - :noop - end - - ActivityPub.notify_and_stream(activity) - {:ok, activity} - else - _e -> - :error - end - end - - def handle_incoming( - %{"type" => "Accept", "object" => follow_object, "actor" => _actor, "id" => id} = data, - _options - ) do - with actor <- Containment.get_actor(data), - {:ok, %User{} = followed} <- User.get_or_fetch_by_ap_id(actor), - {:ok, follow_activity} <- get_follow_activity(follow_object, followed), - {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "accept"), - %User{local: true} = follower <- User.get_cached_by_ap_id(follow_activity.data["actor"]), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_accept) do - User.update_follower_count(followed) - User.update_following_count(follower) - - Notification.update_notification_type(followed, follow_activity) - - ActivityPub.accept(%{ - to: follow_activity.data["to"], - type: "Accept", - actor: followed, - object: follow_activity.data["id"], - local: false, - activity_id: id - }) - else - _e -> - :error - end - end - - def handle_incoming( - %{"type" => "Reject", "object" => follow_object, "actor" => _actor, "id" => id} = data, - _options - ) do - with actor <- Containment.get_actor(data), - {:ok, %User{} = followed} <- User.get_or_fetch_by_ap_id(actor), - {:ok, follow_activity} <- get_follow_activity(follow_object, followed), - {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "reject"), - %User{local: true} = follower <- User.get_cached_by_ap_id(follow_activity.data["actor"]), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_reject), - {:ok, activity} <- - ActivityPub.reject(%{ - to: follow_activity.data["to"], - type: "Reject", - actor: followed, - object: follow_activity.data["id"], - local: false, - activity_id: id - }) do - {:ok, activity} - else - _e -> :error - end - end - @misskey_reactions %{ "like" => "👍", "love" => "❤️", @@ -663,9 +546,10 @@ def handle_incoming( end def handle_incoming( - %{"type" => "Create", "object" => %{"type" => "ChatMessage"}} = data, + %{"type" => "Create", "object" => %{"type" => objtype}} = data, _options - ) do + ) + when objtype in ~w{Question Answer ChatMessage Audio Event} do with {:ok, %User{}} <- ObjectValidator.fetch_actor(data), {:ok, activity, _} <- Pipeline.common_pipeline(data, local: false) do {:ok, activity} @@ -673,7 +557,7 @@ def handle_incoming( end def handle_incoming(%{"type" => type} = data, _options) - when type in ["Like", "EmojiReact", "Announce"] do + when type in ~w{Like EmojiReact Announce} do with :ok <- ObjectValidator.fetch_actor_and_object(data), {:ok, activity, _meta} <- Pipeline.common_pipeline(data, local: false) do @@ -684,35 +568,14 @@ def handle_incoming(%{"type" => type} = data, _options) end def handle_incoming( - %{"type" => "Update", "object" => %{"type" => object_type} = object, "actor" => actor_id} = - data, + %{"type" => type} = data, _options ) - when object_type in [ - "Person", - "Application", - "Service", - "Organization" - ] do - with %User{ap_id: ^actor_id} = actor <- User.get_cached_by_ap_id(object["id"]) do - {:ok, new_user_data} = ActivityPub.user_data_from_user_object(object) - - actor - |> User.remote_user_changeset(new_user_data) - |> User.update_and_set_cache() - - ActivityPub.update(%{ - local: false, - to: data["to"] || [], - cc: data["cc"] || [], - object: object, - actor: actor_id, - activity_id: data["id"] - }) - else - e -> - Logger.error(e) - :error + when type in ~w{Update Block Follow Accept Reject} do + with {:ok, %User{}} <- ObjectValidator.fetch_actor(data), + {:ok, activity, _} <- + Pipeline.common_pipeline(data, local: false) do + {:ok, activity} end end @@ -720,12 +583,13 @@ def handle_incoming( %{"type" => "Delete"} = data, _options ) do - with {:ok, activity, _} <- Pipeline.common_pipeline(data, local: false) do + with {:ok, activity, _} <- + Pipeline.common_pipeline(data, local: false) do {:ok, activity} else {:error, {:validate_object, _}} = e -> # Check if we have a create activity for this - with {:ok, object_id} <- Types.ObjectID.cast(data["object"]), + with {:ok, object_id} <- ObjectValidators.ObjectID.cast(data["object"]), %Activity{data: %{"actor" => actor}} <- Activity.create_by_object_ap_id(object_id) |> Repo.one(), # We have one, insert a tombstone and retry @@ -788,21 +652,6 @@ def handle_incoming( end end - def handle_incoming( - %{"type" => "Block", "object" => blocked, "actor" => blocker, "id" => id} = _data, - _options - ) do - with %User{local: true} = blocked = User.get_cached_by_ap_id(blocked), - {:ok, %User{} = blocker} = User.get_or_fetch_by_ap_id(blocker), - {:ok, activity} <- ActivityPub.block(blocker, blocked, id, false) do - User.unfollow(blocker, blocked) - User.block(blocker, blocked) - {:ok, activity} - else - _e -> :error - end - end - def handle_incoming( %{ "type" => "Move", diff --git a/lib/pleroma/web/activity_pub/utils.ex b/lib/pleroma/web/activity_pub/utils.ex index dfae602df..713b0ca1f 100644 --- a/lib/pleroma/web/activity_pub/utils.ex +++ b/lib/pleroma/web/activity_pub/utils.ex @@ -719,15 +719,18 @@ defp build_flag_object(act) when is_map(act) or is_binary(act) do case Activity.get_by_ap_id_with_object(id) do %Activity{} = activity -> + activity_actor = User.get_by_ap_id(activity.object.data["actor"]) + %{ "type" => "Note", "id" => activity.data["id"], "content" => activity.object.data["content"], "published" => activity.object.data["published"], "actor" => - AccountView.render("show.json", %{ - user: User.get_by_ap_id(activity.object.data["actor"]) - }) + AccountView.render( + "show.json", + %{user: activity_actor, skip_visibility_check: true} + ) } _ -> diff --git a/lib/pleroma/web/activity_pub/views/user_view.ex b/lib/pleroma/web/activity_pub/views/user_view.ex index 4a02b09a1..3a4564912 100644 --- a/lib/pleroma/web/activity_pub/views/user_view.ex +++ b/lib/pleroma/web/activity_pub/views/user_view.ex @@ -81,6 +81,15 @@ def render("user.json", %{user: user}) do fields = Enum.map(user.fields, &Map.put(&1, "type", "PropertyValue")) + capabilities = + if is_boolean(user.accepts_chat_messages) do + %{ + "acceptsChatMessages" => user.accepts_chat_messages + } + else + %{} + end + %{ "id" => user.ap_id, "type" => user.actor_type, @@ -101,7 +110,8 @@ def render("user.json", %{user: user}) do "endpoints" => endpoints, "attachment" => fields, "tag" => emoji_tags, - "discoverable" => user.discoverable + "discoverable" => user.discoverable, + "capabilities" => capabilities } |> Map.merge(maybe_make_image(&User.avatar_url/2, "icon", user)) |> Map.merge(maybe_make_image(&User.banner_url/2, "image", user)) diff --git a/lib/pleroma/web/activity_pub/visibility.ex b/lib/pleroma/web/activity_pub/visibility.ex index 453a6842e..5c349bb7a 100644 --- a/lib/pleroma/web/activity_pub/visibility.ex +++ b/lib/pleroma/web/activity_pub/visibility.ex @@ -47,6 +47,10 @@ def is_list?(_), do: false @spec visible_for_user?(Activity.t(), User.t() | nil) :: boolean() def visible_for_user?(%{actor: ap_id}, %User{ap_id: ap_id}), do: true + def visible_for_user?(nil, _), do: false + + def visible_for_user?(%{data: %{"listMessage" => _}}, nil), do: false + def visible_for_user?(%{data: %{"listMessage" => list_ap_id}} = activity, %User{} = user) do user.ap_id in activity.data["to"] || list_ap_id @@ -54,15 +58,10 @@ def visible_for_user?(%{data: %{"listMessage" => list_ap_id}} = activity, %User{ |> Pleroma.List.member?(user) end - def visible_for_user?(%{data: %{"listMessage" => _}}, nil), do: false - def visible_for_user?(%{local: local} = activity, nil) do - cfg_key = - if local, - do: :local, - else: :remote + cfg_key = if local, do: :local, else: :remote - if Pleroma.Config.get([:restrict_unauthenticated, :activities, cfg_key]), + if Pleroma.Config.restrict_unauthenticated_access?(:activities, cfg_key), do: false, else: is_public?(activity) end diff --git a/lib/pleroma/web/admin_api/controllers/admin_api_controller.ex b/lib/pleroma/web/admin_api/controllers/admin_api_controller.ex index 5cbf0dd4f..f5e4d49f9 100644 --- a/lib/pleroma/web/admin_api/controllers/admin_api_controller.ex +++ b/lib/pleroma/web/admin_api/controllers/admin_api_controller.ex @@ -44,6 +44,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do :user_toggle_activation, :user_activate, :user_deactivate, + :user_approve, :tag_users, :untag_users, :right_add, @@ -111,8 +112,7 @@ def user_delete(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) action: "delete" }) - conn - |> json(nicknames) + json(conn, nicknames) end def user_follow(%{assigns: %{user: admin}} = conn, %{ @@ -131,8 +131,7 @@ def user_follow(%{assigns: %{user: admin}} = conn, %{ }) end - conn - |> json("ok") + json(conn, "ok") end def user_unfollow(%{assigns: %{user: admin}} = conn, %{ @@ -151,8 +150,7 @@ def user_unfollow(%{assigns: %{user: admin}} = conn, %{ }) end - conn - |> json("ok") + json(conn, "ok") end def users_create(%{assigns: %{user: admin}} = conn, %{"users" => users}) do @@ -191,8 +189,7 @@ def users_create(%{assigns: %{user: admin}} = conn, %{"users" => users}) do action: "create" }) - conn - |> json(res) + json(conn, res) {:error, id, changeset, _} -> res = @@ -210,8 +207,8 @@ def users_create(%{assigns: %{user: admin}} = conn, %{"users" => users}) do end end - def user_show(conn, %{"nickname" => nickname}) do - with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do + def user_show(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do + with %User{} = user <- User.get_cached_by_nickname_or_id(nickname, for: admin) do conn |> put_view(AccountView) |> render("show.json", %{user: user}) @@ -237,11 +234,11 @@ def list_instance_statuses(conn, %{"instance" => instance} = params) do |> render("index.json", %{activities: activities, as: :activity}) end - def list_user_statuses(conn, %{"nickname" => nickname} = params) do + def list_user_statuses(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname} = params) do with_reblogs = params["with_reblogs"] == "true" || params["with_reblogs"] == true godmode = params["godmode"] == "true" || params["godmode"] == true - with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do + with %User{} = user <- User.get_cached_by_nickname_or_id(nickname, for: admin) do {_, page_size} = page_params(params) activities = @@ -307,6 +304,21 @@ def user_deactivate(%{assigns: %{user: admin}} = conn, %{"nicknames" => nickname |> render("index.json", %{users: Keyword.values(updated_users)}) end + def user_approve(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do + users = Enum.map(nicknames, &User.get_cached_by_nickname/1) + {:ok, updated_users} = User.approve(users) + + ModerationLog.insert_log(%{ + actor: admin, + subject: users, + action: "approve" + }) + + conn + |> put_view(AccountView) + |> render("index.json", %{users: updated_users}) + end + def tag_users(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames, "tags" => tags}) do with {:ok, _} <- User.tag(nicknames, tags) do ModerationLog.insert_log(%{ @@ -349,12 +361,16 @@ def list_users(conn, params) do with {:ok, users, count} <- Search.user(Map.merge(search_params, filters)) do json( conn, - AccountView.render("index.json", users: users, count: count, page_size: page_size) + AccountView.render("index.json", + users: users, + count: count, + page_size: page_size + ) ) end end - @filters ~w(local external active deactivated is_admin is_moderator) + @filters ~w(local external active deactivated need_approval is_admin is_moderator) @spec maybe_parse_filters(String.t()) :: %{required(String.t()) => true} | %{} defp maybe_parse_filters(filters) when is_nil(filters) or filters == "", do: %{} @@ -363,8 +379,7 @@ defp maybe_parse_filters(filters) do filters |> String.split(",") |> Enum.filter(&Enum.member?(@filters, &1)) - |> Enum.map(&String.to_atom(&1)) - |> Enum.into(%{}, &{&1, true}) + |> Map.new(&{String.to_existing_atom(&1), true}) end def right_add_multiple(%{assigns: %{user: admin}} = conn, %{ @@ -530,7 +545,7 @@ def disable_mfa(conn, %{"nickname" => nickname}) do @doc "Show a given user's credentials" def show_user_credentials(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do - with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do + with %User{} = user <- User.get_cached_by_nickname_or_id(nickname, for: admin) do conn |> put_view(AccountView) |> render("credentials.json", %{user: user, for: admin}) @@ -568,10 +583,10 @@ def update_user_credentials( {:error, changeset} -> errors = Map.new(changeset.errors, fn {key, {error, _}} -> {key, error} end) - json(conn, %{errors: errors}) + {:errors, errors} _ -> - json(conn, %{error: "Unable to update user."}) + {:error, :not_found} end end @@ -616,42 +631,36 @@ defp configurable_from_database do def reload_emoji(conn, _params) do Pleroma.Emoji.reload() - conn |> json("ok") + json(conn, "ok") end def confirm_email(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do - users = nicknames |> Enum.map(&User.get_cached_by_nickname/1) + users = Enum.map(nicknames, &User.get_cached_by_nickname/1) User.toggle_confirmation(users) - ModerationLog.insert_log(%{ - actor: admin, - subject: users, - action: "confirm_email" - }) + ModerationLog.insert_log(%{actor: admin, subject: users, action: "confirm_email"}) - conn |> json("") + json(conn, "") end def resend_confirmation_email(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do - users = nicknames |> Enum.map(&User.get_cached_by_nickname/1) + users = + Enum.map(nicknames, fn nickname -> + nickname + |> User.get_cached_by_nickname() + |> User.send_confirmation_email() + end) - User.try_send_confirmation_email(users) + ModerationLog.insert_log(%{actor: admin, subject: users, action: "resend_confirmation_email"}) - ModerationLog.insert_log(%{ - actor: admin, - subject: users, - action: "resend_confirmation_email" - }) - - conn |> json("") + json(conn, "") end - def stats(conn, _) do - count = Stats.get_status_visibility_count() + def stats(conn, params) do + counters = Stats.get_status_visibility_count(params["instance"]) - conn - |> json(%{"status_visibility" => count}) + json(conn, %{"status_visibility" => counters}) end defp page_params(params) do diff --git a/lib/pleroma/web/admin_api/controllers/config_controller.ex b/lib/pleroma/web/admin_api/controllers/config_controller.ex index d6e2019bc..0df13007f 100644 --- a/lib/pleroma/web/admin_api/controllers/config_controller.ex +++ b/lib/pleroma/web/admin_api/controllers/config_controller.ex @@ -9,8 +9,6 @@ defmodule Pleroma.Web.AdminAPI.ConfigController do alias Pleroma.ConfigDB alias Pleroma.Plugs.OAuthScopesPlug - @descriptions Pleroma.Docs.JSON.compile() - plug(Pleroma.Web.ApiSpec.CastAndValidate) plug(OAuthScopesPlug, %{scopes: ["write"], admin: true} when action == :update) @@ -25,7 +23,7 @@ defmodule Pleroma.Web.AdminAPI.ConfigController do defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.Admin.ConfigOperation def descriptions(conn, _params) do - descriptions = Enum.filter(@descriptions, &whitelisted_config?/1) + descriptions = Enum.filter(Pleroma.Docs.JSON.compiled_descriptions(), &whitelisted_config?/1) json(conn, descriptions) end @@ -33,7 +31,11 @@ def descriptions(conn, _params) do def show(conn, %{only_db: true}) do with :ok <- configurable_from_database() do configs = Pleroma.Repo.all(ConfigDB) - render(conn, "index.json", %{configs: configs}) + + render(conn, "index.json", %{ + configs: configs, + need_reboot: Restarter.Pleroma.need_reboot?() + }) end end @@ -61,17 +63,20 @@ def show(conn, _params) do value end - %{ - group: ConfigDB.convert(group), - key: ConfigDB.convert(key), - value: ConfigDB.convert(merged_value) + %ConfigDB{ + group: group, + key: key, + value: merged_value } |> Pleroma.Maps.put_if_present(:db, db) end) end) |> List.flatten() - json(conn, %{configs: merged, need_reboot: Restarter.Pleroma.need_reboot?()}) + render(conn, "index.json", %{ + configs: merged, + need_reboot: Restarter.Pleroma.need_reboot?() + }) end end @@ -91,24 +96,17 @@ def update(%{body_params: %{configs: configs}} = conn, _) do {deleted, updated} = results - |> Enum.map(fn {:ok, config} -> - Map.put(config, :db, ConfigDB.get_db_keys(config)) - end) - |> Enum.split_with(fn config -> - Ecto.get_meta(config, :state) == :deleted + |> Enum.map(fn {:ok, %{key: key, value: value} = config} -> + Map.put(config, :db, ConfigDB.get_db_keys(value, key)) end) + |> Enum.split_with(&(Ecto.get_meta(&1, :state) == :deleted)) Config.TransferTask.load_and_update_env(deleted, false) if not Restarter.Pleroma.need_reboot?() do changed_reboot_settings? = (updated ++ deleted) - |> Enum.any?(fn config -> - group = ConfigDB.from_string(config.group) - key = ConfigDB.from_string(config.key) - value = ConfigDB.from_binary(config.value) - Config.TransferTask.pleroma_need_restart?(group, key, value) - end) + |> Enum.any?(&Config.TransferTask.pleroma_need_restart?(&1.group, &1.key, &1.value)) if changed_reboot_settings?, do: Restarter.Pleroma.need_reboot() end diff --git a/lib/pleroma/web/admin_api/controllers/fallback_controller.ex b/lib/pleroma/web/admin_api/controllers/fallback_controller.ex index 82965936d..34d90db07 100644 --- a/lib/pleroma/web/admin_api/controllers/fallback_controller.ex +++ b/lib/pleroma/web/admin_api/controllers/fallback_controller.ex @@ -17,6 +17,12 @@ def call(conn, {:error, reason}) do |> json(%{error: reason}) end + def call(conn, {:errors, errors}) do + conn + |> put_status(:bad_request) + |> json(%{errors: errors}) + end + def call(conn, {:param_cast, _}) do conn |> put_status(:bad_request) diff --git a/lib/pleroma/web/admin_api/controllers/media_proxy_cache_controller.ex b/lib/pleroma/web/admin_api/controllers/media_proxy_cache_controller.ex new file mode 100644 index 000000000..131e22d78 --- /dev/null +++ b/lib/pleroma/web/admin_api/controllers/media_proxy_cache_controller.ex @@ -0,0 +1,74 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.AdminAPI.MediaProxyCacheController do + use Pleroma.Web, :controller + + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.Web.ApiSpec.Admin, as: Spec + alias Pleroma.Web.MediaProxy + + plug(Pleroma.Web.ApiSpec.CastAndValidate) + + plug( + OAuthScopesPlug, + %{scopes: ["read:media_proxy_caches"], admin: true} when action in [:index] + ) + + plug( + OAuthScopesPlug, + %{scopes: ["write:media_proxy_caches"], admin: true} when action in [:purge, :delete] + ) + + action_fallback(Pleroma.Web.AdminAPI.FallbackController) + + defdelegate open_api_operation(action), to: Spec.MediaProxyCacheOperation + + def index(%{assigns: %{user: _}} = conn, params) do + entries = fetch_entries(params) + urls = paginate_entries(entries, params.page, params.page_size) + + render(conn, "index.json", + urls: urls, + page_size: params.page_size, + count: length(entries) + ) + end + + defp fetch_entries(params) do + MediaProxy.cache_table() + |> Cachex.stream!(Cachex.Query.create(true, :key)) + |> filter_entries(params[:query]) + end + + defp filter_entries(stream, query) when is_binary(query) do + regex = ~r/#{query}/i + + stream + |> Enum.filter(fn url -> String.match?(url, regex) end) + |> Enum.to_list() + end + + defp filter_entries(stream, _), do: Enum.to_list(stream) + + defp paginate_entries(entries, page, page_size) do + offset = page_size * (page - 1) + Enum.slice(entries, offset, page_size) + end + + def delete(%{assigns: %{user: _}, body_params: %{urls: urls}} = conn, _) do + MediaProxy.remove_from_banned_urls(urls) + json(conn, %{}) + end + + def purge(%{assigns: %{user: _}, body_params: %{urls: urls, ban: ban}} = conn, _) do + MediaProxy.Invalidation.purge(urls) + + if ban do + MediaProxy.put_in_banned_urls(urls) + end + + json(conn, %{}) + end +end diff --git a/lib/pleroma/web/admin_api/controllers/relay_controller.ex b/lib/pleroma/web/admin_api/controllers/relay_controller.ex index cf9f3a14b..95d06dde7 100644 --- a/lib/pleroma/web/admin_api/controllers/relay_controller.ex +++ b/lib/pleroma/web/admin_api/controllers/relay_controller.ex @@ -39,7 +39,7 @@ def follow(%{assigns: %{user: admin}, body_params: %{relay_url: target}} = conn, target: target }) - json(conn, target) + json(conn, %{actor: target, followed_back: target in Relay.following()}) else _ -> conn diff --git a/lib/pleroma/web/admin_api/views/account_view.ex b/lib/pleroma/web/admin_api/views/account_view.ex index e1e929632..9c477feab 100644 --- a/lib/pleroma/web/admin_api/views/account_view.ex +++ b/lib/pleroma/web/admin_api/views/account_view.ex @@ -77,7 +77,10 @@ def render("show.json", %{user: user}) do "roles" => User.roles(user), "tags" => user.tags || [], "confirmation_pending" => user.confirmation_pending, - "url" => user.uri || user.ap_id + "approval_pending" => user.approval_pending, + "url" => user.uri || user.ap_id, + "registration_reason" => user.registration_reason, + "actor_type" => user.actor_type } end @@ -105,7 +108,7 @@ def render("create-error.json", %{changeset: %Ecto.Changeset{changes: changes, e end def merge_account_views(%User{} = user) do - MastodonAPI.AccountView.render("show.json", %{user: user}) + MastodonAPI.AccountView.render("show.json", %{user: user, skip_visibility_check: true}) |> Map.merge(AdminAPI.AccountView.render("show.json", %{user: user})) end diff --git a/lib/pleroma/web/admin_api/views/config_view.ex b/lib/pleroma/web/admin_api/views/config_view.ex index 587ef760e..d2d8b5907 100644 --- a/lib/pleroma/web/admin_api/views/config_view.ex +++ b/lib/pleroma/web/admin_api/views/config_view.ex @@ -5,23 +5,20 @@ defmodule Pleroma.Web.AdminAPI.ConfigView do use Pleroma.Web, :view - def render("index.json", %{configs: configs} = params) do - map = %{ - configs: render_many(configs, __MODULE__, "show.json", as: :config) - } + alias Pleroma.ConfigDB - if params[:need_reboot] do - Map.put(map, :need_reboot, true) - else - map - end + def render("index.json", %{configs: configs} = params) do + %{ + configs: render_many(configs, __MODULE__, "show.json", as: :config), + need_reboot: params[:need_reboot] + } end def render("show.json", %{config: config}) do map = %{ - key: config.key, - group: config.group, - value: Pleroma.ConfigDB.from_binary_with_convert(config.value) + key: ConfigDB.to_json_types(config.key), + group: ConfigDB.to_json_types(config.group), + value: ConfigDB.to_json_types(config.value) } if config.db != [] do diff --git a/lib/pleroma/web/admin_api/views/media_proxy_cache_view.ex b/lib/pleroma/web/admin_api/views/media_proxy_cache_view.ex new file mode 100644 index 000000000..a803bda0b --- /dev/null +++ b/lib/pleroma/web/admin_api/views/media_proxy_cache_view.ex @@ -0,0 +1,15 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.AdminAPI.MediaProxyCacheView do + use Pleroma.Web, :view + + def render("index.json", %{urls: urls, page_size: page_size, count: count}) do + %{ + urls: urls, + count: count, + page_size: page_size + } + end +end diff --git a/lib/pleroma/web/api_spec/cast_and_validate.ex b/lib/pleroma/web/api_spec/cast_and_validate.ex index bd9026237..fbfc27d6f 100644 --- a/lib/pleroma/web/api_spec/cast_and_validate.ex +++ b/lib/pleroma/web/api_spec/cast_and_validate.ex @@ -40,7 +40,7 @@ def call(%{private: %{open_api_spex: private_data}} = conn, %{ |> List.first() _ -> - nil + "application/json" end private_data = Map.put(private_data, :operation_id, operation_id) diff --git a/lib/pleroma/web/api_spec/helpers.ex b/lib/pleroma/web/api_spec/helpers.ex index a9cfe0fed..2a7f1a706 100644 --- a/lib/pleroma/web/api_spec/helpers.ex +++ b/lib/pleroma/web/api_spec/helpers.ex @@ -29,6 +29,10 @@ def request_body(description, schema_ref, opts \\ []) do } end + def admin_api_params do + [Operation.parameter(:admin_token, :query, :string, "Allows authorization via admin token.")] + end + def pagination_params do [ Operation.parameter(:max_id, :query, :string, "Return items older than this ID"), @@ -39,6 +43,12 @@ def pagination_params do :string, "Return the newest items newer than this ID" ), + Operation.parameter( + :offset, + :query, + %Schema{type: :integer, default: 0}, + "Return items past this number of items" + ), Operation.parameter( :limit, :query, diff --git a/lib/pleroma/web/api_spec/operations/account_operation.ex b/lib/pleroma/web/api_spec/operations/account_operation.ex index 20572f8ea..aaebc9b5c 100644 --- a/lib/pleroma/web/api_spec/operations/account_operation.ex +++ b/lib/pleroma/web/api_spec/operations/account_operation.ex @@ -61,7 +61,7 @@ def update_credentials_operation do description: "Update the user's display and preferences.", operationId: "AccountController.update_credentials", security: [%{"oAuth" => ["write:accounts"]}], - requestBody: request_body("Parameters", update_creadentials_request(), required: true), + requestBody: request_body("Parameters", update_credentials_request(), required: true), responses: %{ 200 => Operation.response("Account", "application/json", Account), 403 => Operation.response("Error", "application/json", ApiError) @@ -102,6 +102,7 @@ def show_operation do parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}], responses: %{ 200 => Operation.response("Account", "application/json", Account), + 401 => Operation.response("Error", "application/json", ApiError), 404 => Operation.response("Error", "application/json", ApiError) } } @@ -142,6 +143,7 @@ def statuses_operation do ] ++ pagination_params(), responses: %{ 200 => Operation.response("Statuses", "application/json", array_of_statuses()), + 401 => Operation.response("Error", "application/json", ApiError), 404 => Operation.response("Error", "application/json", ApiError) } } @@ -157,6 +159,7 @@ def followers_operation do "Accounts which follow the given account, if network is not hidden by the account owner.", parameters: [ %Reference{"$ref": "#/components/parameters/accountIdOrNickname"}, + Operation.parameter(:id, :query, :string, "ID of the resource owner"), with_relationships_param() | pagination_params() ], responses: %{ @@ -175,6 +178,7 @@ def following_operation do "Accounts which the given account is following, if network is not hidden by the account owner.", parameters: [ %Reference{"$ref": "#/components/parameters/accountIdOrNickname"}, + Operation.parameter(:id, :query, :string, "ID of the resource owner"), with_relationships_param() | pagination_params() ], responses: %{200 => Operation.response("Accounts", "application/json", array_of_accounts())} @@ -201,14 +205,23 @@ def follow_operation do security: [%{"oAuth" => ["follow", "write:follows"]}], description: "Follow the given account", parameters: [ - %Reference{"$ref": "#/components/parameters/accountIdOrNickname"}, - Operation.parameter( - :reblogs, - :query, - BooleanLike, - "Receive this account's reblogs in home timeline? Defaults to true." - ) + %Reference{"$ref": "#/components/parameters/accountIdOrNickname"} ], + requestBody: + request_body( + "Parameters", + %Schema{ + type: :object, + properties: %{ + reblogs: %Schema{ + type: :boolean, + description: "Receive this account's reblogs in home timeline? Defaults to true.", + default: true + } + } + }, + required: false + ), responses: %{ 200 => Operation.response("Relationship", "application/json", AccountRelationship), 400 => Operation.response("Error", "application/json", ApiError), @@ -436,27 +449,45 @@ defp create_request do } end + # Note: this is a token response (if login succeeds!), but there's no oauth operation file yet. defp create_response do %Schema{ title: "AccountCreateResponse", description: "Response schema for an account", type: :object, properties: %{ + # The response when auto-login on create succeeds (token is issued): token_type: %Schema{type: :string}, access_token: %Schema{type: :string}, - scope: %Schema{type: :array, items: %Schema{type: :string}}, - created_at: %Schema{type: :integer, format: :"date-time"} + refresh_token: %Schema{type: :string}, + scope: %Schema{type: :string}, + created_at: %Schema{type: :integer, format: :"date-time"}, + me: %Schema{type: :string}, + expires_in: %Schema{type: :integer}, + # + # The response when registration succeeds but auto-login fails (no token): + identifier: %Schema{type: :string}, + message: %Schema{type: :string} }, + required: [], + # Note: example of successful registration with failed login response: + # example: %{ + # "identifier" => "missing_confirmed_email", + # "message" => "You have been registered. Please check your email for further instructions." + # }, example: %{ + "token_type" => "Bearer", "access_token" => "i9hAVVzGld86Pl5JtLtizKoXVvtTlSCJvwaugCxvZzk", + "refresh_token" => "i9hAVVzGld86Pl5JtLtizKoXVvtTlSCJvwaugCxvZzz", "created_at" => 1_585_918_714, - "scope" => ["read", "write", "follow", "push"], - "token_type" => "Bearer" + "expires_in" => 600, + "scope" => "read write follow push", + "me" => "https://gensokyo.2hu/users/raymoo" } } end - defp update_creadentials_request do + defp update_credentials_request do %Schema{ title: "AccountUpdateCredentialsRequest", description: "POST body for creating an account", @@ -490,6 +521,11 @@ defp update_creadentials_request do nullable: true, description: "Whether manual approval of follow requests is required." }, + accepts_chat_messages: %Schema{ + allOf: [BooleanLike], + nullable: true, + description: "Whether the user accepts receiving chat messages." + }, fields_attributes: %Schema{ nullable: true, oneOf: [ diff --git a/lib/pleroma/web/api_spec/operations/admin/config_operation.ex b/lib/pleroma/web/api_spec/operations/admin/config_operation.ex index 7b38a2ef4..3a8380797 100644 --- a/lib/pleroma/web/api_spec/operations/admin/config_operation.ex +++ b/lib/pleroma/web/api_spec/operations/admin/config_operation.ex @@ -26,6 +26,7 @@ def show_operation do %Schema{type: :boolean, default: false}, "Get only saved in database settings" ) + | admin_api_params() ], security: [%{"oAuth" => ["read"]}], responses: %{ @@ -41,6 +42,7 @@ def update_operation do summary: "Update config settings", operationId: "AdminAPI.ConfigController.update", security: [%{"oAuth" => ["write"]}], + parameters: admin_api_params(), requestBody: request_body("Parameters", %Schema{ type: :object, @@ -73,6 +75,7 @@ def descriptions_operation do summary: "Get JSON with config descriptions.", operationId: "AdminAPI.ConfigController.descriptions", security: [%{"oAuth" => ["read"]}], + parameters: admin_api_params(), responses: %{ 200 => Operation.response("Config Descriptions", "application/json", %Schema{ diff --git a/lib/pleroma/web/api_spec/operations/admin/invite_operation.ex b/lib/pleroma/web/api_spec/operations/admin/invite_operation.ex index d3af9db49..801024d75 100644 --- a/lib/pleroma/web/api_spec/operations/admin/invite_operation.ex +++ b/lib/pleroma/web/api_spec/operations/admin/invite_operation.ex @@ -20,6 +20,7 @@ def index_operation do summary: "Get a list of generated invites", operationId: "AdminAPI.InviteController.index", security: [%{"oAuth" => ["read:invites"]}], + parameters: admin_api_params(), responses: %{ 200 => Operation.response("Invites", "application/json", %Schema{ @@ -51,6 +52,7 @@ def create_operation do summary: "Create an account registration invite token", operationId: "AdminAPI.InviteController.create", security: [%{"oAuth" => ["write:invites"]}], + parameters: admin_api_params(), requestBody: request_body("Parameters", %Schema{ type: :object, @@ -71,6 +73,7 @@ def revoke_operation do summary: "Revoke invite by token", operationId: "AdminAPI.InviteController.revoke", security: [%{"oAuth" => ["write:invites"]}], + parameters: admin_api_params(), requestBody: request_body( "Parameters", @@ -97,6 +100,7 @@ def email_operation do summary: "Sends registration invite via email", operationId: "AdminAPI.InviteController.email", security: [%{"oAuth" => ["write:invites"]}], + parameters: admin_api_params(), requestBody: request_body( "Parameters", diff --git a/lib/pleroma/web/api_spec/operations/admin/media_proxy_cache_operation.ex b/lib/pleroma/web/api_spec/operations/admin/media_proxy_cache_operation.ex new file mode 100644 index 000000000..ab45d6633 --- /dev/null +++ b/lib/pleroma/web/api_spec/operations/admin/media_proxy_cache_operation.ex @@ -0,0 +1,121 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ApiSpec.Admin.MediaProxyCacheOperation do + alias OpenApiSpex.Operation + alias OpenApiSpex.Schema + alias Pleroma.Web.ApiSpec.Schemas.ApiError + + import Pleroma.Web.ApiSpec.Helpers + + def open_api_operation(action) do + operation = String.to_existing_atom("#{action}_operation") + apply(__MODULE__, operation, []) + end + + def index_operation do + %Operation{ + tags: ["Admin", "MediaProxyCache"], + summary: "Fetch a paginated list of all banned MediaProxy URLs in Cachex", + operationId: "AdminAPI.MediaProxyCacheController.index", + security: [%{"oAuth" => ["read:media_proxy_caches"]}], + parameters: [ + Operation.parameter( + :query, + :query, + %Schema{type: :string, default: nil}, + "Page" + ), + Operation.parameter( + :page, + :query, + %Schema{type: :integer, default: 1}, + "Page" + ), + Operation.parameter( + :page_size, + :query, + %Schema{type: :integer, default: 50}, + "Number of statuses to return" + ) + | admin_api_params() + ], + responses: %{ + 200 => + Operation.response( + "Array of banned MediaProxy URLs in Cachex", + "application/json", + %Schema{ + type: :object, + properties: %{ + count: %Schema{type: :integer}, + page_size: %Schema{type: :integer}, + urls: %Schema{ + type: :array, + items: %Schema{ + type: :string, + format: :uri, + description: "MediaProxy URLs" + } + } + } + } + ) + } + } + end + + def delete_operation do + %Operation{ + tags: ["Admin", "MediaProxyCache"], + summary: "Remove a banned MediaProxy URL from Cachex", + operationId: "AdminAPI.MediaProxyCacheController.delete", + security: [%{"oAuth" => ["write:media_proxy_caches"]}], + parameters: admin_api_params(), + requestBody: + request_body( + "Parameters", + %Schema{ + type: :object, + required: [:urls], + properties: %{ + urls: %Schema{type: :array, items: %Schema{type: :string, format: :uri}} + } + }, + required: true + ), + responses: %{ + 200 => empty_object_response(), + 400 => Operation.response("Error", "application/json", ApiError) + } + } + end + + def purge_operation do + %Operation{ + tags: ["Admin", "MediaProxyCache"], + summary: "Purge and optionally ban a MediaProxy URL", + operationId: "AdminAPI.MediaProxyCacheController.purge", + security: [%{"oAuth" => ["write:media_proxy_caches"]}], + parameters: admin_api_params(), + requestBody: + request_body( + "Parameters", + %Schema{ + type: :object, + required: [:urls], + properties: %{ + urls: %Schema{type: :array, items: %Schema{type: :string, format: :uri}}, + ban: %Schema{type: :boolean, default: true} + } + }, + required: true + ), + responses: %{ + 200 => empty_object_response(), + 400 => Operation.response("Error", "application/json", ApiError) + } + } + end +end diff --git a/lib/pleroma/web/api_spec/operations/admin/oauth_app_operation.ex b/lib/pleroma/web/api_spec/operations/admin/oauth_app_operation.ex index fbc9f80d7..a75f3e622 100644 --- a/lib/pleroma/web/api_spec/operations/admin/oauth_app_operation.ex +++ b/lib/pleroma/web/api_spec/operations/admin/oauth_app_operation.ex @@ -36,6 +36,7 @@ def index_operation do %Schema{type: :integer, default: 50}, "Number of apps to return" ) + | admin_api_params() ], responses: %{ 200 => @@ -72,6 +73,7 @@ def create_operation do summary: "Create OAuth App", operationId: "AdminAPI.OAuthAppController.create", requestBody: request_body("Parameters", create_request()), + parameters: admin_api_params(), security: [%{"oAuth" => ["write"]}], responses: %{ 200 => Operation.response("App", "application/json", oauth_app()), @@ -85,7 +87,7 @@ def update_operation do tags: ["Admin", "oAuth Apps"], summary: "Update OAuth App", operationId: "AdminAPI.OAuthAppController.update", - parameters: [id_param()], + parameters: [id_param() | admin_api_params()], security: [%{"oAuth" => ["write"]}], requestBody: request_body("Parameters", update_request()), responses: %{ @@ -103,7 +105,7 @@ def delete_operation do tags: ["Admin", "oAuth Apps"], summary: "Delete OAuth App", operationId: "AdminAPI.OAuthAppController.delete", - parameters: [id_param()], + parameters: [id_param() | admin_api_params()], security: [%{"oAuth" => ["write"]}], responses: %{ 204 => no_content_response(), diff --git a/lib/pleroma/web/api_spec/operations/admin/relay_operation.ex b/lib/pleroma/web/api_spec/operations/admin/relay_operation.ex index 7672cb467..e06b2d164 100644 --- a/lib/pleroma/web/api_spec/operations/admin/relay_operation.ex +++ b/lib/pleroma/web/api_spec/operations/admin/relay_operation.ex @@ -19,6 +19,7 @@ def index_operation do summary: "List Relays", operationId: "AdminAPI.RelayController.index", security: [%{"oAuth" => ["read"]}], + parameters: admin_api_params(), responses: %{ 200 => Operation.response("Response", "application/json", %Schema{ @@ -26,8 +27,7 @@ def index_operation do properties: %{ relays: %Schema{ type: :array, - items: %Schema{type: :string}, - example: ["lain.com", "mstdn.io"] + items: relay() } } }) @@ -41,19 +41,10 @@ def follow_operation do summary: "Follow a Relay", operationId: "AdminAPI.RelayController.follow", security: [%{"oAuth" => ["write:follows"]}], - requestBody: - request_body("Parameters", %Schema{ - type: :object, - properties: %{ - relay_url: %Schema{type: :string, format: :uri} - } - }), + parameters: admin_api_params(), + requestBody: request_body("Parameters", relay_url()), responses: %{ - 200 => - Operation.response("Status", "application/json", %Schema{ - type: :string, - example: "http://mastodon.example.org/users/admin" - }) + 200 => Operation.response("Status", "application/json", relay()) } } end @@ -64,13 +55,8 @@ def unfollow_operation do summary: "Unfollow a Relay", operationId: "AdminAPI.RelayController.unfollow", security: [%{"oAuth" => ["write:follows"]}], - requestBody: - request_body("Parameters", %Schema{ - type: :object, - properties: %{ - relay_url: %Schema{type: :string, format: :uri} - } - }), + parameters: admin_api_params(), + requestBody: request_body("Parameters", relay_url()), responses: %{ 200 => Operation.response("Status", "application/json", %Schema{ @@ -80,4 +66,29 @@ def unfollow_operation do } } end + + defp relay do + %Schema{ + type: :object, + properties: %{ + actor: %Schema{ + type: :string, + example: "https://example.com/relay" + }, + followed_back: %Schema{ + type: :boolean, + description: "Is relay followed back by this actor?" + } + } + } + end + + defp relay_url do + %Schema{ + type: :object, + properties: %{ + relay_url: %Schema{type: :string, format: :uri} + } + } + end end diff --git a/lib/pleroma/web/api_spec/operations/admin/report_operation.ex b/lib/pleroma/web/api_spec/operations/admin/report_operation.ex index 15e78bfaf..3bb7ec49e 100644 --- a/lib/pleroma/web/api_spec/operations/admin/report_operation.ex +++ b/lib/pleroma/web/api_spec/operations/admin/report_operation.ex @@ -48,6 +48,7 @@ def index_operation do %Schema{type: :integer, default: 50}, "Number number of log entries per page" ) + | admin_api_params() ], responses: %{ 200 => @@ -71,7 +72,7 @@ def show_operation do tags: ["Admin", "Reports"], summary: "Get an individual report", operationId: "AdminAPI.ReportController.show", - parameters: [id_param()], + parameters: [id_param() | admin_api_params()], security: [%{"oAuth" => ["read:reports"]}], responses: %{ 200 => Operation.response("Report", "application/json", report()), @@ -86,6 +87,7 @@ def update_operation do summary: "Change the state of one or multiple reports", operationId: "AdminAPI.ReportController.update", security: [%{"oAuth" => ["write:reports"]}], + parameters: admin_api_params(), requestBody: request_body("Parameters", update_request(), required: true), responses: %{ 204 => no_content_response(), @@ -100,7 +102,7 @@ def notes_create_operation do tags: ["Admin", "Reports"], summary: "Create report note", operationId: "AdminAPI.ReportController.notes_create", - parameters: [id_param()], + parameters: [id_param() | admin_api_params()], requestBody: request_body("Parameters", %Schema{ type: :object, @@ -124,6 +126,7 @@ def notes_delete_operation do parameters: [ Operation.parameter(:report_id, :path, :string, "Report ID"), Operation.parameter(:id, :path, :string, "Note ID") + | admin_api_params() ], security: [%{"oAuth" => ["write:reports"]}], responses: %{ diff --git a/lib/pleroma/web/api_spec/operations/admin/status_operation.ex b/lib/pleroma/web/api_spec/operations/admin/status_operation.ex index 745399b4b..c105838a4 100644 --- a/lib/pleroma/web/api_spec/operations/admin/status_operation.ex +++ b/lib/pleroma/web/api_spec/operations/admin/status_operation.ex @@ -55,6 +55,7 @@ def index_operation do %Schema{type: :integer, default: 50}, "Number of statuses to return" ) + | admin_api_params() ], responses: %{ 200 => @@ -71,7 +72,7 @@ def show_operation do tags: ["Admin", "Statuses"], summary: "Show Status", operationId: "AdminAPI.StatusController.show", - parameters: [id_param()], + parameters: [id_param() | admin_api_params()], security: [%{"oAuth" => ["read:statuses"]}], responses: %{ 200 => Operation.response("Status", "application/json", status()), @@ -85,7 +86,7 @@ def update_operation do tags: ["Admin", "Statuses"], summary: "Change the scope of an individual reported status", operationId: "AdminAPI.StatusController.update", - parameters: [id_param()], + parameters: [id_param() | admin_api_params()], security: [%{"oAuth" => ["write:statuses"]}], requestBody: request_body("Parameters", update_request(), required: true), responses: %{ @@ -100,7 +101,7 @@ def delete_operation do tags: ["Admin", "Statuses"], summary: "Delete an individual reported status", operationId: "AdminAPI.StatusController.delete", - parameters: [id_param()], + parameters: [id_param() | admin_api_params()], security: [%{"oAuth" => ["write:statuses"]}], responses: %{ 200 => empty_object_response(), diff --git a/lib/pleroma/web/api_spec/operations/chat_operation.ex b/lib/pleroma/web/api_spec/operations/chat_operation.ex index cf299bfc2..b1a0d26ab 100644 --- a/lib/pleroma/web/api_spec/operations/chat_operation.ex +++ b/lib/pleroma/web/api_spec/operations/chat_operation.ex @@ -300,11 +300,11 @@ def chat_messages_response do "content" => "Check this out :firefox:", "id" => "13", "chat_id" => "1", - "actor_id" => "someflakeid", + "account_id" => "someflakeid", "unread" => false }, %{ - "actor_id" => "someflakeid", + "account_id" => "someflakeid", "content" => "Whats' up?", "id" => "12", "chat_id" => "1", diff --git a/lib/pleroma/web/api_spec/operations/domain_block_operation.ex b/lib/pleroma/web/api_spec/operations/domain_block_operation.ex index 049bcf931..1e0da8209 100644 --- a/lib/pleroma/web/api_spec/operations/domain_block_operation.ex +++ b/lib/pleroma/web/api_spec/operations/domain_block_operation.ex @@ -31,6 +31,7 @@ def index_operation do } end + # Supporting domain query parameter is deprecated in Mastodon API def create_operation do %Operation{ tags: ["domain_blocks"], @@ -45,11 +46,13 @@ def create_operation do """, operationId: "DomainBlockController.create", requestBody: domain_block_request(), + parameters: [Operation.parameter(:domain, :query, %Schema{type: :string}, "Domain name")], security: [%{"oAuth" => ["follow", "write:blocks"]}], responses: %{200 => empty_object_response()} } end + # Supporting domain query parameter is deprecated in Mastodon API def delete_operation do %Operation{ tags: ["domain_blocks"], @@ -57,6 +60,7 @@ def delete_operation do description: "Remove a domain block, if it exists in the user's array of blocked domains.", operationId: "DomainBlockController.delete", requestBody: domain_block_request(), + parameters: [Operation.parameter(:domain, :query, %Schema{type: :string}, "Domain name")], security: [%{"oAuth" => ["follow", "write:blocks"]}], responses: %{ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}) @@ -71,10 +75,9 @@ defp domain_block_request do type: :object, properties: %{ domain: %Schema{type: :string} - }, - required: [:domain] + } }, - required: true, + required: false, example: %{ "domain" => "facebook.com" } diff --git a/lib/pleroma/web/api_spec/operations/list_operation.ex b/lib/pleroma/web/api_spec/operations/list_operation.ex index c88ed5dd0..15039052e 100644 --- a/lib/pleroma/web/api_spec/operations/list_operation.ex +++ b/lib/pleroma/web/api_spec/operations/list_operation.ex @@ -114,7 +114,7 @@ def add_to_list_operation do description: "Add accounts to the given list.", operationId: "ListController.add_to_list", parameters: [id_param()], - requestBody: add_remove_accounts_request(), + requestBody: add_remove_accounts_request(true), security: [%{"oAuth" => ["write:lists"]}], responses: %{ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}) @@ -127,8 +127,16 @@ def remove_from_list_operation do tags: ["Lists"], summary: "Remove accounts from list", operationId: "ListController.remove_from_list", - parameters: [id_param()], - requestBody: add_remove_accounts_request(), + parameters: [ + id_param(), + Operation.parameter( + :account_ids, + :query, + %Schema{type: :array, items: %Schema{type: :string}}, + "Array of account IDs" + ) + ], + requestBody: add_remove_accounts_request(false), security: [%{"oAuth" => ["write:lists"]}], responses: %{ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}) @@ -171,7 +179,7 @@ defp create_update_request do ) end - defp add_remove_accounts_request do + defp add_remove_accounts_request(required) when is_boolean(required) do request_body( "Parameters", %Schema{ @@ -180,9 +188,9 @@ defp add_remove_accounts_request do properties: %{ account_ids: %Schema{type: :array, description: "Array of account IDs", items: FlakeID} }, - required: [:account_ids] + required: required && [:account_ids] }, - required: true + required: required ) end end diff --git a/lib/pleroma/web/api_spec/operations/notification_operation.ex b/lib/pleroma/web/api_spec/operations/notification_operation.ex index c966b553a..f09be64cb 100644 --- a/lib/pleroma/web/api_spec/operations/notification_operation.ex +++ b/lib/pleroma/web/api_spec/operations/notification_operation.ex @@ -163,6 +163,13 @@ def notification do description: "Status that was the object of the notification, e.g. in mentions, reblogs, favourites, or polls.", nullable: true + }, + pleroma: %Schema{ + type: :object, + properties: %{ + is_seen: %Schema{type: :boolean}, + is_muted: %Schema{type: :boolean} + } } }, example: %{ @@ -170,7 +177,8 @@ def notification do "type" => "mention", "created_at" => "2019-11-23T07:49:02.064Z", "account" => Account.schema().example, - "status" => Status.schema().example + "status" => Status.schema().example, + "pleroma" => %{"is_seen" => false, "is_muted" => false} } } end @@ -183,7 +191,6 @@ defp notification_type do "favourite", "reblog", "mention", - "poll", "pleroma:emoji_reaction", "pleroma:chat_mention", "move", diff --git a/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex b/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex index 90922c064..97836b2eb 100644 --- a/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex +++ b/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex @@ -4,7 +4,6 @@ defmodule Pleroma.Web.ApiSpec.PleromaAccountOperation do alias OpenApiSpex.Operation - alias OpenApiSpex.Schema alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship alias Pleroma.Web.ApiSpec.Schemas.ApiError alias Pleroma.Web.ApiSpec.Schemas.FlakeID @@ -40,48 +39,6 @@ def confirmation_resend_operation do } end - def update_avatar_operation do - %Operation{ - tags: ["Accounts"], - summary: "Set/clear user avatar image", - operationId: "PleromaAPI.AccountController.update_avatar", - requestBody: - request_body("Parameters", update_avatar_or_background_request(), required: true), - security: [%{"oAuth" => ["write:accounts"]}], - responses: %{ - 200 => update_response(), - 403 => Operation.response("Forbidden", "application/json", ApiError) - } - } - end - - def update_banner_operation do - %Operation{ - tags: ["Accounts"], - summary: "Set/clear user banner image", - operationId: "PleromaAPI.AccountController.update_banner", - requestBody: request_body("Parameters", update_banner_request(), required: true), - security: [%{"oAuth" => ["write:accounts"]}], - responses: %{ - 200 => update_response() - } - } - end - - def update_background_operation do - %Operation{ - tags: ["Accounts"], - summary: "Set/clear user background image", - operationId: "PleromaAPI.AccountController.update_background", - security: [%{"oAuth" => ["write:accounts"]}], - requestBody: - request_body("Parameters", update_avatar_or_background_request(), required: true), - responses: %{ - 200 => update_response() - } - } - end - def favourites_operation do %Operation{ tags: ["Accounts"], @@ -136,52 +93,4 @@ defp id_param do required: true ) end - - defp update_avatar_or_background_request do - %Schema{ - title: "PleromaAccountUpdateAvatarOrBackgroundRequest", - type: :object, - properties: %{ - img: %Schema{ - nullable: true, - type: :string, - format: :binary, - description: "Image encoded using `multipart/form-data` or an empty string to clear" - } - } - } - end - - defp update_banner_request do - %Schema{ - title: "PleromaAccountUpdateBannerRequest", - type: :object, - properties: %{ - banner: %Schema{ - type: :string, - nullable: true, - format: :binary, - description: "Image encoded using `multipart/form-data` or an empty string to clear" - } - } - } - end - - defp update_response do - Operation.response("PleromaAccountUpdateResponse", "application/json", %Schema{ - type: :object, - properties: %{ - url: %Schema{ - type: :string, - format: :uri, - nullable: true, - description: "Image URL" - } - }, - example: %{ - "url" => - "https://cofe.party/media/9d0add56-bcb6-4c0f-8225-cbbd0b6dd773/13eadb6972c9ccd3f4ffa3b8196f0e0d38b4d2f27594457c52e52946c054cd9a.gif" - } - }) - end end diff --git a/lib/pleroma/web/api_spec/operations/pleroma_emoji_pack_operation.ex b/lib/pleroma/web/api_spec/operations/pleroma_emoji_pack_operation.ex index 567688ff5..b2b4f8713 100644 --- a/lib/pleroma/web/api_spec/operations/pleroma_emoji_pack_operation.ex +++ b/lib/pleroma/web/api_spec/operations/pleroma_emoji_pack_operation.ex @@ -33,6 +33,20 @@ def index_operation do tags: ["Emoji Packs"], summary: "Lists local custom emoji packs", operationId: "PleromaAPI.EmojiPackController.index", + parameters: [ + Operation.parameter( + :page, + :query, + %Schema{type: :integer, default: 1}, + "Page" + ), + Operation.parameter( + :page_size, + :query, + %Schema{type: :integer, default: 50}, + "Number of emoji packs to return" + ) + ], responses: %{ 200 => emoji_packs_response() } @@ -44,7 +58,21 @@ def show_operation do tags: ["Emoji Packs"], summary: "Show emoji pack", operationId: "PleromaAPI.EmojiPackController.show", - parameters: [name_param()], + parameters: [ + name_param(), + Operation.parameter( + :page, + :query, + %Schema{type: :integer, default: 1}, + "Page" + ), + Operation.parameter( + :page_size, + :query, + %Schema{type: :integer, default: 30}, + "Number of emoji to return" + ) + ], responses: %{ 200 => Operation.response("Emoji Pack", "application/json", emoji_pack()), 400 => Operation.response("Bad Request", "application/json", ApiError), diff --git a/lib/pleroma/web/api_spec/operations/status_operation.ex b/lib/pleroma/web/api_spec/operations/status_operation.ex index 0b7fad793..5bd4619d5 100644 --- a/lib/pleroma/web/api_spec/operations/status_operation.ex +++ b/lib/pleroma/web/api_spec/operations/status_operation.ex @@ -84,7 +84,7 @@ def delete_operation do operationId: "StatusController.delete", parameters: [id_param()], responses: %{ - 200 => empty_object_response(), + 200 => status_response(), 403 => Operation.response("Forbidden", "application/json", ApiError), 404 => Operation.response("Not Found", "application/json", ApiError) } diff --git a/lib/pleroma/web/api_spec/schemas/account.ex b/lib/pleroma/web/api_spec/schemas/account.ex index d54e2158d..ca79f0747 100644 --- a/lib/pleroma/web/api_spec/schemas/account.ex +++ b/lib/pleroma/web/api_spec/schemas/account.ex @@ -40,33 +40,72 @@ defmodule Pleroma.Web.ApiSpec.Schemas.Account do pleroma: %Schema{ type: :object, properties: %{ - allow_following_move: %Schema{type: :boolean}, - background_image: %Schema{type: :string, nullable: true}, + allow_following_move: %Schema{ + type: :boolean, + description: "whether the user allows automatically follow moved following accounts" + }, + background_image: %Schema{type: :string, nullable: true, format: :uri}, chat_token: %Schema{type: :string}, - confirmation_pending: %Schema{type: :boolean}, + confirmation_pending: %Schema{ + type: :boolean, + description: + "whether the user account is waiting on email confirmation to be activated" + }, hide_favorites: %Schema{type: :boolean}, - hide_followers_count: %Schema{type: :boolean}, - hide_followers: %Schema{type: :boolean}, - hide_follows_count: %Schema{type: :boolean}, - hide_follows: %Schema{type: :boolean}, - is_admin: %Schema{type: :boolean}, - is_moderator: %Schema{type: :boolean}, + hide_followers_count: %Schema{ + type: :boolean, + description: "whether the user has follower stat hiding enabled" + }, + hide_followers: %Schema{ + type: :boolean, + description: "whether the user has follower hiding enabled" + }, + hide_follows_count: %Schema{ + type: :boolean, + description: "whether the user has follow stat hiding enabled" + }, + hide_follows: %Schema{ + type: :boolean, + description: "whether the user has follow hiding enabled" + }, + is_admin: %Schema{ + type: :boolean, + description: "whether the user is an admin of the local instance" + }, + is_moderator: %Schema{ + type: :boolean, + description: "whether the user is a moderator of the local instance" + }, skip_thread_containment: %Schema{type: :boolean}, - tags: %Schema{type: :array, items: %Schema{type: :string}}, - unread_conversation_count: %Schema{type: :integer}, + tags: %Schema{ + type: :array, + items: %Schema{type: :string}, + description: + "List of tags being used for things like extra roles or moderation(ie. marking all media as nsfw all)." + }, + unread_conversation_count: %Schema{ + type: :integer, + description: "The count of unread conversations. Only returned to the account owner." + }, notification_settings: %Schema{ type: :object, properties: %{ - followers: %Schema{type: :boolean}, - follows: %Schema{type: :boolean}, - non_followers: %Schema{type: :boolean}, - non_follows: %Schema{type: :boolean}, - privacy_option: %Schema{type: :boolean} + block_from_strangers: %Schema{type: :boolean}, + hide_notification_contents: %Schema{type: :boolean} } }, relationship: AccountRelationship, settings_store: %Schema{ - type: :object + type: :object, + description: + "A generic map of settings for frontends. Opaque to the backend. Only returned in `verify_credentials` and `update_credentials`" + }, + accepts_chat_messages: %Schema{type: :boolean, nullable: true}, + favicon: %Schema{ + type: :string, + format: :uri, + nullable: true, + description: "Favicon image of the user's instance" } } }, @@ -74,16 +113,32 @@ defmodule Pleroma.Web.ApiSpec.Schemas.Account do type: :object, properties: %{ fields: %Schema{type: :array, items: AccountField}, - note: %Schema{type: :string}, + note: %Schema{ + type: :string, + description: + "Plaintext version of the bio without formatting applied by the backend, used for editing the bio." + }, privacy: VisibilityScope, sensitive: %Schema{type: :boolean}, pleroma: %Schema{ type: :object, properties: %{ actor_type: ActorType, - discoverable: %Schema{type: :boolean}, - no_rich_text: %Schema{type: :boolean}, - show_role: %Schema{type: :boolean} + discoverable: %Schema{ + type: :boolean, + description: + "whether the user allows discovery of the account in search results and other services." + }, + no_rich_text: %Schema{ + type: :boolean, + description: + "whether the HTML tags for rich-text formatting are stripped from all statuses requested from the API." + }, + show_role: %Schema{ + type: :boolean, + description: + "whether the user wants their role (e.g admin, moderator) to be shown" + } } } } @@ -118,16 +173,14 @@ defmodule Pleroma.Web.ApiSpec.Schemas.Account do "is_admin" => false, "is_moderator" => false, "skip_thread_containment" => false, + "accepts_chat_messages" => true, "chat_token" => "SFMyNTY.g3QAAAACZAAEZGF0YW0AAAASOXRLaTNlc2JHN09RZ1oyOTIwZAAGc2lnbmVkbgYARNplS3EB.Mb_Iaqew2bN1I1o79B_iP7encmVCpTKC4OtHZRxdjKc", "unread_conversation_count" => 0, "tags" => [], "notification_settings" => %{ - "followers" => true, - "follows" => true, - "non_followers" => true, - "non_follows" => true, - "privacy_option" => false + "block_from_strangers" => false, + "hide_notification_contents" => false }, "relationship" => %{ "blocked_by" => false, diff --git a/lib/pleroma/web/api_spec/schemas/chat_message.ex b/lib/pleroma/web/api_spec/schemas/chat_message.ex index 3ee85aa76..bbf2a4427 100644 --- a/lib/pleroma/web/api_spec/schemas/chat_message.ex +++ b/lib/pleroma/web/api_spec/schemas/chat_message.ex @@ -19,13 +19,46 @@ defmodule Pleroma.Web.ApiSpec.Schemas.ChatMessage do content: %Schema{type: :string, nullable: true}, created_at: %Schema{type: :string, format: :"date-time"}, emojis: %Schema{type: :array}, - attachment: %Schema{type: :object, nullable: true} + attachment: %Schema{type: :object, nullable: true}, + card: %Schema{ + type: :object, + nullable: true, + description: "Preview card for links included within status content", + required: [:url, :title, :description, :type], + properties: %{ + type: %Schema{ + type: :string, + enum: ["link", "photo", "video", "rich"], + description: "The type of the preview card" + }, + provider_name: %Schema{ + type: :string, + nullable: true, + description: "The provider of the original resource" + }, + provider_url: %Schema{ + type: :string, + format: :uri, + description: "A link to the provider of the original resource" + }, + url: %Schema{type: :string, format: :uri, description: "Location of linked resource"}, + image: %Schema{ + type: :string, + nullable: true, + format: :uri, + description: "Preview thumbnail" + }, + title: %Schema{type: :string, description: "Title of linked resource"}, + description: %Schema{type: :string, description: "Description of preview"} + } + } }, example: %{ "account_id" => "someflakeid", "chat_id" => "1", "content" => "hey you again", "created_at" => "2020-04-21T15:06:45.000Z", + "card" => nil, "emojis" => [ %{ "static_url" => "https://dontbulling.me/emoji/Firefox.gif", diff --git a/lib/pleroma/web/api_spec/schemas/status.ex b/lib/pleroma/web/api_spec/schemas/status.ex index 8b87cb25b..947e42890 100644 --- a/lib/pleroma/web/api_spec/schemas/status.ex +++ b/lib/pleroma/web/api_spec/schemas/status.ex @@ -62,6 +62,11 @@ defmodule Pleroma.Web.ApiSpec.Schemas.Status do } }, content: %Schema{type: :string, format: :html, description: "HTML-encoded status content"}, + text: %Schema{ + type: :string, + description: "Original unformatted content in plain text", + nullable: true + }, created_at: %Schema{ type: :string, format: "date-time", @@ -184,6 +189,10 @@ defmodule Pleroma.Web.ApiSpec.Schemas.Status do thread_muted: %Schema{ type: :boolean, description: "`true` if the thread the post belongs to is muted" + }, + parent_visible: %Schema{ + type: :boolean, + description: "`true` if the parent post is visible to the user" } } }, diff --git a/lib/pleroma/web/auth/ldap_authenticator.ex b/lib/pleroma/web/auth/ldap_authenticator.ex index f63a66c03..402ab428b 100644 --- a/lib/pleroma/web/auth/ldap_authenticator.ex +++ b/lib/pleroma/web/auth/ldap_authenticator.ex @@ -28,10 +28,6 @@ def get_user(%Plug.Conn{} = conn) do %User{} = user <- ldap_user(name, password) do {:ok, user} else - {:error, {:ldap_connection_error, _}} -> - # When LDAP is unavailable, try default authenticator - @base.get_user(conn) - {:ldap, _} -> @base.get_user(conn) @@ -92,7 +88,7 @@ defp bind_user(connection, ldap, name, password) do user _ -> - register_user(connection, base, uid, name, password) + register_user(connection, base, uid, name) end error -> @@ -100,34 +96,31 @@ defp bind_user(connection, ldap, name, password) do end end - defp register_user(connection, base, uid, name, password) do + defp register_user(connection, base, uid, name) do case :eldap.search(connection, [ {:base, to_charlist(base)}, {:filter, :eldap.equalityMatch(to_charlist(uid), to_charlist(name))}, {:scope, :eldap.wholeSubtree()}, - {:attributes, ['mail', 'email']}, {:timeout, @search_timeout} ]) do {:ok, {:eldap_search_result, [{:eldap_entry, _, attributes}], _}} -> - with {_, [mail]} <- List.keyfind(attributes, 'mail', 0) do - params = %{ - email: :erlang.list_to_binary(mail), - name: name, - nickname: name, - password: password, - password_confirmation: password - } + params = %{ + name: name, + nickname: name, + password: nil + } - changeset = User.register_changeset(%User{}, params) - - case User.register(changeset) do - {:ok, user} -> user - error -> error + params = + case List.keyfind(attributes, 'mail', 0) do + {_, [mail]} -> Map.put_new(params, :email, :erlang.list_to_binary(mail)) + _ -> params end - else - _ -> - Logger.error("Could not find LDAP attribute mail: #{inspect(attributes)}") - {:error, :ldap_registration_missing_attributes} + + changeset = User.register_changeset_ldap(%User{}, params) + + case User.register(changeset) do + {:ok, user} -> user + error -> error end error -> diff --git a/lib/pleroma/web/auth/pleroma_authenticator.ex b/lib/pleroma/web/auth/pleroma_authenticator.ex index 200ca03dc..c611b3e09 100644 --- a/lib/pleroma/web/auth/pleroma_authenticator.ex +++ b/lib/pleroma/web/auth/pleroma_authenticator.ex @@ -68,7 +68,7 @@ def create_from_registration( nickname = value([registration_attrs["nickname"], Registration.nickname(registration)]) email = value([registration_attrs["email"], Registration.email(registration)]) name = value([registration_attrs["name"], Registration.name(registration)]) || nickname - bio = value([registration_attrs["bio"], Registration.description(registration)]) + bio = value([registration_attrs["bio"], Registration.description(registration)]) || "" random_password = :crypto.strong_rand_bytes(64) |> Base.encode64() diff --git a/lib/pleroma/web/chat_channel.ex b/lib/pleroma/web/chat_channel.ex index bce27897f..3b1469c19 100644 --- a/lib/pleroma/web/chat_channel.ex +++ b/lib/pleroma/web/chat_channel.ex @@ -4,8 +4,10 @@ defmodule Pleroma.Web.ChatChannel do use Phoenix.Channel + alias Pleroma.User alias Pleroma.Web.ChatChannel.ChatChannelState + alias Pleroma.Web.MastodonAPI.AccountView def join("chat:public", _message, socket) do send(self(), :after_join) @@ -22,9 +24,9 @@ def handle_in("new_msg", %{"text" => text}, %{assigns: %{user_name: user_name}} if String.length(text) in 1..Pleroma.Config.get([:instance, :chat_limit]) do author = User.get_cached_by_nickname(user_name) - author = Pleroma.Web.MastodonAPI.AccountView.render("show.json", user: author) + author_json = AccountView.render("show.json", user: author, skip_visibility_check: true) - message = ChatChannelState.add_message(%{text: text, author: author}) + message = ChatChannelState.add_message(%{text: text, author: author_json}) broadcast!(socket, "new_msg", message) end diff --git a/lib/pleroma/web/common_api/activity_draft.ex b/lib/pleroma/web/common_api/activity_draft.ex index 9bcb9f587..548f76609 100644 --- a/lib/pleroma/web/common_api/activity_draft.ex +++ b/lib/pleroma/web/common_api/activity_draft.ex @@ -186,6 +186,7 @@ defp object(draft) do draft.poll ) |> Map.put("emoji", emoji) + |> Map.put("source", draft.status) %__MODULE__{draft | object: object} end @@ -201,7 +202,7 @@ defp changes(draft) do additional = case draft.expires_at do - %NaiveDateTime{} = expires_at -> Map.put(additional, "expires_at", expires_at) + %DateTime{} = expires_at -> Map.put(additional, "expires_at", expires_at) _ -> additional end diff --git a/lib/pleroma/web/common_api/common_api.ex b/lib/pleroma/web/common_api/common_api.ex index 04e081a8e..500c3883e 100644 --- a/lib/pleroma/web/common_api/common_api.ex +++ b/lib/pleroma/web/common_api/common_api.ex @@ -4,11 +4,8 @@ defmodule Pleroma.Web.CommonAPI do alias Pleroma.Activity - alias Pleroma.ActivityExpiration alias Pleroma.Conversation.Participation - alias Pleroma.FollowingRelationship alias Pleroma.Formatter - alias Pleroma.Notification alias Pleroma.Object alias Pleroma.ThreadMute alias Pleroma.User @@ -25,6 +22,13 @@ defmodule Pleroma.Web.CommonAPI do require Pleroma.Constants require Logger + def block(blocker, blocked) do + with {:ok, block_data, _} <- Builder.block(blocker, blocked), + {:ok, block, _} <- Pipeline.common_pipeline(block_data, local: true) do + {:ok, block} + end + end + def post_chat_message(%User{} = user, %User{} = recipient, content, opts \\ []) do with maybe_attachment <- opts[:media_id] && Object.get_by_id(opts[:media_id]), :ok <- validate_chat_content_length(content, !!maybe_attachment), @@ -94,10 +98,14 @@ def unblock(blocker, blocked) do def follow(follower, followed) do timeout = Pleroma.Config.get([:activitypub, :follow_handshake_timeout]) - with {:ok, follower} <- User.maybe_direct_follow(follower, followed), - {:ok, activity} <- ActivityPub.follow(follower, followed), + with {:ok, follow_data, _} <- Builder.follow(follower, followed), + {:ok, activity, _} <- Pipeline.common_pipeline(follow_data, local: true), {:ok, follower, followed} <- User.wait_and_refresh(timeout, follower, followed) do - {:ok, follower, followed, activity} + if activity.data["state"] == "reject" do + {:error, :rejected} + else + {:ok, follower, followed, activity} + end end end @@ -111,33 +119,16 @@ def unfollow(follower, unfollowed) do def accept_follow_request(follower, followed) do with %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed), - {:ok, follower} <- User.follow(follower, followed), - {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "accept"), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_accept), - {:ok, _activity} <- - ActivityPub.accept(%{ - to: [follower.ap_id], - actor: followed, - object: follow_activity.data["id"], - type: "Accept" - }) do - Notification.update_notification_type(followed, follow_activity) + {:ok, accept_data, _} <- Builder.accept(followed, follow_activity), + {:ok, _activity, _} <- Pipeline.common_pipeline(accept_data, local: true) do {:ok, follower} end end def reject_follow_request(follower, followed) do with %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed), - {:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "reject"), - {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_reject), - {:ok, _notifications} <- Notification.dismiss(follow_activity), - {:ok, _activity} <- - ActivityPub.reject(%{ - to: [follower.ap_id], - actor: followed, - object: follow_activity.data["id"], - type: "Reject" - }) do + {:ok, reject_data, _} <- Builder.reject(followed, follow_activity), + {:ok, _activity, _} <- Pipeline.common_pipeline(reject_data, local: true) do {:ok, follower} end end @@ -297,18 +288,19 @@ def vote(user, %{data: %{"type" => "Question"}} = object, choices) do {:ok, options, choices} <- normalize_and_validate_choices(choices, object) do answer_activities = Enum.map(choices, fn index -> - answer_data = make_answer_data(user, object, Enum.at(options, index)["name"]) + {:ok, answer_object, _meta} = + Builder.answer(user, object, Enum.at(options, index)["name"]) - {:ok, activity} = - ActivityPub.create(%{ - to: answer_data["to"], - actor: user, - context: object.data["context"], - object: answer_data, - additional: %{"cc" => answer_data["cc"]} - }) + {:ok, activity_data, _meta} = Builder.create(user, answer_object, []) - activity + {:ok, activity, _meta} = + activity_data + |> Map.put("cc", answer_object["cc"]) + |> Map.put("context", answer_object["context"]) + |> Pipeline.common_pipeline(local: true) + + # TODO: Do preload of Pleroma.Object in Pipeline + Activity.normalize(activity.data) end) object = Object.get_cached_by_ap_id(object.data["id"]) @@ -329,8 +321,13 @@ defp validate_existing_votes(%{ap_id: ap_id}, object) do end end - defp get_options_and_max_count(%{data: %{"anyOf" => any_of}}), do: {any_of, Enum.count(any_of)} - defp get_options_and_max_count(%{data: %{"oneOf" => one_of}}), do: {one_of, 1} + defp get_options_and_max_count(%{data: %{"anyOf" => any_of}}) + when is_list(any_of) and any_of != [], + do: {any_of, Enum.count(any_of)} + + defp get_options_and_max_count(%{data: %{"oneOf" => one_of}}) + when is_list(one_of) and one_of != [], + do: {one_of, 1} defp normalize_and_validate_choices(choices, object) do choices = Enum.map(choices, fn i -> if is_binary(i), do: String.to_integer(i), else: i end) @@ -383,9 +380,9 @@ def get_replied_to_visibility(activity) do def check_expiry_date({:ok, nil} = res), do: res def check_expiry_date({:ok, in_seconds}) do - expiry = NaiveDateTime.utc_now() |> NaiveDateTime.add(in_seconds) + expiry = DateTime.add(DateTime.utc_now(), in_seconds) - if ActivityExpiration.expires_late_enough?(expiry) do + if Pleroma.Workers.PurgeExpiredActivity.expires_late_enough?(expiry) do {:ok, expiry} else {:error, "Expiry date is too soon"} @@ -454,7 +451,8 @@ def unpin(id, user) do end def add_mute(user, activity) do - with {:ok, _} <- ThreadMute.add_mute(user.id, activity.data["context"]) do + with {:ok, _} <- ThreadMute.add_mute(user.id, activity.data["context"]), + _ <- Pleroma.Notification.mark_context_as_read(user, activity.data["context"]) do {:ok, activity} else {:error, _} -> {:error, dgettext("errors", "conversation is already muted")} @@ -467,7 +465,7 @@ def remove_mute(user, activity) do end def thread_muted?(%User{id: user_id}, %{data: %{"context" => context}}) - when is_binary("context") do + when is_binary(context) do ThreadMute.exists?(user_id, context) end diff --git a/lib/pleroma/web/common_api/utils.ex b/lib/pleroma/web/common_api/utils.ex index 15594125f..9d7b24eb2 100644 --- a/lib/pleroma/web/common_api/utils.ex +++ b/lib/pleroma/web/common_api/utils.ex @@ -143,7 +143,7 @@ def make_poll_data(%{"poll" => %{"expires_in" => expires_in}} = data) def make_poll_data(%{poll: %{options: options, expires_in: expires_in}} = data) when is_list(options) do - limits = Pleroma.Config.get([:instance, :poll_limits]) + limits = Config.get([:instance, :poll_limits]) with :ok <- validate_poll_expiration(expires_in, limits), :ok <- validate_poll_options_amount(options, limits), @@ -502,7 +502,7 @@ def maybe_extract_mentions(_), do: [] def make_report_content_html(nil), do: {:ok, {nil, [], []}} def make_report_content_html(comment) do - max_size = Pleroma.Config.get([:instance, :max_report_comment_size], 1000) + max_size = Config.get([:instance, :max_report_comment_size], 1000) if String.length(comment) <= max_size do {:ok, format_input(comment, "text/plain")} @@ -548,23 +548,12 @@ def conversation_id_to_context(id) do end end - def make_answer_data(%User{ap_id: ap_id}, object, name) do - %{ - "type" => "Answer", - "actor" => ap_id, - "cc" => [object.data["actor"]], - "to" => [], - "name" => name, - "inReplyTo" => object.data["id"] - } - end - def validate_character_limit("" = _full_payload, [] = _attachments) do {:error, dgettext("errors", "Cannot post an empty status without attachments")} end def validate_character_limit(full_payload, _attachments) do - limit = Pleroma.Config.get([:instance, :limit]) + limit = Config.get([:instance, :limit]) length = String.length(full_payload) if length <= limit do diff --git a/lib/pleroma/web/controller_helper.ex b/lib/pleroma/web/controller_helper.ex index 69946fb81..6445966e0 100644 --- a/lib/pleroma/web/controller_helper.ex +++ b/lib/pleroma/web/controller_helper.ex @@ -18,6 +18,12 @@ def falsy_param?(value), def truthy_param?(value), do: not falsy_param?(value) + def json_response(conn, status, _) when status in [204, :no_content] do + conn + |> put_resp_header("content-type", "application/json") + |> send_resp(status, "") + end + def json_response(conn, status, json) do conn |> put_status(status) diff --git a/lib/pleroma/web/endpoint.ex b/lib/pleroma/web/endpoint.ex index 226d42c2c..8b153763d 100644 --- a/lib/pleroma/web/endpoint.ex +++ b/lib/pleroma/web/endpoint.ex @@ -28,6 +28,29 @@ defmodule Pleroma.Web.Endpoint do } ) + # Careful! No `only` restriction here, as we don't know what frontends contain. + plug(Pleroma.Plugs.FrontendStatic, + at: "/", + frontend_type: :primary, + gzip: true, + cache_control_for_etags: @static_cache_control, + headers: %{ + "cache-control" => @static_cache_control + } + ) + + plug(Plug.Static.IndexHtml, at: "/pleroma/admin/") + + plug(Pleroma.Plugs.FrontendStatic, + at: "/pleroma/admin", + frontend_type: :admin, + gzip: true, + cache_control_for_etags: @static_cache_control, + headers: %{ + "cache-control" => @static_cache_control + } + ) + # Serve at "/" the static files from "priv/static" directory. # # You should set gzip to true if you are running phoenix.digest @@ -45,8 +68,6 @@ defmodule Pleroma.Web.Endpoint do } ) - plug(Plug.Static.IndexHtml, at: "/pleroma/admin/") - plug(Plug.Static, at: "/pleroma/admin/", from: {:pleroma, "priv/static/adminfe/"} diff --git a/lib/pleroma/web/fallback_redirect_controller.ex b/lib/pleroma/web/fallback_redirect_controller.ex index 0d9d578fc..431ad5485 100644 --- a/lib/pleroma/web/fallback_redirect_controller.ex +++ b/lib/pleroma/web/fallback_redirect_controller.ex @@ -9,6 +9,7 @@ defmodule Fallback.RedirectController do alias Pleroma.User alias Pleroma.Web.Metadata + alias Pleroma.Web.Preload def api_not_implemented(conn, _params) do conn @@ -16,16 +17,7 @@ def api_not_implemented(conn, _params) do |> json(%{error: "Not implemented"}) end - def redirector(conn, _params, code \\ 200) - - # redirect to admin section - # /pleroma/admin -> /pleroma/admin/ - # - def redirector(conn, %{"path" => ["pleroma", "admin"]} = _, _code) do - redirect(conn, to: "/pleroma/admin/") - end - - def redirector(conn, _params, code) do + def redirector(conn, _params, code \\ 200) do conn |> put_resp_content_type("text/html") |> send_file(code, index_file_path()) @@ -43,28 +35,33 @@ def redirector_with_meta(conn, %{"maybe_nickname_or_id" => maybe_nickname_or_id} def redirector_with_meta(conn, params) do {:ok, index_content} = File.read(index_file_path()) - tags = - try do - Metadata.build_tags(params) - rescue - e -> - Logger.error( - "Metadata rendering for #{conn.request_path} failed.\n" <> - Exception.format(:error, e, __STACKTRACE__) - ) + tags = build_tags(conn, params) + preloads = preload_data(conn, params) - "" - end - - response = String.replace(index_content, "", tags) + response = + index_content + |> String.replace("", tags <> preloads) conn |> put_resp_content_type("text/html") |> send_resp(200, response) end - def index_file_path do - Pleroma.Plugs.InstanceStatic.file_path("index.html") + def redirector_with_preload(conn, %{"path" => ["pleroma", "admin"]}) do + redirect(conn, to: "/pleroma/admin/") + end + + def redirector_with_preload(conn, params) do + {:ok, index_content} = File.read(index_file_path()) + preloads = preload_data(conn, params) + + response = + index_content + |> String.replace("", preloads) + + conn + |> put_resp_content_type("text/html") + |> send_resp(200, response) end def registration_page(conn, params) do @@ -76,4 +73,36 @@ def empty(conn, _params) do |> put_status(204) |> text("") end + + defp index_file_path do + Pleroma.Plugs.InstanceStatic.file_path("index.html") + end + + defp build_tags(conn, params) do + try do + Metadata.build_tags(params) + rescue + e -> + Logger.error( + "Metadata rendering for #{conn.request_path} failed.\n" <> + Exception.format(:error, e, __STACKTRACE__) + ) + + "" + end + end + + defp preload_data(conn, params) do + try do + Preload.build_tags(conn, params) + rescue + e -> + Logger.error( + "Preloading for #{conn.request_path} failed.\n" <> + Exception.format(:error, e, __STACKTRACE__) + ) + + "" + end + end end diff --git a/lib/pleroma/web/feed/tag_controller.ex b/lib/pleroma/web/feed/tag_controller.ex index 39b2a766a..93a8294b7 100644 --- a/lib/pleroma/web/feed/tag_controller.ex +++ b/lib/pleroma/web/feed/tag_controller.ex @@ -9,7 +9,15 @@ defmodule Pleroma.Web.Feed.TagController do alias Pleroma.Web.ActivityPub.ActivityPub alias Pleroma.Web.Feed.FeedView - def feed(conn, %{"tag" => raw_tag} = params) do + def feed(conn, params) do + unless Pleroma.Config.restrict_unauthenticated_access?(:activities, :local) do + render_feed(conn, params) + else + render_error(conn, :not_found, "Not found") + end + end + + def render_feed(conn, %{"tag" => raw_tag} = params) do {format, tag} = parse_tag(raw_tag) activities = diff --git a/lib/pleroma/web/feed/user_controller.ex b/lib/pleroma/web/feed/user_controller.ex index d56f43818..71eb1ea7e 100644 --- a/lib/pleroma/web/feed/user_controller.ex +++ b/lib/pleroma/web/feed/user_controller.ex @@ -37,7 +37,15 @@ def feed_redirect(conn, %{"nickname" => nickname}) do end end - def feed(conn, %{"nickname" => nickname} = params) do + def feed(conn, params) do + unless Pleroma.Config.restrict_unauthenticated_access?(:profiles, :local) do + render_feed(conn, params) + else + errors(conn, {:error, :not_found}) + end + end + + def render_feed(conn, %{"nickname" => nickname} = params) do format = get_format(conn) format = @@ -47,7 +55,7 @@ def feed(conn, %{"nickname" => nickname} = params) do "atom" end - with {_, %User{} = user} <- {:fetch_user, User.get_cached_by_nickname(nickname)} do + with {_, %User{local: true} = user} <- {:fetch_user, User.get_cached_by_nickname(nickname)} do activities = %{ type: ["Create"], @@ -71,6 +79,7 @@ def errors(conn, {:error, :not_found}) do render_error(conn, :not_found, "Not found") end + def errors(conn, {:fetch_user, %User{local: false}}), do: errors(conn, {:error, :not_found}) def errors(conn, {:fetch_user, nil}), do: errors(conn, {:error, :not_found}) def errors(conn, _) do diff --git a/lib/pleroma/web/masto_fe_controller.ex b/lib/pleroma/web/masto_fe_controller.ex index d0d8bc8eb..43ec70021 100644 --- a/lib/pleroma/web/masto_fe_controller.ex +++ b/lib/pleroma/web/masto_fe_controller.ex @@ -49,7 +49,7 @@ def manifest(conn, _params) do |> render("manifest.json") end - @doc "PUT /api/web/settings" + @doc "PUT /api/web/settings: Backend-obscure settings blob for MastoFE, don't parse/reuse elsewhere" def put_settings(%{assigns: %{user: user}} = conn, %{"data" => settings} = _params) do with {:ok, _} <- User.mastodon_settings_update(user, settings) do json(conn, %{}) diff --git a/lib/pleroma/web/mastodon_api/controllers/account_controller.ex b/lib/pleroma/web/mastodon_api/controllers/account_controller.ex index 7cdd8f458..95d8452df 100644 --- a/lib/pleroma/web/mastodon_api/controllers/account_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/account_controller.ex @@ -20,12 +20,15 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do alias Pleroma.Plugs.RateLimiter alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.Pipeline alias Pleroma.Web.CommonAPI alias Pleroma.Web.MastodonAPI.ListView alias Pleroma.Web.MastodonAPI.MastodonAPI alias Pleroma.Web.MastodonAPI.MastodonAPIController alias Pleroma.Web.MastodonAPI.StatusView - alias Pleroma.Web.OAuth.Token + alias Pleroma.Web.OAuth.OAuthController + alias Pleroma.Web.OAuth.OAuthView alias Pleroma.Web.TwitterAPI.TwitterAPI plug(Pleroma.Web.ApiSpec.CastAndValidate) @@ -97,16 +100,34 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do def create(%{assigns: %{app: app}, body_params: params} = conn, _params) do with :ok <- validate_email_param(params), :ok <- TwitterAPI.validate_captcha(app, params), - {:ok, user} <- TwitterAPI.register_user(params, need_confirmation: true), - {:ok, token} <- Token.create_token(app, user, %{scopes: app.scopes}) do - json(conn, %{ - token_type: "Bearer", - access_token: token.token, - scope: app.scopes, - created_at: Token.Utils.format_created_at(token) - }) + {:ok, user} <- TwitterAPI.register_user(params), + {_, {:ok, token}} <- + {:login, OAuthController.login(user, app, app.scopes)} do + json(conn, OAuthView.render("token.json", %{user: user, token: token})) else - {:error, error} -> json_response(conn, :bad_request, %{error: error}) + {:login, {:account_status, :confirmation_pending}} -> + json_response(conn, :ok, %{ + message: "You have been registered. Please check your email for further instructions.", + identifier: "missing_confirmed_email" + }) + + {:login, {:account_status, :approval_pending}} -> + json_response(conn, :ok, %{ + message: + "You have been registered. You'll be able to log in once your account is approved.", + identifier: "awaiting_approval" + }) + + {:login, _} -> + json_response(conn, :ok, %{ + message: + "You have been registered. Some post-registration steps may be pending. " <> + "Please log in manually.", + identifier: "manual_login_required" + }) + + {:error, error} -> + json_response(conn, :bad_request, %{error: error}) end end @@ -146,6 +167,13 @@ def update_credentials(%{assigns: %{user: user}, body_params: params} = conn, _p |> Enum.filter(fn {_, value} -> not is_nil(value) end) |> Enum.into(%{}) + # We use an empty string as a special value to reset + # avatars, banners, backgrounds + user_image_value = fn + "" -> {:ok, nil} + value -> {:ok, value} + end + user_params = [ :no_rich_text, @@ -158,16 +186,18 @@ def update_credentials(%{assigns: %{user: user}, body_params: params} = conn, _p :show_role, :skip_thread_containment, :allow_following_move, - :discoverable + :discoverable, + :accepts_chat_messages ] |> Enum.reduce(%{}, fn key, acc -> Maps.put_if_present(acc, key, params[key], &{:ok, truthy_param?(&1)}) end) |> Maps.put_if_present(:name, params[:display_name]) |> Maps.put_if_present(:bio, params[:note]) - |> Maps.put_if_present(:avatar, params[:avatar]) - |> Maps.put_if_present(:banner, params[:header]) - |> Maps.put_if_present(:background, params[:pleroma_background_image]) + |> Maps.put_if_present(:raw_bio, params[:note]) + |> Maps.put_if_present(:avatar, params[:avatar], user_image_value) + |> Maps.put_if_present(:banner, params[:header], user_image_value) + |> Maps.put_if_present(:background, params[:pleroma_background_image], user_image_value) |> Maps.put_if_present( :raw_fields, params[:fields_attributes], @@ -176,36 +206,44 @@ def update_credentials(%{assigns: %{user: user}, body_params: params} = conn, _p |> Maps.put_if_present(:pleroma_settings_store, params[:pleroma_settings_store]) |> Maps.put_if_present(:default_scope, params[:default_scope]) |> Maps.put_if_present(:default_scope, params["source"]["privacy"]) + |> Maps.put_if_present(:actor_type, params[:bot], fn bot -> + if bot, do: {:ok, "Service"}, else: {:ok, "Person"} + end) |> Maps.put_if_present(:actor_type, params[:actor_type]) - changeset = User.update_changeset(user, user_params) - - with {:ok, user} <- User.update_and_set_cache(changeset) do - user - |> build_update_activity_params() - |> ActivityPub.update() - - render(conn, "show.json", user: user, for: user, with_pleroma_settings: true) + # What happens here: + # + # We want to update the user through the pipeline, but the ActivityPub + # update information is not quite enough for this, because this also + # contains local settings that don't federate and don't even appear + # in the Update activity. + # + # So we first build the normal local changeset, then apply it to the + # user data, but don't persist it. With this, we generate the object + # data for our update activity. We feed this and the changeset as meta + # inforation into the pipeline, where they will be properly updated and + # federated. + with changeset <- User.update_changeset(user, user_params), + {:ok, unpersisted_user} <- Ecto.Changeset.apply_action(changeset, :update), + updated_object <- + Pleroma.Web.ActivityPub.UserView.render("user.json", user: unpersisted_user) + |> Map.delete("@context"), + {:ok, update_data, []} <- Builder.update(user, updated_object), + {:ok, _update, _} <- + Pipeline.common_pipeline(update_data, + local: true, + user_update_changeset: changeset + ) do + render(conn, "show.json", + user: unpersisted_user, + for: unpersisted_user, + with_pleroma_settings: true + ) else _e -> render_error(conn, :forbidden, "Invalid request") end end - # Hotfix, handling will be redone with the pipeline - defp build_update_activity_params(user) do - object = - Pleroma.Web.ActivityPub.UserView.render("user.json", user: user) - |> Map.delete("@context") - - %{ - local: true, - to: [user.follower_address], - cc: [], - object: object, - actor: user.ap_id - } - end - defp normalize_fields_attributes(fields) do if Enum.all?(fields, &is_tuple/1) do Enum.map(fields, fn {_, v} -> v end) @@ -230,17 +268,17 @@ def relationships(%{assigns: %{user: _user}} = conn, _), do: json(conn, []) @doc "GET /api/v1/accounts/:id" def show(%{assigns: %{user: for_user}} = conn, %{id: nickname_or_id}) do with %User{} = user <- User.get_cached_by_nickname_or_id(nickname_or_id, for: for_user), - true <- User.visible_for?(user, for_user) do + :visible <- User.visible_for(user, for_user) do render(conn, "show.json", user: user, for: for_user) else - _e -> render_error(conn, :not_found, "Can't find user") + error -> user_visibility_error(conn, error) end end @doc "GET /api/v1/accounts/:id/statuses" def statuses(%{assigns: %{user: reading_user}} = conn, params) do with %User{} = user <- User.get_cached_by_nickname_or_id(params.id, for: reading_user), - true <- User.visible_for?(user, reading_user) do + :visible <- User.visible_for(user, reading_user) do params = params |> Map.delete(:tagged) @@ -257,7 +295,17 @@ def statuses(%{assigns: %{user: reading_user}} = conn, params) do as: :activity ) else - _e -> render_error(conn, :not_found, "Can't find user") + error -> user_visibility_error(conn, error) + end + end + + defp user_visibility_error(conn, error) do + case error do + :restrict_unauthenticated -> + render_error(conn, :unauthorized, "This API requires an authenticated user") + + _ -> + render_error(conn, :not_found, "Can't find user") end end @@ -325,7 +373,7 @@ def follow(%{assigns: %{user: %{id: id}, account: %{id: id}}}, _params) do {:error, "Can not follow yourself"} end - def follow(%{assigns: %{user: follower, account: followed}} = conn, params) do + def follow(%{body_params: params, assigns: %{user: follower, account: followed}} = conn, _) do with {:ok, follower} <- MastodonAPI.follow(follower, followed, params) do render(conn, "relationship.json", user: follower, target: followed) else @@ -364,8 +412,7 @@ def unmute(%{assigns: %{user: muter, account: muted}} = conn, _params) do @doc "POST /api/v1/accounts/:id/block" def block(%{assigns: %{user: blocker, account: blocked}} = conn, _params) do - with {:ok, _user_block} <- User.block(blocker, blocked), - {:ok, _activity} <- ActivityPub.block(blocker, blocked) do + with {:ok, _activity} <- CommonAPI.block(blocker, blocked) do render(conn, "relationship.json", user: blocker, target: blocked) else {:error, message} -> json_response(conn, :forbidden, %{error: message}) diff --git a/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex b/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex index 753b3db3e..9f09550e1 100644 --- a/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex @@ -59,17 +59,11 @@ def logout(conn, _) do def password_reset(conn, params) do nickname_or_email = params["email"] || params["nickname"] - with {:ok, _} <- TwitterAPI.password_reset(nickname_or_email) do - conn - |> put_status(:no_content) - |> json("") - else - {:error, "unknown user"} -> - send_resp(conn, :not_found, "") + TwitterAPI.password_reset(nickname_or_email) - {:error, _} -> - send_resp(conn, :bad_request, "") - end + conn + |> put_status(:no_content) + |> json("") end defp local_mastodon_root_path(conn) do diff --git a/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex b/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex index 825b231ab..9c2d093cd 100644 --- a/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex @@ -32,9 +32,19 @@ def create(%{assigns: %{user: blocker}, body_params: %{domain: domain}} = conn, json(conn, %{}) end + def create(%{assigns: %{user: blocker}} = conn, %{domain: domain}) do + User.block_domain(blocker, domain) + json(conn, %{}) + end + @doc "DELETE /api/v1/domain_blocks" def delete(%{assigns: %{user: blocker}, body_params: %{domain: domain}} = conn, _params) do User.unblock_domain(blocker, domain) json(conn, %{}) end + + def delete(%{assigns: %{user: blocker}} = conn, %{domain: domain}) do + User.unblock_domain(blocker, domain) + json(conn, %{}) + end end diff --git a/lib/pleroma/web/mastodon_api/controllers/list_controller.ex b/lib/pleroma/web/mastodon_api/controllers/list_controller.ex index acdc76fd2..5daeaa780 100644 --- a/lib/pleroma/web/mastodon_api/controllers/list_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/list_controller.ex @@ -74,7 +74,7 @@ def add_to_list(%{assigns: %{list: list}, body_params: %{account_ids: account_id # DELETE /api/v1/lists/:id/accounts def remove_from_list( - %{assigns: %{list: list}, body_params: %{account_ids: account_ids}} = conn, + %{assigns: %{list: list}, params: %{account_ids: account_ids}} = conn, _ ) do Enum.each(account_ids, fn account_id -> @@ -86,6 +86,10 @@ def remove_from_list( json(conn, %{}) end + def remove_from_list(%{body_params: params} = conn, _) do + remove_from_list(%{conn | params: params}, %{}) + end + defp list_by_id_and_user(%{assigns: %{user: user}, params: %{id: id}} = conn, _) do case Pleroma.List.get(id, user) do %Pleroma.List{} = list -> assign(conn, :list, list) diff --git a/lib/pleroma/web/mastodon_api/controllers/search_controller.ex b/lib/pleroma/web/mastodon_api/controllers/search_controller.ex index 3be0ca095..5a983db39 100644 --- a/lib/pleroma/web/mastodon_api/controllers/search_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/search_controller.ex @@ -44,6 +44,7 @@ def search2(conn, params), do: do_search(:v2, conn, params) def search(conn, params), do: do_search(:v1, conn, params) defp do_search(version, %{assigns: %{user: user}} = conn, %{q: query} = params) do + query = String.trim(query) options = search_options(params, user) timeout = Keyword.get(Repo.config(), :timeout, 15_000) default_values = %{"statuses" => [], "accounts" => [], "hashtags" => []} @@ -92,7 +93,6 @@ defp resource_search(_, "accounts", query, options) do AccountView.render("index.json", users: accounts, for: options[:for_user], - as: :user, embed_relationships: options[:embed_relationships] ) end @@ -107,21 +107,21 @@ defp resource_search(_, "statuses", query, options) do ) end - defp resource_search(:v2, "hashtags", query, _options) do + defp resource_search(:v2, "hashtags", query, options) do tags_path = Web.base_url() <> "/tag/" query - |> prepare_tags() + |> prepare_tags(options) |> Enum.map(fn tag -> %{name: tag, url: tags_path <> tag} end) end - defp resource_search(:v1, "hashtags", query, _options) do - prepare_tags(query) + defp resource_search(:v1, "hashtags", query, options) do + prepare_tags(query, options) end - defp prepare_tags(query, add_joined_tag \\ true) do + defp prepare_tags(query, options) do tags = query |> preprocess_uri_query() @@ -139,13 +139,20 @@ defp prepare_tags(query, add_joined_tag \\ true) do tags = Enum.map(tags, fn tag -> String.trim_leading(tag, "#") end) - if Enum.empty?(explicit_tags) && add_joined_tag do - tags - |> Kernel.++([joined_tag(tags)]) - |> Enum.uniq_by(&String.downcase/1) - else - tags - end + tags = + if Enum.empty?(explicit_tags) && !options[:skip_joined_tag] do + add_joined_tag(tags) + else + tags + end + + Pleroma.Pagination.paginate(tags, options) + end + + defp add_joined_tag(tags) do + tags + |> Kernel.++([joined_tag(tags)]) + |> Enum.uniq_by(&String.downcase/1) end # If `query` is a URI, returns last component of its path, otherwise returns `query` diff --git a/lib/pleroma/web/mastodon_api/controllers/status_controller.ex b/lib/pleroma/web/mastodon_api/controllers/status_controller.ex index 468b44b67..ecfa38489 100644 --- a/lib/pleroma/web/mastodon_api/controllers/status_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/status_controller.ex @@ -172,6 +172,11 @@ def create(%{assigns: %{user: user}, body_params: %{status: _} = params} = conn, with_direct_conversation_id: true ) else + {:error, {:reject, message}} -> + conn + |> put_status(:unprocessable_entity) + |> json(%{error: message}) + {:error, message} -> conn |> put_status(:unprocessable_entity) @@ -200,11 +205,16 @@ def show(%{assigns: %{user: user}} = conn, %{id: id}) do @doc "DELETE /api/v1/statuses/:id" def delete(%{assigns: %{user: user}} = conn, %{id: id}) do - with {:ok, %Activity{}} <- CommonAPI.delete(id, user) do - json(conn, %{}) + with %Activity{} = activity <- Activity.get_by_id_with_object(id), + {:ok, %Activity{}} <- CommonAPI.delete(id, user) do + try_render(conn, "show.json", + activity: activity, + for: user, + with_direct_conversation_id: true, + with_source: true + ) else - {:error, :not_found} = e -> e - _e -> render_error(conn, :forbidden, "Can't delete this post") + _e -> {:error, :not_found} end end @@ -304,7 +314,8 @@ def card(%{assigns: %{user: user}} = conn, %{id: status_id}) do @doc "GET /api/v1/statuses/:id/favourited_by" def favourited_by(%{assigns: %{user: user}} = conn, %{id: id}) do - with %Activity{} = activity <- Activity.get_by_id_with_object(id), + with true <- Pleroma.Config.get([:instance, :show_reactions]), + %Activity{} = activity <- Activity.get_by_id_with_object(id), {:visible, true} <- {:visible, Visibility.visible_for_user?(activity, user)}, %Object{data: %{"likes" => likes}} <- Object.normalize(activity) do users = diff --git a/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex b/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex index 4bdd46d7e..5272790d3 100644 --- a/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex +++ b/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex @@ -8,6 +8,7 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do import Pleroma.Web.ControllerHelper, only: [add_link_headers: 2, add_link_headers: 3] + alias Pleroma.Config alias Pleroma.Pagination alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug @@ -88,21 +89,20 @@ def direct(%{assigns: %{user: user}} = conn, params) do ) end + defp restrict_unauthenticated?(true = _local_only) do + Config.restrict_unauthenticated_access?(:timelines, :local) + end + + defp restrict_unauthenticated?(_) do + Config.restrict_unauthenticated_access?(:timelines, :federated) + end + # GET /api/v1/timelines/public def public(%{assigns: %{user: user}} = conn, params) do local_only = params[:local] - cfg_key = - if local_only do - :local - else - :federated - end - - restrict? = Pleroma.Config.get([:restrict_unauthenticated, :timelines, cfg_key]) - - if restrict? and is_nil(user) do - render_error(conn, :unauthorized, "authorization required for timeline view") + if is_nil(user) and restrict_unauthenticated?(local_only) do + fail_on_bad_auth(conn) else activities = params @@ -123,6 +123,10 @@ def public(%{assigns: %{user: user}} = conn, params) do end end + defp fail_on_bad_auth(conn) do + render_error(conn, :unauthorized, "authorization required for timeline view") + end + defp hashtag_fetching(params, user, local_only) do tags = [params[:tag], params[:any]] @@ -157,15 +161,20 @@ defp hashtag_fetching(params, user, local_only) do # GET /api/v1/timelines/tag/:tag def hashtag(%{assigns: %{user: user}} = conn, params) do local_only = params[:local] - activities = hashtag_fetching(params, user, local_only) - conn - |> add_link_headers(activities, %{"local" => local_only}) - |> render("index.json", - activities: activities, - for: user, - as: :activity - ) + if is_nil(user) and restrict_unauthenticated?(local_only) do + fail_on_bad_auth(conn) + else + activities = hashtag_fetching(params, user, local_only) + + conn + |> add_link_headers(activities, %{"local" => local_only}) + |> render("index.json", + activities: activities, + for: user, + as: :activity + ) + end end # GET /api/v1/timelines/list/:list_id @@ -173,11 +182,10 @@ def list(%{assigns: %{user: user}} = conn, %{list_id: id} = params) do with %Pleroma.List{title: _title, following: following} <- Pleroma.List.get(id, user) do params = params - |> Map.new(fn {key, value} -> {to_string(key), value} end) - |> Map.put("type", "Create") - |> Map.put("blocking_user", user) - |> Map.put("user", user) - |> Map.put("muting_user", user) + |> Map.put(:type, "Create") + |> Map.put(:blocking_user, user) + |> Map.put(:user, user) + |> Map.put(:muting_user, user) # we must filter the following list for the user to avoid leaking statuses the user # does not actually have permission to see (for more info, peruse security issue #270). diff --git a/lib/pleroma/web/mastodon_api/views/account_view.ex b/lib/pleroma/web/mastodon_api/views/account_view.ex index 9fc06bf9d..d2a30a548 100644 --- a/lib/pleroma/web/mastodon_api/views/account_view.ex +++ b/lib/pleroma/web/mastodon_api/views/account_view.ex @@ -27,21 +27,40 @@ def render("index.json", %{users: users} = opts) do UserRelationship.view_relationships_option(reading_user, users) end - opts = Map.put(opts, :relationships, relationships_opt) + opts = + opts + |> Map.merge(%{relationships: relationships_opt, as: :user}) + |> Map.delete(:users) users |> render_many(AccountView, "show.json", opts) |> Enum.filter(&Enum.any?/1) end - def render("show.json", %{user: user} = opts) do - if User.visible_for?(user, opts[:for]) do + @doc """ + Renders specified user account. + :skip_visibility_check option skips visibility check and renders any user (local or remote) + regardless of [:pleroma, :restrict_unauthenticated] setting. + :for option specifies the requester and can be a User record or nil. + Only use `user: user, for: user` when `user` is the actual requester of own profile. + """ + def render("show.json", %{user: _user, skip_visibility_check: true} = opts) do + do_render("show.json", opts) + end + + def render("show.json", %{user: user, for: for_user_or_nil} = opts) do + if User.visible_for(user, for_user_or_nil) == :visible do do_render("show.json", opts) else %{} end end + def render("show.json", _) do + raise "In order to prevent account accessibility issues, " <> + ":skip_visibility_check or :for option is required." + end + def render("mention.json", %{user: user}) do %{ id: to_string(user.id), @@ -179,7 +198,7 @@ defp do_render("show.json", %{user: user} = opts) do 0 end - bot = user.actor_type in ["Application", "Service"] + bot = user.actor_type == "Service" emojis = Enum.map(user.emoji, fn {shortcode, raw_url} -> @@ -204,6 +223,18 @@ defp do_render("show.json", %{user: user} = opts) do %{} end + favicon = + if Pleroma.Config.get([:instances_favicons, :enabled]) do + user + |> Map.get(:ap_id, "") + |> URI.parse() + |> URI.merge("/") + |> Pleroma.Instances.Instance.get_or_update_favicon() + |> MediaProxy.url() + else + nil + end + %{ id: to_string(user.id), username: username_from_nickname(user.nickname), @@ -214,7 +245,7 @@ defp do_render("show.json", %{user: user} = opts) do followers_count: followers_count, following_count: following_count, statuses_count: user.note_count, - note: user.bio || "", + note: user.bio, url: user.uri || user.ap_id, avatar: image, avatar_static: image, @@ -224,7 +255,7 @@ defp do_render("show.json", %{user: user} = opts) do fields: user.fields, bot: bot, source: %{ - note: prepare_user_bio(user), + note: user.raw_bio || "", sensitive: false, fields: user.raw_fields, pleroma: %{ @@ -245,7 +276,9 @@ defp do_render("show.json", %{user: user} = opts) do hide_favorites: user.hide_favorites, relationship: relationship, skip_thread_containment: user.skip_thread_containment, - background_image: image_url(user.background) |> MediaProxy.url() + background_image: image_url(user.background) |> MediaProxy.url(), + accepts_chat_messages: user.accepts_chat_messages, + favicon: favicon } } |> maybe_put_role(user, opts[:for]) @@ -260,17 +293,6 @@ defp do_render("show.json", %{user: user} = opts) do |> maybe_put_unread_notification_count(user, opts[:for]) end - defp prepare_user_bio(%User{bio: ""}), do: "" - - defp prepare_user_bio(%User{bio: bio}) when is_binary(bio) do - bio - |> String.replace(~r(
), "\n") - |> Pleroma.HTML.strip_tags() - |> HtmlEntities.decode() - end - - defp prepare_user_bio(_), do: "" - defp username_from_nickname(string) when is_binary(string) do hd(String.split(string, "@")) end diff --git a/lib/pleroma/web/mastodon_api/views/conversation_view.ex b/lib/pleroma/web/mastodon_api/views/conversation_view.ex index fbe618377..a91994915 100644 --- a/lib/pleroma/web/mastodon_api/views/conversation_view.ex +++ b/lib/pleroma/web/mastodon_api/views/conversation_view.ex @@ -23,10 +23,13 @@ def render("participation.json", %{participation: participation, for: user}) do last_activity_id = with nil <- participation.last_activity_id do - ActivityPub.fetch_latest_activity_id_for_context(participation.conversation.ap_id, %{ - user: user, - blocking_user: user - }) + ActivityPub.fetch_latest_direct_activity_id_for_context( + participation.conversation.ap_id, + %{ + user: user, + blocking_user: user + } + ) end activity = Activity.get_by_id_with_object(last_activity_id) @@ -35,7 +38,7 @@ def render("participation.json", %{participation: participation, for: user}) do %{ id: participation.id |> to_string(), - accounts: render(AccountView, "index.json", users: users, as: :user), + accounts: render(AccountView, "index.json", users: users, for: user), unread: !participation.read, last_status: render(StatusView, "show.json", diff --git a/lib/pleroma/web/mastodon_api/views/filter_view.ex b/lib/pleroma/web/mastodon_api/views/filter_view.ex index aeff646f5..c37f624e0 100644 --- a/lib/pleroma/web/mastodon_api/views/filter_view.ex +++ b/lib/pleroma/web/mastodon_api/views/filter_view.ex @@ -25,7 +25,7 @@ def render("show.json", %{filter: filter}) do context: filter.context, expires_at: expires_at, irreversible: filter.hide, - whole_word: false + whole_word: filter.whole_word } end end diff --git a/lib/pleroma/web/mastodon_api/views/instance_view.ex b/lib/pleroma/web/mastodon_api/views/instance_view.ex index c498fe632..ea2d3aa9c 100644 --- a/lib/pleroma/web/mastodon_api/views/instance_view.ex +++ b/lib/pleroma/web/mastodon_api/views/instance_view.ex @@ -23,9 +23,10 @@ def render("show.json", _) do streaming_api: Pleroma.Web.Endpoint.websocket_url() }, stats: Pleroma.Stats.get_stats(), - thumbnail: instance_thumbnail(), + thumbnail: Keyword.get(instance, :instance_thumbnail), languages: ["en"], registrations: Keyword.get(instance, :registrations_open), + approval_required: Keyword.get(instance, :account_approval_required), # Extra (not present in Mastodon): max_toot_chars: Keyword.get(instance, :limit), poll_limits: Keyword.get(instance, :poll_limits), @@ -34,10 +35,15 @@ def render("show.json", _) do background_upload_limit: Keyword.get(instance, :background_upload_limit), banner_upload_limit: Keyword.get(instance, :banner_upload_limit), background_image: Keyword.get(instance, :background_image), + chat_limit: Keyword.get(instance, :chat_limit), + description_limit: Keyword.get(instance, :description_limit), pleroma: %{ metadata: %{ + account_activation_required: Keyword.get(instance, :account_activation_required), features: features(), - federation: federation() + federation: federation(), + fields_limits: fields_limits(), + post_formats: Config.get([:instance, :allowed_post_formats]) }, vapid_public_key: Keyword.get(Pleroma.Web.Push.vapid_config(), :public_key) } @@ -78,7 +84,7 @@ def features do def federation do quarantined = Config.get([:instance, :quarantined_instances], []) - if Config.get([:instance, :mrf_transparency]) do + if Config.get([:mrf, :transparency]) do {:ok, data} = MRF.describe() data @@ -89,8 +95,12 @@ def federation do |> Map.put(:enabled, Config.get([:instance, :federating])) end - defp instance_thumbnail do - Pleroma.Config.get([:instance, :instance_thumbnail]) || - "#{Pleroma.Web.base_url()}/instance/thumbnail.jpeg" + def fields_limits do + %{ + max_fields: Config.get([:instance, :max_account_fields]), + max_remote_fields: Config.get([:instance, :max_remote_account_fields]), + name_length: Config.get([:instance, :account_field_name_length]), + value_length: Config.get([:instance, :account_field_value_length]) + } end end diff --git a/lib/pleroma/web/mastodon_api/views/notification_view.ex b/lib/pleroma/web/mastodon_api/views/notification_view.ex index 3865be280..c97e6d32f 100644 --- a/lib/pleroma/web/mastodon_api/views/notification_view.ex +++ b/lib/pleroma/web/mastodon_api/views/notification_view.ex @@ -84,12 +84,7 @@ def render( # Note: :relationships contain user mutes (needed for :muted flag in :status) status_render_opts = %{relationships: opts[:relationships]} - - account = - AccountView.render( - "show.json", - %{user: actor, for: reading_user} - ) + account = AccountView.render("show.json", %{user: actor, for: reading_user}) response = %{ id: to_string(notification.id), @@ -97,6 +92,7 @@ def render( created_at: CommonAPI.Utils.to_masto_date(notification.inserted_at), account: account, pleroma: %{ + is_muted: User.mutes?(reading_user, actor), is_seen: notification.seen } } diff --git a/lib/pleroma/web/mastodon_api/views/poll_view.ex b/lib/pleroma/web/mastodon_api/views/poll_view.ex index 59a5deb28..1208dc9a0 100644 --- a/lib/pleroma/web/mastodon_api/views/poll_view.ex +++ b/lib/pleroma/web/mastodon_api/views/poll_view.ex @@ -28,10 +28,10 @@ def render("show.json", %{object: object, multiple: multiple, options: options} def render("show.json", %{object: object} = params) do case object.data do - %{"anyOf" => options} when is_list(options) -> + %{"anyOf" => [_ | _] = options} -> render(__MODULE__, "show.json", Map.merge(params, %{multiple: true, options: options})) - %{"oneOf" => options} when is_list(options) -> + %{"oneOf" => [_ | _] = options} -> render(__MODULE__, "show.json", Map.merge(params, %{multiple: false, options: options})) _ -> @@ -40,15 +40,13 @@ def render("show.json", %{object: object} = params) do end defp end_time_and_expired(object) do - case object.data["closed"] || object.data["endTime"] do - end_time when is_binary(end_time) -> - end_time = NaiveDateTime.from_iso8601!(end_time) - expired = NaiveDateTime.compare(end_time, NaiveDateTime.utc_now()) == :lt + if object.data["closed"] do + end_time = NaiveDateTime.from_iso8601!(object.data["closed"]) + expired = NaiveDateTime.compare(end_time, NaiveDateTime.utc_now()) == :lt - {Utils.to_masto_date(end_time), expired} - - _ -> - {nil, false} + {Utils.to_masto_date(end_time), expired} + else + {nil, false} end end diff --git a/lib/pleroma/web/mastodon_api/views/status_view.ex b/lib/pleroma/web/mastodon_api/views/status_view.ex index 2c49bedb3..ca42917fc 100644 --- a/lib/pleroma/web/mastodon_api/views/status_view.ex +++ b/lib/pleroma/web/mastodon_api/views/status_view.ex @@ -8,7 +8,6 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do require Pleroma.Constants alias Pleroma.Activity - alias Pleroma.ActivityExpiration alias Pleroma.HTML alias Pleroma.Object alias Pleroma.Repo @@ -21,7 +20,18 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do alias Pleroma.Web.MastodonAPI.StatusView alias Pleroma.Web.MediaProxy - import Pleroma.Web.ActivityPub.Visibility, only: [get_visibility: 1] + import Pleroma.Web.ActivityPub.Visibility, only: [get_visibility: 1, visible_for_user?: 2] + + # This is a naive way to do this, just spawning a process per activity + # to fetch the preview. However it should be fine considering + # pagination is restricted to 40 activities at a time + defp fetch_rich_media_for_activities(activities) do + Enum.each(activities, fn activity -> + spawn(fn -> + Pleroma.Web.RichMedia.Helpers.fetch_data_for_activity(activity) + end) + end) + end # TODO: Add cached version. defp get_replied_to_activities([]), do: %{} @@ -80,6 +90,11 @@ def render("index.json", opts) do # To do: check AdminAPIControllerTest on the reasons behind nil activities in the list activities = Enum.filter(opts.activities, & &1) + + # Start fetching rich media before doing anything else, so that later calls to get the cards + # only block for timeout in the worst case, as opposed to + # length(activities_with_links) * timeout + fetch_rich_media_for_activities(activities) replied_to_activities = get_replied_to_activities(activities) parent_activities = @@ -229,8 +244,8 @@ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} expires_at = with true <- client_posted_this_activity, - %ActivityExpiration{scheduled_at: scheduled_at} <- - ActivityExpiration.get_by_activity_id(activity.id) do + %Oban.Job{scheduled_at: scheduled_at} <- + Pleroma.Workers.PurgeExpiredActivity.get_expiration(activity.id) do scheduled_at else _ -> nil @@ -297,13 +312,17 @@ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} emoji_reactions = with %{data: %{"reactions" => emoji_reactions}} <- object do - Enum.map(emoji_reactions, fn [emoji, users] -> - %{ - name: emoji, - count: length(users), - me: !!(opts[:for] && opts[:for].ap_id in users) - } + Enum.map(emoji_reactions, fn + [emoji, users] when is_list(users) -> + build_emoji_map(emoji, users, opts[:for]) + + {emoji, users} when is_list(users) -> + build_emoji_map(emoji, users, opts[:for]) + + _ -> + nil end) + |> Enum.reject(&is_nil/1) else _ -> [] end @@ -333,6 +352,7 @@ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} reblog: nil, card: card, content: content_html, + text: opts[:with_source] && object.data["source"], created_at: created_at, reblogs_count: announcement_count, replies_count: object.data["repliesCount"] || 0, @@ -364,7 +384,8 @@ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} expires_at: expires_at, direct_conversation_id: direct_conversation_id, thread_muted: thread_muted?, - emoji_reactions: emoji_reactions + emoji_reactions: emoji_reactions, + parent_visible: visible_for_user?(reply_to, opts[:for]) } } end @@ -467,23 +488,10 @@ def get_reply_to(%{data: %{"object" => _object}} = activity, _) do end end - def render_content(%{data: %{"type" => object_type}} = object) - when object_type in ["Video", "Event", "Audio"] do - with name when not is_nil(name) and name != "" <- object.data["name"] do - "

#{name}

#{object.data["content"]}" - else - _ -> object.data["content"] || "" - end - end + def render_content(%{data: %{"name" => name}} = object) when not is_nil(name) and name != "" do + url = object.data["url"] || object.data["id"] - def render_content(%{data: %{"type" => object_type}} = object) - when object_type in ["Article", "Page"] do - with summary when not is_nil(summary) and summary != "" <- object.data["name"], - url when is_bitstring(url) <- object.data["url"] do - "

#{summary}

#{object.data["content"]}" - else - _ -> object.data["content"] || "" - end + "

#{name}

#{object.data["content"]}" end def render_content(object), do: object.data["content"] || "" @@ -543,4 +551,12 @@ defp present?(_), do: true defp pinned?(%Activity{id: id}, %User{pinned_activities: pinned_activities}), do: id in pinned_activities + + defp build_emoji_map(emoji, users, current_user) do + %{ + name: emoji, + count: length(users), + me: !!(current_user && current_user.ap_id in users) + } + end end diff --git a/lib/pleroma/web/mastodon_api/websocket_handler.ex b/lib/pleroma/web/mastodon_api/websocket_handler.ex index 94e4595d8..cf923ded8 100644 --- a/lib/pleroma/web/mastodon_api/websocket_handler.ex +++ b/lib/pleroma/web/mastodon_api/websocket_handler.ex @@ -37,12 +37,12 @@ def init(%{qs: qs} = req, state) do else {:error, :bad_topic} -> Logger.debug("#{__MODULE__} bad topic #{inspect(req)}") - {:ok, req} = :cowboy_req.reply(404, req) + req = :cowboy_req.reply(404, req) {:ok, req, state} {:error, :unauthorized} -> Logger.debug("#{__MODULE__} authentication error: #{inspect(req)}") - {:ok, req} = :cowboy_req.reply(401, req) + req = :cowboy_req.reply(401, req) {:ok, req, state} end end @@ -64,7 +64,9 @@ def websocket_handle(:pong, state) do {:ok, %{state | timer: timer()}} end - # We never receive messages. + # We only receive pings for now + def websocket_handle(:ping, state), do: {:ok, state} + def websocket_handle(frame, state) do Logger.error("#{__MODULE__} received frame: #{inspect(frame)}") {:ok, state} @@ -98,6 +100,10 @@ def websocket_info(:tick, state) do {:reply, :ping, %{state | timer: nil, count: 0}, :hibernate} end + # State can be `[]` only in case we terminate before switching to websocket, + # we already log errors for these cases in `init/1`, so just do nothing here + def terminate(_reason, _req, []), do: :ok + def terminate(reason, _req, state) do Logger.debug( "#{__MODULE__} terminating websocket connection for user #{ diff --git a/lib/pleroma/web/media_proxy/invalidation.ex b/lib/pleroma/web/media_proxy/invalidation.ex index c037ff13e..5808861e6 100644 --- a/lib/pleroma/web/media_proxy/invalidation.ex +++ b/lib/pleroma/web/media_proxy/invalidation.ex @@ -5,22 +5,34 @@ defmodule Pleroma.Web.MediaProxy.Invalidation do @moduledoc false - @callback purge(list(String.t()), map()) :: {:ok, String.t()} | {:error, String.t()} + @callback purge(list(String.t()), Keyword.t()) :: {:ok, list(String.t())} | {:error, String.t()} alias Pleroma.Config + alias Pleroma.Web.MediaProxy - @spec purge(list(String.t())) :: {:ok, String.t()} | {:error, String.t()} + @spec enabled?() :: boolean() + def enabled?, do: Config.get([:media_proxy, :invalidation, :enabled]) + + @spec purge(list(String.t()) | String.t()) :: {:ok, list(String.t())} | {:error, String.t()} def purge(urls) do - [:media_proxy, :invalidation, :enabled] - |> Config.get() - |> do_purge(urls) + prepared_urls = prepare_urls(urls) + + if enabled?() do + do_purge(prepared_urls) + else + {:ok, prepared_urls} + end end - defp do_purge(true, urls) do + defp do_purge(urls) do provider = Config.get([:media_proxy, :invalidation, :provider]) options = Config.get(provider) provider.purge(urls, options) end - defp do_purge(_, _), do: :ok + def prepare_urls(urls) do + urls + |> List.wrap() + |> Enum.map(&MediaProxy.url/1) + end end diff --git a/lib/pleroma/web/media_proxy/invalidations/http.ex b/lib/pleroma/web/media_proxy/invalidations/http.ex index 07248df6e..bb81d8888 100644 --- a/lib/pleroma/web/media_proxy/invalidations/http.ex +++ b/lib/pleroma/web/media_proxy/invalidations/http.ex @@ -9,10 +9,10 @@ defmodule Pleroma.Web.MediaProxy.Invalidation.Http do require Logger @impl Pleroma.Web.MediaProxy.Invalidation - def purge(urls, opts) do - method = Map.get(opts, :method, :purge) - headers = Map.get(opts, :headers, []) - options = Map.get(opts, :options, []) + def purge(urls, opts \\ []) do + method = Keyword.get(opts, :method, :purge) + headers = Keyword.get(opts, :headers, []) + options = Keyword.get(opts, :options, []) Logger.debug("Running cache purge: #{inspect(urls)}") @@ -22,7 +22,7 @@ def purge(urls, opts) do end end) - {:ok, "success"} + {:ok, urls} end defp do_purge(method, url, headers, options) do diff --git a/lib/pleroma/web/media_proxy/invalidations/script.ex b/lib/pleroma/web/media_proxy/invalidations/script.ex index 6be782132..d32ffc50b 100644 --- a/lib/pleroma/web/media_proxy/invalidations/script.ex +++ b/lib/pleroma/web/media_proxy/invalidations/script.ex @@ -10,32 +10,34 @@ defmodule Pleroma.Web.MediaProxy.Invalidation.Script do require Logger @impl Pleroma.Web.MediaProxy.Invalidation - def purge(urls, %{script_path: script_path} = _options) do + def purge(urls, opts \\ []) do args = urls |> List.wrap() |> Enum.uniq() |> Enum.join(" ") - path = Path.expand(script_path) - - Logger.debug("Running cache purge: #{inspect(urls)}, #{path}") - - case do_purge(path, [args]) do - {result, exit_status} when exit_status > 0 -> - Logger.error("Error while cache purge: #{inspect(result)}") - {:error, inspect(result)} - - _ -> - {:ok, "success"} - end + opts + |> Keyword.get(:script_path) + |> do_purge([args]) + |> handle_result(urls) end - def purge(_, _), do: {:error, "not found script path"} - - defp do_purge(path, args) do + defp do_purge(script_path, args) when is_binary(script_path) do + path = Path.expand(script_path) + Logger.debug("Running cache purge: #{inspect(args)}, #{inspect(path)}") System.cmd(path, args) rescue - error -> {inspect(error), 1} + error -> error + end + + defp do_purge(_, _), do: {:error, "not found script path"} + + defp handle_result({_result, 0}, urls), do: {:ok, urls} + defp handle_result({:error, error}, urls), do: handle_result(error, urls) + + defp handle_result(error, _) do + Logger.error("Error while cache purge: #{inspect(error)}") + {:error, inspect(error)} end end diff --git a/lib/pleroma/web/media_proxy/media_proxy.ex b/lib/pleroma/web/media_proxy/media_proxy.ex index b2b524524..e18dd8224 100644 --- a/lib/pleroma/web/media_proxy/media_proxy.ex +++ b/lib/pleroma/web/media_proxy/media_proxy.ex @@ -6,20 +6,56 @@ defmodule Pleroma.Web.MediaProxy do alias Pleroma.Config alias Pleroma.Upload alias Pleroma.Web + alias Pleroma.Web.MediaProxy.Invalidation @base64_opts [padding: false] + @cache_table :banned_urls_cache + + def cache_table, do: @cache_table + + @spec in_banned_urls(String.t()) :: boolean() + def in_banned_urls(url), do: elem(Cachex.exists?(@cache_table, url(url)), 1) + + def remove_from_banned_urls(urls) when is_list(urls) do + Cachex.execute!(@cache_table, fn cache -> + Enum.each(Invalidation.prepare_urls(urls), &Cachex.del(cache, &1)) + end) + end + + def remove_from_banned_urls(url) when is_binary(url) do + Cachex.del(@cache_table, url(url)) + end + + def put_in_banned_urls(urls) when is_list(urls) do + Cachex.execute!(@cache_table, fn cache -> + Enum.each(Invalidation.prepare_urls(urls), &Cachex.put(cache, &1, true)) + end) + end + + def put_in_banned_urls(url) when is_binary(url) do + Cachex.put(@cache_table, url(url), true) + end def url(url) when is_nil(url) or url == "", do: nil def url("/" <> _ = url), do: url def url(url) do - if disabled?() or local?(url) or whitelisted?(url) do + if disabled?() or not url_proxiable?(url) do url else encode_url(url) end end + @spec url_proxiable?(String.t()) :: boolean() + def url_proxiable?(url) do + if local?(url) or whitelisted?(url) do + false + else + true + end + end + defp disabled?, do: !Config.get([:media_proxy, :enabled], false) defp local?(url), do: String.starts_with?(url, Pleroma.Web.base_url()) @@ -27,22 +63,28 @@ defp local?(url), do: String.starts_with?(url, Pleroma.Web.base_url()) defp whitelisted?(url) do %{host: domain} = URI.parse(url) - mediaproxy_whitelist = Config.get([:media_proxy, :whitelist]) + mediaproxy_whitelist_domains = + [:media_proxy, :whitelist] + |> Config.get() + |> Enum.map(&maybe_get_domain_from_url/1) - upload_base_url_domain = - if !is_nil(Config.get([Upload, :base_url])) do - [URI.parse(Config.get([Upload, :base_url])).host] + whitelist_domains = + if base_url = Config.get([Upload, :base_url]) do + %{host: base_domain} = URI.parse(base_url) + [base_domain | mediaproxy_whitelist_domains] else - [] + mediaproxy_whitelist_domains end - whitelist = mediaproxy_whitelist ++ upload_base_url_domain - - Enum.any?(whitelist, fn pattern -> - String.equivalent?(domain, pattern) - end) + domain in whitelist_domains end + defp maybe_get_domain_from_url("http" <> _ = url) do + URI.parse(url).host + end + + defp maybe_get_domain_from_url(domain), do: domain + def encode_url(url) do base64 = Base.url_encode64(url, @base64_opts) @@ -73,7 +115,7 @@ def filename(url_or_path) do def build_url(sig_base64, url_base64, filename \\ nil) do [ - Pleroma.Config.get([:media_proxy, :base_url], Web.base_url()), + Config.get([:media_proxy, :base_url], Web.base_url()), "proxy", sig_base64, url_base64, diff --git a/lib/pleroma/web/media_proxy/media_proxy_controller.ex b/lib/pleroma/web/media_proxy/media_proxy_controller.ex index 4657a4383..9a64b0ef3 100644 --- a/lib/pleroma/web/media_proxy/media_proxy_controller.ex +++ b/lib/pleroma/web/media_proxy/media_proxy_controller.ex @@ -14,10 +14,11 @@ def remote(conn, %{"sig" => sig64, "url" => url64} = params) do with config <- Pleroma.Config.get([:media_proxy], []), true <- Keyword.get(config, :enabled, false), {:ok, url} <- MediaProxy.decode_url(sig64, url64), + {_, false} <- {:in_banned_urls, MediaProxy.in_banned_urls(url)}, :ok <- filename_matches(params, conn.request_path, url) do ReverseProxy.call(conn, url, Keyword.get(config, :proxy_opts, @default_proxy_opts)) else - false -> + error when error in [false, {:in_banned_urls, true}] -> send_resp(conn, 404, Plug.Conn.Status.reason_phrase(404)) {:error, :invalid_signature} -> diff --git a/lib/pleroma/web/metadata.ex b/lib/pleroma/web/metadata.ex index a9f70c43e..0f2d8d1e7 100644 --- a/lib/pleroma/web/metadata.ex +++ b/lib/pleroma/web/metadata.ex @@ -7,8 +7,9 @@ defmodule Pleroma.Web.Metadata do def build_tags(params) do providers = [ + Pleroma.Web.Metadata.Providers.RelMe, Pleroma.Web.Metadata.Providers.RestrictIndexing - | Pleroma.Config.get([__MODULE__, :providers], []) + | activated_providers() ] Enum.reduce(providers, "", fn parser, acc -> @@ -42,4 +43,12 @@ def activity_nsfw?(%{data: %{"sensitive" => sensitive}}) do def activity_nsfw?(_) do false end + + defp activated_providers do + unless Pleroma.Config.restrict_unauthenticated_access?(:activities, :local) do + [Pleroma.Web.Metadata.Providers.Feed | Pleroma.Config.get([__MODULE__, :providers], [])] + else + [] + end + end end diff --git a/lib/pleroma/web/metadata/opengraph.ex b/lib/pleroma/web/metadata/opengraph.ex index 68c871e71..bb1b23208 100644 --- a/lib/pleroma/web/metadata/opengraph.ex +++ b/lib/pleroma/web/metadata/opengraph.ex @@ -61,7 +61,7 @@ def build_tags(%{ @impl Provider def build_tags(%{user: user}) do - with truncated_bio = Utils.scrub_html_and_truncate(user.bio || "") do + with truncated_bio = Utils.scrub_html_and_truncate(user.bio) do [ {:meta, [ diff --git a/lib/pleroma/web/metadata/twitter_card.ex b/lib/pleroma/web/metadata/twitter_card.ex index 5d08ce422..df34b033f 100644 --- a/lib/pleroma/web/metadata/twitter_card.ex +++ b/lib/pleroma/web/metadata/twitter_card.ex @@ -40,7 +40,7 @@ def build_tags(%{activity_id: id, object: object, user: user}) do @impl Provider def build_tags(%{user: user}) do - with truncated_bio = Utils.scrub_html_and_truncate(user.bio || "") do + with truncated_bio = Utils.scrub_html_and_truncate(user.bio) do [ title_tag(user), {:meta, [property: "twitter:description", content: truncated_bio], []}, diff --git a/lib/pleroma/web/nodeinfo/nodeinfo.ex b/lib/pleroma/web/nodeinfo/nodeinfo.ex new file mode 100644 index 000000000..47fa46376 --- /dev/null +++ b/lib/pleroma/web/nodeinfo/nodeinfo.ex @@ -0,0 +1,91 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Nodeinfo.Nodeinfo do + alias Pleroma.Config + alias Pleroma.Stats + alias Pleroma.User + alias Pleroma.Web.Federator.Publisher + alias Pleroma.Web.MastodonAPI.InstanceView + + # returns a nodeinfo 2.0 map, since 2.1 just adds a repository field + # under software. + def get_nodeinfo("2.0") do + stats = Stats.get_stats() + + staff_accounts = + User.all_superusers() + |> Enum.map(fn u -> u.ap_id end) + + federation = InstanceView.federation() + features = InstanceView.features() + + %{ + version: "2.0", + software: %{ + name: Pleroma.Application.name() |> String.downcase(), + version: Pleroma.Application.version() + }, + protocols: Publisher.gather_nodeinfo_protocol_names(), + services: %{ + inbound: [], + outbound: [] + }, + openRegistrations: Config.get([:instance, :registrations_open]), + usage: %{ + users: %{ + total: Map.get(stats, :user_count, 0) + }, + localPosts: Map.get(stats, :status_count, 0) + }, + metadata: %{ + nodeName: Config.get([:instance, :name]), + nodeDescription: Config.get([:instance, :description]), + private: !Config.get([:instance, :public], true), + suggestions: %{ + enabled: false + }, + staffAccounts: staff_accounts, + federation: federation, + pollLimits: Config.get([:instance, :poll_limits]), + postFormats: Config.get([:instance, :allowed_post_formats]), + uploadLimits: %{ + general: Config.get([:instance, :upload_limit]), + avatar: Config.get([:instance, :avatar_upload_limit]), + banner: Config.get([:instance, :banner_upload_limit]), + background: Config.get([:instance, :background_upload_limit]) + }, + fieldsLimits: %{ + maxFields: Config.get([:instance, :max_account_fields]), + maxRemoteFields: Config.get([:instance, :max_remote_account_fields]), + nameLength: Config.get([:instance, :account_field_name_length]), + valueLength: Config.get([:instance, :account_field_value_length]) + }, + accountActivationRequired: Config.get([:instance, :account_activation_required], false), + invitesEnabled: Config.get([:instance, :invites_enabled], false), + mailerEnabled: Config.get([Pleroma.Emails.Mailer, :enabled], false), + features: features, + restrictedNicknames: Config.get([Pleroma.User, :restricted_nicknames]), + skipThreadContainment: Config.get([:instance, :skip_thread_containment], false) + } + } + end + + def get_nodeinfo("2.1") do + raw_response = get_nodeinfo("2.0") + + updated_software = + raw_response + |> Map.get(:software) + |> Map.put(:repository, Pleroma.Application.repository()) + + raw_response + |> Map.put(:software, updated_software) + |> Map.put(:version, "2.1") + end + + def get_nodeinfo(_version) do + {:error, :missing} + end +end diff --git a/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex b/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex index 721b599d4..8c7a9e565 100644 --- a/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex +++ b/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex @@ -5,12 +5,8 @@ defmodule Pleroma.Web.Nodeinfo.NodeinfoController do use Pleroma.Web, :controller - alias Pleroma.Config - alias Pleroma.Stats - alias Pleroma.User alias Pleroma.Web - alias Pleroma.Web.Federator.Publisher - alias Pleroma.Web.MastodonAPI.InstanceView + alias Pleroma.Web.Nodeinfo.Nodeinfo def schemas(conn, _params) do response = %{ @@ -29,102 +25,20 @@ def schemas(conn, _params) do json(conn, response) end - # returns a nodeinfo 2.0 map, since 2.1 just adds a repository field - # under software. - def raw_nodeinfo do - stats = Stats.get_stats() - - staff_accounts = - User.all_superusers() - |> Enum.map(fn u -> u.ap_id end) - - features = InstanceView.features() - federation = InstanceView.federation() - - %{ - version: "2.0", - software: %{ - name: Pleroma.Application.name() |> String.downcase(), - version: Pleroma.Application.version() - }, - protocols: Publisher.gather_nodeinfo_protocol_names(), - services: %{ - inbound: [], - outbound: [] - }, - openRegistrations: Config.get([:instance, :registrations_open]), - usage: %{ - users: %{ - total: Map.get(stats, :user_count, 0) - }, - localPosts: Map.get(stats, :status_count, 0) - }, - metadata: %{ - nodeName: Config.get([:instance, :name]), - nodeDescription: Config.get([:instance, :description]), - private: !Config.get([:instance, :public], true), - suggestions: %{ - enabled: false - }, - staffAccounts: staff_accounts, - federation: federation, - pollLimits: Config.get([:instance, :poll_limits]), - postFormats: Config.get([:instance, :allowed_post_formats]), - uploadLimits: %{ - general: Config.get([:instance, :upload_limit]), - avatar: Config.get([:instance, :avatar_upload_limit]), - banner: Config.get([:instance, :banner_upload_limit]), - background: Config.get([:instance, :background_upload_limit]) - }, - fieldsLimits: %{ - maxFields: Config.get([:instance, :max_account_fields]), - maxRemoteFields: Config.get([:instance, :max_remote_account_fields]), - nameLength: Config.get([:instance, :account_field_name_length]), - valueLength: Config.get([:instance, :account_field_value_length]) - }, - accountActivationRequired: Config.get([:instance, :account_activation_required], false), - invitesEnabled: Config.get([:instance, :invites_enabled], false), - mailerEnabled: Config.get([Pleroma.Emails.Mailer, :enabled], false), - features: features, - restrictedNicknames: Config.get([Pleroma.User, :restricted_nicknames]), - skipThreadContainment: Config.get([:instance, :skip_thread_containment], false) - } - } - end - # Schema definition: https://github.com/jhass/nodeinfo/blob/master/schemas/2.0/schema.json # and https://github.com/jhass/nodeinfo/blob/master/schemas/2.1/schema.json - def nodeinfo(conn, %{"version" => "2.0"}) do - conn - |> put_resp_header( - "content-type", - "application/json; profile=http://nodeinfo.diaspora.software/ns/schema/2.0#; charset=utf-8" - ) - |> json(raw_nodeinfo()) - end + def nodeinfo(conn, %{"version" => version}) do + case Nodeinfo.get_nodeinfo(version) do + {:error, :missing} -> + render_error(conn, :not_found, "Nodeinfo schema version not handled") - def nodeinfo(conn, %{"version" => "2.1"}) do - raw_response = raw_nodeinfo() - - updated_software = - raw_response - |> Map.get(:software) - |> Map.put(:repository, Pleroma.Application.repository()) - - response = - raw_response - |> Map.put(:software, updated_software) - |> Map.put(:version, "2.1") - - conn - |> put_resp_header( - "content-type", - "application/json; profile=http://nodeinfo.diaspora.software/ns/schema/2.1#; charset=utf-8" - ) - |> json(response) - end - - def nodeinfo(conn, _) do - render_error(conn, :not_found, "Nodeinfo schema version not handled") + node_info -> + conn + |> put_resp_header( + "content-type", + "application/json; profile=http://nodeinfo.diaspora.software/ns/schema/2.0#; charset=utf-8" + ) + |> json(node_info) + end end end diff --git a/lib/pleroma/web/oauth/mfa_controller.ex b/lib/pleroma/web/oauth/mfa_controller.ex index 53e19f82e..f102c93e7 100644 --- a/lib/pleroma/web/oauth/mfa_controller.ex +++ b/lib/pleroma/web/oauth/mfa_controller.ex @@ -13,6 +13,7 @@ defmodule Pleroma.Web.OAuth.MFAController do alias Pleroma.Web.Auth.TOTPAuthenticator alias Pleroma.Web.OAuth.MFAView, as: View alias Pleroma.Web.OAuth.OAuthController + alias Pleroma.Web.OAuth.OAuthView alias Pleroma.Web.OAuth.Token plug(:fetch_session when action in [:show, :verify]) @@ -74,7 +75,7 @@ def challenge(conn, %{"mfa_token" => mfa_token} = params) do {:ok, %{user: user, authorization: auth}} <- MFA.Token.validate(mfa_token), {:ok, _} <- validates_challenge(user, params), {:ok, token} <- Token.exchange_token(app, auth) do - json(conn, Token.Response.build(user, token)) + json(conn, OAuthView.render("token.json", %{user: user, token: token})) else _error -> conn diff --git a/lib/pleroma/web/oauth/mfa_view.ex b/lib/pleroma/web/oauth/mfa_view.ex index 41d5578dc..5d87db268 100644 --- a/lib/pleroma/web/oauth/mfa_view.ex +++ b/lib/pleroma/web/oauth/mfa_view.ex @@ -5,4 +5,13 @@ defmodule Pleroma.Web.OAuth.MFAView do use Pleroma.Web, :view import Phoenix.HTML.Form + alias Pleroma.MFA + + def render("mfa_response.json", %{token: token, user: user}) do + %{ + error: "mfa_required", + mfa_token: token.token, + supported_challenge_types: MFA.supported_methods(user) + } + end end diff --git a/lib/pleroma/web/oauth/oauth_controller.ex b/lib/pleroma/web/oauth/oauth_controller.ex index c557778ca..26e68be42 100644 --- a/lib/pleroma/web/oauth/oauth_controller.ex +++ b/lib/pleroma/web/oauth/oauth_controller.ex @@ -17,6 +17,8 @@ defmodule Pleroma.Web.OAuth.OAuthController do alias Pleroma.Web.OAuth.App alias Pleroma.Web.OAuth.Authorization alias Pleroma.Web.OAuth.MFAController + alias Pleroma.Web.OAuth.MFAView + alias Pleroma.Web.OAuth.OAuthView alias Pleroma.Web.OAuth.Scopes alias Pleroma.Web.OAuth.Token alias Pleroma.Web.OAuth.Token.Strategy.RefreshToken @@ -74,6 +76,13 @@ defp do_authorize(%Plug.Conn{} = conn, params) do available_scopes = (app && app.scopes) || [] scopes = Scopes.fetch_scopes(params, available_scopes) + scopes = + if scopes == [] do + available_scopes + else + scopes + end + # Note: `params` might differ from `conn.params`; use `@params` not `@conn.params` in template render(conn, Authenticator.auth_template(), %{ response_type: params["response_type"], @@ -136,7 +145,10 @@ def create_authorization( def after_create_authorization(%Plug.Conn{} = conn, %Authorization{} = auth, %{ "authorization" => %{"redirect_uri" => @oob_token_redirect_uri} }) do - render(conn, "oob_authorization_created.html", %{auth: auth}) + # Enforcing the view to reuse the template when calling from other controllers + conn + |> put_view(OAuthView) + |> render("oob_authorization_created.html", %{auth: auth}) end def after_create_authorization(%Plug.Conn{} = conn, %Authorization{} = auth, %{ @@ -188,7 +200,7 @@ defp handle_create_authorization_error( {:mfa_required, user, auth, _}, params ) do - {:ok, token} = MFA.Token.create_token(user, auth) + {:ok, token} = MFA.Token.create(user, auth) data = %{ "mfa_token" => token.token, @@ -233,9 +245,7 @@ def token_exchange( with {:ok, app} <- Token.Utils.fetch_app(conn), {:ok, %{user: user} = token} <- Token.get_by_refresh_token(app, token), {:ok, token} <- RefreshToken.grant(token) do - response_attrs = %{created_at: Token.Utils.format_created_at(token)} - - json(conn, Token.Response.build(user, token, response_attrs)) + json(conn, OAuthView.render("token.json", %{user: user, token: token})) else _error -> render_invalid_credentials_error(conn) end @@ -247,9 +257,7 @@ def token_exchange(%Plug.Conn{} = conn, %{"grant_type" => "authorization_code"} {:ok, auth} <- Authorization.get_by_token(app, fixed_token), %User{} = user <- User.get_cached_by_id(auth.user_id), {:ok, token} <- Token.exchange_token(app, auth) do - response_attrs = %{created_at: Token.Utils.format_created_at(token)} - - json(conn, Token.Response.build(user, token, response_attrs)) + json(conn, OAuthView.render("token.json", %{user: user, token: token})) else error -> handle_token_exchange_error(conn, error) @@ -262,12 +270,9 @@ def token_exchange( ) do with {:ok, %User{} = user} <- Authenticator.get_user(conn), {:ok, app} <- Token.Utils.fetch_app(conn), - {:account_status, :active} <- {:account_status, User.account_status(user)}, - {:ok, scopes} <- validate_scopes(app, params), - {:ok, auth} <- Authorization.create_authorization(app, user, scopes), - {:mfa_required, _, _, false} <- {:mfa_required, user, auth, MFA.require?(user)}, - {:ok, token} <- Token.exchange_token(app, auth) do - json(conn, Token.Response.build(user, token)) + requested_scopes <- Scopes.fetch_scopes(params, app.scopes), + {:ok, token} <- login(user, app, requested_scopes) do + json(conn, OAuthView.render("token.json", %{user: user, token: token})) else error -> handle_token_exchange_error(conn, error) @@ -290,7 +295,7 @@ def token_exchange(%Plug.Conn{} = conn, %{"grant_type" => "client_credentials"} with {:ok, app} <- Token.Utils.fetch_app(conn), {:ok, auth} <- Authorization.create_authorization(app, %User{}), {:ok, token} <- Token.exchange_token(app, auth) do - json(conn, Token.Response.build_for_client_credentials(token)) + json(conn, OAuthView.render("token.json", %{token: token})) else _error -> handle_token_exchange_error(conn, :invalid_credentails) @@ -339,6 +344,16 @@ defp handle_token_exchange_error(%Plug.Conn{} = conn, {:account_status, :confirm ) end + defp handle_token_exchange_error(%Plug.Conn{} = conn, {:account_status, :approval_pending}) do + render_error( + conn, + :forbidden, + "Your account is awaiting approval.", + %{}, + "awaiting_approval" + ) + end + defp handle_token_exchange_error(%Plug.Conn{} = conn, _error) do render_invalid_credentials_error(conn) end @@ -514,6 +529,8 @@ def register(%Plug.Conn{} = conn, %{"authorization" => _, "op" => "register"} = end end + defp do_create_authorization(conn, auth_attrs, user \\ nil) + defp do_create_authorization( %Plug.Conn{} = conn, %{ @@ -523,19 +540,37 @@ defp do_create_authorization( "redirect_uri" => redirect_uri } = auth_attrs }, - user \\ nil + user ) do with {_, {:ok, %User{} = user}} <- {:get_user, (user && {:ok, user}) || Authenticator.get_user(conn)}, %App{} = app <- Repo.get_by(App, client_id: client_id), true <- redirect_uri in String.split(app.redirect_uris), - {:ok, scopes} <- validate_scopes(app, auth_attrs), - {:account_status, :active} <- {:account_status, User.account_status(user)}, - {:ok, auth} <- Authorization.create_authorization(app, user, scopes) do + requested_scopes <- Scopes.fetch_scopes(auth_attrs, app.scopes), + {:ok, auth} <- do_create_authorization(user, app, requested_scopes) do {:ok, auth, user} end end + defp do_create_authorization(%User{} = user, %App{} = app, requested_scopes) + when is_list(requested_scopes) do + with {:account_status, :active} <- {:account_status, User.account_status(user)}, + {:ok, scopes} <- validate_scopes(app, requested_scopes), + {:ok, auth} <- Authorization.create_authorization(app, user, scopes) do + {:ok, auth} + end + end + + # Note: intended to be a private function but opened for AccountController that logs in on signup + @doc "If checks pass, creates authorization and token for given user, app and requested scopes." + def login(%User{} = user, %App{} = app, requested_scopes) when is_list(requested_scopes) do + with {:ok, auth} <- do_create_authorization(user, app, requested_scopes), + {:mfa_required, _, _, false} <- {:mfa_required, user, auth, MFA.require?(user)}, + {:ok, token} <- Token.exchange_token(app, auth) do + {:ok, token} + end + end + # Special case: Local MastodonFE defp redirect_uri(%Plug.Conn{} = conn, "."), do: auth_url(conn, :login) @@ -547,17 +582,20 @@ defp put_session_registration_id(%Plug.Conn{} = conn, registration_id), do: put_session(conn, :registration_id, registration_id) defp build_and_response_mfa_token(user, auth) do - with {:ok, token} <- MFA.Token.create_token(user, auth) do - Token.Response.build_for_mfa_token(user, token) + with {:ok, token} <- MFA.Token.create(user, auth) do + MFAView.render("mfa_response.json", %{token: token, user: user}) end end - @spec validate_scopes(App.t(), map()) :: + @spec validate_scopes(App.t(), map() | list()) :: {:ok, list()} | {:error, :missing_scopes | :unsupported_scopes} - defp validate_scopes(%App{} = app, params) do - params - |> Scopes.fetch_scopes(app.scopes) - |> Scopes.validate(app.scopes) + defp validate_scopes(%App{} = app, params) when is_map(params) do + requested_scopes = Scopes.fetch_scopes(params, app.scopes) + validate_scopes(app, requested_scopes) + end + + defp validate_scopes(%App{} = app, requested_scopes) when is_list(requested_scopes) do + Scopes.validate(requested_scopes, app.scopes) end def default_redirect_uri(%App{} = app) do diff --git a/lib/pleroma/web/oauth/oauth_view.ex b/lib/pleroma/web/oauth/oauth_view.ex index 94ddaf913..f55247ebd 100644 --- a/lib/pleroma/web/oauth/oauth_view.ex +++ b/lib/pleroma/web/oauth/oauth_view.ex @@ -5,4 +5,26 @@ defmodule Pleroma.Web.OAuth.OAuthView do use Pleroma.Web, :view import Phoenix.HTML.Form + + alias Pleroma.Web.OAuth.Token.Utils + + def render("token.json", %{token: token} = opts) do + response = %{ + token_type: "Bearer", + access_token: token.token, + refresh_token: token.refresh_token, + expires_in: expires_in(), + scope: Enum.join(token.scopes, " "), + created_at: Utils.format_created_at(token) + } + + if user = opts[:user] do + response + |> Map.put(:me, user.ap_id) + else + response + end + end + + defp expires_in, do: Pleroma.Config.get([:oauth2, :token_expires_in], 600) end diff --git a/lib/pleroma/web/oauth/token.ex b/lib/pleroma/web/oauth/token.ex index 08bb7326d..de37998f2 100644 --- a/lib/pleroma/web/oauth/token.ex +++ b/lib/pleroma/web/oauth/token.ex @@ -50,7 +50,7 @@ def exchange_token(app, auth) do true <- auth.app_id == app.id do user = if auth.user_id, do: User.get_cached_by_id(auth.user_id), else: %User{} - create_token( + create( app, user, %{scopes: auth.scopes} @@ -83,8 +83,22 @@ defp put_valid_until(changeset, attrs) do |> validate_required([:valid_until]) end - @spec create_token(App.t(), User.t(), map()) :: {:ok, Token} | {:error, Changeset.t()} - def create_token(%App{} = app, %User{} = user, attrs \\ %{}) do + @spec create(App.t(), User.t(), map()) :: {:ok, Token} | {:error, Changeset.t()} + def create(%App{} = app, %User{} = user, attrs \\ %{}) do + with {:ok, token} <- do_create(app, user, attrs) do + if Pleroma.Config.get([:oauth2, :clean_expired_tokens]) do + Pleroma.Workers.PurgeExpiredToken.enqueue(%{ + token_id: token.id, + valid_until: DateTime.from_naive!(token.valid_until, "Etc/UTC"), + mod: __MODULE__ + }) + end + + {:ok, token} + end + end + + defp do_create(app, user, attrs) do %__MODULE__{user_id: user.id, app_id: app.id} |> cast(%{scopes: attrs[:scopes] || app.scopes}, [:scopes]) |> validate_required([:scopes, :app_id]) @@ -105,11 +119,6 @@ def delete_user_token(%User{id: user_id}, token_id) do |> Repo.delete_all() end - def delete_expired_tokens do - Query.get_expired_tokens() - |> Repo.delete_all() - end - def get_user_tokens(%User{id: user_id}) do Query.get_by_user(user_id) |> Query.preload([:app]) diff --git a/lib/pleroma/web/oauth/token/clean_worker.ex b/lib/pleroma/web/oauth/token/clean_worker.ex deleted file mode 100644 index e3aa4eb7e..000000000 --- a/lib/pleroma/web/oauth/token/clean_worker.ex +++ /dev/null @@ -1,38 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.OAuth.Token.CleanWorker do - @moduledoc """ - The module represents functions to clean an expired OAuth and MFA tokens. - """ - use GenServer - - @ten_seconds 10_000 - @one_day 86_400_000 - - alias Pleroma.MFA - alias Pleroma.Web.OAuth - alias Pleroma.Workers.BackgroundWorker - - def start_link(_), do: GenServer.start_link(__MODULE__, %{}) - - def init(_) do - Process.send_after(self(), :perform, @ten_seconds) - {:ok, nil} - end - - @doc false - def handle_info(:perform, state) do - BackgroundWorker.enqueue("clean_expired_tokens", %{}) - interval = Pleroma.Config.get([:oauth2, :clean_expired_tokens_interval], @one_day) - - Process.send_after(self(), :perform, interval) - {:noreply, state} - end - - def perform(:clean) do - OAuth.Token.delete_expired_tokens() - MFA.Token.delete_expired_tokens() - end -end diff --git a/lib/pleroma/web/oauth/token/query.ex b/lib/pleroma/web/oauth/token/query.ex index 93d6e26ed..fd6d9b112 100644 --- a/lib/pleroma/web/oauth/token/query.ex +++ b/lib/pleroma/web/oauth/token/query.ex @@ -33,12 +33,6 @@ def get_by_id(query \\ Token, id) do from(q in query, where: q.id == ^id) end - @spec get_expired_tokens(query, DateTime.t() | nil) :: query - def get_expired_tokens(query \\ Token, date \\ nil) do - expired_date = date || Timex.now() - from(q in query, where: fragment("?", q.valid_until) < ^expired_date) - end - @spec get_by_user(query, String.t()) :: query def get_by_user(query \\ Token, user_id) do from(q in query, where: q.user_id == ^user_id) diff --git a/lib/pleroma/web/oauth/token/response.ex b/lib/pleroma/web/oauth/token/response.ex deleted file mode 100644 index 0e72c31e9..000000000 --- a/lib/pleroma/web/oauth/token/response.ex +++ /dev/null @@ -1,45 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Web.OAuth.Token.Response do - @moduledoc false - - alias Pleroma.MFA - alias Pleroma.User - alias Pleroma.Web.OAuth.Token.Utils - - @doc false - def build(%User{} = user, token, opts \\ %{}) do - %{ - token_type: "Bearer", - access_token: token.token, - refresh_token: token.refresh_token, - expires_in: expires_in(), - scope: Enum.join(token.scopes, " "), - me: user.ap_id - } - |> Map.merge(opts) - end - - def build_for_client_credentials(token) do - %{ - token_type: "Bearer", - access_token: token.token, - refresh_token: token.refresh_token, - created_at: Utils.format_created_at(token), - expires_in: expires_in(), - scope: Enum.join(token.scopes, " ") - } - end - - def build_for_mfa_token(user, mfa_token) do - %{ - error: "mfa_required", - mfa_token: mfa_token.token, - supported_challenge_types: MFA.supported_methods(user) - } - end - - defp expires_in, do: Pleroma.Config.get([:oauth2, :token_expires_in], 600) -end diff --git a/lib/pleroma/web/oauth/token/strategy/refresh_token.ex b/lib/pleroma/web/oauth/token/strategy/refresh_token.ex index debc29b0b..625b0fde2 100644 --- a/lib/pleroma/web/oauth/token/strategy/refresh_token.ex +++ b/lib/pleroma/web/oauth/token/strategy/refresh_token.ex @@ -46,7 +46,7 @@ defp revoke_access_token(token) do defp create_access_token({:error, error}, _), do: {:error, error} defp create_access_token({:ok, token}, %{app: app, user: user} = token_params) do - Token.create_token(app, user, add_refresh_token(token_params, token.refresh_token)) + Token.create(app, user, add_refresh_token(token_params, token.refresh_token)) end defp add_refresh_token(params, token) do diff --git a/lib/pleroma/web/pleroma_api/controllers/account_controller.ex b/lib/pleroma/web/pleroma_api/controllers/account_controller.ex index c76cbfc48..a0ed41d96 100644 --- a/lib/pleroma/web/pleroma_api/controllers/account_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/account_controller.ex @@ -8,7 +8,6 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do import Pleroma.Web.ControllerHelper, only: [json_response: 3, add_link_headers: 2, assign_account_by_id: 2] - alias Ecto.Changeset alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Plugs.RateLimiter @@ -40,17 +39,6 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do %{scopes: ["follow", "write:follows"]} when action in [:subscribe, :unsubscribe] ) - plug( - OAuthScopesPlug, - %{scopes: ["write:accounts"]} - # Note: the following actions are not permission-secured in Mastodon: - when action in [ - :update_avatar, - :update_banner, - :update_background - ] - ) - plug( OAuthScopesPlug, %{scopes: ["read:favourites"], fallback: :proceed_unauthenticated} when action == :favourites @@ -73,56 +61,6 @@ def confirmation_resend(conn, params) do end end - @doc "PATCH /api/v1/pleroma/accounts/update_avatar" - def update_avatar(%{assigns: %{user: user}, body_params: %{img: ""}} = conn, _) do - {:ok, _user} = - user - |> Changeset.change(%{avatar: nil}) - |> User.update_and_set_cache() - - json(conn, %{url: nil}) - end - - def update_avatar(%{assigns: %{user: user}, body_params: params} = conn, _params) do - {:ok, %{data: data}} = ActivityPub.upload(params, type: :avatar) - {:ok, _user} = user |> Changeset.change(%{avatar: data}) |> User.update_and_set_cache() - %{"url" => [%{"href" => href} | _]} = data - - json(conn, %{url: href}) - end - - @doc "PATCH /api/v1/pleroma/accounts/update_banner" - def update_banner(%{assigns: %{user: user}, body_params: %{banner: ""}} = conn, _) do - with {:ok, _user} <- User.update_banner(user, %{}) do - json(conn, %{url: nil}) - end - end - - def update_banner(%{assigns: %{user: user}, body_params: params} = conn, _) do - with {:ok, object} <- ActivityPub.upload(%{img: params[:banner]}, type: :banner), - {:ok, _user} <- User.update_banner(user, object.data) do - %{"url" => [%{"href" => href} | _]} = object.data - - json(conn, %{url: href}) - end - end - - @doc "PATCH /api/v1/pleroma/accounts/update_background" - def update_background(%{assigns: %{user: user}, body_params: %{img: ""}} = conn, _) do - with {:ok, _user} <- User.update_background(user, %{}) do - json(conn, %{url: nil}) - end - end - - def update_background(%{assigns: %{user: user}, body_params: params} = conn, _) do - with {:ok, object} <- ActivityPub.upload(params, type: :background), - {:ok, _user} <- User.update_background(user, object.data) do - %{"url" => [%{"href" => href} | _]} = object.data - - json(conn, %{url: href}) - end - end - @doc "GET /api/v1/pleroma/accounts/:id/favourites" def favourites(%{assigns: %{account: %{hide_favorites: true}}} = conn, _params) do render_error(conn, :forbidden, "Can't get favorites") diff --git a/lib/pleroma/web/pleroma_api/controllers/chat_controller.ex b/lib/pleroma/web/pleroma_api/controllers/chat_controller.ex index c8ef3d915..e8a1746d4 100644 --- a/lib/pleroma/web/pleroma_api/controllers/chat_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/chat_controller.ex @@ -89,11 +89,11 @@ def post_chat_message( cm_ref <- MessageReference.for_chat_and_object(chat, message) do conn |> put_view(MessageReferenceView) - |> render("show.json", for: user, chat_message_reference: cm_ref) + |> render("show.json", chat_message_reference: cm_ref) end end - def mark_message_as_read(%{assigns: %{user: %{id: user_id} = user}} = conn, %{ + def mark_message_as_read(%{assigns: %{user: %{id: user_id}}} = conn, %{ id: chat_id, message_id: message_id }) do @@ -104,12 +104,15 @@ def mark_message_as_read(%{assigns: %{user: %{id: user_id} = user}} = conn, %{ {:ok, cm_ref} <- MessageReference.mark_as_read(cm_ref) do conn |> put_view(MessageReferenceView) - |> render("show.json", for: user, chat_message_reference: cm_ref) + |> render("show.json", chat_message_reference: cm_ref) end end def mark_as_read( - %{body_params: %{last_read_id: last_read_id}, assigns: %{user: %{id: user_id}}} = conn, + %{ + body_params: %{last_read_id: last_read_id}, + assigns: %{user: %{id: user_id}} + } = conn, %{id: id} ) do with %Chat{} = chat <- Repo.get_by(Chat, id: id, user_id: user_id), @@ -121,7 +124,7 @@ def mark_as_read( end end - def messages(%{assigns: %{user: %{id: user_id} = user}} = conn, %{id: id} = params) do + def messages(%{assigns: %{user: %{id: user_id}}} = conn, %{id: id} = params) do with %Chat{} = chat <- Repo.get_by(Chat, id: id, user_id: user_id) do cm_refs = chat @@ -130,7 +133,7 @@ def messages(%{assigns: %{user: %{id: user_id} = user}} = conn, %{id: id} = para conn |> put_view(MessageReferenceView) - |> render("index.json", for: user, chat_message_references: cm_refs) + |> render("index.json", chat_message_references: cm_refs) else _ -> conn diff --git a/lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex b/lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex index d1efdeb5d..657f46324 100644 --- a/lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex @@ -21,8 +21,8 @@ defmodule Pleroma.Web.PleromaAPI.EmojiPackController do ] ) - @skip_plugs [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug] - plug(:skip_plug, @skip_plugs when action in [:archive, :show, :list]) + @skip_plugs [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug] + plug(:skip_plug, @skip_plugs when action in [:index, :show, :archive]) defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.PleromaEmojiPackOperation @@ -37,14 +37,14 @@ def remote(conn, %{url: url}) do end end - def index(conn, _params) do + def index(conn, params) do emoji_path = [:instance, :static_dir] |> Pleroma.Config.get!() |> Path.join("emoji") - with {:ok, packs} <- Pack.list_local() do - json(conn, packs) + with {:ok, packs, count} <- Pack.list_local(page: params.page, page_size: params.page_size) do + json(conn, %{packs: packs, count: count}) else {:error, :create_dir, e} -> conn @@ -60,10 +60,10 @@ def index(conn, _params) do end end - def show(conn, %{name: name}) do + def show(conn, %{name: name, page: page, page_size: page_size}) do name = String.trim(name) - with {:ok, pack} <- Pack.show(name) do + with {:ok, pack} <- Pack.show(name: name, page: page, page_size: page_size) do json(conn, pack) else {:error, :not_found} -> diff --git a/lib/pleroma/web/pleroma_api/controllers/emoji_reaction_controller.ex b/lib/pleroma/web/pleroma_api/controllers/emoji_reaction_controller.ex index 19dcffdf3..7f9254c13 100644 --- a/lib/pleroma/web/pleroma_api/controllers/emoji_reaction_controller.ex +++ b/lib/pleroma/web/pleroma_api/controllers/emoji_reaction_controller.ex @@ -25,7 +25,8 @@ defmodule Pleroma.Web.PleromaAPI.EmojiReactionController do action_fallback(Pleroma.Web.MastodonAPI.FallbackController) def index(%{assigns: %{user: user}} = conn, %{id: activity_id} = params) do - with %Activity{} = activity <- Activity.get_by_id_with_object(activity_id), + with true <- Pleroma.Config.get([:instance, :show_reactions]), + %Activity{} = activity <- Activity.get_by_id_with_object(activity_id), %Object{data: %{"reactions" => reactions}} when is_list(reactions) <- Object.normalize(activity) do reactions = filter(reactions, params) diff --git a/lib/pleroma/web/pleroma_api/views/chat/message_reference_view.ex b/lib/pleroma/web/pleroma_api/views/chat/message_reference_view.ex index f2112a86e..d4e08b50d 100644 --- a/lib/pleroma/web/pleroma_api/views/chat/message_reference_view.ex +++ b/lib/pleroma/web/pleroma_api/views/chat/message_reference_view.ex @@ -14,7 +14,7 @@ def render( %{ chat_message_reference: %{ id: id, - object: %{data: chat_message}, + object: %{data: chat_message} = object, chat_id: chat_id, unread: unread } @@ -30,7 +30,12 @@ def render( attachment: chat_message["attachment"] && StatusView.render("attachment.json", attachment: chat_message["attachment"]), - unread: unread + unread: unread, + card: + StatusView.render( + "card.json", + Pleroma.Web.RichMedia.Helpers.fetch_data_for_object(object) + ) } end diff --git a/lib/pleroma/web/pleroma_api/views/chat_view.ex b/lib/pleroma/web/pleroma_api/views/chat_view.ex index 1c996da11..04dc20d51 100644 --- a/lib/pleroma/web/pleroma_api/views/chat_view.ex +++ b/lib/pleroma/web/pleroma_api/views/chat_view.ex @@ -15,10 +15,11 @@ defmodule Pleroma.Web.PleromaAPI.ChatView do def render("show.json", %{chat: %Chat{} = chat} = opts) do recipient = User.get_cached_by_ap_id(chat.recipient) last_message = opts[:last_message] || MessageReference.last_message_for_chat(chat) + account_view_opts = account_view_opts(opts, recipient) %{ id: chat.id |> to_string(), - account: AccountView.render("show.json", Map.put(opts, :user, recipient)), + account: AccountView.render("show.json", account_view_opts), unread: MessageReference.unread_count_for_chat(chat), last_message: last_message && @@ -27,7 +28,17 @@ def render("show.json", %{chat: %Chat{} = chat} = opts) do } end - def render("index.json", %{chats: chats}) do - render_many(chats, __MODULE__, "show.json") + def render("index.json", %{chats: chats} = opts) do + render_many(chats, __MODULE__, "show.json", Map.delete(opts, :chats)) + end + + defp account_view_opts(opts, recipient) do + account_view_opts = Map.put(opts, :user, recipient) + + if Map.has_key?(account_view_opts, :for) do + account_view_opts + else + Map.put(account_view_opts, :skip_visibility_check, true) + end end end diff --git a/lib/pleroma/web/pleroma_api/views/emoji_reaction_view.ex b/lib/pleroma/web/pleroma_api/views/emoji_reaction_view.ex index 84d2d303d..e0f98b50a 100644 --- a/lib/pleroma/web/pleroma_api/views/emoji_reaction_view.ex +++ b/lib/pleroma/web/pleroma_api/views/emoji_reaction_view.ex @@ -17,7 +17,7 @@ def render("show.json", %{emoji_reaction: [emoji, user_ap_ids], user: user}) do %{ name: emoji, count: length(users), - accounts: render(AccountView, "index.json", users: users, for: user, as: :user), + accounts: render(AccountView, "index.json", users: users, for: user), me: !!(user && user.ap_id in user_ap_ids) } end diff --git a/lib/pleroma/web/preload.ex b/lib/pleroma/web/preload.ex new file mode 100644 index 000000000..90e454468 --- /dev/null +++ b/lib/pleroma/web/preload.ex @@ -0,0 +1,36 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload do + alias Phoenix.HTML + require Logger + + def build_tags(_conn, params) do + preload_data = + Enum.reduce(Pleroma.Config.get([__MODULE__, :providers], []), %{}, fn parser, acc -> + terms = + params + |> parser.generate_terms() + |> Enum.map(fn {k, v} -> {k, Base.encode64(Jason.encode!(v))} end) + |> Enum.into(%{}) + + Map.merge(acc, terms) + end) + + rendered_html = + preload_data + |> Jason.encode!() + |> build_script_tag() + |> HTML.safe_to_string() + + rendered_html + end + + def build_script_tag(content) do + HTML.Tag.content_tag(:script, HTML.raw(content), + id: "initial-results", + type: "application/json" + ) + end +end diff --git a/lib/pleroma/web/preload/instance.ex b/lib/pleroma/web/preload/instance.ex new file mode 100644 index 000000000..50d1f3382 --- /dev/null +++ b/lib/pleroma/web/preload/instance.ex @@ -0,0 +1,50 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload.Providers.Instance do + alias Pleroma.Plugs.InstanceStatic + alias Pleroma.Web.MastodonAPI.InstanceView + alias Pleroma.Web.Nodeinfo.Nodeinfo + alias Pleroma.Web.Preload.Providers.Provider + + @behaviour Provider + @instance_url "/api/v1/instance" + @panel_url "/instance/panel.html" + @nodeinfo_url "/nodeinfo/2.0.json" + + @impl Provider + def generate_terms(_params) do + %{} + |> build_info_tag() + |> build_panel_tag() + |> build_nodeinfo_tag() + end + + defp build_info_tag(acc) do + info_data = InstanceView.render("show.json", %{}) + + Map.put(acc, @instance_url, info_data) + end + + defp build_panel_tag(acc) do + instance_path = InstanceStatic.file_path(@panel_url |> to_string()) + + if File.exists?(instance_path) do + panel_data = File.read!(instance_path) + Map.put(acc, @panel_url, panel_data) + else + acc + end + end + + defp build_nodeinfo_tag(acc) do + case Nodeinfo.get_nodeinfo("2.0") do + {:error, _} -> + acc + + nodeinfo_data -> + Map.put(acc, @nodeinfo_url, nodeinfo_data) + end + end +end diff --git a/lib/pleroma/web/preload/provider.ex b/lib/pleroma/web/preload/provider.ex new file mode 100644 index 000000000..7ef595a34 --- /dev/null +++ b/lib/pleroma/web/preload/provider.ex @@ -0,0 +1,7 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload.Providers.Provider do + @callback generate_terms(map()) :: map() +end diff --git a/lib/pleroma/web/preload/timelines.ex b/lib/pleroma/web/preload/timelines.ex new file mode 100644 index 000000000..b279a865d --- /dev/null +++ b/lib/pleroma/web/preload/timelines.ex @@ -0,0 +1,39 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload.Providers.Timelines do + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.MastodonAPI.StatusView + alias Pleroma.Web.Preload.Providers.Provider + + @behaviour Provider + @public_url "/api/v1/timelines/public" + + @impl Provider + def generate_terms(params) do + build_public_tag(%{}, params) + end + + def build_public_tag(acc, params) do + if Pleroma.Config.restrict_unauthenticated_access?(:timelines, :federated) do + acc + else + Map.put(acc, @public_url, public_timeline(params)) + end + end + + defp public_timeline(%{"path" => ["main", "all"]}), do: get_public_timeline(false) + + defp public_timeline(_params), do: get_public_timeline(true) + + defp get_public_timeline(local_only) do + activities = + ActivityPub.fetch_public_activities(%{ + type: ["Create"], + local_only: local_only + }) + + StatusView.render("index.json", activities: activities, for: nil, as: :activity) + end +end diff --git a/lib/pleroma/web/preload/user.ex b/lib/pleroma/web/preload/user.ex new file mode 100644 index 000000000..b3d2e9b8d --- /dev/null +++ b/lib/pleroma/web/preload/user.ex @@ -0,0 +1,26 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload.Providers.User do + alias Pleroma.User + alias Pleroma.Web.MastodonAPI.AccountView + alias Pleroma.Web.Preload.Providers.Provider + + @behaviour Provider + @account_url_base "/api/v1/accounts" + + @impl Provider + def generate_terms(%{user: user}) do + build_accounts_tag(%{}, user) + end + + def generate_terms(_params), do: %{} + + def build_accounts_tag(acc, %User{} = user) do + account_data = AccountView.render("show.json", %{user: user, for: user}) + Map.put(acc, "#{@account_url_base}/#{user.id}", account_data) + end + + def build_accounts_tag(acc, _), do: acc +end diff --git a/lib/pleroma/web/push/impl.ex b/lib/pleroma/web/push/impl.ex index cdb827e76..16368485e 100644 --- a/lib/pleroma/web/push/impl.ex +++ b/lib/pleroma/web/push/impl.ex @@ -104,7 +104,7 @@ def build_content(notification, actor, object, mastodon_type \\ nil) def build_content( %{ - user: %{notification_settings: %{privacy_option: true}} + user: %{notification_settings: %{hide_notification_contents: true}} } = notification, _actor, _object, diff --git a/lib/pleroma/web/rel_me.ex b/lib/pleroma/web/rel_me.ex index 8e2b51508..28f75b18d 100644 --- a/lib/pleroma/web/rel_me.ex +++ b/lib/pleroma/web/rel_me.ex @@ -5,7 +5,8 @@ defmodule Pleroma.Web.RelMe do @options [ pool: :media, - max_body: 2_000_000 + max_body: 2_000_000, + recv_timeout: 2_000 ] if Pleroma.Config.get(:env) == :test do @@ -23,18 +24,8 @@ def parse(url) when is_binary(url) do def parse(_), do: {:error, "No URL provided"} defp parse_url(url) do - opts = - if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do - Keyword.merge(@options, - recv_timeout: 2_000, - with_body: true - ) - else - @options - end - with {:ok, %Tesla.Env{body: html, status: status}} when status in 200..299 <- - Pleroma.HTTP.get(url, [], adapter: opts), + Pleroma.HTTP.get(url, [], @options), {:ok, html_tree} <- Floki.parse_document(html), data <- Floki.attribute(html_tree, "link[rel~=me]", "href") ++ diff --git a/lib/pleroma/web/rich_media/helpers.ex b/lib/pleroma/web/rich_media/helpers.ex index 1729141e9..bd7f03cbe 100644 --- a/lib/pleroma/web/rich_media/helpers.ex +++ b/lib/pleroma/web/rich_media/helpers.ex @@ -9,12 +9,18 @@ defmodule Pleroma.Web.RichMedia.Helpers do alias Pleroma.Object alias Pleroma.Web.RichMedia.Parser + @options [ + pool: :media, + max_body: 2_000_000, + recv_timeout: 2_000 + ] + @spec validate_page_url(URI.t() | binary()) :: :ok | :error defp validate_page_url(page_url) when is_binary(page_url) do - validate_tld = Application.get_env(:auto_linker, :opts)[:validate_tld] + validate_tld = Config.get([Pleroma.Formatter, :validate_tld]) page_url - |> AutoLinker.Parser.url?(scheme: true, validate_tld: validate_tld) + |> Linkify.Parser.url?(validate_tld: validate_tld) |> parse_uri(page_url) end @@ -49,11 +55,11 @@ defp get_tld(host) do |> hd end - def fetch_data_for_activity(%Activity{data: %{"type" => "Create"}} = activity) do + def fetch_data_for_object(object) do with true <- Config.get([:rich_media, :enabled]), - %Object{} = object <- Object.normalize(activity), false <- object.data["sensitive"] || false, - {:ok, page_url} <- HTML.extract_first_external_url(object, object.data["content"]), + {:ok, page_url} <- + HTML.extract_first_external_url_from_object(object), :ok <- validate_page_url(page_url), {:ok, rich_media} <- Parser.parse(page_url) do %{page_url: page_url, rich_media: rich_media} @@ -62,10 +68,25 @@ def fetch_data_for_activity(%Activity{data: %{"type" => "Create"}} = activity) d end end + def fetch_data_for_activity(%Activity{data: %{"type" => "Create"}} = activity) do + with true <- Config.get([:rich_media, :enabled]), + %Object{} = object <- Object.normalize(activity) do + fetch_data_for_object(object) + else + _ -> %{} + end + end + def fetch_data_for_activity(_), do: %{} def perform(:fetch, %Activity{} = activity) do fetch_data_for_activity(activity) :ok end + + def rich_media_get(url) do + headers = [{"user-agent", Pleroma.Application.user_agent() <> "; Bot"}] + + Pleroma.HTTP.get(url, headers, @options) + end end diff --git a/lib/pleroma/web/rich_media/parser.ex b/lib/pleroma/web/rich_media/parser.ex index ef5ead2da..5727fda18 100644 --- a/lib/pleroma/web/rich_media/parser.ex +++ b/lib/pleroma/web/rich_media/parser.ex @@ -3,10 +3,7 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.RichMedia.Parser do - @options [ - pool: :media, - max_body: 2_000_000 - ] + require Logger defp parsers do Pleroma.Config.get([:rich_media, :parsers]) @@ -15,17 +12,34 @@ defp parsers do def parse(nil), do: {:error, "No URL provided"} if Pleroma.Config.get(:env) == :test do + @spec parse(String.t()) :: {:ok, map()} | {:error, any()} def parse(url), do: parse_url(url) else + @spec parse(String.t()) :: {:ok, map()} | {:error, any()} def parse(url) do - try do - Cachex.fetch!(:rich_media_cache, url, fn _ -> - {:commit, parse_url(url)} - end) - |> set_ttl_based_on_image(url) - rescue - e -> - {:error, "Cachex error: #{inspect(e)}"} + with {:ok, data} <- get_cached_or_parse(url), + {:ok, _} <- set_ttl_based_on_image(data, url) do + {:ok, data} + else + {:error, {:invalid_metadata, data}} = e -> + Logger.debug(fn -> "Incomplete or invalid metadata for #{url}: #{inspect(data)}" end) + e + + error -> + Logger.error(fn -> "Rich media error for #{url}: #{inspect(error)}" end) + error + end + end + + defp get_cached_or_parse(url) do + case Cachex.fetch!(:rich_media_cache, url, fn _ -> {:commit, parse_url(url)} end) do + {:ok, _data} = res -> + res + + {:error, _} = e -> + ttl = Pleroma.Config.get([:rich_media, :failure_backoff], 60_000) + Cachex.expire(:rich_media_cache, url, ttl) + e end end end @@ -52,19 +66,26 @@ def ttl(data, url) do config :pleroma, :rich_media, ttl_setters: [MyModule] """ - def set_ttl_based_on_image({:ok, data}, url) do - with {:ok, nil} <- Cachex.ttl(:rich_media_cache, url), - ttl when is_number(ttl) <- get_ttl_from_image(data, url) do - Cachex.expire_at(:rich_media_cache, url, ttl * 1000) - {:ok, data} - else + @spec set_ttl_based_on_image(map(), String.t()) :: + {:ok, Integer.t() | :noop} | {:error, :no_key} + def set_ttl_based_on_image(data, url) do + case get_ttl_from_image(data, url) do + {:ok, ttl} when is_number(ttl) -> + ttl = ttl * 1000 + + case Cachex.expire_at(:rich_media_cache, url, ttl) do + {:ok, true} -> {:ok, ttl} + {:ok, false} -> {:error, :no_key} + end + _ -> - {:ok, data} + {:ok, :noop} end end defp get_ttl_from_image(data, url) do - Pleroma.Config.get([:rich_media, :ttl_setters]) + [:rich_media, :ttl_setters] + |> Pleroma.Config.get() |> Enum.reduce({:ok, nil}, fn module, {:ok, _ttl} -> module.ttl(data, url) @@ -74,34 +95,17 @@ defp get_ttl_from_image(data, url) do end) end - defp parse_url(url) do - opts = - if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do - Keyword.merge(@options, - recv_timeout: 2_000, - with_body: true - ) - else - @options - end - - try do - {:ok, %Tesla.Env{body: html}} = Pleroma.HTTP.get(url, [], adapter: opts) - + def parse_url(url) do + with {:ok, %Tesla.Env{body: html}} <- Pleroma.Web.RichMedia.Helpers.rich_media_get(url), + {:ok, html} <- Floki.parse_document(html) do html - |> parse_html() |> maybe_parse() |> Map.put("url", url) |> clean_parsed_data() |> check_parsed_data() - rescue - e -> - {:error, "Parsing error: #{inspect(e)} #{inspect(__STACKTRACE__)}"} end end - defp parse_html(html), do: Floki.parse_document!(html) - defp maybe_parse(html) do Enum.reduce_while(parsers(), %{}, fn parser, acc -> case parser.parse(html, acc) do @@ -117,7 +121,7 @@ defp check_parsed_data(%{"title" => title} = data) end defp check_parsed_data(data) do - {:error, "Found metadata was invalid or incomplete: #{inspect(data)}"} + {:error, {:invalid_metadata, data}} end defp clean_parsed_data(data) do diff --git a/lib/pleroma/web/rich_media/parsers/oembed_parser.ex b/lib/pleroma/web/rich_media/parsers/oembed_parser.ex index 6bdeac89c..1fe6729c3 100644 --- a/lib/pleroma/web/rich_media/parsers/oembed_parser.ex +++ b/lib/pleroma/web/rich_media/parsers/oembed_parser.ex @@ -22,7 +22,7 @@ defp get_oembed_url([{"link", attributes, _children} | _]) do end defp get_oembed_data(url) do - with {:ok, %Tesla.Env{body: json}} <- Pleroma.HTTP.get(url, [], adapter: [pool: :media]) do + with {:ok, %Tesla.Env{body: json}} <- Pleroma.Web.RichMedia.Helpers.rich_media_get(url) do Jason.decode(json) end end diff --git a/lib/pleroma/web/rich_media/parsers/ttl/aws_signed_url.ex b/lib/pleroma/web/rich_media/parsers/ttl/aws_signed_url.ex index 0dc1efdaf..c5aaea2d4 100644 --- a/lib/pleroma/web/rich_media/parsers/ttl/aws_signed_url.ex +++ b/lib/pleroma/web/rich_media/parsers/ttl/aws_signed_url.ex @@ -10,20 +10,15 @@ def ttl(data, _url) do |> parse_query_params() |> format_query_params() |> get_expiration_timestamp() + else + {:error, "Not aws signed url #{inspect(image)}"} end end - defp is_aws_signed_url(""), do: nil - defp is_aws_signed_url(nil), do: nil - - defp is_aws_signed_url(image) when is_binary(image) do + defp is_aws_signed_url(image) when is_binary(image) and image != "" do %URI{host: host, query: query} = URI.parse(image) - if String.contains?(host, "amazonaws.com") and String.contains?(query, "X-Amz-Expires") do - image - else - nil - end + String.contains?(host, "amazonaws.com") and String.contains?(query, "X-Amz-Expires") end defp is_aws_signed_url(_), do: nil @@ -46,6 +41,6 @@ defp get_expiration_timestamp(params) when is_map(params) do |> Map.get("X-Amz-Date") |> Timex.parse("{ISO:Basic:Z}") - Timex.to_unix(date) + String.to_integer(Map.get(params, "X-Amz-Expires")) + {:ok, Timex.to_unix(date) + String.to_integer(Map.get(params, "X-Amz-Expires"))} end end diff --git a/lib/pleroma/web/router.ex b/lib/pleroma/web/router.ex index 57570b672..c6433cc53 100644 --- a/lib/pleroma/web/router.ex +++ b/lib/pleroma/web/router.ex @@ -138,6 +138,7 @@ defmodule Pleroma.Web.Router do patch("/users/:nickname/toggle_activation", AdminAPIController, :user_toggle_activation) patch("/users/activate", AdminAPIController, :user_activate) patch("/users/deactivate", AdminAPIController, :user_deactivate) + patch("/users/approve", AdminAPIController, :user_approve) put("/users/tag", AdminAPIController, :tag_users) delete("/users/tag", AdminAPIController, :untag_users) @@ -209,6 +210,10 @@ defmodule Pleroma.Web.Router do post("/oauth_app", OAuthAppController, :create) patch("/oauth_app/:id", OAuthAppController, :update) delete("/oauth_app/:id", OAuthAppController, :delete) + + get("/media_proxy_caches", MediaProxyCacheController, :index) + post("/media_proxy_caches/delete", MediaProxyCacheController, :delete) + post("/media_proxy_caches/purge", MediaProxyCacheController, :purge) end scope "/api/pleroma/emoji", Pleroma.Web.PleromaAPI do @@ -324,10 +329,6 @@ defmodule Pleroma.Web.Router do delete("/statuses/:id/reactions/:emoji", EmojiReactionController, :delete) post("/notifications/read", NotificationController, :mark_as_read) - patch("/accounts/update_avatar", AccountController, :update_avatar) - patch("/accounts/update_banner", AccountController, :update_banner) - patch("/accounts/update_background", AccountController, :update_background) - get("/mascot", MascotController, :show) put("/mascot", MascotController, :update) @@ -463,6 +464,7 @@ defmodule Pleroma.Web.Router do scope "/api/web", Pleroma.Web do pipe_through(:authenticated_api) + # Backend-obscure settings blob for MastoFE, don't parse/reuse elsewhere put("/settings", MastoFEController, :put_settings) end @@ -511,10 +513,6 @@ defmodule Pleroma.Web.Router do scope "/api", Pleroma.Web do pipe_through(:config) - get("/help/test", TwitterAPI.UtilController, :help_test) - post("/help/test", TwitterAPI.UtilController, :help_test) - get("/statusnet/config", TwitterAPI.UtilController, :config) - get("/statusnet/version", TwitterAPI.UtilController, :version) get("/pleroma/frontend_configurations", TwitterAPI.UtilController, :frontend_configurations) end @@ -721,7 +719,7 @@ defmodule Pleroma.Web.Router do get("/registration/:token", RedirectController, :registration_page) get("/:maybe_nickname_or_id", RedirectController, :redirector_with_meta) get("/api*path", RedirectController, :api_not_implemented) - get("/*path", RedirectController, :redirector) + get("/*path", RedirectController, :redirector_with_preload) options("/*path", RedirectController, :empty) end diff --git a/lib/pleroma/web/streamer/streamer.ex b/lib/pleroma/web/streamer/streamer.ex index d1d2c9b9c..d1d70e556 100644 --- a/lib/pleroma/web/streamer/streamer.ex +++ b/lib/pleroma/web/streamer/streamer.ex @@ -104,7 +104,9 @@ def stream(topics, items) do :ok end - def filtered_by_user?(%User{} = user, %Activity{} = item) do + def filtered_by_user?(user, item, streamed_type \\ :activity) + + def filtered_by_user?(%User{} = user, %Activity{} = item, streamed_type) do %{block: blocked_ap_ids, mute: muted_ap_ids, reblog_mute: reblog_muted_ap_ids} = User.outgoing_relationships_ap_ids(user, [:block, :mute, :reblog_mute]) @@ -116,6 +118,9 @@ def filtered_by_user?(%User{} = user, %Activity{} = item) do true <- Enum.all?([blocked_ap_ids, muted_ap_ids], &(item.actor not in &1)), true <- item.data["type"] != "Announce" || item.actor not in reblog_muted_ap_ids, + true <- + !(streamed_type == :activity && item.data["type"] == "Announce" && + parent.data["actor"] == user.ap_id), true <- Enum.all?([blocked_ap_ids, muted_ap_ids], &(parent.data["actor"] not in &1)), true <- MapSet.disjoint?(recipients, recipient_blocks), %{host: item_host} <- URI.parse(item.actor), @@ -130,8 +135,8 @@ def filtered_by_user?(%User{} = user, %Activity{} = item) do end end - def filtered_by_user?(%User{} = user, %Notification{activity: activity}) do - filtered_by_user?(user, activity) + def filtered_by_user?(%User{} = user, %Notification{activity: activity}, _) do + filtered_by_user?(user, activity, :notification) end defp do_stream("direct", item) do diff --git a/lib/pleroma/web/templates/layout/app.html.eex b/lib/pleroma/web/templates/layout/app.html.eex index 5836ec1e0..51603fe0c 100644 --- a/lib/pleroma/web/templates/layout/app.html.eex +++ b/lib/pleroma/web/templates/layout/app.html.eex @@ -37,7 +37,7 @@ } a { - color: color: #d8a070; + color: #d8a070; text-decoration: none; } diff --git a/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex b/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex index 750f65386..5ab59b57b 100644 --- a/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex +++ b/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex @@ -10,7 +10,7 @@ <%= form_for @conn, mfa_verify_path(@conn, :verify), [as: "mfa"], fn f -> %>
<%= label f, :code, "Recovery code" %> - <%= text_input f, :code %> + <%= text_input f, :code, [autocomplete: false, autocorrect: "off", autocapitalize: "off", autofocus: true, spellcheck: false] %> <%= hidden_input f, :mfa_token, value: @mfa_token %> <%= hidden_input f, :state, value: @state %> <%= hidden_input f, :redirect_uri, value: @redirect_uri %> diff --git a/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex b/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex index af6e546b0..af85777eb 100644 --- a/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex +++ b/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex @@ -10,7 +10,7 @@ <%= form_for @conn, mfa_verify_path(@conn, :verify), [as: "mfa"], fn f -> %>
<%= label f, :code, "Authentication code" %> - <%= text_input f, :code %> + <%= text_input f, :code, [autocomplete: false, autocorrect: "off", autocapitalize: "off", autofocus: true, pattern: "[0-9]*", spellcheck: false] %> <%= hidden_input f, :mfa_token, value: @mfa_token %> <%= hidden_input f, :state, value: @state %> <%= hidden_input f, :redirect_uri, value: @redirect_uri %> diff --git a/lib/pleroma/web/templates/o_auth/o_auth/oob_authorization_created.html.eex b/lib/pleroma/web/templates/o_auth/o_auth/oob_authorization_created.html.eex index 8443d906b..ffabe29a6 100644 --- a/lib/pleroma/web/templates/o_auth/o_auth/oob_authorization_created.html.eex +++ b/lib/pleroma/web/templates/o_auth/o_auth/oob_authorization_created.html.eex @@ -1,2 +1,2 @@

Successfully authorized

-

Token code is <%= @auth.token %>

+

Token code is
<%= @auth.token %>

diff --git a/lib/pleroma/web/templates/o_auth/o_auth/oob_token_exists.html.eex b/lib/pleroma/web/templates/o_auth/o_auth/oob_token_exists.html.eex index 961aad976..82785c4b9 100644 --- a/lib/pleroma/web/templates/o_auth/o_auth/oob_token_exists.html.eex +++ b/lib/pleroma/web/templates/o_auth/o_auth/oob_token_exists.html.eex @@ -1,2 +1,2 @@

Authorization exists

-

Access token is <%= @token.token %>

+

Access token is
<%= @token.token %>

diff --git a/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex b/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex index 521dc9322..072d889e2 100644 --- a/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex +++ b/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex @@ -135,7 +135,7 @@ defp handle_follow_error(conn, {:verify_mfa_code, followee, token, _} = _) do end defp handle_follow_error(conn, {:mfa_required, followee, user, _} = _) do - {:ok, %{token: token}} = MFA.Token.create_token(user) + {:ok, %{token: token}} = MFA.Token.create(user) render(conn, "follow_mfa.html", %{followee: followee, mfa_token: token, error: false}) end diff --git a/lib/pleroma/web/twitter_api/controllers/util_controller.ex b/lib/pleroma/web/twitter_api/controllers/util_controller.ex index fd2aee175..f02c4075c 100644 --- a/lib/pleroma/web/twitter_api/controllers/util_controller.ex +++ b/lib/pleroma/web/twitter_api/controllers/util_controller.ex @@ -13,7 +13,6 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do alias Pleroma.Notification alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.User - alias Pleroma.Web alias Pleroma.Web.CommonAPI alias Pleroma.Web.WebFinger @@ -41,12 +40,6 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do plug(OAuthScopesPlug, %{scopes: ["write:notifications"]} when action == :notifications_read) - plug(Pleroma.Plugs.SetFormatPlug when action in [:config, :version]) - - def help_test(conn, _params) do - json(conn, "ok") - end - def remote_subscribe(conn, %{"nickname" => nick, "profile" => _}) do with %User{} = user <- User.get_cached_by_nickname(nick), avatar = User.avatar_url(user) do @@ -88,90 +81,14 @@ def notifications_read(%{assigns: %{user: user}} = conn, %{"id" => notification_ end end - def config(%{assigns: %{format: "xml"}} = conn, _params) do - instance = Pleroma.Config.get(:instance) - - response = """ - - - #{Keyword.get(instance, :name)} - #{Web.base_url()} - #{Keyword.get(instance, :limit)} - #{!Keyword.get(instance, :registrations_open)} - - - """ - - conn - |> put_resp_content_type("application/xml") - |> send_resp(200, response) - end - - def config(conn, _params) do - instance = Pleroma.Config.get(:instance) - - vapid_public_key = Keyword.get(Pleroma.Web.Push.vapid_config(), :public_key) - - uploadlimit = %{ - uploadlimit: to_string(Keyword.get(instance, :upload_limit)), - avatarlimit: to_string(Keyword.get(instance, :avatar_upload_limit)), - backgroundlimit: to_string(Keyword.get(instance, :background_upload_limit)), - bannerlimit: to_string(Keyword.get(instance, :banner_upload_limit)) - } - - data = %{ - name: Keyword.get(instance, :name), - description: Keyword.get(instance, :description), - server: Web.base_url(), - textlimit: to_string(Keyword.get(instance, :limit)), - uploadlimit: uploadlimit, - closed: bool_to_val(Keyword.get(instance, :registrations_open), "0", "1"), - private: bool_to_val(Keyword.get(instance, :public, true), "0", "1"), - vapidPublicKey: vapid_public_key, - accountActivationRequired: - bool_to_val(Keyword.get(instance, :account_activation_required, false)), - invitesEnabled: bool_to_val(Keyword.get(instance, :invites_enabled, false)), - safeDMMentionsEnabled: bool_to_val(Pleroma.Config.get([:instance, :safe_dm_mentions])) - } - - managed_config = Keyword.get(instance, :managed_config) - - data = - if managed_config do - pleroma_fe = Pleroma.Config.get([:frontend_configurations, :pleroma_fe]) - Map.put(data, "pleromafe", pleroma_fe) - else - data - end - - json(conn, %{site: data}) - end - - defp bool_to_val(true), do: "1" - defp bool_to_val(_), do: "0" - defp bool_to_val(true, val, _), do: val - defp bool_to_val(_, _, val), do: val - def frontend_configurations(conn, _params) do config = - Pleroma.Config.get(:frontend_configurations, %{}) + Config.get(:frontend_configurations, %{}) |> Enum.into(%{}) json(conn, config) end - def version(%{assigns: %{format: "xml"}} = conn, _params) do - version = Pleroma.Application.named_version() - - conn - |> put_resp_content_type("application/xml") - |> send_resp(200, "#{version}") - end - - def version(conn, _params) do - json(conn, Pleroma.Application.named_version()) - end - def emoji(conn, _params) do emoji = Enum.reduce(Emoji.get_all(), %{}, fn {code, %Emoji{file: file, tags: tags}}, acc -> diff --git a/lib/pleroma/web/twitter_api/twitter_api.ex b/lib/pleroma/web/twitter_api/twitter_api.ex index 5cfb385ac..5d7948507 100644 --- a/lib/pleroma/web/twitter_api/twitter_api.ex +++ b/lib/pleroma/web/twitter_api/twitter_api.ex @@ -19,6 +19,7 @@ def register_user(params, opts \\ []) do |> Map.put(:nickname, params[:username]) |> Map.put(:name, Map.get(params, :fullname, params[:username])) |> Map.put(:password_confirmation, params[:password]) + |> Map.put(:registration_reason, params[:reason]) if Pleroma.Config.get([:instance, :registrations_open]) do create_user(params, opts) @@ -44,6 +45,7 @@ defp create_user(params, opts) do case User.register(changeset) do {:ok, user} -> + maybe_notify_admins(user) {:ok, user} {:error, changeset} -> @@ -56,9 +58,21 @@ defp create_user(params, opts) do end end + defp maybe_notify_admins(%User{} = account) do + if Pleroma.Config.get([:instance, :account_approval_required]) do + User.all_superusers() + |> Enum.filter(fn user -> not is_nil(user.email) end) + |> Enum.each(fn superuser -> + superuser + |> Pleroma.Emails.AdminEmail.new_unapproved_registration(account) + |> Pleroma.Emails.Mailer.deliver_async() + end) + end + end + def password_reset(nickname_or_email) do with true <- is_binary(nickname_or_email), - %User{local: true, email: email} = user when is_binary(email) <- + %User{local: true, email: email, deactivated: false} = user when is_binary(email) <- User.get_by_nickname_or_email(nickname_or_email), {:ok, token_record} <- Pleroma.PasswordResetToken.create_token(user) do user @@ -67,17 +81,8 @@ def password_reset(nickname_or_email) do {:ok, :enqueued} else - false -> - {:error, "bad user identifier"} - - %User{local: true, email: nil} -> + _ -> {:ok, :noop} - - %User{local: false} -> - {:error, "remote user"} - - nil -> - {:error, "unknown user"} end end diff --git a/lib/pleroma/web/twitter_api/views/util_view.ex b/lib/pleroma/web/twitter_api/views/util_view.ex index 52054e020..d3bdb4f62 100644 --- a/lib/pleroma/web/twitter_api/views/util_view.ex +++ b/lib/pleroma/web/twitter_api/views/util_view.ex @@ -5,4 +5,18 @@ defmodule Pleroma.Web.TwitterAPI.UtilView do use Pleroma.Web, :view import Phoenix.HTML.Form + alias Pleroma.Web + + def status_net_config(instance) do + """ + + + #{Keyword.get(instance, :name)} + #{Web.base_url()} + #{Keyword.get(instance, :limit)} + #{!Keyword.get(instance, :registrations_open)} + + + """ + end end diff --git a/lib/pleroma/web/views/masto_fe_view.ex b/lib/pleroma/web/views/masto_fe_view.ex index c3096006e..b1669d198 100644 --- a/lib/pleroma/web/views/masto_fe_view.ex +++ b/lib/pleroma/web/views/masto_fe_view.ex @@ -9,36 +9,6 @@ defmodule Pleroma.Web.MastoFEView do alias Pleroma.Web.MastodonAPI.AccountView alias Pleroma.Web.MastodonAPI.CustomEmojiView - @default_settings %{ - onboarded: true, - home: %{ - shows: %{ - reblog: true, - reply: true - } - }, - notifications: %{ - alerts: %{ - follow: true, - favourite: true, - reblog: true, - mention: true - }, - shows: %{ - follow: true, - favourite: true, - reblog: true, - mention: true - }, - sounds: %{ - follow: true, - favourite: true, - reblog: true, - mention: true - } - } - } - def initial_state(token, user, custom_emojis) do limit = Config.get([:instance, :limit]) @@ -86,7 +56,7 @@ def initial_state(token, user, custom_emojis) do "video\/mp4" ] }, - settings: user.settings || @default_settings, + settings: user.mastofe_settings || %{}, push_subscription: nil, accounts: %{user.id => render(AccountView, "show.json", user: user, for: user)}, custom_emojis: render(CustomEmojiView, "index.json", custom_emojis: custom_emojis), diff --git a/lib/pleroma/web/web_finger/web_finger.ex b/lib/pleroma/web/web_finger/web_finger.ex index 71ccf251a..6629f5356 100644 --- a/lib/pleroma/web/web_finger/web_finger.ex +++ b/lib/pleroma/web/web_finger/web_finger.ex @@ -136,12 +136,12 @@ def get_template_from_xml(body) do def find_lrdd_template(domain) do with {:ok, %{status: status, body: body}} when status in 200..299 <- - HTTP.get("http://#{domain}/.well-known/host-meta", []) do + HTTP.get("http://#{domain}/.well-known/host-meta") do get_template_from_xml(body) else _ -> with {:ok, %{body: body, status: status}} when status in 200..299 <- - HTTP.get("https://#{domain}/.well-known/host-meta", []) do + HTTP.get("https://#{domain}/.well-known/host-meta") do get_template_from_xml(body) else e -> {:error, "Can't find LRDD template: #{inspect(e)}"} @@ -149,6 +149,18 @@ def find_lrdd_template(domain) do end end + defp get_address_from_domain(domain, encoded_account) when is_binary(domain) do + case find_lrdd_template(domain) do + {:ok, template} -> + String.replace(template, "{uri}", encoded_account) + + _ -> + "https://#{domain}/.well-known/webfinger?resource=#{encoded_account}" + end + end + + defp get_address_from_domain(_, _), do: nil + @spec finger(String.t()) :: {:ok, map()} | {:error, any()} def finger(account) do account = String.trim_leading(account, "@") @@ -163,16 +175,8 @@ def finger(account) do encoded_account = URI.encode("acct:#{account}") - address = - case find_lrdd_template(domain) do - {:ok, template} -> - String.replace(template, "{uri}", encoded_account) - - _ -> - "https://#{domain}/.well-known/webfinger?resource=#{encoded_account}" - end - - with response <- + with address when is_binary(address) <- get_address_from_domain(domain, encoded_account), + response <- HTTP.get( address, [{"accept", "application/xrd+xml,application/jrd+json"}] diff --git a/lib/pleroma/workers/attachments_cleanup_worker.ex b/lib/pleroma/workers/attachments_cleanup_worker.ex index 49352db2a..58226b395 100644 --- a/lib/pleroma/workers/attachments_cleanup_worker.ex +++ b/lib/pleroma/workers/attachments_cleanup_worker.ex @@ -11,20 +11,25 @@ defmodule Pleroma.Workers.AttachmentsCleanupWorker do use Pleroma.Workers.WorkerHelper, queue: "attachments_cleanup" @impl Oban.Worker - def perform( - %{ + def perform(%Job{ + args: %{ "op" => "cleanup_attachments", "object" => %{"data" => %{"attachment" => [_ | _] = attachments, "actor" => actor}} - }, - _job - ) do - hrefs = - Enum.flat_map(attachments, fn attachment -> - Enum.map(attachment["url"], & &1["href"]) - end) + } + }) do + attachments + |> Enum.flat_map(fn item -> Enum.map(item["url"], & &1["href"]) end) + |> fetch_objects + |> prepare_objects(actor, Enum.map(attachments, & &1["name"])) + |> filter_objects + |> do_clean - names = Enum.map(attachments, & &1["name"]) + {:ok, :success} + end + def perform(%Job{args: %{"op" => "cleanup_attachments", "object" => _object}}), do: {:ok, :skip} + + defp do_clean({object_ids, attachment_urls}) do uploader = Pleroma.Config.get([Pleroma.Upload, :uploader]) prefix = @@ -39,68 +44,70 @@ def perform( "/" ) - # find all objects for copies of the attachments, name and actor doesn't matter here - object_ids_and_hrefs = - from(o in Object, - where: - fragment( - "to_jsonb(array(select jsonb_array_elements((?)#>'{url}') ->> 'href' where jsonb_typeof((?)#>'{url}') = 'array'))::jsonb \\?| (?)", - o.data, - o.data, - ^hrefs - ) - ) - # The query above can be time consumptive on large instances until we - # refactor how uploads are stored - |> Repo.all(timeout: :infinity) - # we should delete 1 object for any given attachment, but don't delete - # files if there are more than 1 object for it - |> Enum.reduce(%{}, fn %{ - id: id, - data: %{ - "url" => [%{"href" => href}], - "actor" => obj_actor, - "name" => name - } - }, - acc -> - Map.update(acc, href, %{id: id, count: 1}, fn val -> - case obj_actor == actor and name in names do - true -> - # set id of the actor's object that will be deleted - %{val | id: id, count: val.count + 1} + Enum.each(attachment_urls, fn href -> + href + |> String.trim_leading("#{base_url}/#{prefix}") + |> uploader.delete_file() + end) - false -> - # another actor's object, just increase count to not delete file - %{val | count: val.count + 1} - end - end) - end) - |> Enum.map(fn {href, %{id: id, count: count}} -> - # only delete files that have single instance - with 1 <- count do - href - |> String.trim_leading("#{base_url}/#{prefix}") - |> uploader.delete_file() - - {id, href} - else - _ -> {id, nil} - end - end) - - object_ids = Enum.map(object_ids_and_hrefs, fn {id, _} -> id end) - - from(o in Object, where: o.id in ^object_ids) - |> Repo.delete_all() - - object_ids_and_hrefs - |> Enum.filter(fn {_, href} -> not is_nil(href) end) - |> Enum.map(&elem(&1, 1)) - |> Pleroma.Web.MediaProxy.Invalidation.purge() - - {:ok, :success} + delete_objects(object_ids) end - def perform(%{"op" => "cleanup_attachments", "object" => _object}, _job), do: {:ok, :skip} + defp delete_objects([_ | _] = object_ids) do + Repo.delete_all(from(o in Object, where: o.id in ^object_ids)) + end + + defp delete_objects(_), do: :ok + + # we should delete 1 object for any given attachment, but don't delete + # files if there are more than 1 object for it + defp filter_objects(objects) do + Enum.reduce(objects, {[], []}, fn {href, %{id: id, count: count}}, {ids, hrefs} -> + with 1 <- count do + {ids ++ [id], hrefs ++ [href]} + else + _ -> {ids ++ [id], hrefs} + end + end) + end + + defp prepare_objects(objects, actor, names) do + objects + |> Enum.reduce(%{}, fn %{ + id: id, + data: %{ + "url" => [%{"href" => href}], + "actor" => obj_actor, + "name" => name + } + }, + acc -> + Map.update(acc, href, %{id: id, count: 1}, fn val -> + case obj_actor == actor and name in names do + true -> + # set id of the actor's object that will be deleted + %{val | id: id, count: val.count + 1} + + false -> + # another actor's object, just increase count to not delete file + %{val | count: val.count + 1} + end + end) + end) + end + + defp fetch_objects(hrefs) do + from(o in Object, + where: + fragment( + "to_jsonb(array(select jsonb_array_elements((?)#>'{url}') ->> 'href' where jsonb_typeof((?)#>'{url}') = 'array'))::jsonb \\?| (?)", + o.data, + o.data, + ^hrefs + ) + ) + # The query above can be time consumptive on large instances until we + # refactor how uploads are stored + |> Repo.all(timeout: :infinity) + end end diff --git a/lib/pleroma/workers/background_worker.ex b/lib/pleroma/workers/background_worker.ex index 57c3a9c3a..cec5a7462 100644 --- a/lib/pleroma/workers/background_worker.ex +++ b/lib/pleroma/workers/background_worker.ex @@ -11,59 +11,59 @@ defmodule Pleroma.Workers.BackgroundWorker do @impl Oban.Worker - def perform(%{"op" => "deactivate_user", "user_id" => user_id, "status" => status}, _job) do + def perform(%Job{args: %{"op" => "deactivate_user", "user_id" => user_id, "status" => status}}) do user = User.get_cached_by_id(user_id) User.perform(:deactivate_async, user, status) end - def perform(%{"op" => "delete_user", "user_id" => user_id}, _job) do + def perform(%Job{args: %{"op" => "delete_user", "user_id" => user_id}}) do user = User.get_cached_by_id(user_id) User.perform(:delete, user) end - def perform(%{"op" => "force_password_reset", "user_id" => user_id}, _job) do + def perform(%Job{args: %{"op" => "force_password_reset", "user_id" => user_id}}) do user = User.get_cached_by_id(user_id) User.perform(:force_password_reset, user) end - def perform( - %{ + def perform(%Job{ + args: %{ "op" => "blocks_import", "blocker_id" => blocker_id, "blocked_identifiers" => blocked_identifiers - }, - _job - ) do + } + }) do blocker = User.get_cached_by_id(blocker_id) {:ok, User.perform(:blocks_import, blocker, blocked_identifiers)} end - def perform( - %{ + def perform(%Job{ + args: %{ "op" => "follow_import", "follower_id" => follower_id, "followed_identifiers" => followed_identifiers - }, - _job - ) do + } + }) do follower = User.get_cached_by_id(follower_id) {:ok, User.perform(:follow_import, follower, followed_identifiers)} end - def perform(%{"op" => "media_proxy_preload", "message" => message}, _job) do + def perform(%Job{args: %{"op" => "media_proxy_preload", "message" => message}}) do MediaProxyWarmingPolicy.perform(:preload, message) end - def perform(%{"op" => "media_proxy_prefetch", "url" => url}, _job) do + def perform(%Job{args: %{"op" => "media_proxy_prefetch", "url" => url}}) do MediaProxyWarmingPolicy.perform(:prefetch, url) end - def perform(%{"op" => "fetch_data_for_activity", "activity_id" => activity_id}, _job) do + def perform(%Job{args: %{"op" => "fetch_data_for_activity", "activity_id" => activity_id}}) do activity = Activity.get_by_id(activity_id) Pleroma.Web.RichMedia.Helpers.perform(:fetch, activity) end - def perform(%{"op" => "move_following", "origin_id" => origin_id, "target_id" => target_id}, _) do + def perform(%Job{ + args: %{"op" => "move_following", "origin_id" => origin_id, "target_id" => target_id} + }) do origin = User.get_cached_by_id(origin_id) target = User.get_cached_by_id(target_id) diff --git a/lib/pleroma/workers/cron/clear_oauth_token_worker.ex b/lib/pleroma/workers/cron/clear_oauth_token_worker.ex deleted file mode 100644 index a4c3b9516..000000000 --- a/lib/pleroma/workers/cron/clear_oauth_token_worker.ex +++ /dev/null @@ -1,23 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Workers.Cron.ClearOauthTokenWorker do - @moduledoc """ - The worker to cleanup expired oAuth tokens. - """ - - use Oban.Worker, queue: "background" - - alias Pleroma.Config - alias Pleroma.Web.OAuth.Token - - @impl Oban.Worker - def perform(_opts, _job) do - if Config.get([:oauth2, :clean_expired_tokens], false) do - Token.delete_expired_tokens() - else - :ok - end - end -end diff --git a/lib/pleroma/workers/cron/digest_emails_worker.ex b/lib/pleroma/workers/cron/digest_emails_worker.ex index 7f09ff3cf..0c56f00fb 100644 --- a/lib/pleroma/workers/cron/digest_emails_worker.ex +++ b/lib/pleroma/workers/cron/digest_emails_worker.ex @@ -19,7 +19,7 @@ defmodule Pleroma.Workers.Cron.DigestEmailsWorker do require Logger @impl Oban.Worker - def perform(_opts, _job) do + def perform(_job) do config = Config.get([:email_notifications, :digest]) if config[:active] do @@ -37,9 +37,9 @@ def perform(_opts, _job) do ) |> Repo.all() |> send_emails - else - :ok end + + :ok end def send_emails(users) do diff --git a/lib/pleroma/workers/cron/new_users_digest_worker.ex b/lib/pleroma/workers/cron/new_users_digest_worker.ex index 5c816b3fe..8bbaed83d 100644 --- a/lib/pleroma/workers/cron/new_users_digest_worker.ex +++ b/lib/pleroma/workers/cron/new_users_digest_worker.ex @@ -12,7 +12,7 @@ defmodule Pleroma.Workers.Cron.NewUsersDigestWorker do use Pleroma.Workers.WorkerHelper, queue: "new_users_digest" @impl Oban.Worker - def perform(_args, _job) do + def perform(_job) do if Pleroma.Config.get([Pleroma.Emails.NewUsersDigestEmail, :enabled]) do today = NaiveDateTime.utc_now() |> Timex.beginning_of_day() @@ -55,11 +55,9 @@ def perform(_args, _job) do |> Repo.all() |> Enum.map(&Pleroma.Emails.NewUsersDigestEmail.new_users(&1, users_and_statuses)) |> Enum.each(&Pleroma.Emails.Mailer.deliver/1) - else - :ok end - else - :ok end + + :ok end end diff --git a/lib/pleroma/workers/cron/purge_expired_activities_worker.ex b/lib/pleroma/workers/cron/purge_expired_activities_worker.ex deleted file mode 100644 index 84b3b84de..000000000 --- a/lib/pleroma/workers/cron/purge_expired_activities_worker.ex +++ /dev/null @@ -1,48 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker do - @moduledoc """ - The worker to purge expired activities. - """ - - use Oban.Worker, queue: "activity_expiration" - - alias Pleroma.Activity - alias Pleroma.ActivityExpiration - alias Pleroma.Config - alias Pleroma.User - alias Pleroma.Web.CommonAPI - - require Logger - - @interval :timer.minutes(1) - - @impl Oban.Worker - def perform(_opts, _job) do - if Config.get([ActivityExpiration, :enabled]) do - Enum.each(ActivityExpiration.due_expirations(@interval), &delete_activity/1) - else - :ok - end - end - - def delete_activity(%ActivityExpiration{activity_id: activity_id}) do - with {:activity, %Activity{} = activity} <- - {:activity, Activity.get_by_id_with_object(activity_id)}, - {:user, %User{} = user} <- {:user, User.get_by_ap_id(activity.object.data["actor"])} do - CommonAPI.delete(activity.id, user) - else - {:activity, _} -> - Logger.error( - "#{__MODULE__} Couldn't delete expired activity: not found activity ##{activity_id}" - ) - - {:user, _} -> - Logger.error( - "#{__MODULE__} Couldn't delete expired activity: not found actorof ##{activity_id}" - ) - end - end -end diff --git a/lib/pleroma/workers/cron/stats_worker.ex b/lib/pleroma/workers/cron/stats_worker.ex deleted file mode 100644 index e9b8d59c4..000000000 --- a/lib/pleroma/workers/cron/stats_worker.ex +++ /dev/null @@ -1,16 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Workers.Cron.StatsWorker do - @moduledoc """ - The worker to update peers statistics. - """ - - use Oban.Worker, queue: "background" - - @impl Oban.Worker - def perform(_opts, _job) do - Pleroma.Stats.do_collect() - end -end diff --git a/lib/pleroma/workers/mailer_worker.ex b/lib/pleroma/workers/mailer_worker.ex index 6955338a5..32273cfa5 100644 --- a/lib/pleroma/workers/mailer_worker.ex +++ b/lib/pleroma/workers/mailer_worker.ex @@ -6,7 +6,7 @@ defmodule Pleroma.Workers.MailerWorker do use Pleroma.Workers.WorkerHelper, queue: "mailer" @impl Oban.Worker - def perform(%{"op" => "email", "encoded_email" => encoded_email, "config" => config}, _job) do + def perform(%Job{args: %{"op" => "email", "encoded_email" => encoded_email, "config" => config}}) do encoded_email |> Base.decode64!() |> :erlang.binary_to_term() diff --git a/lib/pleroma/workers/publisher_worker.ex b/lib/pleroma/workers/publisher_worker.ex index daf79efc0..e739c3cd0 100644 --- a/lib/pleroma/workers/publisher_worker.ex +++ b/lib/pleroma/workers/publisher_worker.ex @@ -8,17 +8,17 @@ defmodule Pleroma.Workers.PublisherWorker do use Pleroma.Workers.WorkerHelper, queue: "federator_outgoing" - def backoff(attempt) when is_integer(attempt) do + def backoff(%Job{attempt: attempt}) when is_integer(attempt) do Pleroma.Workers.WorkerHelper.sidekiq_backoff(attempt, 5) end @impl Oban.Worker - def perform(%{"op" => "publish", "activity_id" => activity_id}, _job) do + def perform(%Job{args: %{"op" => "publish", "activity_id" => activity_id}}) do activity = Activity.get_by_id(activity_id) Federator.perform(:publish, activity) end - def perform(%{"op" => "publish_one", "module" => module_name, "params" => params}, _job) do + def perform(%Job{args: %{"op" => "publish_one", "module" => module_name, "params" => params}}) do params = Map.new(params, fn {k, v} -> {String.to_atom(k), v} end) Federator.perform(:publish_one, String.to_atom(module_name), params) end diff --git a/lib/pleroma/workers/purge_expired_activity.ex b/lib/pleroma/workers/purge_expired_activity.ex new file mode 100644 index 000000000..c168890a2 --- /dev/null +++ b/lib/pleroma/workers/purge_expired_activity.ex @@ -0,0 +1,72 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Workers.PurgeExpiredActivity do + @moduledoc """ + Worker which purges expired activity. + """ + + use Oban.Worker, queue: :activity_expiration, max_attempts: 1 + + import Ecto.Query + + alias Pleroma.Activity + + @spec enqueue(map()) :: + {:ok, Oban.Job.t()} + | {:error, :expired_activities_disabled} + | {:error, :expiration_too_close} + def enqueue(args) do + with true <- enabled?() do + {scheduled_at, args} = Map.pop(args, :expires_at) + + args + |> new(scheduled_at: scheduled_at) + |> Oban.insert() + end + end + + @impl true + def perform(%Oban.Job{args: %{"activity_id" => id}}) do + with %Activity{} = activity <- find_activity(id), + %Pleroma.User{} = user <- find_user(activity.object.data["actor"]) do + Pleroma.Web.CommonAPI.delete(activity.id, user) + end + end + + defp enabled? do + with false <- Pleroma.Config.get([__MODULE__, :enabled], false) do + {:error, :expired_activities_disabled} + end + end + + defp find_activity(id) do + with nil <- Activity.get_by_id_with_object(id) do + {:error, :activity_not_found} + end + end + + defp find_user(ap_id) do + with nil <- Pleroma.User.get_by_ap_id(ap_id) do + {:error, :user_not_found} + end + end + + def get_expiration(id) do + from(j in Oban.Job, + where: j.state == "scheduled", + where: j.queue == "activity_expiration", + where: fragment("?->>'activity_id' = ?", j.args, ^id) + ) + |> Pleroma.Repo.one() + end + + @spec expires_late_enough?(DateTime.t()) :: boolean() + def expires_late_enough?(scheduled_at) do + now = DateTime.utc_now() + diff = DateTime.diff(scheduled_at, now, :millisecond) + min_lifetime = Pleroma.Config.get([__MODULE__, :min_lifetime], 600) + diff > :timer.seconds(min_lifetime) + end +end diff --git a/lib/pleroma/workers/purge_expired_token.ex b/lib/pleroma/workers/purge_expired_token.ex new file mode 100644 index 000000000..a81e0cd28 --- /dev/null +++ b/lib/pleroma/workers/purge_expired_token.ex @@ -0,0 +1,29 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Workers.PurgeExpiredToken do + @moduledoc """ + Worker which purges expired OAuth tokens + """ + + use Oban.Worker, queue: :token_expiration, max_attempts: 1 + + @spec enqueue(%{token_id: integer(), valid_until: DateTime.t(), mod: module()}) :: + {:ok, Oban.Job.t()} | {:error, Ecto.Changeset.t()} + def enqueue(args) do + {scheduled_at, args} = Map.pop(args, :valid_until) + + args + |> __MODULE__.new(scheduled_at: scheduled_at) + |> Oban.insert() + end + + @impl true + def perform(%Oban.Job{args: %{"token_id" => id, "mod" => module}}) do + module + |> String.to_existing_atom() + |> Pleroma.Repo.get(id) + |> Pleroma.Repo.delete() + end +end diff --git a/lib/pleroma/workers/receiver_worker.ex b/lib/pleroma/workers/receiver_worker.ex index f7a7124f3..1b97af1a8 100644 --- a/lib/pleroma/workers/receiver_worker.ex +++ b/lib/pleroma/workers/receiver_worker.ex @@ -8,7 +8,7 @@ defmodule Pleroma.Workers.ReceiverWorker do use Pleroma.Workers.WorkerHelper, queue: "federator_incoming" @impl Oban.Worker - def perform(%{"op" => "incoming_ap_doc", "params" => params}, _job) do + def perform(%Job{args: %{"op" => "incoming_ap_doc", "params" => params}}) do Federator.perform(:incoming_ap_doc, params) end end diff --git a/lib/pleroma/workers/remote_fetcher_worker.ex b/lib/pleroma/workers/remote_fetcher_worker.ex index ec6534f21..27e2e3386 100644 --- a/lib/pleroma/workers/remote_fetcher_worker.ex +++ b/lib/pleroma/workers/remote_fetcher_worker.ex @@ -8,13 +8,7 @@ defmodule Pleroma.Workers.RemoteFetcherWorker do use Pleroma.Workers.WorkerHelper, queue: "remote_fetcher" @impl Oban.Worker - def perform( - %{ - "op" => "fetch_remote", - "id" => id - } = args, - _job - ) do + def perform(%Job{args: %{"op" => "fetch_remote", "id" => id} = args}) do {:ok, _object} = Fetcher.fetch_object_from_id(id, depth: args["depth"]) end end diff --git a/lib/pleroma/workers/scheduled_activity_worker.ex b/lib/pleroma/workers/scheduled_activity_worker.ex index 97d1efbfb..dd9986fe4 100644 --- a/lib/pleroma/workers/scheduled_activity_worker.ex +++ b/lib/pleroma/workers/scheduled_activity_worker.ex @@ -17,7 +17,7 @@ defmodule Pleroma.Workers.ScheduledActivityWorker do require Logger @impl Oban.Worker - def perform(%{"activity_id" => activity_id}, _job) do + def perform(%Job{args: %{"activity_id" => activity_id}}) do if Config.get([ScheduledActivity, :enabled]) do case Pleroma.Repo.get(ScheduledActivity, activity_id) do %ScheduledActivity{} = scheduled_activity -> diff --git a/lib/pleroma/workers/transmogrifier_worker.ex b/lib/pleroma/workers/transmogrifier_worker.ex index 11239ca5e..15f36375c 100644 --- a/lib/pleroma/workers/transmogrifier_worker.ex +++ b/lib/pleroma/workers/transmogrifier_worker.ex @@ -8,7 +8,7 @@ defmodule Pleroma.Workers.TransmogrifierWorker do use Pleroma.Workers.WorkerHelper, queue: "transmogrifier" @impl Oban.Worker - def perform(%{"op" => "user_upgrade", "user_id" => user_id}, _job) do + def perform(%Job{args: %{"op" => "user_upgrade", "user_id" => user_id}}) do user = User.get_cached_by_id(user_id) Pleroma.Web.ActivityPub.Transmogrifier.perform(:user_upgrade, user) end diff --git a/lib/pleroma/workers/web_pusher_worker.ex b/lib/pleroma/workers/web_pusher_worker.ex index 58ad25e39..0cfdc6a6f 100644 --- a/lib/pleroma/workers/web_pusher_worker.ex +++ b/lib/pleroma/workers/web_pusher_worker.ex @@ -9,7 +9,7 @@ defmodule Pleroma.Workers.WebPusherWorker do use Pleroma.Workers.WorkerHelper, queue: "web_push" @impl Oban.Worker - def perform(%{"op" => "web_push", "notification_id" => notification_id}, _job) do + def perform(%Job{args: %{"op" => "web_push", "notification_id" => notification_id}}) do notification = Notification |> Repo.get(notification_id) diff --git a/lib/pleroma/workers/worker_helper.ex b/lib/pleroma/workers/worker_helper.ex index d1f90c35b..7d1289be2 100644 --- a/lib/pleroma/workers/worker_helper.ex +++ b/lib/pleroma/workers/worker_helper.ex @@ -32,6 +32,8 @@ defmacro __using__(opts) do queue: unquote(queue), max_attempts: 1 + alias Oban.Job + def enqueue(op, params, worker_args \\ []) do params = Map.merge(%{"op" => op}, params) queue_atom = String.to_atom(unquote(queue)) @@ -39,7 +41,7 @@ def enqueue(op, params, worker_args \\ []) do unquote(caller_module) |> apply(:new, [params, worker_args]) - |> Pleroma.Repo.insert() + |> Oban.insert() end end end diff --git a/mix.exs b/mix.exs index 8fcbaa34e..d2a40bcc8 100644 --- a/mix.exs +++ b/mix.exs @@ -4,8 +4,8 @@ defmodule Pleroma.Mixfile do def project do [ app: :pleroma, - version: version("2.0.50"), - elixir: "~> 1.8", + version: version("2.1.50"), + elixir: "~> 1.9", elixirc_paths: elixirc_paths(Mix.env()), compilers: [:phoenix, :gettext] ++ Mix.compilers(), elixirc_options: [warnings_as_errors: warnings_as_errors(Mix.env())], @@ -90,8 +90,6 @@ defp elixirc_paths(:test), do: ["lib", "test/support"] defp elixirc_paths(_), do: ["lib"] defp warnings_as_errors(:prod), do: false - # Uncomment this if you need testing configurable_from_database logic - # defp warnings_as_errors(:dev), do: false defp warnings_as_errors(_), do: true # Specifies OAuth dependencies. @@ -116,65 +114,57 @@ defp oauth_deps do # Type `mix help deps` for examples and options. defp deps do [ - {:phoenix, "~> 1.4.8"}, - {:tzdata, "~> 0.5.21"}, - {:plug_cowboy, "~> 2.0"}, + {:phoenix, "~> 1.4.17"}, + {:tzdata, "~> 1.0.3"}, + {:plug_cowboy, "~> 2.3"}, {:phoenix_pubsub, "~> 1.1"}, {:phoenix_ecto, "~> 4.0"}, {:ecto_enum, "~> 1.4"}, - {:ecto_sql, "~> 3.3.2"}, - {:postgrex, ">= 0.13.5"}, - {:oban, "~> 1.2"}, - {:gettext, "~> 0.15"}, - {:pbkdf2_elixir, "~> 1.0"}, - {:bcrypt_elixir, "~> 2.0"}, + {:ecto_sql, "~> 3.4.4"}, + {:postgrex, ">= 0.15.5"}, + {:oban, "~> 2.0.0"}, + {:gettext, "~> 0.18"}, + {:pbkdf2_elixir, "~> 1.2"}, + {:bcrypt_elixir, "~> 2.2"}, {:trailing_format_plug, "~> 0.0.7"}, - {:fast_sanitize, "~> 0.1"}, + {:fast_sanitize, "~> 0.2.0"}, {:html_entities, "~> 0.5", override: true}, - {:phoenix_html, "~> 2.10"}, - {:calendar, "~> 0.17.4"}, + {:phoenix_html, "~> 2.14"}, + {:calendar, "~> 1.0"}, {:cachex, "~> 3.2"}, {:poison, "~> 3.0", override: true}, - # {:tesla, "~> 1.3", override: true}, {:tesla, - git: "https://git.pleroma.social/pleroma/elixir-libraries/tesla.git", - ref: "61b7503cef33f00834f78ddfafe0d5d9dec2270b", + git: "https://github.com/teamon/tesla/", + ref: "9f7261ca49f9f901ceb73b60219ad6f8a9f6aa30", override: true}, {:castore, "~> 0.1"}, - {:cowlib, "~> 2.8", override: true}, + {:cowlib, "~> 2.9", override: true}, {:gun, - github: "ninenines/gun", ref: "e1a69b36b180a574c0ac314ced9613fdd52312cc", override: true}, - {:jason, "~> 1.0"}, - {:mogrify, "~> 0.6.1"}, + github: "ninenines/gun", ref: "921c47146b2d9567eac7e9a4d2ccc60fffd4f327", override: true}, + {:jason, "~> 1.2"}, + {:mogrify, "~> 0.7.4"}, {:ex_aws, "~> 2.1"}, {:ex_aws_s3, "~> 2.0"}, {:sweet_xml, "~> 0.6.6"}, - {:earmark, "~> 1.3"}, + {:earmark, "1.4.3"}, {:bbcode_pleroma, "~> 0.2.0"}, - {:ex_machina, "~> 2.3", only: :test}, - {:credo, "~> 1.1.0", only: [:dev, :test], runtime: false}, - {:mock, "~> 0.3.3", only: :test}, {:crypt, - git: "https://github.com/msantos/crypt", ref: "f63a705f92c26955977ee62a313012e309a4d77a"}, - {:cors_plug, "~> 1.5"}, - {:ex_doc, "~> 0.21", only: :dev, runtime: false}, - {:web_push_encryption, "~> 0.2.1"}, - {:swoosh, "~> 0.23.2"}, - {:phoenix_swoosh, "~> 0.2"}, + git: "https://github.com/msantos/crypt.git", + ref: "f63a705f92c26955977ee62a313012e309a4d77a"}, + {:cors_plug, "~> 2.0"}, + {:web_push_encryption, "~> 0.3"}, + {:swoosh, "~> 1.0"}, + {:phoenix_swoosh, "~> 0.3"}, {:gen_smtp, "~> 0.13"}, - {:websocket_client, git: "https://github.com/jeremyong/websocket_client.git", only: :test}, {:ex_syslogger, "~> 1.4"}, - {:floki, "~> 0.25"}, - {:timex, "~> 3.5"}, + {:floki, "~> 0.27"}, + {:timex, "~> 3.6"}, {:ueberauth, "~> 0.4"}, - {:auto_linker, - git: "https://git.pleroma.social/pleroma/auto_linker.git", - ref: "95e8188490e97505c56636c1379ffdf036c1fdde"}, - {:http_signatures, - git: "https://git.pleroma.social/pleroma/http_signatures.git", - ref: "293d77bb6f4a67ac8bde1428735c3b42f22cbb30"}, + {:linkify, "~> 0.2.0"}, + {:http_signatures, "~> 0.1.0"}, {:telemetry, "~> 0.3"}, {:poolboy, "~> 1.5"}, + {:prometheus, "~> 4.6"}, {:prometheus_ex, "~> 3.0"}, {:prometheus_plugs, "~> 1.1"}, {:prometheus_phoenix, "~> 1.3"}, @@ -183,24 +173,36 @@ defp deps do {:quack, "~> 0.1.1"}, {:joken, "~> 2.0"}, {:benchee, "~> 1.0"}, - {:pot, "~> 0.10.2"}, + {:pot, "~> 0.11"}, {:esshd, "~> 0.1.0", runtime: Application.get_env(:esshd, :enabled, false)}, {:ex_const, "~> 0.2"}, {:plug_static_index_html, "~> 1.0.0"}, - {:excoveralls, "~> 0.12.1", only: :test}, {:flake_id, "~> 0.1.0"}, + {:concurrent_limiter, + git: "https://git.pleroma.social/pleroma/elixir-libraries/concurrent_limiter.git", + ref: "d81be41024569330f296fc472e24198d7499ba78"}, {:remote_ip, git: "https://git.pleroma.social/pleroma/remote_ip.git", ref: "b647d0deecaa3acb140854fe4bda5b7e1dc6d1c8"}, {:captcha, git: "https://git.pleroma.social/pleroma/elixir-libraries/elixir-captcha.git", ref: "e0f16822d578866e186a0974d65ad58cddc1e2ab"}, - {:mox, "~> 0.5", only: :test}, {:restarter, path: "./restarter"}, {:majic, git: "https://github.com/hrefhref/majic", branch: "develop"}, {:open_api_spex, git: "https://git.pleroma.social/pleroma/elixir-libraries/open_api_spex.git", - ref: "f296ac0924ba3cf79c7a588c4c252889df4c2edd"} + ref: "f296ac0924ba3cf79c7a588c4c252889df4c2edd"}, + + ## dev & test + {:ex_doc, "~> 0.22", only: :dev, runtime: false}, + {:ex_machina, "~> 2.4", only: :test}, + {:credo, "~> 1.4", only: [:dev, :test], runtime: false}, + {:mock, "~> 0.3.5", only: :test}, + # temporary downgrade for excoveralls, hackney until hackney max_connections bug will be fixed + {:excoveralls, "0.12.3", only: :test}, + {:hackney, "1.15.2", override: true}, + {:mox, "~> 0.5", only: :test}, + {:websocket_client, git: "https://github.com/jeremyong/websocket_client.git", only: :test} ] ++ oauth_deps() end @@ -217,7 +219,8 @@ defp aliases do "ecto.setup": ["ecto.create", "ecto.migrate", "run priv/repo/seeds.exs"], "ecto.reset": ["ecto.drop", "ecto.setup"], test: ["ecto.create --quiet", "ecto.migrate", "test"], - docs: ["pleroma.docs", "docs"] + docs: ["pleroma.docs", "docs"], + analyze: ["credo --strict --only=warnings,todo,fixme,consistency,readability"] ] end @@ -231,32 +234,37 @@ defp aliases do defp version(version) do identifier_filter = ~r/[^0-9a-z\-]+/i - # Pre-release version, denoted from patch version with a hyphen - {tag, tag_err} = - System.cmd("git", ["describe", "--tags", "--abbrev=0"], stderr_to_stdout: true) - - {describe, describe_err} = System.cmd("git", ["describe", "--tags", "--abbrev=8"]) - {commit_hash, commit_hash_err} = System.cmd("git", ["rev-parse", "--short", "HEAD"]) + git_available? = match?({_output, 0}, System.cmd("sh", ["-c", "command -v git"])) git_pre_release = - cond do - tag_err == 0 and describe_err == 0 -> - describe - |> String.trim() - |> String.replace(String.trim(tag), "") - |> String.trim_leading("-") - |> String.trim() + if git_available? do + {tag, tag_err} = + System.cmd("git", ["describe", "--tags", "--abbrev=0"], stderr_to_stdout: true) - commit_hash_err == 0 -> - "0-g" <> String.trim(commit_hash) + {describe, describe_err} = System.cmd("git", ["describe", "--tags", "--abbrev=8"]) + {commit_hash, commit_hash_err} = System.cmd("git", ["rev-parse", "--short", "HEAD"]) - true -> - "" + # Pre-release version, denoted from patch version with a hyphen + cond do + tag_err == 0 and describe_err == 0 -> + describe + |> String.trim() + |> String.replace(String.trim(tag), "") + |> String.trim_leading("-") + |> String.trim() + + commit_hash_err == 0 -> + "0-g" <> String.trim(commit_hash) + + true -> + nil + end end # Branch name as pre-release version component, denoted with a dot branch_name = - with {branch_name, 0} <- System.cmd("git", ["rev-parse", "--abbrev-ref", "HEAD"]), + with true <- git_available?, + {branch_name, 0} <- System.cmd("git", ["rev-parse", "--abbrev-ref", "HEAD"]), branch_name <- String.trim(branch_name), branch_name <- System.get_env("PLEROMA_BUILD_BRANCH") || branch_name, true <- @@ -270,7 +278,7 @@ defp version(version) do branch_name else - _ -> "stable" + _ -> "" end build_name = diff --git a/mix.lock b/mix.lock index b69f7eb8e..96d10641f 100644 --- a/mix.lock +++ b/mix.lock @@ -1,6 +1,5 @@ %{ "accept": {:hex, :accept, "0.3.5", "b33b127abca7cc948bbe6caa4c263369abf1347cfa9d8e699c6d214660f10cd1", [:rebar3], [], "hexpm", "11b18c220bcc2eab63b5470c038ef10eb6783bcb1fcdb11aa4137defa5ac1bb8"}, - "auto_linker": {:git, "https://git.pleroma.social/pleroma/auto_linker.git", "95e8188490e97505c56636c1379ffdf036c1fdde", [ref: "95e8188490e97505c56636c1379ffdf036c1fdde"]}, "base62": {:hex, :base62, "1.2.1", "4866763e08555a7b3917064e9eef9194c41667276c51b59de2bc42c6ea65f806", [:mix], [{:custom_base, "~> 0.2.1", [hex: :custom_base, repo: "hexpm", optional: false]}], "hexpm", "3b29948de2013d3f93aa898c884a9dff847e7aec75d9d6d8c1dc4c61c2716c42"}, "base64url": {:hex, :base64url, "0.0.1", "36a90125f5948e3afd7be97662a1504b934dd5dac78451ca6e9abf85a10286be", [:rebar], [], "hexpm"}, "bbcode": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/bbcode.git", "f2d267675e9a7e1ad1ea9beb4cc23382762b66c2", [ref: "v0.2.0"]}, @@ -9,114 +8,116 @@ "benchee": {:hex, :benchee, "1.0.1", "66b211f9bfd84bd97e6d1beaddf8fc2312aaabe192f776e8931cb0c16f53a521", [:mix], [{:deep_merge, "~> 1.0", [hex: :deep_merge, repo: "hexpm", optional: false]}], "hexpm", "3ad58ae787e9c7c94dd7ceda3b587ec2c64604563e049b2a0e8baafae832addb"}, "bunt": {:hex, :bunt, "0.2.0", "951c6e801e8b1d2cbe58ebbd3e616a869061ddadcc4863d0a2182541acae9a38", [:mix], [], "hexpm", "7af5c7e09fe1d40f76c8e4f9dd2be7cebd83909f31fee7cd0e9eadc567da8353"}, "cachex": {:hex, :cachex, "3.2.0", "a596476c781b0646e6cb5cd9751af2e2974c3e0d5498a8cab71807618b74fe2f", [:mix], [{:eternal, "~> 1.2", [hex: :eternal, repo: "hexpm", optional: false]}, {:jumper, "~> 1.0", [hex: :jumper, repo: "hexpm", optional: false]}, {:sleeplocks, "~> 1.1", [hex: :sleeplocks, repo: "hexpm", optional: false]}, {:unsafe, "~> 1.0", [hex: :unsafe, repo: "hexpm", optional: false]}], "hexpm", "aef93694067a43697ae0531727e097754a9e992a1e7946296f5969d6dd9ac986"}, - "calendar": {:hex, :calendar, "0.17.6", "ec291cb2e4ba499c2e8c0ef5f4ace974e2f9d02ae9e807e711a9b0c7850b9aee", [:mix], [{:tzdata, "~> 0.5.20 or ~> 0.1.201603 or ~> 1.0", [hex: :tzdata, repo: "hexpm", optional: false]}], "hexpm", "738d0e17a93c2ccfe4ddc707bdc8e672e9074c8569498483feb1c4530fb91b2b"}, + "calendar": {:hex, :calendar, "1.0.0", "f52073a708528482ec33d0a171954ca610fe2bd28f1e871f247dc7f1565fa807", [:mix], [{:tzdata, "~> 0.5.20 or ~> 0.1.201603 or ~> 1.0", [hex: :tzdata, repo: "hexpm", optional: false]}], "hexpm", "990e9581920c82912a5ee50e62ff5ef96da6b15949a2ee4734f935fdef0f0a6f"}, "captcha": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/elixir-captcha.git", "e0f16822d578866e186a0974d65ad58cddc1e2ab", [ref: "e0f16822d578866e186a0974d65ad58cddc1e2ab"]}, - "castore": {:hex, :castore, "0.1.5", "591c763a637af2cc468a72f006878584bc6c306f8d111ef8ba1d4c10e0684010", [:mix], [], "hexpm", "6db356b2bc6cc22561e051ff545c20ad064af57647e436650aa24d7d06cd941a"}, - "certifi": {:hex, :certifi, "2.5.2", "b7cfeae9d2ed395695dd8201c57a2d019c0c43ecaf8b8bcb9320b40d6662f340", [:rebar3], [{:parse_trans, "~>3.3", [hex: :parse_trans, repo: "hexpm", optional: false]}], "hexpm", "3b3b5f36493004ac3455966991eaf6e768ce9884693d9968055aeeeb1e575040"}, + "castore": {:hex, :castore, "0.1.7", "1ca19eee705cde48c9e809e37fdd0730510752cc397745e550f6065a56a701e9", [:mix], [], "hexpm", "a2ae2c13d40e9c308387f1aceb14786dca019ebc2a11484fb2a9f797ea0aa0d8"}, + "certifi": {:hex, :certifi, "2.5.1", "867ce347f7c7d78563450a18a6a28a8090331e77fa02380b4a21962a65d36ee5", [:rebar3], [{:parse_trans, "~>3.3", [hex: :parse_trans, repo: "hexpm", optional: false]}], "hexpm", "805abd97539caf89ec6d4732c91e62ba9da0cda51ac462380bbd28ee697a8c42"}, "combine": {:hex, :combine, "0.10.0", "eff8224eeb56498a2af13011d142c5e7997a80c8f5b97c499f84c841032e429f", [:mix], [], "hexpm", "1b1dbc1790073076580d0d1d64e42eae2366583e7aecd455d1215b0d16f2451b"}, "comeonin": {:hex, :comeonin, "5.3.1", "7fe612b739c78c9c1a75186ef2d322ce4d25032d119823269d0aa1e2f1e20025", [:mix], [], "hexpm", "d6222483060c17f0977fad1b7401ef0c5863c985a64352755f366aee3799c245"}, + "concurrent_limiter": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/concurrent_limiter.git", "d81be41024569330f296fc472e24198d7499ba78", [ref: "d81be41024569330f296fc472e24198d7499ba78"]}, "connection": {:hex, :connection, "1.0.4", "a1cae72211f0eef17705aaededacac3eb30e6625b04a6117c1b2db6ace7d5976", [:mix], [], "hexpm", "4a0850c9be22a43af9920a71ab17c051f5f7d45c209e40269a1938832510e4d9"}, - "cors_plug": {:hex, :cors_plug, "1.5.2", "72df63c87e4f94112f458ce9d25800900cc88608c1078f0e4faddf20933eda6e", [:mix], [{:plug, "~> 1.3 or ~> 1.4 or ~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "9af027d20dc12dd0c4345a6b87247e0c62965871feea0bfecf9764648b02cc69"}, - "cowboy": {:hex, :cowboy, "2.7.0", "91ed100138a764355f43316b1d23d7ff6bdb0de4ea618cb5d8677c93a7a2f115", [:rebar3], [{:cowlib, "~> 2.8.0", [hex: :cowlib, repo: "hexpm", optional: false]}, {:ranch, "~> 1.7.1", [hex: :ranch, repo: "hexpm", optional: false]}], "hexpm", "04fd8c6a39edc6aaa9c26123009200fc61f92a3a94f3178c527b70b767c6e605"}, - "cowlib": {:hex, :cowlib, "2.8.0", "fd0ff1787db84ac415b8211573e9a30a3ebe71b5cbff7f720089972b2319c8a4", [:rebar3], [], "hexpm", "79f954a7021b302186a950a32869dbc185523d99d3e44ce430cd1f3289f41ed4"}, - "credo": {:hex, :credo, "1.1.5", "caec7a3cadd2e58609d7ee25b3931b129e739e070539ad1a0cd7efeeb47014f4", [:mix], [{:bunt, "~> 0.2.0", [hex: :bunt, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}], "hexpm", "d0bbd3222607ccaaac5c0340f7f525c627ae4d7aee6c8c8c108922620c5b6446"}, + "cors_plug": {:hex, :cors_plug, "2.0.2", "2b46083af45e4bc79632bd951550509395935d3e7973275b2b743bd63cc942ce", [:mix], [{:plug, "~> 1.8", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "f0d0e13f71c51fd4ef8b2c7e051388e4dfb267522a83a22392c856de7e46465f"}, + "cowboy": {:hex, :cowboy, "2.8.0", "f3dc62e35797ecd9ac1b50db74611193c29815401e53bac9a5c0577bd7bc667d", [:rebar3], [{:cowlib, "~> 2.9.1", [hex: :cowlib, repo: "hexpm", optional: false]}, {:ranch, "~> 1.7.1", [hex: :ranch, repo: "hexpm", optional: false]}], "hexpm", "4643e4fba74ac96d4d152c75803de6fad0b3fa5df354c71afdd6cbeeb15fac8a"}, + "cowlib": {:hex, :cowlib, "2.9.1", "61a6c7c50cf07fdd24b2f45b89500bb93b6686579b069a89f88cb211e1125c78", [:rebar3], [], "hexpm", "e4175dc240a70d996156160891e1c62238ede1729e45740bdd38064dad476170"}, + "credo": {:hex, :credo, "1.4.0", "92339d4cbadd1e88b5ee43d427b639b68a11071b6f73854e33638e30a0ea11f5", [:mix], [{:bunt, "~> 0.2.0", [hex: :bunt, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}], "hexpm", "1fd3b70dce216574ce3c18bdf510b57e7c4c85c2ec9cad4bff854abaf7e58658"}, "crontab": {:hex, :crontab, "1.1.8", "2ce0e74777dfcadb28a1debbea707e58b879e6aa0ffbf9c9bb540887bce43617", [:mix], [{:ecto, "~> 1.0 or ~> 2.0 or ~> 3.0", [hex: :ecto, repo: "hexpm", optional: true]}], "hexpm"}, - "crypt": {:git, "https://github.com/msantos/crypt", "f63a705f92c26955977ee62a313012e309a4d77a", [ref: "f63a705f92c26955977ee62a313012e309a4d77a"]}, + "crypt": {:git, "https://github.com/msantos/crypt.git", "f63a705f92c26955977ee62a313012e309a4d77a", [ref: "f63a705f92c26955977ee62a313012e309a4d77a"]}, "custom_base": {:hex, :custom_base, "0.2.1", "4a832a42ea0552299d81652aa0b1f775d462175293e99dfbe4d7dbaab785a706", [:mix], [], "hexpm", "8df019facc5ec9603e94f7270f1ac73ddf339f56ade76a721eaa57c1493ba463"}, - "db_connection": {:hex, :db_connection, "2.2.1", "caee17725495f5129cb7faebde001dc4406796f12a62b8949f4ac69315080566", [:mix], [{:connection, "~> 1.0.2", [hex: :connection, repo: "hexpm", optional: false]}], "hexpm", "2b02ece62d9f983fcd40954e443b7d9e6589664380e5546b2b9b523cd0fb59e1"}, + "db_connection": {:hex, :db_connection, "2.2.2", "3bbca41b199e1598245b716248964926303b5d4609ff065125ce98bcd368939e", [:mix], [{:connection, "~> 1.0.2", [hex: :connection, repo: "hexpm", optional: false]}], "hexpm", "642af240d8a8affb93b4ba5a6fcd2bbcbdc327e1a524b825d383711536f8070c"}, "decimal": {:hex, :decimal, "1.8.1", "a4ef3f5f3428bdbc0d35374029ffcf4ede8533536fa79896dd450168d9acdf3c", [:mix], [], "hexpm", "3cb154b00225ac687f6cbd4acc4b7960027c757a5152b369923ead9ddbca7aec"}, "deep_merge": {:hex, :deep_merge, "1.0.0", "b4aa1a0d1acac393bdf38b2291af38cb1d4a52806cf7a4906f718e1feb5ee961", [:mix], [], "hexpm", "ce708e5f094b9cd4e8f2be4f00d2f4250c4095be93f8cd6d018c753894885430"}, "earmark": {:hex, :earmark, "1.4.3", "364ca2e9710f6bff494117dbbd53880d84bebb692dafc3a78eb50aa3183f2bfd", [:mix], [], "hexpm", "8cf8a291ebf1c7b9539e3cddb19e9cef066c2441b1640f13c34c1d3cfc825fec"}, - "ecto": {:hex, :ecto, "3.4.4", "a2c881e80dc756d648197ae0d936216c0308370332c5e77a2325a10293eef845", [:mix], [{:decimal, "~> 1.6 or ~> 2.0", [hex: :decimal, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "cc4bd3ad62abc3b21fb629f0f7a3dab23a192fca837d257dd08449fba7373561"}, + "earmark_parser": {:hex, :earmark_parser, "1.4.10", "6603d7a603b9c18d3d20db69921527f82ef09990885ed7525003c7fe7dc86c56", [:mix], [], "hexpm", "8e2d5370b732385db2c9b22215c3f59c84ac7dda7ed7e544d7c459496ae519c0"}, + "ecto": {:hex, :ecto, "3.4.5", "2bcd262f57b2c888b0bd7f7a28c8a48aa11dc1a2c6a858e45dd8f8426d504265", [:mix], [{:decimal, "~> 1.6 or ~> 2.0", [hex: :decimal, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "8c6d1d4d524559e9b7a062f0498e2c206122552d63eacff0a6567ffe7a8e8691"}, "ecto_enum": {:hex, :ecto_enum, "1.4.0", "d14b00e04b974afc69c251632d1e49594d899067ee2b376277efd8233027aec8", [:mix], [{:ecto, ">= 3.0.0", [hex: :ecto, repo: "hexpm", optional: false]}, {:ecto_sql, "> 3.0.0", [hex: :ecto_sql, repo: "hexpm", optional: false]}, {:mariaex, ">= 0.0.0", [hex: :mariaex, repo: "hexpm", optional: true]}, {:postgrex, ">= 0.0.0", [hex: :postgrex, repo: "hexpm", optional: true]}], "hexpm", "8fb55c087181c2b15eee406519dc22578fa60dd82c088be376d0010172764ee4"}, - "ecto_sql": {:hex, :ecto_sql, "3.3.4", "aa18af12eb875fbcda2f75e608b3bd534ebf020fc4f6448e4672fcdcbb081244", [:mix], [{:db_connection, "~> 2.2", [hex: :db_connection, repo: "hexpm", optional: false]}, {:ecto, "~> 3.4 or ~> 3.3.3", [hex: :ecto, repo: "hexpm", optional: false]}, {:myxql, "~> 0.3.0", [hex: :myxql, repo: "hexpm", optional: true]}, {:postgrex, "~> 0.15.0", [hex: :postgrex, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4.0", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "5eccbdbf92e3c6f213007a82d5dbba4cd9bb659d1a21331f89f408e4c0efd7a8"}, + "ecto_sql": {:hex, :ecto_sql, "3.4.5", "30161f81b167d561a9a2df4329c10ae05ff36eca7ccc84628f2c8b9fa1e43323", [:mix], [{:db_connection, "~> 2.2", [hex: :db_connection, repo: "hexpm", optional: false]}, {:ecto, "~> 3.4.3", [hex: :ecto, repo: "hexpm", optional: false]}, {:myxql, "~> 0.3.0 or ~> 0.4.0", [hex: :myxql, repo: "hexpm", optional: true]}, {:postgrex, "~> 0.15.0", [hex: :postgrex, repo: "hexpm", optional: true]}, {:tds, "~> 2.1.0", [hex: :tds, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4.0", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "31990c6a3579b36a3c0841d34a94c275e727de8b84f58509da5f1b2032c98ac2"}, "elixir_make": {:hex, :elixir_make, "0.6.0", "38349f3e29aff4864352084fc736fa7fa0f2995a819a737554f7ebd28b85aaab", [:mix], [], "hexpm", "d522695b93b7f0b4c0fcb2dfe73a6b905b1c301226a5a55cb42e5b14d509e050"}, "esshd": {:hex, :esshd, "0.1.1", "d4dd4c46698093a40a56afecce8a46e246eb35463c457c246dacba2e056f31b5", [:mix], [], "hexpm", "d73e341e3009d390aa36387dc8862860bf9f874c94d9fd92ade2926376f49981"}, "eternal": {:hex, :eternal, "1.2.1", "d5b6b2499ba876c57be2581b5b999ee9bdf861c647401066d3eeed111d096bc4", [:mix], [], "hexpm", "b14f1dc204321429479c569cfbe8fb287541184ed040956c8862cb7a677b8406"}, "ex2ms": {:hex, :ex2ms, "1.5.0", "19e27f9212be9a96093fed8cdfbef0a2b56c21237196d26760f11dfcfae58e97", [:mix], [], "hexpm"}, - "ex_aws": {:hex, :ex_aws, "2.1.1", "1e4de2106cfbf4e837de41be41cd15813eabc722315e388f0d6bb3732cec47cd", [:mix], [{:configparser_ex, "~> 4.0", [hex: :configparser_ex, repo: "hexpm", optional: true]}, {:hackney, "1.6.3 or 1.6.5 or 1.7.1 or 1.8.6 or ~> 1.9", [hex: :hackney, repo: "hexpm", optional: true]}, {:jsx, "~> 2.8", [hex: :jsx, repo: "hexpm", optional: true]}, {:poison, ">= 1.2.0", [hex: :poison, repo: "hexpm", optional: true]}, {:sweet_xml, "~> 0.6", [hex: :sweet_xml, repo: "hexpm", optional: true]}], "hexpm", "06b6fde12b33bb6d65d5d3493e903ba5a56d57a72350c15285a4298338089e10"}, + "ex_aws": {:hex, :ex_aws, "2.1.3", "26b6f036f0127548706aade4a509978fc7c26bd5334b004fba9bfe2687a525df", [:mix], [{:configparser_ex, "~> 4.0", [hex: :configparser_ex, repo: "hexpm", optional: true]}, {:hackney, "~> 1.9", [hex: :hackney, repo: "hexpm", optional: true]}, {:jason, "~> 1.1", [hex: :jason, repo: "hexpm", optional: true]}, {:jsx, "~> 2.8", [hex: :jsx, repo: "hexpm", optional: true]}, {:sweet_xml, "~> 0.6", [hex: :sweet_xml, repo: "hexpm", optional: true]}], "hexpm", "0bdbe2aed9f326922fc5a6a80417e32f0c895f4b3b2b0b9676ebf23dd16c5da4"}, "ex_aws_s3": {:hex, :ex_aws_s3, "2.0.2", "c0258bbdfea55de4f98f0b2f0ca61fe402cc696f573815134beb1866e778f47b", [:mix], [{:ex_aws, "~> 2.0", [hex: :ex_aws, repo: "hexpm", optional: false]}, {:sweet_xml, ">= 0.0.0", [hex: :sweet_xml, repo: "hexpm", optional: true]}], "hexpm", "0569f5b211b1a3b12b705fe2a9d0e237eb1360b9d76298028df2346cad13097a"}, "ex_const": {:hex, :ex_const, "0.2.4", "d06e540c9d834865b012a17407761455efa71d0ce91e5831e86881b9c9d82448", [:mix], [], "hexpm", "96fd346610cc992b8f896ed26a98be82ac4efb065a0578f334a32d60a3ba9767"}, - "ex_doc": {:hex, :ex_doc, "0.21.3", "857ec876b35a587c5d9148a2512e952e24c24345552259464b98bfbb883c7b42", [:mix], [{:earmark, "~> 1.4", [hex: :earmark, repo: "hexpm", optional: false]}, {:makeup_elixir, "~> 0.14", [hex: :makeup_elixir, repo: "hexpm", optional: false]}], "hexpm", "0db1ee8d1547ab4877c5b5dffc6604ef9454e189928d5ba8967d4a58a801f161"}, - "ex_machina": {:hex, :ex_machina, "2.3.0", "92a5ad0a8b10ea6314b876a99c8c9e3f25f4dde71a2a835845b136b9adaf199a", [:mix], [{:ecto, "~> 2.2 or ~> 3.0", [hex: :ecto, repo: "hexpm", optional: true]}, {:ecto_sql, "~> 3.0", [hex: :ecto_sql, repo: "hexpm", optional: true]}], "hexpm", "b84f6af156264530b312a8ab98ac6088f6b77ae5fe2058305c81434aa01fbaf9"}, + "ex_doc": {:hex, :ex_doc, "0.22.2", "03a2a58bdd2ba0d83d004507c4ee113b9c521956938298eba16e55cc4aba4a6c", [:mix], [{:earmark_parser, "~> 1.4.0", [hex: :earmark_parser, repo: "hexpm", optional: false]}, {:makeup_elixir, "~> 0.14", [hex: :makeup_elixir, repo: "hexpm", optional: false]}], "hexpm", "cf60e1b3e2efe317095b6bb79651f83a2c1b3edcb4d319c421d7fcda8b3aff26"}, + "ex_machina": {:hex, :ex_machina, "2.4.0", "09a34c5d371bfb5f78399029194a8ff67aff340ebe8ba19040181af35315eabb", [:mix], [{:ecto, "~> 2.2 or ~> 3.0", [hex: :ecto, repo: "hexpm", optional: true]}, {:ecto_sql, "~> 3.0", [hex: :ecto_sql, repo: "hexpm", optional: true]}], "hexpm", "a20bc9ddc721b33ea913b93666c5d0bdca5cbad7a67540784ae277228832d72c"}, "ex_syslogger": {:hex, :ex_syslogger, "1.5.2", "72b6aa2d47a236e999171f2e1ec18698740f40af0bd02c8c650bf5f1fd1bac79", [:mix], [{:poison, ">= 1.5.0", [hex: :poison, repo: "hexpm", optional: true]}, {:syslog, "~> 1.1.0", [hex: :syslog, repo: "hexpm", optional: false]}], "hexpm", "ab9fab4136dbc62651ec6f16fa4842f10cf02ab4433fa3d0976c01be99398399"}, - "excoveralls": {:hex, :excoveralls, "0.12.2", "a513defac45c59e310ac42fcf2b8ae96f1f85746410f30b1ff2b710a4b6cd44b", [:mix], [{:hackney, "~> 1.0", [hex: :hackney, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}], "hexpm", "151c476331d49b45601ffc45f43cb3a8beb396b02a34e3777fea0ad34ae57d89"}, - "fast_html": {:hex, :fast_html, "1.0.3", "2cc0d4b68496266a1530e0c852cafeaede0bd10cfdee26fda50dc696c203162f", [:make, :mix], [], "hexpm", "ab3d782b639d3c4655fbaec0f9d032c91f8cab8dd791ac7469c2381bc7c32f85"}, - "fast_sanitize": {:hex, :fast_sanitize, "0.1.7", "2a7cd8734c88a2de6de55022104f8a3b87f1fdbe8bbf131d9049764b53d50d0d", [:mix], [{:fast_html, "~> 1.0", [hex: :fast_html, repo: "hexpm", optional: false]}, {:plug, "~> 1.8", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "f39fe8ea08fbac17487c30bf09b7d9f3e12472e51fb07a88ffeb8fd17da8ab67"}, + "excoveralls": {:hex, :excoveralls, "0.12.3", "2142be7cb978a3ae78385487edda6d1aff0e482ffc6123877bb7270a8ffbcfe0", [:mix], [{:hackney, "~> 1.0", [hex: :hackney, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}], "hexpm", "568a3e616c264283f5dea5b020783ae40eef3f7ee2163f7a67cbd7b35bcadada"}, + "fast_html": {:hex, :fast_html, "2.0.4", "4910ee49f2f6b19692e3bf30bf97f1b6b7dac489cd6b0f34cd0fe3042c56ba30", [:make, :mix], [{:elixir_make, "~> 0.4", [hex: :elixir_make, repo: "hexpm", optional: false]}, {:nimble_pool, "~> 0.1.0", [hex: :nimble_pool, repo: "hexpm", optional: false]}], "hexpm", "3bb49d541dfc02ad5e425904f53376d758c09f89e521afc7d2b174b3227761ea"}, + "fast_sanitize": {:hex, :fast_sanitize, "0.2.2", "3cbbaebaea6043865dfb5b4ecb0f1af066ad410a51470e353714b10c42007b81", [:mix], [{:fast_html, "~> 2.0", [hex: :fast_html, repo: "hexpm", optional: false]}, {:plug, "~> 1.8", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "69f204db9250afa94a0d559d9110139850f57de2b081719fbafa1e9a89e94466"}, "flake_id": {:hex, :flake_id, "0.1.0", "7716b086d2e405d09b647121a166498a0d93d1a623bead243e1f74216079ccb3", [:mix], [{:base62, "~> 1.2", [hex: :base62, repo: "hexpm", optional: false]}, {:ecto, ">= 2.0.0", [hex: :ecto, repo: "hexpm", optional: true]}], "hexpm", "31fc8090fde1acd267c07c36ea7365b8604055f897d3a53dd967658c691bd827"}, - "floki": {:hex, :floki, "0.25.0", "b1c9ddf5f32a3a90b43b76f3386ca054325dc2478af020e87b5111c19f2284ac", [:mix], [{:html_entities, "~> 0.5.0", [hex: :html_entities, repo: "hexpm", optional: false]}], "hexpm", "631f4e627c46d5ecd347df5a2accdaf0621c77c3693c5b75a8ad58e84c61f242"}, - "gen_magic": {:git, "https://github.com/hrefhref/gen_magic", "eafdc2ea156433ccd87d1d99eaf1be758064a1db", [branch: "develop"]}, + "floki": {:hex, :floki, "0.27.0", "6b29a14283f1e2e8fad824bc930eaa9477c462022075df6bea8f0ad811c13599", [:mix], [{:html_entities, "~> 0.5.0", [hex: :html_entities, repo: "hexpm", optional: false]}], "hexpm", "583b8c13697c37179f1f82443bcc7ad2f76fbc0bf4c186606eebd658f7f2631b"}, "gen_smtp": {:hex, :gen_smtp, "0.15.0", "9f51960c17769b26833b50df0b96123605a8024738b62db747fece14eb2fbfcc", [:rebar3], [], "hexpm", "29bd14a88030980849c7ed2447b8db6d6c9278a28b11a44cafe41b791205440f"}, "gen_stage": {:hex, :gen_stage, "0.14.3", "d0c66f1c87faa301c1a85a809a3ee9097a4264b2edf7644bf5c123237ef732bf", [:mix], [], "hexpm"}, "gen_state_machine": {:hex, :gen_state_machine, "2.0.5", "9ac15ec6e66acac994cc442dcc2c6f9796cf380ec4b08267223014be1c728a95", [:mix], [], "hexpm"}, - "gettext": {:hex, :gettext, "0.17.4", "f13088e1ec10ce01665cf25f5ff779e7df3f2dc71b37084976cf89d1aa124d5c", [:mix], [], "hexpm", "3c75b5ea8288e2ee7ea503ff9e30dfe4d07ad3c054576a6e60040e79a801e14d"}, - "gun": {:git, "https://github.com/ninenines/gun.git", "e1a69b36b180a574c0ac314ced9613fdd52312cc", [ref: "e1a69b36b180a574c0ac314ced9613fdd52312cc"]}, - "hackney": {:hex, :hackney, "1.16.0", "5096ac8e823e3a441477b2d187e30dd3fff1a82991a806b2003845ce72ce2d84", [:rebar3], [{:certifi, "2.5.2", [hex: :certifi, repo: "hexpm", optional: false]}, {:idna, "6.0.1", [hex: :idna, repo: "hexpm", optional: false]}, {:metrics, "1.0.1", [hex: :metrics, repo: "hexpm", optional: false]}, {:mimerl, "~>1.1", [hex: :mimerl, repo: "hexpm", optional: false]}, {:parse_trans, "3.3.0", [hex: :parse_trans, repo: "hexpm", optional: false]}, {:ssl_verify_fun, "1.1.6", [hex: :ssl_verify_fun, repo: "hexpm", optional: false]}], "hexpm", "3bf0bebbd5d3092a3543b783bf065165fa5d3ad4b899b836810e513064134e18"}, + "gettext": {:hex, :gettext, "0.18.0", "406d6b9e0e3278162c2ae1de0a60270452c553536772167e2d701f028116f870", [:mix], [], "hexpm", "c3f850be6367ebe1a08616c2158affe4a23231c70391050bf359d5f92f66a571"}, + "gun": {:git, "https://github.com/ninenines/gun.git", "921c47146b2d9567eac7e9a4d2ccc60fffd4f327", [ref: "921c47146b2d9567eac7e9a4d2ccc60fffd4f327"]}, + "hackney": {:hex, :hackney, "1.15.2", "07e33c794f8f8964ee86cebec1a8ed88db5070e52e904b8f12209773c1036085", [:rebar3], [{:certifi, "2.5.1", [hex: :certifi, repo: "hexpm", optional: false]}, {:idna, "6.0.0", [hex: :idna, repo: "hexpm", optional: false]}, {:metrics, "1.0.1", [hex: :metrics, repo: "hexpm", optional: false]}, {:mimerl, "~>1.1", [hex: :mimerl, repo: "hexpm", optional: false]}, {:ssl_verify_fun, "1.1.5", [hex: :ssl_verify_fun, repo: "hexpm", optional: false]}], "hexpm", "e0100f8ef7d1124222c11ad362c857d3df7cb5f4204054f9f0f4a728666591fc"}, "html_entities": {:hex, :html_entities, "0.5.1", "1c9715058b42c35a2ab65edc5b36d0ea66dd083767bef6e3edb57870ef556549", [:mix], [], "hexpm", "30efab070904eb897ff05cd52fa61c1025d7f8ef3a9ca250bc4e6513d16c32de"}, "html_sanitize_ex": {:hex, :html_sanitize_ex, "1.3.0", "f005ad692b717691203f940c686208aa3d8ffd9dd4bb3699240096a51fa9564e", [:mix], [{:mochiweb, "~> 2.15", [hex: :mochiweb, repo: "hexpm", optional: false]}], "hexpm"}, - "http_signatures": {:git, "https://git.pleroma.social/pleroma/http_signatures.git", "293d77bb6f4a67ac8bde1428735c3b42f22cbb30", [ref: "293d77bb6f4a67ac8bde1428735c3b42f22cbb30"]}, + "http_signatures": {:hex, :http_signatures, "0.1.0", "4e4b501a936dbf4cb5222597038a89ea10781776770d2e185849fa829686b34c", [:mix], [], "hexpm", "f8a7b3731e3fd17d38fa6e343fcad7b03d6874a3b0a108c8568a71ed9c2cf824"}, "httpoison": {:hex, :httpoison, "1.6.2", "ace7c8d3a361cebccbed19c283c349b3d26991eff73a1eaaa8abae2e3c8089b6", [:mix], [{:hackney, "~> 1.15 and >= 1.15.2", [hex: :hackney, repo: "hexpm", optional: false]}], "hexpm", "aa2c74bd271af34239a3948779612f87df2422c2fdcfdbcec28d9c105f0773fe"}, - "idna": {:hex, :idna, "6.0.1", "1d038fb2e7668ce41fbf681d2c45902e52b3cb9e9c77b55334353b222c2ee50c", [:rebar3], [{:unicode_util_compat, "0.5.0", [hex: :unicode_util_compat, repo: "hexpm", optional: false]}], "hexpm", "a02c8a1c4fd601215bb0b0324c8a6986749f807ce35f25449ec9e69758708122"}, + "idna": {:hex, :idna, "6.0.0", "689c46cbcdf3524c44d5f3dde8001f364cd7608a99556d8fbd8239a5798d4c10", [:rebar3], [{:unicode_util_compat, "0.4.1", [hex: :unicode_util_compat, repo: "hexpm", optional: false]}], "hexpm", "4bdd305eb64e18b0273864920695cb18d7a2021f31a11b9c5fbcd9a253f936e2"}, "inet_cidr": {:hex, :inet_cidr, "1.0.4", "a05744ab7c221ca8e395c926c3919a821eb512e8f36547c062f62c4ca0cf3d6e", [:mix], [], "hexpm", "64a2d30189704ae41ca7dbdd587f5291db5d1dda1414e0774c29ffc81088c1bc"}, "jason": {:hex, :jason, "1.2.1", "12b22825e22f468c02eb3e4b9985f3d0cb8dc40b9bd704730efa11abd2708c44", [:mix], [{:decimal, "~> 1.0", [hex: :decimal, repo: "hexpm", optional: true]}], "hexpm", "b659b8571deedf60f79c5a608e15414085fa141344e2716fbd6988a084b5f993"}, "joken": {:hex, :joken, "2.2.0", "2daa1b12be05184aff7b5ace1d43ca1f81345962285fff3f88db74927c954d3a", [:mix], [{:jose, "~> 1.9", [hex: :jose, repo: "hexpm", optional: false]}], "hexpm", "b4f92e30388206f869dd25d1af628a1d99d7586e5cf0672f64d4df84c4d2f5e9"}, "jose": {:hex, :jose, "1.10.1", "16d8e460dae7203c6d1efa3f277e25b5af8b659febfc2f2eb4bacf87f128b80a", [:mix, :rebar3], [], "hexpm", "3c7ddc8a9394b92891db7c2771da94bf819834a1a4c92e30857b7d582e2f8257"}, "jumper": {:hex, :jumper, "1.0.1", "3c00542ef1a83532b72269fab9f0f0c82bf23a35e27d278bfd9ed0865cecabff", [:mix], [], "hexpm", "318c59078ac220e966d27af3646026db9b5a5e6703cb2aa3e26bcfaba65b7433"}, "libring": {:hex, :libring, "1.4.0", "41246ba2f3fbc76b3971f6bce83119dfec1eee17e977a48d8a9cfaaf58c2a8d6", [:mix], [], "hexpm"}, - "majic": {:git, "https://github.com/hrefhref/majic", "91a10cfa0c902eb889584238a3ef5aa595c21ef8", [branch: "develop"]}, - "makeup": {:hex, :makeup, "1.0.0", "671df94cf5a594b739ce03b0d0316aa64312cee2574b6a44becb83cd90fb05dc", [:mix], [{:nimble_parsec, "~> 0.5.0", [hex: :nimble_parsec, repo: "hexpm", optional: false]}], "hexpm", "a10c6eb62cca416019663129699769f0c2ccf39428b3bb3c0cb38c718a0c186d"}, - "makeup_elixir": {:hex, :makeup_elixir, "0.14.0", "cf8b7c66ad1cff4c14679698d532f0b5d45a3968ffbcbfd590339cb57742f1ae", [:mix], [{:makeup, "~> 1.0", [hex: :makeup, repo: "hexpm", optional: false]}], "hexpm", "d4b316c7222a85bbaa2fd7c6e90e37e953257ad196dc229505137c5e505e9eff"}, + "linkify": {:hex, :linkify, "0.2.0", "2518bbbea21d2caa9d372424e1ad845b640c6630e2d016f1bd1f518f9ebcca28", [:mix], [], "hexpm", "b8ca8a68b79e30b7938d6c996085f3db14939f29538a59ca5101988bb7f917f6"}, + "majic": {:git, "https://github.com/hrefhref/majic", "51ecea6458c4b2fbc98272ce5ab2951f2c0d46cc", [branch: "develop"]}, + "makeup": {:hex, :makeup, "1.0.3", "e339e2f766d12e7260e6672dd4047405963c5ec99661abdc432e6ec67d29ef95", [:mix], [{:nimble_parsec, "~> 0.5", [hex: :nimble_parsec, repo: "hexpm", optional: false]}], "hexpm", "2e9b4996d11832947731f7608fed7ad2f9443011b3b479ae288011265cdd3dad"}, + "makeup_elixir": {:hex, :makeup_elixir, "0.14.1", "4f0e96847c63c17841d42c08107405a005a2680eb9c7ccadfd757bd31dabccfb", [:mix], [{:makeup, "~> 1.0", [hex: :makeup, repo: "hexpm", optional: false]}], "hexpm", "f2438b1a80eaec9ede832b5c41cd4f373b38fd7aa33e3b22d9db79e640cbde11"}, "meck": {:hex, :meck, "0.8.13", "ffedb39f99b0b99703b8601c6f17c7f76313ee12de6b646e671e3188401f7866", [:rebar3], [], "hexpm", "d34f013c156db51ad57cc556891b9720e6a1c1df5fe2e15af999c84d6cebeb1a"}, "metrics": {:hex, :metrics, "1.0.1", "25f094dea2cda98213cecc3aeff09e940299d950904393b2a29d191c346a8486", [:rebar3], [], "hexpm", "69b09adddc4f74a40716ae54d140f93beb0fb8978d8636eaded0c31b6f099f16"}, - "mime": {:hex, :mime, "1.3.1", "30ce04ab3175b6ad0bdce0035cba77bba68b813d523d1aac73d9781b4d193cf8", [:mix], [], "hexpm", "6cbe761d6a0ca5a31a0931bf4c63204bceb64538e664a8ecf784a9a6f3b875f1"}, + "mime": {:hex, :mime, "1.4.0", "5066f14944b470286146047d2f73518cf5cca82f8e4815cf35d196b58cf07c47", [:mix], [], "hexpm", "75fa42c4228ea9a23f70f123c74ba7cece6a03b1fd474fe13f6a7a85c6ea4ff6"}, "mimerl": {:hex, :mimerl, "1.2.0", "67e2d3f571088d5cfd3e550c383094b47159f3eee8ffa08e64106cdf5e981be3", [:rebar3], [], "hexpm", "f278585650aa581986264638ebf698f8bb19df297f66ad91b18910dfc6e19323"}, "mochiweb": {:hex, :mochiweb, "2.18.0", "eb55f1db3e6e960fac4e6db4e2db9ec3602cc9f30b86cd1481d56545c3145d2e", [:rebar3], [], "hexpm"}, - "mock": {:hex, :mock, "0.3.4", "c5862eb3b8c64237f45f586cf00c9d892ba07bb48305a43319d428ce3c2897dd", [:mix], [{:meck, "~> 0.8.13", [hex: :meck, repo: "hexpm", optional: false]}], "hexpm", "e6d886252f1a41f4ba06ecf2b4c8d38760b34b1c08a11c28f7397b2e03995964"}, - "mogrify": {:hex, :mogrify, "0.6.1", "de1b527514f2d95a7bbe9642eb556061afb337e220cf97adbf3a4e6438ed70af", [:mix], [], "hexpm", "3bc928d817974fa10cc11e6c89b9a9361e37e96dbbf3d868c41094ec05745dcd"}, - "mox": {:hex, :mox, "0.5.1", "f86bb36026aac1e6f924a4b6d024b05e9adbed5c63e8daa069bd66fb3292165b", [:mix], [], "hexpm", "052346cf322311c49a0f22789f3698eea030eec09b8c47367f0686ef2634ae14"}, + "mock": {:hex, :mock, "0.3.5", "feb81f52b8dcf0a0d65001d2fec459f6b6a8c22562d94a965862f6cc066b5431", [:mix], [{:meck, "~> 0.8.13", [hex: :meck, repo: "hexpm", optional: false]}], "hexpm", "6fae404799408300f863550392635d8f7e3da6b71abdd5c393faf41b131c8728"}, + "mogrify": {:hex, :mogrify, "0.7.4", "9b2496dde44b1ce12676f85d7dc531900939e6367bc537c7243a1b089435b32d", [:mix], [], "hexpm", "50d79e337fba6bc95bfbef918058c90f50b17eed9537771e61d4619488f099c3"}, + "mox": {:hex, :mox, "0.5.2", "55a0a5ba9ccc671518d068c8dddd20eeb436909ea79d1799e2209df7eaa98b6c", [:mix], [], "hexpm", "df4310628cd628ee181df93f50ddfd07be3e5ecc30232d3b6aadf30bdfe6092b"}, "myhtmlex": {:git, "https://git.pleroma.social/pleroma/myhtmlex.git", "ad0097e2f61d4953bfef20fb6abddf23b87111e6", [ref: "ad0097e2f61d4953bfef20fb6abddf23b87111e6", submodules: true]}, - "nimble_parsec": {:hex, :nimble_parsec, "0.5.3", "def21c10a9ed70ce22754fdeea0810dafd53c2db3219a0cd54cf5526377af1c6", [:mix], [], "hexpm", "589b5af56f4afca65217a1f3eb3fee7e79b09c40c742fddc1c312b3ac0b3399f"}, + "nimble_parsec": {:hex, :nimble_parsec, "0.6.0", "32111b3bf39137144abd7ba1cce0914533b2d16ef35e8abc5ec8be6122944263", [:mix], [], "hexpm", "27eac315a94909d4dc68bc07a4a83e06c8379237c5ea528a9acff4ca1c873c52"}, "nimble_pool": {:hex, :nimble_pool, "0.1.0", "ffa9d5be27eee2b00b0c634eb649aa27f97b39186fec3c493716c2a33e784ec6", [:mix], [], "hexpm", "343a1eaa620ddcf3430a83f39f2af499fe2370390d4f785cd475b4df5acaf3f9"}, "nodex": {:git, "https://git.pleroma.social/pleroma/nodex", "cb6730f943cfc6aad674c92161be23a8411f15d1", [ref: "cb6730f943cfc6aad674c92161be23a8411f15d1"]}, - "oban": {:hex, :oban, "1.2.0", "7cca94d341be43d220571e28f69131c4afc21095b25257397f50973d3fc59b07", [:mix], [{:ecto_sql, "~> 3.1", [hex: :ecto_sql, repo: "hexpm", optional: false]}, {:jason, "~> 1.1", [hex: :jason, repo: "hexpm", optional: false]}, {:postgrex, "~> 0.14", [hex: :postgrex, repo: "hexpm", optional: false]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "ba5f8b3f7d76967b3e23cf8014f6a13e4ccb33431e4808f036709a7f822362ee"}, + "oban": {:hex, :oban, "2.0.0", "e6ce70d94dd46815ec0882a1ffb7356df9a9d5b8a40a64ce5c2536617a447379", [:mix], [{:ecto_sql, ">= 3.4.3", [hex: :ecto_sql, repo: "hexpm", optional: false]}, {:jason, "~> 1.1", [hex: :jason, repo: "hexpm", optional: false]}, {:postgrex, "~> 0.14", [hex: :postgrex, repo: "hexpm", optional: false]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "cf574813bd048b98a698aa587c21367d2e06842d4e1b1993dcd6a696e9e633bd"}, "open_api_spex": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/open_api_spex.git", "f296ac0924ba3cf79c7a588c4c252889df4c2edd", [ref: "f296ac0924ba3cf79c7a588c4c252889df4c2edd"]}, "parse_trans": {:hex, :parse_trans, "3.3.0", "09765507a3c7590a784615cfd421d101aec25098d50b89d7aa1d66646bc571c1", [:rebar3], [], "hexpm", "17ef63abde837ad30680ea7f857dd9e7ced9476cdd7b0394432af4bfc241b960"}, "pbkdf2_elixir": {:hex, :pbkdf2_elixir, "1.2.1", "9cbe354b58121075bd20eb83076900a3832324b7dd171a6895fab57b6bb2752c", [:mix], [{:comeonin, "~> 5.3", [hex: :comeonin, repo: "hexpm", optional: false]}], "hexpm", "d3b40a4a4630f0b442f19eca891fcfeeee4c40871936fed2f68e1c4faa30481f"}, - "phoenix": {:hex, :phoenix, "1.4.13", "67271ad69b51f3719354604f4a3f968f83aa61c19199343656c9caee057ff3b8", [:mix], [{:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}, {:phoenix_pubsub, "~> 1.1", [hex: :phoenix_pubsub, repo: "hexpm", optional: false]}, {:plug, "~> 1.8.1 or ~> 1.9", [hex: :plug, repo: "hexpm", optional: false]}, {:plug_cowboy, "~> 1.0 or ~> 2.0", [hex: :plug_cowboy, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "ab765a0feddb81fc62e2116c827b5f068df85159c162bee760745276ad7ddc1b"}, + "phoenix": {:hex, :phoenix, "1.4.17", "1b1bd4cff7cfc87c94deaa7d60dd8c22e04368ab95499483c50640ef3bd838d8", [:mix], [{:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}, {:phoenix_pubsub, "~> 1.1", [hex: :phoenix_pubsub, repo: "hexpm", optional: false]}, {:plug, "~> 1.8.1 or ~> 1.9", [hex: :plug, repo: "hexpm", optional: false]}, {:plug_cowboy, "~> 1.0 or ~> 2.0", [hex: :plug_cowboy, repo: "hexpm", optional: true]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "3a8e5d7a3d76d452bb5fb86e8b7bd115f737e4f8efe202a463d4aeb4a5809611"}, "phoenix_ecto": {:hex, :phoenix_ecto, "4.1.0", "a044d0756d0464c5a541b4a0bf4bcaf89bffcaf92468862408290682c73ae50d", [:mix], [{:ecto, "~> 3.0", [hex: :ecto, repo: "hexpm", optional: false]}, {:phoenix_html, "~> 2.9", [hex: :phoenix_html, repo: "hexpm", optional: true]}, {:plug, "~> 1.0", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "c5e666a341ff104d0399d8f0e4ff094559b2fde13a5985d4cb5023b2c2ac558b"}, - "phoenix_html": {:hex, :phoenix_html, "2.14.0", "d8c6bc28acc8e65f8ea0080ee05aa13d912c8758699283b8d3427b655aabe284", [:mix], [{:plug, "~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "b0bb30eda478a06dbfbe96728061a93833db3861a49ccb516f839ecb08493fbb"}, + "phoenix_html": {:hex, :phoenix_html, "2.14.2", "b8a3899a72050f3f48a36430da507dd99caf0ac2d06c77529b1646964f3d563e", [:mix], [{:plug, "~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "58061c8dfd25da5df1ea0ca47c972f161beb6c875cd293917045b92ffe1bf617"}, "phoenix_pubsub": {:hex, :phoenix_pubsub, "1.1.2", "496c303bdf1b2e98a9d26e89af5bba3ab487ba3a3735f74bf1f4064d2a845a3e", [:mix], [], "hexpm", "1f13f9f0f3e769a667a6b6828d29dec37497a082d195cc52dbef401a9b69bf38"}, - "phoenix_swoosh": {:hex, :phoenix_swoosh, "0.2.0", "a7e0b32077cd6d2323ae15198839b05d9caddfa20663fd85787479e81f89520e", [:mix], [{:phoenix, "~> 1.0", [hex: :phoenix, repo: "hexpm", optional: false]}, {:phoenix_html, "~> 2.2", [hex: :phoenix_html, repo: "hexpm", optional: false]}, {:swoosh, "~> 0.1", [hex: :swoosh, repo: "hexpm", optional: false]}], "hexpm", "ebf1bfa7b3c1c850c04929afe02e2e0d7ab135e0706332c865de03e761676b1f"}, - "plug": {:hex, :plug, "1.9.0", "8d7c4e26962283ff9f8f3347bd73838e2413fbc38b7bb5467d5924f68f3a5a4a", [:mix], [{:mime, "~> 1.0", [hex: :mime, repo: "hexpm", optional: false]}, {:plug_crypto, "~> 1.0", [hex: :plug_crypto, repo: "hexpm", optional: false]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: true]}], "hexpm", "9902eda2c52ada2a096434682e99a2493f5d06a94d6ac6bcfff9805f952350f1"}, - "plug_cowboy": {:hex, :plug_cowboy, "2.1.2", "8b0addb5908c5238fac38e442e81b6fcd32788eaa03246b4d55d147c47c5805e", [:mix], [{:cowboy, "~> 2.5", [hex: :cowboy, repo: "hexpm", optional: false]}, {:plug, "~> 1.7", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "7d722581ce865a237e14da6d946f92704101740a256bd13ec91e63c0b122fc70"}, + "phoenix_swoosh": {:hex, :phoenix_swoosh, "0.3.0", "2acfa0db038a7649e0a4614eee970e6ed9a39d191ccd79a03583b51d0da98165", [:mix], [{:hackney, "~> 1.9", [hex: :hackney, repo: "hexpm", optional: false]}, {:phoenix, "~> 1.4", [hex: :phoenix, repo: "hexpm", optional: false]}, {:phoenix_html, "~> 2.14", [hex: :phoenix_html, repo: "hexpm", optional: false]}, {:swoosh, "~> 1.0", [hex: :swoosh, repo: "hexpm", optional: false]}], "hexpm", "b8bbae4b59a676de6b8bd8675eda37bc8b4424812ae429d6fdcb2b039e00003b"}, + "plug": {:hex, :plug, "1.10.4", "41eba7d1a2d671faaf531fa867645bd5a3dce0957d8e2a3f398ccff7d2ef017f", [:mix], [{:mime, "~> 1.0", [hex: :mime, repo: "hexpm", optional: false]}, {:plug_crypto, "~> 1.1.1 or ~> 1.2", [hex: :plug_crypto, repo: "hexpm", optional: false]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "ad1e233fe73d2eec56616568d260777b67f53148a999dc2d048f4eb9778fe4a0"}, + "plug_cowboy": {:hex, :plug_cowboy, "2.3.0", "149a50e05cb73c12aad6506a371cd75750c0b19a32f81866e1a323dda9e0e99d", [:mix], [{:cowboy, "~> 2.7", [hex: :cowboy, repo: "hexpm", optional: false]}, {:plug, "~> 1.7", [hex: :plug, repo: "hexpm", optional: false]}, {:telemetry, "~> 0.4", [hex: :telemetry, repo: "hexpm", optional: false]}], "hexpm", "bc595a1870cef13f9c1e03df56d96804db7f702175e4ccacdb8fc75c02a7b97e"}, "plug_crypto": {:hex, :plug_crypto, "1.1.2", "bdd187572cc26dbd95b87136290425f2b580a116d3fb1f564216918c9730d227", [:mix], [], "hexpm", "6b8b608f895b6ffcfad49c37c7883e8df98ae19c6a28113b02aa1e9c5b22d6b5"}, "plug_static_index_html": {:hex, :plug_static_index_html, "1.0.0", "840123d4d3975585133485ea86af73cb2600afd7f2a976f9f5fd8b3808e636a0", [:mix], [{:plug, "~> 1.0", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "79fd4fcf34d110605c26560cbae8f23c603ec4158c08298bd4360fdea90bb5cf"}, "poison": {:hex, :poison, "3.1.0", "d9eb636610e096f86f25d9a46f35a9facac35609a7591b3be3326e99a0484665", [:mix], [], "hexpm", "fec8660eb7733ee4117b85f55799fd3833eb769a6df71ccf8903e8dc5447cfce"}, "poolboy": {:hex, :poolboy, "1.5.2", "392b007a1693a64540cead79830443abf5762f5d30cf50bc95cb2c1aaafa006b", [:rebar3], [], "hexpm", "dad79704ce5440f3d5a3681c8590b9dc25d1a561e8f5a9c995281012860901e3"}, - "postgrex": {:hex, :postgrex, "0.15.3", "5806baa8a19a68c4d07c7a624ccdb9b57e89cbc573f1b98099e3741214746ae4", [:mix], [{:connection, "~> 1.0", [hex: :connection, repo: "hexpm", optional: false]}, {:db_connection, "~> 2.1", [hex: :db_connection, repo: "hexpm", optional: false]}, {:decimal, "~> 1.5", [hex: :decimal, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}], "hexpm", "4737ce62a31747b4c63c12b20c62307e51bb4fcd730ca0c32c280991e0606c90"}, - "pot": {:hex, :pot, "0.10.2", "9895c83bcff8cd22d9f5bc79dfc88a188176b261b618ad70d93faf5c5ca36e67", [:rebar3], [], "hexpm", "ac589a8e296b7802681e93cd0a436faec117ea63e9916709c628df31e17e91e2"}, - "prometheus": {:hex, :prometheus, "4.5.0", "8f4a2246fe0beb50af0f77c5e0a5bb78fe575c34a9655d7f8bc743aad1c6bf76", [:mix, :rebar3], [], "hexpm", "679b5215480fff612b8351f45c839d995a07ce403e42ff02f1c6b20960d41a4e"}, + "postgrex": {:hex, :postgrex, "0.15.5", "aec40306a622d459b01bff890fa42f1430dac61593b122754144ad9033a2152f", [:mix], [{:connection, "~> 1.0", [hex: :connection, repo: "hexpm", optional: false]}, {:db_connection, "~> 2.1", [hex: :db_connection, repo: "hexpm", optional: false]}, {:decimal, "~> 1.5", [hex: :decimal, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: true]}], "hexpm", "ed90c81e1525f65a2ba2279dbcebf030d6d13328daa2f8088b9661eb9143af7f"}, + "pot": {:hex, :pot, "0.11.0", "61bad869a94534739dd4614a25a619bc5c47b9970e9a0ea5bef4628036fc7a16", [:rebar3], [], "hexpm", "57ee6ee6bdeb639661ffafb9acefe3c8f966e45394de6a766813bb9e1be4e54b"}, + "prometheus": {:hex, :prometheus, "4.6.0", "20510f381db1ccab818b4cf2fac5fa6ab5cc91bc364a154399901c001465f46f", [:mix, :rebar3], [], "hexpm", "4905fd2992f8038eccd7aa0cd22f40637ed618c0bed1f75c05aacec15b7545de"}, "prometheus_ecto": {:hex, :prometheus_ecto, "1.4.3", "3dd4da1812b8e0dbee81ea58bb3b62ed7588f2eae0c9e97e434c46807ff82311", [:mix], [{:ecto, "~> 2.0 or ~> 3.0", [hex: :ecto, repo: "hexpm", optional: false]}, {:prometheus_ex, "~> 1.1 or ~> 2.0 or ~> 3.0", [hex: :prometheus_ex, repo: "hexpm", optional: false]}], "hexpm", "8d66289f77f913b37eda81fd287340c17e61a447549deb28efc254532b2bed82"}, "prometheus_ex": {:hex, :prometheus_ex, "3.0.5", "fa58cfd983487fc5ead331e9a3e0aa622c67232b3ec71710ced122c4c453a02f", [:mix], [{:prometheus, "~> 4.0", [hex: :prometheus, repo: "hexpm", optional: false]}], "hexpm", "9fd13404a48437e044b288b41f76e64acd9735fb8b0e3809f494811dfa66d0fb"}, "prometheus_phoenix": {:hex, :prometheus_phoenix, "1.3.0", "c4b527e0b3a9ef1af26bdcfbfad3998f37795b9185d475ca610fe4388fdd3bb5", [:mix], [{:phoenix, "~> 1.4", [hex: :phoenix, repo: "hexpm", optional: false]}, {:prometheus_ex, "~> 1.3 or ~> 2.0 or ~> 3.0", [hex: :prometheus_ex, repo: "hexpm", optional: false]}], "hexpm", "c4d1404ac4e9d3d963da601db2a7d8ea31194f0017057fabf0cfb9bf5a6c8c75"}, "prometheus_plugs": {:hex, :prometheus_plugs, "1.1.5", "25933d48f8af3a5941dd7b621c889749894d8a1082a6ff7c67cc99dec26377c5", [:mix], [{:accept, "~> 0.1", [hex: :accept, repo: "hexpm", optional: false]}, {:plug, "~> 1.0", [hex: :plug, repo: "hexpm", optional: false]}, {:prometheus_ex, "~> 1.1 or ~> 2.0 or ~> 3.0", [hex: :prometheus_ex, repo: "hexpm", optional: false]}, {:prometheus_process_collector, "~> 1.1", [hex: :prometheus_process_collector, repo: "hexpm", optional: true]}], "hexpm", "0273a6483ccb936d79ca19b0ab629aef0dba958697c94782bb728b920dfc6a79"}, "quack": {:hex, :quack, "0.1.1", "cca7b4da1a233757fdb44b3334fce80c94785b3ad5a602053b7a002b5a8967bf", [:mix], [{:poison, ">= 1.0.0", [hex: :poison, repo: "hexpm", optional: false]}, {:tesla, "~> 1.2.0", [hex: :tesla, repo: "hexpm", optional: false]}], "hexpm", "d736bfa7444112eb840027bb887832a0e403a4a3437f48028c3b29a2dbbd2543"}, "ranch": {:hex, :ranch, "1.7.1", "6b1fab51b49196860b733a49c07604465a47bdb78aa10c1c16a3d199f7f8c881", [:rebar3], [], "hexpm", "451d8527787df716d99dc36162fca05934915db0b6141bbdac2ea8d3c7afc7d7"}, - "recon": {:hex, :recon, "2.5.0", "2f7fcbec2c35034bade2f9717f77059dc54eb4e929a3049ca7ba6775c0bd66cd", [:mix, :rebar3], [], "hexpm", "72f3840fedd94f06315c523f6cecf5b4827233bed7ae3fe135b2a0ebeab5e196"}, + "recon": {:hex, :recon, "2.5.1", "430ffa60685ac1efdfb1fe4c97b8767c92d0d92e6e7c3e8621559ba77598678a", [:mix, :rebar3], [], "hexpm", "5721c6b6d50122d8f68cccac712caa1231f97894bab779eff5ff0f886cb44648"}, "remote_ip": {:git, "https://git.pleroma.social/pleroma/remote_ip.git", "b647d0deecaa3acb140854fe4bda5b7e1dc6d1c8", [ref: "b647d0deecaa3acb140854fe4bda5b7e1dc6d1c8"]}, "sleeplocks": {:hex, :sleeplocks, "1.1.1", "3d462a0639a6ef36cc75d6038b7393ae537ab394641beb59830a1b8271faeed3", [:rebar3], [], "hexpm", "84ee37aeff4d0d92b290fff986d6a95ac5eedf9b383fadfd1d88e9b84a1c02e1"}, - "ssl_verify_fun": {:hex, :ssl_verify_fun, "1.1.6", "cf344f5692c82d2cd7554f5ec8fd961548d4fd09e7d22f5b62482e5aeaebd4b0", [:make, :mix, :rebar3], [], "hexpm", "bdb0d2471f453c88ff3908e7686f86f9be327d065cc1ec16fa4540197ea04680"}, + "ssl_verify_fun": {:hex, :ssl_verify_fun, "1.1.5", "6eaf7ad16cb568bb01753dbbd7a95ff8b91c7979482b95f38443fe2c8852a79b", [:make, :mix, :rebar3], [], "hexpm", "13104d7897e38ed7f044c4de953a6c28597d1c952075eb2e328bc6d6f2bfc496"}, "sweet_xml": {:hex, :sweet_xml, "0.6.6", "fc3e91ec5dd7c787b6195757fbcf0abc670cee1e4172687b45183032221b66b8", [:mix], [], "hexpm", "2e1ec458f892ffa81f9f8386e3f35a1af6db7a7a37748a64478f13163a1f3573"}, - "swoosh": {:hex, :swoosh, "0.23.5", "bfd9404bbf5069b1be2ffd317923ce57e58b332e25dbca2a35dedd7820dfee5a", [:mix], [{:cowboy, "~> 1.0.1 or ~> 1.1 or ~> 2.4", [hex: :cowboy, repo: "hexpm", optional: true]}, {:gen_smtp, "~> 0.13", [hex: :gen_smtp, repo: "hexpm", optional: true]}, {:hackney, "~> 1.9", [hex: :hackney, repo: "hexpm", optional: false]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}, {:mail, "~> 0.2", [hex: :mail, repo: "hexpm", optional: true]}, {:mime, "~> 1.1", [hex: :mime, repo: "hexpm", optional: false]}, {:plug_cowboy, ">= 1.0.0", [hex: :plug_cowboy, repo: "hexpm", optional: true]}], "hexpm", "e3928e1d2889a308aaf3e42755809ac21cffd77cb58eef01cbfdab4ce2fd1e21"}, + "swoosh": {:hex, :swoosh, "1.0.0", "c547cfc83f30e12d5d1fdcb623d7de2c2e29a5becfc68bf8f42ba4d23d2c2756", [:mix], [{:cowboy, "~> 1.0.1 or ~> 1.1 or ~> 2.4", [hex: :cowboy, repo: "hexpm", optional: true]}, {:gen_smtp, "~> 0.13", [hex: :gen_smtp, repo: "hexpm", optional: true]}, {:hackney, "~> 1.9", [hex: :hackney, repo: "hexpm", optional: true]}, {:jason, "~> 1.0", [hex: :jason, repo: "hexpm", optional: false]}, {:mail, "~> 0.2", [hex: :mail, repo: "hexpm", optional: true]}, {:mime, "~> 1.1", [hex: :mime, repo: "hexpm", optional: false]}, {:plug_cowboy, ">= 1.0.0", [hex: :plug_cowboy, repo: "hexpm", optional: true]}], "hexpm", "b3b08e463f876cb6167f7168e9ad99a069a724e124bcee61847e0e1ed13f4a0d"}, "syslog": {:hex, :syslog, "1.1.0", "6419a232bea84f07b56dc575225007ffe34d9fdc91abe6f1b2f254fd71d8efc2", [:rebar3], [], "hexpm", "4c6a41373c7e20587be33ef841d3de6f3beba08519809329ecc4d27b15b659e1"}, - "telemetry": {:hex, :telemetry, "0.4.1", "ae2718484892448a24470e6aa341bc847c3277bfb8d4e9289f7474d752c09c7f", [:rebar3], [], "hexpm", "4738382e36a0a9a2b6e25d67c960e40e1a2c95560b9f936d8e29de8cd858480f"}, - "tesla": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/tesla.git", "61b7503cef33f00834f78ddfafe0d5d9dec2270b", [ref: "61b7503cef33f00834f78ddfafe0d5d9dec2270b"]}, - "timex": {:hex, :timex, "3.6.1", "efdf56d0e67a6b956cc57774353b0329c8ab7726766a11547e529357ffdc1d56", [:mix], [{:combine, "~> 0.10", [hex: :combine, repo: "hexpm", optional: false]}, {:gettext, "~> 0.10", [hex: :gettext, repo: "hexpm", optional: false]}, {:tzdata, "~> 0.1.8 or ~> 0.5 or ~> 1.0.0", [hex: :tzdata, repo: "hexpm", optional: false]}], "hexpm", "f354efb2400dd7a80fd9eb6c8419068c4f632da4ac47f3d8822d6e33f08bc852"}, + "telemetry": {:hex, :telemetry, "0.4.2", "2808c992455e08d6177322f14d3bdb6b625fbcfd233a73505870d8738a2f4599", [:rebar3], [], "hexpm", "2d1419bd9dda6a206d7b5852179511722e2b18812310d304620c7bd92a13fcef"}, + "tesla": {:git, "https://github.com/teamon/tesla/", "9f7261ca49f9f901ceb73b60219ad6f8a9f6aa30", [ref: "9f7261ca49f9f901ceb73b60219ad6f8a9f6aa30"]}, + "timex": {:hex, :timex, "3.6.2", "845cdeb6119e2fef10751c0b247b6c59d86d78554c83f78db612e3290f819bc2", [:mix], [{:combine, "~> 0.10", [hex: :combine, repo: "hexpm", optional: false]}, {:gettext, "~> 0.10", [hex: :gettext, repo: "hexpm", optional: false]}, {:tzdata, "~> 0.1.8 or ~> 0.5 or ~> 1.0.0", [hex: :tzdata, repo: "hexpm", optional: false]}], "hexpm", "26030b46199d02a590be61c2394b37ea25a3664c02fafbeca0b24c972025d47a"}, "trailing_format_plug": {:hex, :trailing_format_plug, "0.0.7", "64b877f912cf7273bed03379936df39894149e35137ac9509117e59866e10e45", [:mix], [{:plug, "> 0.12.0", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "bd4fde4c15f3e993a999e019d64347489b91b7a9096af68b2bdadd192afa693f"}, - "tzdata": {:hex, :tzdata, "0.5.22", "f2ba9105117ee0360eae2eca389783ef7db36d533899b2e84559404dbc77ebb8", [:mix], [{:hackney, "~> 1.0", [hex: :hackney, repo: "hexpm", optional: false]}], "hexpm", "cd66c8a1e6a9e121d1f538b01bef459334bb4029a1ffb4eeeb5e4eae0337e7b6"}, - "ueberauth": {:hex, :ueberauth, "0.6.2", "25a31111249d60bad8b65438b2306a4dc91f3208faa62f5a8c33e8713989b2e8", [:mix], [{:plug, "~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "db9fbfb5ac707bc4f85a297758406340bf0358b4af737a88113c1a9eee120ac7"}, - "unicode_util_compat": {:hex, :unicode_util_compat, "0.5.0", "8516502659002cec19e244ebd90d312183064be95025a319a6c7e89f4bccd65b", [:rebar3], [], "hexpm", "d48d002e15f5cc105a696cf2f1bbb3fc72b4b770a184d8420c8db20da2674b38"}, + "tzdata": {:hex, :tzdata, "1.0.3", "73470ad29dde46e350c60a66e6b360d3b99d2d18b74c4c349dbebbc27a09a3eb", [:mix], [{:hackney, "~> 1.0", [hex: :hackney, repo: "hexpm", optional: false]}], "hexpm", "a6e1ee7003c4d04ecbd21dd3ec690d4c6662db5d3bbdd7262d53cdf5e7c746c1"}, + "ueberauth": {:hex, :ueberauth, "0.6.3", "d42ace28b870e8072cf30e32e385579c57b9cc96ec74fa1f30f30da9c14f3cc0", [:mix], [{:plug, "~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "afc293d8a1140d6591b53e3eaf415ca92842cb1d32fad3c450c6f045f7f91b60"}, + "unicode_util_compat": {:hex, :unicode_util_compat, "0.4.1", "d869e4c68901dd9531385bb0c8c40444ebf624e60b6962d95952775cac5e90cd", [:rebar3], [], "hexpm", "1d1848c40487cdb0b30e8ed975e34e025860c02e419cb615d255849f3427439d"}, "unsafe": {:hex, :unsafe, "1.0.1", "a27e1874f72ee49312e0a9ec2e0b27924214a05e3ddac90e91727bc76f8613d8", [:mix], [], "hexpm", "6c7729a2d214806450d29766abc2afaa7a2cbecf415be64f36a6691afebb50e5"}, - "web_push_encryption": {:hex, :web_push_encryption, "0.2.3", "a0ceab85a805a30852f143d22d71c434046fbdbafbc7292e7887cec500826a80", [:mix], [{:httpoison, "~> 1.0", [hex: :httpoison, repo: "hexpm", optional: false]}, {:jose, "~> 1.8", [hex: :jose, repo: "hexpm", optional: false]}, {:poison, "~> 3.0", [hex: :poison, repo: "hexpm", optional: false]}], "hexpm", "9315c8f37c108835cf3f8e9157d7a9b8f420a34f402d1b1620a31aed5b93ecdf"}, + "web_push_encryption": {:hex, :web_push_encryption, "0.3.0", "598b5135e696fd1404dc8d0d7c0fa2c027244a4e5d5e5a98ba267f14fdeaabc8", [:mix], [{:httpoison, "~> 1.0", [hex: :httpoison, repo: "hexpm", optional: false]}, {:jose, "~> 1.8", [hex: :jose, repo: "hexpm", optional: false]}], "hexpm", "f10bdd1afe527ede694749fb77a2f22f146a51b054c7fa541c9fd920fba7c875"}, "websocket_client": {:git, "https://github.com/jeremyong/websocket_client.git", "9a6f65d05ebf2725d62fb19262b21f1805a59fbf", []}, } diff --git a/priv/gettext/errors.pot b/priv/gettext/errors.pot index 0e1cf37eb..e337226a7 100644 --- a/priv/gettext/errors.pot +++ b/priv/gettext/errors.pot @@ -90,110 +90,100 @@ msgid "must be equal to %{number}" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:421 +#: lib/pleroma/web/common_api/common_api.ex:505 msgid "Account not found" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:249 +#: lib/pleroma/web/common_api/common_api.ex:339 msgid "Already voted" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:360 +#: lib/pleroma/web/oauth/oauth_controller.ex:359 msgid "Bad request" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:425 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:426 msgid "Can't delete object" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:196 -msgid "Can't delete this post" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/controller_helper.ex:95 -#: lib/pleroma/web/controller_helper.ex:101 +#: lib/pleroma/web/controller_helper.ex:105 +#: lib/pleroma/web/controller_helper.ex:111 msgid "Can't display this activity" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:227 -#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:254 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:285 msgid "Can't find user" msgstr "" #, elixir-format -#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:114 +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:61 msgid "Can't get favorites" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:437 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:438 msgid "Can't like object" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:556 +#: lib/pleroma/web/common_api/utils.ex:563 msgid "Cannot post an empty status without attachments" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:504 +#: lib/pleroma/web/common_api/utils.ex:511 msgid "Comment must be up to %{max_size} characters" msgstr "" #, elixir-format -#: lib/pleroma/config/config_db.ex:222 +#: lib/pleroma/config/config_db.ex:191 msgid "Config with params %{params} not found" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:95 +#: lib/pleroma/web/common_api/common_api.ex:181 +#: lib/pleroma/web/common_api/common_api.ex:185 msgid "Could not delete" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:141 +#: lib/pleroma/web/common_api/common_api.ex:231 msgid "Could not favorite" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:370 +#: lib/pleroma/web/common_api/common_api.ex:453 msgid "Could not pin" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:112 -msgid "Could not repeat" -msgstr "" - -#, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:188 +#: lib/pleroma/web/common_api/common_api.ex:278 msgid "Could not unfavorite" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:380 +#: lib/pleroma/web/common_api/common_api.ex:463 msgid "Could not unpin" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:126 +#: lib/pleroma/web/common_api/common_api.ex:216 msgid "Could not unrepeat" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:428 -#: lib/pleroma/web/common_api/common_api.ex:437 +#: lib/pleroma/web/common_api/common_api.ex:512 +#: lib/pleroma/web/common_api/common_api.ex:521 msgid "Could not update state" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:202 +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:207 msgid "Error." msgstr "" @@ -203,8 +193,8 @@ msgid "Invalid CAPTCHA" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:117 -#: lib/pleroma/web/oauth/oauth_controller.ex:569 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:116 +#: lib/pleroma/web/oauth/oauth_controller.ex:568 msgid "Invalid credentials" msgstr "" @@ -214,22 +204,22 @@ msgid "Invalid credentials." msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:265 +#: lib/pleroma/web/common_api/common_api.ex:355 msgid "Invalid indices" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:1147 +#: lib/pleroma/web/admin_api/controllers/fallback_controller.ex:29 msgid "Invalid parameters" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:411 +#: lib/pleroma/web/common_api/utils.ex:414 msgid "Invalid password." msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:187 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:220 msgid "Invalid request" msgstr "" @@ -239,44 +229,44 @@ msgid "Kocaptcha service unavailable" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:113 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:112 msgid "Missing parameters" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:540 +#: lib/pleroma/web/common_api/utils.ex:547 msgid "No such conversation" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:439 -#: lib/pleroma/web/admin_api/admin_api_controller.ex:465 lib/pleroma/web/admin_api/admin_api_controller.ex:507 +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:388 +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:414 lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:456 msgid "No such permission_group" msgstr "" #, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:74 -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:485 lib/pleroma/web/admin_api/admin_api_controller.ex:1135 -#: lib/pleroma/web/feed/user_controller.ex:73 lib/pleroma/web/ostatus/ostatus_controller.ex:143 +#: lib/pleroma/plugs/uploaded_media.ex:84 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:486 lib/pleroma/web/admin_api/controllers/fallback_controller.ex:11 +#: lib/pleroma/web/feed/user_controller.ex:71 lib/pleroma/web/ostatus/ostatus_controller.ex:143 msgid "Not found" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:241 +#: lib/pleroma/web/common_api/common_api.ex:331 msgid "Poll's author can't vote" msgstr "" #, elixir-format #: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:20 #: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:37 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:49 -#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:290 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:306 #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:71 msgid "Record not found" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:1153 -#: lib/pleroma/web/feed/user_controller.ex:79 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:32 +#: lib/pleroma/web/admin_api/controllers/fallback_controller.ex:35 +#: lib/pleroma/web/feed/user_controller.ex:77 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:36 #: lib/pleroma/web/ostatus/ostatus_controller.ex:149 msgid "Something went wrong" msgstr "" @@ -287,7 +277,7 @@ msgid "The message visibility must be direct" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/utils.ex:566 +#: lib/pleroma/web/common_api/utils.ex:573 msgid "The status is over the character limit" msgstr "" @@ -302,65 +292,65 @@ msgid "Throttled" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:266 +#: lib/pleroma/web/common_api/common_api.ex:356 msgid "Too many choices" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:442 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:443 msgid "Unhandled activity type" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:536 +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:485 msgid "You can't revoke your own admin status." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:218 -#: lib/pleroma/web/oauth/oauth_controller.ex:309 +#: lib/pleroma/web/oauth/oauth_controller.ex:221 +#: lib/pleroma/web/oauth/oauth_controller.ex:308 msgid "Your account is currently disabled" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:180 -#: lib/pleroma/web/oauth/oauth_controller.ex:332 +#: lib/pleroma/web/oauth/oauth_controller.ex:183 +#: lib/pleroma/web/oauth/oauth_controller.ex:331 msgid "Your login is missing a confirmed e-mail address" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:389 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:390 msgid "can't read inbox of %{nickname} as %{as_nickname}" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:472 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:473 msgid "can't update outbox of %{nickname} as %{as_nickname}" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:388 +#: lib/pleroma/web/common_api/common_api.ex:471 msgid "conversation is already muted" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:316 -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:491 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:314 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:492 msgid "error" msgstr "" #, elixir-format -#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:29 +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:32 msgid "mascots can only be images" msgstr "" #, elixir-format -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:60 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:62 msgid "not found" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:395 +#: lib/pleroma/web/oauth/oauth_controller.ex:394 msgid "Bad OAuth request." msgstr "" @@ -375,17 +365,17 @@ msgid "CAPTCHA expired" msgstr "" #, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:55 +#: lib/pleroma/plugs/uploaded_media.ex:57 msgid "Failed" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:411 +#: lib/pleroma/web/oauth/oauth_controller.ex:410 msgid "Failed to authenticate: %{message}." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:442 +#: lib/pleroma/web/oauth/oauth_controller.ex:441 msgid "Failed to set up user account." msgstr "" @@ -395,7 +385,7 @@ msgid "Insufficient permissions: %{permissions}." msgstr "" #, elixir-format -#: lib/pleroma/plugs/uploaded_media.ex:94 +#: lib/pleroma/plugs/uploaded_media.ex:104 msgid "Internal Error" msgstr "" @@ -411,12 +401,12 @@ msgid "Invalid answer data" msgstr "" #, elixir-format -#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:128 +#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:33 msgid "Nodeinfo schema version not handled" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:169 +#: lib/pleroma/web/oauth/oauth_controller.ex:172 msgid "This action is outside the authorized scopes" msgstr "" @@ -426,13 +416,13 @@ msgid "Unknown error, please check the details and try again." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:116 -#: lib/pleroma/web/oauth/oauth_controller.ex:155 +#: lib/pleroma/web/oauth/oauth_controller.ex:119 +#: lib/pleroma/web/oauth/oauth_controller.ex:158 msgid "Unlisted redirect_uri." msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:391 +#: lib/pleroma/web/oauth/oauth_controller.ex:390 msgid "Unsupported OAuth provider: %{provider}." msgstr "" @@ -452,12 +442,12 @@ msgid "CAPTCHA Error" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:200 +#: lib/pleroma/web/common_api/common_api.ex:290 msgid "Could not add reaction emoji" msgstr "" #, elixir-format -#: lib/pleroma/web/common_api/common_api.ex:211 +#: lib/pleroma/web/common_api/common_api.ex:301 msgid "Could not remove reaction emoji" msgstr "" @@ -472,39 +462,45 @@ msgid "List not found" msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:124 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:123 msgid "Missing parameter: %{name}" msgstr "" #, elixir-format -#: lib/pleroma/web/oauth/oauth_controller.ex:207 -#: lib/pleroma/web/oauth/oauth_controller.ex:322 +#: lib/pleroma/web/oauth/oauth_controller.ex:210 +#: lib/pleroma/web/oauth/oauth_controller.ex:321 msgid "Password reset is required" msgstr "" #, elixir-format #: lib/pleroma/tests/auth_test_controller.ex:9 -#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/admin_api_controller.ex:6 -#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/fallback_redirect_controller.ex:6 -#: lib/pleroma/web/feed/tag_controller.ex:6 lib/pleroma/web/feed/user_controller.ex:6 -#: lib/pleroma/web/mailer/subscription_controller.ex:2 lib/pleroma/web/masto_fe_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14 lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8 lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7 lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6 -#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6 lib/pleroma/web/media_proxy/media_proxy_controller.ex:6 -#: lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6 lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6 -#: lib/pleroma/web/oauth/fallback_controller.ex:6 lib/pleroma/web/oauth/mfa_controller.ex:10 -#: lib/pleroma/web/oauth/oauth_controller.ex:6 lib/pleroma/web/ostatus/ostatus_controller.ex:6 -#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:2 -#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex:6 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/config_controller.ex:6 lib/pleroma/web/admin_api/controllers/fallback_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/invite_controller.ex:6 lib/pleroma/web/admin_api/controllers/media_proxy_cache_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/oauth_app_controller.ex:6 lib/pleroma/web/admin_api/controllers/relay_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/report_controller.ex:6 lib/pleroma/web/admin_api/controllers/status_controller.ex:6 +#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/embed_controller.ex:6 +#: lib/pleroma/web/fallback_redirect_controller.ex:6 lib/pleroma/web/feed/tag_controller.ex:6 +#: lib/pleroma/web/feed/user_controller.ex:6 lib/pleroma/web/mailer/subscription_controller.ex:2 +#: lib/pleroma/web/masto_fe_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14 +#: lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8 +#: lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7 +#: lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6 +#: lib/pleroma/web/media_proxy/media_proxy_controller.ex:6 lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6 +#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6 lib/pleroma/web/oauth/fallback_controller.ex:6 +#: lib/pleroma/web/oauth/mfa_controller.ex:10 lib/pleroma/web/oauth/oauth_controller.ex:6 +#: lib/pleroma/web/ostatus/ostatus_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/chat_controller.ex:5 lib/pleroma/web/pleroma_api/controllers/conversation_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:2 lib/pleroma/web/pleroma_api/controllers/emoji_reaction_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/notification_controller.ex:6 #: lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex:6 #: lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex:7 lib/pleroma/web/static_fe/static_fe_controller.ex:6 #: lib/pleroma/web/twitter_api/controllers/password_controller.ex:10 lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex:6 @@ -519,46 +515,56 @@ msgid "Two-factor authentication enabled, you must use a access token." msgstr "" #, elixir-format -#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:210 +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:210 msgid "Unexpected error occurred while adding file to pack." msgstr "" #, elixir-format -#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:138 +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:138 msgid "Unexpected error occurred while creating pack." msgstr "" #, elixir-format -#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:278 +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:278 msgid "Unexpected error occurred while removing file from pack." msgstr "" #, elixir-format -#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:250 +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:250 msgid "Unexpected error occurred while updating file in pack." msgstr "" #, elixir-format -#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:179 +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:179 msgid "Unexpected error occurred while updating pack metadata." msgstr "" -#, elixir-format -#: lib/pleroma/plugs/user_is_admin_plug.ex:40 -msgid "User is not an admin or OAuth admin scope is not granted." -msgstr "" - #, elixir-format #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61 msgid "Web push subscription is disabled on this Pleroma instance" msgstr "" #, elixir-format -#: lib/pleroma/web/admin_api/admin_api_controller.ex:502 +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:451 msgid "You can't revoke your own admin/moderator status." msgstr "" #, elixir-format -#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:105 +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:126 msgid "authorization required for timeline view" msgstr "" + +#, elixir-format +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:24 +msgid "Access denied" +msgstr "" + +#, elixir-format +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:282 +msgid "This API requires an authenticated user" +msgstr "" + +#, elixir-format +#: lib/pleroma/plugs/user_is_admin_plug.ex:21 +msgid "User is not an admin." +msgstr "" diff --git a/priv/gettext/es/LC_MESSAGES/errors.po b/priv/gettext/es/LC_MESSAGES/errors.po new file mode 100644 index 000000000..ba75936a9 --- /dev/null +++ b/priv/gettext/es/LC_MESSAGES/errors.po @@ -0,0 +1,586 @@ +msgid "" +msgstr "" +"Project-Id-Version: PACKAGE VERSION\n" +"Report-Msgid-Bugs-To: \n" +"POT-Creation-Date: 2020-09-09 09:49+0000\n" +"PO-Revision-Date: 2020-09-09 10:52+0000\n" +"Last-Translator: tarteka \n" +"Language-Team: Spanish \n" +"Language: es\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Plural-Forms: nplurals=2; plural=n != 1;\n" +"X-Generator: Weblate 4.0.4\n" + +## This file is a PO Template file. +## +## `msgid`s here are often extracted from source code. +## Add new translations manually only if they're dynamic +## translations that can't be statically extracted. +## +## Run `mix gettext.extract` to bring this file up to +## date. Leave `msgstr`s empty as changing them here as no +## effect: edit them in PO (`.po`) files instead. +## From Ecto.Changeset.cast/4 +msgid "can't be blank" +msgstr "no puede estar en blanco" + +## From Ecto.Changeset.unique_constraint/3 +msgid "has already been taken" +msgstr "ya está en uso" + +## From Ecto.Changeset.put_change/3 +msgid "is invalid" +msgstr "es inválido" + +## From Ecto.Changeset.validate_format/3 +msgid "has invalid format" +msgstr "el formato no es válido" + +## From Ecto.Changeset.validate_subset/3 +msgid "has an invalid entry" +msgstr "tiene una entrada inválida" + +## From Ecto.Changeset.validate_exclusion/3 +msgid "is reserved" +msgstr "está reservado" + +## From Ecto.Changeset.validate_confirmation/3 +msgid "does not match confirmation" +msgstr "la confirmación no coincide" + +## From Ecto.Changeset.no_assoc_constraint/3 +msgid "is still associated with this entry" +msgstr "todavía está asociado con esta entrada" + +msgid "are still associated with this entry" +msgstr "todavía están asociados con esta entrada" + +## From Ecto.Changeset.validate_length/3 +msgid "should be %{count} character(s)" +msgid_plural "should be %{count} character(s)" +msgstr[0] "debe tener %{count} carácter" +msgstr[1] "debe tener %{count} caracteres" + +msgid "should have %{count} item(s)" +msgid_plural "should have %{count} item(s)" +msgstr[0] "" +msgstr[1] "" + +msgid "should be at least %{count} character(s)" +msgid_plural "should be at least %{count} character(s)" +msgstr[0] "" +msgstr[1] "" + +msgid "should have at least %{count} item(s)" +msgid_plural "should have at least %{count} item(s)" +msgstr[0] "" +msgstr[1] "" + +msgid "should be at most %{count} character(s)" +msgid_plural "should be at most %{count} character(s)" +msgstr[0] "" +msgstr[1] "" + +msgid "should have at most %{count} item(s)" +msgid_plural "should have at most %{count} item(s)" +msgstr[0] "" +msgstr[1] "" + +## From Ecto.Changeset.validate_number/3 +msgid "must be less than %{number}" +msgstr "" + +msgid "must be greater than %{number}" +msgstr "" + +msgid "must be less than or equal to %{number}" +msgstr "" + +msgid "must be greater than or equal to %{number}" +msgstr "" + +msgid "must be equal to %{number}" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:505 +#, elixir-format +msgid "Account not found" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:339 +#, elixir-format +msgid "Already voted" +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:359 +#, elixir-format +msgid "Bad request" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:426 +#, elixir-format +msgid "Can't delete object" +msgstr "" + +#: lib/pleroma/web/controller_helper.ex:105 +#: lib/pleroma/web/controller_helper.ex:111 +#, elixir-format +msgid "Can't display this activity" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:285 +#, elixir-format +msgid "Can't find user" +msgstr "" + +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:61 +#, elixir-format +msgid "Can't get favorites" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:438 +#, elixir-format +msgid "Can't like object" +msgstr "" + +#: lib/pleroma/web/common_api/utils.ex:563 +#, elixir-format +msgid "Cannot post an empty status without attachments" +msgstr "" + +#: lib/pleroma/web/common_api/utils.ex:511 +#, elixir-format +msgid "Comment must be up to %{max_size} characters" +msgstr "" + +#: lib/pleroma/config/config_db.ex:191 +#, elixir-format +msgid "Config with params %{params} not found" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:181 +#: lib/pleroma/web/common_api/common_api.ex:185 +#, elixir-format +msgid "Could not delete" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:231 +#, elixir-format +msgid "Could not favorite" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:453 +#, elixir-format +msgid "Could not pin" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:278 +#, elixir-format +msgid "Could not unfavorite" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:463 +#, elixir-format +msgid "Could not unpin" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:216 +#, elixir-format +msgid "Could not unrepeat" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:512 +#: lib/pleroma/web/common_api/common_api.ex:521 +#, elixir-format +msgid "Could not update state" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:207 +#, elixir-format +msgid "Error." +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:106 +#, elixir-format +msgid "Invalid CAPTCHA" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:116 +#: lib/pleroma/web/oauth/oauth_controller.ex:568 +#, elixir-format +msgid "Invalid credentials" +msgstr "" + +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:38 +#, elixir-format +msgid "Invalid credentials." +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:355 +#, elixir-format +msgid "Invalid indices" +msgstr "" + +#: lib/pleroma/web/admin_api/controllers/fallback_controller.ex:29 +#, elixir-format +msgid "Invalid parameters" +msgstr "" + +#: lib/pleroma/web/common_api/utils.ex:414 +#, elixir-format +msgid "Invalid password." +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:220 +#, elixir-format +msgid "Invalid request" +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:109 +#, elixir-format +msgid "Kocaptcha service unavailable" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:112 +#, elixir-format +msgid "Missing parameters" +msgstr "" + +#: lib/pleroma/web/common_api/utils.ex:547 +#, elixir-format +msgid "No such conversation" +msgstr "" + +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:388 +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:414 lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:456 +#, elixir-format +msgid "No such permission_group" +msgstr "" + +#: lib/pleroma/plugs/uploaded_media.ex:84 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:486 lib/pleroma/web/admin_api/controllers/fallback_controller.ex:11 +#: lib/pleroma/web/feed/user_controller.ex:71 lib/pleroma/web/ostatus/ostatus_controller.ex:143 +#, elixir-format +msgid "Not found" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:331 +#, elixir-format +msgid "Poll's author can't vote" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:20 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:37 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:49 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:306 +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:71 +#, elixir-format +msgid "Record not found" +msgstr "" + +#: lib/pleroma/web/admin_api/controllers/fallback_controller.ex:35 +#: lib/pleroma/web/feed/user_controller.ex:77 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:36 +#: lib/pleroma/web/ostatus/ostatus_controller.ex:149 +#, elixir-format +msgid "Something went wrong" +msgstr "" + +#: lib/pleroma/web/common_api/activity_draft.ex:107 +#, elixir-format +msgid "The message visibility must be direct" +msgstr "" + +#: lib/pleroma/web/common_api/utils.ex:573 +#, elixir-format +msgid "The status is over the character limit" +msgstr "" + +#: lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex:31 +#, elixir-format +msgid "This resource requires authentication." +msgstr "" + +#: lib/pleroma/plugs/rate_limiter/rate_limiter.ex:206 +#, elixir-format +msgid "Throttled" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:356 +#, elixir-format +msgid "Too many choices" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:443 +#, elixir-format +msgid "Unhandled activity type" +msgstr "" + +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:485 +#, elixir-format +msgid "You can't revoke your own admin status." +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:221 +#: lib/pleroma/web/oauth/oauth_controller.ex:308 +#, elixir-format +msgid "Your account is currently disabled" +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:183 +#: lib/pleroma/web/oauth/oauth_controller.ex:331 +#, elixir-format +msgid "Your login is missing a confirmed e-mail address" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:390 +#, elixir-format +msgid "can't read inbox of %{nickname} as %{as_nickname}" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:473 +#, elixir-format +msgid "can't update outbox of %{nickname} as %{as_nickname}" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:471 +#, elixir-format +msgid "conversation is already muted" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:314 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:492 +#, elixir-format +msgid "error" +msgstr "" + +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:32 +#, elixir-format +msgid "mascots can only be images" +msgstr "" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:62 +#, elixir-format +msgid "not found" +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:394 +#, elixir-format +msgid "Bad OAuth request." +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:115 +#, elixir-format +msgid "CAPTCHA already used" +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:112 +#, elixir-format +msgid "CAPTCHA expired" +msgstr "" + +#: lib/pleroma/plugs/uploaded_media.ex:57 +#, elixir-format +msgid "Failed" +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:410 +#, elixir-format +msgid "Failed to authenticate: %{message}." +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:441 +#, elixir-format +msgid "Failed to set up user account." +msgstr "" + +#: lib/pleroma/plugs/oauth_scopes_plug.ex:38 +#, elixir-format +msgid "Insufficient permissions: %{permissions}." +msgstr "" + +#: lib/pleroma/plugs/uploaded_media.ex:104 +#, elixir-format +msgid "Internal Error" +msgstr "" + +#: lib/pleroma/web/oauth/fallback_controller.ex:22 +#: lib/pleroma/web/oauth/fallback_controller.ex:29 +#, elixir-format +msgid "Invalid Username/Password" +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:118 +#, elixir-format +msgid "Invalid answer data" +msgstr "" + +#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:33 +#, elixir-format +msgid "Nodeinfo schema version not handled" +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:172 +#, elixir-format +msgid "This action is outside the authorized scopes" +msgstr "" + +#: lib/pleroma/web/oauth/fallback_controller.ex:14 +#, elixir-format +msgid "Unknown error, please check the details and try again." +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:119 +#: lib/pleroma/web/oauth/oauth_controller.ex:158 +#, elixir-format +msgid "Unlisted redirect_uri." +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:390 +#, elixir-format +msgid "Unsupported OAuth provider: %{provider}." +msgstr "" + +#: lib/pleroma/uploaders/uploader.ex:72 +#, elixir-format +msgid "Uploader callback timeout" +msgstr "" + +#: lib/pleroma/web/uploader_controller.ex:23 +#, elixir-format +msgid "bad request" +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:103 +#, elixir-format +msgid "CAPTCHA Error" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:290 +#, elixir-format +msgid "Could not add reaction emoji" +msgstr "" + +#: lib/pleroma/web/common_api/common_api.ex:301 +#, elixir-format +msgid "Could not remove reaction emoji" +msgstr "" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:129 +#, elixir-format +msgid "Invalid CAPTCHA (Missing parameter: %{name})" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:92 +#, elixir-format +msgid "List not found" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:123 +#, elixir-format +msgid "Missing parameter: %{name}" +msgstr "" + +#: lib/pleroma/web/oauth/oauth_controller.ex:210 +#: lib/pleroma/web/oauth/oauth_controller.ex:321 +#, elixir-format +msgid "Password reset is required" +msgstr "" + +#: lib/pleroma/tests/auth_test_controller.ex:9 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/config_controller.ex:6 lib/pleroma/web/admin_api/controllers/fallback_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/invite_controller.ex:6 lib/pleroma/web/admin_api/controllers/media_proxy_cache_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/oauth_app_controller.ex:6 lib/pleroma/web/admin_api/controllers/relay_controller.ex:6 +#: lib/pleroma/web/admin_api/controllers/report_controller.ex:6 lib/pleroma/web/admin_api/controllers/status_controller.ex:6 +#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/embed_controller.ex:6 +#: lib/pleroma/web/fallback_redirect_controller.ex:6 lib/pleroma/web/feed/tag_controller.ex:6 +#: lib/pleroma/web/feed/user_controller.ex:6 lib/pleroma/web/mailer/subscription_controller.ex:2 +#: lib/pleroma/web/masto_fe_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14 +#: lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8 +#: lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7 +#: lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6 +#: lib/pleroma/web/media_proxy/media_proxy_controller.ex:6 lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6 +#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6 lib/pleroma/web/oauth/fallback_controller.ex:6 +#: lib/pleroma/web/oauth/mfa_controller.ex:10 lib/pleroma/web/oauth/oauth_controller.ex:6 +#: lib/pleroma/web/ostatus/ostatus_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/chat_controller.ex:5 lib/pleroma/web/pleroma_api/controllers/conversation_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:2 lib/pleroma/web/pleroma_api/controllers/emoji_reaction_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/notification_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex:7 lib/pleroma/web/static_fe/static_fe_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/password_controller.ex:10 lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/util_controller.ex:6 lib/pleroma/web/twitter_api/twitter_api_controller.ex:6 +#: lib/pleroma/web/uploader_controller.ex:6 lib/pleroma/web/web_finger/web_finger_controller.ex:6 +#, elixir-format +msgid "Security violation: OAuth scopes check was neither handled nor explicitly skipped." +msgstr "" + +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:28 +#, elixir-format +msgid "Two-factor authentication enabled, you must use a access token." +msgstr "" + +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:210 +#, elixir-format +msgid "Unexpected error occurred while adding file to pack." +msgstr "" + +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:138 +#, elixir-format +msgid "Unexpected error occurred while creating pack." +msgstr "" + +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:278 +#, elixir-format +msgid "Unexpected error occurred while removing file from pack." +msgstr "" + +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:250 +#, elixir-format +msgid "Unexpected error occurred while updating file in pack." +msgstr "" + +#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:179 +#, elixir-format +msgid "Unexpected error occurred while updating pack metadata." +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61 +#, elixir-format +msgid "Web push subscription is disabled on this Pleroma instance" +msgstr "" + +#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:451 +#, elixir-format +msgid "You can't revoke your own admin/moderator status." +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:126 +#, elixir-format +msgid "authorization required for timeline view" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:24 +#, elixir-format +msgid "Access denied" +msgstr "" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:282 +#, elixir-format +msgid "This API requires an authenticated user" +msgstr "" + +#: lib/pleroma/plugs/user_is_admin_plug.ex:21 +#, elixir-format +msgid "User is not an admin." +msgstr "" diff --git a/priv/gettext/it/LC_MESSAGES/errors.po b/priv/gettext/it/LC_MESSAGES/errors.po new file mode 100644 index 000000000..cd0cd6c65 --- /dev/null +++ b/priv/gettext/it/LC_MESSAGES/errors.po @@ -0,0 +1,585 @@ +msgid "" +msgstr "" +"Project-Id-Version: PACKAGE VERSION\n" +"Report-Msgid-Bugs-To: \n" +"POT-Creation-Date: 2020-06-19 14:33+0000\n" +"PO-Revision-Date: 2020-07-09 14:40+0000\n" +"Last-Translator: Ben Is \n" +"Language-Team: Italian \n" +"Language: it\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Plural-Forms: nplurals=2; plural=n != 1;\n" +"X-Generator: Weblate 4.0.4\n" + +## This file is a PO Template file. +## +## `msgid`s here are often extracted from source code. +## Add new translations manually only if they're dynamic +## translations that can't be statically extracted. +## +## Run `mix gettext.extract` to bring this file up to +## date. Leave `msgstr`s empty as changing them here as no +## effect: edit them in PO (`.po`) files instead. +## From Ecto.Changeset.cast/4 +msgid "can't be blank" +msgstr "non può essere nullo" + +## From Ecto.Changeset.unique_constraint/3 +msgid "has already been taken" +msgstr "è stato già creato" + +## From Ecto.Changeset.put_change/3 +msgid "is invalid" +msgstr "non è valido" + +## From Ecto.Changeset.validate_format/3 +msgid "has invalid format" +msgstr "è in un formato invalido" + +## From Ecto.Changeset.validate_subset/3 +msgid "has an invalid entry" +msgstr "ha una voce invalida" + +## From Ecto.Changeset.validate_exclusion/3 +msgid "is reserved" +msgstr "è vietato" + +## From Ecto.Changeset.validate_confirmation/3 +msgid "does not match confirmation" +msgstr "non corrisponde alla verifica" + +## From Ecto.Changeset.no_assoc_constraint/3 +msgid "is still associated with this entry" +msgstr "è ancora associato con questa voce" + +msgid "are still associated with this entry" +msgstr "sono ancora associati con questa voce" + +## From Ecto.Changeset.validate_length/3 +msgid "should be %{count} character(s)" +msgid_plural "should be %{count} character(s)" +msgstr[0] "dovrebbe essere %{count} carattere" +msgstr[1] "dovrebbero essere %{count} caratteri" + +msgid "should have %{count} item(s)" +msgid_plural "should have %{count} item(s)" +msgstr[0] "dovrebbe avere %{count} voce" +msgstr[1] "dovrebbe avere %{count} voci" + +msgid "should be at least %{count} character(s)" +msgid_plural "should be at least %{count} character(s)" +msgstr[0] "dovrebbe contenere almeno %{count} carattere" +msgstr[1] "dovrebbe contenere almeno %{count} caratteri" + +msgid "should have at least %{count} item(s)" +msgid_plural "should have at least %{count} item(s)" +msgstr[0] "dovrebbe avere almeno %{count} voce" +msgstr[1] "dovrebbe avere almeno %{count} voci" + +msgid "should be at most %{count} character(s)" +msgid_plural "should be at most %{count} character(s)" +msgstr[0] "dovrebbe avere al massimo %{count} carattere" +msgstr[1] "dovrebbe avere al massimo %{count} caratteri" + +msgid "should have at most %{count} item(s)" +msgid_plural "should have at most %{count} item(s)" +msgstr[0] "dovrebbe avere al massimo %{count} voce" +msgstr[1] "dovrebbe avere al massimo %{count} voci" + +## From Ecto.Changeset.validate_number/3 +msgid "must be less than %{number}" +msgstr "dev'essere minore di %{number}" + +msgid "must be greater than %{number}" +msgstr "dev'essere maggiore di %{number}" + +msgid "must be less than or equal to %{number}" +msgstr "dev'essere minore o uguale a %{number}" + +msgid "must be greater than or equal to %{number}" +msgstr "dev'essere maggiore o uguale a %{number}" + +msgid "must be equal to %{number}" +msgstr "dev'essere uguale a %{number}" + +#: lib/pleroma/web/common_api/common_api.ex:421 +#, elixir-format +msgid "Account not found" +msgstr "Profilo non trovato" + +#: lib/pleroma/web/common_api/common_api.ex:249 +#, elixir-format +msgid "Already voted" +msgstr "Hai già votato" + +#: lib/pleroma/web/oauth/oauth_controller.ex:360 +#, elixir-format +msgid "Bad request" +msgstr "Richiesta invalida" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:425 +#, elixir-format +msgid "Can't delete object" +msgstr "Non puoi eliminare quest'oggetto" + +#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:196 +#, elixir-format +msgid "Can't delete this post" +msgstr "Non puoi eliminare questo messaggio" + +#: lib/pleroma/web/controller_helper.ex:95 +#: lib/pleroma/web/controller_helper.ex:101 +#, elixir-format +msgid "Can't display this activity" +msgstr "Non puoi vedere questo elemento" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:227 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:254 +#, elixir-format +msgid "Can't find user" +msgstr "Non trovo questo utente" + +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:114 +#, elixir-format +msgid "Can't get favorites" +msgstr "Non posso ricevere i gradimenti" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:437 +#, elixir-format +msgid "Can't like object" +msgstr "Non posso gradire quest'oggetto" + +#: lib/pleroma/web/common_api/utils.ex:556 +#, elixir-format +msgid "Cannot post an empty status without attachments" +msgstr "Non puoi pubblicare un messaggio vuoto senza allegati" + +#: lib/pleroma/web/common_api/utils.ex:504 +#, elixir-format +msgid "Comment must be up to %{max_size} characters" +msgstr "I commenti posso al massimo consistere di %{max_size} caratteri" + +#: lib/pleroma/config/config_db.ex:222 +#, elixir-format +msgid "Config with params %{params} not found" +msgstr "Configurazione con parametri %{max_size} non trovata" + +#: lib/pleroma/web/common_api/common_api.ex:95 +#, elixir-format +msgid "Could not delete" +msgstr "Non eliminato" + +#: lib/pleroma/web/common_api/common_api.ex:141 +#, elixir-format +msgid "Could not favorite" +msgstr "Non gradito" + +#: lib/pleroma/web/common_api/common_api.ex:370 +#, elixir-format +msgid "Could not pin" +msgstr "Non intestato" + +#: lib/pleroma/web/common_api/common_api.ex:112 +#, elixir-format +msgid "Could not repeat" +msgstr "Non ripetuto" + +#: lib/pleroma/web/common_api/common_api.ex:188 +#, elixir-format +msgid "Could not unfavorite" +msgstr "Non sgradito" + +#: lib/pleroma/web/common_api/common_api.ex:380 +#, elixir-format +msgid "Could not unpin" +msgstr "Non de-intestato" + +#: lib/pleroma/web/common_api/common_api.ex:126 +#, elixir-format +msgid "Could not unrepeat" +msgstr "Non de-ripetuto" + +#: lib/pleroma/web/common_api/common_api.ex:428 +#: lib/pleroma/web/common_api/common_api.ex:437 +#, elixir-format +msgid "Could not update state" +msgstr "Non aggiornato" + +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:202 +#, elixir-format +msgid "Error." +msgstr "Errore." + +#: lib/pleroma/web/twitter_api/twitter_api.ex:106 +#, elixir-format +msgid "Invalid CAPTCHA" +msgstr "CAPTCHA invalido" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:117 +#: lib/pleroma/web/oauth/oauth_controller.ex:569 +#, elixir-format +msgid "Invalid credentials" +msgstr "Credenziali invalide" + +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:38 +#, elixir-format +msgid "Invalid credentials." +msgstr "Credenziali invalide." + +#: lib/pleroma/web/common_api/common_api.ex:265 +#, elixir-format +msgid "Invalid indices" +msgstr "Indici invalidi" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:1147 +#, elixir-format +msgid "Invalid parameters" +msgstr "Parametri invalidi" + +#: lib/pleroma/web/common_api/utils.ex:411 +#, elixir-format +msgid "Invalid password." +msgstr "Parola d'ordine invalida." + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:187 +#, elixir-format +msgid "Invalid request" +msgstr "Richiesta invalida" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:109 +#, elixir-format +msgid "Kocaptcha service unavailable" +msgstr "Servizio Kocaptcha non disponibile" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:113 +#, elixir-format +msgid "Missing parameters" +msgstr "Parametri mancanti" + +#: lib/pleroma/web/common_api/utils.ex:540 +#, elixir-format +msgid "No such conversation" +msgstr "Conversazione inesistente" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:439 +#: lib/pleroma/web/admin_api/admin_api_controller.ex:465 lib/pleroma/web/admin_api/admin_api_controller.ex:507 +#, elixir-format +msgid "No such permission_group" +msgstr "permission_group non esistente" + +#: lib/pleroma/plugs/uploaded_media.ex:74 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:485 lib/pleroma/web/admin_api/admin_api_controller.ex:1135 +#: lib/pleroma/web/feed/user_controller.ex:73 lib/pleroma/web/ostatus/ostatus_controller.ex:143 +#, elixir-format +msgid "Not found" +msgstr "Non trovato" + +#: lib/pleroma/web/common_api/common_api.ex:241 +#, elixir-format +msgid "Poll's author can't vote" +msgstr "L'autore del sondaggio non può votare" + +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:20 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:37 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:49 +#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:290 +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:71 +#, elixir-format +msgid "Record not found" +msgstr "Voce non trovata" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:1153 +#: lib/pleroma/web/feed/user_controller.ex:79 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:32 +#: lib/pleroma/web/ostatus/ostatus_controller.ex:149 +#, elixir-format +msgid "Something went wrong" +msgstr "C'è stato un problema" + +#: lib/pleroma/web/common_api/activity_draft.ex:107 +#, elixir-format +msgid "The message visibility must be direct" +msgstr "Il messaggio dev'essere privato" + +#: lib/pleroma/web/common_api/utils.ex:566 +#, elixir-format +msgid "The status is over the character limit" +msgstr "Il messaggio ha superato la lunghezza massima" + +#: lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex:31 +#, elixir-format +msgid "This resource requires authentication." +msgstr "Accedi per leggere." + +#: lib/pleroma/plugs/rate_limiter/rate_limiter.ex:206 +#, elixir-format +msgid "Throttled" +msgstr "Strozzato" + +#: lib/pleroma/web/common_api/common_api.ex:266 +#, elixir-format +msgid "Too many choices" +msgstr "Troppe alternative" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:442 +#, elixir-format +msgid "Unhandled activity type" +msgstr "Tipo di attività non gestibile" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:536 +#, elixir-format +msgid "You can't revoke your own admin status." +msgstr "Non puoi divestirti da solo." + +#: lib/pleroma/web/oauth/oauth_controller.ex:218 +#: lib/pleroma/web/oauth/oauth_controller.ex:309 +#, elixir-format +msgid "Your account is currently disabled" +msgstr "Il tuo profilo è attualmente disabilitato" + +#: lib/pleroma/web/oauth/oauth_controller.ex:180 +#: lib/pleroma/web/oauth/oauth_controller.ex:332 +#, elixir-format +msgid "Your login is missing a confirmed e-mail address" +msgstr "Devi aggiungere un indirizzo email valido" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:389 +#, elixir-format +msgid "can't read inbox of %{nickname} as %{as_nickname}" +msgstr "non puoi leggere i messaggi privati di %{nickname} come %{as_nickname}" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:472 +#, elixir-format +msgid "can't update outbox of %{nickname} as %{as_nickname}" +msgstr "non puoi aggiornare gli inviati di %{nickname} come %{as_nickname}" + +#: lib/pleroma/web/common_api/common_api.ex:388 +#, elixir-format +msgid "conversation is already muted" +msgstr "la conversazione è già zittita" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:316 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:491 +#, elixir-format +msgid "error" +msgstr "errore" + +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:29 +#, elixir-format +msgid "mascots can only be images" +msgstr "le mascotte possono solo essere immagini" + +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:60 +#, elixir-format +msgid "not found" +msgstr "non trovato" + +#: lib/pleroma/web/oauth/oauth_controller.ex:395 +#, elixir-format +msgid "Bad OAuth request." +msgstr "Richiesta OAuth malformata." + +#: lib/pleroma/web/twitter_api/twitter_api.ex:115 +#, elixir-format +msgid "CAPTCHA already used" +msgstr "CAPTCHA già utilizzato" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:112 +#, elixir-format +msgid "CAPTCHA expired" +msgstr "CAPTCHA scaduto" + +#: lib/pleroma/plugs/uploaded_media.ex:55 +#, elixir-format +msgid "Failed" +msgstr "Fallito" + +#: lib/pleroma/web/oauth/oauth_controller.ex:411 +#, elixir-format +msgid "Failed to authenticate: %{message}." +msgstr "Autenticazione fallita per: %{message}." + +#: lib/pleroma/web/oauth/oauth_controller.ex:442 +#, elixir-format +msgid "Failed to set up user account." +msgstr "Profilo utente non creato." + +#: lib/pleroma/plugs/oauth_scopes_plug.ex:38 +#, elixir-format +msgid "Insufficient permissions: %{permissions}." +msgstr "Permessi insufficienti: %{permissions}." + +#: lib/pleroma/plugs/uploaded_media.ex:94 +#, elixir-format +msgid "Internal Error" +msgstr "Errore interno" + +#: lib/pleroma/web/oauth/fallback_controller.ex:22 +#: lib/pleroma/web/oauth/fallback_controller.ex:29 +#, elixir-format +msgid "Invalid Username/Password" +msgstr "Nome utente/parola d'ordine invalidi" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:118 +#, elixir-format +msgid "Invalid answer data" +msgstr "Risposta malformata" + +#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:128 +#, elixir-format +msgid "Nodeinfo schema version not handled" +msgstr "Versione schema nodeinfo non compatibile" + +#: lib/pleroma/web/oauth/oauth_controller.ex:169 +#, elixir-format +msgid "This action is outside the authorized scopes" +msgstr "Quest'azione non è consentita in questa visibilità" + +#: lib/pleroma/web/oauth/fallback_controller.ex:14 +#, elixir-format +msgid "Unknown error, please check the details and try again." +msgstr "Errore sconosciuto, controlla i dettagli e riprova." + +#: lib/pleroma/web/oauth/oauth_controller.ex:116 +#: lib/pleroma/web/oauth/oauth_controller.ex:155 +#, elixir-format +msgid "Unlisted redirect_uri." +msgstr "redirect_uri nascosto." + +#: lib/pleroma/web/oauth/oauth_controller.ex:391 +#, elixir-format +msgid "Unsupported OAuth provider: %{provider}." +msgstr "Gestore OAuth non supportato: %{provider}." + +#: lib/pleroma/uploaders/uploader.ex:72 +#, elixir-format +msgid "Uploader callback timeout" +msgstr "Callback caricatmento scaduta" + +#: lib/pleroma/web/uploader_controller.ex:23 +#, elixir-format +msgid "bad request" +msgstr "richiesta malformata" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:103 +#, elixir-format +msgid "CAPTCHA Error" +msgstr "Errore CAPTCHA" + +#: lib/pleroma/web/common_api/common_api.ex:200 +#, elixir-format +msgid "Could not add reaction emoji" +msgstr "Reazione emoji non riuscita" + +#: lib/pleroma/web/common_api/common_api.ex:211 +#, elixir-format +msgid "Could not remove reaction emoji" +msgstr "Rimozione reazione non riuscita" + +#: lib/pleroma/web/twitter_api/twitter_api.ex:129 +#, elixir-format +msgid "Invalid CAPTCHA (Missing parameter: %{name})" +msgstr "CAPTCHA invalido (Parametro mancante: %{name})" + +#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:92 +#, elixir-format +msgid "List not found" +msgstr "Lista non trovata" + +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:124 +#, elixir-format +msgid "Missing parameter: %{name}" +msgstr "Parametro mancante: %{name}" + +#: lib/pleroma/web/oauth/oauth_controller.ex:207 +#: lib/pleroma/web/oauth/oauth_controller.ex:322 +#, elixir-format +msgid "Password reset is required" +msgstr "Necessario reimpostare parola d'ordine" + +#: lib/pleroma/tests/auth_test_controller.ex:9 +#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/admin_api_controller.ex:6 +#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/fallback_redirect_controller.ex:6 +#: lib/pleroma/web/feed/tag_controller.ex:6 lib/pleroma/web/feed/user_controller.ex:6 +#: lib/pleroma/web/mailer/subscription_controller.ex:2 lib/pleroma/web/masto_fe_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14 lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8 lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7 lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6 +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6 lib/pleroma/web/media_proxy/media_proxy_controller.ex:6 +#: lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6 lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6 +#: lib/pleroma/web/oauth/fallback_controller.ex:6 lib/pleroma/web/oauth/mfa_controller.ex:10 +#: lib/pleroma/web/oauth/oauth_controller.ex:6 lib/pleroma/web/ostatus/ostatus_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:2 +#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex:6 +#: lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex:7 lib/pleroma/web/static_fe/static_fe_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/password_controller.ex:10 lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex:6 +#: lib/pleroma/web/twitter_api/controllers/util_controller.ex:6 lib/pleroma/web/twitter_api/twitter_api_controller.ex:6 +#: lib/pleroma/web/uploader_controller.ex:6 lib/pleroma/web/web_finger/web_finger_controller.ex:6 +#, elixir-format +msgid "Security violation: OAuth scopes check was neither handled nor explicitly skipped." +msgstr "" +"Sicurezza violata: il controllo autorizzazioni di OAuth non è stato svolto " +"né saltato." + +#: lib/pleroma/plugs/ensure_authenticated_plug.ex:28 +#, elixir-format +msgid "Two-factor authentication enabled, you must use a access token." +msgstr "" +"Autenticazione bifattoriale abilitata, devi utilizzare una chiave d'accesso." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:210 +#, elixir-format +msgid "Unexpected error occurred while adding file to pack." +msgstr "Errore inaspettato durante l'aggiunta del file al pacchetto." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:138 +#, elixir-format +msgid "Unexpected error occurred while creating pack." +msgstr "Errore inaspettato durante la creazione del pacchetto." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:278 +#, elixir-format +msgid "Unexpected error occurred while removing file from pack." +msgstr "Errore inaspettato durante la rimozione del file dal pacchetto." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:250 +#, elixir-format +msgid "Unexpected error occurred while updating file in pack." +msgstr "Errore inaspettato durante l'aggiornamento del file nel pacchetto." + +#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:179 +#, elixir-format +msgid "Unexpected error occurred while updating pack metadata." +msgstr "Errore inaspettato durante l'aggiornamento dei metadati del pacchetto." + +#: lib/pleroma/plugs/user_is_admin_plug.ex:21 +#, elixir-format +msgid "User is not an admin." +msgstr "" +"L'utente non è un amministratore." +"OAuth." + +#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61 +#, elixir-format +msgid "Web push subscription is disabled on this Pleroma instance" +msgstr "Gli aggiornamenti web push non sono disponibili in questa stanza" + +#: lib/pleroma/web/admin_api/admin_api_controller.ex:502 +#, elixir-format +msgid "You can't revoke your own admin/moderator status." +msgstr "Non puoi divestire te stesso." + +#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:105 +#, elixir-format +msgid "authorization required for timeline view" +msgstr "autorizzazione richiesta per vedere la sequenza" diff --git a/priv/gettext/nl/LC_MESSAGES/errors.po b/priv/gettext/nl/LC_MESSAGES/errors.po index 3118f6b5d..cfcb05fe6 100644 --- a/priv/gettext/nl/LC_MESSAGES/errors.po +++ b/priv/gettext/nl/LC_MESSAGES/errors.po @@ -559,9 +559,9 @@ msgstr "" msgid "Unexpected error occurred while updating pack metadata." msgstr "" -#: lib/pleroma/plugs/user_is_admin_plug.ex:40 +#: lib/pleroma/plugs/user_is_admin_plug.ex:21 #, elixir-format -msgid "User is not an admin or OAuth admin scope is not granted." +msgid "User is not an admin." msgstr "" #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61 diff --git a/priv/gettext/pl/LC_MESSAGES/errors.po b/priv/gettext/pl/LC_MESSAGES/errors.po index 7bc39c52a..653ea00a1 100644 --- a/priv/gettext/pl/LC_MESSAGES/errors.po +++ b/priv/gettext/pl/LC_MESSAGES/errors.po @@ -3,8 +3,8 @@ msgstr "" "Project-Id-Version: PACKAGE VERSION\n" "Report-Msgid-Bugs-To: \n" "POT-Creation-Date: 2020-05-13 16:37+0000\n" -"PO-Revision-Date: 2020-05-16 17:13+0000\n" -"Last-Translator: Jędrzej Tomaszewski \n" +"PO-Revision-Date: 2020-07-09 14:40+0000\n" +"Last-Translator: Ben Is \n" "Language-Team: Polish \n" "Language: pl\n" @@ -50,7 +50,7 @@ msgstr "jest zarezerwowany" ## From Ecto.Changeset.validate_confirmation/3 msgid "does not match confirmation" -msgstr "" +msgstr "nie pasuje do potwierdzenia" ## From Ecto.Changeset.no_assoc_constraint/3 msgid "is still associated with this entry" @@ -566,9 +566,9 @@ msgstr "Nieoczekiwany błąd podczas zmieniania pliku w paczce." msgid "Unexpected error occurred while updating pack metadata." msgstr "Nieoczekiwany błąd podczas zmieniania metadanych paczki." -#: lib/pleroma/plugs/user_is_admin_plug.ex:40 +#: lib/pleroma/plugs/user_is_admin_plug.ex:21 #, elixir-format -msgid "User is not an admin or OAuth admin scope is not granted." +msgid "User is not an admin." msgstr "" #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61 diff --git a/priv/repo/migrations/20200322174133_user_raw_bio.exs b/priv/repo/migrations/20200322174133_user_raw_bio.exs new file mode 100644 index 000000000..ddf9be4f5 --- /dev/null +++ b/priv/repo/migrations/20200322174133_user_raw_bio.exs @@ -0,0 +1,9 @@ +defmodule Pleroma.Repo.Migrations.UserRawBio do + use Ecto.Migration + + def change do + alter table(:users) do + add_if_not_exists(:raw_bio, :text) + end + end +end diff --git a/priv/repo/migrations/20200323122421_mrf_config_move_from_instance_namespace.exs b/priv/repo/migrations/20200323122421_mrf_config_move_from_instance_namespace.exs new file mode 100644 index 000000000..ef36c4eb7 --- /dev/null +++ b/priv/repo/migrations/20200323122421_mrf_config_move_from_instance_namespace.exs @@ -0,0 +1,39 @@ +defmodule Pleroma.Repo.Migrations.MrfConfigMoveFromInstanceNamespace do + use Ecto.Migration + + alias Pleroma.ConfigDB + + @old_keys [:rewrite_policy, :mrf_transparency, :mrf_transparency_exclusions] + def change do + config = ConfigDB.get_by_params(%{group: :pleroma, key: :instance}) + + if config do + mrf = + config.value + |> Keyword.take(@old_keys) + |> Keyword.new(fn + {:rewrite_policy, policies} -> {:policies, policies} + {:mrf_transparency, transparency} -> {:transparency, transparency} + {:mrf_transparency_exclusions, exclusions} -> {:transparency_exclusions, exclusions} + end) + + if mrf != [] do + {:ok, _} = + %ConfigDB{} + |> ConfigDB.changeset(%{group: :pleroma, key: :mrf, value: mrf}) + |> Pleroma.Repo.insert() + + new_instance = Keyword.drop(config.value, @old_keys) + + if new_instance != [] do + {:ok, _} = + config + |> ConfigDB.changeset(%{value: new_instance}) + |> Pleroma.Repo.update() + else + {:ok, _} = ConfigDB.delete(config) + end + end + end + end +end diff --git a/priv/repo/migrations/20200328193433_populate_user_raw_bio.exs b/priv/repo/migrations/20200328193433_populate_user_raw_bio.exs new file mode 100644 index 000000000..cb35db3f5 --- /dev/null +++ b/priv/repo/migrations/20200328193433_populate_user_raw_bio.exs @@ -0,0 +1,25 @@ +defmodule Pleroma.Repo.Migrations.PopulateUserRawBio do + use Ecto.Migration + import Ecto.Query + alias Pleroma.User + alias Pleroma.Repo + + def change do + {:ok, _} = Application.ensure_all_started(:fast_sanitize) + + User.Query.build(%{local: true}) + |> select([u], struct(u, [:id, :ap_id, :bio])) + |> Repo.stream() + |> Enum.each(fn %{bio: bio} = user -> + if bio do + raw_bio = + bio + |> String.replace(~r(
), "\n") + |> Pleroma.HTML.strip_tags() + + Ecto.Changeset.cast(user, %{raw_bio: raw_bio}, [:raw_bio]) + |> Repo.update() + end + end) + end +end diff --git a/priv/repo/migrations/20200508092434_update_counter_cache_table.exs b/priv/repo/migrations/20200508092434_update_counter_cache_table.exs new file mode 100644 index 000000000..738344868 --- /dev/null +++ b/priv/repo/migrations/20200508092434_update_counter_cache_table.exs @@ -0,0 +1,143 @@ +defmodule Pleroma.Repo.Migrations.UpdateCounterCacheTable do + use Ecto.Migration + + @function_name "update_status_visibility_counter_cache" + @trigger_name "status_visibility_counter_cache_trigger" + + def up do + execute("drop trigger if exists #{@trigger_name} on activities") + execute("drop function if exists #{@function_name}()") + drop_if_exists(unique_index(:counter_cache, [:name])) + drop_if_exists(table(:counter_cache)) + + create_if_not_exists table(:counter_cache) do + add(:instance, :string, null: false) + add(:direct, :bigint, null: false, default: 0) + add(:private, :bigint, null: false, default: 0) + add(:unlisted, :bigint, null: false, default: 0) + add(:public, :bigint, null: false, default: 0) + end + + create_if_not_exists(unique_index(:counter_cache, [:instance])) + + """ + CREATE OR REPLACE FUNCTION #{@function_name}() + RETURNS TRIGGER AS + $$ + DECLARE + hostname character varying(255); + visibility_new character varying(64); + visibility_old character varying(64); + actor character varying(255); + BEGIN + IF TG_OP = 'DELETE' THEN + actor := OLD.actor; + ELSE + actor := NEW.actor; + END IF; + hostname := split_part(actor, '/', 3); + IF TG_OP = 'INSERT' THEN + visibility_new := activity_visibility(NEW.actor, NEW.recipients, NEW.data); + IF NEW.data->>'type' = 'Create' + AND visibility_new IN ('public', 'unlisted', 'private', 'direct') THEN + EXECUTE format('INSERT INTO "counter_cache" ("instance", %1$I) VALUES ($1, 1) + ON CONFLICT ("instance") DO + UPDATE SET %1$I = "counter_cache".%1$I + 1', visibility_new) + USING hostname; + END IF; + RETURN NEW; + ELSIF TG_OP = 'UPDATE' THEN + visibility_new := activity_visibility(NEW.actor, NEW.recipients, NEW.data); + visibility_old := activity_visibility(OLD.actor, OLD.recipients, OLD.data); + IF (NEW.data->>'type' = 'Create') + AND (OLD.data->>'type' = 'Create') + AND visibility_new != visibility_old + AND visibility_new IN ('public', 'unlisted', 'private', 'direct') THEN + EXECUTE format('UPDATE "counter_cache" SET + %1$I = greatest("counter_cache".%1$I - 1, 0), + %2$I = "counter_cache".%2$I + 1 + WHERE "instance" = $1', visibility_old, visibility_new) + USING hostname; + END IF; + RETURN NEW; + ELSIF TG_OP = 'DELETE' THEN + IF OLD.data->>'type' = 'Create' THEN + visibility_old := activity_visibility(OLD.actor, OLD.recipients, OLD.data); + EXECUTE format('UPDATE "counter_cache" SET + %1$I = greatest("counter_cache".%1$I - 1, 0) + WHERE "instance" = $1', visibility_old) + USING hostname; + END IF; + RETURN OLD; + END IF; + END; + $$ + LANGUAGE 'plpgsql'; + """ + |> execute() + + execute("DROP TRIGGER IF EXISTS #{@trigger_name} ON activities") + + """ + CREATE TRIGGER #{@trigger_name} + BEFORE + INSERT + OR UPDATE of recipients, data + OR DELETE + ON activities + FOR EACH ROW + EXECUTE PROCEDURE #{@function_name}(); + """ + |> execute() + end + + def down do + execute("DROP TRIGGER IF EXISTS #{@trigger_name} ON activities") + execute("DROP FUNCTION IF EXISTS #{@function_name}()") + drop_if_exists(unique_index(:counter_cache, [:instance])) + drop_if_exists(table(:counter_cache)) + + create_if_not_exists table(:counter_cache) do + add(:name, :string, null: false) + add(:count, :bigint, null: false, default: 0) + end + + create_if_not_exists(unique_index(:counter_cache, [:name])) + + """ + CREATE OR REPLACE FUNCTION #{@function_name}() + RETURNS TRIGGER AS + $$ + DECLARE + BEGIN + IF TG_OP = 'INSERT' THEN + IF NEW.data->>'type' = 'Create' THEN + EXECUTE 'INSERT INTO counter_cache (name, count) VALUES (''status_visibility_' || activity_visibility(NEW.actor, NEW.recipients, NEW.data) || ''', 1) ON CONFLICT (name) DO UPDATE SET count = counter_cache.count + 1'; + END IF; + RETURN NEW; + ELSIF TG_OP = 'UPDATE' THEN + IF (NEW.data->>'type' = 'Create') and (OLD.data->>'type' = 'Create') and activity_visibility(NEW.actor, NEW.recipients, NEW.data) != activity_visibility(OLD.actor, OLD.recipients, OLD.data) THEN + EXECUTE 'INSERT INTO counter_cache (name, count) VALUES (''status_visibility_' || activity_visibility(NEW.actor, NEW.recipients, NEW.data) || ''', 1) ON CONFLICT (name) DO UPDATE SET count = counter_cache.count + 1'; + EXECUTE 'update counter_cache SET count = counter_cache.count - 1 where count > 0 and name = ''status_visibility_' || activity_visibility(OLD.actor, OLD.recipients, OLD.data) || ''';'; + END IF; + RETURN NEW; + ELSIF TG_OP = 'DELETE' THEN + IF OLD.data->>'type' = 'Create' THEN + EXECUTE 'update counter_cache SET count = counter_cache.count - 1 where count > 0 and name = ''status_visibility_' || activity_visibility(OLD.actor, OLD.recipients, OLD.data) || ''';'; + END IF; + RETURN OLD; + END IF; + END; + $$ + LANGUAGE 'plpgsql'; + """ + |> execute() + + """ + CREATE TRIGGER #{@trigger_name} BEFORE INSERT OR UPDATE of recipients, data OR DELETE ON activities + FOR EACH ROW + EXECUTE PROCEDURE #{@function_name}(); + """ + |> execute() + end +end diff --git a/priv/repo/migrations/20200626163359_rename_notification_privacy_option.exs b/priv/repo/migrations/20200626163359_rename_notification_privacy_option.exs new file mode 100644 index 000000000..06d7f7272 --- /dev/null +++ b/priv/repo/migrations/20200626163359_rename_notification_privacy_option.exs @@ -0,0 +1,19 @@ +defmodule Pleroma.Repo.Migrations.RenameNotificationPrivacyOption do + use Ecto.Migration + + def up do + execute( + "UPDATE users SET notification_settings = notification_settings - 'privacy_option' || jsonb_build_object('hide_notification_contents', notification_settings->'privacy_option') +where notification_settings ? 'privacy_option' +and local" + ) + end + + def down do + execute( + "UPDATE users SET notification_settings = notification_settings - 'hide_notification_contents' || jsonb_build_object('privacy_option', notification_settings->'hide_notification_contents') +where notification_settings ? 'hide_notification_contents' +and local" + ) + end +end diff --git a/priv/repo/migrations/20200630162024_rename_user_settings_col.exs b/priv/repo/migrations/20200630162024_rename_user_settings_col.exs new file mode 100644 index 000000000..2355eb681 --- /dev/null +++ b/priv/repo/migrations/20200630162024_rename_user_settings_col.exs @@ -0,0 +1,11 @@ +defmodule Pleroma.Repo.Migrations.RenameUserSettingsCol do + use Ecto.Migration + + def up do + rename(table(:users), :settings, to: :mastofe_settings) + end + + def down do + rename(table(:users), :mastofe_settings, to: :settings) + end +end diff --git a/priv/repo/migrations/20200703101031_add_chat_acceptance_to_users.exs b/priv/repo/migrations/20200703101031_add_chat_acceptance_to_users.exs new file mode 100644 index 000000000..8dfda89f1 --- /dev/null +++ b/priv/repo/migrations/20200703101031_add_chat_acceptance_to_users.exs @@ -0,0 +1,17 @@ +defmodule Pleroma.Repo.Migrations.AddChatAcceptanceToUsers do + use Ecto.Migration + + def up do + alter table(:users) do + add(:accepts_chat_messages, :boolean, nullable: true) + end + + execute("update users set accepts_chat_messages = true where local = true") + end + + def down do + alter table(:users) do + remove(:accepts_chat_messages) + end + end +end diff --git a/priv/repo/migrations/20200706060258_remove_tesla_from_config.exs b/priv/repo/migrations/20200706060258_remove_tesla_from_config.exs new file mode 100644 index 000000000..798687f8a --- /dev/null +++ b/priv/repo/migrations/20200706060258_remove_tesla_from_config.exs @@ -0,0 +1,10 @@ +defmodule Pleroma.Repo.Migrations.RemoveTeslaFromConfig do + use Ecto.Migration + + def up do + execute("DELETE FROM config WHERE config.group = ':tesla'") + end + + def down do + end +end diff --git a/priv/repo/migrations/20200707112859_instances_add_favicon.exs b/priv/repo/migrations/20200707112859_instances_add_favicon.exs new file mode 100644 index 000000000..5538749dc --- /dev/null +++ b/priv/repo/migrations/20200707112859_instances_add_favicon.exs @@ -0,0 +1,10 @@ +defmodule Pleroma.Repo.Migrations.InstancesAddFavicon do + use Ecto.Migration + + def change do + alter table(:instances) do + add(:favicon, :string) + add(:favicon_updated_at, :naive_datetime) + end + end +end diff --git a/priv/repo/migrations/20200708193702_drop_user_trigram_index.exs b/priv/repo/migrations/20200708193702_drop_user_trigram_index.exs new file mode 100644 index 000000000..94efe323a --- /dev/null +++ b/priv/repo/migrations/20200708193702_drop_user_trigram_index.exs @@ -0,0 +1,18 @@ +defmodule Pleroma.Repo.Migrations.DropUserTrigramIndex do + @moduledoc "Drops unused trigram index on `users` (FTS index is being used instead)" + + use Ecto.Migration + + def up do + drop_if_exists(index(:users, [], name: :users_trigram_index)) + end + + def down do + create_if_not_exists( + index(:users, ["(trim(nickname || ' ' || coalesce(name, ''))) gist_trgm_ops"], + name: :users_trigram_index, + using: :gist + ) + ) + end +end diff --git a/priv/repo/migrations/20200712234852_add_approval_fields_to_users.exs b/priv/repo/migrations/20200712234852_add_approval_fields_to_users.exs new file mode 100644 index 000000000..43f741a5b --- /dev/null +++ b/priv/repo/migrations/20200712234852_add_approval_fields_to_users.exs @@ -0,0 +1,10 @@ +defmodule Pleroma.Repo.Migrations.AddApprovalFieldsToUsers do + use Ecto.Migration + + def change do + alter table(:users) do + add(:approval_pending, :boolean) + add(:registration_reason, :text) + end + end +end diff --git a/priv/repo/migrations/20200714081657_oban_2_0_config_changes.exs b/priv/repo/migrations/20200714081657_oban_2_0_config_changes.exs new file mode 100644 index 000000000..c54bb2511 --- /dev/null +++ b/priv/repo/migrations/20200714081657_oban_2_0_config_changes.exs @@ -0,0 +1,27 @@ +defmodule Elixir.Pleroma.Repo.Migrations.Oban20ConfigChanges do + use Ecto.Migration + import Ecto.Query + alias Pleroma.ConfigDB + alias Pleroma.Repo + + def change do + config_entry = + from(c in ConfigDB, where: c.group == ^":pleroma" and c.key == ^"Oban") + |> select([c], struct(c, [:value, :id])) + |> Repo.one() + + if config_entry do + %{value: value} = config_entry + + value = + case Keyword.fetch(value, :verbose) do + {:ok, log} -> Keyword.put_new(value, :log, log) + _ -> value + end + |> Keyword.drop([:verbose, :prune]) + + Ecto.Changeset.change(config_entry, %{value: value}) + |> Repo.update() + end + end +end diff --git a/priv/repo/migrations/20200716195806_autolinker_to_linkify.exs b/priv/repo/migrations/20200716195806_autolinker_to_linkify.exs new file mode 100644 index 000000000..570acba84 --- /dev/null +++ b/priv/repo/migrations/20200716195806_autolinker_to_linkify.exs @@ -0,0 +1,36 @@ +defmodule Pleroma.Repo.Migrations.AutolinkerToLinkify do + use Ecto.Migration + alias Pleroma.ConfigDB + + @autolinker_path %{group: :auto_linker, key: :opts} + @linkify_path %{group: :pleroma, key: Pleroma.Formatter} + + @compat_opts [:class, :rel, :new_window, :truncate, :strip_prefix, :extra] + + def change do + with {:ok, {old, new}} <- maybe_get_params() do + move_config(old, new) + end + end + + defp move_config(%{} = old, %{} = new) do + {:ok, _} = ConfigDB.update_or_create(new) + {:ok, _} = ConfigDB.delete(old) + :ok + end + + defp maybe_get_params() do + with %ConfigDB{value: opts} <- ConfigDB.get_by_params(@autolinker_path), + opts <- transform_opts(opts), + %{} = linkify_params <- Map.put(@linkify_path, :value, opts) do + {:ok, {@autolinker_path, linkify_params}} + end + end + + def transform_opts(opts) when is_list(opts) do + opts + |> Enum.into(%{}) + |> Map.take(@compat_opts) + |> Map.to_list() + end +end diff --git a/priv/repo/migrations/20200722185515_fix_malformed_formatter_config.exs b/priv/repo/migrations/20200722185515_fix_malformed_formatter_config.exs new file mode 100644 index 000000000..77b760825 --- /dev/null +++ b/priv/repo/migrations/20200722185515_fix_malformed_formatter_config.exs @@ -0,0 +1,26 @@ +defmodule Pleroma.Repo.Migrations.FixMalformedFormatterConfig do + use Ecto.Migration + alias Pleroma.ConfigDB + + @config_path %{group: :pleroma, key: Pleroma.Formatter} + + def change do + with %ConfigDB{value: %{} = opts} <- ConfigDB.get_by_params(@config_path), + fixed_opts <- Map.to_list(opts) do + fix_config(fixed_opts) + else + _ -> :skipped + end + end + + defp fix_config(fixed_opts) when is_list(fixed_opts) do + {:ok, _} = + ConfigDB.update_or_create(%{ + group: :pleroma, + key: Pleroma.Formatter, + value: fixed_opts + }) + + :ok + end +end diff --git a/priv/repo/migrations/20200724133313_move_welcome_settings.exs b/priv/repo/migrations/20200724133313_move_welcome_settings.exs new file mode 100644 index 000000000..323a8fcee --- /dev/null +++ b/priv/repo/migrations/20200724133313_move_welcome_settings.exs @@ -0,0 +1,94 @@ +defmodule Pleroma.Repo.Migrations.MoveWelcomeSettings do + use Ecto.Migration + + alias Pleroma.ConfigDB + + @old_keys [:welcome_user_nickname, :welcome_message] + + def up do + with {:ok, config, {keep_values, move_values}} <- get_old_values() do + insert_welcome_settings(move_values) + update_instance_config(config, keep_values) + end + end + + def down do + with {:ok, welcome_config, revert_values} <- get_revert_values() do + revert_instance_config(revert_values) + Pleroma.Repo.delete(welcome_config) + end + end + + defp insert_welcome_settings([_ | _] = values) do + unless String.trim(values[:welcome_message]) == "" do + config_values = [ + direct_message: %{ + enabled: true, + sender_nickname: values[:welcome_user_nickname], + message: values[:welcome_message] + }, + email: %{ + enabled: false, + sender: nil, + subject: "Welcome to <%= instance_name %>", + html: "Welcome to <%= instance_name %>", + text: "Welcome to <%= instance_name %>" + } + ] + + {:ok, _} = + %ConfigDB{} + |> ConfigDB.changeset(%{group: :pleroma, key: :welcome, value: config_values}) + |> Pleroma.Repo.insert() + end + + :ok + end + + defp insert_welcome_settings(_), do: :noop + + defp revert_instance_config(%{} = revert_values) do + values = [ + welcome_user_nickname: revert_values[:sender_nickname], + welcome_message: revert_values[:message] + ] + + ConfigDB.update_or_create(%{group: :pleroma, key: :instance, value: values}) + end + + defp revert_instance_config(_), do: :noop + + defp update_instance_config(config, values) do + {:ok, _} = + config + |> ConfigDB.changeset(%{value: values}) + |> Pleroma.Repo.update() + + :ok + end + + defp get_revert_values do + config = ConfigDB.get_by_params(%{group: :pleroma, key: :welcome}) + + cond do + is_nil(config) -> {:noop, nil, nil} + true -> {:ok, config, config.value[:direct_message]} + end + end + + defp get_old_values do + config = ConfigDB.get_by_params(%{group: :pleroma, key: :instance}) + + cond do + is_nil(config) -> + {:noop, config, {}} + + is_binary(config.value[:welcome_message]) -> + {:ok, config, + {Keyword.drop(config.value, @old_keys), Keyword.take(config.value, @old_keys)}} + + true -> + {:ok, config, {Keyword.drop(config.value, @old_keys), []}} + end + end +end diff --git a/priv/repo/migrations/20200802170532_fix_legacy_tags.exs b/priv/repo/migrations/20200802170532_fix_legacy_tags.exs new file mode 100644 index 000000000..ca82fac42 --- /dev/null +++ b/priv/repo/migrations/20200802170532_fix_legacy_tags.exs @@ -0,0 +1,40 @@ +# Fix legacy tags set by AdminFE that don't align with TagPolicy MRF + +defmodule Pleroma.Repo.Migrations.FixLegacyTags do + use Ecto.Migration + alias Pleroma.Repo + alias Pleroma.User + import Ecto.Query + + @old_new_map %{ + "force_nsfw" => "mrf_tag:media-force-nsfw", + "strip_media" => "mrf_tag:media-strip", + "force_unlisted" => "mrf_tag:force-unlisted", + "sandbox" => "mrf_tag:sandbox", + "disable_remote_subscription" => "mrf_tag:disable-remote-subscription", + "disable_any_subscription" => "mrf_tag:disable-any-subscription" + } + + def change do + legacy_tags = Map.keys(@old_new_map) + + from(u in User, + where: fragment("? && ?", u.tags, ^legacy_tags), + select: struct(u, [:tags, :id]) + ) + |> Repo.chunk_stream(100) + |> Enum.each(fn user -> + fix_tags_changeset(user) + |> Repo.update() + end) + end + + defp fix_tags_changeset(%User{tags: tags} = user) do + new_tags = + Enum.map(tags, fn tag -> + Map.get(@old_new_map, tag, tag) + end) + + Ecto.Changeset.change(user, tags: new_tags) + end +end diff --git a/priv/repo/migrations/20200804180322_remove_nonlocal_expirations.exs b/priv/repo/migrations/20200804180322_remove_nonlocal_expirations.exs new file mode 100644 index 000000000..389935f0d --- /dev/null +++ b/priv/repo/migrations/20200804180322_remove_nonlocal_expirations.exs @@ -0,0 +1,19 @@ +defmodule Pleroma.Repo.Migrations.RemoveNonlocalExpirations do + use Ecto.Migration + + def up do + statement = """ + DELETE FROM + activity_expirations A USING activities B + WHERE + A.activity_id = B.id + AND B.local = false; + """ + + execute(statement) + end + + def down do + :ok + end +end diff --git a/priv/repo/migrations/20200804183107_add_unique_index_to_app_client_id.exs b/priv/repo/migrations/20200804183107_add_unique_index_to_app_client_id.exs new file mode 100644 index 000000000..83de18096 --- /dev/null +++ b/priv/repo/migrations/20200804183107_add_unique_index_to_app_client_id.exs @@ -0,0 +1,7 @@ +defmodule Pleroma.Repo.Migrations.AddUniqueIndexToAppClientId do + use Ecto.Migration + + def change do + create(unique_index(:apps, [:client_id])) + end +end diff --git a/priv/repo/migrations/20200808173046_only_expire_creates.exs b/priv/repo/migrations/20200808173046_only_expire_creates.exs new file mode 100644 index 000000000..9df52956f --- /dev/null +++ b/priv/repo/migrations/20200808173046_only_expire_creates.exs @@ -0,0 +1,19 @@ +defmodule Pleroma.Repo.Migrations.OnlyExpireCreates do + use Ecto.Migration + + def up do + statement = """ + DELETE FROM + activity_expirations a_exp USING activities a, objects o + WHERE + a_exp.activity_id = a.id AND (o.data->>'id') = COALESCE(a.data->'object'->>'id', a.data->>'object') + AND (a.data->>'type' != 'Create' OR o.data->>'type' != 'Note'); + """ + + execute(statement) + end + + def down do + :ok + end +end diff --git a/priv/repo/migrations/20200811125613_set_defaults_to_user_approval_pending.exs b/priv/repo/migrations/20200811125613_set_defaults_to_user_approval_pending.exs new file mode 100644 index 000000000..eec7da03f --- /dev/null +++ b/priv/repo/migrations/20200811125613_set_defaults_to_user_approval_pending.exs @@ -0,0 +1,15 @@ +defmodule Pleroma.Repo.Migrations.SetDefaultsToUserApprovalPending do + use Ecto.Migration + + def up do + execute("UPDATE users SET approval_pending = false WHERE approval_pending IS NULL") + + alter table(:users) do + modify(:approval_pending, :boolean, default: false, null: false) + end + end + + def down do + :ok + end +end diff --git a/priv/repo/migrations/20200811143147_ap_id_not_null.exs b/priv/repo/migrations/20200811143147_ap_id_not_null.exs new file mode 100644 index 000000000..df649c7ca --- /dev/null +++ b/priv/repo/migrations/20200811143147_ap_id_not_null.exs @@ -0,0 +1,19 @@ +defmodule Pleroma.Repo.Migrations.ApIdNotNull do + use Ecto.Migration + + require Logger + + def up do + Logger.warn( + "If this migration fails please open an issue at https://git.pleroma.social/pleroma/pleroma/-/issues/new \n" + ) + + alter table(:users) do + modify(:ap_id, :string, null: false) + end + end + + def down do + :ok + end +end diff --git a/priv/repo/migrations/20200817120935_add_invisible_index_to_users.exs b/priv/repo/migrations/20200817120935_add_invisible_index_to_users.exs new file mode 100644 index 000000000..2417d366e --- /dev/null +++ b/priv/repo/migrations/20200817120935_add_invisible_index_to_users.exs @@ -0,0 +1,7 @@ +defmodule Pleroma.Repo.Migrations.AddInvisibleIndexToUsers do + use Ecto.Migration + + def change do + create(index(:users, [:invisible])) + end +end diff --git a/priv/repo/migrations/20200824115541_rename_activity_expiration_setting.exs b/priv/repo/migrations/20200824115541_rename_activity_expiration_setting.exs new file mode 100644 index 000000000..241882ef6 --- /dev/null +++ b/priv/repo/migrations/20200824115541_rename_activity_expiration_setting.exs @@ -0,0 +1,13 @@ +defmodule Pleroma.Repo.Migrations.RenameActivityExpirationSetting do + use Ecto.Migration + + def change do + config = Pleroma.ConfigDB.get_by_params(%{group: :pleroma, key: Pleroma.ActivityExpiration}) + + if config do + config + |> Ecto.Changeset.change(key: Pleroma.Workers.PurgeExpiredActivity) + |> Pleroma.Repo.update() + end + end +end diff --git a/priv/repo/migrations/20200825061316_move_activity_expirations_to_oban.exs b/priv/repo/migrations/20200825061316_move_activity_expirations_to_oban.exs new file mode 100644 index 000000000..cdc00d20b --- /dev/null +++ b/priv/repo/migrations/20200825061316_move_activity_expirations_to_oban.exs @@ -0,0 +1,26 @@ +defmodule Pleroma.Repo.Migrations.MoveActivityExpirationsToOban do + use Ecto.Migration + + import Ecto.Query, only: [from: 2] + + def change do + Supervisor.start_link([{Oban, Pleroma.Config.get(Oban)}], + strategy: :one_for_one, + name: Pleroma.Supervisor + ) + + from(e in "activity_expirations", + select: %{id: e.id, activity_id: e.activity_id, scheduled_at: e.scheduled_at} + ) + |> Pleroma.Repo.stream() + |> Stream.each(fn expiration -> + with {:ok, expires_at} <- DateTime.from_naive(expiration.scheduled_at, "Etc/UTC") do + Pleroma.Workers.PurgeExpiredActivity.enqueue(%{ + activity_id: FlakeId.to_string(expiration.activity_id), + expires_at: expires_at + }) + end + end) + |> Stream.run() + end +end diff --git a/priv/repo/migrations/20200825093037_drop_activity_expirations_table.exs b/priv/repo/migrations/20200825093037_drop_activity_expirations_table.exs new file mode 100644 index 000000000..11c461427 --- /dev/null +++ b/priv/repo/migrations/20200825093037_drop_activity_expirations_table.exs @@ -0,0 +1,7 @@ +defmodule Pleroma.Repo.Migrations.DropActivityExpirationsTable do + use Ecto.Migration + + def change do + drop(table("activity_expirations")) + end +end diff --git a/priv/repo/migrations/20200831142509_chat_constraints.exs b/priv/repo/migrations/20200831142509_chat_constraints.exs new file mode 100644 index 000000000..868a40a45 --- /dev/null +++ b/priv/repo/migrations/20200831142509_chat_constraints.exs @@ -0,0 +1,22 @@ +defmodule Pleroma.Repo.Migrations.ChatConstraints do + use Ecto.Migration + + def change do + remove_orphans = """ + delete from chats where not exists(select id from users where ap_id = chats.recipient); + """ + + execute(remove_orphans) + + drop(constraint(:chats, "chats_user_id_fkey")) + + alter table(:chats) do + modify(:user_id, references(:users, type: :uuid, on_delete: :delete_all)) + + modify( + :recipient, + references(:users, column: :ap_id, type: :string, on_delete: :delete_all) + ) + end + end +end diff --git a/priv/repo/migrations/20200901061256_ensure_bio_is_string.exs b/priv/repo/migrations/20200901061256_ensure_bio_is_string.exs new file mode 100644 index 000000000..0e3bb3c81 --- /dev/null +++ b/priv/repo/migrations/20200901061256_ensure_bio_is_string.exs @@ -0,0 +1,7 @@ +defmodule Pleroma.Repo.Migrations.EnsureBioIsString do + use Ecto.Migration + + def change do + execute("update users set bio = '' where bio is null", "") + end +end diff --git a/priv/repo/migrations/20200901061637_bio_set_not_null.exs b/priv/repo/migrations/20200901061637_bio_set_not_null.exs new file mode 100644 index 000000000..e3a67d4e7 --- /dev/null +++ b/priv/repo/migrations/20200901061637_bio_set_not_null.exs @@ -0,0 +1,10 @@ +defmodule Pleroma.Repo.Migrations.BioSetNotNull do + use Ecto.Migration + + def change do + execute( + "alter table users alter column bio set not null", + "alter table users alter column bio drop not null" + ) + end +end diff --git a/priv/repo/migrations/20200905082737_rename_await_up_timeout_in_connections_pool.exs b/priv/repo/migrations/20200905082737_rename_await_up_timeout_in_connections_pool.exs new file mode 100644 index 000000000..22c40663c --- /dev/null +++ b/priv/repo/migrations/20200905082737_rename_await_up_timeout_in_connections_pool.exs @@ -0,0 +1,13 @@ +defmodule Pleroma.Repo.Migrations.RenameAwaitUpTimeoutInConnectionsPool do + use Ecto.Migration + + def change do + with %Pleroma.ConfigDB{} = config <- + Pleroma.ConfigDB.get_by_params(%{group: :pleroma, key: :connections_pool}), + {timeout, value} when is_integer(timeout) <- Keyword.pop(config.value, :await_up_timeout) do + config + |> Ecto.Changeset.change(value: Keyword.put(value, :connect_timeout, timeout)) + |> Pleroma.Repo.update() + end + end +end diff --git a/priv/repo/migrations/20200905091427_rename_timeout_in_pools.exs b/priv/repo/migrations/20200905091427_rename_timeout_in_pools.exs new file mode 100644 index 000000000..bb2f50ecc --- /dev/null +++ b/priv/repo/migrations/20200905091427_rename_timeout_in_pools.exs @@ -0,0 +1,19 @@ +defmodule Pleroma.Repo.Migrations.RenameTimeoutInPools do + use Ecto.Migration + + def change do + with %Pleroma.ConfigDB{} = config <- + Pleroma.ConfigDB.get_by_params(%{group: :pleroma, key: :pools}) do + updated_value = + Enum.map(config.value, fn {pool, pool_value} -> + with {timeout, value} when is_integer(timeout) <- Keyword.pop(pool_value, :timeout) do + {pool, Keyword.put(value, :recv_timeout, timeout)} + end + end) + + config + |> Ecto.Changeset.change(value: updated_value) + |> Pleroma.Repo.update() + end + end +end diff --git a/priv/repo/migrations/20200906072147_remove_cron_stats_worker_from_oban_config.exs b/priv/repo/migrations/20200906072147_remove_cron_stats_worker_from_oban_config.exs new file mode 100644 index 000000000..022f21dc7 --- /dev/null +++ b/priv/repo/migrations/20200906072147_remove_cron_stats_worker_from_oban_config.exs @@ -0,0 +1,19 @@ +defmodule Pleroma.Repo.Migrations.RemoveCronStatsWorkerFromObanConfig do + use Ecto.Migration + + def change do + with %Pleroma.ConfigDB{} = config <- + Pleroma.ConfigDB.get_by_params(%{group: :pleroma, key: Oban}), + crontab when is_list(crontab) <- config.value[:crontab], + index when is_integer(index) <- + Enum.find_index(crontab, fn {_, worker} -> + worker == Pleroma.Workers.Cron.StatsWorker + end) do + updated_value = Keyword.put(config.value, :crontab, List.delete_at(crontab, index)) + + config + |> Ecto.Changeset.change(value: updated_value) + |> Pleroma.Repo.update() + end + end +end diff --git a/priv/repo/migrations/20200907084956_remove_cron_clear_oauth_token_worker_from_oban_config.exs b/priv/repo/migrations/20200907084956_remove_cron_clear_oauth_token_worker_from_oban_config.exs new file mode 100644 index 000000000..b5a0a0ff6 --- /dev/null +++ b/priv/repo/migrations/20200907084956_remove_cron_clear_oauth_token_worker_from_oban_config.exs @@ -0,0 +1,19 @@ +defmodule Pleroma.Repo.Migrations.RemoveCronClearOauthTokenWorkerFromObanConfig do + use Ecto.Migration + + def change do + with %Pleroma.ConfigDB{} = config <- + Pleroma.ConfigDB.get_by_params(%{group: :pleroma, key: Oban}), + crontab when is_list(crontab) <- config.value[:crontab], + index when is_integer(index) <- + Enum.find_index(crontab, fn {_, worker} -> + worker == Pleroma.Workers.Cron.ClearOauthTokenWorker + end) do + updated_value = Keyword.put(config.value, :crontab, List.delete_at(crontab, index)) + + config + |> Ecto.Changeset.change(value: updated_value) + |> Pleroma.Repo.update() + end + end +end diff --git a/priv/repo/migrations/20200907092050_move_tokens_expiration_into_oban.exs b/priv/repo/migrations/20200907092050_move_tokens_expiration_into_oban.exs new file mode 100644 index 000000000..832bd02a7 --- /dev/null +++ b/priv/repo/migrations/20200907092050_move_tokens_expiration_into_oban.exs @@ -0,0 +1,36 @@ +defmodule Pleroma.Repo.Migrations.MoveTokensExpirationIntoOban do + use Ecto.Migration + + import Ecto.Query, only: [from: 2] + + def change do + Supervisor.start_link([{Oban, Pleroma.Config.get(Oban)}], + strategy: :one_for_one, + name: Pleroma.Supervisor + ) + + if Pleroma.Config.get([:oauth2, :clean_expired_tokens]) do + from(t in Pleroma.Web.OAuth.Token, where: t.valid_until > ^NaiveDateTime.utc_now()) + |> Pleroma.Repo.stream() + |> Stream.each(fn token -> + Pleroma.Workers.PurgeExpiredToken.enqueue(%{ + token_id: token.id, + valid_until: DateTime.from_naive!(token.valid_until, "Etc/UTC"), + mod: Pleroma.Web.OAuth.Token + }) + end) + |> Stream.run() + end + + from(t in Pleroma.MFA.Token, where: t.valid_until > ^NaiveDateTime.utc_now()) + |> Pleroma.Repo.stream() + |> Stream.each(fn token -> + Pleroma.Workers.PurgeExpiredToken.enqueue(%{ + token_id: token.id, + valid_until: DateTime.from_naive!(token.valid_until, "Etc/UTC"), + mod: Pleroma.MFA.Token + }) + end) + |> Stream.run() + end +end diff --git a/priv/repo/optional_migrations/rum_indexing/20190510135645_add_fts_index_to_objects_two.exs b/priv/repo/optional_migrations/rum_indexing/20190510135645_add_fts_index_to_objects_two.exs index 6227769dc..757afa129 100644 --- a/priv/repo/optional_migrations/rum_indexing/20190510135645_add_fts_index_to_objects_two.exs +++ b/priv/repo/optional_migrations/rum_indexing/20190510135645_add_fts_index_to_objects_two.exs @@ -10,8 +10,8 @@ def up do execute("CREATE FUNCTION objects_fts_update() RETURNS trigger AS $$ begin - new.fts_content := to_tsvector('english', new.data->>'content'); - return new; + new.fts_content := to_tsvector('english', new.data->>'content'); + return new; end $$ LANGUAGE plpgsql") execute("create index if not exists objects_fts on objects using RUM (fts_content rum_tsvector_addon_ops, inserted_at) with (attach = 'inserted_at', to = 'fts_content');") diff --git a/priv/static/adminfe/app.796ca6d4.css b/priv/static/adminfe/app.07a1f8db.css similarity index 77% rename from priv/static/adminfe/app.796ca6d4.css rename to priv/static/adminfe/app.07a1f8db.css index 1b83a8a39..9d74d13dc 100644 Binary files a/priv/static/adminfe/app.796ca6d4.css and b/priv/static/adminfe/app.07a1f8db.css differ diff --git a/priv/static/adminfe/chunk-0171.aa11eafe.css b/priv/static/adminfe/chunk-0171.aa11eafe.css new file mode 100644 index 000000000..45340d06b Binary files /dev/null and b/priv/static/adminfe/chunk-0171.aa11eafe.css differ diff --git a/priv/static/adminfe/chunk-0598.d8f2b478.css b/priv/static/adminfe/chunk-0598.d8f2b478.css new file mode 100644 index 000000000..9b84800d0 Binary files /dev/null and b/priv/static/adminfe/chunk-0598.d8f2b478.css differ diff --git a/priv/static/adminfe/chunk-0778.d9e7180a.css b/priv/static/adminfe/chunk-0778.29be65e2.css similarity index 100% rename from priv/static/adminfe/chunk-0778.d9e7180a.css rename to priv/static/adminfe/chunk-0778.29be65e2.css diff --git a/priv/static/adminfe/chunk-0f09.66ca2a61.css b/priv/static/adminfe/chunk-0f09.66ca2a61.css new file mode 100644 index 000000000..b580e0699 Binary files /dev/null and b/priv/static/adminfe/chunk-0f09.66ca2a61.css differ diff --git a/priv/static/adminfe/chunk-176e.b7aa5351.css b/priv/static/adminfe/chunk-176e.b7aa5351.css new file mode 100644 index 000000000..0bedf3773 Binary files /dev/null and b/priv/static/adminfe/chunk-176e.b7aa5351.css differ diff --git a/priv/static/adminfe/chunk-19e2.934ad654.css b/priv/static/adminfe/chunk-19e2.934ad654.css new file mode 100644 index 000000000..4fd86df25 Binary files /dev/null and b/priv/static/adminfe/chunk-19e2.934ad654.css differ diff --git a/priv/static/adminfe/chunk-22d2.813009b9.css b/priv/static/adminfe/chunk-22d2.813009b9.css deleted file mode 100644 index f0a98583e..000000000 Binary files a/priv/static/adminfe/chunk-22d2.813009b9.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-28f8.0aae6427.css b/priv/static/adminfe/chunk-28f8.0aae6427.css new file mode 100644 index 000000000..e811b3260 Binary files /dev/null and b/priv/static/adminfe/chunk-28f8.0aae6427.css differ diff --git a/priv/static/adminfe/chunk-2d97.82cbb623.css b/priv/static/adminfe/chunk-2d97.82cbb623.css new file mode 100644 index 000000000..f6e28e1fb Binary files /dev/null and b/priv/static/adminfe/chunk-2d97.82cbb623.css differ diff --git a/priv/static/adminfe/chunk-3221.0ef79c67.css b/priv/static/adminfe/chunk-3221.0ef79c67.css new file mode 100644 index 000000000..bd64e939a Binary files /dev/null and b/priv/static/adminfe/chunk-3221.0ef79c67.css differ diff --git a/priv/static/adminfe/chunk-3384.d50ed383.css b/priv/static/adminfe/chunk-3384.d50ed383.css deleted file mode 100644 index 70ae2a26b..000000000 Binary files a/priv/static/adminfe/chunk-3384.d50ed383.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-39ad.ba67c97f.css b/priv/static/adminfe/chunk-39ad.ba67c97f.css new file mode 100644 index 000000000..778a932cf Binary files /dev/null and b/priv/static/adminfe/chunk-39ad.ba67c97f.css differ diff --git a/priv/static/adminfe/chunk-3ba2.63b1228d.css b/priv/static/adminfe/chunk-3ba2.63b1228d.css new file mode 100644 index 000000000..b375f08d5 Binary files /dev/null and b/priv/static/adminfe/chunk-3ba2.63b1228d.css differ diff --git a/priv/static/adminfe/chunk-40a4.665332db.css b/priv/static/adminfe/chunk-40a4.665332db.css new file mode 100644 index 000000000..83fefcb55 Binary files /dev/null and b/priv/static/adminfe/chunk-40a4.665332db.css differ diff --git a/priv/static/adminfe/chunk-4eb4.b72d16c3.css b/priv/static/adminfe/chunk-4eb4.b72d16c3.css new file mode 100644 index 000000000..1ecdec162 Binary files /dev/null and b/priv/static/adminfe/chunk-4eb4.b72d16c3.css differ diff --git a/priv/static/adminfe/chunk-565e.8c036a6e.css b/priv/static/adminfe/chunk-565e.8c036a6e.css new file mode 100644 index 000000000..c126f246e Binary files /dev/null and b/priv/static/adminfe/chunk-565e.8c036a6e.css differ diff --git a/priv/static/adminfe/chunk-60a9.7b5b9559.css b/priv/static/adminfe/chunk-60a9.7b5b9559.css new file mode 100644 index 000000000..d45d79f4c Binary files /dev/null and b/priv/static/adminfe/chunk-60a9.7b5b9559.css differ diff --git a/priv/static/adminfe/chunk-0961.d3692214.css b/priv/static/adminfe/chunk-6198.3c37d6af.css similarity index 100% rename from priv/static/adminfe/chunk-0961.d3692214.css rename to priv/static/adminfe/chunk-6198.3c37d6af.css diff --git a/priv/static/adminfe/chunk-654e.b2e16b59.css b/priv/static/adminfe/chunk-654e.b2e16b59.css new file mode 100644 index 000000000..483d88545 Binary files /dev/null and b/priv/static/adminfe/chunk-654e.b2e16b59.css differ diff --git a/priv/static/adminfe/chunk-0558.af0d89cd.css b/priv/static/adminfe/chunk-68ea.7633295f.css similarity index 100% rename from priv/static/adminfe/chunk-0558.af0d89cd.css rename to priv/static/adminfe/chunk-68ea.7633295f.css diff --git a/priv/static/adminfe/chunk-68ea.81e11186.css b/priv/static/adminfe/chunk-68ea.81e11186.css new file mode 100644 index 000000000..30bf7de23 Binary files /dev/null and b/priv/static/adminfe/chunk-68ea.81e11186.css differ diff --git a/priv/static/adminfe/chunk-6b68.0cc00484.css b/priv/static/adminfe/chunk-6b68.0cc00484.css deleted file mode 100644 index 7061b3d03..000000000 Binary files a/priv/static/adminfe/chunk-6b68.0cc00484.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-6e81.0e80d020.css b/priv/static/adminfe/chunk-6e81.0e9e6d27.css similarity index 100% rename from priv/static/adminfe/chunk-6e81.0e80d020.css rename to priv/static/adminfe/chunk-6e81.0e9e6d27.css diff --git a/priv/static/adminfe/chunk-6e81.7e5babfc.css b/priv/static/adminfe/chunk-6e81.7e5babfc.css new file mode 100644 index 000000000..da819ca09 Binary files /dev/null and b/priv/static/adminfe/chunk-6e81.7e5babfc.css differ diff --git a/priv/static/adminfe/chunk-6e8c.ef26acfd.css b/priv/static/adminfe/chunk-6e8c.ef26acfd.css new file mode 100644 index 000000000..76f698880 Binary files /dev/null and b/priv/static/adminfe/chunk-6e8c.ef26acfd.css differ diff --git a/priv/static/adminfe/chunk-7503.cc089ee4.css b/priv/static/adminfe/chunk-7503.cc089ee4.css new file mode 100644 index 000000000..cc1e824b8 Binary files /dev/null and b/priv/static/adminfe/chunk-7503.cc089ee4.css differ diff --git a/priv/static/adminfe/chunk-7637.941c4edb.css b/priv/static/adminfe/chunk-7637.941c4edb.css deleted file mode 100644 index be1d183a9..000000000 Binary files a/priv/static/adminfe/chunk-7637.941c4edb.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-7c6b.b529c720.css b/priv/static/adminfe/chunk-7c6b.b529c720.css new file mode 100644 index 000000000..9d730019a Binary files /dev/null and b/priv/static/adminfe/chunk-7c6b.b529c720.css differ diff --git a/priv/static/adminfe/chunk-7e30.f2b9674a.css b/priv/static/adminfe/chunk-7e30.f2b9674a.css deleted file mode 100644 index a4a56712e..000000000 Binary files a/priv/static/adminfe/chunk-7e30.f2b9674a.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-9043.3f527a93.css b/priv/static/adminfe/chunk-9043.3f527a93.css new file mode 100644 index 000000000..d3b7604aa Binary files /dev/null and b/priv/static/adminfe/chunk-9043.3f527a93.css differ diff --git a/priv/static/adminfe/chunk-970d.f59cca8c.css b/priv/static/adminfe/chunk-970d.f59cca8c.css deleted file mode 100644 index 15511f12f..000000000 Binary files a/priv/static/adminfe/chunk-970d.f59cca8c.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-97e2.9f9fab0f.css b/priv/static/adminfe/chunk-97e2.9f9fab0f.css new file mode 100644 index 000000000..d3b7604aa Binary files /dev/null and b/priv/static/adminfe/chunk-97e2.9f9fab0f.css differ diff --git a/priv/static/adminfe/chunk-9a72.786caeb3.css b/priv/static/adminfe/chunk-9a72.786caeb3.css new file mode 100644 index 000000000..c0074e6f7 Binary files /dev/null and b/priv/static/adminfe/chunk-9a72.786caeb3.css differ diff --git a/priv/static/adminfe/chunk-commons.a343b725.css b/priv/static/adminfe/chunk-commons.a343b725.css new file mode 100644 index 000000000..42f5e0ee9 Binary files /dev/null and b/priv/static/adminfe/chunk-commons.a343b725.css differ diff --git a/priv/static/adminfe/chunk-d38a.cabdc22e.css b/priv/static/adminfe/chunk-d38a.cabdc22e.css deleted file mode 100644 index 4a2bf472b..000000000 Binary files a/priv/static/adminfe/chunk-d38a.cabdc22e.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-d892.56863b19.css b/priv/static/adminfe/chunk-d892.56863b19.css new file mode 100644 index 000000000..483d88545 Binary files /dev/null and b/priv/static/adminfe/chunk-d892.56863b19.css differ diff --git a/priv/static/adminfe/chunk-e458.6c0703cb.css b/priv/static/adminfe/chunk-e458.6c0703cb.css deleted file mode 100644 index 6d2a5d996..000000000 Binary files a/priv/static/adminfe/chunk-e458.6c0703cb.css and /dev/null differ diff --git a/priv/static/adminfe/chunk-elementUI.1abbc9b8.css b/priv/static/adminfe/chunk-elementUI.40545a1f.css similarity index 100% rename from priv/static/adminfe/chunk-elementUI.1abbc9b8.css rename to priv/static/adminfe/chunk-elementUI.40545a1f.css diff --git a/priv/static/adminfe/chunk-libs.686b5876.css b/priv/static/adminfe/chunk-libs.0380664d.css similarity index 100% rename from priv/static/adminfe/chunk-libs.686b5876.css rename to priv/static/adminfe/chunk-libs.0380664d.css diff --git a/priv/static/adminfe/index.html b/priv/static/adminfe/index.html index 73e680115..0500424b6 100644 --- a/priv/static/adminfe/index.html +++ b/priv/static/adminfe/index.html @@ -1 +1 @@ -Admin FE
\ No newline at end of file +Admin FE
\ No newline at end of file diff --git a/priv/static/adminfe/static/js/ZhIB.861df339.js b/priv/static/adminfe/static/js/ZhIB.861df339.js deleted file mode 100644 index aeec873c8..000000000 Binary files a/priv/static/adminfe/static/js/ZhIB.861df339.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/ZhIB.861df339.js.map b/priv/static/adminfe/static/js/ZhIB.861df339.js.map deleted file mode 100644 index ff11a2e71..000000000 Binary files a/priv/static/adminfe/static/js/ZhIB.861df339.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/app.0146039c.js b/priv/static/adminfe/static/js/app.0146039c.js deleted file mode 100644 index ab08475ad..000000000 Binary files a/priv/static/adminfe/static/js/app.0146039c.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/app.0146039c.js.map b/priv/static/adminfe/static/js/app.0146039c.js.map deleted file mode 100644 index 178715dc6..000000000 Binary files a/priv/static/adminfe/static/js/app.0146039c.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/app.1df22cde.js b/priv/static/adminfe/static/js/app.1df22cde.js new file mode 100644 index 000000000..00a5fbcd3 Binary files /dev/null and b/priv/static/adminfe/static/js/app.1df22cde.js differ diff --git a/priv/static/adminfe/static/js/app.1df22cde.js.map b/priv/static/adminfe/static/js/app.1df22cde.js.map new file mode 100644 index 000000000..4f6ad8e95 Binary files /dev/null and b/priv/static/adminfe/static/js/app.1df22cde.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-0171.9e927b8a.js b/priv/static/adminfe/static/js/chunk-0171.9e927b8a.js new file mode 100644 index 000000000..f20f619ad Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-0171.9e927b8a.js differ diff --git a/priv/static/adminfe/static/js/chunk-0171.9e927b8a.js.map b/priv/static/adminfe/static/js/chunk-0171.9e927b8a.js.map new file mode 100644 index 000000000..4f2d63f3e Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-0171.9e927b8a.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-0778.b17650df.js.map b/priv/static/adminfe/static/js/chunk-0778.b17650df.js.map deleted file mode 100644 index 1f96c3236..000000000 Binary files a/priv/static/adminfe/static/js/chunk-0778.b17650df.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-176e.5c19378d.js b/priv/static/adminfe/static/js/chunk-176e.5c19378d.js new file mode 100644 index 000000000..65269ccf1 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-176e.5c19378d.js differ diff --git a/priv/static/adminfe/static/js/chunk-176e.5c19378d.js.map b/priv/static/adminfe/static/js/chunk-176e.5c19378d.js.map new file mode 100644 index 000000000..fa116fb3b Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-176e.5c19378d.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js b/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js deleted file mode 100644 index 903f553b0..000000000 Binary files a/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js.map b/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js.map deleted file mode 100644 index 68735ed26..000000000 Binary files a/priv/static/adminfe/static/js/chunk-22d2.a0cf7976.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-2d97.079e9e64.js b/priv/static/adminfe/static/js/chunk-2d97.079e9e64.js new file mode 100644 index 000000000..90399920a Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-2d97.079e9e64.js differ diff --git a/priv/static/adminfe/static/js/chunk-2d97.079e9e64.js.map b/priv/static/adminfe/static/js/chunk-2d97.079e9e64.js.map new file mode 100644 index 000000000..5e3e417cd Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-2d97.079e9e64.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-3384.b2ebeeca.js b/priv/static/adminfe/static/js/chunk-3384.b2ebeeca.js deleted file mode 100644 index 6a161a0c6..000000000 Binary files a/priv/static/adminfe/static/js/chunk-3384.b2ebeeca.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-3384.b2ebeeca.js.map b/priv/static/adminfe/static/js/chunk-3384.b2ebeeca.js.map deleted file mode 100644 index b08db9d6e..000000000 Binary files a/priv/static/adminfe/static/js/chunk-3384.b2ebeeca.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-40a4.5dc0e299.js b/priv/static/adminfe/static/js/chunk-40a4.5dc0e299.js new file mode 100644 index 000000000..ee0e267db Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-40a4.5dc0e299.js differ diff --git a/priv/static/adminfe/static/js/chunk-40a4.5dc0e299.js.map b/priv/static/adminfe/static/js/chunk-40a4.5dc0e299.js.map new file mode 100644 index 000000000..61c30c39b Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-40a4.5dc0e299.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-7f9e.c49aa694.js b/priv/static/adminfe/static/js/chunk-5118.7c48ad58.js similarity index 99% rename from priv/static/adminfe/static/js/chunk-7f9e.c49aa694.js rename to priv/static/adminfe/static/js/chunk-5118.7c48ad58.js index 9fb60af23..2357e225d 100644 Binary files a/priv/static/adminfe/static/js/chunk-7f9e.c49aa694.js and b/priv/static/adminfe/static/js/chunk-5118.7c48ad58.js differ diff --git a/priv/static/adminfe/static/js/chunk-7f9e.c49aa694.js.map b/priv/static/adminfe/static/js/chunk-5118.7c48ad58.js.map similarity index 99% rename from priv/static/adminfe/static/js/chunk-7f9e.c49aa694.js.map rename to priv/static/adminfe/static/js/chunk-5118.7c48ad58.js.map index 241c6cc21..c29b4b170 100644 Binary files a/priv/static/adminfe/static/js/chunk-7f9e.c49aa694.js.map and b/priv/static/adminfe/static/js/chunk-5118.7c48ad58.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-565e.e1555105.js b/priv/static/adminfe/static/js/chunk-565e.e1555105.js new file mode 100644 index 000000000..638c78b38 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-565e.e1555105.js differ diff --git a/priv/static/adminfe/static/js/chunk-565e.e1555105.js.map b/priv/static/adminfe/static/js/chunk-565e.e1555105.js.map new file mode 100644 index 000000000..1cfc4cdfa Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-565e.e1555105.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-60a9.22fe45f3.js b/priv/static/adminfe/static/js/chunk-60a9.22fe45f3.js new file mode 100644 index 000000000..a23d46b72 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-60a9.22fe45f3.js differ diff --git a/priv/static/adminfe/static/js/chunk-60a9.22fe45f3.js.map b/priv/static/adminfe/static/js/chunk-60a9.22fe45f3.js.map new file mode 100644 index 000000000..690979713 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-60a9.22fe45f3.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-654e.38dd4b85.js b/priv/static/adminfe/static/js/chunk-654e.38dd4b85.js new file mode 100644 index 000000000..eecdac498 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-654e.38dd4b85.js differ diff --git a/priv/static/adminfe/static/js/chunk-654e.38dd4b85.js.map b/priv/static/adminfe/static/js/chunk-654e.38dd4b85.js.map new file mode 100644 index 000000000..4fc105fb7 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-654e.38dd4b85.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-0558.75954137.js b/priv/static/adminfe/static/js/chunk-68ea.0dae7e55.js similarity index 94% rename from priv/static/adminfe/static/js/chunk-0558.75954137.js rename to priv/static/adminfe/static/js/chunk-68ea.0dae7e55.js index 7b29707fa..dc31a8bb0 100644 Binary files a/priv/static/adminfe/static/js/chunk-0558.75954137.js and b/priv/static/adminfe/static/js/chunk-68ea.0dae7e55.js differ diff --git a/priv/static/adminfe/static/js/chunk-0558.75954137.js.map b/priv/static/adminfe/static/js/chunk-68ea.0dae7e55.js.map similarity index 99% rename from priv/static/adminfe/static/js/chunk-0558.75954137.js.map rename to priv/static/adminfe/static/js/chunk-68ea.0dae7e55.js.map index e9e2affb6..6c87803a8 100644 Binary files a/priv/static/adminfe/static/js/chunk-0558.75954137.js.map and b/priv/static/adminfe/static/js/chunk-68ea.0dae7e55.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js b/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js deleted file mode 100644 index bfdf936f8..000000000 Binary files a/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js.map b/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js.map deleted file mode 100644 index d1d728b80..000000000 Binary files a/priv/static/adminfe/static/js/chunk-6b68.fbc0f684.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js b/priv/static/adminfe/static/js/chunk-6e81.6043af74.js similarity index 97% rename from priv/static/adminfe/static/js/chunk-6e81.3733ace2.js rename to priv/static/adminfe/static/js/chunk-6e81.6043af74.js index c888ce03f..82b08ad24 100644 Binary files a/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js and b/priv/static/adminfe/static/js/chunk-6e81.6043af74.js differ diff --git a/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js.map b/priv/static/adminfe/static/js/chunk-6e81.6043af74.js.map similarity index 98% rename from priv/static/adminfe/static/js/chunk-6e81.3733ace2.js.map rename to priv/static/adminfe/static/js/chunk-6e81.6043af74.js.map index 63128dd67..2c1c86e2c 100644 Binary files a/priv/static/adminfe/static/js/chunk-6e81.3733ace2.js.map and b/priv/static/adminfe/static/js/chunk-6e81.6043af74.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-6e8c.2aa335e0.js b/priv/static/adminfe/static/js/chunk-6e8c.2aa335e0.js new file mode 100644 index 000000000..020158f81 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-6e8c.2aa335e0.js differ diff --git a/priv/static/adminfe/static/js/chunk-6e8c.2aa335e0.js.map b/priv/static/adminfe/static/js/chunk-6e8c.2aa335e0.js.map new file mode 100644 index 000000000..1e742c3f9 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-6e8c.2aa335e0.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-7503.278e0031.js b/priv/static/adminfe/static/js/chunk-7503.278e0031.js new file mode 100644 index 000000000..3875f9ad9 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-7503.278e0031.js differ diff --git a/priv/static/adminfe/static/js/chunk-7503.278e0031.js.map b/priv/static/adminfe/static/js/chunk-7503.278e0031.js.map new file mode 100644 index 000000000..494d1a763 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-7503.278e0031.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js b/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js deleted file mode 100644 index b38644b98..000000000 Binary files a/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js.map b/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js.map deleted file mode 100644 index ddd53f1cd..000000000 Binary files a/priv/static/adminfe/static/js/chunk-7637.8f5fb36e.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-0778.b17650df.js b/priv/static/adminfe/static/js/chunk-7c6b.1ebeb0e4.js similarity index 82% rename from priv/static/adminfe/static/js/chunk-0778.b17650df.js rename to priv/static/adminfe/static/js/chunk-7c6b.1ebeb0e4.js index 1a174cc1e..63be4d84f 100644 Binary files a/priv/static/adminfe/static/js/chunk-0778.b17650df.js and b/priv/static/adminfe/static/js/chunk-7c6b.1ebeb0e4.js differ diff --git a/priv/static/adminfe/static/js/chunk-7c6b.1ebeb0e4.js.map b/priv/static/adminfe/static/js/chunk-7c6b.1ebeb0e4.js.map new file mode 100644 index 000000000..85d8dcb1c Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-7c6b.1ebeb0e4.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-7e30.ec42e302.js b/priv/static/adminfe/static/js/chunk-7e30.ec42e302.js deleted file mode 100644 index 0a0e1ca34..000000000 Binary files a/priv/static/adminfe/static/js/chunk-7e30.ec42e302.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-7e30.ec42e302.js.map b/priv/static/adminfe/static/js/chunk-7e30.ec42e302.js.map deleted file mode 100644 index bc47158ea..000000000 Binary files a/priv/static/adminfe/static/js/chunk-7e30.ec42e302.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-970d.2457e066.js b/priv/static/adminfe/static/js/chunk-970d.2457e066.js deleted file mode 100644 index 0f99d835e..000000000 Binary files a/priv/static/adminfe/static/js/chunk-970d.2457e066.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-970d.2457e066.js.map b/priv/static/adminfe/static/js/chunk-970d.2457e066.js.map deleted file mode 100644 index 6896407b0..000000000 Binary files a/priv/static/adminfe/static/js/chunk-970d.2457e066.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-97e2.c51fe6b0.js b/priv/static/adminfe/static/js/chunk-97e2.c51fe6b0.js new file mode 100644 index 000000000..a9cef7b6b Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-97e2.c51fe6b0.js differ diff --git a/priv/static/adminfe/static/js/chunk-97e2.c51fe6b0.js.map b/priv/static/adminfe/static/js/chunk-97e2.c51fe6b0.js.map new file mode 100644 index 000000000..1d489f4c2 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-97e2.c51fe6b0.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js b/priv/static/adminfe/static/js/chunk-9a72.41e843cd.js similarity index 97% rename from priv/static/adminfe/static/js/chunk-0961.ef33e81b.js rename to priv/static/adminfe/static/js/chunk-9a72.41e843cd.js index e090bb93c..575a01d30 100644 Binary files a/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js and b/priv/static/adminfe/static/js/chunk-9a72.41e843cd.js differ diff --git a/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js.map b/priv/static/adminfe/static/js/chunk-9a72.41e843cd.js.map similarity index 99% rename from priv/static/adminfe/static/js/chunk-0961.ef33e81b.js.map rename to priv/static/adminfe/static/js/chunk-9a72.41e843cd.js.map index 97c6a4b54..aede70d0a 100644 Binary files a/priv/static/adminfe/static/js/chunk-0961.ef33e81b.js.map and b/priv/static/adminfe/static/js/chunk-9a72.41e843cd.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-commons.51fe2926.js b/priv/static/adminfe/static/js/chunk-commons.51fe2926.js new file mode 100644 index 000000000..3fe10f0d3 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-commons.51fe2926.js differ diff --git a/priv/static/adminfe/static/js/chunk-commons.51fe2926.js.map b/priv/static/adminfe/static/js/chunk-commons.51fe2926.js.map new file mode 100644 index 000000000..7d55c69d6 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-commons.51fe2926.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-d38a.a851004a.js b/priv/static/adminfe/static/js/chunk-d38a.a851004a.js deleted file mode 100644 index c302af310..000000000 Binary files a/priv/static/adminfe/static/js/chunk-d38a.a851004a.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-d38a.a851004a.js.map b/priv/static/adminfe/static/js/chunk-d38a.a851004a.js.map deleted file mode 100644 index 6779f6dc1..000000000 Binary files a/priv/static/adminfe/static/js/chunk-d38a.a851004a.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-e458.bb460d81.js b/priv/static/adminfe/static/js/chunk-e458.bb460d81.js deleted file mode 100644 index a08717166..000000000 Binary files a/priv/static/adminfe/static/js/chunk-e458.bb460d81.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-e458.bb460d81.js.map b/priv/static/adminfe/static/js/chunk-e458.bb460d81.js.map deleted file mode 100644 index 89f05fb99..000000000 Binary files a/priv/static/adminfe/static/js/chunk-e458.bb460d81.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-elementUI.fba0efec.js b/priv/static/adminfe/static/js/chunk-elementUI.8e5c404c.js similarity index 99% rename from priv/static/adminfe/static/js/chunk-elementUI.fba0efec.js rename to priv/static/adminfe/static/js/chunk-elementUI.8e5c404c.js index f106931f5..e8424c9ed 100644 Binary files a/priv/static/adminfe/static/js/chunk-elementUI.fba0efec.js and b/priv/static/adminfe/static/js/chunk-elementUI.8e5c404c.js differ diff --git a/priv/static/adminfe/static/js/chunk-elementUI.fba0efec.js.map b/priv/static/adminfe/static/js/chunk-elementUI.8e5c404c.js.map similarity index 99% rename from priv/static/adminfe/static/js/chunk-elementUI.fba0efec.js.map rename to priv/static/adminfe/static/js/chunk-elementUI.8e5c404c.js.map index a1f726fde..a3c9be946 100644 Binary files a/priv/static/adminfe/static/js/chunk-elementUI.fba0efec.js.map and b/priv/static/adminfe/static/js/chunk-elementUI.8e5c404c.js.map differ diff --git a/priv/static/adminfe/static/js/chunk-libs.b8c453ab.js.map b/priv/static/adminfe/static/js/chunk-libs.b8c453ab.js.map deleted file mode 100644 index 9c9d9acde..000000000 Binary files a/priv/static/adminfe/static/js/chunk-libs.b8c453ab.js.map and /dev/null differ diff --git a/priv/static/adminfe/static/js/chunk-libs.b8c453ab.js b/priv/static/adminfe/static/js/chunk-libs.f842b12e.js similarity index 80% rename from priv/static/adminfe/static/js/chunk-libs.b8c453ab.js rename to priv/static/adminfe/static/js/chunk-libs.f842b12e.js index 2af35eb62..2e8e0aba5 100644 Binary files a/priv/static/adminfe/static/js/chunk-libs.b8c453ab.js and b/priv/static/adminfe/static/js/chunk-libs.f842b12e.js differ diff --git a/priv/static/adminfe/static/js/chunk-libs.f842b12e.js.map b/priv/static/adminfe/static/js/chunk-libs.f842b12e.js.map new file mode 100644 index 000000000..de17844c9 Binary files /dev/null and b/priv/static/adminfe/static/js/chunk-libs.f842b12e.js.map differ diff --git a/priv/static/adminfe/static/js/runtime.04c4fa2f.js b/priv/static/adminfe/static/js/runtime.04c4fa2f.js new file mode 100644 index 000000000..c08585729 Binary files /dev/null and b/priv/static/adminfe/static/js/runtime.04c4fa2f.js differ diff --git a/priv/static/adminfe/static/js/runtime.04c4fa2f.js.map b/priv/static/adminfe/static/js/runtime.04c4fa2f.js.map new file mode 100644 index 000000000..bf0af11e1 Binary files /dev/null and b/priv/static/adminfe/static/js/runtime.04c4fa2f.js.map differ diff --git a/priv/static/adminfe/static/js/runtime.b08eb412.js b/priv/static/adminfe/static/js/runtime.b08eb412.js deleted file mode 100644 index 2a9a4e0db..000000000 Binary files a/priv/static/adminfe/static/js/runtime.b08eb412.js and /dev/null differ diff --git a/priv/static/adminfe/static/js/runtime.b08eb412.js.map b/priv/static/adminfe/static/js/runtime.b08eb412.js.map deleted file mode 100644 index 62f70ee3e..000000000 Binary files a/priv/static/adminfe/static/js/runtime.b08eb412.js.map and /dev/null differ diff --git a/priv/static/index.html b/priv/static/index.html index ddd4ec4eb..6fa237768 100644 --- a/priv/static/index.html +++ b/priv/static/index.html @@ -1 +1 @@ -Pleroma
\ No newline at end of file +Pleroma
\ No newline at end of file diff --git a/priv/static/schemas/litepub-0.1.jsonld b/priv/static/schemas/litepub-0.1.jsonld index 7cc3fee40..e7722cf72 100644 --- a/priv/static/schemas/litepub-0.1.jsonld +++ b/priv/static/schemas/litepub-0.1.jsonld @@ -13,6 +13,7 @@ }, "discoverable": "toot:discoverable", "manuallyApprovesFollowers": "as:manuallyApprovesFollowers", + "capabilities": "litepub:capabilities", "ostatus": "http://ostatus.org#", "schema": "http://schema.org#", "toot": "http://joinmastodon.org/ns#", diff --git a/priv/static/static-fe/static-fe.css b/priv/static/static-fe/static-fe.css index db61ff266..89e9f4877 100644 Binary files a/priv/static/static-fe/static-fe.css and b/priv/static/static-fe/static-fe.css differ diff --git a/priv/static/static/config.json b/priv/static/static/config.json index 727dde73b..0030f78f1 100644 --- a/priv/static/static/config.json +++ b/priv/static/static/config.json @@ -14,7 +14,6 @@ "logoMargin": ".1em", "logoMask": true, "minimalScopesMode": false, - "noAttachmentLinks": false, "nsfwCensorImage": "", "postContentType": "text/plain", "redirectRootLogin": "/main/friends", @@ -22,6 +21,7 @@ "scopeCopy": true, "showFeaturesPanel": true, "showInstanceSpecificPanel": false, + "sidebarRight": false, "subjectLineBehavior": "email", "theme": "pleroma-dark", "webPushNotifications": false diff --git a/priv/static/static/css/2.0778a6a864a1307a6c41.css b/priv/static/static/css/2.0778a6a864a1307a6c41.css new file mode 100644 index 000000000..a33585ef1 Binary files /dev/null and b/priv/static/static/css/2.0778a6a864a1307a6c41.css differ diff --git a/priv/static/static/css/2.0778a6a864a1307a6c41.css.map b/priv/static/static/css/2.0778a6a864a1307a6c41.css.map new file mode 100644 index 000000000..28cd8ba54 --- /dev/null +++ b/priv/static/static/css/2.0778a6a864a1307a6c41.css.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///./src/hocs/with_subscription/with_subscription.scss"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA,C","file":"static/css/2.0778a6a864a1307a6c41.css","sourcesContent":[".with-subscription-loading {\n padding: 10px;\n text-align: center;\n}\n.with-subscription-loading .error {\n font-size: 14px;\n}"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/css/vendors~app.18fea621d430000acc27.css b/priv/static/static/css/3.b2603a50868c68a1c192.css similarity index 92% rename from priv/static/static/css/vendors~app.18fea621d430000acc27.css rename to priv/static/static/css/3.b2603a50868c68a1c192.css index ef783cbb3..4cec5785b 100644 Binary files a/priv/static/static/css/vendors~app.18fea621d430000acc27.css and b/priv/static/static/css/3.b2603a50868c68a1c192.css differ diff --git a/priv/static/static/css/3.b2603a50868c68a1c192.css.map b/priv/static/static/css/3.b2603a50868c68a1c192.css.map new file mode 100644 index 000000000..805e7dc04 --- /dev/null +++ b/priv/static/static/css/3.b2603a50868c68a1c192.css.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///./node_modules/cropperjs/dist/cropper.css"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA,wCAAwC;AACxC;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA","file":"static/css/3.b2603a50868c68a1c192.css","sourcesContent":["/*!\n * Cropper.js v1.4.3\n * https://fengyuanchen.github.io/cropperjs\n *\n * Copyright 2015-present Chen Fengyuan\n * Released under the MIT license\n *\n * Date: 2018-10-24T13:07:11.429Z\n */\n\n.cropper-container {\n direction: ltr;\n font-size: 0;\n line-height: 0;\n position: relative;\n -ms-touch-action: none;\n touch-action: none;\n -webkit-user-select: none;\n -moz-user-select: none;\n -ms-user-select: none;\n user-select: none;\n}\n\n.cropper-container img {\n display: block;\n height: 100%;\n image-orientation: 0deg;\n max-height: none !important;\n max-width: none !important;\n min-height: 0 !important;\n min-width: 0 !important;\n width: 100%;\n}\n\n.cropper-wrap-box,\n.cropper-canvas,\n.cropper-drag-box,\n.cropper-crop-box,\n.cropper-modal {\n bottom: 0;\n left: 0;\n position: absolute;\n right: 0;\n top: 0;\n}\n\n.cropper-wrap-box,\n.cropper-canvas {\n overflow: hidden;\n}\n\n.cropper-drag-box {\n background-color: #fff;\n opacity: 0;\n}\n\n.cropper-modal {\n background-color: #000;\n opacity: .5;\n}\n\n.cropper-view-box {\n display: block;\n height: 100%;\n outline-color: rgba(51, 153, 255, 0.75);\n outline: 1px solid #39f;\n overflow: hidden;\n width: 100%;\n}\n\n.cropper-dashed {\n border: 0 dashed #eee;\n display: block;\n opacity: .5;\n position: absolute;\n}\n\n.cropper-dashed.dashed-h {\n border-bottom-width: 1px;\n border-top-width: 1px;\n height: calc(100% / 3);\n left: 0;\n top: calc(100% / 3);\n width: 100%;\n}\n\n.cropper-dashed.dashed-v {\n border-left-width: 1px;\n border-right-width: 1px;\n height: 100%;\n left: calc(100% / 3);\n top: 0;\n width: calc(100% / 3);\n}\n\n.cropper-center {\n display: block;\n height: 0;\n left: 50%;\n opacity: .75;\n position: absolute;\n top: 50%;\n width: 0;\n}\n\n.cropper-center:before,\n.cropper-center:after {\n background-color: #eee;\n content: ' ';\n display: block;\n position: absolute;\n}\n\n.cropper-center:before {\n height: 1px;\n left: -3px;\n top: 0;\n width: 7px;\n}\n\n.cropper-center:after {\n height: 7px;\n left: 0;\n top: -3px;\n width: 1px;\n}\n\n.cropper-face,\n.cropper-line,\n.cropper-point {\n display: block;\n height: 100%;\n opacity: .1;\n position: absolute;\n width: 100%;\n}\n\n.cropper-face {\n background-color: #fff;\n left: 0;\n top: 0;\n}\n\n.cropper-line {\n background-color: #39f;\n}\n\n.cropper-line.line-e {\n cursor: ew-resize;\n right: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-n {\n cursor: ns-resize;\n height: 5px;\n left: 0;\n top: -3px;\n}\n\n.cropper-line.line-w {\n cursor: ew-resize;\n left: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-s {\n bottom: -3px;\n cursor: ns-resize;\n height: 5px;\n left: 0;\n}\n\n.cropper-point {\n background-color: #39f;\n height: 5px;\n opacity: .75;\n width: 5px;\n}\n\n.cropper-point.point-e {\n cursor: ew-resize;\n margin-top: -3px;\n right: -3px;\n top: 50%;\n}\n\n.cropper-point.point-n {\n cursor: ns-resize;\n left: 50%;\n margin-left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-w {\n cursor: ew-resize;\n left: -3px;\n margin-top: -3px;\n top: 50%;\n}\n\n.cropper-point.point-s {\n bottom: -3px;\n cursor: s-resize;\n left: 50%;\n margin-left: -3px;\n}\n\n.cropper-point.point-ne {\n cursor: nesw-resize;\n right: -3px;\n top: -3px;\n}\n\n.cropper-point.point-nw {\n cursor: nwse-resize;\n left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-sw {\n bottom: -3px;\n cursor: nesw-resize;\n left: -3px;\n}\n\n.cropper-point.point-se {\n bottom: -3px;\n cursor: nwse-resize;\n height: 20px;\n opacity: 1;\n right: -3px;\n width: 20px;\n}\n\n@media (min-width: 768px) {\n .cropper-point.point-se {\n height: 15px;\n width: 15px;\n }\n}\n\n@media (min-width: 992px) {\n .cropper-point.point-se {\n height: 10px;\n width: 10px;\n }\n}\n\n@media (min-width: 1200px) {\n .cropper-point.point-se {\n height: 5px;\n opacity: .75;\n width: 5px;\n }\n}\n\n.cropper-point.point-se:before {\n background-color: #39f;\n bottom: -50%;\n content: ' ';\n display: block;\n height: 200%;\n opacity: 0;\n position: absolute;\n right: -50%;\n width: 200%;\n}\n\n.cropper-invisible {\n opacity: 0;\n}\n\n.cropper-bg {\n background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQAQMAAAAlPW0iAAAAA3NCSVQICAjb4U/gAAAABlBMVEXMzMz////TjRV2AAAACXBIWXMAAArrAAAK6wGCiw1aAAAAHHRFWHRTb2Z0d2FyZQBBZG9iZSBGaXJld29ya3MgQ1M26LyyjAAAABFJREFUCJlj+M/AgBVhF/0PAH6/D/HkDxOGAAAAAElFTkSuQmCC');\n}\n\n.cropper-hide {\n display: block;\n height: 0;\n position: absolute;\n width: 0;\n}\n\n.cropper-hidden {\n display: none !important;\n}\n\n.cropper-move {\n cursor: move;\n}\n\n.cropper-crop {\n cursor: crosshair;\n}\n\n.cropper-disabled .cropper-drag-box,\n.cropper-disabled .cropper-face,\n.cropper-disabled .cropper-line,\n.cropper-disabled .cropper-point {\n cursor: not-allowed;\n}\n"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/css/app.613cef07981cd95ccceb.css b/priv/static/static/css/app.613cef07981cd95ccceb.css deleted file mode 100644 index c1d5f8188..000000000 Binary files a/priv/static/static/css/app.613cef07981cd95ccceb.css and /dev/null differ diff --git a/priv/static/static/css/app.613cef07981cd95ccceb.css.map b/priv/static/static/css/app.613cef07981cd95ccceb.css.map deleted file mode 100644 index 556e0bb0b..000000000 --- a/priv/static/static/css/app.613cef07981cd95ccceb.css.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"sources":["webpack:///./src/hocs/with_load_more/with_load_more.scss","webpack:///./src/components/tab_switcher/tab_switcher.scss","webpack:///./src/hocs/with_subscription/with_subscription.scss"],"names":[],"mappings":"AAAA,uBAAuB,aAAa,kBAAkB,qBAAqB,sBAAsB,qCAAqC,8BAA8B,e;ACApK,cAAc,oBAAoB,aAAa,0BAA0B,sBAAsB,wBAAwB,kBAAkB,cAAc,eAAe,gCAAgC,aAAa,wCAAwC,0BAA0B,aAAa,gBAAgB,oBAAoB,oBAAoB,aAAa,kBAAkB,WAAW,kBAAkB,gBAAgB,gBAAgB,sBAAsB,uDAAuD,cAAc,WAAW,kBAAkB,cAAc,wBAAwB,yBAAyB,wCAAwC,iCAAiC,YAAY,kBAAkB,oBAAoB,aAAa,kBAAkB,cAAc,sCAAsC,WAAW,cAAc,kBAAkB,4BAA4B,6BAA6B,gBAAgB,oBAAoB,oBAAoB,mBAAmB,cAAc,8BAA8B,yBAAyB,qCAAqC,mDAAmD,UAAU,yDAAyD,UAAU,6CAA6C,uBAAuB,UAAU,cAAc,oCAAoC,0CAA0C,gBAAgB,mBAAmB,gBAAgB,qDAAqD,WAAW,kBAAkB,OAAO,QAAQ,SAAS,UAAU,wBAAwB,yBAAyB,wC;ACAtlD,2BAA2B,aAAa,kBAAkB,kCAAkC,e","file":"static/css/app.613cef07981cd95ccceb.css","sourcesContent":[".with-load-more-footer{padding:10px;text-align:center;border-top:1px solid;border-top-color:#222;border-top-color:var(--border, #222)}.with-load-more-footer .error{font-size:14px}",".tab-switcher{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.tab-switcher .contents{-ms-flex:1 0 auto;flex:1 0 auto;min-height:0px}.tab-switcher .contents .hidden{display:none}.tab-switcher .contents.scrollable-tabs{-ms-flex-preferred-size:0;flex-basis:0;overflow-y:auto}.tab-switcher .tabs{display:-ms-flexbox;display:flex;position:relative;width:100%;overflow-y:hidden;overflow-x:auto;padding-top:5px;box-sizing:border-box}.tab-switcher .tabs::after,.tab-switcher .tabs::before{display:block;content:\"\";-ms-flex:1 1 auto;flex:1 1 auto;border-bottom:1px solid;border-bottom-color:#222;border-bottom-color:var(--border, #222)}.tab-switcher .tabs .tab-wrapper{height:28px;position:relative;display:-ms-flexbox;display:flex;-ms-flex:0 0 auto;flex:0 0 auto}.tab-switcher .tabs .tab-wrapper .tab{width:100%;min-width:1px;position:relative;border-bottom-left-radius:0;border-bottom-right-radius:0;padding:6px 1em;padding-bottom:99px;margin-bottom:-93px;white-space:nowrap;color:#b9b9ba;color:var(--tabText, #b9b9ba);background-color:#182230;background-color:var(--tab, #182230)}.tab-switcher .tabs .tab-wrapper .tab:not(.active){z-index:4}.tab-switcher .tabs .tab-wrapper .tab:not(.active):hover{z-index:6}.tab-switcher .tabs .tab-wrapper .tab.active{background:transparent;z-index:5;color:#b9b9ba;color:var(--tabActiveText, #b9b9ba)}.tab-switcher .tabs .tab-wrapper .tab img{max-height:26px;vertical-align:top;margin-top:-5px}.tab-switcher .tabs .tab-wrapper:not(.active)::after{content:\"\";position:absolute;left:0;right:0;bottom:0;z-index:7;border-bottom:1px solid;border-bottom-color:#222;border-bottom-color:var(--border, #222)}",".with-subscription-loading{padding:10px;text-align:center}.with-subscription-loading .error{font-size:14px}"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/css/app.77b1644622e3bae24b6b.css b/priv/static/static/css/app.77b1644622e3bae24b6b.css new file mode 100644 index 000000000..8038882c0 Binary files /dev/null and b/priv/static/static/css/app.77b1644622e3bae24b6b.css differ diff --git a/priv/static/static/css/app.77b1644622e3bae24b6b.css.map b/priv/static/static/css/app.77b1644622e3bae24b6b.css.map new file mode 100644 index 000000000..4b042ef35 --- /dev/null +++ b/priv/static/static/css/app.77b1644622e3bae24b6b.css.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///./src/components/tab_switcher/tab_switcher.scss","webpack:///./src/hocs/with_load_more/with_load_more.scss"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,C;ACtOA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,C","file":"static/css/app.77b1644622e3bae24b6b.css","sourcesContent":[".tab-switcher {\n display: -ms-flexbox;\n display: flex;\n}\n.tab-switcher .tab-icon {\n font-size: 2em;\n display: block;\n}\n.tab-switcher.top-tabs {\n -ms-flex-direction: column;\n flex-direction: column;\n}\n.tab-switcher.top-tabs > .tabs {\n width: 100%;\n overflow-y: hidden;\n overflow-x: auto;\n padding-top: 5px;\n -ms-flex-direction: row;\n flex-direction: row;\n}\n.tab-switcher.top-tabs > .tabs::after, .tab-switcher.top-tabs > .tabs::before {\n content: \"\";\n -ms-flex: 1 1 auto;\n flex: 1 1 auto;\n border-bottom: 1px solid;\n border-bottom-color: #222;\n border-bottom-color: var(--border, #222);\n}\n.tab-switcher.top-tabs > .tabs .tab-wrapper {\n height: 28px;\n}\n.tab-switcher.top-tabs > .tabs .tab-wrapper:not(.active)::after {\n left: 0;\n right: 0;\n bottom: 0;\n border-bottom: 1px solid;\n border-bottom-color: #222;\n border-bottom-color: var(--border, #222);\n}\n.tab-switcher.top-tabs > .tabs .tab {\n width: 100%;\n min-width: 1px;\n border-bottom-left-radius: 0;\n border-bottom-right-radius: 0;\n padding-bottom: 99px;\n margin-bottom: -93px;\n}\n.tab-switcher.top-tabs .contents.scrollable-tabs {\n -ms-flex-preferred-size: 0;\n flex-basis: 0;\n}\n.tab-switcher.side-tabs {\n -ms-flex-direction: row;\n flex-direction: row;\n}\n@media all and (max-width: 800px) {\n .tab-switcher.side-tabs {\n overflow-x: auto;\n }\n}\n.tab-switcher.side-tabs > .contents {\n -ms-flex: 1 1 auto;\n flex: 1 1 auto;\n}\n.tab-switcher.side-tabs > .tabs {\n -ms-flex: 0 0 auto;\n flex: 0 0 auto;\n overflow-y: auto;\n overflow-x: hidden;\n -ms-flex-direction: column;\n flex-direction: column;\n}\n.tab-switcher.side-tabs > .tabs::after, .tab-switcher.side-tabs > .tabs::before {\n -ms-flex-negative: 0;\n flex-shrink: 0;\n -ms-flex-preferred-size: 0.5em;\n flex-basis: 0.5em;\n content: \"\";\n border-right: 1px solid;\n border-right-color: #222;\n border-right-color: var(--border, #222);\n}\n.tab-switcher.side-tabs > .tabs::after {\n -ms-flex-positive: 1;\n flex-grow: 1;\n}\n.tab-switcher.side-tabs > .tabs::before {\n -ms-flex-positive: 0;\n flex-grow: 0;\n}\n.tab-switcher.side-tabs > .tabs .tab-wrapper {\n min-width: 10em;\n display: -ms-flexbox;\n display: flex;\n -ms-flex-direction: column;\n flex-direction: column;\n}\n@media all and (max-width: 800px) {\n .tab-switcher.side-tabs > .tabs .tab-wrapper {\n min-width: 1em;\n }\n}\n.tab-switcher.side-tabs > .tabs .tab-wrapper:not(.active)::after {\n top: 0;\n right: 0;\n bottom: 0;\n border-right: 1px solid;\n border-right-color: #222;\n border-right-color: var(--border, #222);\n}\n.tab-switcher.side-tabs > .tabs .tab-wrapper::before {\n -ms-flex: 0 0 6px;\n flex: 0 0 6px;\n content: \"\";\n border-right: 1px solid;\n border-right-color: #222;\n border-right-color: var(--border, #222);\n}\n.tab-switcher.side-tabs > .tabs .tab-wrapper:last-child .tab {\n margin-bottom: 0;\n}\n.tab-switcher.side-tabs > .tabs .tab {\n -ms-flex: 1;\n flex: 1;\n box-sizing: content-box;\n min-width: 10em;\n min-width: 1px;\n border-top-right-radius: 0;\n border-bottom-right-radius: 0;\n padding-left: 1em;\n padding-right: calc(1em + 200px);\n margin-right: -200px;\n margin-left: 1em;\n}\n@media all and (max-width: 800px) {\n .tab-switcher.side-tabs > .tabs .tab {\n padding-left: 0.25em;\n padding-right: calc(.25em + 200px);\n margin-right: calc(.25em - 200px);\n margin-left: 0.25em;\n }\n .tab-switcher.side-tabs > .tabs .tab .text {\n display: none;\n }\n}\n.tab-switcher .contents {\n -ms-flex: 1 0 auto;\n flex: 1 0 auto;\n min-height: 0px;\n}\n.tab-switcher .contents .hidden {\n display: none;\n}\n.tab-switcher .contents .full-height:not(.hidden) {\n height: 100%;\n display: -ms-flexbox;\n display: flex;\n -ms-flex-direction: column;\n flex-direction: column;\n}\n.tab-switcher .contents .full-height:not(.hidden) > *:not(.mobile-label) {\n -ms-flex: 1;\n flex: 1;\n}\n.tab-switcher .contents.scrollable-tabs {\n overflow-y: auto;\n}\n.tab-switcher .tab {\n position: relative;\n white-space: nowrap;\n padding: 6px 1em;\n background-color: #182230;\n background-color: var(--tab, #182230);\n}\n.tab-switcher .tab, .tab-switcher .tab:active .tab-icon {\n color: #b9b9ba;\n color: var(--tabText, #b9b9ba);\n}\n.tab-switcher .tab:not(.active) {\n z-index: 4;\n}\n.tab-switcher .tab:not(.active):hover {\n z-index: 6;\n}\n.tab-switcher .tab.active {\n background: transparent;\n z-index: 5;\n color: #b9b9ba;\n color: var(--tabActiveText, #b9b9ba);\n}\n.tab-switcher .tab img {\n max-height: 26px;\n vertical-align: top;\n margin-top: -5px;\n}\n.tab-switcher .tabs {\n display: -ms-flexbox;\n display: flex;\n position: relative;\n box-sizing: border-box;\n}\n.tab-switcher .tabs::after, .tab-switcher .tabs::before {\n display: block;\n -ms-flex: 1 1 auto;\n flex: 1 1 auto;\n}\n.tab-switcher .tab-wrapper {\n position: relative;\n display: -ms-flexbox;\n display: flex;\n -ms-flex: 0 0 auto;\n flex: 0 0 auto;\n}\n.tab-switcher .tab-wrapper:not(.active)::after {\n content: \"\";\n position: absolute;\n z-index: 7;\n}\n.tab-switcher .mobile-label {\n padding-left: 0.3em;\n padding-bottom: 0.25em;\n margin-top: 0.5em;\n margin-left: 0.2em;\n margin-bottom: 0.25em;\n border-bottom: 1px solid var(--border, #222);\n}\n@media all and (min-width: 800px) {\n .tab-switcher .mobile-label {\n display: none;\n }\n}",".with-load-more-footer {\n padding: 10px;\n text-align: center;\n border-top: 1px solid;\n border-top-color: #222;\n border-top-color: var(--border, #222);\n}\n.with-load-more-footer .error {\n font-size: 14px;\n}\n.with-load-more-footer a {\n cursor: pointer;\n}"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/css/vendors~app.18fea621d430000acc27.css.map b/priv/static/static/css/vendors~app.18fea621d430000acc27.css.map deleted file mode 100644 index 057d67d6a..000000000 --- a/priv/static/static/css/vendors~app.18fea621d430000acc27.css.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"sources":["webpack:///./node_modules/cropperjs/dist/cropper.css"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA,wCAAwC;AACxC;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA","file":"static/css/vendors~app.18fea621d430000acc27.css","sourcesContent":["/*!\n * Cropper.js v1.5.6\n * https://fengyuanchen.github.io/cropperjs\n *\n * Copyright 2015-present Chen Fengyuan\n * Released under the MIT license\n *\n * Date: 2019-10-04T04:33:44.164Z\n */\n\n.cropper-container {\n direction: ltr;\n font-size: 0;\n line-height: 0;\n position: relative;\n -ms-touch-action: none;\n touch-action: none;\n -webkit-user-select: none;\n -ms-user-select: none;\n user-select: none;\n}\n\n.cropper-container img {\n display: block;\n height: 100%;\n image-orientation: 0deg;\n max-height: none !important;\n max-width: none !important;\n min-height: 0 !important;\n min-width: 0 !important;\n width: 100%;\n}\n\n.cropper-wrap-box,\n.cropper-canvas,\n.cropper-drag-box,\n.cropper-crop-box,\n.cropper-modal {\n bottom: 0;\n left: 0;\n position: absolute;\n right: 0;\n top: 0;\n}\n\n.cropper-wrap-box,\n.cropper-canvas {\n overflow: hidden;\n}\n\n.cropper-drag-box {\n background-color: #fff;\n opacity: 0;\n}\n\n.cropper-modal {\n background-color: #000;\n opacity: 0.5;\n}\n\n.cropper-view-box {\n display: block;\n height: 100%;\n outline: 1px solid #39f;\n outline-color: rgba(51, 153, 255, 0.75);\n overflow: hidden;\n width: 100%;\n}\n\n.cropper-dashed {\n border: 0 dashed #eee;\n display: block;\n opacity: 0.5;\n position: absolute;\n}\n\n.cropper-dashed.dashed-h {\n border-bottom-width: 1px;\n border-top-width: 1px;\n height: calc(100% / 3);\n left: 0;\n top: calc(100% / 3);\n width: 100%;\n}\n\n.cropper-dashed.dashed-v {\n border-left-width: 1px;\n border-right-width: 1px;\n height: 100%;\n left: calc(100% / 3);\n top: 0;\n width: calc(100% / 3);\n}\n\n.cropper-center {\n display: block;\n height: 0;\n left: 50%;\n opacity: 0.75;\n position: absolute;\n top: 50%;\n width: 0;\n}\n\n.cropper-center::before,\n.cropper-center::after {\n background-color: #eee;\n content: ' ';\n display: block;\n position: absolute;\n}\n\n.cropper-center::before {\n height: 1px;\n left: -3px;\n top: 0;\n width: 7px;\n}\n\n.cropper-center::after {\n height: 7px;\n left: 0;\n top: -3px;\n width: 1px;\n}\n\n.cropper-face,\n.cropper-line,\n.cropper-point {\n display: block;\n height: 100%;\n opacity: 0.1;\n position: absolute;\n width: 100%;\n}\n\n.cropper-face {\n background-color: #fff;\n left: 0;\n top: 0;\n}\n\n.cropper-line {\n background-color: #39f;\n}\n\n.cropper-line.line-e {\n cursor: ew-resize;\n right: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-n {\n cursor: ns-resize;\n height: 5px;\n left: 0;\n top: -3px;\n}\n\n.cropper-line.line-w {\n cursor: ew-resize;\n left: -3px;\n top: 0;\n width: 5px;\n}\n\n.cropper-line.line-s {\n bottom: -3px;\n cursor: ns-resize;\n height: 5px;\n left: 0;\n}\n\n.cropper-point {\n background-color: #39f;\n height: 5px;\n opacity: 0.75;\n width: 5px;\n}\n\n.cropper-point.point-e {\n cursor: ew-resize;\n margin-top: -3px;\n right: -3px;\n top: 50%;\n}\n\n.cropper-point.point-n {\n cursor: ns-resize;\n left: 50%;\n margin-left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-w {\n cursor: ew-resize;\n left: -3px;\n margin-top: -3px;\n top: 50%;\n}\n\n.cropper-point.point-s {\n bottom: -3px;\n cursor: s-resize;\n left: 50%;\n margin-left: -3px;\n}\n\n.cropper-point.point-ne {\n cursor: nesw-resize;\n right: -3px;\n top: -3px;\n}\n\n.cropper-point.point-nw {\n cursor: nwse-resize;\n left: -3px;\n top: -3px;\n}\n\n.cropper-point.point-sw {\n bottom: -3px;\n cursor: nesw-resize;\n left: -3px;\n}\n\n.cropper-point.point-se {\n bottom: -3px;\n cursor: nwse-resize;\n height: 20px;\n opacity: 1;\n right: -3px;\n width: 20px;\n}\n\n@media (min-width: 768px) {\n .cropper-point.point-se {\n height: 15px;\n width: 15px;\n }\n}\n\n@media (min-width: 992px) {\n .cropper-point.point-se {\n height: 10px;\n width: 10px;\n }\n}\n\n@media (min-width: 1200px) {\n .cropper-point.point-se {\n height: 5px;\n opacity: 0.75;\n width: 5px;\n }\n}\n\n.cropper-point.point-se::before {\n background-color: #39f;\n bottom: -50%;\n content: ' ';\n display: block;\n height: 200%;\n opacity: 0;\n position: absolute;\n right: -50%;\n width: 200%;\n}\n\n.cropper-invisible {\n opacity: 0;\n}\n\n.cropper-bg {\n background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQAQMAAAAlPW0iAAAAA3NCSVQICAjb4U/gAAAABlBMVEXMzMz////TjRV2AAAACXBIWXMAAArrAAAK6wGCiw1aAAAAHHRFWHRTb2Z0d2FyZQBBZG9iZSBGaXJld29ya3MgQ1M26LyyjAAAABFJREFUCJlj+M/AgBVhF/0PAH6/D/HkDxOGAAAAAElFTkSuQmCC');\n}\n\n.cropper-hide {\n display: block;\n height: 0;\n position: absolute;\n width: 0;\n}\n\n.cropper-hidden {\n display: none !important;\n}\n\n.cropper-move {\n cursor: move;\n}\n\n.cropper-crop {\n cursor: crosshair;\n}\n\n.cropper-disabled .cropper-drag-box,\n.cropper-disabled .cropper-face,\n.cropper-disabled .cropper-line,\n.cropper-disabled .cropper-point {\n cursor: not-allowed;\n}\n"],"sourceRoot":""} \ No newline at end of file diff --git a/priv/static/static/font/fontello.1589385935077.woff b/priv/static/static/font/fontello.1589385935077.woff deleted file mode 100644 index f48488a77..000000000 Binary files a/priv/static/static/font/fontello.1589385935077.woff and /dev/null differ diff --git a/priv/static/static/font/fontello.1589385935077.woff2 b/priv/static/static/font/fontello.1589385935077.woff2 deleted file mode 100644 index 012eb9305..000000000 Binary files a/priv/static/static/font/fontello.1589385935077.woff2 and /dev/null differ diff --git a/priv/static/static/font/fontello.1589385935077.eot b/priv/static/static/font/fontello.1599568314856.eot similarity index 80% rename from priv/static/static/font/fontello.1589385935077.eot rename to priv/static/static/font/fontello.1599568314856.eot index e5f37013a..1a6931a0e 100644 Binary files a/priv/static/static/font/fontello.1589385935077.eot and b/priv/static/static/font/fontello.1599568314856.eot differ diff --git a/priv/static/static/font/fontello.1589385935077.svg b/priv/static/static/font/fontello.1599568314856.svg similarity index 92% rename from priv/static/static/font/fontello.1589385935077.svg rename to priv/static/static/font/fontello.1599568314856.svg index e63fb7529..71b5d70af 100644 --- a/priv/static/static/font/fontello.1589385935077.svg +++ b/priv/static/static/font/fontello.1599568314856.svg @@ -80,8 +80,18 @@ + + + + + + + + + + @@ -90,6 +100,10 @@ + + + + diff --git a/priv/static/static/font/fontello.1589385935077.ttf b/priv/static/static/font/fontello.1599568314856.ttf similarity index 80% rename from priv/static/static/font/fontello.1589385935077.ttf rename to priv/static/static/font/fontello.1599568314856.ttf index 0fde96cea..795464475 100644 Binary files a/priv/static/static/font/fontello.1589385935077.ttf and b/priv/static/static/font/fontello.1599568314856.ttf differ diff --git a/priv/static/static/font/fontello.1599568314856.woff b/priv/static/static/font/fontello.1599568314856.woff new file mode 100644 index 000000000..64f566383 Binary files /dev/null and b/priv/static/static/font/fontello.1599568314856.woff differ diff --git a/priv/static/static/font/fontello.1599568314856.woff2 b/priv/static/static/font/fontello.1599568314856.woff2 new file mode 100644 index 000000000..972e70831 Binary files /dev/null and b/priv/static/static/font/fontello.1599568314856.woff2 differ diff --git a/priv/static/static/fontello.1589385935077.css b/priv/static/static/fontello.1599568314856.css similarity index 82% rename from priv/static/static/fontello.1589385935077.css rename to priv/static/static/fontello.1599568314856.css index 746492163..e636286c0 100644 Binary files a/priv/static/static/fontello.1589385935077.css and b/priv/static/static/fontello.1599568314856.css differ diff --git a/priv/static/static/fontello.json b/priv/static/static/fontello.json old mode 100755 new mode 100644 index 7f0e7cdd5..706800cdb --- a/priv/static/static/fontello.json +++ b/priv/static/static/fontello.json @@ -363,6 +363,48 @@ "css": "ok", "code": 59431, "src": "fontawesome" + }, + { + "uid": "4109c474ff99cad28fd5a2c38af2ec6f", + "css": "filter", + "code": 61616, + "src": "fontawesome" + }, + { + "uid": "9a76bc135eac17d2c8b8ad4a5774fc87", + "css": "download", + "code": 59429, + "src": "fontawesome" + }, + { + "uid": "f04a5d24e9e659145b966739c4fde82a", + "css": "bookmark", + "code": 59430, + "src": "fontawesome" + }, + { + "uid": "2f5ef6f6b7aaebc56458ab4e865beff5", + "css": "bookmark-empty", + "code": 61591, + "src": "fontawesome" + }, + { + "uid": "9ea0a737ccc45d6c510dcbae56058849", + "css": "music", + "code": 59432, + "src": "fontawesome" + }, + { + "uid": "1b5a5d7b7e3c71437f5a26befdd045ed", + "css": "doc", + "code": 59433, + "src": "fontawesome" + }, + { + "uid": "98d9c83c1ee7c2c25af784b518c522c5", + "css": "block", + "code": 59434, + "src": "fontawesome" } ] } \ No newline at end of file diff --git a/priv/static/static/js/10.46fbbdfaf0d4800f349b.js b/priv/static/static/js/10.46fbbdfaf0d4800f349b.js new file mode 100644 index 000000000..0fd8463df Binary files /dev/null and b/priv/static/static/js/10.46fbbdfaf0d4800f349b.js differ diff --git a/priv/static/static/js/10.46fbbdfaf0d4800f349b.js.map b/priv/static/static/js/10.46fbbdfaf0d4800f349b.js.map new file mode 100644 index 000000000..bee2feb10 Binary files /dev/null and b/priv/static/static/js/10.46fbbdfaf0d4800f349b.js.map differ diff --git a/priv/static/static/js/11.708cc2513c53879a92cc.js b/priv/static/static/js/11.708cc2513c53879a92cc.js new file mode 100644 index 000000000..4fe316ecf Binary files /dev/null and b/priv/static/static/js/11.708cc2513c53879a92cc.js differ diff --git a/priv/static/static/js/11.708cc2513c53879a92cc.js.map b/priv/static/static/js/11.708cc2513c53879a92cc.js.map new file mode 100644 index 000000000..64c9320c4 Binary files /dev/null and b/priv/static/static/js/11.708cc2513c53879a92cc.js.map differ diff --git a/priv/static/static/js/12.b3bf0bc313861d6ec36b.js b/priv/static/static/js/12.b3bf0bc313861d6ec36b.js new file mode 100644 index 000000000..4890ca10a Binary files /dev/null and b/priv/static/static/js/12.b3bf0bc313861d6ec36b.js differ diff --git a/priv/static/static/js/12.b3bf0bc313861d6ec36b.js.map b/priv/static/static/js/12.b3bf0bc313861d6ec36b.js.map new file mode 100644 index 000000000..28545ac96 Binary files /dev/null and b/priv/static/static/js/12.b3bf0bc313861d6ec36b.js.map differ diff --git a/priv/static/static/js/13.adb8a942514d735722c4.js b/priv/static/static/js/13.adb8a942514d735722c4.js new file mode 100644 index 000000000..41abcb5a6 Binary files /dev/null and b/priv/static/static/js/13.adb8a942514d735722c4.js differ diff --git a/priv/static/static/js/13.adb8a942514d735722c4.js.map b/priv/static/static/js/13.adb8a942514d735722c4.js.map new file mode 100644 index 000000000..2b8ff6d6c Binary files /dev/null and b/priv/static/static/js/13.adb8a942514d735722c4.js.map differ diff --git a/priv/static/static/js/14.d015d9b2ea16407e389c.js b/priv/static/static/js/14.d015d9b2ea16407e389c.js new file mode 100644 index 000000000..200a79625 Binary files /dev/null and b/priv/static/static/js/14.d015d9b2ea16407e389c.js differ diff --git a/priv/static/static/js/14.d015d9b2ea16407e389c.js.map b/priv/static/static/js/14.d015d9b2ea16407e389c.js.map new file mode 100644 index 000000000..49dab13f7 Binary files /dev/null and b/priv/static/static/js/14.d015d9b2ea16407e389c.js.map differ diff --git a/priv/static/static/js/15.19866e6a366ccf982284.js b/priv/static/static/js/15.19866e6a366ccf982284.js new file mode 100644 index 000000000..0cc2e266a Binary files /dev/null and b/priv/static/static/js/15.19866e6a366ccf982284.js differ diff --git a/priv/static/static/js/15.19866e6a366ccf982284.js.map b/priv/static/static/js/15.19866e6a366ccf982284.js.map new file mode 100644 index 000000000..561ab7dcf Binary files /dev/null and b/priv/static/static/js/15.19866e6a366ccf982284.js.map differ diff --git a/priv/static/static/js/16.38a984effd54736f6a2c.js b/priv/static/static/js/16.38a984effd54736f6a2c.js new file mode 100644 index 000000000..b3cebb0bd Binary files /dev/null and b/priv/static/static/js/16.38a984effd54736f6a2c.js differ diff --git a/priv/static/static/js/16.38a984effd54736f6a2c.js.map b/priv/static/static/js/16.38a984effd54736f6a2c.js.map new file mode 100644 index 000000000..68ee95f97 Binary files /dev/null and b/priv/static/static/js/16.38a984effd54736f6a2c.js.map differ diff --git a/priv/static/static/js/17.9c25507194320db2e85b.js b/priv/static/static/js/17.9c25507194320db2e85b.js new file mode 100644 index 000000000..451bf8bd3 Binary files /dev/null and b/priv/static/static/js/17.9c25507194320db2e85b.js differ diff --git a/priv/static/static/js/17.9c25507194320db2e85b.js.map b/priv/static/static/js/17.9c25507194320db2e85b.js.map new file mode 100644 index 000000000..f843d4400 Binary files /dev/null and b/priv/static/static/js/17.9c25507194320db2e85b.js.map differ diff --git a/priv/static/static/js/18.94946caca48930c224c7.js b/priv/static/static/js/18.94946caca48930c224c7.js new file mode 100644 index 000000000..5a1f40c6d Binary files /dev/null and b/priv/static/static/js/18.94946caca48930c224c7.js differ diff --git a/priv/static/static/js/18.94946caca48930c224c7.js.map b/priv/static/static/js/18.94946caca48930c224c7.js.map new file mode 100644 index 000000000..ad04b99ab Binary files /dev/null and b/priv/static/static/js/18.94946caca48930c224c7.js.map differ diff --git a/priv/static/static/js/19.233c81ac2c28d55e9f13.js b/priv/static/static/js/19.233c81ac2c28d55e9f13.js new file mode 100644 index 000000000..ace0a1d41 Binary files /dev/null and b/priv/static/static/js/19.233c81ac2c28d55e9f13.js differ diff --git a/priv/static/static/js/19.233c81ac2c28d55e9f13.js.map b/priv/static/static/js/19.233c81ac2c28d55e9f13.js.map new file mode 100644 index 000000000..cd3f7354d Binary files /dev/null and b/priv/static/static/js/19.233c81ac2c28d55e9f13.js.map differ diff --git a/priv/static/static/js/2.18e4adec273c4ce867a8.js b/priv/static/static/js/2.18e4adec273c4ce867a8.js deleted file mode 100644 index d191aa852..000000000 Binary files a/priv/static/static/js/2.18e4adec273c4ce867a8.js and /dev/null differ diff --git a/priv/static/static/js/2.18e4adec273c4ce867a8.js.map b/priv/static/static/js/2.18e4adec273c4ce867a8.js.map deleted file mode 100644 index a7f98bfef..000000000 Binary files a/priv/static/static/js/2.18e4adec273c4ce867a8.js.map and /dev/null differ diff --git a/priv/static/static/js/2.c92f4803ff24726cea58.js b/priv/static/static/js/2.c92f4803ff24726cea58.js new file mode 100644 index 000000000..55aa1f44e Binary files /dev/null and b/priv/static/static/js/2.c92f4803ff24726cea58.js differ diff --git a/priv/static/static/js/2.c92f4803ff24726cea58.js.map b/priv/static/static/js/2.c92f4803ff24726cea58.js.map new file mode 100644 index 000000000..e3cc6a3fb Binary files /dev/null and b/priv/static/static/js/2.c92f4803ff24726cea58.js.map differ diff --git a/priv/static/static/js/20.818c38d27369c3a4d677.js b/priv/static/static/js/20.818c38d27369c3a4d677.js new file mode 100644 index 000000000..133eac52d Binary files /dev/null and b/priv/static/static/js/20.818c38d27369c3a4d677.js differ diff --git a/priv/static/static/js/20.818c38d27369c3a4d677.js.map b/priv/static/static/js/20.818c38d27369c3a4d677.js.map new file mode 100644 index 000000000..696eab20f Binary files /dev/null and b/priv/static/static/js/20.818c38d27369c3a4d677.js.map differ diff --git a/priv/static/static/js/21.ce4cda179d888ca6bc2a.js b/priv/static/static/js/21.ce4cda179d888ca6bc2a.js new file mode 100644 index 000000000..49700403c Binary files /dev/null and b/priv/static/static/js/21.ce4cda179d888ca6bc2a.js differ diff --git a/priv/static/static/js/21.ce4cda179d888ca6bc2a.js.map b/priv/static/static/js/21.ce4cda179d888ca6bc2a.js.map new file mode 100644 index 000000000..124d58abc Binary files /dev/null and b/priv/static/static/js/21.ce4cda179d888ca6bc2a.js.map differ diff --git a/priv/static/static/js/22.2ea93c6cc569ef0256ab.js b/priv/static/static/js/22.2ea93c6cc569ef0256ab.js new file mode 100644 index 000000000..1d2077720 Binary files /dev/null and b/priv/static/static/js/22.2ea93c6cc569ef0256ab.js differ diff --git a/priv/static/static/js/22.2ea93c6cc569ef0256ab.js.map b/priv/static/static/js/22.2ea93c6cc569ef0256ab.js.map new file mode 100644 index 000000000..773159f01 Binary files /dev/null and b/priv/static/static/js/22.2ea93c6cc569ef0256ab.js.map differ diff --git a/priv/static/static/js/23.a57a7845cc20fafd06d1.js b/priv/static/static/js/23.a57a7845cc20fafd06d1.js new file mode 100644 index 000000000..b15a888df Binary files /dev/null and b/priv/static/static/js/23.a57a7845cc20fafd06d1.js differ diff --git a/priv/static/static/js/23.a57a7845cc20fafd06d1.js.map b/priv/static/static/js/23.a57a7845cc20fafd06d1.js.map new file mode 100644 index 000000000..0e5b421e6 Binary files /dev/null and b/priv/static/static/js/23.a57a7845cc20fafd06d1.js.map differ diff --git a/priv/static/static/js/24.35eb55a657b5485f8491.js b/priv/static/static/js/24.35eb55a657b5485f8491.js new file mode 100644 index 000000000..d09d5c371 Binary files /dev/null and b/priv/static/static/js/24.35eb55a657b5485f8491.js differ diff --git a/priv/static/static/js/24.35eb55a657b5485f8491.js.map b/priv/static/static/js/24.35eb55a657b5485f8491.js.map new file mode 100644 index 000000000..93ffbb2e9 Binary files /dev/null and b/priv/static/static/js/24.35eb55a657b5485f8491.js.map differ diff --git a/priv/static/static/js/25.5a9efe20e3ae1352e6d2.js b/priv/static/static/js/25.5a9efe20e3ae1352e6d2.js new file mode 100644 index 000000000..e96c5e6ec Binary files /dev/null and b/priv/static/static/js/25.5a9efe20e3ae1352e6d2.js differ diff --git a/priv/static/static/js/25.5a9efe20e3ae1352e6d2.js.map b/priv/static/static/js/25.5a9efe20e3ae1352e6d2.js.map new file mode 100644 index 000000000..a506e6fa8 Binary files /dev/null and b/priv/static/static/js/25.5a9efe20e3ae1352e6d2.js.map differ diff --git a/priv/static/static/js/26.cf13231d524e5ca3b3e6.js b/priv/static/static/js/26.cf13231d524e5ca3b3e6.js new file mode 100644 index 000000000..adc57d6c7 Binary files /dev/null and b/priv/static/static/js/26.cf13231d524e5ca3b3e6.js differ diff --git a/priv/static/static/js/26.cf13231d524e5ca3b3e6.js.map b/priv/static/static/js/26.cf13231d524e5ca3b3e6.js.map new file mode 100644 index 000000000..8654bda10 Binary files /dev/null and b/priv/static/static/js/26.cf13231d524e5ca3b3e6.js.map differ diff --git a/priv/static/static/js/27.fca8d4f6e444bd14f376.js b/priv/static/static/js/27.fca8d4f6e444bd14f376.js new file mode 100644 index 000000000..9f8b5c85d Binary files /dev/null and b/priv/static/static/js/27.fca8d4f6e444bd14f376.js differ diff --git a/priv/static/static/js/27.fca8d4f6e444bd14f376.js.map b/priv/static/static/js/27.fca8d4f6e444bd14f376.js.map new file mode 100644 index 000000000..f6ea8afc9 Binary files /dev/null and b/priv/static/static/js/27.fca8d4f6e444bd14f376.js.map differ diff --git a/priv/static/static/js/28.e0f9f164e0bfd890dc61.js b/priv/static/static/js/28.e0f9f164e0bfd890dc61.js new file mode 100644 index 000000000..75ba6d69d Binary files /dev/null and b/priv/static/static/js/28.e0f9f164e0bfd890dc61.js differ diff --git a/priv/static/static/js/28.e0f9f164e0bfd890dc61.js.map b/priv/static/static/js/28.e0f9f164e0bfd890dc61.js.map new file mode 100644 index 000000000..536ae2d7a Binary files /dev/null and b/priv/static/static/js/28.e0f9f164e0bfd890dc61.js.map differ diff --git a/priv/static/static/js/29.0b69359f0fe5c0785746.js b/priv/static/static/js/29.0b69359f0fe5c0785746.js new file mode 100644 index 000000000..24d73bcd5 Binary files /dev/null and b/priv/static/static/js/29.0b69359f0fe5c0785746.js differ diff --git a/priv/static/static/js/29.0b69359f0fe5c0785746.js.map b/priv/static/static/js/29.0b69359f0fe5c0785746.js.map new file mode 100644 index 000000000..65cd6bc82 Binary files /dev/null and b/priv/static/static/js/29.0b69359f0fe5c0785746.js.map differ diff --git a/priv/static/static/js/3.7d21accf4e5bd07e3ebf.js b/priv/static/static/js/3.7d21accf4e5bd07e3ebf.js new file mode 100644 index 000000000..d98aadec2 Binary files /dev/null and b/priv/static/static/js/3.7d21accf4e5bd07e3ebf.js differ diff --git a/priv/static/static/js/3.7d21accf4e5bd07e3ebf.js.map b/priv/static/static/js/3.7d21accf4e5bd07e3ebf.js.map new file mode 100644 index 000000000..37826baac Binary files /dev/null and b/priv/static/static/js/3.7d21accf4e5bd07e3ebf.js.map differ diff --git a/priv/static/static/js/30.fce58be0b52ca3e32fa4.js b/priv/static/static/js/30.fce58be0b52ca3e32fa4.js new file mode 100644 index 000000000..03a5d65f6 Binary files /dev/null and b/priv/static/static/js/30.fce58be0b52ca3e32fa4.js differ diff --git a/priv/static/static/js/30.fce58be0b52ca3e32fa4.js.map b/priv/static/static/js/30.fce58be0b52ca3e32fa4.js.map new file mode 100644 index 000000000..f7dc83701 Binary files /dev/null and b/priv/static/static/js/30.fce58be0b52ca3e32fa4.js.map differ diff --git a/priv/static/static/js/4.5719922a4e807145346d.js b/priv/static/static/js/4.5719922a4e807145346d.js new file mode 100644 index 000000000..91ea2ac5e Binary files /dev/null and b/priv/static/static/js/4.5719922a4e807145346d.js differ diff --git a/priv/static/static/js/4.5719922a4e807145346d.js.map b/priv/static/static/js/4.5719922a4e807145346d.js.map new file mode 100644 index 000000000..d5e592cfd Binary files /dev/null and b/priv/static/static/js/4.5719922a4e807145346d.js.map differ diff --git a/priv/static/static/js/5.cf05c5ddbdbac890ae35.js b/priv/static/static/js/5.cf05c5ddbdbac890ae35.js new file mode 100644 index 000000000..f54d67fb3 Binary files /dev/null and b/priv/static/static/js/5.cf05c5ddbdbac890ae35.js differ diff --git a/priv/static/static/js/5.cf05c5ddbdbac890ae35.js.map b/priv/static/static/js/5.cf05c5ddbdbac890ae35.js.map new file mode 100644 index 000000000..77f2d0898 Binary files /dev/null and b/priv/static/static/js/5.cf05c5ddbdbac890ae35.js.map differ diff --git a/priv/static/static/js/6.ecfd3302a692de148391.js b/priv/static/static/js/6.ecfd3302a692de148391.js new file mode 100644 index 000000000..354243ec2 Binary files /dev/null and b/priv/static/static/js/6.ecfd3302a692de148391.js differ diff --git a/priv/static/static/js/6.ecfd3302a692de148391.js.map b/priv/static/static/js/6.ecfd3302a692de148391.js.map new file mode 100644 index 000000000..a17c7d297 Binary files /dev/null and b/priv/static/static/js/6.ecfd3302a692de148391.js.map differ diff --git a/priv/static/static/js/7.dd44c3d58fb9dced093d.js b/priv/static/static/js/7.dd44c3d58fb9dced093d.js new file mode 100644 index 000000000..cb95efc73 Binary files /dev/null and b/priv/static/static/js/7.dd44c3d58fb9dced093d.js differ diff --git a/priv/static/static/js/7.dd44c3d58fb9dced093d.js.map b/priv/static/static/js/7.dd44c3d58fb9dced093d.js.map new file mode 100644 index 000000000..ae7e35d5d Binary files /dev/null and b/priv/static/static/js/7.dd44c3d58fb9dced093d.js.map differ diff --git a/priv/static/static/js/8.636322a87bb10a1754f8.js b/priv/static/static/js/8.636322a87bb10a1754f8.js new file mode 100644 index 000000000..6e635fb6a Binary files /dev/null and b/priv/static/static/js/8.636322a87bb10a1754f8.js differ diff --git a/priv/static/static/js/8.636322a87bb10a1754f8.js.map b/priv/static/static/js/8.636322a87bb10a1754f8.js.map new file mode 100644 index 000000000..f074928a5 Binary files /dev/null and b/priv/static/static/js/8.636322a87bb10a1754f8.js.map differ diff --git a/priv/static/static/js/9.6010dbcce7b4d7c05a18.js b/priv/static/static/js/9.6010dbcce7b4d7c05a18.js new file mode 100644 index 000000000..fcad39a7e Binary files /dev/null and b/priv/static/static/js/9.6010dbcce7b4d7c05a18.js differ diff --git a/priv/static/static/js/9.6010dbcce7b4d7c05a18.js.map b/priv/static/static/js/9.6010dbcce7b4d7c05a18.js.map new file mode 100644 index 000000000..e5e1cd823 Binary files /dev/null and b/priv/static/static/js/9.6010dbcce7b4d7c05a18.js.map differ diff --git a/priv/static/static/js/app.55d173dc5e39519aa518.js b/priv/static/static/js/app.55d173dc5e39519aa518.js new file mode 100644 index 000000000..d04ae3499 Binary files /dev/null and b/priv/static/static/js/app.55d173dc5e39519aa518.js differ diff --git a/priv/static/static/js/app.55d173dc5e39519aa518.js.map b/priv/static/static/js/app.55d173dc5e39519aa518.js.map new file mode 100644 index 000000000..600e97afa Binary files /dev/null and b/priv/static/static/js/app.55d173dc5e39519aa518.js.map differ diff --git a/priv/static/static/js/app.838ffa9aecf210c7d744.js b/priv/static/static/js/app.838ffa9aecf210c7d744.js deleted file mode 100644 index 7e224748e..000000000 Binary files a/priv/static/static/js/app.838ffa9aecf210c7d744.js and /dev/null differ diff --git a/priv/static/static/js/app.838ffa9aecf210c7d744.js.map b/priv/static/static/js/app.838ffa9aecf210c7d744.js.map deleted file mode 100644 index 4c2835cb4..000000000 Binary files a/priv/static/static/js/app.838ffa9aecf210c7d744.js.map and /dev/null differ diff --git a/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js b/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js deleted file mode 100644 index d1f1a1830..000000000 Binary files a/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js and /dev/null differ diff --git a/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js.map b/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js.map deleted file mode 100644 index 0d4a859ea..000000000 Binary files a/priv/static/static/js/vendors~app.561a1c605d1dfb0e6f74.js.map and /dev/null differ diff --git a/priv/static/static/js/vendors~app.90c4af83c1ae68f4cd95.js b/priv/static/static/js/vendors~app.90c4af83c1ae68f4cd95.js new file mode 100644 index 000000000..879a3b312 Binary files /dev/null and b/priv/static/static/js/vendors~app.90c4af83c1ae68f4cd95.js differ diff --git a/priv/static/static/js/vendors~app.90c4af83c1ae68f4cd95.js.map b/priv/static/static/js/vendors~app.90c4af83c1ae68f4cd95.js.map new file mode 100644 index 000000000..395f83b6b Binary files /dev/null and b/priv/static/static/js/vendors~app.90c4af83c1ae68f4cd95.js.map differ diff --git a/priv/static/static/terms-of-service.html b/priv/static/static/terms-of-service.html index a6da539e4..3b6bbb36b 100644 --- a/priv/static/static/terms-of-service.html +++ b/priv/static/static/terms-of-service.html @@ -1,4 +1,9 @@

Terms of Service

-

This is a placeholder ToS. Edit "/static/terms-of-service.html" to make it fit the needs of your instance.

+

This is the default placeholder ToS. You should copy it over to your static folder and edit it to fit the needs of your instance.

+ +

To do so, place a file at "/instance/static/static/terms-of-service.html" in your + Pleroma install containing the real ToS for your instance.

+

See the Pleroma documentation for more information.

+
diff --git a/priv/static/static/themes/redmond-xx-se.json b/priv/static/static/themes/redmond-xx-se.json index 7a4a29da3..24480d2c7 100644 --- a/priv/static/static/themes/redmond-xx-se.json +++ b/priv/static/static/themes/redmond-xx-se.json @@ -286,7 +286,9 @@ "cGreen": "#008000", "cOrange": "#808000", "highlight": "--accent", - "selectedPost": "--bg,-10" + "selectedPost": "--bg,-10", + "selectedMenu": "--accent", + "selectedMenuPopover": "--accent" }, "radii": { "btn": "0", diff --git a/priv/static/static/themes/redmond-xx.json b/priv/static/static/themes/redmond-xx.json index ff95b1e06..cf9010fe2 100644 --- a/priv/static/static/themes/redmond-xx.json +++ b/priv/static/static/themes/redmond-xx.json @@ -277,7 +277,9 @@ "cGreen": "#008000", "cOrange": "#808000", "highlight": "--accent", - "selectedPost": "--bg,-10" + "selectedPost": "--bg,-10", + "selectedMenu": "--accent", + "selectedMenuPopover": "--accent" }, "radii": { "btn": "0", diff --git a/priv/static/static/themes/redmond-xxi.json b/priv/static/static/themes/redmond-xxi.json index f788bdb83..7fdc4a6d6 100644 --- a/priv/static/static/themes/redmond-xxi.json +++ b/priv/static/static/themes/redmond-xxi.json @@ -259,7 +259,9 @@ "cGreen": "#669966", "cOrange": "#cc6633", "highlight": "--accent", - "selectedPost": "--bg,-10" + "selectedPost": "--bg,-10", + "selectedMenu": "--accent", + "selectedMenuPopover": "--accent" }, "radii": { "btn": "0", diff --git a/priv/static/sw-pleroma.js b/priv/static/sw-pleroma.js index 4d73c414e..54c6ed8f0 100644 Binary files a/priv/static/sw-pleroma.js and b/priv/static/sw-pleroma.js differ diff --git a/priv/static/sw-pleroma.js.map b/priv/static/sw-pleroma.js.map index c704cb951..cd5ea0ae6 100644 Binary files a/priv/static/sw-pleroma.js.map and b/priv/static/sw-pleroma.js.map differ diff --git a/priv/static/sw.js b/priv/static/sw.js index 0fde0f440..5605bb05e 100644 Binary files a/priv/static/sw.js and b/priv/static/sw.js differ diff --git a/test/activity_expiration_test.exs b/test/activity_expiration_test.exs deleted file mode 100644 index e899d4509..000000000 --- a/test/activity_expiration_test.exs +++ /dev/null @@ -1,52 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.ActivityExpirationTest do - use Pleroma.DataCase - alias Pleroma.ActivityExpiration - import Pleroma.Factory - - setup do: clear_config([ActivityExpiration, :enabled]) - - test "finds activities due to be deleted only" do - activity = insert(:note_activity) - expiration_due = insert(:expiration_in_the_past, %{activity_id: activity.id}) - activity2 = insert(:note_activity) - insert(:expiration_in_the_future, %{activity_id: activity2.id}) - - expirations = ActivityExpiration.due_expirations() - - assert length(expirations) == 1 - assert hd(expirations) == expiration_due - end - - test "denies expirations that don't live long enough" do - activity = insert(:note_activity) - now = NaiveDateTime.utc_now() - assert {:error, _} = ActivityExpiration.create(activity, now) - end - - test "deletes an expiration activity" do - Pleroma.Config.put([ActivityExpiration, :enabled], true) - activity = insert(:note_activity) - - naive_datetime = - NaiveDateTime.add( - NaiveDateTime.utc_now(), - -:timer.minutes(2), - :millisecond - ) - - expiration = - insert( - :expiration_in_the_past, - %{activity_id: activity.id, scheduled_at: naive_datetime} - ) - - Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker.perform(:ops, :pid) - - refute Pleroma.Repo.get(Pleroma.Activity, activity.id) - refute Pleroma.Repo.get(Pleroma.ActivityExpiration, expiration.id) - end -end diff --git a/test/activity_test.exs b/test/activity_test.exs index 2a92327d1..ee6a99cc3 100644 --- a/test/activity_test.exs +++ b/test/activity_test.exs @@ -185,15 +185,6 @@ test "find all statuses for unauthenticated users when `limit_to_local_content` end end - test "add an activity with an expiration" do - activity = insert(:note_activity) - insert(:expiration_in_the_future, %{activity_id: activity.id}) - - Pleroma.ActivityExpiration - |> where([a], a.activity_id == ^activity.id) - |> Repo.one!() - end - test "all_by_ids_with_object/1" do %{id: id1} = insert(:note_activity) %{id: id2} = insert(:note_activity) diff --git a/test/application_requirements_test.exs b/test/application_requirements_test.exs new file mode 100644 index 000000000..21d24ddd0 --- /dev/null +++ b/test/application_requirements_test.exs @@ -0,0 +1,146 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.ApplicationRequirementsTest do + use Pleroma.DataCase + import ExUnit.CaptureLog + import Mock + + alias Pleroma.Repo + + describe "check_welcome_message_config!/1" do + setup do: clear_config([:welcome]) + setup do: clear_config([Pleroma.Emails.Mailer]) + + test "raises if welcome email enabled but mail disabled" do + Pleroma.Config.put([:welcome, :email, :enabled], true) + Pleroma.Config.put([Pleroma.Emails.Mailer, :enabled], false) + + assert_raise Pleroma.ApplicationRequirements.VerifyError, "The mail disabled.", fn -> + capture_log(&Pleroma.ApplicationRequirements.verify!/0) + end + end + end + + describe "check_confirmation_accounts!" do + setup_with_mocks([ + {Pleroma.ApplicationRequirements, [:passthrough], + [ + check_migrations_applied!: fn _ -> :ok end + ]} + ]) do + :ok + end + + setup do: clear_config([:instance, :account_activation_required]) + + test "raises if account confirmation is required but mailer isn't enable" do + Pleroma.Config.put([:instance, :account_activation_required], true) + Pleroma.Config.put([Pleroma.Emails.Mailer, :enabled], false) + + assert_raise Pleroma.ApplicationRequirements.VerifyError, + "Account activation enabled, but Mailer is disabled. Cannot send confirmation emails.", + fn -> + capture_log(&Pleroma.ApplicationRequirements.verify!/0) + end + end + + test "doesn't do anything if account confirmation is disabled" do + Pleroma.Config.put([:instance, :account_activation_required], false) + Pleroma.Config.put([Pleroma.Emails.Mailer, :enabled], false) + assert Pleroma.ApplicationRequirements.verify!() == :ok + end + + test "doesn't do anything if account confirmation is required and mailer is enabled" do + Pleroma.Config.put([:instance, :account_activation_required], true) + Pleroma.Config.put([Pleroma.Emails.Mailer, :enabled], true) + assert Pleroma.ApplicationRequirements.verify!() == :ok + end + end + + describe "check_rum!" do + setup_with_mocks([ + {Pleroma.ApplicationRequirements, [:passthrough], + [check_migrations_applied!: fn _ -> :ok end]} + ]) do + :ok + end + + setup do: clear_config([:database, :rum_enabled]) + + test "raises if rum is enabled and detects unapplied rum migrations" do + Pleroma.Config.put([:database, :rum_enabled], true) + + with_mocks([{Repo, [:passthrough], [exists?: fn _, _ -> false end]}]) do + assert_raise Pleroma.ApplicationRequirements.VerifyError, + "Unapplied RUM Migrations detected", + fn -> + capture_log(&Pleroma.ApplicationRequirements.verify!/0) + end + end + end + + test "raises if rum is disabled and detects rum migrations" do + Pleroma.Config.put([:database, :rum_enabled], false) + + with_mocks([{Repo, [:passthrough], [exists?: fn _, _ -> true end]}]) do + assert_raise Pleroma.ApplicationRequirements.VerifyError, + "RUM Migrations detected", + fn -> + capture_log(&Pleroma.ApplicationRequirements.verify!/0) + end + end + end + + test "doesn't do anything if rum enabled and applied migrations" do + Pleroma.Config.put([:database, :rum_enabled], true) + + with_mocks([{Repo, [:passthrough], [exists?: fn _, _ -> true end]}]) do + assert Pleroma.ApplicationRequirements.verify!() == :ok + end + end + + test "doesn't do anything if rum disabled" do + Pleroma.Config.put([:database, :rum_enabled], false) + + with_mocks([{Repo, [:passthrough], [exists?: fn _, _ -> false end]}]) do + assert Pleroma.ApplicationRequirements.verify!() == :ok + end + end + end + + describe "check_migrations_applied!" do + setup_with_mocks([ + {Ecto.Migrator, [], + [ + with_repo: fn repo, fun -> passthrough([repo, fun]) end, + migrations: fn Repo -> + [ + {:up, 20_191_128_153_944, "fix_missing_following_count"}, + {:up, 20_191_203_043_610, "create_report_notes"}, + {:down, 20_191_220_174_645, "add_scopes_to_pleroma_feo_auth_records"} + ] + end + ]} + ]) do + :ok + end + + setup do: clear_config([:i_am_aware_this_may_cause_data_loss, :disable_migration_check]) + + test "raises if it detects unapplied migrations" do + assert_raise Pleroma.ApplicationRequirements.VerifyError, + "Unapplied Migrations detected", + fn -> + capture_log(&Pleroma.ApplicationRequirements.verify!/0) + end + end + + test "doesn't do anything if disabled" do + Pleroma.Config.put([:i_am_aware_this_may_cause_data_loss, :disable_migration_check], true) + + assert :ok == Pleroma.ApplicationRequirements.verify!() + end + end +end diff --git a/test/captcha_test.exs b/test/captcha_test.exs index 1ab9019ab..1b9f4a12f 100644 --- a/test/captcha_test.exs +++ b/test/captcha_test.exs @@ -41,7 +41,8 @@ test "new and validate" do answer_data: answer, token: ^token, url: ^url, - type: :kocaptcha + type: :kocaptcha, + seconds_valid: 300 } = new assert Kocaptcha.validate(token, "7oEy8c", answer) == :ok @@ -56,7 +57,8 @@ test "new and validate" do answer_data: answer, token: token, type: :native, - url: "data:image/png;base64," <> _ + url: "data:image/png;base64," <> _, + seconds_valid: 300 } = new assert is_binary(answer) diff --git a/test/chat_test.exs b/test/chat_test.exs index 332f2180a..9e8a9ebf0 100644 --- a/test/chat_test.exs +++ b/test/chat_test.exs @@ -26,6 +26,28 @@ test "it creates a chat for a user and recipient" do assert chat.id end + test "deleting the user deletes the chat" do + user = insert(:user) + other_user = insert(:user) + + {:ok, chat} = Chat.bump_or_create(user.id, other_user.ap_id) + + Repo.delete(user) + + refute Chat.get_by_id(chat.id) + end + + test "deleting the recipient deletes the chat" do + user = insert(:user) + other_user = insert(:user) + + {:ok, chat} = Chat.bump_or_create(user.id, other_user.ap_id) + + Repo.delete(other_user) + + refute Chat.get_by_id(chat.id) + end + test "it returns and bumps a chat for a user and recipient if it already exists" do user = insert(:user) other_user = insert(:user) diff --git a/test/config/config_db_test.exs b/test/config/config_db_test.exs index 336de7359..3895e2cda 100644 --- a/test/config/config_db_test.exs +++ b/test/config/config_db_test.exs @@ -7,40 +7,28 @@ defmodule Pleroma.ConfigDBTest do import Pleroma.Factory alias Pleroma.ConfigDB - test "get_by_key/1" do + test "get_by_params/1" do config = insert(:config) insert(:config) assert config == ConfigDB.get_by_params(%{group: config.group, key: config.key}) end - test "create/1" do - {:ok, config} = ConfigDB.create(%{group: ":pleroma", key: ":some_key", value: "some_value"}) - assert config == ConfigDB.get_by_params(%{group: ":pleroma", key: ":some_key"}) - end - - test "update/1" do - config = insert(:config) - {:ok, updated} = ConfigDB.update(config, %{value: "some_value"}) - loaded = ConfigDB.get_by_params(%{group: config.group, key: config.key}) - assert loaded == updated - end - test "get_all_as_keyword/0" do saved = insert(:config) - insert(:config, group: ":quack", key: ":level", value: ConfigDB.to_binary(:info)) - insert(:config, group: ":quack", key: ":meta", value: ConfigDB.to_binary([:none])) + insert(:config, group: ":quack", key: ":level", value: :info) + insert(:config, group: ":quack", key: ":meta", value: [:none]) insert(:config, group: ":quack", key: ":webhook_url", - value: ConfigDB.to_binary("https://hooks.slack.com/services/KEY/some_val") + value: "https://hooks.slack.com/services/KEY/some_val" ) config = ConfigDB.get_all_as_keyword() assert config[:pleroma] == [ - {ConfigDB.from_string(saved.key), ConfigDB.from_binary(saved.value)} + {saved.key, saved.value} ] assert config[:quack][:level] == :info @@ -51,11 +39,11 @@ test "get_all_as_keyword/0" do describe "update_or_create/1" do test "common" do config = insert(:config) - key2 = "another_key" + key2 = :another_key params = [ - %{group: "pleroma", key: key2, value: "another_value"}, - %{group: config.group, key: config.key, value: "new_value"} + %{group: :pleroma, key: key2, value: "another_value"}, + %{group: :pleroma, key: config.key, value: [a: 1, b: 2, c: "new_value"]} ] assert Repo.all(ConfigDB) |> length() == 1 @@ -65,16 +53,16 @@ test "common" do assert Repo.all(ConfigDB) |> length() == 2 config1 = ConfigDB.get_by_params(%{group: config.group, key: config.key}) - config2 = ConfigDB.get_by_params(%{group: "pleroma", key: key2}) + config2 = ConfigDB.get_by_params(%{group: :pleroma, key: key2}) - assert config1.value == ConfigDB.transform("new_value") - assert config2.value == ConfigDB.transform("another_value") + assert config1.value == [a: 1, b: 2, c: "new_value"] + assert config2.value == "another_value" end test "partial update" do - config = insert(:config, value: ConfigDB.to_binary(key1: "val1", key2: :val2)) + config = insert(:config, value: [key1: "val1", key2: :val2]) - {:ok, _config} = + {:ok, config} = ConfigDB.update_or_create(%{ group: config.group, key: config.key, @@ -83,15 +71,14 @@ test "partial update" do updated = ConfigDB.get_by_params(%{group: config.group, key: config.key}) - value = ConfigDB.from_binary(updated.value) - assert length(value) == 3 - assert value[:key1] == :val1 - assert value[:key2] == :val2 - assert value[:key3] == :val3 + assert config.value == updated.value + assert updated.value[:key1] == :val1 + assert updated.value[:key2] == :val2 + assert updated.value[:key3] == :val3 end test "deep merge" do - config = insert(:config, value: ConfigDB.to_binary(key1: "val1", key2: [k1: :v1, k2: "v2"])) + config = insert(:config, value: [key1: "val1", key2: [k1: :v1, k2: "v2"]]) {:ok, config} = ConfigDB.update_or_create(%{ @@ -103,18 +90,15 @@ test "deep merge" do updated = ConfigDB.get_by_params(%{group: config.group, key: config.key}) assert config.value == updated.value - - value = ConfigDB.from_binary(updated.value) - assert value[:key1] == :val1 - assert value[:key2] == [k1: :v1, k2: :v2, k3: :v3] - assert value[:key3] == :val3 + assert updated.value[:key1] == :val1 + assert updated.value[:key2] == [k1: :v1, k2: :v2, k3: :v3] + assert updated.value[:key3] == :val3 end test "only full update for some keys" do - config1 = insert(:config, key: ":ecto_repos", value: ConfigDB.to_binary(repo: Pleroma.Repo)) + config1 = insert(:config, key: :ecto_repos, value: [repo: Pleroma.Repo]) - config2 = - insert(:config, group: ":cors_plug", key: ":max_age", value: ConfigDB.to_binary(18)) + config2 = insert(:config, group: :cors_plug, key: :max_age, value: 18) {:ok, _config} = ConfigDB.update_or_create(%{ @@ -133,8 +117,8 @@ test "only full update for some keys" do updated1 = ConfigDB.get_by_params(%{group: config1.group, key: config1.key}) updated2 = ConfigDB.get_by_params(%{group: config2.group, key: config2.key}) - assert ConfigDB.from_binary(updated1.value) == [another_repo: [Pleroma.Repo]] - assert ConfigDB.from_binary(updated2.value) == 777 + assert updated1.value == [another_repo: [Pleroma.Repo]] + assert updated2.value == 777 end test "full update if value is not keyword" do @@ -142,7 +126,7 @@ test "full update if value is not keyword" do insert(:config, group: ":tesla", key: ":adapter", - value: ConfigDB.to_binary(Tesla.Adapter.Hackney) + value: Tesla.Adapter.Hackney ) {:ok, _config} = @@ -154,20 +138,20 @@ test "full update if value is not keyword" do updated = ConfigDB.get_by_params(%{group: config.group, key: config.key}) - assert ConfigDB.from_binary(updated.value) == Tesla.Adapter.Httpc + assert updated.value == Tesla.Adapter.Httpc end test "only full update for some subkeys" do config1 = insert(:config, key: ":emoji", - value: ConfigDB.to_binary(groups: [a: 1, b: 2], key: [a: 1]) + value: [groups: [a: 1, b: 2], key: [a: 1]] ) config2 = insert(:config, key: ":assets", - value: ConfigDB.to_binary(mascots: [a: 1, b: 2], key: [a: 1]) + value: [mascots: [a: 1, b: 2], key: [a: 1]] ) {:ok, _config} = @@ -187,8 +171,8 @@ test "only full update for some subkeys" do updated1 = ConfigDB.get_by_params(%{group: config1.group, key: config1.key}) updated2 = ConfigDB.get_by_params(%{group: config2.group, key: config2.key}) - assert ConfigDB.from_binary(updated1.value) == [groups: [c: 3, d: 4], key: [a: 1, b: 2]] - assert ConfigDB.from_binary(updated2.value) == [mascots: [c: 3, d: 4], key: [a: 1, b: 2]] + assert updated1.value == [groups: [c: 3, d: 4], key: [a: 1, b: 2]] + assert updated2.value == [mascots: [c: 3, d: 4], key: [a: 1, b: 2]] end end @@ -206,14 +190,14 @@ test "full delete" do end test "partial subkeys delete" do - config = insert(:config, value: ConfigDB.to_binary(groups: [a: 1, b: 2], key: [a: 1])) + config = insert(:config, value: [groups: [a: 1, b: 2], key: [a: 1]]) {:ok, deleted} = ConfigDB.delete(%{group: config.group, key: config.key, subkeys: [":groups"]}) assert Ecto.get_meta(deleted, :state) == :loaded - assert deleted.value == ConfigDB.to_binary(key: [a: 1]) + assert deleted.value == [key: [a: 1]] updated = ConfigDB.get_by_params(%{group: config.group, key: config.key}) @@ -221,7 +205,7 @@ test "partial subkeys delete" do end test "full delete if remaining value after subkeys deletion is empty list" do - config = insert(:config, value: ConfigDB.to_binary(groups: [a: 1, b: 2])) + config = insert(:config, value: [groups: [a: 1, b: 2]]) {:ok, deleted} = ConfigDB.delete(%{group: config.group, key: config.key, subkeys: [":groups"]}) @@ -232,234 +216,159 @@ test "full delete if remaining value after subkeys deletion is empty list" do end end - describe "transform/1" do + describe "to_elixir_types/1" do test "string" do - binary = ConfigDB.transform("value as string") - assert binary == :erlang.term_to_binary("value as string") - assert ConfigDB.from_binary(binary) == "value as string" + assert ConfigDB.to_elixir_types("value as string") == "value as string" end test "boolean" do - binary = ConfigDB.transform(false) - assert binary == :erlang.term_to_binary(false) - assert ConfigDB.from_binary(binary) == false + assert ConfigDB.to_elixir_types(false) == false end test "nil" do - binary = ConfigDB.transform(nil) - assert binary == :erlang.term_to_binary(nil) - assert ConfigDB.from_binary(binary) == nil + assert ConfigDB.to_elixir_types(nil) == nil end test "integer" do - binary = ConfigDB.transform(150) - assert binary == :erlang.term_to_binary(150) - assert ConfigDB.from_binary(binary) == 150 + assert ConfigDB.to_elixir_types(150) == 150 end test "atom" do - binary = ConfigDB.transform(":atom") - assert binary == :erlang.term_to_binary(:atom) - assert ConfigDB.from_binary(binary) == :atom + assert ConfigDB.to_elixir_types(":atom") == :atom end test "ssl options" do - binary = ConfigDB.transform([":tlsv1", ":tlsv1.1", ":tlsv1.2"]) - assert binary == :erlang.term_to_binary([:tlsv1, :"tlsv1.1", :"tlsv1.2"]) - assert ConfigDB.from_binary(binary) == [:tlsv1, :"tlsv1.1", :"tlsv1.2"] + assert ConfigDB.to_elixir_types([":tlsv1", ":tlsv1.1", ":tlsv1.2"]) == [ + :tlsv1, + :"tlsv1.1", + :"tlsv1.2" + ] end test "pleroma module" do - binary = ConfigDB.transform("Pleroma.Bookmark") - assert binary == :erlang.term_to_binary(Pleroma.Bookmark) - assert ConfigDB.from_binary(binary) == Pleroma.Bookmark + assert ConfigDB.to_elixir_types("Pleroma.Bookmark") == Pleroma.Bookmark end test "pleroma string" do - binary = ConfigDB.transform("Pleroma") - assert binary == :erlang.term_to_binary("Pleroma") - assert ConfigDB.from_binary(binary) == "Pleroma" + assert ConfigDB.to_elixir_types("Pleroma") == "Pleroma" end test "phoenix module" do - binary = ConfigDB.transform("Phoenix.Socket.V1.JSONSerializer") - assert binary == :erlang.term_to_binary(Phoenix.Socket.V1.JSONSerializer) - assert ConfigDB.from_binary(binary) == Phoenix.Socket.V1.JSONSerializer + assert ConfigDB.to_elixir_types("Phoenix.Socket.V1.JSONSerializer") == + Phoenix.Socket.V1.JSONSerializer end test "tesla module" do - binary = ConfigDB.transform("Tesla.Adapter.Hackney") - assert binary == :erlang.term_to_binary(Tesla.Adapter.Hackney) - assert ConfigDB.from_binary(binary) == Tesla.Adapter.Hackney + assert ConfigDB.to_elixir_types("Tesla.Adapter.Hackney") == Tesla.Adapter.Hackney end test "ExSyslogger module" do - binary = ConfigDB.transform("ExSyslogger") - assert binary == :erlang.term_to_binary(ExSyslogger) - assert ConfigDB.from_binary(binary) == ExSyslogger + assert ConfigDB.to_elixir_types("ExSyslogger") == ExSyslogger end test "Quack.Logger module" do - binary = ConfigDB.transform("Quack.Logger") - assert binary == :erlang.term_to_binary(Quack.Logger) - assert ConfigDB.from_binary(binary) == Quack.Logger + assert ConfigDB.to_elixir_types("Quack.Logger") == Quack.Logger end test "Swoosh.Adapters modules" do - binary = ConfigDB.transform("Swoosh.Adapters.SMTP") - assert binary == :erlang.term_to_binary(Swoosh.Adapters.SMTP) - assert ConfigDB.from_binary(binary) == Swoosh.Adapters.SMTP - binary = ConfigDB.transform("Swoosh.Adapters.AmazonSES") - assert binary == :erlang.term_to_binary(Swoosh.Adapters.AmazonSES) - assert ConfigDB.from_binary(binary) == Swoosh.Adapters.AmazonSES + assert ConfigDB.to_elixir_types("Swoosh.Adapters.SMTP") == Swoosh.Adapters.SMTP + assert ConfigDB.to_elixir_types("Swoosh.Adapters.AmazonSES") == Swoosh.Adapters.AmazonSES end test "sigil" do - binary = ConfigDB.transform("~r[comp[lL][aA][iI][nN]er]") - assert binary == :erlang.term_to_binary(~r/comp[lL][aA][iI][nN]er/) - assert ConfigDB.from_binary(binary) == ~r/comp[lL][aA][iI][nN]er/ + assert ConfigDB.to_elixir_types("~r[comp[lL][aA][iI][nN]er]") == ~r/comp[lL][aA][iI][nN]er/ end test "link sigil" do - binary = ConfigDB.transform("~r/https:\/\/example.com/") - assert binary == :erlang.term_to_binary(~r/https:\/\/example.com/) - assert ConfigDB.from_binary(binary) == ~r/https:\/\/example.com/ + assert ConfigDB.to_elixir_types("~r/https:\/\/example.com/") == ~r/https:\/\/example.com/ end test "link sigil with um modifiers" do - binary = ConfigDB.transform("~r/https:\/\/example.com/um") - assert binary == :erlang.term_to_binary(~r/https:\/\/example.com/um) - assert ConfigDB.from_binary(binary) == ~r/https:\/\/example.com/um + assert ConfigDB.to_elixir_types("~r/https:\/\/example.com/um") == + ~r/https:\/\/example.com/um end test "link sigil with i modifier" do - binary = ConfigDB.transform("~r/https:\/\/example.com/i") - assert binary == :erlang.term_to_binary(~r/https:\/\/example.com/i) - assert ConfigDB.from_binary(binary) == ~r/https:\/\/example.com/i + assert ConfigDB.to_elixir_types("~r/https:\/\/example.com/i") == ~r/https:\/\/example.com/i end test "link sigil with s modifier" do - binary = ConfigDB.transform("~r/https:\/\/example.com/s") - assert binary == :erlang.term_to_binary(~r/https:\/\/example.com/s) - assert ConfigDB.from_binary(binary) == ~r/https:\/\/example.com/s + assert ConfigDB.to_elixir_types("~r/https:\/\/example.com/s") == ~r/https:\/\/example.com/s end test "raise if valid delimiter not found" do assert_raise ArgumentError, "valid delimiter for Regex expression not found", fn -> - ConfigDB.transform("~r/https://[]{}<>\"'()|example.com/s") + ConfigDB.to_elixir_types("~r/https://[]{}<>\"'()|example.com/s") end end test "2 child tuple" do - binary = ConfigDB.transform(%{"tuple" => ["v1", ":v2"]}) - assert binary == :erlang.term_to_binary({"v1", :v2}) - assert ConfigDB.from_binary(binary) == {"v1", :v2} + assert ConfigDB.to_elixir_types(%{"tuple" => ["v1", ":v2"]}) == {"v1", :v2} end test "proxy tuple with localhost" do - binary = - ConfigDB.transform(%{ - "tuple" => [":proxy_url", %{"tuple" => [":socks5", "localhost", 1234]}] - }) - - assert binary == :erlang.term_to_binary({:proxy_url, {:socks5, :localhost, 1234}}) - assert ConfigDB.from_binary(binary) == {:proxy_url, {:socks5, :localhost, 1234}} + assert ConfigDB.to_elixir_types(%{ + "tuple" => [":proxy_url", %{"tuple" => [":socks5", "localhost", 1234]}] + }) == {:proxy_url, {:socks5, :localhost, 1234}} end test "proxy tuple with domain" do - binary = - ConfigDB.transform(%{ - "tuple" => [":proxy_url", %{"tuple" => [":socks5", "domain.com", 1234]}] - }) - - assert binary == :erlang.term_to_binary({:proxy_url, {:socks5, 'domain.com', 1234}}) - assert ConfigDB.from_binary(binary) == {:proxy_url, {:socks5, 'domain.com', 1234}} + assert ConfigDB.to_elixir_types(%{ + "tuple" => [":proxy_url", %{"tuple" => [":socks5", "domain.com", 1234]}] + }) == {:proxy_url, {:socks5, 'domain.com', 1234}} end test "proxy tuple with ip" do - binary = - ConfigDB.transform(%{ - "tuple" => [":proxy_url", %{"tuple" => [":socks5", "127.0.0.1", 1234]}] - }) - - assert binary == :erlang.term_to_binary({:proxy_url, {:socks5, {127, 0, 0, 1}, 1234}}) - assert ConfigDB.from_binary(binary) == {:proxy_url, {:socks5, {127, 0, 0, 1}, 1234}} + assert ConfigDB.to_elixir_types(%{ + "tuple" => [":proxy_url", %{"tuple" => [":socks5", "127.0.0.1", 1234]}] + }) == {:proxy_url, {:socks5, {127, 0, 0, 1}, 1234}} end test "tuple with n childs" do - binary = - ConfigDB.transform(%{ - "tuple" => [ - "v1", - ":v2", - "Pleroma.Bookmark", - 150, - false, - "Phoenix.Socket.V1.JSONSerializer" - ] - }) - - assert binary == - :erlang.term_to_binary( - {"v1", :v2, Pleroma.Bookmark, 150, false, Phoenix.Socket.V1.JSONSerializer} - ) - - assert ConfigDB.from_binary(binary) == - {"v1", :v2, Pleroma.Bookmark, 150, false, Phoenix.Socket.V1.JSONSerializer} + assert ConfigDB.to_elixir_types(%{ + "tuple" => [ + "v1", + ":v2", + "Pleroma.Bookmark", + 150, + false, + "Phoenix.Socket.V1.JSONSerializer" + ] + }) == {"v1", :v2, Pleroma.Bookmark, 150, false, Phoenix.Socket.V1.JSONSerializer} end test "map with string key" do - binary = ConfigDB.transform(%{"key" => "value"}) - assert binary == :erlang.term_to_binary(%{"key" => "value"}) - assert ConfigDB.from_binary(binary) == %{"key" => "value"} + assert ConfigDB.to_elixir_types(%{"key" => "value"}) == %{"key" => "value"} end test "map with atom key" do - binary = ConfigDB.transform(%{":key" => "value"}) - assert binary == :erlang.term_to_binary(%{key: "value"}) - assert ConfigDB.from_binary(binary) == %{key: "value"} + assert ConfigDB.to_elixir_types(%{":key" => "value"}) == %{key: "value"} end test "list of strings" do - binary = ConfigDB.transform(["v1", "v2", "v3"]) - assert binary == :erlang.term_to_binary(["v1", "v2", "v3"]) - assert ConfigDB.from_binary(binary) == ["v1", "v2", "v3"] + assert ConfigDB.to_elixir_types(["v1", "v2", "v3"]) == ["v1", "v2", "v3"] end test "list of modules" do - binary = ConfigDB.transform(["Pleroma.Repo", "Pleroma.Activity"]) - assert binary == :erlang.term_to_binary([Pleroma.Repo, Pleroma.Activity]) - assert ConfigDB.from_binary(binary) == [Pleroma.Repo, Pleroma.Activity] + assert ConfigDB.to_elixir_types(["Pleroma.Repo", "Pleroma.Activity"]) == [ + Pleroma.Repo, + Pleroma.Activity + ] end test "list of atoms" do - binary = ConfigDB.transform([":v1", ":v2", ":v3"]) - assert binary == :erlang.term_to_binary([:v1, :v2, :v3]) - assert ConfigDB.from_binary(binary) == [:v1, :v2, :v3] + assert ConfigDB.to_elixir_types([":v1", ":v2", ":v3"]) == [:v1, :v2, :v3] end test "list of mixed values" do - binary = - ConfigDB.transform([ - "v1", - ":v2", - "Pleroma.Repo", - "Phoenix.Socket.V1.JSONSerializer", - 15, - false - ]) - - assert binary == - :erlang.term_to_binary([ - "v1", - :v2, - Pleroma.Repo, - Phoenix.Socket.V1.JSONSerializer, - 15, - false - ]) - - assert ConfigDB.from_binary(binary) == [ + assert ConfigDB.to_elixir_types([ + "v1", + ":v2", + "Pleroma.Repo", + "Phoenix.Socket.V1.JSONSerializer", + 15, + false + ]) == [ "v1", :v2, Pleroma.Repo, @@ -470,40 +379,17 @@ test "list of mixed values" do end test "simple keyword" do - binary = ConfigDB.transform([%{"tuple" => [":key", "value"]}]) - assert binary == :erlang.term_to_binary([{:key, "value"}]) - assert ConfigDB.from_binary(binary) == [{:key, "value"}] - assert ConfigDB.from_binary(binary) == [key: "value"] - end - - test "keyword with partial_chain key" do - binary = - ConfigDB.transform([%{"tuple" => [":partial_chain", "&:hackney_connect.partial_chain/1"]}]) - - assert binary == :erlang.term_to_binary(partial_chain: &:hackney_connect.partial_chain/1) - assert ConfigDB.from_binary(binary) == [partial_chain: &:hackney_connect.partial_chain/1] + assert ConfigDB.to_elixir_types([%{"tuple" => [":key", "value"]}]) == [key: "value"] end test "keyword" do - binary = - ConfigDB.transform([ - %{"tuple" => [":types", "Pleroma.PostgresTypes"]}, - %{"tuple" => [":telemetry_event", ["Pleroma.Repo.Instrumenter"]]}, - %{"tuple" => [":migration_lock", nil]}, - %{"tuple" => [":key1", 150]}, - %{"tuple" => [":key2", "string"]} - ]) - - assert binary == - :erlang.term_to_binary( - types: Pleroma.PostgresTypes, - telemetry_event: [Pleroma.Repo.Instrumenter], - migration_lock: nil, - key1: 150, - key2: "string" - ) - - assert ConfigDB.from_binary(binary) == [ + assert ConfigDB.to_elixir_types([ + %{"tuple" => [":types", "Pleroma.PostgresTypes"]}, + %{"tuple" => [":telemetry_event", ["Pleroma.Repo.Instrumenter"]]}, + %{"tuple" => [":migration_lock", nil]}, + %{"tuple" => [":key1", 150]}, + %{"tuple" => [":key2", "string"]} + ]) == [ types: Pleroma.PostgresTypes, telemetry_event: [Pleroma.Repo.Instrumenter], migration_lock: nil, @@ -512,86 +398,60 @@ test "keyword" do ] end - test "complex keyword with nested mixed childs" do - binary = - ConfigDB.transform([ - %{"tuple" => [":uploader", "Pleroma.Uploaders.Local"]}, - %{"tuple" => [":filters", ["Pleroma.Upload.Filter.Dedupe"]]}, - %{"tuple" => [":link_name", true]}, - %{"tuple" => [":proxy_remote", false]}, - %{"tuple" => [":common_map", %{":key" => "value"}]}, - %{ - "tuple" => [ - ":proxy_opts", - [ - %{"tuple" => [":redirect_on_failure", false]}, - %{"tuple" => [":max_body_length", 1_048_576]}, - %{ - "tuple" => [ - ":http", - [%{"tuple" => [":follow_redirect", true]}, %{"tuple" => [":pool", ":upload"]}] - ] - } - ] - ] - } - ]) + test "trandformed keyword" do + assert ConfigDB.to_elixir_types(a: 1, b: 2, c: "string") == [a: 1, b: 2, c: "string"] + end - assert binary == - :erlang.term_to_binary( - uploader: Pleroma.Uploaders.Local, - filters: [Pleroma.Upload.Filter.Dedupe], - link_name: true, - proxy_remote: false, - common_map: %{key: "value"}, - proxy_opts: [ - redirect_on_failure: false, - max_body_length: 1_048_576, - http: [ - follow_redirect: true, - pool: :upload + test "complex keyword with nested mixed childs" do + assert ConfigDB.to_elixir_types([ + %{"tuple" => [":uploader", "Pleroma.Uploaders.Local"]}, + %{"tuple" => [":filters", ["Pleroma.Upload.Filter.Dedupe"]]}, + %{"tuple" => [":link_name", true]}, + %{"tuple" => [":proxy_remote", false]}, + %{"tuple" => [":common_map", %{":key" => "value"}]}, + %{ + "tuple" => [ + ":proxy_opts", + [ + %{"tuple" => [":redirect_on_failure", false]}, + %{"tuple" => [":max_body_length", 1_048_576]}, + %{ + "tuple" => [ + ":http", + [ + %{"tuple" => [":follow_redirect", true]}, + %{"tuple" => [":pool", ":upload"]} + ] + ] + } ] ] - ) - - assert ConfigDB.from_binary(binary) == - [ - uploader: Pleroma.Uploaders.Local, - filters: [Pleroma.Upload.Filter.Dedupe], - link_name: true, - proxy_remote: false, - common_map: %{key: "value"}, - proxy_opts: [ - redirect_on_failure: false, - max_body_length: 1_048_576, - http: [ - follow_redirect: true, - pool: :upload - ] + } + ]) == [ + uploader: Pleroma.Uploaders.Local, + filters: [Pleroma.Upload.Filter.Dedupe], + link_name: true, + proxy_remote: false, + common_map: %{key: "value"}, + proxy_opts: [ + redirect_on_failure: false, + max_body_length: 1_048_576, + http: [ + follow_redirect: true, + pool: :upload ] ] + ] end test "common keyword" do - binary = - ConfigDB.transform([ - %{"tuple" => [":level", ":warn"]}, - %{"tuple" => [":meta", [":all"]]}, - %{"tuple" => [":path", ""]}, - %{"tuple" => [":val", nil]}, - %{"tuple" => [":webhook_url", "https://hooks.slack.com/services/YOUR-KEY-HERE"]} - ]) - - assert binary == - :erlang.term_to_binary( - level: :warn, - meta: [:all], - path: "", - val: nil, - webhook_url: "https://hooks.slack.com/services/YOUR-KEY-HERE" - ) - - assert ConfigDB.from_binary(binary) == [ + assert ConfigDB.to_elixir_types([ + %{"tuple" => [":level", ":warn"]}, + %{"tuple" => [":meta", [":all"]]}, + %{"tuple" => [":path", ""]}, + %{"tuple" => [":val", nil]}, + %{"tuple" => [":webhook_url", "https://hooks.slack.com/services/YOUR-KEY-HERE"]} + ]) == [ level: :warn, meta: [:all], path: "", @@ -601,98 +461,73 @@ test "common keyword" do end test "complex keyword with sigil" do - binary = - ConfigDB.transform([ - %{"tuple" => [":federated_timeline_removal", []]}, - %{"tuple" => [":reject", ["~r/comp[lL][aA][iI][nN]er/"]]}, - %{"tuple" => [":replace", []]} - ]) - - assert binary == - :erlang.term_to_binary( - federated_timeline_removal: [], - reject: [~r/comp[lL][aA][iI][nN]er/], - replace: [] - ) - - assert ConfigDB.from_binary(binary) == - [federated_timeline_removal: [], reject: [~r/comp[lL][aA][iI][nN]er/], replace: []] + assert ConfigDB.to_elixir_types([ + %{"tuple" => [":federated_timeline_removal", []]}, + %{"tuple" => [":reject", ["~r/comp[lL][aA][iI][nN]er/"]]}, + %{"tuple" => [":replace", []]} + ]) == [ + federated_timeline_removal: [], + reject: [~r/comp[lL][aA][iI][nN]er/], + replace: [] + ] end test "complex keyword with tuples with more than 2 values" do - binary = - ConfigDB.transform([ - %{ - "tuple" => [ - ":http", - [ - %{ - "tuple" => [ - ":key1", - [ - %{ - "tuple" => [ - ":_", - [ - %{ - "tuple" => [ - "/api/v1/streaming", - "Pleroma.Web.MastodonAPI.WebsocketHandler", - [] - ] - }, - %{ - "tuple" => [ - "/websocket", - "Phoenix.Endpoint.CowboyWebSocket", - %{ - "tuple" => [ - "Phoenix.Transports.WebSocket", - %{ - "tuple" => [ - "Pleroma.Web.Endpoint", - "Pleroma.Web.UserSocket", - [] - ] - } - ] - } - ] - }, - %{ - "tuple" => [ - ":_", - "Phoenix.Endpoint.Cowboy2Handler", - %{"tuple" => ["Pleroma.Web.Endpoint", []]} - ] - } - ] - ] - } - ] - ] - } - ] - ] - } - ]) - - assert binary == - :erlang.term_to_binary( - http: [ - key1: [ - _: [ - {"/api/v1/streaming", Pleroma.Web.MastodonAPI.WebsocketHandler, []}, - {"/websocket", Phoenix.Endpoint.CowboyWebSocket, - {Phoenix.Transports.WebSocket, - {Pleroma.Web.Endpoint, Pleroma.Web.UserSocket, []}}}, - {:_, Phoenix.Endpoint.Cowboy2Handler, {Pleroma.Web.Endpoint, []}} - ] + assert ConfigDB.to_elixir_types([ + %{ + "tuple" => [ + ":http", + [ + %{ + "tuple" => [ + ":key1", + [ + %{ + "tuple" => [ + ":_", + [ + %{ + "tuple" => [ + "/api/v1/streaming", + "Pleroma.Web.MastodonAPI.WebsocketHandler", + [] + ] + }, + %{ + "tuple" => [ + "/websocket", + "Phoenix.Endpoint.CowboyWebSocket", + %{ + "tuple" => [ + "Phoenix.Transports.WebSocket", + %{ + "tuple" => [ + "Pleroma.Web.Endpoint", + "Pleroma.Web.UserSocket", + [] + ] + } + ] + } + ] + }, + %{ + "tuple" => [ + ":_", + "Phoenix.Endpoint.Cowboy2Handler", + %{"tuple" => ["Pleroma.Web.Endpoint", []]} + ] + } + ] + ] + } + ] + ] + } ] ] - ) - - assert ConfigDB.from_binary(binary) == [ + } + ]) == [ http: [ key1: [ {:_, diff --git a/test/config/deprecation_warnings_test.exs b/test/config/deprecation_warnings_test.exs new file mode 100644 index 000000000..e22052404 --- /dev/null +++ b/test/config/deprecation_warnings_test.exs @@ -0,0 +1,112 @@ +defmodule Pleroma.Config.DeprecationWarningsTest do + use ExUnit.Case, async: true + use Pleroma.Tests.Helpers + + import ExUnit.CaptureLog + + alias Pleroma.Config + alias Pleroma.Config.DeprecationWarnings + + test "check_old_mrf_config/0" do + clear_config([:instance, :rewrite_policy], Pleroma.Web.ActivityPub.MRF.NoOpPolicy) + clear_config([:instance, :mrf_transparency], true) + clear_config([:instance, :mrf_transparency_exclusions], []) + + assert capture_log(fn -> DeprecationWarnings.check_old_mrf_config() end) =~ + """ + !!!DEPRECATION WARNING!!! + Your config is using old namespaces for MRF configuration. They should work for now, but you are advised to change to new namespaces to prevent possible issues later: + + * `config :pleroma, :instance, rewrite_policy` is now `config :pleroma, :mrf, policies` + * `config :pleroma, :instance, mrf_transparency` is now `config :pleroma, :mrf, transparency` + * `config :pleroma, :instance, mrf_transparency_exclusions` is now `config :pleroma, :mrf, transparency_exclusions` + """ + end + + test "move_namespace_and_warn/2" do + old_group1 = [:group, :key] + old_group2 = [:group, :key2] + old_group3 = [:group, :key3] + + new_group1 = [:another_group, :key4] + new_group2 = [:another_group, :key5] + new_group3 = [:another_group, :key6] + + clear_config(old_group1, 1) + clear_config(old_group2, 2) + clear_config(old_group3, 3) + + clear_config(new_group1) + clear_config(new_group2) + clear_config(new_group3) + + config_map = [ + {old_group1, new_group1, "\n error :key"}, + {old_group2, new_group2, "\n error :key2"}, + {old_group3, new_group3, "\n error :key3"} + ] + + assert capture_log(fn -> + DeprecationWarnings.move_namespace_and_warn( + config_map, + "Warning preface" + ) + end) =~ "Warning preface\n error :key\n error :key2\n error :key3" + + assert Config.get(new_group1) == 1 + assert Config.get(new_group2) == 2 + assert Config.get(new_group3) == 3 + end + + test "check_media_proxy_whitelist_config/0" do + clear_config([:media_proxy, :whitelist], ["https://example.com", "example2.com"]) + + assert capture_log(fn -> + DeprecationWarnings.check_media_proxy_whitelist_config() + end) =~ "Your config is using old format (only domain) for MediaProxy whitelist option" + end + + describe "check_gun_pool_options/0" do + test "await_up_timeout" do + config = Config.get(:connections_pool) + clear_config(:connections_pool, Keyword.put(config, :await_up_timeout, 5_000)) + + assert capture_log(fn -> + DeprecationWarnings.check_gun_pool_options() + end) =~ + "Your config is using old setting name `await_up_timeout` instead of `connect_timeout`" + end + + test "pool timeout" do + old_config = [ + federation: [ + size: 50, + max_waiting: 10, + timeout: 10_000 + ], + media: [ + size: 50, + max_waiting: 10, + timeout: 10_000 + ], + upload: [ + size: 25, + max_waiting: 5, + timeout: 15_000 + ], + default: [ + size: 10, + max_waiting: 2, + timeout: 5_000 + ] + ] + + clear_config(:pools, old_config) + + assert capture_log(fn -> + DeprecationWarnings.check_gun_pool_options() + end) =~ + "Your config is using old setting name `timeout` instead of `recv_timeout` in pool settings" + end + end +end diff --git a/test/config/holder_test.exs b/test/config/holder_test.exs index 15d48b5c7..abcaa27dd 100644 --- a/test/config/holder_test.exs +++ b/test/config/holder_test.exs @@ -10,7 +10,6 @@ defmodule Pleroma.Config.HolderTest do test "default_config/0" do config = Holder.default_config() assert config[:pleroma][Pleroma.Uploaders.Local][:uploads] == "test/uploads" - assert config[:tesla][:adapter] == Tesla.Mock refute config[:pleroma][Pleroma.Repo] refute config[:pleroma][Pleroma.Web.Endpoint] @@ -18,17 +17,15 @@ test "default_config/0" do refute config[:pleroma][:configurable_from_database] refute config[:pleroma][:database] refute config[:phoenix][:serve_endpoints] + refute config[:tesla][:adapter] end test "default_config/1" do pleroma_config = Holder.default_config(:pleroma) assert pleroma_config[Pleroma.Uploaders.Local][:uploads] == "test/uploads" - tesla_config = Holder.default_config(:tesla) - assert tesla_config[:adapter] == Tesla.Mock end test "default_config/2" do assert Holder.default_config(:pleroma, Pleroma.Uploaders.Local) == [uploads: "test/uploads"] - assert Holder.default_config(:tesla, :adapter) == Tesla.Mock end end diff --git a/test/config/transfer_task_test.exs b/test/config/transfer_task_test.exs index 473899d1d..f53829e09 100644 --- a/test/config/transfer_task_test.exs +++ b/test/config/transfer_task_test.exs @@ -6,9 +6,9 @@ defmodule Pleroma.Config.TransferTaskTest do use Pleroma.DataCase import ExUnit.CaptureLog + import Pleroma.Factory alias Pleroma.Config.TransferTask - alias Pleroma.ConfigDB setup do: clear_config(:configurable_from_database, true) @@ -19,31 +19,11 @@ test "transfer config values from db to env" do refute Application.get_env(:postgrex, :test_key) initial = Application.get_env(:logger, :level) - ConfigDB.create(%{ - group: ":pleroma", - key: ":test_key", - value: [live: 2, com: 3] - }) - - ConfigDB.create(%{ - group: ":idna", - key: ":test_key", - value: [live: 15, com: 35] - }) - - ConfigDB.create(%{ - group: ":quack", - key: ":test_key", - value: [:test_value1, :test_value2] - }) - - ConfigDB.create(%{ - group: ":postgrex", - key: ":test_key", - value: :value - }) - - ConfigDB.create(%{group: ":logger", key: ":level", value: :debug}) + insert(:config, key: :test_key, value: [live: 2, com: 3]) + insert(:config, group: :idna, key: :test_key, value: [live: 15, com: 35]) + insert(:config, group: :quack, key: :test_key, value: [:test_value1, :test_value2]) + insert(:config, group: :postgrex, key: :test_key, value: :value) + insert(:config, group: :logger, key: :level, value: :debug) TransferTask.start_link([]) @@ -66,17 +46,8 @@ test "transfer config values for 1 group and some keys" do level = Application.get_env(:quack, :level) meta = Application.get_env(:quack, :meta) - ConfigDB.create(%{ - group: ":quack", - key: ":level", - value: :info - }) - - ConfigDB.create(%{ - group: ":quack", - key: ":meta", - value: [:none] - }) + insert(:config, group: :quack, key: :level, value: :info) + insert(:config, group: :quack, key: :meta, value: [:none]) TransferTask.start_link([]) @@ -95,17 +66,8 @@ test "transfer config values with full subkey update" do clear_config(:emoji) clear_config(:assets) - ConfigDB.create(%{ - group: ":pleroma", - key: ":emoji", - value: [groups: [a: 1, b: 2]] - }) - - ConfigDB.create(%{ - group: ":pleroma", - key: ":assets", - value: [mascots: [a: 1, b: 2]] - }) + insert(:config, key: :emoji, value: [groups: [a: 1, b: 2]]) + insert(:config, key: :assets, value: [mascots: [a: 1, b: 2]]) TransferTask.start_link([]) @@ -122,12 +84,7 @@ test "transfer config values with full subkey update" do test "don't restart if no reboot time settings were changed" do clear_config(:emoji) - - ConfigDB.create(%{ - group: ":pleroma", - key: ":emoji", - value: [groups: [a: 1, b: 2]] - }) + insert(:config, key: :emoji, value: [groups: [a: 1, b: 2]]) refute String.contains?( capture_log(fn -> TransferTask.start_link([]) end), @@ -137,25 +94,13 @@ test "don't restart if no reboot time settings were changed" do test "on reboot time key" do clear_config(:chat) - - ConfigDB.create(%{ - group: ":pleroma", - key: ":chat", - value: [enabled: false] - }) - + insert(:config, key: :chat, value: [enabled: false]) assert capture_log(fn -> TransferTask.start_link([]) end) =~ "pleroma restarted" end test "on reboot time subkey" do clear_config(Pleroma.Captcha) - - ConfigDB.create(%{ - group: ":pleroma", - key: "Pleroma.Captcha", - value: [seconds_valid: 60] - }) - + insert(:config, key: Pleroma.Captcha, value: [seconds_valid: 60]) assert capture_log(fn -> TransferTask.start_link([]) end) =~ "pleroma restarted" end @@ -163,17 +108,8 @@ test "don't restart pleroma on reboot time key and subkey if there is false flag clear_config(:chat) clear_config(Pleroma.Captcha) - ConfigDB.create(%{ - group: ":pleroma", - key: ":chat", - value: [enabled: false] - }) - - ConfigDB.create(%{ - group: ":pleroma", - key: "Pleroma.Captcha", - value: [seconds_valid: 60] - }) + insert(:config, key: :chat, value: [enabled: false]) + insert(:config, key: Pleroma.Captcha, value: [seconds_valid: 60]) refute String.contains?( capture_log(fn -> TransferTask.load_and_update_env([], false) end), diff --git a/test/config_test.exs b/test/config_test.exs index a46ab4302..1556e4237 100644 --- a/test/config_test.exs +++ b/test/config_test.exs @@ -28,6 +28,34 @@ test "get/1 with a list of keys" do assert Pleroma.Config.get([:azerty, :uiop], true) == true end + describe "nil values" do + setup do + Pleroma.Config.put(:lorem, nil) + Pleroma.Config.put(:ipsum, %{dolor: [sit: nil]}) + Pleroma.Config.put(:dolor, sit: %{amet: nil}) + + on_exit(fn -> Enum.each(~w(lorem ipsum dolor)a, &Pleroma.Config.delete/1) end) + end + + test "get/1 with an atom for nil value" do + assert Pleroma.Config.get(:lorem) == nil + end + + test "get/2 with an atom for nil value" do + assert Pleroma.Config.get(:lorem, true) == nil + end + + test "get/1 with a list of keys for nil value" do + assert Pleroma.Config.get([:ipsum, :dolor, :sit]) == nil + assert Pleroma.Config.get([:dolor, :sit, :amet]) == nil + end + + test "get/2 with a list of keys for nil value" do + assert Pleroma.Config.get([:ipsum, :dolor, :sit], true) == nil + assert Pleroma.Config.get([:dolor, :sit, :amet], true) == nil + end + end + test "get/1 when value is false" do Pleroma.Config.put([:instance, :false_test], false) Pleroma.Config.put([:instance, :nested], []) @@ -89,5 +117,23 @@ test "delete/2 with a list of keys" do Pleroma.Config.put([:delete_me, :delete_me], hello: "world", world: "Hello") Pleroma.Config.delete([:delete_me, :delete_me, :world]) assert Pleroma.Config.get([:delete_me, :delete_me]) == [hello: "world"] + + assert Pleroma.Config.delete([:this_key_does_not_exist]) + assert Pleroma.Config.delete([:non, :existing, :key]) + end + + test "fetch/1" do + Pleroma.Config.put([:lorem], :ipsum) + Pleroma.Config.put([:ipsum], dolor: :sit) + + assert Pleroma.Config.fetch([:lorem]) == {:ok, :ipsum} + assert Pleroma.Config.fetch(:lorem) == {:ok, :ipsum} + assert Pleroma.Config.fetch([:ipsum, :dolor]) == {:ok, :sit} + assert Pleroma.Config.fetch([:lorem, :ipsum]) == :error + assert Pleroma.Config.fetch([:loremipsum]) == :error + assert Pleroma.Config.fetch(:loremipsum) == :error + + Pleroma.Config.delete([:lorem]) + Pleroma.Config.delete([:ipsum]) end end diff --git a/test/docs/generator_test.exs b/test/docs/generator_test.exs index 9c9f4357b..b32918a69 100644 --- a/test/docs/generator_test.exs +++ b/test/docs/generator_test.exs @@ -13,21 +13,13 @@ defmodule Pleroma.Docs.GeneratorTest do key: :uploader, type: :module, description: "", - suggestions: - Generator.list_modules_in_dir( - "lib/pleroma/upload/filter", - "Elixir.Pleroma.Upload.Filter." - ) + suggestions: {:list_behaviour_implementations, Pleroma.Upload.Filter} }, %{ key: :filters, type: {:list, :module}, description: "", - suggestions: - Generator.list_modules_in_dir( - "lib/pleroma/web/activity_pub/mrf", - "Elixir.Pleroma.Web.ActivityPub.MRF." - ) + suggestions: {:list_behaviour_implementations, Pleroma.Web.ActivityPub.MRF} }, %{ key: Pleroma.Upload, diff --git a/test/emails/admin_email_test.exs b/test/emails/admin_email_test.exs index bc871a0a9..e24231e27 100644 --- a/test/emails/admin_email_test.exs +++ b/test/emails/admin_email_test.exs @@ -31,7 +31,7 @@ test "build report email" do account_url }\">#{account.nickname}

\n

Comment: Test comment\n

Statuses:\n

\n

\n\n" + }\">#{status_url}\n \n

\n\n

\nView Reports in AdminFE\n" end test "it works when the reporter is a remote user without email" do @@ -46,4 +46,24 @@ test "it works when the reporter is a remote user without email" do assert res.to == [{to_user.name, to_user.email}] assert res.from == {config[:name], config[:notify_email]} end + + test "new unapproved registration email" do + config = Pleroma.Config.get(:instance) + to_user = insert(:user) + account = insert(:user, registration_reason: "Plz let me in") + + res = AdminEmail.new_unapproved_registration(to_user, account) + + account_url = Helpers.user_feed_url(Pleroma.Web.Endpoint, :feed_redirect, account.id) + + assert res.to == [{to_user.name, to_user.email}] + assert res.from == {config[:name], config[:notify_email]} + assert res.subject == "New account up for review on #{config[:name]} (@#{account.nickname})" + + assert res.html_body == """ +

New account for review: @#{account.nickname}

+
Plz let me in
+ Visit AdminFE + """ + end end diff --git a/test/emails/mailer_test.exs b/test/emails/mailer_test.exs index e6e34cba8..9e232d2a0 100644 --- a/test/emails/mailer_test.exs +++ b/test/emails/mailer_test.exs @@ -14,11 +14,12 @@ defmodule Pleroma.Emails.MailerTest do subject: "Pleroma test email", to: [{"Test User", "user1@example.com"}] } - setup do: clear_config([Pleroma.Emails.Mailer, :enabled]) + setup do: clear_config([Pleroma.Emails.Mailer, :enabled], true) test "not send email when mailer is disabled" do - Pleroma.Config.put([Pleroma.Emails.Mailer, :enabled], false) + clear_config([Pleroma.Emails.Mailer, :enabled], false) Mailer.deliver(@email) + :timer.sleep(100) refute_email_sent( from: {"Pleroma", "noreply@example.com"}, @@ -30,6 +31,7 @@ test "not send email when mailer is disabled" do test "send email" do Mailer.deliver(@email) + :timer.sleep(100) assert_email_sent( from: {"Pleroma", "noreply@example.com"}, @@ -41,6 +43,7 @@ test "send email" do test "perform" do Mailer.perform(:deliver_async, @email, []) + :timer.sleep(100) assert_email_sent( from: {"Pleroma", "noreply@example.com"}, diff --git a/test/filter_test.exs b/test/filter_test.exs index 63a30c736..0a5c4426a 100644 --- a/test/filter_test.exs +++ b/test/filter_test.exs @@ -3,37 +3,39 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.FilterTest do - alias Pleroma.Repo use Pleroma.DataCase import Pleroma.Factory + alias Pleroma.Filter + alias Pleroma.Repo + describe "creating filters" do test "creating one filter" do user = insert(:user) - query = %Pleroma.Filter{ + query = %Filter{ user_id: user.id, filter_id: 42, phrase: "knights", context: ["home"] } - {:ok, %Pleroma.Filter{} = filter} = Pleroma.Filter.create(query) - result = Pleroma.Filter.get(filter.filter_id, user) + {:ok, %Filter{} = filter} = Filter.create(query) + result = Filter.get(filter.filter_id, user) assert query.phrase == result.phrase end test "creating one filter without a pre-defined filter_id" do user = insert(:user) - query = %Pleroma.Filter{ + query = %Filter{ user_id: user.id, phrase: "knights", context: ["home"] } - {:ok, %Pleroma.Filter{} = filter} = Pleroma.Filter.create(query) + {:ok, %Filter{} = filter} = Filter.create(query) # Should start at 1 assert filter.filter_id == 1 end @@ -41,23 +43,23 @@ test "creating one filter without a pre-defined filter_id" do test "creating additional filters uses previous highest filter_id + 1" do user = insert(:user) - query_one = %Pleroma.Filter{ + query_one = %Filter{ user_id: user.id, filter_id: 42, phrase: "knights", context: ["home"] } - {:ok, %Pleroma.Filter{} = filter_one} = Pleroma.Filter.create(query_one) + {:ok, %Filter{} = filter_one} = Filter.create(query_one) - query_two = %Pleroma.Filter{ + query_two = %Filter{ user_id: user.id, # No filter_id phrase: "who", context: ["home"] } - {:ok, %Pleroma.Filter{} = filter_two} = Pleroma.Filter.create(query_two) + {:ok, %Filter{} = filter_two} = Filter.create(query_two) assert filter_two.filter_id == filter_one.filter_id + 1 end @@ -65,29 +67,29 @@ test "filter_id is unique per user" do user_one = insert(:user) user_two = insert(:user) - query_one = %Pleroma.Filter{ + query_one = %Filter{ user_id: user_one.id, phrase: "knights", context: ["home"] } - {:ok, %Pleroma.Filter{} = filter_one} = Pleroma.Filter.create(query_one) + {:ok, %Filter{} = filter_one} = Filter.create(query_one) - query_two = %Pleroma.Filter{ + query_two = %Filter{ user_id: user_two.id, phrase: "who", context: ["home"] } - {:ok, %Pleroma.Filter{} = filter_two} = Pleroma.Filter.create(query_two) + {:ok, %Filter{} = filter_two} = Filter.create(query_two) assert filter_one.filter_id == 1 assert filter_two.filter_id == 1 - result_one = Pleroma.Filter.get(filter_one.filter_id, user_one) + result_one = Filter.get(filter_one.filter_id, user_one) assert result_one.phrase == filter_one.phrase - result_two = Pleroma.Filter.get(filter_two.filter_id, user_two) + result_two = Filter.get(filter_two.filter_id, user_two) assert result_two.phrase == filter_two.phrase end end @@ -95,38 +97,38 @@ test "filter_id is unique per user" do test "deleting a filter" do user = insert(:user) - query = %Pleroma.Filter{ + query = %Filter{ user_id: user.id, filter_id: 0, phrase: "knights", context: ["home"] } - {:ok, _filter} = Pleroma.Filter.create(query) - {:ok, filter} = Pleroma.Filter.delete(query) - assert is_nil(Repo.get(Pleroma.Filter, filter.filter_id)) + {:ok, _filter} = Filter.create(query) + {:ok, filter} = Filter.delete(query) + assert is_nil(Repo.get(Filter, filter.filter_id)) end test "getting all filters by an user" do user = insert(:user) - query_one = %Pleroma.Filter{ + query_one = %Filter{ user_id: user.id, filter_id: 1, phrase: "knights", context: ["home"] } - query_two = %Pleroma.Filter{ + query_two = %Filter{ user_id: user.id, filter_id: 2, phrase: "who", context: ["home"] } - {:ok, filter_one} = Pleroma.Filter.create(query_one) - {:ok, filter_two} = Pleroma.Filter.create(query_two) - filters = Pleroma.Filter.get_filters(user) + {:ok, filter_one} = Filter.create(query_one) + {:ok, filter_two} = Filter.create(query_two) + filters = Filter.get_filters(user) assert filter_one in filters assert filter_two in filters end @@ -134,7 +136,7 @@ test "getting all filters by an user" do test "updating a filter" do user = insert(:user) - query_one = %Pleroma.Filter{ + query_one = %Filter{ user_id: user.id, filter_id: 1, phrase: "knights", @@ -146,8 +148,9 @@ test "updating a filter" do context: ["home", "timeline"] } - {:ok, filter_one} = Pleroma.Filter.create(query_one) - {:ok, filter_two} = Pleroma.Filter.update(filter_one, changes) + {:ok, filter_one} = Filter.create(query_one) + {:ok, filter_two} = Filter.update(filter_one, changes) + assert filter_one != filter_two assert filter_two.phrase == changes.phrase assert filter_two.context == changes.context diff --git a/test/fixtures/23211.atom b/test/fixtures/23211.atom deleted file mode 100644 index d5d111baa..000000000 --- a/test/fixtures/23211.atom +++ /dev/null @@ -1,508 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-02T14:59:30+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2015260:2017-05-02T14:45:47+00:00 - Favorite - lambadalambda favorited something by godemperorofdune: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> It's because your instance decided to be trap! lol.</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T14:45:47+00:00 - 2017-05-02T14:45:47+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:pawoo.net,2017-05-02:objectId=7397439:objectType=Status - New comment by godemperorofdune - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> It's because your instance decided to be trap! lol.</p> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=136e244b26cdf1e9 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-05-02:noticeId=2015221:objectType=note - New note by lambadalambda - Some script thinks I'm a mastodon server.<br /> <br /> [info] GET /api/v1/timelines/public<br /> [debug] Processing with Fallback.RedirectController.redirector/2<br /> Parameters: %{&quot;limit&quot; =&gt; &quot;40&quot;, &quot;path&quot; =&gt; [&quot;api&quot;, &quot;v1&quot;, &quot;timelines&quot;, &quot;public&quot;]}<br /> Pipelines: [] - - - http://activitystrea.ms/schema/1.0/post - 2017-05-02T14:40:50+00:00 - 2017-05-02T14:40:50+00:00 - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=136e244b26cdf1e9 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-02:noticeId=2014759:objectType=comment - New comment by lambadalambda - @<a href="https://mstdn.io/users/mattskala" class="h-card u-url p-nickname mention" title="Matthew Skala">mattskala</a> You and @<a href="https://mastodon.social/users/kevinmarks" class="h-card u-url p-nickname mention" title="Kevin Marks">kevinmarks</a> are not wrong, but my comment was a suggestion to users and admins: Don't use big instances, don't run big instances. Also, it's a secondary advice to devs: Don't add features that encourage big instances. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-02T14:11:54+00:00 - 2017-05-02T14:11:54+00:00 - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=58e32e013ab6487d - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-02:noticeId=2014684:objectType=comment - New comment by lambadalambda - @<a href="https://mastodon.social/users/Ronkjeffries" class="h-card u-url p-nickname mention" title="Ron K Jeffries social">ronkjeffries</a> @<a href="https://xoxo.zone/users/KevinMarks" class="h-card u-url p-nickname mention" title="Kevin Marks ">kevinmarks</a> Usually people who run their own private instance just look at the timelines of other servers, follow a seed population and then go from there. This is of course hard on Mastodon, because it doesn't have a publicly visible timeline. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-02T14:07:00+00:00 - 2017-05-02T14:07:00+00:00 - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=58e32e013ab6487d - - - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2014584:2017-05-02T14:05:32+00:00 - Favorite - lambadalambda favorited something by mattskala: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> It's reasonable to expect that instance sizes will obey a power-law distribution because that's what such things in nature nearly always do. If so, there'll necessarily be a few instances much larger than the others; even if most are small, the network both socially and technically has to be able to deal with the existence of the few large ones.</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T14:05:32+00:00 - 2017-05-02T14:05:32+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:mstdn.io,2017-05-02:objectId=1316931:objectType=Status - New comment by mattskala - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> It's reasonable to expect that instance sizes will obey a power-law distribution because that's what such things in nature nearly always do. If so, there'll necessarily be a few instances much larger than the others; even if most are small, the network both socially and technically has to be able to deal with the existence of the few large ones.</p> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=58e32e013ab6487d - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2013568:2017-05-02T14:05:29+00:00 - Favorite - lambadalambda favorited something by kevinmarks: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> except instance populations will be power law distributed, and the problems for the tummlers are worse at scale</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T14:05:29+00:00 - 2017-05-02T14:05:29+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:xoxo.zone,2017-05-02:objectId=89478:objectType=Status - New comment by kevinmarks - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> except instance populations will be power law distributed, and the problems for the tummlers are worse at scale</p> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=58e32e013ab6487d - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2014060:2017-05-02T13:34:32+00:00 - Favorite - lambadalambda favorited something by gcarregues: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> Oh purée ! Ma vie en images !</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T13:34:32+00:00 - 2017-05-02T13:34:32+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:mastodon.etalab.gouv.fr,2017-05-02:objectId=55287:objectType=Status - New comment by gcarregues - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> Oh purée ! Ma vie en images !</p> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=2c27c27df8ec4dcc - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:note:2013573:2017-05-02T13:03:33+00:00 - Favorite - lambadalambda favorited something by phildobangnz: also @<a href="https://sealion.club/user/579" class="h-card mention" title="Sim Bot">sim</a> reminder you are awesome; don't even trip- u kewler than Tutankhamen's cucumber, fam. Okay, good night. - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T13:03:33+00:00 - 2017-05-02T13:03:33+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:sealion.club,2017-05-02:noticeId=3060818:objectType=note - New note by phildobangnz - also @<a href="https://sealion.club/user/579" class="h-card mention" title="Sim Bot">sim</a> reminder you are awesome; don't even trip- u kewler than Tutankhamen's cucumber, fam. Okay, good night. - - - - - - - https://sealion.club/conversation/1633267 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-02:noticeId=2013586:objectType=comment - New comment by lambadalambda - @<a href="https://xoxo.zone/users/KevinMarks" class="h-card u-url p-nickname mention" title="Kevin Marks ">kevinmarks</a> People can stay in their giant unmoderatable instances with meaningless public and federated timelines and experience constant federation drama if they want. I'll stay here with my 5 friends. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-02T12:54:59+00:00 - 2017-05-02T12:54:59+00:00 - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=58e32e013ab6487d - - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:note:2013486:2017-05-02T12:46:48+00:00 - Favorite - lambadalambda favorited something by fortune: There once was a dentist named Stone<br /> Who saw all his patients alone.<br /> In a fit of depravity<br /> He filled the wrong cavity,<br /> And my, how his practice has grown! - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T12:46:48+00:00 - 2017-05-02T12:46:48+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:gs.kawa-kun.com,2017-05-02:noticeId=1655658:objectType=note - New note by fortune - There once was a dentist named Stone<br /> Who saw all his patients alone.<br /> In a fit of depravity<br /> He filled the wrong cavity,<br /> And my, how his practice has grown! - - - - - - - https://gs.kawa-kun.com/conversation/714072 - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:note:2013365:2017-05-02T12:37:55+00:00 - Favorite - lambadalambda favorited something by xj9: <p>&gt; rollerblading to work</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T12:37:55+00:00 - 2017-05-02T12:37:55+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:sunshinegardens.org,2017-05-02:objectId=61020:objectType=Status - New note by xj9 - <p>&gt; rollerblading to work</p> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=5a0e98612f634218 - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2013259:2017-05-02T12:29:03+00:00 - Favorite - lambadalambda favorited something by cereal: @<a href="https://gs.smuglo.li/user/28250" class="h-card mention" title="Bricky">thatbrickster</a> @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> But why? - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T12:29:03+00:00 - 2017-05-02T12:29:03+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:sealion.club,2017-05-02:noticeId=3059985:objectType=comment - New comment by cereal - @<a href="https://gs.smuglo.li/user/28250" class="h-card mention" title="Bricky">thatbrickster</a> @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> But why? - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=2c27c27df8ec4dcc - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2013227:2017-05-02T12:24:27+00:00 - Favorite - lambadalambda favorited something by thatbrickster: @<a href="https://social.heldscal.la/user/23211" class="h-card u-url p-nickname mention" title="Constance Variable">lambadalambda</a> install gentoo - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T12:24:27+00:00 - 2017-05-02T12:24:27+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:gs.smuglo.li,2017-05-02:noticeId=2144296:objectType=comment - New comment by thatbrickster - @<a href="https://social.heldscal.la/user/23211" class="h-card u-url p-nickname mention" title="Constance Variable">lambadalambda</a> install gentoo - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=2c27c27df8ec4dcc - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2013213:2017-05-02T12:22:53+00:00 - Favorite - lambadalambda favorited something by dwmatiz: @<a href="https://social.heldscal.la/user/23211" class="h-card mention">lambadalambda</a> *unzips dick* - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T12:22:53+00:00 - 2017-05-02T12:22:53+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:sealion.club,2017-05-02:noticeId=3059800:objectType=comment - New comment by dwmatiz - @<a href="https://social.heldscal.la/user/23211" class="h-card mention">lambadalambda</a> *unzips dick* - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=2c27c27df8ec4dcc - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2013199:2017-05-02T12:22:03+00:00 - Favorite - lambadalambda favorited something by shpuld: @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> get #<span class="tag"><a href="https://shitposter.club/tag/cofe" rel="tag">cofe</a></span> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T12:22:03+00:00 - 2017-05-02T12:22:03+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-02:noticeId=2783524:objectType=comment - New comment by shpuld - @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> get #<span class="tag"><a href="https://shitposter.club/tag/cofe" rel="tag">cofe</a></span> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=2c27c27df8ec4dcc - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-05-02:noticeId=2013185:objectType=note - New note by lambadalambda - What now? <a href="https://social.heldscal.la/file/e4822d95de677757ff50d49672a4046c83218b76c04a0ad5e5f1f0a9a9eb1a74.gif" title="https://social.heldscal.la/file/e4822d95de677757ff50d49672a4046c83218b76c04a0ad5e5f1f0a9a9eb1a74.gif" rel="nofollow external noreferrer" class="attachment" id="attachment-422572">https://social.heldscal.la/attachment/422572</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-02T12:21:04+00:00 - 2017-05-02T12:21:04+00:00 - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=2c27c27df8ec4dcc - - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:note:2012929:2017-05-02T12:01:25+00:00 - Favorite - lambadalambda favorited something by drkmttr: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> I checked out No Agenda because I saw you mention it several time. Sadly, I wasn't impressed. I'm all about varying perspectives but Adam and John basically just sound like resentful curmudgeons. It seems like their shtick is basically playing devil's advocate to everything to arouse some discontent. Just my two cents. 😉</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T12:01:25+00:00 - 2017-05-02T12:01:25+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:mstdn.io,2017-05-02:objectId=1310093:objectType=Status - New note by drkmttr - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> I checked out No Agenda because I saw you mention it several time. Sadly, I wasn't impressed. I'm all about varying perspectives but Adam and John basically just sound like resentful curmudgeons. It seems like their shtick is basically playing devil's advocate to everything to arouse some discontent. Just my two cents. 😉</p> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=2f329b4eb20e83e2 - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2012336:2017-05-02T11:06:42+00:00 - Favorite - lambadalambda favorited something by clacke: @<a href="https://mastodon.org.uk/users/dick_turpin" class="h-card u-url p-nickname mention" title="dick_turpin">dickturpin</a> @<a href="http://quitter.se/user/113503" class="h-card u-url p-nickname mention" title="Luke">luke</a> Oh no, I miss being irritated by you, it helps me understand myself and others. Also it builds character. :-)<br /> <br /> So if this is not federation because you can't follow all of online mankind, what should we call it? Proto-federated? Pre-federated?<br /> <br /> The term has been used decades ago for just one Microsoft Active Directory domain cross-certifying the root of another, by mutual agreement. I don't see how it's any less relevant to opportunistic federation between open servers on an open internet.<br /> <br /> I'm not saying we should be satisfied, I'm just saying that "federate" is a useful word and to build a big system we need to start with a small one. And focus on the things we *can* change, like helping the OStatus network grow and making the tools more useful.<br /> <br /> Saying that the network's ideals have failed because other networks aren't joining is doing neither of that. - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T11:06:42+00:00 - 2017-05-02T11:06:42+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-02:noticeId=2012336:objectType=comment - New comment by clacke - @<a href="https://mastodon.org.uk/users/dick_turpin" class="h-card u-url p-nickname mention" title="dick_turpin">dickturpin</a> @<a href="http://quitter.se/user/113503" class="h-card u-url p-nickname mention" title="Luke">luke</a> Oh no, I miss being irritated by you, it helps me understand myself and others. Also it builds character. :-)<br /> <br /> So if this is not federation because you can't follow all of online mankind, what should we call it? Proto-federated? Pre-federated?<br /> <br /> The term has been used decades ago for just one Microsoft Active Directory domain cross-certifying the root of another, by mutual agreement. I don't see how it's any less relevant to opportunistic federation between open servers on an open internet.<br /> <br /> I'm not saying we should be satisfied, I'm just saying that &quot;federate&quot; is a useful word and to build a big system we need to start with a small one. And focus on the things we *can* change, like helping the OStatus network grow and making the tools more useful.<br /> <br /> Saying that the network's ideals have failed because other networks aren't joining is doing neither of that. - - - - - - - https://s.wefamlee.be/conversation/16478 - - - - - - - tag:social.heldscal.la,2017-05-02:fave:23211:comment:2011332:2017-05-02T10:37:40+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> <a href="https://www.youtube.com/watch?v=mKLizztikRk" title="https://www.youtube.com/watch?v=mKLizztikRk" class="attachment" rel="nofollow">https://www.youtube.com/watch?v=mKLizztikRk</a> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-02T10:37:40+00:00 - 2017-05-02T10:37:40+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-02:noticeId=2781833:objectType=comment - New comment by moonman - @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> <a href="https://www.youtube.com/watch?v=mKLizztikRk" title="https://www.youtube.com/watch?v=mKLizztikRk" class="attachment" rel="nofollow">https://www.youtube.com/watch?v=mKLizztikRk</a> - - - - - - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=11d8b8c27d9513ec - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-02:noticeId=2012145:objectType=comment - New comment by lambadalambda - @<a href="https://sealion.club/user/186" class="h-card u-url p-nickname mention" title="I'M CEREAL U GUISE">cereal</a> ? No, you don't even need the identity servers for federation. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-02T10:37:33+00:00 - 2017-05-02T10:37:33+00:00 - - - - https://sealion.club/conversation/1629037 - - - - - - - diff --git a/test/fixtures/DSCN0010.jpg b/test/fixtures/DSCN0010.jpg new file mode 100644 index 000000000..4a2c1552b Binary files /dev/null and b/test/fixtures/DSCN0010.jpg differ diff --git a/test/fixtures/config/temp.secret.exs b/test/fixtures/config/temp.secret.exs index dc950ca30..fa8c7c7e8 100644 --- a/test/fixtures/config/temp.secret.exs +++ b/test/fixtures/config/temp.secret.exs @@ -9,3 +9,5 @@ config :pleroma, Pleroma.Repo, pool: Ecto.Adapters.SQL.Sandbox config :postgrex, :json_library, Poison + +config :pleroma, :database, rum_enabled: true diff --git a/test/fixtures/cw_retweet.xml b/test/fixtures/cw_retweet.xml deleted file mode 100644 index c99a569d7..000000000 --- a/test/fixtures/cw_retweet.xml +++ /dev/null @@ -1,68 +0,0 @@ - - - https://mastodon.social/users/lambadalambda.atom - Critical Value - - 2017-04-16T21:47:25Z - https://files.mastodon.social/accounts/avatars/000/000/264/original/1429214160519.gif - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - - lambadalambda - Critical Value - public - - - - - - - tag:mastodon.social,2017-05-11:objectId=5647963:objectType=Status - 2017-05-11T10:23:15Z - 2017-05-11T10:23:15Z - lambadalambda shared a status by Skruyb@mamot.fr - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:mamot.fr,2017-05-10:objectId=1294943:objectType=Status - 2017-05-10T17:31:44Z - 2017-05-10T17:31:45Z - New status by Skruyb@mamot.fr - - https://mamot.fr/users/Skruyb - http://activitystrea.ms/schema/1.0/person - https://mamot.fr/users/Skruyb - Skruyb - Skruyb@mamot.fr - <p>Fr and En.<br>Posts will disappear on a regular basis.</p> - - - - Skruyb - The 7th Son - Fr and En.Posts will disappear on a regular basis. - public - - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - Hey. - <p><span class="h-card"><a href="https://mastodon.social/@lambadalambda">@<span>lambadalambda</span></a></span></p><p>Hey!!!</p> - - - public - - - - <p><span class="h-card"><a href="https://mastodon.social/@lambadalambda">@<span>lambadalambda</span></a></span></p><p>Hey!!!</p> - - public - - - - diff --git a/test/fixtures/delete.xml b/test/fixtures/delete.xml deleted file mode 100644 index 731e1c204..000000000 --- a/test/fixtures/delete.xml +++ /dev/null @@ -1,39 +0,0 @@ - - - https://mastodon.sdf.org/users/snowdusk.atom - snowdusk - Amateur live performance DJ/radio DJ on SDF's underground Internet radio http://aNONradio.net (LIVE Sat Sun Mon Tue 23:00-24:00 UTC) - http://snowdusk.sdf.org - 2017-06-17T04:14:34Z - https://mastodon.sdf.org/system/accounts/avatars/000/000/002/original/405a7652d5f60449.jpg?1497672873 - - https://mastodon.sdf.org/users/snowdusk - http://activitystrea.ms/schema/1.0/person - https://mastodon.sdf.org/users/snowdusk - snowdusk - snowdusk@mastodon.sdf.org - <p>Amateur live performance DJ/radio DJ on SDF&apos;s underground Internet radio <a href="http://anonradio.net/" rel="nofollow noopener" target="_blank"><span class="invisible">http://</span><span class="">anonradio.net/</span><span class="invisible"></span></a> (LIVE Sat Sun Mon Tue 23:00-24:00 UTC) - <a href="http://snowdusk.sdf.org/" rel="nofollow noopener" target="_blank"><span class="invisible">http://</span><span class="">snowdusk.sdf.org/</span><span class="invisible"></span></a></p> - - - - snowdusk - snowdusk - Amateur live performance DJ/radio DJ on SDF's underground Internet radio http://aNONradio.net (LIVE Sat Sun Mon Tue 23:00-24:00 UTC) - http://snowdusk.sdf.org - public - - - - - - - - tag:mastodon.sdf.org,2017-06-10:objectId=310513:objectType=Status - 2017-06-10T22:02:31Z - 2017-06-10T22:02:31Z - snowdusk deleted status - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/delete - Deleted status - - - - diff --git a/test/fixtures/dm.xml b/test/fixtures/dm.xml deleted file mode 100644 index d0b8aa811..000000000 --- a/test/fixtures/dm.xml +++ /dev/null @@ -1,27 +0,0 @@ - - - tag:mastodon.social,2017-06-30:objectId=11260427:objectType=Status - 2017-06-30T13:27:47Z - 2017-06-30T13:27:47Z - New status by lambadalambda - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - lambadalambda - Critical Value - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> Hey.</p> - - direct - - - - diff --git a/test/fixtures/favorite.xml b/test/fixtures/favorite.xml deleted file mode 100644 index c32b4a403..000000000 --- a/test/fixtures/favorite.xml +++ /dev/null @@ -1,65 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-05T09:12:53+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061643:2017-05-05T09:12:50+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T09:12:50+00:00 - 2017-05-05T09:12:50+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=55ead90125cd4bd4 - - - - - - diff --git a/test/fixtures/favorite_with_local_note.xml b/test/fixtures/favorite_with_local_note.xml deleted file mode 100644 index 3c955607d..000000000 --- a/test/fixtures/favorite_with_local_note.xml +++ /dev/null @@ -1,64 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-05T09:12:53+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061643:2017-05-05T09:12:50+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T09:12:50+00:00 - 2017-05-05T09:12:50+00:00 - - http://activitystrea.ms/schema/1.0/comment - localid - New comment by moonman - @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=55ead90125cd4bd4 - - - - - - diff --git a/test/fixtures/fetch_mocks/104410921027210069.json b/test/fixtures/fetch_mocks/104410921027210069.json new file mode 100644 index 000000000..583f7a4dc --- /dev/null +++ b/test/fixtures/fetch_mocks/104410921027210069.json @@ -0,0 +1,72 @@ +{ + "@context" : [ + "https://www.w3.org/ns/activitystreams", + { + "atomUri" : "ostatus:atomUri", + "conversation" : "ostatus:conversation", + "inReplyToAtomUri" : "ostatus:inReplyToAtomUri", + "ostatus" : "http://ostatus.org#", + "sensitive" : "as:sensitive", + "toot" : "http://joinmastodon.org/ns#", + "votersCount" : "toot:votersCount" + } + ], + "atomUri" : "https://busshi.moe/users/tuxcrafting/statuses/104410921027210069", + "attachment" : [], + "attributedTo" : "https://busshi.moe/users/tuxcrafting", + "cc" : [ + "https://busshi.moe/users/tuxcrafting/followers", + "https://stereophonic.space/users/fixpoint", + "https://blob.cat/users/blobyoumu", + "https://cawfee.club/users/grips", + "https://jaeger.website/users/igel" + ], + "content" : "

@fixpoint @blobyoumu @grips @igel there's a difference between not liking nukes and not liking nuclear power
nukes are pretty bad as are all WMDs in general but disliking nuclear power just indicates you are unable of thought

", + "contentMap" : { + "en" : "

@fixpoint @blobyoumu @grips @igel there's a difference between not liking nukes and not liking nuclear power
nukes are pretty bad as are all WMDs in general but disliking nuclear power just indicates you are unable of thought

" + }, + "conversation" : "https://cawfee.club/contexts/ad6c73d8-efc2-4e74-84ea-2dacf1a27a5e", + "id" : "https://busshi.moe/users/tuxcrafting/statuses/104410921027210069", + "inReplyTo" : "https://stereophonic.space/objects/02997b83-3ea7-4b63-94af-ef3aa2d4ed17", + "inReplyToAtomUri" : "https://stereophonic.space/objects/02997b83-3ea7-4b63-94af-ef3aa2d4ed17", + "published" : "2020-06-26T15:10:19Z", + "replies" : { + "first" : { + "items" : [], + "next" : "https://busshi.moe/users/tuxcrafting/statuses/104410921027210069/replies?only_other_accounts=true&page=true", + "partOf" : "https://busshi.moe/users/tuxcrafting/statuses/104410921027210069/replies", + "type" : "CollectionPage" + }, + "id" : "https://busshi.moe/users/tuxcrafting/statuses/104410921027210069/replies", + "type" : "Collection" + }, + "sensitive" : false, + "summary" : null, + "tag" : [ + { + "href" : "https://stereophonic.space/users/fixpoint", + "name" : "@fixpoint@stereophonic.space", + "type" : "Mention" + }, + { + "href" : "https://blob.cat/users/blobyoumu", + "name" : "@blobyoumu@blob.cat", + "type" : "Mention" + }, + { + "href" : "https://cawfee.club/users/grips", + "name" : "@grips@cawfee.club", + "type" : "Mention" + }, + { + "href" : "https://jaeger.website/users/igel", + "name" : "@igel@jaeger.website", + "type" : "Mention" + } + ], + "to" : [ + "https://www.w3.org/ns/activitystreams#Public" + ], + "type" : "Note", + "url" : "https://busshi.moe/@tuxcrafting/104410921027210069" +} diff --git a/test/fixtures/fetch_mocks/9wTkLEnuq47B25EehM.json b/test/fixtures/fetch_mocks/9wTkLEnuq47B25EehM.json new file mode 100644 index 000000000..0226b058a --- /dev/null +++ b/test/fixtures/fetch_mocks/9wTkLEnuq47B25EehM.json @@ -0,0 +1,59 @@ +{ + "@context" : [ + "https://www.w3.org/ns/activitystreams", + "https://social.sakamoto.gq/schemas/litepub-0.1.jsonld", + { + "@language" : "und" + } + ], + "actor" : "https://social.sakamoto.gq/users/eal", + "attachment" : [], + "attributedTo" : "https://social.sakamoto.gq/users/eal", + "cc" : [ + "https://social.sakamoto.gq/users/eal/followers" + ], + "content" : "@tuxcrafting @fixpoint @blobyoumu @grips @igel What's bad about nukes?", + "context" : "https://cawfee.club/contexts/ad6c73d8-efc2-4e74-84ea-2dacf1a27a5e", + "conversation" : "https://cawfee.club/contexts/ad6c73d8-efc2-4e74-84ea-2dacf1a27a5e", + "id" : "https://social.sakamoto.gq/objects/f20f2497-66d9-4a52-a2e1-1be2a39c32c1", + "inReplyTo" : "https://busshi.moe/users/tuxcrafting/statuses/104410921027210069", + "published" : "2020-06-26T15:20:15.975737Z", + "sensitive" : false, + "summary" : "", + "tag" : [ + { + "href" : "https://blob.cat/users/blobyoumu", + "name" : "@blobyoumu@blob.cat", + "type" : "Mention" + }, + { + "href" : "https://busshi.moe/users/tuxcrafting", + "name" : "@tuxcrafting@busshi.moe", + "type" : "Mention" + }, + { + "href" : "https://cawfee.club/users/grips", + "name" : "@grips@cawfee.club", + "type" : "Mention" + }, + { + "href" : "https://jaeger.website/users/igel", + "name" : "@igel@jaeger.website", + "type" : "Mention" + }, + { + "href" : "https://stereophonic.space/users/fixpoint", + "name" : "@fixpoint@stereophonic.space", + "type" : "Mention" + } + ], + "to" : [ + "https://busshi.moe/users/tuxcrafting", + "https://www.w3.org/ns/activitystreams#Public", + "https://blob.cat/users/blobyoumu", + "https://stereophonic.space/users/fixpoint", + "https://cawfee.club/users/grips", + "https://jaeger.website/users/igel" + ], + "type" : "Note" +} diff --git a/test/fixtures/fetch_mocks/eal.json b/test/fixtures/fetch_mocks/eal.json new file mode 100644 index 000000000..a605476e6 --- /dev/null +++ b/test/fixtures/fetch_mocks/eal.json @@ -0,0 +1,43 @@ +{ + "@context" : [ + "https://www.w3.org/ns/activitystreams", + "https://social.sakamoto.gq/schemas/litepub-0.1.jsonld", + { + "@language" : "und" + } + ], + "attachment" : [], + "discoverable" : true, + "endpoints" : { + "oauthAuthorizationEndpoint" : "https://social.sakamoto.gq/oauth/authorize", + "oauthRegistrationEndpoint" : "https://social.sakamoto.gq/api/v1/apps", + "oauthTokenEndpoint" : "https://social.sakamoto.gq/oauth/token", + "sharedInbox" : "https://social.sakamoto.gq/inbox", + "uploadMedia" : "https://social.sakamoto.gq/api/ap/upload_media" + }, + "followers" : "https://social.sakamoto.gq/users/eal/followers", + "following" : "https://social.sakamoto.gq/users/eal/following", + "icon" : { + "type" : "Image", + "url" : "https://social.sakamoto.gq/media/f1cb6f79bf6839f3223ca240441f766056b74ddd23c69bcaf8bb1ba1ecff6eec.jpg" + }, + "id" : "https://social.sakamoto.gq/users/eal", + "image" : { + "type" : "Image", + "url" : "https://social.sakamoto.gq/media/e5cccf26421e8366f4e34be3c9d5042b8bc8dcceccc7c8e89785fa312dd9632c.jpg" + }, + "inbox" : "https://social.sakamoto.gq/users/eal/inbox", + "manuallyApprovesFollowers" : false, + "name" : "에알", + "outbox" : "https://social.sakamoto.gq/users/eal/outbox", + "preferredUsername" : "eal", + "publicKey" : { + "id" : "https://social.sakamoto.gq/users/eal#main-key", + "owner" : "https://social.sakamoto.gq/users/eal", + "publicKeyPem" : "-----BEGIN PUBLIC KEY-----\nMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAz3pF85YOhhv2Zaxv9YQ7\nrCe1aEhetCMVHtrK63tUVGoGdsblyKnVeJNbFcr6k3y35OpHS3HXIi6GzgihYcTu\nONLP4eQMHTnLUNAQZi03mjJA4iIq8v/tm8ZkL2mXsQSAbWj6Iq518mHNN7OvCoNt\n3Xjepl/0kgkc2gsund7m8r+Wu0Fusx6UlUyyAk3PexdDRdSSlVLeskqtP8jtdQDo\nL70pMyL+VD+Qb9RKFdtgJ+M4OqYP+7FVzCqXN0QIPhFf/kvHSLr+c4Y3Wm0nAKHU\n9CwXWXz5Xqscpv41KlgnUCOkTXb5eBSt23lNulae5srVzWBiFb6guiCpNzBGa+Sq\nrwIDAQAB\n-----END PUBLIC KEY-----\n\n" + }, + "summary" : "Pizza napoletana supremacist.

Any artworks posted here that are good are not mine.", + "tag" : [], + "type" : "Person", + "url" : "https://social.sakamoto.gq/users/eal" +} diff --git a/test/fixtures/fetch_mocks/tuxcrafting.json b/test/fixtures/fetch_mocks/tuxcrafting.json new file mode 100644 index 000000000..5dce2a16d --- /dev/null +++ b/test/fixtures/fetch_mocks/tuxcrafting.json @@ -0,0 +1,59 @@ +{ + "@context" : [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "IdentityProof" : "toot:IdentityProof", + "PropertyValue" : "schema:PropertyValue", + "alsoKnownAs" : { + "@id" : "as:alsoKnownAs", + "@type" : "@id" + }, + "discoverable" : "toot:discoverable", + "featured" : { + "@id" : "toot:featured", + "@type" : "@id" + }, + "focalPoint" : { + "@container" : "@list", + "@id" : "toot:focalPoint" + }, + "manuallyApprovesFollowers" : "as:manuallyApprovesFollowers", + "movedTo" : { + "@id" : "as:movedTo", + "@type" : "@id" + }, + "schema" : "http://schema.org#", + "toot" : "http://joinmastodon.org/ns#", + "value" : "schema:value" + } + ], + "attachment" : [], + "discoverable" : true, + "endpoints" : { + "sharedInbox" : "https://busshi.moe/inbox" + }, + "featured" : "https://busshi.moe/users/tuxcrafting/collections/featured", + "followers" : "https://busshi.moe/users/tuxcrafting/followers", + "following" : "https://busshi.moe/users/tuxcrafting/following", + "icon" : { + "mediaType" : "image/jpeg", + "type" : "Image", + "url" : "https://blobcdn.busshi.moe/busshifiles/accounts/avatars/000/046/872/original/054f0806ccb303d0.jpg" + }, + "id" : "https://busshi.moe/users/tuxcrafting", + "inbox" : "https://busshi.moe/users/tuxcrafting/inbox", + "manuallyApprovesFollowers" : true, + "name" : "@tuxcrafting@localhost:8080", + "outbox" : "https://busshi.moe/users/tuxcrafting/outbox", + "preferredUsername" : "tuxcrafting", + "publicKey" : { + "id" : "https://busshi.moe/users/tuxcrafting#main-key", + "owner" : "https://busshi.moe/users/tuxcrafting", + "publicKeyPem" : "-----BEGIN PUBLIC KEY-----\nMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAwqWWTBf9OizsBiBhGS/M\nQTT6fB1VvQP6vvxouGZ5cGg1a97V67ouhjJ+nGMuWr++DNYjJYkk2TOynfykk0H/\n8rRSujSe3BNRKYGNzdnRJu/4XxgIE847Fqx5SijSP23JGYcn8TjeSUsN2u2YYVXK\n+Eb3Bu7DjGiqwNon6YB0h5qkGjkMSMVIFn0hZx6Z21bkfYWgra96Ok5OWf7Ck3je\nCuErlCMZcbQcHtFpBueJAxYchjNvm6fqwZxLX/NtaHdr7Fm2kin89mqzliapBlFH\nCXk7Jln6xV5I6ryggPAMzm3fuHzeo0RWlu8lrxLfARBVwaQQZS99bwqp6N9O2aUp\nYwIDAQAB\n-----END PUBLIC KEY-----\n" + }, + "summary" : "

expert procrastinator

trans(humanist|gender|istorized)

web: https://tuxcrafting.port0.org
pronouns: she/they
languages: french (native)/english (fluent)/hebrew (ok-ish)/esperanto (barely)

", + "tag" : [], + "type" : "Person", + "url" : "https://busshi.moe/@tuxcrafting" +} diff --git a/test/fixtures/follow.xml b/test/fixtures/follow.xml deleted file mode 100644 index d4e89954b..000000000 --- a/test/fixtures/follow.xml +++ /dev/null @@ -1,68 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-07T09:54:49+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - tag:social.heldscal.la,2017-05-07:subscription:23211:person:44803:2017-05-07T09:54:48+00:00 - Constance Variable (lambadalambda@social.heldscal.la)'s status on Sunday, 07-May-2017 09:54:49 UTC - <a href="https://social.heldscal.la/lambadalambda">Constance Variable</a> started following <a href="https://pawoo.net/@pekorino">mono</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-05-07T09:54:49+00:00 - 2017-05-07T09:54:49+00:00 - - http://activitystrea.ms/schema/1.0/person - https://pawoo.net/users/pekorino - mono - http://shitposter.club/mono 孤独のグルメ - - - - - pekorino - mono - http://shitposter.club/mono 孤独のグルメ - - - tag:social.heldscal.la,2017-05-07:objectType=thread:nonce=6e80caf94e03029f - - - - - - diff --git a/test/fixtures/incoming_note_activity.xml b/test/fixtures/incoming_note_activity.xml deleted file mode 100644 index 21eda2d30..000000000 --- a/test/fixtures/incoming_note_activity.xml +++ /dev/null @@ -1,42 +0,0 @@ - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-23:noticeId=29:objectType=note - New note by lambda - @<a href="http://pleroma.example.org:4000/users/lain3" class="h-card mention">lain3</a> - - - - - http://activitystrea.ms/schema/1.0/post - 2017-04-23T14:51:03+00:00 - 2017-04-23T14:51:03+00:00 - - http://activitystrea.ms/schema/1.0/person - http://gs.example.org:4040/index.php/user/1 - lambda - - - - - lambda - lambda - - - - - tag:gs.example.org:4040,2017-04-23:objectType=thread:nonce=f09e22f58abd5c7b - - - - http://gs.example.org:4040/index.php/api/statuses/user_timeline/1.atom - lambda - - - - http://gs.example.org:4040/theme/neo-gnu/default-avatar-profile.png - 2017-04-23T14:51:03+00:00 - - - - - diff --git a/test/fixtures/incoming_note_activity_answer.xml b/test/fixtures/incoming_note_activity_answer.xml deleted file mode 100644 index b1244faa6..000000000 --- a/test/fixtures/incoming_note_activity_answer.xml +++ /dev/null @@ -1,42 +0,0 @@ - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=55:objectType=note - New note by lambda - hey. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:16:13+00:00 - 2017-04-25T18:16:13+00:00 - - http://activitystrea.ms/schema/1.0/person - http://gs.example.org:4040/index.php/user/1 - lambda - - - - - lambda - lambda - - - - - - - http://pleroma.example.org:4000/contexts/8f6f45d4-8e4d-4e1a-a2de-09f27367d2d0 - - - - http://gs.example.org:4040/index.php/api/statuses/user_timeline/1.atom - lambda - - - - http://gs.example.org:4040/theme/neo-gnu/default-avatar-profile.png - 2017-04-25T18:16:13+00:00 - - - - - diff --git a/test/fixtures/incoming_reply_mastodon.xml b/test/fixtures/incoming_reply_mastodon.xml deleted file mode 100644 index 8ee1186cc..000000000 --- a/test/fixtures/incoming_reply_mastodon.xml +++ /dev/null @@ -1,29 +0,0 @@ - - - tag:mastodon.social,2017-05-02:objectId=4901603:objectType=Status - 2017-05-02T18:33:06Z - 2017-05-02T18:33:06Z - New status by lambadalambda - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - - lambadalambda - Critical Value - public - - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> hey</p> - - - public - - - - diff --git a/test/fixtures/incoming_websub_gnusocial_attachments.xml b/test/fixtures/incoming_websub_gnusocial_attachments.xml deleted file mode 100644 index 9d331ef32..000000000 --- a/test/fixtures/incoming_websub_gnusocial_attachments.xml +++ /dev/null @@ -1,59 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-02T20:29:35+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-05-02:noticeId=2020923:objectType=note - New note by lambadalambda - Okay gonna stream some cool games!! <a href="https://social.heldscal.la/file/7ed5ee508e6376a6e3dd581e17e7ed0b7b638147c7e86784bf83abc2641ee3d4.gif" title="https://social.heldscal.la/file/7ed5ee508e6376a6e3dd581e17e7ed0b7b638147c7e86784bf83abc2641ee3d4.gif" rel="nofollow external noreferrer" class="attachment" id="attachment-423842">https://social.heldscal.la/attachment/423842</a> <a href="https://social.heldscal.la/file/4c209099cadfc5afd3e27a334aa0db96b3a7510dde1603305d68a2707e59a11f.png" title="https://social.heldscal.la/file/4c209099cadfc5afd3e27a334aa0db96b3a7510dde1603305d68a2707e59a11f.png" rel="nofollow external noreferrer" class="attachment" id="attachment-423843">https://social.heldscal.la/attachment/423843</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-02T20:29:35+00:00 - 2017-05-02T20:29:35+00:00 - - tag:social.heldscal.la,2017-05-02:objectType=thread:nonce=26c7afdcbcf4ebd4 - - - - - - - - diff --git a/test/fixtures/lambadalambda.atom b/test/fixtures/lambadalambda.atom deleted file mode 100644 index 964a416f7..000000000 --- a/test/fixtures/lambadalambda.atom +++ /dev/null @@ -1,479 +0,0 @@ - - - https://mastodon.social/users/lambadalambda.atom - Critical Value - - 2017-04-16T21:47:25Z - https://files.mastodon.social/accounts/avatars/000/000/264/original/1429214160519.gif?1492379244 - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - a cool dude. - - - - lambadalambda - Critical Value - public - - - - - - - - tag:mastodon.social,2017-04-07:objectId=1874242:objectType=Status - 2017-04-07T11:02:56Z - 2017-04-07T11:02:56Z - lambadalambda shared a status by 0xroy@social.wxcafe.net - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:social.wxcafe.net,2017-04-07:objectId=72554:objectType=Status - 2017-04-07T11:01:59Z - 2017-04-07T11:02:00Z - New status by 0xroy@social.wxcafe.net - - https://social.wxcafe.net/users/0xroy - http://activitystrea.ms/schema/1.0/person - https://social.wxcafe.net/users/0xroy - 0xroy - 0xroy@social.wxcafe.net - ta caution weeb | discussions privées : <a href="https://💌.0xroy.me" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="">💌.0xroy.me</span><span class="invisible"></span></a> - - - - 0xroy - 「R O Y 🍵 B O S」 - ta caution weeb | discussions privées : <a href="https://%F0%9F%92%8C.0xroy.me" rel="nofollow noopener"><span class="invisible">https://</span><span class="">💌.0xroy.me</span><span class="invisible"></span></a> - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>someone pls eli5 matrix (protocol) and riot</p> - - public - - - <p>someone pls eli5 matrix (protocol) and riot</p> - - public - - - - - tag:mastodon.social,2017-04-06:objectId=1768247:objectType=Status - 2017-04-06T11:10:19Z - 2017-04-06T11:10:19Z - lambadalambda shared a status by areyoutoo@mastodon.xyz - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:mastodon.xyz,2017-04-05:objectId=133327:objectType=Status - 2017-04-05T17:36:41Z - 2017-04-05T18:12:14Z - New status by areyoutoo@mastodon.xyz - - https://mastodon.xyz/users/areyoutoo - http://activitystrea.ms/schema/1.0/person - https://mastodon.xyz/users/areyoutoo - areyoutoo - areyoutoo@mastodon.xyz - devops | retired gamedev | always boost puppy pics - - - - areyoutoo - Raw Butter - devops | retired gamedev | always boost puppy pics - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Some UX thoughts for <a href="https://mastodon.xyz/tags/mastodev" class="mention hashtag">#<span>mastodev</span></a>:</p><p>- Would be nice if I could work on multiple draft toots? Clicking to reply to someone seems to erase any draft I had been working on.</p><p>- Kinda risky to click on the Federated Timeline if it loads new toots and scrolls 10ms before I click on something.</p><p>I probably don't know enough web frontend to help, but it might be fun to try.</p> - - - public - - - <p>Some UX thoughts for <a href="https://mastodon.xyz/tags/mastodev" class="mention hashtag">#<span>mastodev</span></a>:</p><p>- Would be nice if I could work on multiple draft toots? Clicking to reply to someone seems to erase any draft I had been working on.</p><p>- Kinda risky to click on the Federated Timeline if it loads new toots and scrolls 10ms before I click on something.</p><p>I probably don't know enough web frontend to help, but it might be fun to try.</p> - - public - - - - - tag:mastodon.social,2017-04-06:objectId=1764509:objectType=Status - 2017-04-06T10:15:38Z - 2017-04-06T10:15:38Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - This is a test for cw federation - <p>This is a test for cw federation body text.</p> - - public - - - - - tag:mastodon.social,2017-04-05:objectId=1645208:objectType=Status - 2017-04-05T07:14:53Z - 2017-04-05T07:14:53Z - lambadalambda shared a status by lambadalambda@social.heldscal.la - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:social.heldscal.la,2017-04-05:noticeId=1502088:objectType=note - 2017-04-05T06:12:09Z - 2017-04-05T07:12:47Z - New status by lambadalambda@social.heldscal.la - - https://social.heldscal.la/user/23211 - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - lambadalambda@social.heldscal.la - Call me Deacon Blues. - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - Federation 101: <a href="https://www.youtube.com/watch?v=t1lYU5CA40o" rel="nofollow external noreferrer" class="attachment thumbnail">https://www.youtube.com/watch?v=t1lYU5CA40o</a> - - public - - - Federation 101: <a href="https://www.youtube.com/watch?v=t1lYU5CA40o" rel="nofollow external noreferrer" class="attachment thumbnail">https://www.youtube.com/watch?v=t1lYU5CA40o</a> - - public - - - - - tag:mastodon.social,2017-04-05:objectId=1641750:objectType=Status - 2017-04-05T05:44:48Z - 2017-04-05T05:44:48Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> just a test.</p> - - - public - - - - - tag:mastodon.social,2017-04-04:objectId=1540149:objectType=Status - 2017-04-04T06:31:09Z - 2017-04-04T06:31:09Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Looks like you still can&apos;t delete your account here (PRIVACY!), but I won&apos;t be posting here anymore, my main account is <span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span></p> - - - public - - - - - tag:mastodon.social,2017-04-04:objectId=1539608:objectType=Status - 2017-04-04T06:18:16Z - 2017-04-04T06:18:16Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@ghostbar" class="u-url mention">@<span>ghostbar</span></a></span> Remember to rewrite it in Rust once you&apos;re done.</p> - - - public - - - - - - tag:mastodon.social,2017-04-03:objectId=1504813:objectType=Status - 2017-04-03T18:01:20Z - 2017-04-03T18:01:20Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.xyz/@Azurolu" class="u-url mention">@<span>Azurolu</span></a></span> You mean gs.smuglo.li?</p> - - - public - - - - - - tag:mastodon.social,2017-04-03:objectId=1504805:objectType=Status - 2017-04-03T18:01:05Z - 2017-04-03T18:01:05Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>There&apos;s nothing wrong with having several alt accounts all across the fediverse. Try out another mastodon instance (<a href="https://icosahedron.website" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="">icosahedron.website</span><span class="invisible"></span></a>) or a GNU Social instance (like <a href="https://shitposter.club" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="">shitposter.club</span><span class="invisible"></span></a> or <a href="https://freezepeach.xyz" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="">freezepeach.xyz</span><span class="invisible"></span></a>), or friendica. They are all on the same network, so you can still follow all your friends!</p> - - public - - - - - tag:mastodon.social,2017-04-03:objectId=1503965:objectType=Status - 2017-04-03T17:31:30Z - 2017-04-03T17:31:30Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@20Hz" class="u-url mention">@<span>20Hz</span></a></span> you could also try out a GS instance, which are on the same network :)</p> - - - public - - - - - - tag:mastodon.social,2017-04-03:objectId=1503955:objectType=Status - 2017-04-03T17:31:08Z - 2017-04-03T17:31:08Z - lambadalambda shared a status by shpuld@shitposter.club - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:shitposter.club,2017-04-03:noticeId=2251717:objectType=note - 2017-04-03T17:06:43Z - 2017-04-03T17:12:06Z - New status by shpuld@shitposter.club - - https://shitposter.club/user/5381 - http://activitystrea.ms/schema/1.0/person - https://shitposter.club/user/5381 - shpuld - shpuld@shitposter.club - - - - - shpuld - shp - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - reposting the classic <a href="https://shitposter.club/file/89c5fe483526caf3a46cfc5cdd4ae68061054350e767397731af658d54786e31.jpg" class="attachment" rel="nofollow external">https://shitposter.club/attachment/219846</a> - - - public - - - reposting the classic <a href="https://shitposter.club/file/89c5fe483526caf3a46cfc5cdd4ae68061054350e767397731af658d54786e31.jpg" class="attachment" rel="nofollow external">https://shitposter.club/attachment/219846</a> - - public - - - - - tag:mastodon.social,2017-04-03:objectId=1503929:objectType=Status - 2017-04-03T17:30:43Z - 2017-04-03T17:30:43Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@ghostbar" class="u-url mention">@<span>ghostbar</span></a></span> Normally you shouldn&apos;t be running tens of thousands of users on one instance... That&apos;s one of the reasons for federation.</p> - - - public - - - - - - tag:mastodon.social,2017-04-03:objectId=1477255:objectType=Status - 2017-04-03T08:24:39Z - 2017-04-03T08:24:39Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@dot_tiff" class="u-url mention">@<span>dot_tiff</span></a></span> it&apos;s the vaporwave mode.</p> - - - public - - - - - - tag:mastodon.social,2017-04-03:objectId=1476210:objectType=Status - 2017-04-03T07:45:42Z - 2017-04-03T07:45:42Z - lambadalambda shared a status by lambadalambda@social.heldscal.la - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:social.heldscal.la,2017-04-03:noticeId=1475727:objectType=note - 2017-04-03T07:44:43Z - 2017-04-03T07:44:48Z - New status by lambadalambda@social.heldscal.la - - https://social.heldscal.la/user/23211 - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - lambadalambda@social.heldscal.la - Call me Deacon Blues. - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - Here's a song by the original anti-idol, Togawa Jun: <a href="https://www.youtube.com/watch?v=kNI_NK2YY-s" rel="nofollow external noreferrer" class="attachment">https://www.youtube.com/watch?v=kNI_NK2YY-s</a> - - public - - - Here's a song by the original anti-idol, Togawa Jun: <a href="https://www.youtube.com/watch?v=kNI_NK2YY-s" rel="nofollow external noreferrer" class="attachment">https://www.youtube.com/watch?v=kNI_NK2YY-s</a> - - public - - - - - tag:mastodon.social,2017-04-03:objectId=1476047:objectType=Status - 2017-04-03T07:39:14Z - 2017-04-03T07:39:14Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@amrrr" class="u-url mention">@<span>amrrr</span></a></span> tumblr/10, but pretty good!</p> - - - public - - - - - - tag:mastodon.social,2017-04-03:objectId=1475949:objectType=Status - 2017-04-03T07:35:45Z - 2017-04-03T07:35:45Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@Shookaite" class="u-url mention">@<span>Shookaite</span></a></span> Oh, you mean like userstyles?</p> - - - public - - - - - - tag:mastodon.social,2017-04-03:objectId=1475581:objectType=Status - 2017-04-03T07:20:03Z - 2017-04-03T07:20:03Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@Shookaite" class="u-url mention">@<span>Shookaite</span></a></span> Would be nice if someone helped port Pleroma to Mastodon, that has a theme switcher (click on the cog in the upper right): <a href="https://pleroma.heldscal.la/main/all" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="">pleroma.heldscal.la/main/all</span><span class="invisible"></span></a></p> - - - public - - - - - - tag:mastodon.social,2017-04-02:objectId=1457325:objectType=Status - 2017-04-02T21:57:43Z - 2017-04-02T21:57:43Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@rhosyn" class="u-url mention">@<span>rhosyn</span></a></span> <span class="h-card"><a href="https://mastodon.social/@Meaningness" class="u-url mention">@<span>Meaningness</span></a></span> you could take a look at those listed at social.guhnoo.org</p> - - - - public - - - - - - tag:mastodon.social,2017-04-02:objectId=1447926:objectType=Status - 2017-04-02T18:31:52Z - 2017-04-02T18:31:52Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>My main account is <span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> , btw.</p> - - - public - - - - - tag:mastodon.social,2017-04-02:objectId=1447878:objectType=Status - 2017-04-02T18:30:37Z - 2017-04-02T18:30:37Z - lambadalambda shared a status by Firstaide@awoo.space - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:awoo.space,2017-04-02:objectId=135324:objectType=Status - 2017-04-02T18:29:32Z - 2017-04-02T18:29:32Z - New status by Firstaide@awoo.space - - https://awoo.space/users/Firstaide - http://activitystrea.ms/schema/1.0/person - https://awoo.space/users/Firstaide - Firstaide - Firstaide@awoo.space - A smol awoo account, for a smol autistic 💙 -They/them please! -NB/white/ace - - - - Firstaide - Miff🚑✨ - A smol awoo account, for a smol autistic 💙 -They/them please! -NB/white/ace - public - - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><a href="https://mastodon.social/users/lambadalambda" class="h-card u-url p-nickname mention">@<span>lambadalambda</span></a> yeah, I think that's p much the big issue here? <br>When I first heard of Masto, I thought it was just like twitter at first, I had no idea federation was even a thing?, and I actually joined p early on? :-o </p><p>idk I think more stuff needs to be done about federation promotion, but honestly its gotta come from the get go when people get here to make an account I feel :-o</p> - - - public - - - - <p><a href="https://mastodon.social/users/lambadalambda" class="h-card u-url p-nickname mention">@<span>lambadalambda</span></a> yeah, I think that's p much the big issue here? <br>When I first heard of Masto, I thought it was just like twitter at first, I had no idea federation was even a thing?, and I actually joined p early on? :-o </p><p>idk I think more stuff needs to be done about federation promotion, but honestly its gotta come from the get go when people get here to make an account I feel :-o</p> - - public - - - - diff --git a/test/fixtures/mastodon-note-cw.xml b/test/fixtures/mastodon-note-cw.xml deleted file mode 100644 index 02f49dd61..000000000 --- a/test/fixtures/mastodon-note-cw.xml +++ /dev/null @@ -1,39 +0,0 @@ - - - https://mastodon.social/users/lambadalambda.atom - Critical Value - - 2017-04-16T21:47:25Z - https://files.mastodon.social/accounts/avatars/000/000/264/original/1429214160519.gif - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - - lambadalambda - Critical Value - public - - - - - - - tag:mastodon.social,2017-05-10:objectId=5551985:objectType=Status - 2017-05-10T12:21:36Z - 2017-05-10T12:21:36Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - technologic - <p>test</p> - - public - - - - diff --git a/test/fixtures/mastodon-note-unlisted.xml b/test/fixtures/mastodon-note-unlisted.xml deleted file mode 100644 index d21017b80..000000000 --- a/test/fixtures/mastodon-note-unlisted.xml +++ /dev/null @@ -1,38 +0,0 @@ - - - https://mastodon.social/users/lambadalambda.atom - Critical Value - - 2017-04-16T21:47:25Z - https://files.mastodon.social/accounts/avatars/000/000/264/original/1429214160519.gif - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - - lambadalambda - Critical Value - public - - - - - - - tag:mastodon.social,2017-05-10:objectId=5551985:objectType=Status - 2017-05-10T12:21:36Z - 2017-05-10T12:21:36Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - technologic - <p>test</p> - unlisted - - - - diff --git a/test/fixtures/mastodon-problematic.xml b/test/fixtures/mastodon-problematic.xml deleted file mode 100644 index a39e72759..000000000 --- a/test/fixtures/mastodon-problematic.xml +++ /dev/null @@ -1,72 +0,0 @@ - - - https://icosahedron.website/users/shel.atom - shel🍖‼️ - Gay jackal dog, poet, future librarian. - -http://datapup.info -avatar: @puppytube@twitter.com - 2017-05-02T23:26:01Z - https://icosahedron.website/system/accounts/avatars/000/001/207/original/b1e07b09ae1cc787.png?1493767561 - - https://icosahedron.website/users/shel - http://activitystrea.ms/schema/1.0/person - https://icosahedron.website/users/shel - shel - shel@icosahedron.website - <p>Gay jackal dog, poet, future librarian. </p><p><a href="http://datapup.info/" rel="nofollow noopener" target="_blank"><span class="invisible">http://</span><span class="">datapup.info/</span><span class="invisible"></span></a><br />avatar: @puppytube@twitter.com</p> - - - - shel - shel🍖‼️ - Gay jackal dog, poet, future librarian. - -http://datapup.info -avatar: @puppytube@twitter.com - public - - - - - - - tag:icosahedron.website,2017-05-10:objectId=1414013:objectType=Status - 2017-05-10T17:16:24Z - 2017-05-10T17:16:24Z - shel shared a status by instance_names@cybre.space - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:cybre.space,2017-05-10:objectId=946671:objectType=Status - 2017-05-10T17:15:51Z - 2017-05-10T17:15:52Z - New status by instance_names@cybre.space - - https://cybre.space/users/instance_names - http://activitystrea.ms/schema/1.0/person - https://cybre.space/users/instance_names - instance_names - instance_names@cybre.space - <p>name ideas for your new mastodon instance. made by <span class="h-card"><a href="https://witches.town/@lycaon">@<span>lycaon</span></a></span> source available at <a href="https://github.com/LycaonIsAWolf/instance_names"><span class="invisible">https://</span><span class="ellipsis">github.com/LycaonIsAWolf/insta</span><span class="invisible">nce_names</span></a></p> - - - - instance_names - instance names - name ideas for your new mastodon instance. made by @lycaon source available at https://github.com/LycaonIsAWolf/instance_names - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>dildo.codes</p> - unlisted - - - <p>dildo.codes</p> - - public - - - - diff --git a/test/fixtures/mastodon-question-activity.json b/test/fixtures/mastodon-question-activity.json index ac329c7d5..3648b9f90 100644 --- a/test/fixtures/mastodon-question-activity.json +++ b/test/fixtures/mastodon-question-activity.json @@ -49,7 +49,6 @@ "en": "

Why is Tenshi eating a corndog so cute?

" }, "endTime": "2019-05-11T09:03:36Z", - "closed": "2019-05-11T09:03:36Z", "attachment": [], "tag": [], "replies": { diff --git a/test/fixtures/mastodon_conversation.xml b/test/fixtures/mastodon_conversation.xml deleted file mode 100644 index 8faab2304..000000000 --- a/test/fixtures/mastodon_conversation.xml +++ /dev/null @@ -1,30 +0,0 @@ - - - tag:mastodon.social,2017-08-28:objectId=16402826:objectType=Status - 2017-08-28T17:58:55Z - 2017-08-28T17:58:55Z - New status by lambadalambda - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - - lambadalambda - Critical Value - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>test. <a href="https://mastodon.social/media/XCp0OHGPON9kWZwhjaI" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="ellipsis">mastodon.social/media/XCp0OHGP</span><span class="invisible">ON9kWZwhjaI</span></a></p> - - - public - - - - diff --git a/test/fixtures/nil_mention_entry.xml b/test/fixtures/nil_mention_entry.xml deleted file mode 100644 index e13024cb3..000000000 --- a/test/fixtures/nil_mention_entry.xml +++ /dev/null @@ -1,52 +0,0 @@ - - - GNU social - https://social.stopwatchingus-heidelberg.de/api/statuses/user_timeline/18330.atom - atarifrosch timeline - Updates from atarifrosch on social.stopwatchingus-heidelberg.de! - https://social.stopwatchingus-heidelberg.de/avatar/18330-96-20150628163706.png - 2017-08-24T11:36:49+02:00 - - http://activitystrea.ms/schema/1.0/person - https://social.stopwatchingus-heidelberg.de/user/18330 - atarifrosch - Nerd, Pirat, Debian user, CAcert assurer, Geocacher, Freifunker. Autismus/Depression, agender. GnuPG Key-ID: 0xBCF81ADE - - - - - - atarifrosch - Atari-Frosch - Nerd, Pirat, Debian user, CAcert assurer, Geocacher, Freifunker. Autismus/Depression, agender. GnuPG Key-ID: 0xBCF81ADE - - Düsseldorf, NRW, Germany - - - homepage - https://www.atari-frosch.de/ - true - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978072:objectType=note - New note by atarifrosch - 2017-08-22 Bundesverfassungsgericht: Erfolgreiche Verfassungsbeschwerde gegen die Versagung vorläufiger Leistungen für Kosten der Unterkunft und Heizung – <a href="https://www.bundesverfassungsgericht.de/SharedDocs/Pressemitteilungen/DE/2017/bvg17-072.html" title="https://www.bundesverfassungsgericht.de/SharedDocs/Pressemitteilungen/DE/2017/bvg17-072.html" class="attachment" id="attachment-450768" rel="nofollow external">https://www.bundesverfassungsgericht.de/SharedDocs/Pressemitteilungen/DE/2017/bvg17-072.html</a> !<a href="http://quitter.se/group/2184/id" class="h-card group" title="HartzIV (hartziv)">hartziv</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-08-22T12:00:21+00:00 - 2017-08-22T12:00:21+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978072:objectType=thread:crc32=28a35f44 - - - - - - - - diff --git a/test/fixtures/ostatus_incoming_post.xml b/test/fixtures/ostatus_incoming_post.xml deleted file mode 100644 index 7967e1b32..000000000 --- a/test/fixtures/ostatus_incoming_post.xml +++ /dev/null @@ -1,57 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-04-29T18:25:38+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-04-29:noticeId=1967725:objectType=note - New note by lambadalambda - Will it blend? - - - http://activitystrea.ms/schema/1.0/post - 2017-04-29T18:25:38+00:00 - 2017-04-29T18:25:38+00:00 - - tag:social.heldscal.la,2017-04-29:objectType=thread:nonce=3f3a9dd83acc4e35 - - - - - - diff --git a/test/fixtures/ostatus_incoming_post_tag.xml b/test/fixtures/ostatus_incoming_post_tag.xml deleted file mode 100644 index 0f99c4126..000000000 --- a/test/fixtures/ostatus_incoming_post_tag.xml +++ /dev/null @@ -1,59 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-04-29T18:25:38+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-04-29:noticeId=1967725:objectType=note - New note by lambadalambda - Will it blend? - - - - - http://activitystrea.ms/schema/1.0/post - 2017-04-29T18:25:38+00:00 - 2017-04-29T18:25:38+00:00 - - tag:social.heldscal.la,2017-04-29:objectType=thread:nonce=3f3a9dd83acc4e35 - - - - - - diff --git a/test/fixtures/ostatus_incoming_reply.xml b/test/fixtures/ostatus_incoming_reply.xml deleted file mode 100644 index 83a427a68..000000000 --- a/test/fixtures/ostatus_incoming_reply.xml +++ /dev/null @@ -1,60 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-04-30T09:30:32+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-04-30:noticeId=1978790:objectType=comment - New comment by lambadalambda - @<a href="https://gs.archae.me/user/4687" class="h-card u-url p-nickname mention" title="shpbot">shpbot</a> why not indeed. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-30T09:30:32+00:00 - 2017-04-30T09:30:32+00:00 - - - - https://gs.archae.me/conversation/327120 - - - - - - - diff --git a/test/fixtures/preload_static/instance/panel.html b/test/fixtures/preload_static/instance/panel.html new file mode 100644 index 000000000..fc58e4e93 --- /dev/null +++ b/test/fixtures/preload_static/instance/panel.html @@ -0,0 +1 @@ +HEY! diff --git a/test/fixtures/share-gs-local.xml b/test/fixtures/share-gs-local.xml deleted file mode 100644 index 9d52eab7b..000000000 --- a/test/fixtures/share-gs-local.xml +++ /dev/null @@ -1,99 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-03T08:05:41+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - tag:social.heldscal.la,2017-05-03:noticeId=2028428:objectType=note - lambadalambda repeated a notice by lain - RT @<a href="https://pleroma.soykaf.com/users/lain" class="h-card u-url p-nickname mention" title="Lain Iwakura">lain</a> Added returning the entries as xml... let's see if the mastodon hammering stops now. - - http://activitystrea.ms/schema/1.0/share - 2017-05-03T08:05:41+00:00 - 2017-05-03T08:05:41+00:00 - - http://activitystrea.ms/schema/1.0/activity - LOCAL_ID - - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - http://activitystrea.ms/schema/1.0/post - 2017-05-03T08:04:44+00:00 - 2017-05-03T08:04:44+00:00 - - http://activitystrea.ms/schema/1.0/person - LOCAL_USER - lain - Test account - - - - - - lain - Lain Iwakura - Test account - - - - http://activitystrea.ms/schema/1.0/note - https://pleroma.soykaf.com/objects/4c1bda26-902e-4525-9fcd-b9fd44925193 - New note by lain - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - - - - https://pleroma.soykaf.com/contexts/ede39a2b-7cf3-4fa4-8ccd-cb97431bcc22 - - - https://pleroma.soykaf.com/users/lain/feed.atom - Lain Iwakura - - - https://social.heldscal.la/avatar/43188-96-20170429172422.jpeg - 2017-05-03T08:04:44+00:00 - - - - https://pleroma.soykaf.com/contexts/ede39a2b-7cf3-4fa4-8ccd-cb97431bcc22 - - - - - - diff --git a/test/fixtures/share-gs.xml b/test/fixtures/share-gs.xml deleted file mode 100644 index ab5e488bd..000000000 --- a/test/fixtures/share-gs.xml +++ /dev/null @@ -1,99 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-03T08:05:41+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - tag:social.heldscal.la,2017-05-03:noticeId=2028428:objectType=note - lambadalambda repeated a notice by lain - RT @<a href="https://pleroma.soykaf.com/users/lain" class="h-card u-url p-nickname mention" title="Lain Iwakura">lain</a> Added returning the entries as xml... let's see if the mastodon hammering stops now. - - http://activitystrea.ms/schema/1.0/share - 2017-05-03T08:05:41+00:00 - 2017-05-03T08:05:41+00:00 - - http://activitystrea.ms/schema/1.0/activity - https://pleroma.soykaf.com/objects/4c1bda26-902e-4525-9fcd-b9fd44925193 - - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - http://activitystrea.ms/schema/1.0/post - 2017-05-03T08:04:44+00:00 - 2017-05-03T08:04:44+00:00 - - http://activitystrea.ms/schema/1.0/person - https://pleroma.soykaf.com/users/lain - lain - Test account - - - - - - lain - Lain Iwakura - Test account - - - - http://activitystrea.ms/schema/1.0/note - https://pleroma.soykaf.com/objects/4c1bda26-902e-4525-9fcd-b9fd44925193 - New note by lain - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - - - - https://pleroma.soykaf.com/contexts/ede39a2b-7cf3-4fa4-8ccd-cb97431bcc22 - - - https://pleroma.soykaf.com/users/lain/feed.atom - Lain Iwakura - - - https://social.heldscal.la/avatar/43188-96-20170429172422.jpeg - 2017-05-03T08:04:44+00:00 - - - - https://pleroma.soykaf.com/contexts/ede39a2b-7cf3-4fa4-8ccd-cb97431bcc22 - - - - - - diff --git a/test/fixtures/share.xml b/test/fixtures/share.xml deleted file mode 100644 index e07b88680..000000000 --- a/test/fixtures/share.xml +++ /dev/null @@ -1,54 +0,0 @@ - - - tag:mastodon.social,2017-05-03:objectId=4934452:objectType=Status - 2017-05-03T08:21:09Z - 2017-05-03T08:21:09Z - lambadalambda shared a status by lain@pleroma.soykaf.com - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - - lambadalambda - Critical Value - public - - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - https://pleroma.soykaf.com/objects/4c1bda26-902e-4525-9fcd-b9fd44925193 - 2017-05-03T08:04:44Z - 2017-05-03T08:05:52Z - New status by lain@pleroma.soykaf.com - - https://pleroma.soykaf.com/users/lain - http://activitystrea.ms/schema/1.0/person - https://pleroma.soykaf.com/users/lain - lain - lain@pleroma.soykaf.com - Test account - - - - lain - Lain Iwakura - Test account - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - public - - - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - public - - - diff --git a/test/fixtures/tesla_mock/7369654.atom b/test/fixtures/tesla_mock/7369654.atom deleted file mode 100644 index 74fd9ce6b..000000000 --- a/test/fixtures/tesla_mock/7369654.atom +++ /dev/null @@ -1,44 +0,0 @@ - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-22:noticeId=7369654:objectType=comment - New comment by shpuld - @<a href="https://testing.pleroma.lol/users/lain" class="h-card mention" title="Rael Electric Razor">lain</a> me far right - - - http://activitystrea.ms/schema/1.0/post - 2018-02-22T09:20:12+00:00 - 2018-02-22T09:20:12+00:00 - - http://activitystrea.ms/schema/1.0/person - https://shitposter.club/user/5381 - shpuld - - - - - - shpuld - shp - - - - - - - tag:shitposter.club,2018-02-22:objectType=thread:nonce=e5a7c72d60a9c0e4 - - - - https://shitposter.club/api/statuses/user_timeline/5381.atom - shp - - - - https://shitposter.club/avatar/5381-96-20171230093854.png - 2018-02-23T13:30:15+00:00 - - - - - diff --git a/test/fixtures/tesla_mock/admin@mastdon.example.org.json b/test/fixtures/tesla_mock/admin@mastdon.example.org.json index 9fdd6557c..a911b979a 100644 --- a/test/fixtures/tesla_mock/admin@mastdon.example.org.json +++ b/test/fixtures/tesla_mock/admin@mastdon.example.org.json @@ -26,6 +26,9 @@ "summary": "\u003cp\u003e\u003c/p\u003e", "url": "http://mastodon.example.org/@admin", "manuallyApprovesFollowers": false, + "capabilities": { + "acceptsChatMessages": true + }, "publicKey": { "id": "http://mastodon.example.org/users/admin#main-key", "owner": "http://mastodon.example.org/users/admin", diff --git a/test/fixtures/tesla_mock/atarifrosch_feed.xml b/test/fixtures/tesla_mock/atarifrosch_feed.xml deleted file mode 100644 index e00df782e..000000000 --- a/test/fixtures/tesla_mock/atarifrosch_feed.xml +++ /dev/null @@ -1,473 +0,0 @@ - - - GNU social - https://social.stopwatchingus-heidelberg.de/api/statuses/user_timeline/18330.atom - atarifrosch-Zeitleiste - Aktualisierungen von atarifrosch auf social.stopwatchingus-heidelberg.de! - https://social.stopwatchingus-heidelberg.de/avatar/18330-96-20150628163706.png - 2017-08-24T12:06:55+02:00 - - http://activitystrea.ms/schema/1.0/person - https://social.stopwatchingus-heidelberg.de/user/18330 - atarifrosch - Nerd, Pirat, Debian user, CAcert assurer, Geocacher, Freifunker. Autismus/Depression, agender. GnuPG Key-ID: 0xBCF81ADE - - - - - - atarifrosch - Atari-Frosch - Nerd, Pirat, Debian user, CAcert assurer, Geocacher, Freifunker. Autismus/Depression, agender. GnuPG Key-ID: 0xBCF81ADE - - Düsseldorf, NRW, Germany - - - homepage - https://www.atari-frosch.de/ - true - - - - - - - - - - - - - - tag:social.stopwatchingus-heidelberg.de,2017-08-24:noticeId=978735:objectType=note - atarifrosch repeated a notice by hoergen - RT @<a href="https://social.hoergen.org/hoergen" class="h-card mention" title="hoergen">hoergen</a> Das falsche Bild der Tagesschau &quot;Auffallend &quot;erfolgreich&quot; - Andrea Nahles und Manuela Schwesig&quot; #<span class="tag"><a href="https://social.stopwatchingus-heidelberg.de/tag/geringverdiener" rel="tag">Geringverdiener</a></span> #<span class="tag"><a href="https://social.stopwatchingus-heidelberg.de/tag/mindestlohn" rel="tag">Mindestlohn</a></span> #<span class="tag"><a href="https://social.stopwatchingus-heidelberg.de/tag/mannxismus" rel="tag">mannxismus</a></span> #<span class="tag"><a href="https://social.stopwatchingus-heidelberg.de/tag/erwerbsminderungsrente" rel="tag">Erwerbsminderungsrente</a></span> #<span class="tag"><a href="https://social.stopwatchingus-heidelberg.de/tag/arbeitnehmerflexibilisierung" rel="tag">ArbeitnehmerFlexibilisierung</a></span> #<span class="tag"><a href="https://social.stopwatchingus-heidelberg.de/tag/altersarmut" rel="tag">AltersArmut</a></span> ..... <a href="http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html" title="http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html" class="attachment" id="attachment-450858" rel="nofollow external">http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html</a> - https://social.stopwatchingus-heidelberg.de/notice/978735 - http://activitystrea.ms/schema/1.0/share - 2017-08-24T09:18:25+00:00 - 2017-08-24T09:18:25+00:00 - - http://activitystrea.ms/schema/1.0/activity - tag:social.hoergen.org,2017-08-24:noticeId=222320:objectType=note - - Das falsche Bild der Tagesschau <br /> &quot;Auffallend &quot;erfolgreich&quot; - Andrea Nahles und Manuela Schwesig&quot; #<span class="tag"><a href="https://social.hoergen.org/tag/geringverdiener" rel="tag">Geringverdiener</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/mindestlohn" rel="tag">Mindestlohn</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/mannxismus" rel="tag">mannxismus</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/erwerbsminderungsrente" rel="tag">Erwerbsminderungsrente</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/arbeitnehmerflexibilisierung" rel="tag">ArbeitnehmerFlexibilisierung</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/altersarmut" rel="tag">AltersArmut</a></span> ..... <br /> <br /> <a href="http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html" title="http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html" rel="nofollow external noreferrer" class="attachment">http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html</a> - https://social.hoergen.org/notice/222320 - http://activitystrea.ms/schema/1.0/post - 2017-08-24T07:36:31+00:00 - 2017-08-24T07:36:31+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.hoergen.org/user/2 - hoergen - aka Andi Memyself #humanist #nerd Menschen liebhabender Misanthrop und auch sonst sehr vielseitig interessiert. - - - - - - hoergen - hoergen - aka Andi Memyself #humanist #nerd Menschen liebhabender Misanthrop und auch sonst sehr vielseitig interessiert. - - Berlin - - - homepage - https://hyperblog.de/hoergen/ - true - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.hoergen.org,2017-08-24:noticeId=222320:objectType=note - New note by hoergen - Das falsche Bild der Tagesschau <br /> &quot;Auffallend &quot;erfolgreich&quot; - Andrea Nahles und Manuela Schwesig&quot; #<span class="tag"><a href="https://social.hoergen.org/tag/geringverdiener" rel="tag">Geringverdiener</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/mindestlohn" rel="tag">Mindestlohn</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/mannxismus" rel="tag">mannxismus</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/erwerbsminderungsrente" rel="tag">Erwerbsminderungsrente</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/arbeitnehmerflexibilisierung" rel="tag">ArbeitnehmerFlexibilisierung</a></span> #<span class="tag"><a href="https://social.hoergen.org/tag/altersarmut" rel="tag">AltersArmut</a></span> ..... <br /> <br /> <a href="http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html" title="http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html" rel="nofollow external noreferrer" class="attachment">http://www.tagesschau.de/inland/btw17/bilanz-schwesig-nahles-101.html</a> - - - - - https://social.hoergen.org/conversation/98616 - - - - - - - - - https://social.hoergen.org/api/statuses/user_timeline/2.atom - hoergen - - - https://social.stopwatchingus-heidelberg.de/avatar/54316-original-20170824072526.jpeg - 2017-08-24T09:48:30+00:00 - - - - https://social.hoergen.org/conversation/98616 - - - - - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.stopwatchingus-heidelberg.de,2017-08-24:noticeId=978734:objectType=comment - New comment by atarifrosch - Jo, die Anzahl der Hartz-IV-Sanktionen nennt sie genausowenig wie die Anzahl der Menschen, die von den Repressionsbehörden in Obdachlosigkeit und Suizid getrieben wurden. Das würde die Erfolgszahlen dann doch ein wenig trüben, nech? - - - http://activitystrea.ms/schema/1.0/post - 2017-08-24T09:18:13+00:00 - 2017-08-24T09:18:13+00:00 - - - - https://social.hoergen.org/conversation/98616 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-24:noticeId=978732:objectType=note - New note by atarifrosch - Moin-quak. - - - http://activitystrea.ms/schema/1.0/post - 2017-08-24T09:09:39+00:00 - 2017-08-24T09:09:39+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-24:noticeId=978732:objectType=thread:crc32=2f92b7b6 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-23:noticeId=978594:objectType=note - New note by atarifrosch - n8-quak! - - - http://activitystrea.ms/schema/1.0/post - 2017-08-23T21:39:54+00:00 - 2017-08-23T21:39:54+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-23:noticeId=978594:objectType=thread:crc32=9bdb0ac9 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-23:noticeId=978503:objectType=note - New note by atarifrosch - 2017-08-16 Michal Špaček: Post a boarding pass on Facebook, get your account stolen – Post a boarding pass on Facebook, get your account stolen (gilt übrinx nicht nur für Facebook) - - - http://activitystrea.ms/schema/1.0/post - 2017-08-23T15:14:29+00:00 - 2017-08-23T15:14:29+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-23:noticeId=978503:objectType=thread:crc32=3de05c3a - - - - - - - tag:social.stopwatchingus-heidelberg.de,2017-08-23:fave:18330:activity:978458:2017-08-23T15:18:19+02:00 - Favorite - atarifrosch favorited something by einebiene: Haha, große Überraschung. <a href="http://www.sueddeutsche.de/wirtschaft/abgasaffaere-software-updates-fuer-dieselautos-helfen-kaum-1.3637636" title="http://www.sueddeutsche.de/wirtschaft/abgasaffaere-software-updates-fuer-dieselautos-helfen-kaum-1.3637636" rel="nofollow noreferrer" class="attachment">https://quitter.is/url/1122672</a><br /> Was ich an all diesen Artikeln schade finde, ist, daß immer nur auf den Umstieg von Auto zu anderem Auto gesprochen wird. Öffis werden nicht erwähnt, Carsharing nicht, radeln nicht, und in der Stadt wäre ne Vespa auch deutlich besser als ein SUV. - http://activitystrea.ms/schema/1.0/favorite - 2017-08-23T13:18:19+00:00 - 2017-08-23T13:18:19+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:quitter.is,2017-08-23:noticeId=4032910:objectType=note - New note by einebiene - Haha, große Überraschung. <a href="http://www.sueddeutsche.de/wirtschaft/abgasaffaere-software-updates-fuer-dieselautos-helfen-kaum-1.3637636" title="http://www.sueddeutsche.de/wirtschaft/abgasaffaere-software-updates-fuer-dieselautos-helfen-kaum-1.3637636" rel="nofollow noreferrer" class="attachment">https://quitter.is/url/1122672</a><br /> Was ich an all diesen Artikeln schade finde, ist, daß immer nur auf den Umstieg von Auto zu anderem Auto gesprochen wird. Öffis werden nicht erwähnt, Carsharing nicht, radeln nicht, und in der Stadt wäre ne Vespa auch deutlich besser als ein SUV. - - - - - - - https://quitter.is/conversation/2535246 - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-23:noticeId=978402:objectType=note - New note by atarifrosch - moin-quak - - - http://activitystrea.ms/schema/1.0/post - 2017-08-23T10:57:26+00:00 - 2017-08-23T10:57:26+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-23:noticeId=978402:objectType=thread:crc32=7050c397 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978164:objectType=note - New note by atarifrosch - n8-quak - - - http://activitystrea.ms/schema/1.0/post - 2017-08-22T19:54:30+00:00 - 2017-08-22T19:54:30+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978164:objectType=thread:crc32=b0a209c7 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978072:objectType=note - New note by atarifrosch - 2017-08-22 Bundesverfassungsgericht: Erfolgreiche Verfassungsbeschwerde gegen die Versagung vorläufiger Leistungen für Kosten der Unterkunft und Heizung – <a href="https://www.bundesverfassungsgericht.de/SharedDocs/Pressemitteilungen/DE/2017/bvg17-072.html" title="https://www.bundesverfassungsgericht.de/SharedDocs/Pressemitteilungen/DE/2017/bvg17-072.html" class="attachment" id="attachment-450768" rel="nofollow external">https://www.bundesverfassungsgericht.de/SharedDocs/Pressemitteilungen/DE/2017/bvg17-072.html</a> !<a href="http://quitter.se/group/2184/id" class="h-card group" title="HartzIV (hartziv)">hartziv</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-08-22T12:00:21+00:00 - 2017-08-22T12:00:21+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978072:objectType=thread:crc32=28a35f44 - - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978042:objectType=note - New note by atarifrosch - moin-quak! - - - http://activitystrea.ms/schema/1.0/post - 2017-08-22T07:55:27+00:00 - 2017-08-22T07:55:27+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-22:noticeId=978042:objectType=thread:crc32=f070a9f7 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-21:noticeId=977914:objectType=note - New note by atarifrosch - So, morgen geht's weiter. n8-quak! - - - http://activitystrea.ms/schema/1.0/post - 2017-08-21T22:09:53+00:00 - 2017-08-21T22:09:53+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-21:noticeId=977914:objectType=thread:crc32=c0a9f7fa - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-21:noticeId=977710:objectType=note - New note by atarifrosch - moin-quak. - - - http://activitystrea.ms/schema/1.0/post - 2017-08-21T08:58:26+00:00 - 2017-08-21T08:58:26+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-21:noticeId=977710:objectType=thread:crc32=60cfb466 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-20:noticeId=977526:objectType=note - New note by atarifrosch - Meine Augen meinen, für heute sei es genug. Nun denn. n8-quak. - - - http://activitystrea.ms/schema/1.0/post - 2017-08-20T19:58:16+00:00 - 2017-08-20T19:58:16+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-20:noticeId=977526:objectType=thread:crc32=ce79634 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-20:noticeId=977369:objectType=note - New note by atarifrosch - [Blog] Im Netz aufgefischt #<span class="tag"><a href="https://social.stopwatchingus-heidelberg.de/tag/330" rel="tag">330</a></span> – <a href="https://blog.atari-frosch.de/2017/08/20/im-netz-aufgefischt-330/" title="https://blog.atari-frosch.de/2017/08/20/im-netz-aufgefischt-330/" class="attachment" id="attachment-450668" rel="nofollow external">https://blog.atari-frosch.de/2017/08/20/im-netz-aufgefischt-330/</a> (was ich diese Woche so gelesen habe) - - - http://activitystrea.ms/schema/1.0/post - 2017-08-20T09:14:07+00:00 - 2017-08-20T09:14:07+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-20:noticeId=977369:objectType=thread:crc32=2f800b86 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-19:noticeId=977268:objectType=note - New note by atarifrosch - Fast ständig husten müssen ist echt anstrengend … naja, n8-quak. - - - http://activitystrea.ms/schema/1.0/post - 2017-08-19T21:59:20+00:00 - 2017-08-19T21:59:20+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-19:noticeId=977268:objectType=thread:crc32=deda767a - - - - - - - tag:social.stopwatchingus-heidelberg.de,2017-08-19:fave:18330:activity:977146:2017-08-19T21:39:26+02:00 - Favorite - atarifrosch favorited something by einebienezwo: Ich mach gerade Kompetenztraining.<br /> Ich trainiere die Kompetenz, eine halb aufgegessene Gummibärchentüte nicht ganz aufzuessen. - http://activitystrea.ms/schema/1.0/favorite - 2017-08-19T19:39:26+00:00 - 2017-08-19T19:39:26+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:gnusocial.de,2017-08-19:noticeId=11011264:objectType=note - New note by einebienezwo - Ich mach gerade Kompetenztraining.<br /> Ich trainiere die Kompetenz, eine halb aufgegessene Gummibärchentüte nicht ganz aufzuessen. - - - - - - - https://gnusocial.de/conversation/9363945 - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.stopwatchingus-heidelberg.de,2017-08-19:noticeId=977242:objectType=comment - New comment by atarifrosch - Wir hatten hier schon Ordnungsdienst auf'm Radweg. Fotografisch dokumentiert (nicht von mir, Bekannter hatte es gesehen). Da hatte grad 'ne Pizzeria neu eröffnet … - - - http://activitystrea.ms/schema/1.0/post - 2017-08-19T19:38:53+00:00 - 2017-08-19T19:38:53+00:00 - - - - https://gnusocial.de/conversation/9363813 - - - - - - - - tag:social.stopwatchingus-heidelberg.de,2017-08-19:fave:18330:activity:977180:2017-08-19T21:37:36+02:00 - Favorite - atarifrosch favorited something by jcaktiv: BTW Hallo zusammen &lt;3, wo ich schon mal wieder hier bin - http://activitystrea.ms/schema/1.0/favorite - 2017-08-19T19:37:36+00:00 - 2017-08-19T19:37:36+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:quitter.se,2017-08-19:noticeId=17372467:objectType=note - New note by jcaktiv - BTW Hallo zusammen &lt;3, wo ich schon mal wieder hier bin - - - - - - - tag:quitter.se,2017-08-19:objectType=thread:nonce=46c1c433d88aaa9f - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.stopwatchingus-heidelberg.de,2017-08-19:noticeId=976985:objectType=comment - New comment by atarifrosch - Jo, oder einfach mal nachfragen, so als Realitätsabgleich. - - - http://activitystrea.ms/schema/1.0/post - 2017-08-19T10:34:50+00:00 - 2017-08-19T10:34:50+00:00 - - - - https://gnusocial.de/conversation/9362516 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.stopwatchingus-heidelberg.de,2017-08-19:noticeId=976983:objectType=note - New note by atarifrosch - Schöne Alternative zu mit Werbung überladenen kommerziellen Anbietern: <a href="http://ifconfig.at/" title="http://ifconfig.at/" class="attachment" id="attachment-450636" rel="nofollow external">http://ifconfig.at/</a> – eigene IP, Hostname etc. abfragen, mit curl dann auch in Textform zur lokalen Weiterverarbeitung in Scripten etc. Leider (noch?) kein https. - - - http://activitystrea.ms/schema/1.0/post - 2017-08-19T10:33:04+00:00 - 2017-08-19T10:33:04+00:00 - - tag:social.stopwatchingus-heidelberg.de,2017-08-19:noticeId=976983:objectType=thread:crc32=4a3593c0 - - - - - - diff --git a/test/fixtures/tesla_mock/baptiste.gelex.xyz-article.json b/test/fixtures/tesla_mock/baptiste.gelex.xyz-article.json index 3f3f0f4fb..b76ba96a5 100644 --- a/test/fixtures/tesla_mock/baptiste.gelex.xyz-article.json +++ b/test/fixtures/tesla_mock/baptiste.gelex.xyz-article.json @@ -1 +1,227 @@ -{"@context":["https://www.w3.org/ns/activitystreams","https://w3id.org/security/v1",{"Emoji":"toot:Emoji","Hashtag":"as:Hashtag","atomUri":"ostatus:atomUri","conversation":"ostatus:conversation","featured":"toot:featured","focalPoint":{"@container":"@list","@id":"toot:focalPoint"},"inReplyToAtomUri":"ostatus:inReplyToAtomUri","manuallyApprovesFollowers":"as:manuallyApprovesFollowers","movedTo":"as:movedTo","ostatus":"http://ostatus.org#","sensitive":"as:sensitive","toot":"http://joinmastodon.org/ns#"}],"attributedTo":["https://baptiste.gelez.xyz/@/BaptisteGelez"],"cc":[],"content":"

It has been one month since the last \"This Month in Plume\" article, so it is time for another edition of our monthly changelog!

\n

Bug Fixes and Security

\n

Let's start with the hidden, but still (very) important changes: bug fixes and security patches.

\n

First of all, @Trinity protected us against two major security flaws, called XSS and CSRF. The first one allows the attacker to run malicious code if you visit a Plume page where some of their personal data is present. The second one lets them post data with your Plume account by visiting one of their own website. It is two very common attack, and it is great we are now protected against them!

\n

The other big change in this area, is that we are now validating the data you are sending before doing anything with it. It means that, for instance, you will no longer be able to register with an empty username and to break everything.

\n

On the federation side, many issues were reported by @kaniini and redmatrix (respectively contributing to Pleroma and Hubzilla). By fixing some of them, we made it possible to federate Plume articles to Pleroma!

\n

@Trinity hopefully noticed that there was a bug in our password check code: we were not checking that your password was correct, but only that the verification process went without errors. Concretely, it means that you could login to any account with any password. I wrote this part of the code when I was still the only contributor to the project, so nobody could review my work. We will now be trying to check every change, especially when it deals with critical parts of Plume, to avoid similar issues in the future, and we I'm really sorry this happened (even if I think nobody exploited it).

\n

Zanfib and stephenburgess8 also commited some small bugfixes, improving the general experience.

\n

New Features

\n

Let's now talk about the features that we introduced during this month.

\n

One of the most easy to spot is the redesign of Plume, made by @Madeorsk. I personaly love what he did, it really improved the readability and gave Plume a bit more of identity than the previous design. And he is still improving it.

\n

We also enabled Mardown in comment, to let you write more structured and nicely formatted responses.

\n

As you may have noticed, I have used mentions in this post. Indeed, it is now possible to mention someone in your articles or in comments. It works exactly the same way as in other apps, and you should receive a notification if someone mentionned you.

\n

A dashboard to manage your blogs has also been introduced. In the future it may be used to manage your drafts, and eventually to show some statistics. The goal is to have a more specific homepage for authors.

\n

The federation with other ActivityPub softwares, like Mastodon or Pleroma is starting to work quite well, but the federation between Plume instances is far from being complete. However, we started to work on it, and it is now possible to view a distant user profile or blog from your instance, even if only basic informations are fetched yet (the articles are not loaded for instance).

\n

Another new feature that may not be visible for everyone, is the new NodeInfo endpoint. NodeInfo is a protocol allowing to get informations about a specific federated instance (whatever software it runs). It means that Plume instances can now be listed on sites like fediverse.network.

\n

Maybe you wanted to host a Plume instance, but you don't like long install process during which you are just copy/pasting commands that you don't really understand from the documentation. That's why we introduced a setup script: the first you'll launch Plume, it will ask you a few questions and automatically setup your instance in a few minutes. We hope that this feature will help to host small instances, run by non-professional adminsys. You can see a demo of this tool on asciinema.

\n

Last but not least, Plume is now translatable! It is already available in English, French, Polish (thanks to @m4sk1n)) and German (thanks to bitkeks). If your browser is configured to display pages in these languages, you should normally see the interface in your language. And if your language is not present yet, feel free to add your translation.

\n

Other Changes

\n

We also improved the code a lot. We tried to separate each part as much as possible, making it easier to re-use for other projects. For instance, our database code is now isolated from the rest of the app, which means it will be easier to make import tools from other blogging engines. Some parts of the code are even shared with another project, Aardwolf a federated Facebook alternative. For instance, both of our projects use the same internationalization code, and once Aardwolf will implement federation, this part of the code will probably be shared too. Since the WebFinger module (used to find new users and blogs) and the CSRF protection code (see the \"Bug fixes and Security\" section) have been isolated in their own modules, they may be shared by both projects too.

\n

We also worked a lot on documentation. We now have articles explaining how to setup your Plume instance on various operating systems, but also documenting the translation process. I want to thank BanjoFox (who imported some documentation from their project, Aardwolf, as the setup is quite similar), Kushal and @gled@plume.mastodon.host for working on this.

\n

As you can see, there were many changes this month, but there still a lot to do. Your help will of course be welcome. If you want to contribute to the code, translate Plume in your language, write some documentation, or anything else (or even if you're just curious about the project), feel free to join our Matrix room: #plume:disroot.org. Otherwise, as BanjoFox said on the Aardwolf Team Mastodon account, talking about the project around you is one of the easiest way to help.

\n","id":"https://baptiste.gelez.xyz/~/PlumeDevelopment/this-month-in-plume-june-2018/","likes":null,"name":"This Month in Plume: June 2018","published":"2018-07-10T20:16:24.087622Z","shares":null,"source":null,"tag":[{"href":"https://baptiste.gelez.xyz/@/Trinity","name":"@Trinity","type":"Mention"},{"href":"https://baptiste.gelez.xyz/@/kaniini/","name":"@kaniini","type":"Mention"},{"href":"https://baptiste.gelez.xyz/@/Trinity","name":"@Trinity","type":"Mention"}],"to":["https://unixcorn.xyz/users/Bat","https://mastodon.host/users/federationbot","https://social.tcit.fr/users/tcit","https://framapiaf.org/users/qwerty","https://mastodon.social/users/lthms","https://eldritch.cafe/users/Nausicaa","https://imaginair.es/users/Elanndelh","https://framapiaf.org/users/Drulac","https://mastodon.partipirate.org/users/NicolasConstant","https://aleph.land/users/Madeorsk","https://maly.io/users/Troll","https://hostux.social/users/superjey","https://mamot.fr/users/Phigger","https://mastodon.social/users/wakest","https://social.coop/users/wakest","https://unixcorn.xyz/users/Ce_lo","https://social.art-software.fr/users/Electron","https://framapiaf.org/users/Quenti","https://toot.plus.yt/users/Djyp","https://mastodon.social/users/brainblasted","https://social.mochi.academy/users/Ambraven","https://social.hacktivis.me/users/lanodan","https://mastodon.eliotberriot.com/users/eliotberriot","https://edolas.world/users/0x1C3B00DA","https://toot.cafe/users/zack","https://manowar.social/users/zatnosk","https://eldritch.cafe/users/fluffy","https://mastodon.social/users/david_ross","https://kosmos.social/users/xiroux","https://mastodon.art/users/EmergencyBattle","https://mastodon.social/users/trwnh","https://octodon.social/users/pybyte","https://anticapitalist.party/users/Trinity","https://mstdn.mx/users/xavavu","https://baptiste.gelez.xyz/@/m4sk1n","https://eldritch.cafe/users/milia","https://mastodon.zaclys.com/users/arx","https://toot.cafe/users/sivy","https://mastodon.social/users/ortegacmanuel","https://mastodon.observer/users/stephen","https://octodon.social/users/chloe","https://unixcorn.xyz/users/AmauryPi","https://cybre.space/users/rick_777","https://mastodon.social/users/wezm","https://baptiste.gelez.xyz/@/idlesong","https://mamot.fr/users/dr4Ke","https://imaginair.es/users/Phigger","https://mamot.fr/users/dlink","https://anticapitalist.party/users/a000d4f7a91939d0e71df1646d7a48","https://framapiaf.org/users/PhieLaidMignon","https://mastodon.social/users/y6nH","https://crazynoisybizarre.town/users/FederationBot","https://social.weho.st/users/dvn","https://mastodon.art/users/Wolthera","https://diaspodon.fr/users/dada","https://pachyder.me/users/Lanza","https://mastodon.xyz/users/ag","https://aleph.land/users/yahananxie","https://mstdn.io/users/chablis_social","https://mastodon.gougere.fr/users/fabien","https://functional.cafe/users/otini","https://social.coop/users/bhaugen","https://octodon.social/users/donblanco","https://chaos.social/users/astro","https://pachyder.me/users/sibear","https://mamot.fr/users/yohann","https://social.wxcafe.net/users/Bat","https://mastodon.social/users/dansup","https://chaos.social/users/juh","https://scifi.fyi/users/paeneultima","https://hostux.social/users/Deuchnord","https://mstdn.fr/users/taziden","https://mamot.fr/users/PifyZ","https://mastodon.social/users/plantabaja","https://mastodon.social/users/gitzgrog","https://mastodon.social/users/Syluban","https://masto.pt/users/eloisa","https://pleroma.soykaf.com/users/notclacke","https://mastodon.social/users/SiegfriedEhret","https://writing.exchange/users/write_as","https://mstdn.io/users/shellkr","https://mastodon.uy/users/jorge","https://mastodon.technology/users/bobstechsite","https://mastodon.social/users/hinterwaeldler","https://mastodon.xyz/users/mgdelacroix","https://mastodon.cloud/users/jjatria","https://baptiste.gelez.xyz/@/Jade/","https://edolas.world/users/pfm","https://mstdn.io/users/jort","https://mastodon.social/users/andreipetcu","https://mastodon.technology/users/0xf00fc7c8","https://mastodon.social/users/khanate","https://mastodon.technology/users/francois","https://mastodon.social/users/glherrmann","https://mastodon.host/users/gled","https://social.holdmybeer.solutions/users/kemonine","https://scholar.social/users/bgcarlisle","https://mastodon.social/users/oldgun","https://baptiste.gelez.xyz/@/snoe/","https://mastodon.at/users/switchingsocial","https://scifi.fyi/users/BrokenBiscuit","https://dev.glitch.social/users/hoodie","https://todon.nl/users/paulfree14","https://mastodon.social/users/aadilayub","https://social.fsck.club/users/anarchosaurus","https://mastodonten.de/users/GiantG","https://mastodon.technology/users/cj","https://cybre.space/users/sam","https://layer8.space/users/silkevicious","https://mastodon.xyz/users/Jimmyrwx","https://fosstodon.org/users/danyspin97","https://mstdn.io/users/cristhyano","https://mastodon.social/users/vanyok","https://hulvr.com/users/rook","https://niu.moe/users/Lucifer","https://mamot.fr/users/Thibaut","https://mastodont.cat/users/bgta","https://mstdn.io/users/hontoni","https://niu.moe/users/lionirdeadman","https://functional.cafe/users/phoe","https://mastodon.social/users/toontoet","https://mastodon.social/users/danipozo","https://scholar.social/users/robertson","https://mastodon.social/users/aldatsa","https://elekk.xyz/users/maloki","https://kitty.town/users/nursemchurt","https://neigh.horse/users/commagray","https://mastodon.social/users/hirojin","https://mastodon.xyz/users/mareklach","https://chaos.social/users/benthor","https://mastodon.social/users/djperreault","https://mastodon.art/users/eylul","https://mastodon.opportunis.me/users/bob","https://tootplanet.space/users/Shutsumon","https://toot.cat/users/woozle","https://mastodon.social/users/StephenLB","https://sleeping.town/users/oct2pus","https://mastodon.indie.host/users/stragu","https://social.coop/users/gilscottfitzgerald","https://icosahedron.website/users/joeld","https://mastodon.social/users/hellion","https://cybre.space/users/cooler_ranch","https://mastodon.social/users/kelsonv","https://mastodon.lat/users/scalpol","https://writing.exchange/users/hnb","https://hex.bz/users/Horst","https://mastodon.social/users/weddle","https://maly.io/users/sonya","https://social.coop/users/medusa","https://mastodon.social/users/DystopianK","https://mstdn.io/users/d_io","https://fosstodon.org/users/brandon","https://fosstodon.org/users/Cando","https://mastodon.host/users/panina","https://floss.social/users/tuxether","https://social.tchncs.de/users/suitbertmonz","https://mastodon.social/users/jrt","https://mastodon.social/users/sirikon","https://mstdn.io/users/yabirgb","https://mastodon.cloud/users/FerdiZ","https://mastodon.social/users/carlchenet","https://social.polonkai.eu/users/calendar_social","https://social.polonkai.eu/users/gergely","https://mastodon.social/users/Jelv","https://mastodon.social/users/srinicame","https://cybre.space/users/mastoabed","https://mastodon.social/users/tagomago","https://lgbt.io/users/bootblackCub","https://niu.moe/users/Nopplyy","https://mastodon.social/users/bpugh","https://www.w3.org/ns/activitystreams#Public"],"type":"Article","uploadMedia":null,"url":"https://baptiste.gelez.xyz/~/PlumeDevelopment/this-month-in-plume-june-2018/"} \ No newline at end of file +{ + "@context" : [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "Emoji" : "toot:Emoji", + "Hashtag" : "as:Hashtag", + "atomUri" : "ostatus:atomUri", + "conversation" : "ostatus:conversation", + "featured" : "toot:featured", + "focalPoint" : { + "@container" : "@list", + "@id" : "toot:focalPoint" + }, + "inReplyToAtomUri" : "ostatus:inReplyToAtomUri", + "manuallyApprovesFollowers" : "as:manuallyApprovesFollowers", + "movedTo" : "as:movedTo", + "ostatus" : "http://ostatus.org#", + "sensitive" : "as:sensitive", + "toot" : "http://joinmastodon.org/ns#" + } + ], + "attributedTo" : [ + "https://baptiste.gelez.xyz/@/BaptisteGelez" + ], + "cc" : [], + "content" : "

It has been one month since the last \"This Month in Plume\" article, so it is time for another edition of our monthly changelog!

\n

Bug Fixes and Security

\n

Let's start with the hidden, but still (very) important changes: bug fixes and security patches.

\n

First of all, @Trinity protected us against two major security flaws, called XSS and CSRF. The first one allows the attacker to run malicious code if you visit a Plume page where some of their personal data is present. The second one lets them post data with your Plume account by visiting one of their own website. It is two very common attack, and it is great we are now protected against them!

\n

The other big change in this area, is that we are now validating the data you are sending before doing anything with it. It means that, for instance, you will no longer be able to register with an empty username and to break everything.

\n

On the federation side, many issues were reported by @kaniini and redmatrix (respectively contributing to Pleroma and Hubzilla). By fixing some of them, we made it possible to federate Plume articles to Pleroma!

\n

@Trinity hopefully noticed that there was a bug in our password check code: we were not checking that your password was correct, but only that the verification process went without errors. Concretely, it means that you could login to any account with any password. I wrote this part of the code when I was still the only contributor to the project, so nobody could review my work. We will now be trying to check every change, especially when it deals with critical parts of Plume, to avoid similar issues in the future, and we I'm really sorry this happened (even if I think nobody exploited it).

\n

Zanfib and stephenburgess8 also commited some small bugfixes, improving the general experience.

\n

New Features

\n

Let's now talk about the features that we introduced during this month.

\n

One of the most easy to spot is the redesign of Plume, made by @Madeorsk. I personaly love what he did, it really improved the readability and gave Plume a bit more of identity than the previous design. And he is still improving it.

\n

We also enabled Mardown in comment, to let you write more structured and nicely formatted responses.

\n

As you may have noticed, I have used mentions in this post. Indeed, it is now possible to mention someone in your articles or in comments. It works exactly the same way as in other apps, and you should receive a notification if someone mentionned you.

\n

A dashboard to manage your blogs has also been introduced. In the future it may be used to manage your drafts, and eventually to show some statistics. The goal is to have a more specific homepage for authors.

\n

The federation with other ActivityPub softwares, like Mastodon or Pleroma is starting to work quite well, but the federation between Plume instances is far from being complete. However, we started to work on it, and it is now possible to view a distant user profile or blog from your instance, even if only basic informations are fetched yet (the articles are not loaded for instance).

\n

Another new feature that may not be visible for everyone, is the new NodeInfo endpoint. NodeInfo is a protocol allowing to get informations about a specific federated instance (whatever software it runs). It means that Plume instances can now be listed on sites like fediverse.network.

\n

Maybe you wanted to host a Plume instance, but you don't like long install process during which you are just copy/pasting commands that you don't really understand from the documentation. That's why we introduced a setup script: the first you'll launch Plume, it will ask you a few questions and automatically setup your instance in a few minutes. We hope that this feature will help to host small instances, run by non-professional adminsys. You can see a demo of this tool on asciinema.

\n

Last but not least, Plume is now translatable! It is already available in English, French, Polish (thanks to @m4sk1n)) and German (thanks to bitkeks). If your browser is configured to display pages in these languages, you should normally see the interface in your language. And if your language is not present yet, feel free to add your translation.

\n

Other Changes

\n

We also improved the code a lot. We tried to separate each part as much as possible, making it easier to re-use for other projects. For instance, our database code is now isolated from the rest of the app, which means it will be easier to make import tools from other blogging engines. Some parts of the code are even shared with another project, Aardwolf a federated Facebook alternative. For instance, both of our projects use the same internationalization code, and once Aardwolf will implement federation, this part of the code will probably be shared too. Since the WebFinger module (used to find new users and blogs) and the CSRF protection code (see the \"Bug fixes and Security\" section) have been isolated in their own modules, they may be shared by both projects too.

\n

We also worked a lot on documentation. We now have articles explaining how to setup your Plume instance on various operating systems, but also documenting the translation process. I want to thank BanjoFox (who imported some documentation from their project, Aardwolf, as the setup is quite similar), Kushal and @gled@plume.mastodon.host for working on this.

\n

As you can see, there were many changes this month, but there still a lot to do. Your help will of course be welcome. If you want to contribute to the code, translate Plume in your language, write some documentation, or anything else (or even if you're just curious about the project), feel free to join our Matrix room: #plume:disroot.org. Otherwise, as BanjoFox said on the Aardwolf Team Mastodon account, talking about the project around you is one of the easiest way to help.

\n", + "id" : "https://baptiste.gelez.xyz/~/PlumeDevelopment/this-month-in-plume-june-2018/", + "likes" : null, + "name" : "This Month in Plume: June 2018", + "published" : "2018-07-10T20:16:24.087622Z", + "shares" : null, + "source" : null, + "tag" : [ + { + "href" : "https://baptiste.gelez.xyz/@/Trinity", + "name" : "@Trinity", + "type" : "Mention" + }, + { + "href" : "https://baptiste.gelez.xyz/@/kaniini/", + "name" : "@kaniini", + "type" : "Mention" + }, + { + "href" : "https://baptiste.gelez.xyz/@/Trinity", + "name" : "@Trinity", + "type" : "Mention" + } + ], + "to" : [ + "https://unixcorn.xyz/users/Bat", + "https://mastodon.host/users/federationbot", + "https://social.tcit.fr/users/tcit", + "https://framapiaf.org/users/qwerty", + "https://mastodon.social/users/lthms", + "https://eldritch.cafe/users/Nausicaa", + "https://imaginair.es/users/Elanndelh", + "https://framapiaf.org/users/Drulac", + "https://mastodon.partipirate.org/users/NicolasConstant", + "https://aleph.land/users/Madeorsk", + "https://maly.io/users/Troll", + "https://hostux.social/users/superjey", + "https://mamot.fr/users/Phigger", + "https://mastodon.social/users/wakest", + "https://social.coop/users/wakest", + "https://unixcorn.xyz/users/Ce_lo", + "https://social.art-software.fr/users/Electron", + "https://framapiaf.org/users/Quenti", + "https://toot.plus.yt/users/Djyp", + "https://mastodon.social/users/brainblasted", + "https://social.mochi.academy/users/Ambraven", + "https://social.hacktivis.me/users/lanodan", + "https://mastodon.eliotberriot.com/users/eliotberriot", + "https://edolas.world/users/0x1C3B00DA", + "https://toot.cafe/users/zack", + "https://manowar.social/users/zatnosk", + "https://eldritch.cafe/users/fluffy", + "https://mastodon.social/users/david_ross", + "https://kosmos.social/users/xiroux", + "https://mastodon.art/users/EmergencyBattle", + "https://mastodon.social/users/trwnh", + "https://octodon.social/users/pybyte", + "https://anticapitalist.party/users/Trinity", + "https://mstdn.mx/users/xavavu", + "https://baptiste.gelez.xyz/@/m4sk1n", + "https://eldritch.cafe/users/milia", + "https://mastodon.zaclys.com/users/arx", + "https://toot.cafe/users/sivy", + "https://mastodon.social/users/ortegacmanuel", + "https://mastodon.observer/users/stephen", + "https://octodon.social/users/chloe", + "https://unixcorn.xyz/users/AmauryPi", + "https://cybre.space/users/rick_777", + "https://mastodon.social/users/wezm", + "https://baptiste.gelez.xyz/@/idlesong", + "https://mamot.fr/users/dr4Ke", + "https://imaginair.es/users/Phigger", + "https://mamot.fr/users/dlink", + "https://anticapitalist.party/users/a000d4f7a91939d0e71df1646d7a48", + "https://framapiaf.org/users/PhieLaidMignon", + "https://mastodon.social/users/y6nH", + "https://crazynoisybizarre.town/users/FederationBot", + "https://social.weho.st/users/dvn", + "https://mastodon.art/users/Wolthera", + "https://diaspodon.fr/users/dada", + "https://pachyder.me/users/Lanza", + "https://mastodon.xyz/users/ag", + "https://aleph.land/users/yahananxie", + "https://mstdn.io/users/chablis_social", + "https://mastodon.gougere.fr/users/fabien", + "https://functional.cafe/users/otini", + "https://social.coop/users/bhaugen", + "https://octodon.social/users/donblanco", + "https://chaos.social/users/astro", + "https://pachyder.me/users/sibear", + "https://mamot.fr/users/yohann", + "https://social.wxcafe.net/users/Bat", + "https://mastodon.social/users/dansup", + "https://chaos.social/users/juh", + "https://scifi.fyi/users/paeneultima", + "https://hostux.social/users/Deuchnord", + "https://mstdn.fr/users/taziden", + "https://mamot.fr/users/PifyZ", + "https://mastodon.social/users/plantabaja", + "https://mastodon.social/users/gitzgrog", + "https://mastodon.social/users/Syluban", + "https://masto.pt/users/eloisa", + "https://pleroma.soykaf.com/users/notclacke", + "https://mastodon.social/users/SiegfriedEhret", + "https://writing.exchange/users/write_as", + "https://mstdn.io/users/shellkr", + "https://mastodon.uy/users/jorge", + "https://mastodon.technology/users/bobstechsite", + "https://mastodon.social/users/hinterwaeldler", + "https://mastodon.xyz/users/mgdelacroix", + "https://mastodon.cloud/users/jjatria", + "https://baptiste.gelez.xyz/@/Jade/", + "https://edolas.world/users/pfm", + "https://mstdn.io/users/jort", + "https://mastodon.social/users/andreipetcu", + "https://mastodon.technology/users/0xf00fc7c8", + "https://mastodon.social/users/khanate", + "https://mastodon.technology/users/francois", + "https://mastodon.social/users/glherrmann", + "https://mastodon.host/users/gled", + "https://social.holdmybeer.solutions/users/kemonine", + "https://scholar.social/users/bgcarlisle", + "https://mastodon.social/users/oldgun", + "https://baptiste.gelez.xyz/@/snoe/", + "https://mastodon.at/users/switchingsocial", + "https://scifi.fyi/users/BrokenBiscuit", + "https://dev.glitch.social/users/hoodie", + "https://todon.nl/users/paulfree14", + "https://mastodon.social/users/aadilayub", + "https://social.fsck.club/users/anarchosaurus", + "https://mastodonten.de/users/GiantG", + "https://mastodon.technology/users/cj", + "https://cybre.space/users/sam", + "https://layer8.space/users/silkevicious", + "https://mastodon.xyz/users/Jimmyrwx", + "https://fosstodon.org/users/danyspin97", + "https://mstdn.io/users/cristhyano", + "https://mastodon.social/users/vanyok", + "https://hulvr.com/users/rook", + "https://niu.moe/users/Lucifer", + "https://mamot.fr/users/Thibaut", + "https://mastodont.cat/users/bgta", + "https://mstdn.io/users/hontoni", + "https://niu.moe/users/lionirdeadman", + "https://functional.cafe/users/phoe", + "https://mastodon.social/users/toontoet", + "https://mastodon.social/users/danipozo", + "https://scholar.social/users/robertson", + "https://mastodon.social/users/aldatsa", + "https://elekk.xyz/users/maloki", + "https://kitty.town/users/nursemchurt", + "https://neigh.horse/users/commagray", + "https://mastodon.social/users/hirojin", + "https://mastodon.xyz/users/mareklach", + "https://chaos.social/users/benthor", + "https://mastodon.social/users/djperreault", + "https://mastodon.art/users/eylul", + "https://mastodon.opportunis.me/users/bob", + "https://tootplanet.space/users/Shutsumon", + "https://toot.cat/users/woozle", + "https://mastodon.social/users/StephenLB", + "https://sleeping.town/users/oct2pus", + "https://mastodon.indie.host/users/stragu", + "https://social.coop/users/gilscottfitzgerald", + "https://icosahedron.website/users/joeld", + "https://mastodon.social/users/hellion", + "https://cybre.space/users/cooler_ranch", + "https://mastodon.social/users/kelsonv", + "https://mastodon.lat/users/scalpol", + "https://writing.exchange/users/hnb", + "https://hex.bz/users/Horst", + "https://mastodon.social/users/weddle", + "https://maly.io/users/sonya", + "https://social.coop/users/medusa", + "https://mastodon.social/users/DystopianK", + "https://mstdn.io/users/d_io", + "https://fosstodon.org/users/brandon", + "https://fosstodon.org/users/Cando", + "https://mastodon.host/users/panina", + "https://floss.social/users/tuxether", + "https://social.tchncs.de/users/suitbertmonz", + "https://mastodon.social/users/jrt", + "https://mastodon.social/users/sirikon", + "https://mstdn.io/users/yabirgb", + "https://mastodon.cloud/users/FerdiZ", + "https://mastodon.social/users/carlchenet", + "https://social.polonkai.eu/users/calendar_social", + "https://social.polonkai.eu/users/gergely", + "https://mastodon.social/users/Jelv", + "https://mastodon.social/users/srinicame", + "https://cybre.space/users/mastoabed", + "https://mastodon.social/users/tagomago", + "https://lgbt.io/users/bootblackCub", + "https://niu.moe/users/Nopplyy", + "https://mastodon.social/users/bpugh", + "https://www.w3.org/ns/activitystreams#Public" + ], + "type" : "Article", + "uploadMedia" : null, + "url" : "https://baptiste.gelez.xyz/~/PlumeDevelopment/this-month-in-plume-june-2018/" +} diff --git a/test/fixtures/tesla_mock/dist/test.txt b/test/fixtures/tesla_mock/dist/test.txt new file mode 100644 index 000000000..e9ea42a12 --- /dev/null +++ b/test/fixtures/tesla_mock/dist/test.txt @@ -0,0 +1 @@ +this is a text file diff --git a/test/fixtures/tesla_mock/emelie.atom b/test/fixtures/tesla_mock/emelie.atom deleted file mode 100644 index ddaa1c6ca..000000000 --- a/test/fixtures/tesla_mock/emelie.atom +++ /dev/null @@ -1,306 +0,0 @@ - - - https://mastodon.social/users/emelie.atom - emelie 🎨 - 23 / #Sweden / #Artist / #Equestrian / #GameDev - -If I ain't spending time with my pets, I'm probably drawing. 🐴 🐱 🐰 - 2019-02-04T20:22:19Z - https://files.mastodon.social/accounts/avatars/000/015/657/original/e7163f98280da1a4.png - - https://mastodon.social/users/emelie - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/emelie - emelie - emelie@mastodon.social - <p>23 / <a href="https://mastodon.social/tags/sweden" class="mention hashtag" rel="tag">#<span>Sweden</span></a> / <a href="https://mastodon.social/tags/artist" class="mention hashtag" rel="tag">#<span>Artist</span></a> / <a href="https://mastodon.social/tags/equestrian" class="mention hashtag" rel="tag">#<span>Equestrian</span></a> / <a href="https://mastodon.social/tags/gamedev" class="mention hashtag" rel="tag">#<span>GameDev</span></a></p><p>If I ain&apos;t spending time with my pets, I&apos;m probably drawing. 🐴 🐱 🐰</p> - - - - emelie - emelie 🎨 - 23 / #Sweden / #Artist / #Equestrian / #GameDev - -If I ain't spending time with my pets, I'm probably drawing. 🐴 🐱 🐰 - public - - - - - - - https://mastodon.social/users/emelie/statuses/101850331907006641 - 2019-04-01T09:58:50Z - 2019-04-01T09:58:50Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>Me: I&apos;m going to make this vital change to my world building in the morning, no way I&apos;ll forget this, it&apos;s too big of a deal<br />Also me: forgets</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101849626603073336 - 2019-04-01T06:59:28Z - 2019-04-01T06:59:28Z - New status by emelie - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - - <p><span class="h-card"><a href="https://mastodon.social/@Fergant" class="u-url mention">@<span>Fergant</span></a></span> Dom är i stort sett religiös skrift vid det här laget 👏👏</p><p>har dock bara läst svenska översättningen, kanske är dags att jag läser dom på engelska</p> - - - public - - - - - - - https://mastodon.social/users/emelie/statuses/101849580030237068 - 2019-04-01T06:47:37Z - 2019-04-01T06:47:37Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>What&apos;s you people&apos;s favourite fantasy books? Give me some hot tips 🌞</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101849550599949363 - 2019-04-01T06:40:08Z - 2019-04-01T06:40:08Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>Stick them legs out 💃 <a href="https://mastodon.social/tags/mastocats" class="mention hashtag" rel="tag">#<span>mastocats</span></a></p> - - - - public - - - - - - https://mastodon.social/users/emelie/statuses/101849191533152720 - 2019-04-01T05:08:49Z - 2019-04-01T05:08:49Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>long 🐱 <a href="https://mastodon.social/tags/mastocats" class="mention hashtag" rel="tag">#<span>mastocats</span></a></p> - - - - public - - - - - - https://mastodon.social/users/emelie/statuses/101849165031453009 - 2019-04-01T05:02:05Z - 2019-04-01T05:02:05Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>You gotta take whatever bellyrubbing opportunity you can get before she changes her mind 🦁 <a href="https://mastodon.social/tags/mastocats" class="mention hashtag" rel="tag">#<span>mastocats</span></a></p> - - - - public - - - - - - https://mastodon.social/users/emelie/statuses/101846512530748693 - 2019-03-31T17:47:31Z - 2019-03-31T17:47:31Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>Hello look at this boy having a decent haircut for once <a href="https://mastodon.social/tags/mastohorses" class="mention hashtag" rel="tag">#<span>mastohorses</span></a> <a href="https://mastodon.social/tags/equestrian" class="mention hashtag" rel="tag">#<span>equestrian</span></a></p> - - - - - public - - - - - - https://mastodon.social/users/emelie/statuses/101846181093805500 - 2019-03-31T16:23:14Z - 2019-03-31T16:23:14Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>Sorry did I disturb the who-is-the-longest-cat competition ? <a href="https://mastodon.social/tags/mastocats" class="mention hashtag" rel="tag">#<span>mastocats</span></a></p> - - - - public - - - - - - https://mastodon.social/users/emelie/statuses/101845897513133849 - 2019-03-31T15:11:07Z - 2019-03-31T15:11:07Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - more earthsea ramblings - <p>I&apos;m re-watching Tales from Earthsea for the first time since I read the books, and that Therru doesn&apos;t squash Cob like a spider, as Orm Embar did is a wasted opportunity tbh</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101841219051533307 - 2019-03-30T19:21:19Z - 2019-03-30T19:21:19Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>I gave my cats some mackerel and they ate it all in 0.3 seconds, and now they won&apos;t stop meowing for more, and I&apos;m tired plz shut up</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101839949762341381 - 2019-03-30T13:58:31Z - 2019-03-30T13:58:31Z - New status by emelie - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - - <p>yet I&apos;m confused about this american dude with a gun, like the heck r ya doin in mah ghibli</p> - - public - - - - - - - https://mastodon.social/users/emelie/statuses/101839928677863590 - 2019-03-30T13:53:09Z - 2019-03-30T13:53:09Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>2 hours into Ni no Kuni 2 and I&apos;ve already sold my soul to this game</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101836329521599438 - 2019-03-29T22:37:51Z - 2019-03-29T22:37:51Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>Pippi Longstocking the original one-punch /man</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101835905282948341 - 2019-03-29T20:49:57Z - 2019-03-29T20:49:57Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>I&apos;ve had so much wine I thought I had a 3rd brother</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101835878059204660 - 2019-03-29T20:43:02Z - 2019-03-29T20:43:02Z - New status by emelie - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - - <p>ååååhhh booi</p> - - public - - - - - - https://mastodon.social/users/emelie/statuses/101835848050598939 - 2019-03-29T20:35:24Z - 2019-03-29T20:35:24Z - New status by emelie - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - - <p><span class="h-card"><a href="https://thraeryn.net/@thraeryn" class="u-url mention">@<span>thraeryn</span></a></span> if I spent 1 hour and a half watching this monstrosity, I need to</p> - - - public - - - - - - - https://mastodon.social/users/emelie/statuses/101835823138262290 - 2019-03-29T20:29:04Z - 2019-03-29T20:29:04Z - New status by emelie - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - - medical, fluids mention - <p><span class="h-card"><a href="https://icosahedron.website/@Trev" class="u-url mention">@<span>Trev</span></a></span> *hugs* ✨</p> - - - public - - - - - - diff --git a/test/fixtures/tesla_mock/framatube.org-video.json b/test/fixtures/tesla_mock/framatube.org-video.json new file mode 100644 index 000000000..3d53f0c97 --- /dev/null +++ b/test/fixtures/tesla_mock/framatube.org-video.json @@ -0,0 +1 @@ +{"type":"Video","id":"https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206","name":"Déframasoftisons Internet [Framasoft]","duration":"PT3622S","uuid":"6050732a-8a7a-43d4-a6cd-809525a1d206","tag":[{"type":"Hashtag","name":"déframasoftisons"},{"type":"Hashtag","name":"EPN23"},{"type":"Hashtag","name":"framaconf"},{"type":"Hashtag","name":"Framasoft"},{"type":"Hashtag","name":"pyg"}],"category":{"identifier":"15","name":"Science & Technology"},"views":122,"sensitive":false,"waitTranscoding":false,"state":1,"commentsEnabled":true,"downloadEnabled":true,"published":"2020-05-24T18:34:31.569Z","originallyPublishedAt":"2019-11-30T23:00:00.000Z","updated":"2020-07-05T09:01:01.720Z","mediaType":"text/markdown","content":"Après avoir mené avec un certain succès la campagne « Dégooglisons Internet » en 2014, l’association Framasoft annonce fin 2019 arrêter progressivement un certain nombre de ses services alternatifs aux GAFAM. Pourquoi ?\r\n\r\nTranscription par @april...","support":null,"subtitleLanguage":[],"icon":{"type":"Image","url":"https://framatube.org/static/thumbnails/6050732a-8a7a-43d4-a6cd-809525a1d206.jpg","mediaType":"image/jpeg","width":223,"height":122},"url":[{"type":"Link","mediaType":"text/html","href":"https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206"},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/webseed/6050732a-8a7a-43d4-a6cd-809525a1d206-1080.mp4","height":1080,"size":1157359410,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309939","height":1080,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-1080.torrent","height":1080},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-1080.torrent&xt=urn:btih:381c9429900552e23a4eb506318f1fa01e4d63a8&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fwebseed%2F6050732a-8a7a-43d4-a6cd-809525a1d206-1080.mp4&ws=https%3A%2F%2Fpeertube.iselfhost.com%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-1080.mp4&ws=https%3A%2F%2Ftube.privacytools.io%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-1080.mp4&ws=https%3A%2F%2Fpeertube.live%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-1080.mp4","height":1080},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/webseed/6050732a-8a7a-43d4-a6cd-809525a1d206-480.mp4","height":480,"size":250095131,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309941","height":480,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-480.torrent","height":480},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-480.torrent&xt=urn:btih:a181dcbb5368ab5c31cc9ff07634becb72c344ee&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fwebseed%2F6050732a-8a7a-43d4-a6cd-809525a1d206-480.mp4&ws=https%3A%2F%2Fpeertube.iselfhost.com%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-480.mp4&ws=https%3A%2F%2Ftube.privacytools.io%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-480.mp4&ws=https%3A%2F%2Fpeertube.live%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-480.mp4","height":480},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/webseed/6050732a-8a7a-43d4-a6cd-809525a1d206-360.mp4","height":360,"size":171357733,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309942","height":360,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-360.torrent","height":360},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-360.torrent&xt=urn:btih:aedfa9479ea04a175eee0b0bd0bda64076308746&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fwebseed%2F6050732a-8a7a-43d4-a6cd-809525a1d206-360.mp4&ws=https%3A%2F%2Fpeertube.iselfhost.com%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-360.mp4&ws=https%3A%2F%2Ftube.privacytools.io%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-360.mp4&ws=https%3A%2F%2Fpeertube.live%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-360.mp4","height":360},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/webseed/6050732a-8a7a-43d4-a6cd-809525a1d206-720.mp4","height":720,"size":497100839,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309943","height":720,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-720.torrent","height":720},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-720.torrent&xt=urn:btih:71971668f82a3b24ac71bc3a982848dd8dc5a5f5&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fwebseed%2F6050732a-8a7a-43d4-a6cd-809525a1d206-720.mp4&ws=https%3A%2F%2Fpeertube.iselfhost.com%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-720.mp4&ws=https%3A%2F%2Ftube.privacytools.io%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-720.mp4&ws=https%3A%2F%2Fpeertube.live%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-720.mp4","height":720},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/webseed/6050732a-8a7a-43d4-a6cd-809525a1d206-240.mp4","height":240,"size":113038439,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309944","height":240,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-240.torrent","height":240},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-240.torrent&xt=urn:btih:c42aa6c95efb28d9f114ebd98537f7b00fa72246&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fwebseed%2F6050732a-8a7a-43d4-a6cd-809525a1d206-240.mp4&ws=https%3A%2F%2Fpeertube.iselfhost.com%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-240.mp4&ws=https%3A%2F%2Ftube.privacytools.io%2Fstatic%2Fredundancy%2F6050732a-8a7a-43d4-a6cd-809525a1d206-240.mp4","height":240},{"type":"Link","mediaType":"application/x-mpegURL","href":"https://framatube.org/static/streaming-playlists/hls/6050732a-8a7a-43d4-a6cd-809525a1d206/master.m3u8","tag":[{"type":"Infohash","name":"f7428214539626e062f300f2ca4cf9154575144e"},{"type":"Infohash","name":"46e236dffb1ea6b9123a5396cbe88e97dd94cc6c"},{"type":"Infohash","name":"11f1045830b5d786c788f2594d19f128764e7d87"},{"type":"Infohash","name":"4327ad3e0d84de100130a27e9ab6fe40c4284f0e"},{"type":"Infohash","name":"41e2eee8e7b23a63c23a77c40a46de11492a4831"},{"type":"Link","name":"sha256","mediaType":"application/json","href":"https://framatube.org/static/streaming-playlists/hls/6050732a-8a7a-43d4-a6cd-809525a1d206/segments-sha256.json"},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/streaming-playlists/hls/6050732a-8a7a-43d4-a6cd-809525a1d206/6050732a-8a7a-43d4-a6cd-809525a1d206-1080-fragmented.mp4","height":1080,"size":1156777472,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309940","height":1080,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-1080-hls.torrent","height":1080},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-1080-hls.torrent&xt=urn:btih:0204d780ebfab0d5d9d3476a038e812ad792deeb&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fstreaming-playlists%2Fhls%2F6050732a-8a7a-43d4-a6cd-809525a1d206%2F6050732a-8a7a-43d4-a6cd-809525a1d206-1080-fragmented.mp4","height":1080},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/streaming-playlists/hls/6050732a-8a7a-43d4-a6cd-809525a1d206/6050732a-8a7a-43d4-a6cd-809525a1d206-480-fragmented.mp4","height":480,"size":249562889,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309945","height":480,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-480-hls.torrent","height":480},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-480-hls.torrent&xt=urn:btih:5d14f38ded29de629668fe1cfc61a75f4cce2628&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fstreaming-playlists%2Fhls%2F6050732a-8a7a-43d4-a6cd-809525a1d206%2F6050732a-8a7a-43d4-a6cd-809525a1d206-480-fragmented.mp4","height":480},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/streaming-playlists/hls/6050732a-8a7a-43d4-a6cd-809525a1d206/6050732a-8a7a-43d4-a6cd-809525a1d206-360-fragmented.mp4","height":360,"size":170836415,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309946","height":360,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-360-hls.torrent","height":360},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-360-hls.torrent&xt=urn:btih:30125488789080ad405ebcee6c214945f31b8f30&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fstreaming-playlists%2Fhls%2F6050732a-8a7a-43d4-a6cd-809525a1d206%2F6050732a-8a7a-43d4-a6cd-809525a1d206-360-fragmented.mp4","height":360},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/streaming-playlists/hls/6050732a-8a7a-43d4-a6cd-809525a1d206/6050732a-8a7a-43d4-a6cd-809525a1d206-720-fragmented.mp4","height":720,"size":496533741,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309947","height":720,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-720-hls.torrent","height":720},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-720-hls.torrent&xt=urn:btih:8ed1e8bccde709901c26e315fc8f53bfd26d1ba6&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fstreaming-playlists%2Fhls%2F6050732a-8a7a-43d4-a6cd-809525a1d206%2F6050732a-8a7a-43d4-a6cd-809525a1d206-720-fragmented.mp4","height":720},{"type":"Link","mediaType":"video/mp4","href":"https://framatube.org/static/streaming-playlists/hls/6050732a-8a7a-43d4-a6cd-809525a1d206/6050732a-8a7a-43d4-a6cd-809525a1d206-240-fragmented.mp4","height":240,"size":112529249,"fps":25},{"type":"Link","rel":["metadata","video/mp4"],"mediaType":"application/json","href":"https://framatube.org/api/v1/videos/6050732a-8a7a-43d4-a6cd-809525a1d206/metadata/1309948","height":240,"fps":25},{"type":"Link","mediaType":"application/x-bittorrent","href":"https://framatube.org/static/torrents/6050732a-8a7a-43d4-a6cd-809525a1d206-240-hls.torrent","height":240},{"type":"Link","mediaType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fframatube.org%2Fstatic%2Ftorrents%2F6050732a-8a7a-43d4-a6cd-809525a1d206-240-hls.torrent&xt=urn:btih:8b452bf4e70b9078d4e74ca8b5523cc9dc70d10a&dn=D%C3%A9framasoftisons+Internet+%5BFramasoft%5D&tr=wss%3A%2F%2Fframatube.org%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fframatube.org%2Ftracker%2Fannounce&ws=https%3A%2F%2Fframatube.org%2Fstatic%2Fstreaming-playlists%2Fhls%2F6050732a-8a7a-43d4-a6cd-809525a1d206%2F6050732a-8a7a-43d4-a6cd-809525a1d206-240-fragmented.mp4","height":240}]}],"likes":"https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206/likes","dislikes":"https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206/dislikes","shares":"https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206/announces","comments":"https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206/comments","attributedTo":[{"type":"Person","id":"https://framatube.org/accounts/framasoft"},{"type":"Group","id":"https://framatube.org/video-channels/bf54d359-cfad-4935-9d45-9d6be93f63e8"}],"to":["https://www.w3.org/ns/activitystreams#Public"],"cc":["https://framatube.org/accounts/framasoft/followers"],"@context":["https://www.w3.org/ns/activitystreams","https://w3id.org/security/v1",{"RsaSignature2017":"https://w3id.org/security#RsaSignature2017"},{"pt":"https://joinpeertube.org/ns#","sc":"http://schema.org#","Hashtag":"as:Hashtag","uuid":"sc:identifier","category":"sc:category","licence":"sc:license","subtitleLanguage":"sc:subtitleLanguage","sensitive":"as:sensitive","language":"sc:inLanguage","Infohash":"pt:Infohash","Playlist":"pt:Playlist","PlaylistElement":"pt:PlaylistElement","originallyPublishedAt":"sc:datePublished","views":{"@type":"sc:Number","@id":"pt:views"},"state":{"@type":"sc:Number","@id":"pt:state"},"size":{"@type":"sc:Number","@id":"pt:size"},"fps":{"@type":"sc:Number","@id":"pt:fps"},"startTimestamp":{"@type":"sc:Number","@id":"pt:startTimestamp"},"stopTimestamp":{"@type":"sc:Number","@id":"pt:stopTimestamp"},"position":{"@type":"sc:Number","@id":"pt:position"},"commentsEnabled":{"@type":"sc:Boolean","@id":"pt:commentsEnabled"},"downloadEnabled":{"@type":"sc:Boolean","@id":"pt:downloadEnabled"},"waitTranscoding":{"@type":"sc:Boolean","@id":"pt:waitTranscoding"},"support":{"@type":"sc:Text","@id":"pt:support"},"likes":{"@id":"as:likes","@type":"@id"},"dislikes":{"@id":"as:dislikes","@type":"@id"},"playlists":{"@id":"pt:playlists","@type":"@id"},"shares":{"@id":"as:shares","@type":"@id"},"comments":{"@id":"as:comments","@type":"@id"}}]} \ No newline at end of file diff --git a/test/fixtures/tesla_mock/frontend.zip b/test/fixtures/tesla_mock/frontend.zip new file mode 100644 index 000000000..114d576a3 Binary files /dev/null and b/test/fixtures/tesla_mock/frontend.zip differ diff --git a/test/fixtures/tesla_mock/frontend_dist.zip b/test/fixtures/tesla_mock/frontend_dist.zip new file mode 100644 index 000000000..20d7952a4 Binary files /dev/null and b/test/fixtures/tesla_mock/frontend_dist.zip differ diff --git a/test/fixtures/tesla_mock/funkwhale_create_audio.json b/test/fixtures/tesla_mock/funkwhale_create_audio.json new file mode 100644 index 000000000..fe6059cbf --- /dev/null +++ b/test/fixtures/tesla_mock/funkwhale_create_audio.json @@ -0,0 +1,58 @@ +{ + "@context": [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + "https://funkwhale.audio/ns", + { + "manuallyApprovesFollowers": "as:manuallyApprovesFollowers", + "Hashtag": "as:Hashtag" + } + ], + "type": "Create", + "id": "https://channels.tests.funkwhale.audio/federation/music/uploads/42342395-0208-4fee-a38d-259a6dae0871/activity", + "actor": "https://channels.tests.funkwhale.audio/federation/actors/compositions", + "object": { + "id": "https://channels.tests.funkwhale.audio/federation/music/uploads/42342395-0208-4fee-a38d-259a6dae0871", + "type": "Audio", + "name": "Compositions - Test Audio for Pleroma", + "attributedTo": "https://channels.tests.funkwhale.audio/federation/actors/compositions", + "published": "2020-03-11T10:01:52.714918+00:00", + "to": "https://www.w3.org/ns/activitystreams#Public", + "url": [ + { + "type": "Link", + "mimeType": "audio/ogg", + "href": "https://channels.tests.funkwhale.audio/api/v1/listen/3901e5d8-0445-49d5-9711-e096cf32e515/?upload=42342395-0208-4fee-a38d-259a6dae0871&download=false" + }, + { + "type": "Link", + "mimeType": "text/html", + "href": "https://channels.tests.funkwhale.audio/library/tracks/74" + } + ], + "content": "

This is a test Audio for Pleroma.

", + "mediaType": "text/html", + "tag": [ + { + "type": "Hashtag", + "name": "#funkwhale" + }, + { + "type": "Hashtag", + "name": "#test" + }, + { + "type": "Hashtag", + "name": "#tests" + } + ], + "summary": "#funkwhale #test #tests", + "@context": [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "manuallyApprovesFollowers": "as:manuallyApprovesFollowers" + } + ] + } +} diff --git a/test/fixtures/tesla_mock/http__gs.example.org_index.php_api_statuses_user_timeline_1.atom.xml b/test/fixtures/tesla_mock/http__gs.example.org_index.php_api_statuses_user_timeline_1.atom.xml deleted file mode 100644 index 490467708..000000000 --- a/test/fixtures/tesla_mock/http__gs.example.org_index.php_api_statuses_user_timeline_1.atom.xml +++ /dev/null @@ -1,460 +0,0 @@ - - - GNU social - http://gs.example.org/index.php/api/statuses/user_timeline/1.atom - lambda timeline - Updates from lambda on gs.example.org! - http://gs.example.org/theme/neo-gnu/default-avatar-profile.png - 2017-05-05T12:09:57+00:00 - - http://activitystrea.ms/schema/1.0/person - http://gs.example.org:4040/index.php/user/1 - lambda - - - - - lambda - lambda - - - - - - - - - - - - - tag:gs.example.org,2017-05-04:noticeId=84:objectType=note - lambda repeated a notice by lambda2 - RT @<a href="http://gs.example.org/index.php/user/7" class="h-card mention">lambda2</a> Hello! - - http://activitystrea.ms/schema/1.0/share - 2017-05-04T16:38:50+00:00 - 2017-05-04T16:38:50+00:00 - - http://activitystrea.ms/schema/1.0/activity - tag:gs.example.org,2017-05-01:noticeId=67:objectType=note - - Hello! - - http://activitystrea.ms/schema/1.0/post - 2017-05-01T08:41:04+00:00 - 2017-05-01T08:41:04+00:00 - - http://activitystrea.ms/schema/1.0/person - http://gs.example.org/index.php/user/7 - lambda2 - - - - - - lambda2 - lambda2 - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org,2017-05-01:noticeId=67:objectType=note - New note by lambda2 - Hello! - - - - - tag:gs.example.org,2017-05-01:objectType=thread:nonce=cffa792cb95fe417 - - - http://gs.example.org/index.php/api/statuses/user_timeline/7.atom - lambda2 - - - - http://gs.example.org/avatar/7-96-20170501084054.png - 2017-05-01T16:33:10+00:00 - - - - - - tag:gs.example.org,2017-05-01:objectType=thread:nonce=cffa792cb95fe417 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org,2017-04-30:noticeId=63:objectType=note - New note by lambda - what now? - - - http://activitystrea.ms/schema/1.0/post - 2017-04-30T10:09:57+00:00 - 2017-04-30T10:09:57+00:00 - - - - tag:gs.example.org,2017-04-30:objectType=thread:nonce=1bbb60991ae9874b - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org,2017-04-30:noticeId=61:objectType=note - New note by lambda - @<a href="http://pleroma.example.org:4000/users/lain5" class="h-card mention">lain5</a> Hello! - - - http://activitystrea.ms/schema/1.0/post - 2017-04-30T10:07:26+00:00 - 2017-04-30T10:07:26+00:00 - - tag:gs.example.org,2017-04-30:objectType=thread:nonce=1bbb60991ae9874b - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org,2017-04-29:noticeId=59:objectType=note - New note by lambda - ey - - - http://activitystrea.ms/schema/1.0/post - 2017-04-29T17:04:59+00:00 - 2017-04-29T17:04:59+00:00 - - tag:gs.example.org,2017-04-29:objectType=thread:nonce=4cc42c2c61a0f4bd - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org,2017-04-29:noticeId=58:objectType=note - New note by lambda - Another one. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-29T17:02:47+00:00 - 2017-04-29T17:02:47+00:00 - - tag:gs.example.org,2017-04-29:objectType=thread:nonce=53e9b8f1d6d38d13 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org,2017-04-29:noticeId=57:objectType=note - New note by lambda - Let's see if this comes over. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-29T17:01:39+00:00 - 2017-04-29T17:01:39+00:00 - - tag:gs.example.org,2017-04-29:objectType=thread:nonce=238a7bd3ffc7c9cc - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org,2017-04-29:noticeId=56:objectType=note - New note by lambda - @<a href="http://pleroma.example.org:4000/users/lain5" class="h-card mention">lain5</a> Hey! - - - http://activitystrea.ms/schema/1.0/post - 2017-04-29T16:38:13+00:00 - 2017-04-29T16:38:13+00:00 - - tag:gs.example.org,2017-04-29:objectType=thread:nonce=2629d3a398171b0f - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=55:objectType=note - New note by lambda - hey. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:16:13+00:00 - 2017-04-25T18:16:13+00:00 - - - - http://pleroma.example.org:4000/contexts/8f6f45d4-8e4d-4e1a-a2de-09f27367d2d0 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=53:objectType=note - New note by lambda - and this? - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:14:34+00:00 - 2017-04-25T18:14:34+00:00 - - - - http://pleroma.example.org:4000/contexts/24779b0e-91ad-487e-81bd-6cf5bb437b09 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=52:objectType=note - New note by lambda - yeah it does :) - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:13:31+00:00 - 2017-04-25T18:13:31+00:00 - - - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=e0dc24b1a93ab6b3 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=50:objectType=note - New note by lambda - @<a href="http://pleroma.example.org:4000/users/lain5" class="h-card mention">lain5</a> Let's try with one that originates here! - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:10:28+00:00 - 2017-04-25T18:10:28+00:00 - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=e0dc24b1a93ab6b3 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=48:objectType=note - New note by lambda - works? - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:08:44+00:00 - 2017-04-25T18:08:44+00:00 - - - - http://pleroma.example.org:4000/contexts/24779b0e-91ad-487e-81bd-6cf5bb437b09 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=46:objectType=note - New note by lambda - Let's send you an answer. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:05:31+00:00 - 2017-04-25T18:05:31+00:00 - - - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=73c7bcf6658f7ce3 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=44:objectType=note - New note by lambda - Hey. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T18:01:09+00:00 - 2017-04-25T18:01:09+00:00 - - - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=6e7c8fc2823380b4 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=43:objectType=note - New note by lambda - What's coming to you? - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T17:58:41+00:00 - 2017-04-25T17:58:41+00:00 - - - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=6e7c8fc2823380b4 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=42:objectType=note - New note by lambda - Now this is podracing. - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T17:57:40+00:00 - 2017-04-25T17:57:40+00:00 - - - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=6e7c8fc2823380b4 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=39:objectType=note - New note by lambda - Sure looks like it! - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T17:48:27+00:00 - 2017-04-25T17:48:27+00:00 - - - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=4c6114a75bb4cea5 - - - - - - - - tag:gs.example.org:4040,2017-04-25:subscription:1:person:6:2017-04-25T17:47:47+00:00 - lambda (lambda)'s status on Tuesday, 25-Apr-2017 17:47:47 UTC - <a href="http://gs.example.org:4040/index.php/lambda">lambda</a> started following <a href="http://pleroma.example.org:4000/users/lain5">l</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-25T17:47:47+00:00 - 2017-04-25T17:47:47+00:00 - - http://activitystrea.ms/schema/1.0/person - http://pleroma.example.org:4000/users/lain5 - l - lambadalambda - - - - - - lain5 - l - lambadalambda - - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=119acad17515314c - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=36:objectType=note - New note by lambda - @<a href="http://pleroma.example.org:4000/users/lain5" class="h-card mention">lain5</a> Hey, how are you? - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T17:46:22+00:00 - 2017-04-25T17:46:22+00:00 - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=9c5ec19a18191372 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.example.org:4040,2017-04-25:noticeId=35:objectType=note - New note by lambda - @lain5@pleroma.example.org does this not work? - - - http://activitystrea.ms/schema/1.0/post - 2017-04-25T17:42:31+00:00 - 2017-04-25T17:42:31+00:00 - - tag:gs.example.org:4040,2017-04-25:objectType=thread:nonce=fc841d7f52caa363 - - - - - - diff --git a/test/fixtures/tesla_mock/https___framatube.org_accounts_framasoft.json b/test/fixtures/tesla_mock/https___framatube.org_accounts_framasoft.json new file mode 100644 index 000000000..1c3f779b3 --- /dev/null +++ b/test/fixtures/tesla_mock/https___framatube.org_accounts_framasoft.json @@ -0,0 +1 @@ +{"type":"Person","id":"https://framatube.org/accounts/framasoft","following":"https://framatube.org/accounts/framasoft/following","followers":"https://framatube.org/accounts/framasoft/followers","playlists":"https://framatube.org/accounts/framasoft/playlists","inbox":"https://framatube.org/accounts/framasoft/inbox","outbox":"https://framatube.org/accounts/framasoft/outbox","preferredUsername":"framasoft","url":"https://framatube.org/accounts/framasoft","name":"Framasoft","endpoints":{"sharedInbox":"https://framatube.org/inbox"},"publicKey":{"id":"https://framatube.org/accounts/framasoft#main-key","owner":"https://framatube.org/accounts/framasoft","publicKeyPem":"-----BEGIN PUBLIC KEY-----\nMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAuRh3frgIg866D0y0FThp\nSUkJImMcHGkUvpYQYv2iUgarZZtEbwT8PfQf0bJazy+cP8KqQmMDf5PBhT7dfdny\nf/GKGMw9Olc+QISeKDj3sqZ3Csrm4KV4avMGCfth6eSU7LozojeSGCXdUFz/8UgE\nfhV4mJjEX/FbwRYoKlagv5rY9mkX5XomzZU+z9j6ZVXyofwOwJvmI1hq0SYDv2bc\neB/RgIh/H0nyMtF8o+0CT42FNEET9j9m1BKOBtPzwZHmitKRkEmui5cK256s1laB\nT61KHpcD9gQKkQ+I3sFEzCBUJYfVo6fUe+GehBZuAfq4qDhd15SfE4K9veDscDFI\nTwIDAQAB\n-----END PUBLIC KEY-----"},"icon":{"type":"Image","mediaType":"image/png","url":"https://framatube.org/lazy-static/avatars/f73876f5-1d45-4f8a-942a-d3d5d5ac5dc1.png"},"@context":["https://www.w3.org/ns/activitystreams","https://w3id.org/security/v1",{"RsaSignature2017":"https://w3id.org/security#RsaSignature2017","pt":"https://joinpeertube.org/ns#","sc":"http://schema.org#","Hashtag":"as:Hashtag","uuid":"sc:identifier","category":"sc:category","licence":"sc:license","subtitleLanguage":"sc:subtitleLanguage","sensitive":"as:sensitive","language":"sc:inLanguage","expires":"sc:expires","CacheFile":"pt:CacheFile","Infohash":"pt:Infohash","originallyPublishedAt":"sc:datePublished","views":{"@type":"sc:Number","@id":"pt:views"},"state":{"@type":"sc:Number","@id":"pt:state"},"size":{"@type":"sc:Number","@id":"pt:size"},"fps":{"@type":"sc:Number","@id":"pt:fps"},"startTimestamp":{"@type":"sc:Number","@id":"pt:startTimestamp"},"stopTimestamp":{"@type":"sc:Number","@id":"pt:stopTimestamp"},"position":{"@type":"sc:Number","@id":"pt:position"},"commentsEnabled":{"@type":"sc:Boolean","@id":"pt:commentsEnabled"},"downloadEnabled":{"@type":"sc:Boolean","@id":"pt:downloadEnabled"},"waitTranscoding":{"@type":"sc:Boolean","@id":"pt:waitTranscoding"},"support":{"@type":"sc:Text","@id":"pt:support"}},{"likes":{"@id":"as:likes","@type":"@id"},"dislikes":{"@id":"as:dislikes","@type":"@id"},"playlists":{"@id":"pt:playlists","@type":"@id"},"shares":{"@id":"as:shares","@type":"@id"},"comments":{"@id":"as:comments","@type":"@id"}}],"summary":null} \ No newline at end of file diff --git a/test/fixtures/tesla_mock/https___mamot.fr_users_Skruyb.atom b/test/fixtures/tesla_mock/https___mamot.fr_users_Skruyb.atom deleted file mode 100644 index b5f3d923b..000000000 --- a/test/fixtures/tesla_mock/https___mamot.fr_users_Skruyb.atom +++ /dev/null @@ -1,342 +0,0 @@ - - - https://mamot.fr/users/Skruyb.atom - The 7th Son - Fr and En. -Posts will disappear on a regular basis. - 2017-04-28T13:54:23Z - https://mamot.fr/system/accounts/avatars/000/026/213/original/d95dbcfc76f77f4c.jpg?1493230984 - - https://mamot.fr/users/Skruyb - http://activitystrea.ms/schema/1.0/person - https://mamot.fr/users/Skruyb - Skruyb - Skruyb@mamot.fr - <p>Fr and En.<br />Posts will disappear on a regular basis.</p> - - - - Skruyb - The 7th Son - Fr and En. -Posts will disappear on a regular basis. - public - - - - - - - - tag:mamot.fr,2017-05-10:objectId=1299665:objectType=Status - 2017-05-10T20:06:59Z - 2017-05-10T20:06:59Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pouets.ovh/@noName" class="u-url mention">@<span>noName</span></a></span></p><p>Pour comparer faut avoir tester... Ô wait!!! 😁</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1299185:objectType=Status - 2017-05-10T19:52:14Z - 2017-05-10T19:52:14Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://witches.town/@Dhveszak" class="u-url mention">@<span>Dhveszak</span></a></span></p><p>Toi!! Tu vises le ministère de la propagande avoue!!!!!!!</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1299019:objectType=Status - 2017-05-10T19:47:19Z - 2017-05-10T19:47:19Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Facebook s&apos;attaque aux sites internet &quot;trompeurs&quot;</p><p><a href="http://u.afp.com/4W4z" rel="nofollow noopener" target="_blank"><span class="invisible">http://</span><span class="">u.afp.com/4W4z</span><span class="invisible"></span></a></p><p>J&apos;attends de voir que Facebook s&apos;attaque à lui même... rien qu&apos;à lire leurs conditions générales d&apos;utilisation, le respect de la vie privée...</p><p>Charité bien ordonnée... Parfois l&apos;égoïsme aurait du bon.</p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1298889:objectType=Status - 2017-05-10T19:43:18Z - 2017-05-10T19:43:18Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://octodon.social/@Balise" class="u-url mention">@<span>Balise</span></a></span></p><p>Fait comme moi, annonce que tu fais dans le flou artistique et que seuls des esprits éclairés pourront en percevoir la beauté et apprécier. Globalement après ça, tout le monde trouve les photos cool :-p</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1298728:objectType=Status - 2017-05-10T19:38:39Z - 2017-05-10T19:38:39Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@applecandy" class="u-url mention">@<span>applecandy</span></a></span></p><p>Lucky you!!!</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1298431:objectType=Status - 2017-05-10T19:26:32Z - 2017-05-10T19:26:32Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Est-ce que je suis le seul qui lorsqu&apos;il commence à compter les arbres sur le bord de la route n&apos;arrive pas à s&apos;arrêter de compter?</p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1298224:objectType=Status - 2017-05-10T19:18:17Z - 2017-05-10T19:18:17Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Ca y est j&apos;ai une nouvelle passion. Mettre les bouchons qui trainent par terre dans le bons sens avec mon pied 🙌</p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1297450:objectType=Status - 2017-05-10T18:53:37Z - 2017-05-10T18:53:37Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Ok. On est capable d&apos;envoyer des mecs dans l&apos;espace, avoir des voitures autonomes, des trucs intelligents de partout mais pas tous les bâtiments accessibles aux personnes à mobilité réduite, les émissions sur le services publics avec une personne faisant la traduction pour les sourds et malentendants de manière systématique...</p><p>J&apos;ai du louper un truc dans l&apos;ordre des priorités Oo</p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1297292:objectType=Status - 2017-05-10T18:48:17Z - 2017-05-10T18:48:17Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>J&apos;ai comme envie de faire un truc mais je ne sais pas quoi mais pourtant c&apos;est comme si je ressentais l&apos;idée dans ma tête mais c&apos;est pas clair...</p><p>Fuck!!! J&apos;vais aller draguer Josiane à la compta ça va me changer les idées!!!</p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1296598:objectType=Status - 2017-05-10T18:25:11Z - 2017-05-10T18:25:11Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mamot.fr/@Smeablog" class="u-url mention">@<span>Smeablog</span></a></span></p><p>Pas faux MDR!!!!</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1296571:objectType=Status - 2017-05-10T18:24:13Z - 2017-05-10T18:24:13Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mamot.fr/@Smeablog" class="u-url mention">@<span>Smeablog</span></a></span></p><p>Ca ne change pas la finalité malheureusement, ça ne m&apos;ouvre pas ce à quoi je veux accéder 😭</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1296475:objectType=Status - 2017-05-10T18:20:50Z - 2017-05-10T18:20:50Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Arrrgghhhhhhh!!!!</p><p>Quand t&apos;es sur le point de cliquer sur un lien dans le fil public global et que BOOM ça se met à jour... J&apos;ose même pas imaginer combien j&apos;ai ouvert de pages web sans le vouloir!!!</p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1296426:objectType=Status - 2017-05-10T18:19:17Z - 2017-05-10T18:19:17Z - Skruyb shared a status by Isaluini@mastodon.social - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:mastodon.social,2017-05-10:objectId=5587049:objectType=Status - 2017-05-10T18:18:59Z - 2017-05-10T18:19:00Z - New status by Isaluini@mastodon.social - - https://mastodon.social/users/Isaluini - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/Isaluini - Isaluini - Isaluini@mastodon.social - <p>Adicciones: Escribir, diseñar, cine, café, humor negro, música y dibujar. | Jedi. Bueno, no. Algún día (?) | Gratitude.</p> - - - - Isaluini - Isa - Adicciones: Escribir, diseñar, cine, café, humor negro, música y dibujar. | Jedi. Bueno, no. Algún día (?) | Gratitude. - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>♫ <br><a href="https://www.youtube.com/watch?v=pT68FS3YbQ4"><span class="invisible">https://www.</span><span class="ellipsis">youtube.com/watch?v=pT68FS3YbQ</span><span class="invisible">4</span></a></p> - - public - - - <p>♫ <br><a href="https://www.youtube.com/watch?v=pT68FS3YbQ4"><span class="invisible">https://www.</span><span class="ellipsis">youtube.com/watch?v=pT68FS3YbQ</span><span class="invisible">4</span></a></p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1295893:objectType=Status - 2017-05-10T18:01:51Z - 2017-05-10T18:01:51Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mamot.fr/@Chat2Gouttieres" class="u-url mention">@<span>Chat2Gouttieres</span></a></span></p><p>Ah bah après faut savoir mettre à profit ce savoir ^^</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1295815:objectType=Status - 2017-05-10T18:00:02Z - 2017-05-10T18:00:02Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mamot.fr/@Chat2Gouttieres" class="u-url mention">@<span>Chat2Gouttieres</span></a></span></p><p>Exactement. On a les jeux mais pas le pain encore.</p><p>Finalement on a rien inventé :-p</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1295778:objectType=Status - 2017-05-10T17:58:52Z - 2017-05-10T17:58:52Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mamot.fr/@Chat2Gouttieres" class="u-url mention">@<span>Chat2Gouttieres</span></a></span></p><p>C&apos;est ça visiblement dans notre société dite moderne... &quot;Créer l&apos;illusion que&quot; Oo.</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1294943:objectType=Status - 2017-05-10T17:31:44Z - 2017-05-10T17:31:44Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - Hey. - <p><span class="h-card"><a href="https://mastodon.social/@lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span></p><p>Hey!!!</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1294914:objectType=Status - 2017-05-10T17:30:40Z - 2017-05-10T17:30:40Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mamot.fr/@EloClemTiti" class="u-url mention">@<span>EloClemTiti</span></a></span></p><p>J&apos;ai souvent cette impression en effet 😂</p> - - - public - - - - - - tag:mamot.fr,2017-05-10:objectId=1294148:objectType=Status - 2017-05-10T17:02:01Z - 2017-05-10T17:02:01Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Les gars, les boss veulent voir de l&apos;avancement!! Une idée?</p><p>On fait comme d&apos;habitude. On divise nos tâches en 25.000 tâches unitaires, on fout du vert au maximum et on crée l&apos;illusion que ça a bien avancé!</p><p>Deal!!</p><p>Bob, tu choisis quel vert on utilise<br />Alice, t&apos;es en charge de la typo<br />Moi, je m&apos;occupe qu&apos;on prend bien le dernier template ppt fournit par la comm interne.</p><p>Des winners qu&apos;on est!!!! Des WI-NNERS!!!</p> - - public - - - - - tag:mamot.fr,2017-05-10:objectId=1293995:objectType=Status - 2017-05-10T16:57:53Z - 2017-05-10T16:57:53Z - New status by Skruyb - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://mastodon.social/@SauceHair" class="u-url mention">@<span>SauceHair</span></a></span></p><p>Cool!!</p><p>Bon courage.</p> - - - public - - - - - diff --git a/test/fixtures/tesla_mock/https___mastodon.social_users_lambadalambda.atom b/test/fixtures/tesla_mock/https___mastodon.social_users_lambadalambda.atom deleted file mode 100644 index 4d732b109..000000000 --- a/test/fixtures/tesla_mock/https___mastodon.social_users_lambadalambda.atom +++ /dev/null @@ -1,464 +0,0 @@ - - - https://mastodon.social/users/lambadalambda.atom - Critical Value - - 2017-04-16T21:47:25Z - https://files.mastodon.social/accounts/avatars/000/000/264/original/1429214160519.gif - - https://mastodon.social/users/lambadalambda - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/lambadalambda - lambadalambda - lambadalambda@mastodon.social - - - - lambadalambda - Critical Value - public - - - - - - - - tag:mastodon.social,2017-05-04:objectId=4991300:objectType=Status - 2017-05-04T14:10:30Z - 2017-05-04T14:10:30Z - Delete - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/delete - - - - - tag:mastodon.social,2017-05-04:objectId=4980289:objectType=Status - 2017-05-04T07:43:23Z - 2017-05-04T07:43:23Z - Delete - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/delete - - - - - tag:mastodon.social,2017-05-03:objectId=4952899:objectType=Status - 2017-05-03T17:26:43Z - 2017-05-03T17:26:43Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> OK!!</p> - - - public - - - - - - tag:mastodon.social,2017-05-03:objectId=4952810:objectType=Status - 2017-05-03T17:24:34Z - 2017-05-03T17:24:34Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> yeah :)</p> - - - public - - - - - - tag:mastodon.social,2017-05-03:objectId=4950388:objectType=Status - 2017-05-03T16:22:00Z - 2017-05-03T16:22:00Z - lambadalambda shared a status by lambadalambda@social.heldscal.la - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:social.heldscal.la,2017-05-03:noticeId=2030733:objectType=note - 2017-05-03T12:29:20Z - 2017-05-03T12:29:31Z - New status by lambadalambda@social.heldscal.la - - https://social.heldscal.la/user/23211 - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - lambadalambda@social.heldscal.la - Call me Deacon Blues. - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - Time for work. <a href="https://social.heldscal.la/file/953c117a1e7e4c763755d2ac29cf1aae08e025599f4a4cc11ddff4082c07f969.jpg">https://social.heldscal.la/attachment/120552</a> - - - public - - - Time for work. <a href="https://social.heldscal.la/file/953c117a1e7e4c763755d2ac29cf1aae08e025599f4a4cc11ddff4082c07f969.jpg">https://social.heldscal.la/attachment/120552</a> - - public - - - - - tag:mastodon.social,2017-05-03:objectId=4934452:objectType=Status - 2017-05-03T08:21:09Z - 2017-05-03T08:21:09Z - lambadalambda shared a status by lain@pleroma.soykaf.com - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - https://pleroma.soykaf.com/objects/4c1bda26-902e-4525-9fcd-b9fd44925193 - 2017-05-03T08:04:44Z - 2017-05-03T08:05:52Z - New status by lain@pleroma.soykaf.com - - https://pleroma.soykaf.com/users/lain - http://activitystrea.ms/schema/1.0/person - https://pleroma.soykaf.com/users/lain - lain - lain@pleroma.soykaf.com - Test account - - - - lain - Lain Iwakura - Test account - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - public - - - Added returning the entries as xml... let's see if the mastodon hammering stops now. - - public - - - - - tag:mastodon.social,2017-05-02:objectId=4905499:objectType=Status - 2017-05-02T19:34:21Z - 2017-05-02T19:34:21Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> yay!</p> - - - public - - - - - - tag:mastodon.social,2017-05-02:objectId=4905442:objectType=Status - 2017-05-02T19:33:33Z - 2017-05-02T19:33:33Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> so?</p> - - - public - - - - - - tag:mastodon.social,2017-05-02:objectId=4901603:objectType=Status - 2017-05-02T18:33:06Z - 2017-05-02T18:33:06Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> hey</p> - - - public - - - - - - tag:mastodon.social,2017-05-01:objectId=4836720:objectType=Status - 2017-05-01T18:52:16Z - 2017-05-01T18:52:16Z - lambadalambda shared a status by lain@pleroma.soykaf.com - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - https://pleroma.soykaf.com/objects/7b41bb51-9aba-436a-82d9-dd3f5aca98c9 - 2017-05-01T18:50:54Z - 2017-05-01T18:50:57Z - New status by lain@pleroma.soykaf.com - - https://pleroma.soykaf.com/users/lain - http://activitystrea.ms/schema/1.0/person - https://pleroma.soykaf.com/users/lain - lain - lain@pleroma.soykaf.com - Test account - - - - lain - Lain Iwakura - Test account - public - - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <a href="https://mastodon.social/users/lambadalambda">@lambadalambda@mastodon.social</a> you're an all-star. - - - public - - - - <a href="https://mastodon.social/users/lambadalambda">@lambadalambda@mastodon.social</a> you're an all-star. - - public - - - - - tag:mastodon.social,2017-05-01:objectId=4836142:objectType=Status - 2017-05-01T18:38:47Z - 2017-05-01T18:38:47Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> Hey now!</p> - - - public - - - - - - tag:mastodon.social,2017-05-01:objectId=4836055:objectType=Status - 2017-05-01T18:37:04Z - 2017-05-01T18:37:04Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> hello</p> - - - public - - - - - - tag:mastodon.social,2017-05-01:objectId=4834850:objectType=Status - 2017-05-01T18:10:43Z - 2017-05-01T18:10:43Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> Hey!</p> - - - public - - - - - tag:mastodon.social,2017-04-29:objectId=4694455:objectType=Status - 2017-04-29T18:39:12Z - 2017-04-29T18:39:12Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>@lain@pleroma.soykaf.com What&apos;s up?</p> - - public - - - - - tag:mastodon.social,2017-04-29:objectId=4694384:objectType=Status - 2017-04-29T18:37:32Z - 2017-04-29T18:37:32Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://social.heldscal.la/lain" class="u-url mention">@<span>lain</span></a></span> Hey.</p> - - - public - - - - - tag:mastodon.social,2017-04-07:objectId=1874242:objectType=Status - 2017-04-07T11:02:56Z - 2017-04-07T11:02:56Z - lambadalambda shared a status by 0xroy@social.wxcafe.net - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:social.wxcafe.net,2017-04-07:objectId=72554:objectType=Status - 2017-04-07T11:01:59Z - 2017-04-07T11:02:00Z - New status by 0xroy@social.wxcafe.net - - https://social.wxcafe.net/users/0xroy - http://activitystrea.ms/schema/1.0/person - https://social.wxcafe.net/users/0xroy - 0xroy - 0xroy@social.wxcafe.net - ta caution weeb | discussions privées : <a href="https://%F0%9F%92%8C.0xroy.me"><span class="invisible">https://</span><span class="">💌.0xroy.me</span><span class="invisible"></span></a> - - - - 0xroy - 「R O Y 🍵 B O S」 - ta caution weeb | discussions privées : https://💌.0xroy.me - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>someone pls eli5 matrix (protocol) and riot</p> - - public - - - <p>someone pls eli5 matrix (protocol) and riot</p> - - public - - - - - tag:mastodon.social,2017-04-06:objectId=1768247:objectType=Status - 2017-04-06T11:10:19Z - 2017-04-06T11:10:19Z - lambadalambda shared a status by areyoutoo@mastodon.xyz - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:mastodon.xyz,2017-04-05:objectId=133327:objectType=Status - 2017-04-05T17:36:41Z - 2017-04-05T18:12:14Z - New status by areyoutoo@mastodon.xyz - - https://mastodon.xyz/users/areyoutoo - http://activitystrea.ms/schema/1.0/person - https://mastodon.xyz/users/areyoutoo - areyoutoo - areyoutoo@mastodon.xyz - devops | retired gamedev | always boost puppy pics - - - - areyoutoo - Raw Butter - devops | retired gamedev | always boost puppy pics - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>Some UX thoughts for <a href="https://mastodon.xyz/tags/mastodev">#<span>mastodev</span></a>:</p><p>- Would be nice if I could work on multiple draft toots? Clicking to reply to someone seems to erase any draft I had been working on.</p><p>- Kinda risky to click on the Federated Timeline if it loads new toots and scrolls 10ms before I click on something.</p><p>I probably don't know enough web frontend to help, but it might be fun to try.</p> - - - public - - - <p>Some UX thoughts for <a href="https://mastodon.xyz/tags/mastodev">#<span>mastodev</span></a>:</p><p>- Would be nice if I could work on multiple draft toots? Clicking to reply to someone seems to erase any draft I had been working on.</p><p>- Kinda risky to click on the Federated Timeline if it loads new toots and scrolls 10ms before I click on something.</p><p>I probably don't know enough web frontend to help, but it might be fun to try.</p> - - public - - - - - tag:mastodon.social,2017-04-06:objectId=1764509:objectType=Status - 2017-04-06T10:15:38Z - 2017-04-06T10:15:38Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - This is a test for cw federation - <p>This is a test for cw federation body text.</p> - - public - - - - - tag:mastodon.social,2017-04-05:objectId=1645208:objectType=Status - 2017-04-05T07:14:53Z - 2017-04-05T07:14:53Z - lambadalambda shared a status by lambadalambda@social.heldscal.la - http://activitystrea.ms/schema/1.0/activity - http://activitystrea.ms/schema/1.0/share - - tag:social.heldscal.la,2017-04-05:noticeId=1502088:objectType=note - 2017-04-05T06:12:09Z - 2017-04-05T07:12:47Z - New status by lambadalambda@social.heldscal.la - - https://social.heldscal.la/user/23211 - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - lambadalambda@social.heldscal.la - Call me Deacon Blues. - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - public - - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - Federation 101: <a href="https://www.youtube.com/watch?v=t1lYU5CA40o">https://www.youtube.com/watch?v=t1lYU5CA40o</a> - - public - - - Federation 101: <a href="https://www.youtube.com/watch?v=t1lYU5CA40o">https://www.youtube.com/watch?v=t1lYU5CA40o</a> - - public - - - - - tag:mastodon.social,2017-04-05:objectId=1641750:objectType=Status - 2017-04-05T05:44:48Z - 2017-04-05T05:44:48Z - New status by lambadalambda - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> just a test.</p> - - - public - - - - diff --git a/test/fixtures/tesla_mock/https___osada.macgirvin.com.html b/test/fixtures/tesla_mock/https___osada.macgirvin.com.html new file mode 100644 index 000000000..880273d74 --- /dev/null +++ b/test/fixtures/tesla_mock/https___osada.macgirvin.com.html @@ -0,0 +1,301 @@ + + + + Osada + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +

Welcome to Osada

+ +
+
+
+ + + +
+
+ + +
+
+ +
+ +
+ +
+ +
+ Remote Authentication +
+ +
+ + + +
+
+ +
+
+ + + + \ No newline at end of file diff --git a/test/fixtures/tesla_mock/https___pawoo.net_users_pekorino.atom b/test/fixtures/tesla_mock/https___pawoo.net_users_pekorino.atom deleted file mode 100644 index 17d1956e8..000000000 --- a/test/fixtures/tesla_mock/https___pawoo.net_users_pekorino.atom +++ /dev/null @@ -1,231 +0,0 @@ - - - https://pawoo.net/users/pekorino.atom - モノエ - シアトル・米国 - -GNUsocial 英語版 -http://shitposter.club/mono - - - 2017-05-07T09:28:20Z - https://img.pawoo.net/accounts/avatars/000/128/378/original/e1fce04a36a1ad90.jpg - - https://pawoo.net/users/pekorino - http://activitystrea.ms/schema/1.0/person - https://pawoo.net/users/pekorino - pekorino - pekorino@pawoo.net - <p>シアトル・米国</p><p>GNUsocial 英語版<br /><a href="http://shitposter.club/mono" rel="nofollow noopener" target="_blank"><span class="invisible">http://</span><span class="">shitposter.club/mono</span><span class="invisible"></span></a> </p> - - - - pekorino - モノエ - シアトル・米国 - -GNUsocial 英語版 -http://shitposter.club/mono - - - public - - - - - - - tag:pawoo.net,2017-05-07:objectId=9319211:objectType=Status - 2017-05-07T09:56:35Z - 2017-05-07T09:56:35Z - New status by pekorino - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/moonman" class="u-url mention">@<span>moonman</span></a></span> <span class="h-card"><a href="https://shitposter.club/rw" class="u-url mention">@<span>rw</span></a></span> <span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> <span class="h-card"><a href="https://shitposter.club/mono" class="u-url mention">@<span>mono</span></a></span> </p><p>i have to wait for someone to respond to this before i can follow because i dont think this software has a direct follow by url option</p> - - - - - - public - - - - - - tag:pawoo.net,2017-05-07:objectId=9318595:objectType=Status - 2017-05-07T09:54:39Z - 2017-05-07T09:54:39Z - New status by pekorino - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/mono" class="u-url mention">@<span>mono</span></a></span> <span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> <span class="h-card"><a href="https://shitposter.club/rw" class="u-url mention">@<span>rw</span></a></span> <span class="h-card"><a href="https://shitposter.club/moonman" class="u-url mention">@<span>moonman</span></a></span> <br />please respond</p> - - - - - - public - - - - - - tag:pawoo.net,2017-05-07:objectId=9313978:objectType=Status - 2017-05-07T09:39:17Z - 2017-05-07T09:39:17Z - New status by pekorino - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/moonman" class="u-url mention">@<span>moonman</span></a></span> <br />mastodon is so slow. browser crashed twice trying to set avatar</p> - - - public - - - - - tag:pawoo.net,2017-05-07:objectId=9312691:objectType=Status - 2017-05-07T09:34:38Z - 2017-05-07T09:34:38Z - New status by pekorino - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/hardbass2k8" class="u-url mention">@<span>hardbass2k8</span></a></span> <a href="https://pawoo.net/media/mZJjLpbPU72GFEz2Svk" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="ellipsis">pawoo.net/media/mZJjLpbPU72GFE</span><span class="invisible">z2Svk</span></a></p> - - - - public - - - - - - tag:pawoo.net,2017-05-07:objectId=9312379:objectType=Status - 2017-05-07T09:33:29Z - 2017-05-07T09:33:29Z - New status by pekorino - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/hardbass2k8" class="u-url mention">@<span>hardbass2k8</span></a></span> <a href="https://pawoo.net/media/nt5JHBEHyTN2bqzdcGU" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="ellipsis">pawoo.net/media/nt5JHBEHyTN2bq</span><span class="invisible">zdcGU</span></a></p> - - - - public - - - - - - tag:pawoo.net,2017-05-07:objectId=9311765:objectType=Status - 2017-05-07T09:31:26Z - 2017-05-07T09:31:26Z - New status by pekorino - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><a href="https://pawoo.net/media/C4RV6ubsEtvS04DX6qs" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="ellipsis">pawoo.net/media/C4RV6ubsEtvS04</span><span class="invisible">DX6qs</span></a></p> - - - public - - - - - tag:pawoo.net,2017-05-07:objectId=9311610:objectType=Status - 2017-05-07T09:30:59Z - 2017-05-07T09:30:59Z - New status by pekorino - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><a href="https://pawoo.net/media/MBmkeEdrjs8pAtCHN6s" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="ellipsis">pawoo.net/media/MBmkeEdrjs8pAt</span><span class="invisible">CHN6s</span></a></p> - - - public - - - - - tag:pawoo.net,2017-05-07:objectId=9307782:objectType=Status - 2017-05-07T09:16:47Z - 2017-05-07T09:16:47Z - New status by pekorino - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/mono" class="u-url mention">@<span>mono</span></a></span></p><p>test</p> - - - public - - - - - tag:pawoo.net,2017-05-07:objectId=9307444:objectType=Status - 2017-05-07T09:15:42Z - 2017-05-07T09:15:42Z - New status by pekorino - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/hardbass2k8" class="u-url mention">@<span>hardbass2k8</span></a></span> テスト</p> - - - public - - - - - - tag:pawoo.net,2017-05-07:objectId=9307239:objectType=Status - 2017-05-07T09:14:58Z - 2017-05-07T09:14:58Z - New status by pekorino - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>ててててててテスト</p> - - public - - - - - tag:pawoo.net,2017-04-20:objectId=2212164:objectType=Status - 2017-04-20T06:19:18Z - 2017-04-20T06:19:18Z - New status by pekorino - http://activitystrea.ms/schema/1.0/comment - http://activitystrea.ms/schema/1.0/post - <p><span class="h-card"><a href="https://shitposter.club/mono" class="u-url mention">@<span>mono</span></a></span> <a href="https://pawoo.net/media/iMbjMBVPfZJX3lUC2Sc" rel="nofollow noopener" target="_blank"><span class="invisible">https://</span><span class="ellipsis">pawoo.net/media/iMbjMBVPfZJX3l</span><span class="invisible">UC2Sc</span></a></p> - - - - public - - - - - - tag:pawoo.net,2017-04-20:objectId=2206216:objectType=Status - 2017-04-20T05:57:59Z - 2017-04-20T05:57:59Z - New status by pekorino - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>テスト</p> - - public - - - - - tag:pawoo.net,2017-04-20:objectId=2204702:objectType=Status - 2017-04-20T05:52:09Z - 2017-04-20T05:52:09Z - New status by pekorino - http://activitystrea.ms/schema/1.0/note - http://activitystrea.ms/schema/1.0/post - <p>HELLOWORLD</p> - - public - - - - diff --git a/test/fixtures/tesla_mock/https___pleroma.soykaf.com_users_lain_feed.atom.xml b/test/fixtures/tesla_mock/https___pleroma.soykaf.com_users_lain_feed.atom.xml deleted file mode 100644 index a2a2629a6..000000000 --- a/test/fixtures/tesla_mock/https___pleroma.soykaf.com_users_lain_feed.atom.xml +++ /dev/null @@ -1 +0,0 @@ -https://pleroma.soykaf.com/users/lain/feed.atomlain's timeline2017-05-05T08:38:03.385598https://pleroma.soykaf.com/users/lainhttp://activitystrea.ms/schema/1.0/personhttps://pleroma.soykaf.com/users/lainlainLain IwakuraTest accountlainhttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/sharehttps://pleroma.soykaf.com/activities/579e4224-b2ab-4ffa-8bbe-f7197a0a38d1lain repeated a noticeRT In just seven days, I can make you a man!<br> -- The Rocky Horror Picture Show2017-05-05T08:38:03.3855902017-05-05T08:38:03.385598https://pleroma.soykaf.com/contexts/e8673466-9642-4c9e-8781-f0f69d6b15aehttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/53dd40f4-3069-45a1-863b-94a9b317093dNew note by fortuneIn just seven days, I can make you a man!<br> -- The Rocky Horror Picture Show2017-05-05T02:10:02.9308022017-05-05T08:38:03.423539https://pleroma.soykaf.com/contexts/e8673466-9642-4c9e-8781-f0f69d6b15aehttps://pleroma.soykaf.com/users/fortunehttp://activitystrea.ms/schema/1.0/personhttps://pleroma.soykaf.com/users/fortunefortunefortuneThe trusty unix fortune filefortunehttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/2bc86888-a256-4771-bb53-903f375804f9New note by lainRTs federating into pleroma now.2017-05-04T18:18:50.2764702017-05-04T18:18:50.276476https://pleroma.soykaf.com/contexts/b7ae9350-f317-48aa-8058-2668091bb280http://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/902b1f50-f295-4189-8c15-9c880919e121New favorite by lainlain favorited something2017-05-04T08:03:01.3088902017-05-04T08:03:01.308927http://activitystrea.ms/schema/1.0/notetag:gs.smuglo.li,2017-05-03:noticeId=2164642:objectType=commenthttps://pleroma.soykaf.com/contexts/9419f742-aaba-4eb5-89a2-8b599e8bf43chttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/4e396e66-b063-454c-92c6-583506a9a2deNew note by lainClassic.<br><a href='https://pleroma.soykaf.com/media/adc36781-9765-4d9a-b57c-99b7a99108b2/mikodaemonstop.jpg'>https://pleroma.soykaf.com/media/adc36781-9765-4d9a-b57c-99b7a99108b2/mikodaemonstop.jpg</a>2017-05-04T07:59:45.1806192017-05-04T07:59:45.180628https://pleroma.soykaf.com/contexts/6afd9659-41e6-406d-ae97-43b880722861http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/85d183e9-c935-4655-a1e6-8d69a4108235New note by lainん?<br><a href='https://pleroma.soykaf.com/media/ab144c6d-a38c-4d35-a60b-9a998becc094/n.gif'>https://pleroma.soykaf.com/media/ab144c6d-a38c-4d35-a60b-9a998becc094/n.gif</a>2017-05-04T07:58:08.8107162017-05-04T07:58:08.810726https://pleroma.soykaf.com/contexts/2e1aa616-86ce-4b50-9c81-63045a972156http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/7c5c45bb-e4d9-4f72-b4c6-0314afbd3553New note by lainyeah.2017-05-04T07:55:17.3352902017-05-04T07:55:17.335299https://pleroma.soykaf.com/contexts/702c06cf-56ff-4a2f-bf5a-150bc00bb168http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/f33f5f54-1c1d-4462-b9ed-229bb635dfd8New note by lainyeah.2017-05-04T07:49:24.9314842017-05-04T07:49:24.931492https://pleroma.soykaf.com/contexts/c4932e7a-00cb-431a-b4ec-7404cb9daf65http://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/0709bc79-7ac5-4983-b6d0-2205bf5ceba3New favorite by lainlain favorited something2017-05-03T20:08:11.2945792017-05-03T20:08:11.294587http://activitystrea.ms/schema/1.0/notetag:pawoo.net,2017-05-03:objectId=7967690:objectType=Statushttps://pleroma.soykaf.com/contexts/07a4b34d-6255-4bb2-8c73-c295a09ac952http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/72c0288e-62d8-43d9-b3d8-1a9d78be8375New note by lain<a href='https://pawoo.net/users/God_Emperor_of_Dune'>@God_Emperor_of_Dune@pawoo.net</a> no man, just some fun domination play among buddies, nothing homo about it.2017-05-03T20:01:00.9983142017-05-03T20:01:00.998322https://pleroma.soykaf.com/contexts/07a4b34d-6255-4bb2-8c73-c295a09ac952http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/d846409e-cf2a-4b68-a149-d5de34a91b0dNew note by lain<a href='https://social.heldscal.la/user/24974'>@dtluna@social.heldscal.la</a> btfo.<br><a href='https://pleroma.soykaf.com/media/fbe42e87-5574-4544-89ba-29ddf46227fa/pnc__picked_media_1889ce61-4961-4fea-8a14-04fe6783ebf6.jpg'>https://pleroma.soykaf.com/media/fbe42e87-5574-4544-89ba-29ddf46227fa/pnc__picked_media_1889ce61-4961-4fea-8a14-04fe6783ebf6.jpg</a>2017-05-03T20:00:15.8609952017-05-03T20:00:15.861002https://pleroma.soykaf.com/contexts/0e88f35e-1a38-4181-bef9-5cbb0d943c63http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/9075265f-f3b2-40e8-809f-10714f05a1fdNew note by lain#nohomo <br><a href='https://pleroma.soykaf.com/media/5cc5ad91-d637-4c45-a691-5ea778dc1bb3/pnc__picked_media_f62dc9ae-ea23-4fe6-bf85-cb75a129ab34.jpg'>https://pleroma.soykaf.com/media/5cc5ad91-d637-4c45-a691-5ea778dc1bb3/pnc__picked_media_f62dc9ae-ea23-4fe6-bf85-cb75a129ab34.jpg</a>2017-05-03T19:50:38.5891062017-05-03T19:50:38.589113https://pleroma.soykaf.com/contexts/07a4b34d-6255-4bb2-8c73-c295a09ac952http://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/7924e992-0a95-40d9-8d17-7278c6c634c9New favorite by lainlain favorited something2017-05-03T18:32:59.2733752017-05-03T18:32:59.273382http://activitystrea.ms/schema/1.0/notetag:gs.smuglo.li,2017-05-03:noticeId=2164774:objectType=commenthttps://pleroma.soykaf.com/contexts/9419f742-aaba-4eb5-89a2-8b599e8bf43chttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/569571ba-f54c-41b0-bde4-0fede54599f0New note by lain<a href='https://gs.smuglo.li/user/2'>@nepfag@gs.smuglo.li</a>@gs.smuglo.li I'll do proper subfolders soon, for now it's one per attachment + thumbs etc.2017-05-03T18:27:01.4499492017-05-03T18:27:01.449956https://pleroma.soykaf.com/contexts/9419f742-aaba-4eb5-89a2-8b599e8bf43chttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/sharehttps://pleroma.soykaf.com/activities/b6cc5d7c-0785-4785-a689-f1b05dc9b24dlain repeated a noticeRT <p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> Hey now!</p>2017-05-03T18:13:48.8910612017-05-03T18:13:48.891069https://pleroma.soykaf.com/contexts/ec6fdd27-0ec1-4672-8408-5a8e5a9c094bhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posttag:mastodon.social,2017-05-01:objectId=4836142:objectType=StatusNew note by lambadalambda@mastodon.social<p><span class="h-card"><a href="https://pleroma.soykaf.com/users/lain" class="u-url mention">@<span>lain</span></a></span> Hey now!</p>2017-05-01T18:38:49.3653912017-05-03T18:13:48.934745https://pleroma.soykaf.com/contexts/ec6fdd27-0ec1-4672-8408-5a8e5a9c094bhttps://mastodon.social/users/lambadalambdahttp://activitystrea.ms/schema/1.0/personhttps://mastodon.social/users/lambadalambdalambadalambda@mastodon.socialCritical Valuenillambadalambda@mastodon.socialhttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/sharehttps://pleroma.soykaf.com/activities/3c09eb31-4ba8-4ff5-b4fa-8f6f74d58bf0lain repeated a noticeRT Haha, salmons from mastodon didn't work because it's not implementing conversation id...2017-05-03T18:13:15.1480412017-05-03T18:13:15.148049tag:social.heldscal.la,2017-05-01:objectType=thread:nonce=86cda6c734401d80http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posttag:social.heldscal.la,2017-05-01:noticeId=2000425:objectType=noteNew note by lambadalambda@social.heldscal.laHaha, salmons from mastodon didn't work because it's not implementing conversation id...2017-05-01T18:39:36.2163772017-05-03T18:13:15.171143tag:social.heldscal.la,2017-05-01:objectType=thread:nonce=86cda6c734401d80https://social.heldscal.la/user/23211http://activitystrea.ms/schema/1.0/personhttps://social.heldscal.la/user/23211lambadalambda@social.heldscal.laConstance Variablenillambadalambda@social.heldscal.lahttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/b8fc83d5-d7c0-4b5f-8976-0317b51935eaNew note by lain.<br><a href='https://pleroma.soykaf.com/media/563008a7-9a60-47ac-a263-22835729adf6/1492530528735.png'>https://pleroma.soykaf.com/media/563008a7-9a60-47ac-a263-22835729adf6/1492530528735.png</a>2017-05-03T18:12:50.7452412017-05-03T18:12:50.745249https://pleroma.soykaf.com/contexts/9419f742-aaba-4eb5-89a2-8b599e8bf43chttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/sharehttps://pleroma.soykaf.com/activities/ac93ecef-cde0-48e8-ae4b-19e3b94dbe30lain repeated a noticeRT Awright, which one of you hid my PENIS ENVY?2017-05-03T18:08:49.2310012017-05-03T18:08:49.235354https://pleroma.soykaf.com/contexts/a9132cf8-6afa-4dd8-8b29-7b6fcab623b8http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/04e15c66-4936-4930-a134-32841f088bcfNew note by fortuneAwright, which one of you hid my PENIS ENVY?2017-05-01T19:40:03.1699962017-05-03T18:08:49.285347https://pleroma.soykaf.com/contexts/a9132cf8-6afa-4dd8-8b29-7b6fcab623b8https://pleroma.soykaf.com/users/fortunehttp://activitystrea.ms/schema/1.0/personhttps://pleroma.soykaf.com/users/fortunefortunefortuneThe trusty unix fortune filefortunehttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/sharehttps://pleroma.soykaf.com/activities/54b10fa9-d602-4a0f-b659-e6d3f7bc8c4clain repeated a noticeRT He is a man capable of turning any colour into grey.<br> -- John LeCarre2017-05-03T17:44:47.5789842017-05-03T17:44:47.578996https://pleroma.soykaf.com/contexts/8aebc8e5-5352-4047-8b74-4098a5830ccahttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/70ded299-184d-49cd-af17-23c0950536aaNew note by fortuneHe is a man capable of turning any colour into grey.<br> -- John LeCarre2017-05-02T08:40:03.4194652017-05-03T17:44:47.646192https://pleroma.soykaf.com/contexts/8aebc8e5-5352-4047-8b74-4098a5830ccahttps://pleroma.soykaf.com/users/fortunehttp://activitystrea.ms/schema/1.0/personhttps://pleroma.soykaf.com/users/fortunefortunefortuneThe trusty unix fortune filefortunehttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/sharehttps://pleroma.soykaf.com/activities/eff9fe49-8fc9-48e6-a1a0-921aa25c8118lain repeated a noticeRT The real trouble with women is that they have *all* the pussy.2017-05-03T17:30:22.5960372017-05-03T17:30:22.596048https://pleroma.soykaf.com/contexts/8c88c9df-4e40-4f54-b15f-c21848d1a8e2http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/0b9b008d-49eb-48a9-a18d-172ce7d01ea2New note by fortuneThe real trouble with women is that they have *all* the pussy.2017-05-02T12:10:03.6030862017-05-03T17:30:22.683141https://pleroma.soykaf.com/contexts/8c88c9df-4e40-4f54-b15f-c21848d1a8e2https://pleroma.soykaf.com/users/fortunehttp://activitystrea.ms/schema/1.0/personhttps://pleroma.soykaf.com/users/fortunefortunefortuneThe trusty unix fortune filefortunehttp://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/5d90bb26-ce23-4a5b-8dbd-651011780007New favorite by lainlain favorited something2017-05-03T17:28:20.9679262017-05-03T17:28:20.967935http://activitystrea.ms/schema/1.0/notetag:mastodon.social,2017-05-03:objectId=4952899:objectType=Statushttps://pleroma.soykaf.com/contexts/42701ab4-964a-441a-a372-f51bd183e441 \ No newline at end of file diff --git a/test/fixtures/tesla_mock/https___shitposter.club_api_statuses_show_2827873.atom.xml b/test/fixtures/tesla_mock/https___shitposter.club_api_statuses_show_2827873.atom.xml deleted file mode 100644 index 26fdebb49..000000000 --- a/test/fixtures/tesla_mock/https___shitposter.club_api_statuses_show_2827873.atom.xml +++ /dev/null @@ -1,54 +0,0 @@ - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T08:51:48+00:00 - 2017-05-05T08:51:48+00:00 - - http://activitystrea.ms/schema/1.0/person - https://shitposter.club/user/1 - moonman - EMAIL:shitposterclub@gmail.com XMPP: moon@talk.shitposter.club Matrix Ed25519 fingerprint: 2HuDUTEz3iFN5N3xl6PYp9xZW/EWhgbbt78SrFy4w8o - - - - - - moonman - Generic Enemy - EMAIL:shitposterclub@gmail.com XMPP: moon@talk.shitposter.club Matrix Ed25519 fingerprint: 2HuDUTEz3iFN5N3xl6PYp9xZW/EWhgbbt78SrFy4w8o - - The Moon - - - homepage - https://shitposter.club/moonman - true - - - - - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=3c16e9c2681f6d26 - - - - - https://shitposter.club/api/statuses/user_timeline/1.atom - Generic Enemy - - - - https://shitposter.club/avatar/1-96-20170503024316.jpeg - 2017-05-05T11:43:58+00:00 - - - - - diff --git a/test/fixtures/tesla_mock/https___shitposter.club_api_statuses_user_timeline_1.atom.xml b/test/fixtures/tesla_mock/https___shitposter.club_api_statuses_user_timeline_1.atom.xml deleted file mode 100644 index 31df7c2a6..000000000 --- a/test/fixtures/tesla_mock/https___shitposter.club_api_statuses_user_timeline_1.atom.xml +++ /dev/null @@ -1,454 +0,0 @@ - - - GNU social - https://shitposter.club/api/statuses/user_timeline/1.atom - moonman timeline - Updates from moonman on Shitposter Club! - https://shitposter.club/avatar/1-96-20170503024316.jpeg - 2017-05-05T13:24:09+00:00 - - http://activitystrea.ms/schema/1.0/person - https://shitposter.club/user/1 - moonman - EMAIL:shitposterclub@gmail.com XMPP: moon@talk.shitposter.club Matrix Ed25519 fingerprint: 2HuDUTEz3iFN5N3xl6PYp9xZW/EWhgbbt78SrFy4w8o - - - - - - moonman - Generic Enemy - EMAIL:shitposterclub@gmail.com XMPP: moon@talk.shitposter.club Matrix Ed25519 fingerprint: 2HuDUTEz3iFN5N3xl6PYp9xZW/EWhgbbt78SrFy4w8o - - The Moon - - - homepage - https://shitposter.club/moonman - true - - - - - - - - - - - - - - tag:shitposter.club,2017-05-05:subscription:1:person:23190:2017-05-05T11:43:58+00:00 - Generic Enemy (moonman)'s status on Friday, 05-May-2017 11:43:58 UTC - <a href="https://shitposter.club/moonman">Generic Enemy</a> started following <a href="https://noagendasocial.com/@Ma5on">Mason</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-05-05T11:43:58+00:00 - 2017-05-05T11:43:58+00:00 - - http://activitystrea.ms/schema/1.0/person - https://noagendasocial.com/users/Ma5on - Mason - - - - - - ma5on - Mason - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=abffa9c14a054d3b - - - - - - - tag:shitposter.club,2017-05-05:subscription:1:person:14357:2017-05-05T10:29:03+00:00 - Generic Enemy (moonman)'s status on Friday, 05-May-2017 10:29:03 UTC - <a href="https://shitposter.club/moonman">Generic Enemy</a> started following <a href="https://mastodon.cloud/@ohyran">Jens Reuterberg</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-05-05T10:29:03+00:00 - 2017-05-05T10:29:03+00:00 - - http://activitystrea.ms/schema/1.0/person - https://mastodon.cloud/users/ohyran - Jens Reuterberg - RPG-nerd, illustrator, Open Source enthusiast, KDE dude, designer and gay lefty. Might be a cliché - but we will soon find out! - - - - - - ohyran - Jens Reuterberg - RPG-nerd, illustrator, Open Source enthusiast, KDE dude, designer and gay lefty. Might be a cliché - but we will soon find out! - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=937151d4825a85bf - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828637:objectType=note - New note by moonman - basicall i would just rather have ppl say &quot;i like x and y&quot; than &quot;i'm a nerd&quot; the term can be retired. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:24:54+00:00 - 2017-05-05T10:24:54+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=65992b0b9b5e6931 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2828579:objectType=comment - New comment by moonman - @<a href="https://gs.smuglo.li/user/35497" class="h-card mention" title="Bokuro Bokusawa">boco</a> to be honest i've turned right around and been cruel to other people, i said i'd never do it but it happens again eventually. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:20:33+00:00 - 2017-05-05T10:20:33+00:00 - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=c997fc73d7f8a8f0 - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2828554:objectType=comment - New comment by moonman - @<a href="https://mastodon.cloud/users/ohyran" class="h-card mention" title="Jens Reuterberg">ohyran</a> i won't ever get over bullying but i agree otherwise. i don't go to comic shops too often these days but i got dragged to one last year and the sheer diversity of people enjoying comics now compared to years ago was striking and it pleased me. and i noticed a couple years ago because of youtube i find things i truly enjoy watching, like in-depth videos about electronic parts, didn't exist 20 years ago. it's pretty great. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:18:10+00:00 - 2017-05-05T10:18:10+00:00 - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=efae3a23b6e05767 - - - - - - - - tag:shitposter.club,2017-05-05:fave:1:comment:2828502:2017-05-05T10:12:52+00:00 - Favorite - moonman favorited something by ohyran: <p><span class="h-card"><a href="https://shitposter.club/moonman" class="u-url mention">@<span>moonman</span></a></span> fair enough - that distinction makes it clearer...</p><p>On the other hand - those of us who did "pay the price" of being nerdy little kids in the 80's and 90's should strive to get past it anyway (mental health wise not "just get over it") and see the "nerd culture" thing as a blessing of sorts. We are in the optimal spot to do it. (not saying that that is something easy btw just that NOW is the best of time to start talking about it)</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T10:12:52+00:00 - 2017-05-05T10:12:52+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:mastodon.cloud,2017-05-05:objectId=6334570:objectType=Status - New comment by ohyran - <p><span class="h-card"><a href="https://shitposter.club/moonman" class="u-url mention">@<span>moonman</span></a></span> fair enough - that distinction makes it clearer...</p><p>On the other hand - those of us who did "pay the price" of being nerdy little kids in the 80's and 90's should strive to get past it anyway (mental health wise not "just get over it") and see the "nerd culture" thing as a blessing of sorts. We are in the optimal spot to do it. (not saying that that is something easy btw just that NOW is the best of time to start talking about it)</p> - - - - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=efae3a23b6e05767 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828496:objectType=note - New note by moonman - things are better now, a lot less kids in america get beaten up and called a fag. still too many. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:11:31+00:00 - 2017-05-05T10:11:31+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=c997fc73d7f8a8f0 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2828457:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/21787" class="h-card mention" title="Yukari">cutscenes</a> @<a href="https://gs.smuglo.li/user/28250" class="h-card mention" title="Bricky">thatbrickster</a> @<a href="https://gs.smuglo.li/user/35497" class="h-card mention" title="Bokuro Bokusawa">boco</a> i never understood this because nerds had pocket protectors, which was a draftsman engineer thing and therefore smart, while geeks were people in carnivals who bit heads off small animals. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:07:57+00:00 - 2017-05-05T10:07:57+00:00 - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=efae3a23b6e05767 - - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2828435:objectType=comment - New comment by moonman - @<a href="https://mastodon.cloud/users/ohyran" class="h-card mention" title="Jens Reuterberg">ohyran</a> since i didn't specify i'm talking about people subjected to physical and psychological abuse and not people that are just mad that more people like comic books now. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:05:07+00:00 - 2017-05-05T10:05:07+00:00 - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=efae3a23b6e05767 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828326:objectType=note - New note by moonman - if you were a &quot;nerd&quot; before, like, 2001 you have permanent excuse to hate this kind of shit.   <a href="https://shitposter.club/file/b79fa5644be0d6f22679136e67b7bf45c9c4a74a55c32dd2d0cf15de4ddd5be5.gif" title="https://shitposter.club/file/b79fa5644be0d6f22679136e67b7bf45c9c4a74a55c32dd2d0cf15de4ddd5be5.gif" class="attachment" id="attachment-662105" rel="nofollow external">https://shitposter.club/attachment/662105</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:47:42+00:00 - 2017-05-05T09:47:42+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=efae3a23b6e05767 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828250:objectType=note - New note by moonman - <a href="https://shitposter.club/file/1283e2d4dd8f96b8eeb5d9a16b318e210868aa11386cf0d593891e4c75c9126e.gif" title="https://shitposter.club/file/1283e2d4dd8f96b8eeb5d9a16b318e210868aa11386cf0d593891e4c75c9126e.gif" class="attachment" id="attachment-662098" rel="nofollow external">https://shitposter.club/attachment/662098</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:39:06+00:00 - 2017-05-05T09:39:06+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=ea8ffae90546f0ab - - - - - - - - tag:shitposter.club,2017-05-05:fave:1:comment:2828161:2017-05-05T09:28:19+00:00 - Favorite - moonman favorited something by kro: @<a href="https://shitposter.club/user/1" class="h-card u-url p-nickname mention" title="Generic Enemy">moonman</a> Till Brooklyn? - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T09:28:19+00:00 - 2017-05-05T09:28:19+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:gs.smuglo.li,2017-05-05:noticeId=2188587:objectType=comment - New comment by kro - @<a href="https://shitposter.club/user/1" class="h-card u-url p-nickname mention" title="Generic Enemy">moonman</a> Till Brooklyn? - - - - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=d7aa6b5b057ca555 - - - - - - - tag:shitposter.club,2017-05-05:fave:1:comment:2828125:2017-05-05T09:24:56+00:00 - Favorite - moonman favorited something by hardbass2k8: this has obviously interesting implications in various places, for example:<br /> the nationalism of the nazis might not have been real, who would have thought?<br /> socialism is usually promoted to implementation by real douchebags!<br /> your local social justice people might want diversity but they don't want you, m/19, white, why?<br /> amateur soccer club, they want to be the best in the amateur league but actually they just get drunk after training and are 50% overweight.<br /> This is because humans are not capable of telepathy, so if you join a group it doesn't magically align every little bit of your being with the declared group goals.<br /> <br /> Even though you see unmanned group beliefs flying around from time to time, generally groups are created from a bunch of people. they are not a container for people, they are the people inside them.<br /> <br /> so if you see a group that appears to be cool don't think of it as cool because its goals are cool but because its members are cool. if they aren't, tough cookies. don't be the retard and end up on the camp watchtower. - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T09:24:56+00:00 - 2017-05-05T09:24:56+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2828125:objectType=comment - New comment by hardbass2k8 - this has obviously interesting implications in various places, for example:<br /> the nationalism of the nazis might not have been real, who would have thought?<br /> socialism is usually promoted to implementation by real douchebags!<br /> your local social justice people might want diversity but they don't want you, m/19, white, why?<br /> amateur soccer club, they want to be the best in the amateur league but actually they just get drunk after training and are 50% overweight.<br /> This is because humans are not capable of telepathy, so if you join a group it doesn't magically align every little bit of your being with the declared group goals.<br /> <br /> Even though you see unmanned group beliefs flying around from time to time, generally groups are created from a bunch of people. they are not a container for people, they are the people inside them.<br /> <br /> so if you see a group that appears to be cool don't think of it as cool because its goals are cool but because its members are cool. if they aren't, tough cookies. don't be the retard and end up on the camp watchtower. - - - - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=51b227fe92f6babf - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828128:objectType=note - New note by moonman - In a valid remake of They live, signs would say REBEL, and DON'T GET MARRIED AND HAVE KIDS - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:24:23+00:00 - 2017-05-05T09:24:23+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=b74397fa766b82c9 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828104:objectType=note - New note by moonman - <a href="https://shitposter.club/file/4d34178bde99599f31a28928e1666fbd58448d8a22e94ed82222496e4a45cb07.gif" title="https://shitposter.club/file/4d34178bde99599f31a28928e1666fbd58448d8a22e94ed82222496e4a45cb07.gif" class="attachment" id="attachment-662049" rel="nofollow external">https://shitposter.club/attachment/662049</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:21:01+00:00 - 2017-05-05T09:21:01+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=d7aa6b5b057ca555 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828102:objectType=note - New note by moonman - when ppl find out i haven't always been serious  <a href="https://shitposter.club/file/5859fa95875342cc65dba0d852f726db158ce28198c326d5f13d9de7c0d2c449.gif" title="https://shitposter.club/file/5859fa95875342cc65dba0d852f726db158ce28198c326d5f13d9de7c0d2c449.gif" class="attachment" id="attachment-662053" rel="nofollow external">https://shitposter.club/attachment/662053</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:20:45+00:00 - 2017-05-05T09:20:45+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=0a025ac5a570b4ec - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2828086:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> @<a href="https://gs.smuglo.li/user/35497" class="h-card mention" title="Bokuro Bokusawa">boco</a> you are being too serious lol - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:17:19+00:00 - 2017-05-05T09:17:19+00:00 - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=3c16e9c2681f6d26 - - - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828085:objectType=note - New note by moonman - shitposter dot club  <a href="https://shitposter.club/file/9b084c7210b16abbf4d28594b924a07ef4a2a06f89d901a4c42fb1e243291263.gif" title="https://shitposter.club/file/9b084c7210b16abbf4d28594b924a07ef4a2a06f89d901a4c42fb1e243291263.gif" class="attachment" id="attachment-662047" rel="nofollow external">https://shitposter.club/attachment/662047</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:16:50+00:00 - 2017-05-05T09:16:50+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=d1ae088a1b91e5e5 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2828061:objectType=note - New note by moonman - even when i lie i tell the truth, is that so hard to understand? - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:15:07+00:00 - 2017-05-05T09:15:07+00:00 - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=a516e4b8506b8ef5 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2828052:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/9591" class="h-card mention" title="warum hei&#xDF;en deutschl&#xE4;nder deutschl&#xE4;nder">hardbass2k8</a> history, anthropology. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T09:14:22+00:00 - 2017-05-05T09:14:22+00:00 - - - - tag:shitposter.club,2017-05-05:objectType=thread:nonce=fe4d7f35b13403ba - - - - - - - diff --git a/test/fixtures/tesla_mock/https___shitposter.club_notice_2827873.json b/test/fixtures/tesla_mock/https___shitposter.club_notice_2827873.json deleted file mode 100644 index 4b7b4df44..000000000 --- a/test/fixtures/tesla_mock/https___shitposter.club_notice_2827873.json +++ /dev/null @@ -1 +0,0 @@ -{"@context":["https://www.w3.org/ns/activitystreams","https://shitposter.club/schemas/litepub-0.1.jsonld",{"@language":"und"}],"actor":"https://shitposter.club/users/moonman","attachment":[],"attributedTo":"https://shitposter.club/users/moonman","cc":["https://shitposter.club/users/moonman/followers"],"content":"@neimzr4luzerz @dolus childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English","context":"tag:shitposter.club,2017-05-05:objectType=thread:nonce=3c16e9c2681f6d26","conversation":"tag:shitposter.club,2017-05-05:objectType=thread:nonce=3c16e9c2681f6d26","id":"tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment","inReplyTo":"tag:shitposter.club,2017-05-05:noticeId=2827849:objectType=comment","inReplyToStatusId":2827849,"published":"2017-05-05T08:51:48Z","sensitive":false,"summary":null,"tag":[],"to":["https://www.w3.org/ns/activitystreams#Public"],"type":"Note"} \ No newline at end of file diff --git a/test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_23211.atom.xml b/test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_23211.atom.xml deleted file mode 100644 index 6cba5c28f..000000000 --- a/test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_23211.atom.xml +++ /dev/null @@ -1,591 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-05T12:01:21+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2063249:2017-05-05T11:40:21+00:00 - Favorite - lambadalambda favorited something by tatiana: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> they will start complaining about this, but won't come up with any solutions)</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T11:40:21+00:00 - 2017-05-05T11:40:21+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:social.weho.st,2017-05-05:objectId=172033:objectType=Status - New comment by tatiana - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> they will start complaining about this, but won't come up with any solutions)</p> - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2063041:2017-05-05T11:27:28+00:00 - Favorite - lambadalambda favorited something by kat: @<a href="https://social.heldscal.la/lambadalambda" class="h-card mention" title="Constance Variable">lambadalambda</a> if the admin reading mine would delete a few it would be really useful in prioritising.  - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T11:27:28+00:00 - 2017-05-05T11:27:28+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:quitter.se,2017-05-05:noticeId=11807959:objectType=comment - New comment by kat - @<a href="https://social.heldscal.la/lambadalambda" class="h-card mention" title="Constance Variable">lambadalambda</a> if the admin reading mine would delete a few it would be really useful in prioritising.  - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - tag:social.heldscal.la,2017-05-05:noticeId=2062924:objectType=note - lambadalambda repeated a notice by nielsk - RT @nielsk @<a href="https://social.heldscal.la/user/23211" class="h-card u-url p-nickname mention" title="Constance Variable">lambadalambda</a> but there are soooo many, where should I start to read? - - http://activitystrea.ms/schema/1.0/share - 2017-05-05T11:09:37+00:00 - 2017-05-05T11:09:37+00:00 - - http://activitystrea.ms/schema/1.0/activity - tag:mastodon.social,2017-05-05:objectId=5024471:objectType=Status - - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> but there are soooo many, where should I start to read?</p> - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T11:05:18+00:00 - 2017-05-05T11:05:18+00:00 - - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/nielsk - nielsk - Sysadmin by day and ehm… sysadmin by night. Besides that old video games, Japan, economics and some other stuff - - - - - - nielsk - nielsk - Sysadmin by day and ehm… sysadmin by night. Besides that old video games, Japan, economics and some other stuff - - - - http://activitystrea.ms/schema/1.0/comment - tag:mastodon.social,2017-05-05:objectId=5024471:objectType=Status - New comment by nielsk - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> but there are soooo many, where should I start to read?</p> - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - https://mastodon.social/users/nielsk.atom - nielsk - - - https://social.heldscal.la/avatar/29849-96-20170428120041.jpeg - 2017-05-05T11:06:32+00:00 - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2062875:2017-05-05T11:09:27+00:00 - Favorite - lambadalambda favorited something by nielsk: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> but there are soooo many, where should I start to read?</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T11:09:27+00:00 - 2017-05-05T11:09:27+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:mastodon.social,2017-05-05:objectId=5024471:objectType=Status - New comment by nielsk - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> but there are soooo many, where should I start to read?</p> - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2062863:2017-05-05T11:09:11+00:00 - Favorite - lambadalambda favorited something by kasil: <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> surely, google is not that evil !</p> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T11:09:11+00:00 - 2017-05-05T11:09:11+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:loutre.info,2017-05-05:objectId=23331:objectType=Status - New comment by kasil - <p><span class="h-card"><a href="https://social.heldscal.la/lambadalambda" class="u-url mention">@<span>lambadalambda</span></a></span> surely, google is not that evil !</p> - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-05:noticeId=2062767:objectType=comment - New comment by lambadalambda - @<a href="https://sealion.club/user/4" class="h-card u-url p-nickname mention" title="dewoo &#x274E;">dwmatiz</a> dunno, probably. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:55:17+00:00 - 2017-05-05T10:55:17+00:00 - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-05:noticeId=2062705:objectType=comment - New comment by lambadalambda - @<a href="https://gs.smuglo.li/user/28250" class="h-card u-url p-nickname mention" title="Bricky">thatbrickster</a> I do it, too. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:48:12+00:00 - 2017-05-05T10:48:12+00:00 - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-05-05:noticeId=2062620:objectType=comment - New comment by lambadalambda - @<a href="https://social.tchncs.de/users/israuor" class="h-card u-url p-nickname mention" title="Israuor &#x2642;">israuor</a> @<a href="https://mastodon.gougere.fr/users/bortzmeyer" class="h-card u-url p-nickname mention" title="S. Bortzmeyer &#x2705;">bortzmeyer</a> so, 99%. 100% for 'normal' people. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:38:52+00:00 - 2017-05-05T10:38:52+00:00 - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-05-05:noticeId=2062583:objectType=note - New note by lambadalambda - I wonder what'll happen when people realize the admin at their mail hoster can read all their e-mails. - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T10:35:45+00:00 - 2017-05-05T10:35:45+00:00 - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=e95b99adc050e198 - - - - - - - tag:social.heldscal.la,2017-05-05:subscription:23211:person:35708:2017-05-05T09:34:46+00:00 - Constance Variable (lambadalambda@social.heldscal.la)'s status on Friday, 05-May-2017 09:34:46 UTC - <a href="https://social.heldscal.la/lambadalambda">Constance Variable</a> started following <a href="https://mastodon.social/@milouse">milouse</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-05-05T09:34:46+00:00 - 2017-05-05T09:34:46+00:00 - - http://activitystrea.ms/schema/1.0/person - https://mastodon.social/users/milouse - milouse - #Scout leader #sgdf, interested in #openweb, #semanticweb, #privacy, #foss and #socialeconomy. 0xA714ECAC8C9CEE3D - - - - - - milouse - milouse - #Scout leader #sgdf, interested in #openweb, #semanticweb, #privacy, #foss and #socialeconomy. 0xA714ECAC8C9CEE3D - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=26ca19a355bb6135 - - - - - - - tag:social.heldscal.la,2017-05-05:noticeId=2061871:objectType=note - lambadalambda repeated a notice by safebot - RT @<a href="https://gs.smuglo.li/user/25857" class="h-card u-url p-nickname mention" title="safebot">safebot</a> #<span class="tag"><a href="https://social.heldscal.la/tag/cheers" rel="tag">cheers</a></span> <a href="https://gs.smuglo.li/attachment/456444" title="https://gs.smuglo.li/attachment/456444" rel="nofollow external noreferrer" class="attachment" id="attachment-432334">https://gs.smuglo.li/attachment/456444</a> - - http://activitystrea.ms/schema/1.0/share - 2017-05-05T09:16:17+00:00 - 2017-05-05T09:16:17+00:00 - - http://activitystrea.ms/schema/1.0/activity - tag:gs.smuglo.li,2017-05-05:noticeId=2188073:objectType=note - - #<span class="tag"><a href="https://gs.smuglo.li/tag/cheers" rel="tag">cheers</a></span> <a href="https://gs.smuglo.li/file/5099e73c83da778cd032a721e96880f99a868b712be2975d08238547a5ba06c7.jpg" title="https://gs.smuglo.li/file/5099e73c83da778cd032a721e96880f99a868b712be2975d08238547a5ba06c7.jpg" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/456444</a> - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T08:36:53+00:00 - 2017-05-05T08:36:53+00:00 - - http://activitystrea.ms/schema/1.0/person - https://gs.smuglo.li/user/25857 - safebot - - - - - - safebot - safebot - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.smuglo.li,2017-05-05:noticeId=2188073:objectType=note - New note by safebot - #<span class="tag"><a href="https://gs.smuglo.li/tag/cheers" rel="tag">cheers</a></span> <a href="https://gs.smuglo.li/file/5099e73c83da778cd032a721e96880f99a868b712be2975d08238547a5ba06c7.jpg" title="https://gs.smuglo.li/file/5099e73c83da778cd032a721e96880f99a868b712be2975d08238547a5ba06c7.jpg" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/456444</a> - - - - - https://gs.smuglo.li/conversation/1009429 - - - - https://gs.smuglo.li/api/statuses/user_timeline/25857.atom - safebot - - - https://social.heldscal.la/avatar/25719-original-20161215233234.jpeg - 2017-05-05T12:00:57+00:00 - - - - https://gs.smuglo.li/conversation/1009429 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061643:2017-05-05T09:12:50+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T09:12:50+00:00 - 2017-05-05T09:12:50+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> @<a href="https://gs.smuglo.li/user/2326" class="h-card mention" title="Dolus_McHonest">dolus</a> childhood poring over Strong's concordance and a koine Greek dictionary, fast forward to 2017 and some fuckstick who translates japanese jackoff material tells me you just need to make it sound right in English - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=55ead90125cd4bd4 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061696:2017-05-05T09:06:10+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> <br /> <span class="greentext">&gt; (((common era)))</span> - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T09:06:10+00:00 - 2017-05-05T09:06:10+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827918:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> <br /> <span class="greentext">&gt; (((common era)))</span> - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=55ead90125cd4bd4 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:note:2061673:2017-05-05T08:58:28+00:00 - Favorite - lambadalambda favorited something by moonman: discussion is one thing but any argument I've heard over and over again for the last three decades is going to go unanswered. - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T08:58:28+00:00 - 2017-05-05T08:58:28+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-05-05:noticeId=2827895:objectType=note - New note by moonman - discussion is one thing but any argument I've heard over and over again for the last three decades is going to go unanswered. - - - - - - - https://shitposter.club/conversation/1390494 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061280:2017-05-05T08:47:38+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> sex is for procreation and as an expression of intimacy between commited couples, it is a sacramental act - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T08:47:38+00:00 - 2017-05-05T08:47:38+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827561:objectType=comment - New comment by moonman - @<a href="https://shitposter.club/user/9655" class="h-card mention" title="Solidarity for Pigs">neimzr4luzerz</a> sex is for procreation and as an expression of intimacy between commited couples, it is a sacramental act - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=55ead90125cd4bd4 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:note:2061535:2017-05-05T08:40:55+00:00 - Favorite - lambadalambda favorited something by fortune: What did Mickey Mouse get for Christmas?<br /> <br /> A Dan Quayle watch.<br /> <br /> -- heard from a Mike Dukakis field worker - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T08:40:55+00:00 - 2017-05-05T08:40:55+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-05-05:noticeId=2061535:objectType=note - New note by fortune - What did Mickey Mouse get for Christmas?<br /> <br /> A Dan Quayle watch.<br /> <br /> -- heard from a Mike Dukakis field worker - - - - - - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=5185e5c145ee4762 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061421:2017-05-05T08:36:27+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://maly.io/users/sonya" class="h-card mention" title="Sonya Mann ✅">sonya</a> banned from 4chan. you better watch ou. i'm trouble, y'hear? - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T08:36:27+00:00 - 2017-05-05T08:36:27+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827689:objectType=comment - New comment by moonman - @<a href="https://maly.io/users/sonya" class="h-card mention" title="Sonya Mann ✅">sonya</a> banned from 4chan. you better watch ou. i'm trouble, y'hear? - - - - - - - https://shitposter.club/conversation/1389345 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061351:2017-05-05T08:28:03+00:00 - Favorite - lambadalambda favorited something by moonman: @<a href="https://social.heldscal.la/user/29138" class="h-card mention" title="Claes Wallin (韋嘉誠)">clacke</a> is that the sequel to Time Crisis - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T08:28:03+00:00 - 2017-05-05T08:28:03+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827630:objectType=comment - New comment by moonman - @<a href="https://social.heldscal.la/user/29138" class="h-card mention" title="Claes Wallin (韋嘉誠)">clacke</a> is that the sequel to Time Crisis - - - - - - - https://shitposter.club/conversation/1385528 - - - - - - - tag:social.heldscal.la,2017-05-05:fave:23211:comment:2061339:2017-05-05T08:21:05+00:00 - Favorite - lambadalambda favorited something by hardbass2k8: @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> pretty sure it's money laundering - - http://activitystrea.ms/schema/1.0/favorite - 2017-05-05T08:21:05+00:00 - 2017-05-05T08:21:05+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2017-05-05:noticeId=2827617:objectType=comment - New comment by hardbass2k8 - @<a href="https://social.heldscal.la/user/23211" class="h-card mention" title="Constance Variable">lambadalambda</a> pretty sure it's money laundering - - - - - - - https://shitposter.club/conversation/1387523 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-05-05:noticeId=2061303:objectType=note - New note by lambadalambda - It's got tattoos, it's got a pierced hood<br /> It's got generation X<br /> It's got lesbians, and vitriol<br /> And sadomasochistic latex sex<br /> It's got Mighty Morphin' power brokers<br /> And Tanya Harding nude<br /> Macrobiotic lacto-vegan non-confrontational free range food<br /> It's got the handshake, peace talk, non-aggression pact<br /> A multicultural integration of segregated historical facts<br /> <br /> #<span class="tag"><a href="https://social.heldscal.la/tag/nsfw" rel="tag">nsfw</a></span> <a href="https://social.heldscal.la/file/61c13b99c92f40ec4865e7a3830da340b187e3de70d94b8da38fd2138bbede3a.jpg" title="https://social.heldscal.la/file/61c13b99c92f40ec4865e7a3830da340b187e3de70d94b8da38fd2138bbede3a.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-432199">https://social.heldscal.la/attachment/432199</a> <a href="https://social.heldscal.la/file/a88bba1a324da68ee2cfdbcd1c4cde60bd9553298244d6f81731270b71aa80df.jpg" title="https://social.heldscal.la/file/a88bba1a324da68ee2cfdbcd1c4cde60bd9553298244d6f81731270b71aa80df.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-432200">https://social.heldscal.la/attachment/432200</a> <a href="https://social.heldscal.la/file/887329a303250e73dc2eea06b1f0512fcac4b9d1b534068f03c45f00d5b21c39.jpg" title="https://social.heldscal.la/file/887329a303250e73dc2eea06b1f0512fcac4b9d1b534068f03c45f00d5b21c39.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-432201">https://social.heldscal.la/attachment/432201</a> <a href="https://social.heldscal.la/file/6d7a1ec15c1368c4c68810434d24da528606fcbccdd1da97b25affafeeb6ffda.jpg" title="https://social.heldscal.la/file/6d7a1ec15c1368c4c68810434d24da528606fcbccdd1da97b25affafeeb6ffda.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-432202">https://social.heldscal.la/attachment/432202</a> <a href="https://social.heldscal.la/file/2f55f2bb028eb9be744cc82b35a6b86b496d8c3924c700aff55a872ff11df54c.jpg" title="https://social.heldscal.la/file/2f55f2bb028eb9be744cc82b35a6b86b496d8c3924c700aff55a872ff11df54c.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-432203">https://social.heldscal.la/attachment/432203</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-05-05T08:17:08+00:00 - 2017-05-05T08:17:08+00:00 - - tag:social.heldscal.la,2017-05-05:objectType=thread:nonce=bb6f4343036970e8 - - - - - - - - - - - - diff --git a/test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_29191.atom.xml b/test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_29191.atom.xml deleted file mode 100644 index f70fbc695..000000000 --- a/test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_29191.atom.xml +++ /dev/null @@ -1,719 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/29191.atom - shp timeline - Updates from shp on social.heldscal.la! - https://social.heldscal.la/avatar/29191-96-20170421154949.jpeg - 2017-05-05T11:57:06+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/29191 - shp - cofe - - - - - - shp - shp - cofe - - cofe - - - - - - - - - - - - - - tag:social.heldscal.la,2017-04-29:noticeId=1967657:objectType=note - shp repeated a notice by lain - RT @<a href="https://social.heldscal.la/user/37181" class="h-card u-url p-nickname mention" title="Lain Iwakura">lain</a> @<a href="https://social.heldscal.la/user/29191" class="h-card u-url p-nickname mention" title="shp">shp</a> @<a href="https://social.heldscal.la/user/23211" class="h-card u-url p-nickname mention">lambadalambda</a> cofe. - - http://activitystrea.ms/schema/1.0/share - 2017-04-29T18:19:34+00:00 - 2017-04-29T18:19:34+00:00 - - http://activitystrea.ms/schema/1.0/activity - https://pleroma.soykaf.com/activities/43d12c05-db3f-4f3d-bee1-d676f264490c - - <a href="https://pleroma.soykaf.com/users/shp">@shp</a> <a href="https://social.heldscal.la/user/23211">@lambadalambda@social.heldscal.la</a> cofe. - - http://activitystrea.ms/schema/1.0/post - 2017-04-29T18:14:36+00:00 - 2017-04-29T18:14:36+00:00 - - http://activitystrea.ms/schema/1.0/person - https://pleroma.soykaf.com/users/lain - lain - Test account - - - - - - lain - Lain Iwakura - Test account - - - - http://activitystrea.ms/schema/1.0/note - https://pleroma.soykaf.com/activities/43d12c05-db3f-4f3d-bee1-d676f264490c - New note by lain - <a href="https://pleroma.soykaf.com/users/shp">@shp</a> <a href="https://social.heldscal.la/user/23211">@lambadalambda@social.heldscal.la</a> cofe. - - - - - tag:social.heldscal.la,2017-04-29:objectType=thread:nonce=e0b75431888efdab - - - https://pleroma.soykaf.com/users/lain/feed.atom - Lain Iwakura - - - https://social.heldscal.la/avatar/43188-96-20170429172422.jpeg - 2017-05-05T08:38:03+00:00 - - - - tag:social.heldscal.la,2017-04-29:objectType=thread:nonce=e0b75431888efdab - - - - - - - tag:social.heldscal.la,2017-04-27:subscription:29191:person:29558:2017-04-27T17:26:37+00:00 - shp (shp@social.heldscal.la)'s status on Thursday, 27-Apr-2017 17:26:37 UTC - <a href="https://social.heldscal.la/shp">shp</a> started following <a href="https://gs.smuglo.li/kfist">KFist</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-27T17:26:37+00:00 - 2017-04-27T17:26:37+00:00 - - http://activitystrea.ms/schema/1.0/person - https://gs.smuglo.li/user/28051 - KFist - I stream thanks to @nepfag. I also drink, shitpost, and fly planes. I visited Japan and it changed my life. Do you love your station? - - - - - - kfist - KFist - I stream thanks to @nepfag. I also drink, shitpost, and fly planes. I visited Japan and it changed my life. Do you love your station? - - homepage - http://smuglo.li:8000/stream.m3u - true - - - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=f766240d13ed9c2e - - - - - - - tag:social.heldscal.la,2017-04-27:noticeId=1933030:objectType=note - shp repeated a notice by shpbot - RT @<a href="https://gs.archae.me/user/4687" class="h-card u-url p-nickname mention" title="shpbot">shpbot</a> &gt;QuakeC - - http://activitystrea.ms/schema/1.0/share - 2017-04-27T17:21:10+00:00 - 2017-04-27T17:21:10+00:00 - - http://activitystrea.ms/schema/1.0/activity - tag:gs.archae.me,2017-04-27:noticeId=760881:objectType=note - - <span class='greentext'>&gt;QuakeC</span> - - http://activitystrea.ms/schema/1.0/post - 2017-04-27T17:15:13+00:00 - 2017-04-27T17:15:13+00:00 - - http://activitystrea.ms/schema/1.0/person - https://gs.archae.me/user/4687 - shpbot - - - - - - shpbot - shpbot - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.archae.me,2017-04-27:noticeId=760881:objectType=note - New note by shpbot - <span class='greentext'>&gt;QuakeC</span> - - - - - https://gs.archae.me/conversation/318362 - - - https://gs.archae.me/api/statuses/user_timeline/4687.atom - shpbot - - - https://social.heldscal.la/avatar/31581-original-20170405170019.jpeg - 2017-05-05T11:45:08+00:00 - - - - https://gs.archae.me/conversation/318362 - - - - - - - tag:social.heldscal.la,2017-04-27:subscription:29191:person:23226:2017-04-27T17:20:48+00:00 - shp (shp@social.heldscal.la)'s status on Thursday, 27-Apr-2017 17:20:48 UTC - <a href="https://social.heldscal.la/shp">shp</a> started following <a href="http://quitter.se/taknamay">Internet Turtle Ⓐ 🏴 ✅</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-27T17:20:48+00:00 - 2017-04-27T17:20:48+00:00 - - http://activitystrea.ms/schema/1.0/person - http://quitter.se/user/115823 - Internet Turtle Ⓐ 🏴 ✅ - Scheme programmer, Novice esperantist, Spiritual naturalist - Will listen to your problems for free - XMPP: DarkDungeons94 at chatme.im - - - - - - taknamay - Internet Turtle Ⓐ 🏴 ✅ - Scheme programmer, Novice esperantist, Spiritual naturalist - Will listen to your problems for free - XMPP: DarkDungeons94 at chatme.im - - New Jersey, United States - - - homepage - https://quitter.se/taknamay - true - - - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=a66b1fb22020c152 - - - - - - - tag:social.heldscal.la,2017-04-27:subscription:29191:person:29302:2017-04-27T17:20:33+00:00 - shp (shp@social.heldscal.la)'s status on Thursday, 27-Apr-2017 17:20:33 UTC - <a href="https://social.heldscal.la/shp">shp</a> started following <a href="https://icosahedron.website/@Trev">Chillidan Stormrave</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-27T17:20:33+00:00 - 2017-04-27T17:20:33+00:00 - - http://activitystrea.ms/schema/1.0/person - https://icosahedron.website/users/Trev - Trev Prime - web tech, music, ethics. radical individualist. kinda queer. love thy neighbor. always open for conversation. - - - - - - trev - Trev Prime - web tech, music, ethics. radical individualist. kinda queer. love thy neighbor. always open for conversation. - - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=781c05bd64ad9520 - - - - - - - tag:social.heldscal.la,2017-04-27:subscription:29191:person:29367:2017-04-27T17:20:27+00:00 - shp (shp@social.heldscal.la)'s status on Thursday, 27-Apr-2017 17:20:27 UTC - <a href="https://social.heldscal.la/shp">shp</a> started following <a href="https://gs.kawa-kun.com/aya">射命丸 文</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-27T17:20:27+00:00 - 2017-04-27T17:20:27+00:00 - - http://activitystrea.ms/schema/1.0/person - https://gs.kawa-kun.com/user/4885 - 射命丸 文 - Traditional Reporter of Fantasy - - - - - - aya - 射命丸 文 - Traditional Reporter of Fantasy - - Gensōkyō - - - homepage - https://danbooru.donmai.us - true - - - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=5921da7a934e47ca - - - - - - - tag:social.heldscal.la,2017-04-27:subscription:29191:person:27773:2017-04-27T17:20:18+00:00 - shp (shp@social.heldscal.la)'s status on Thursday, 27-Apr-2017 17:20:18 UTC - <a href="https://social.heldscal.la/shp">shp</a> started following <a href="https://gs.smuglo.li/japananon">JapanAnon</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-27T17:20:18+00:00 - 2017-04-27T17:20:18+00:00 - - http://activitystrea.ms/schema/1.0/person - https://gs.smuglo.li/user/27299 - JapanAnon - 匿名でしていてね! - - - - - - japananon - JapanAnon - 匿名でしていてね! - - ワイヤード - - - homepage - http://www.anonymous-japan.org - true - - - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=ae3d819865886cba - - - - - - - tag:social.heldscal.la,2017-04-27:subscription:29191:person:36560:2017-04-27T17:19:30+00:00 - shp (shp@social.heldscal.la)'s status on Thursday, 27-Apr-2017 17:19:30 UTC - <a href="https://social.heldscal.la/shp">shp</a> started following <a href="https://shitposter.club/wareya">wareya</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-27T17:19:30+00:00 - 2017-04-27T17:19:30+00:00 - - http://activitystrea.ms/schema/1.0/person - https://shitposter.club/user/15439 - wareya - Who are you to defy such a perfect being that is the machine? 日本語難しいけど頑張るぜ github.com/wareya wareya.moe Short: reya or war, never "ware" - - - - - - wareya - wareya - Who are you to defy such a perfect being that is the machine? 日本語難しいけど頑張るぜ github.com/wareya wareya.moe Short: reya or war, never "ware" - - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=bd88a3cd20b5a418 - - - - - - - tag:social.heldscal.la,2017-04-27:subscription:29191:person:41176:2017-04-27T17:19:21+00:00 - shp (shp@social.heldscal.la)'s status on Thursday, 27-Apr-2017 17:19:21 UTC - <a href="https://social.heldscal.la/shp">shp</a> started following <a href="https://hakui.club/takeshitakenji">竹下憲二 (白)</a>. - - http://activitystrea.ms/schema/1.0/follow - 2017-04-27T17:19:21+00:00 - 2017-04-27T17:19:21+00:00 - - http://activitystrea.ms/schema/1.0/person - https://hakui.club/user/6 - 竹下憲二 (白) - Oh boy. - - - - - - takeshitakenji - 竹下憲二 (白) - Oh boy. - - Seattle, WA - - - homepage - http://gs.kawa-kun.com - true - - - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=b139a673deba6963 - - - - - - - tag:social.heldscal.la,2017-04-27:fave:29191:note:1932205:2017-04-27T17:17:46+00:00 - Favorite - shp favorited something by dolus: Looks like Merry is pussing out and caving to pressure. Sad. <a href="https://gs.smuglo.li/file/23e37de3c321248d3f322d8ec042372914568ab4c9431a94e568a61b8146587f.png" title="https://gs.smuglo.li/file/23e37de3c321248d3f322d8ec042372914568ab4c9431a94e568a61b8146587f.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432294</a> <a href="https://gs.smuglo.li/file/e5a9549a19986d59d51750090910f47c186787adf02b2b6ac58df37556887297.png" title="https://gs.smuglo.li/file/e5a9549a19986d59d51750090910f47c186787adf02b2b6ac58df37556887297.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432295</a> <a href="https://gs.smuglo.li/file/2fdfabbc8ab0b8dc135903a8c48c29b440d1f97446b98ced4ad14a54d3b5d41f.png" title="https://gs.smuglo.li/file/2fdfabbc8ab0b8dc135903a8c48c29b440d1f97446b98ced4ad14a54d3b5d41f.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432296</a> <a href="https://gs.smuglo.li/file/af605d7c6fe3a8c26c6d334c2a8e0005f7e86a266f14a5b3755e7d3ac4e226de.png" title="https://gs.smuglo.li/file/af605d7c6fe3a8c26c6d334c2a8e0005f7e86a266f14a5b3755e7d3ac4e226de.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432297</a> - - http://activitystrea.ms/schema/1.0/favorite - 2017-04-27T17:17:46+00:00 - 2017-04-27T17:17:46+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:gs.smuglo.li,2017-04-27:noticeId=2065465:objectType=note - New note by dolus - Looks like Merry is pussing out and caving to pressure. Sad. <a href="https://gs.smuglo.li/file/23e37de3c321248d3f322d8ec042372914568ab4c9431a94e568a61b8146587f.png" title="https://gs.smuglo.li/file/23e37de3c321248d3f322d8ec042372914568ab4c9431a94e568a61b8146587f.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432294</a> <a href="https://gs.smuglo.li/file/e5a9549a19986d59d51750090910f47c186787adf02b2b6ac58df37556887297.png" title="https://gs.smuglo.li/file/e5a9549a19986d59d51750090910f47c186787adf02b2b6ac58df37556887297.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432295</a> <a href="https://gs.smuglo.li/file/2fdfabbc8ab0b8dc135903a8c48c29b440d1f97446b98ced4ad14a54d3b5d41f.png" title="https://gs.smuglo.li/file/2fdfabbc8ab0b8dc135903a8c48c29b440d1f97446b98ced4ad14a54d3b5d41f.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432296</a> <a href="https://gs.smuglo.li/file/af605d7c6fe3a8c26c6d334c2a8e0005f7e86a266f14a5b3755e7d3ac4e226de.png" title="https://gs.smuglo.li/file/af605d7c6fe3a8c26c6d334c2a8e0005f7e86a266f14a5b3755e7d3ac4e226de.png" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432297</a> - - - - - - - https://gs.smuglo.li/conversation/927473 - - - - - - - tag:social.heldscal.la,2017-04-27:fave:29191:note:1932492:2017-04-27T17:13:55+00:00 - Favorite - shp favorited something by zemichi: <a href="https://gs.smuglo.li/file/1d45ea4ffc95f15037f361b56ad6b89f8451b70ad1ff7a03b7bb0345b8e2227c.jpg" title="https://gs.smuglo.li/file/1d45ea4ffc95f15037f361b56ad6b89f8451b70ad1ff7a03b7bb0345b8e2227c.jpg" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432344</a><br /> that's a lot of loli - - http://activitystrea.ms/schema/1.0/favorite - 2017-04-27T17:13:55+00:00 - 2017-04-27T17:13:55+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:gs.smuglo.li,2017-04-27:noticeId=2065713:objectType=note - New note by zemichi - <a href="https://gs.smuglo.li/file/1d45ea4ffc95f15037f361b56ad6b89f8451b70ad1ff7a03b7bb0345b8e2227c.jpg" title="https://gs.smuglo.li/file/1d45ea4ffc95f15037f361b56ad6b89f8451b70ad1ff7a03b7bb0345b8e2227c.jpg" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432344</a><br /> that's a lot of loli - - - - - - - https://gs.smuglo.li/conversation/927673 - - - - - - - tag:social.heldscal.la,2017-04-27:fave:29191:note:1932559:2017-04-27T17:12:46+00:00 - Favorite - shp favorited something by gsimg: <a href="https://gs.kawa-kun.com/file/3435c5cafda46f31cad5abb5837b3521b7b458198507073a496f4d10bad3633b.jpg" title="https://gs.kawa-kun.com/file/3435c5cafda46f31cad5abb5837b3521b7b458198507073a496f4d10bad3633b.jpg" rel="nofollow noreferrer" class="attachment">https://gs.kawa-kun.com/file/3435c5cafda46f31cad5abb5837b3521b7b458198507073a496f4d10bad3633b.jpg</a> #<span class="tag"><a href="https://gs.kawa-kun.com/tag/nsfw" rel="tag">nsfw</a></span> - - http://activitystrea.ms/schema/1.0/favorite - 2017-04-27T17:12:46+00:00 - 2017-04-27T17:12:46+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:gs.kawa-kun.com,2017-04-27:noticeId=1608309:objectType=note - New note by gsimg - <a href="https://gs.kawa-kun.com/file/3435c5cafda46f31cad5abb5837b3521b7b458198507073a496f4d10bad3633b.jpg" title="https://gs.kawa-kun.com/file/3435c5cafda46f31cad5abb5837b3521b7b458198507073a496f4d10bad3633b.jpg" rel="nofollow noreferrer" class="attachment">https://gs.kawa-kun.com/file/3435c5cafda46f31cad5abb5837b3521b7b458198507073a496f4d10bad3633b.jpg</a> #<span class="tag"><a href="https://gs.kawa-kun.com/tag/nsfw" rel="tag">nsfw</a></span> - - - - - - - https://gs.kawa-kun.com/conversation/690817 - - - - - - - tag:social.heldscal.la,2017-04-27:fave:29191:note:1932601:2017-04-27T17:12:28+00:00 - Favorite - shp favorited something by zemichi: <a href="https://gs.smuglo.li/file/5d9114fafea7b9866c9d852bcfeaf66aade65ae26149758346bc5ade7e3fa8f0.jpg" title="https://gs.smuglo.li/file/5d9114fafea7b9866c9d852bcfeaf66aade65ae26149758346bc5ade7e3fa8f0.jpg" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432372</a> - - http://activitystrea.ms/schema/1.0/favorite - 2017-04-27T17:12:28+00:00 - 2017-04-27T17:12:28+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:gs.smuglo.li,2017-04-27:noticeId=2065821:objectType=note - New note by zemichi - <a href="https://gs.smuglo.li/file/5d9114fafea7b9866c9d852bcfeaf66aade65ae26149758346bc5ade7e3fa8f0.jpg" title="https://gs.smuglo.li/file/5d9114fafea7b9866c9d852bcfeaf66aade65ae26149758346bc5ade7e3fa8f0.jpg" rel="nofollow noreferrer" class="attachment">https://gs.smuglo.li/attachment/432372</a> - - - - - - - https://gs.smuglo.li/conversation/927760 - - - - - - - tag:social.heldscal.la,2017-04-27:noticeId=1932867:objectType=note - shp repeated a notice by shpbot - RT @<a href="https://gs.archae.me/user/4687" class="h-card u-url p-nickname mention" title="shpbot">shpbot</a> <a href="https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg" title="https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-237676">https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg</a> #<span class="tag"><a href="https://social.heldscal.la/tag/2hu" rel="tag">2hu</a></span> #<span class="tag"><a href="https://social.heldscal.la/tag/ordinarymagician" rel="tag">ordinarymagician</a></span> :thinking: <a href="https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg" title="https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-312306">https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg</a> - - http://activitystrea.ms/schema/1.0/share - 2017-04-27T17:11:35+00:00 - 2017-04-27T17:11:35+00:00 - - http://activitystrea.ms/schema/1.0/activity - tag:gs.archae.me,2017-04-27:noticeId=760830:objectType=note - - <a href="https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg" title="https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg" rel="nofollow noreferrer" class="attachment">https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg</a> #<span class="tag"><a href="https://gs.archae.me/tag/2hu" rel="tag">2hu</a></span> #<span class="tag"><a href="https://gs.archae.me/tag/ordinarymagician" rel="tag">ordinarymagician</a></span> :thinking: <a href="https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg" title="https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg" rel="nofollow noreferrer" class="attachment">https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg</a> - - http://activitystrea.ms/schema/1.0/post - 2017-04-27T17:00:08+00:00 - 2017-04-27T17:00:08+00:00 - - http://activitystrea.ms/schema/1.0/person - https://gs.archae.me/user/4687 - shpbot - - - - - - shpbot - shpbot - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.archae.me,2017-04-27:noticeId=760830:objectType=note - New note by shpbot - <a href="https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg" title="https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg" rel="nofollow noreferrer" class="attachment">https://shitposter.club/file/cbf7fbbee1127a9870e871305ca7de70f1eb1bbb79ffe5b3b0f33e37514d14d8.jpg</a> #<span class="tag"><a href="https://gs.archae.me/tag/2hu" rel="tag">2hu</a></span> #<span class="tag"><a href="https://gs.archae.me/tag/ordinarymagician" rel="tag">ordinarymagician</a></span> :thinking: <a href="https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg" title="https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg" rel="nofollow noreferrer" class="attachment">https://shitposter.club/file/abf3f82d9ce28d2293d858af26c75bb5d4fdd091c0d90ca7bc72ea7efba220e4.jpg</a> - - - - - https://gs.archae.me/conversation/318317 - - - - - https://gs.archae.me/api/statuses/user_timeline/4687.atom - shpbot - - - https://social.heldscal.la/avatar/31581-original-20170405170019.jpeg - 2017-05-05T11:45:08+00:00 - - - - https://gs.archae.me/conversation/318317 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-04-27:noticeId=1932815:objectType=note - New note by shp - federation issues with SPC atm it seems - - - http://activitystrea.ms/schema/1.0/post - 2017-04-27T17:08:55+00:00 - 2017-04-27T17:08:55+00:00 - - tag:social.heldscal.la,2017-04-27:objectType=thread:nonce=645a13c841f51769 - - - - - - - tag:social.heldscal.la,2017-04-26:fave:29191:note:1907285:2017-04-26T06:59:07+00:00 - Favorite - shp favorited something by lambadalambda: Is this the most offensive video on the net? <a href="https://social.heldscal.la/file/4c34bfb81a8155c265031bc48f7e69c29eb0d2941c57daf63f80e17b0e2e5f47.webm" title="https://social.heldscal.la/file/4c34bfb81a8155c265031bc48f7e69c29eb0d2941c57daf63f80e17b0e2e5f47.webm" rel="nofollow noreferrer" class="attachment">https://social.heldscal.la/attachment/402251</a> - - http://activitystrea.ms/schema/1.0/favorite - 2017-04-26T06:59:07+00:00 - 2017-04-26T06:59:07+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-04-26:noticeId=1907285:objectType=note - New note by lambadalambda - Is this the most offensive video on the net? <a href="https://social.heldscal.la/file/4c34bfb81a8155c265031bc48f7e69c29eb0d2941c57daf63f80e17b0e2e5f47.webm" title="https://social.heldscal.la/file/4c34bfb81a8155c265031bc48f7e69c29eb0d2941c57daf63f80e17b0e2e5f47.webm" rel="nofollow external noreferrer" class="attachment" id="attachment-402251">https://social.heldscal.la/attachment/402251</a> - - - - - - - tag:social.heldscal.la,2017-04-26:objectType=thread:nonce=07b02e1328f456af - - - - - - - tag:social.heldscal.la,2017-04-26:noticeId=1907951:objectType=note - shp repeated a notice by shpbot - RT @<a href="https://gs.archae.me/user/4687" class="h-card u-url p-nickname mention" title="shpbot">shpbot</a> <a href="https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg" title="https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg" rel="nofollow external noreferrer" class="attachment" id="attachment-346198">https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg</a> - - http://activitystrea.ms/schema/1.0/share - 2017-04-26T06:58:19+00:00 - 2017-04-26T06:58:19+00:00 - - http://activitystrea.ms/schema/1.0/activity - tag:gs.archae.me,2017-04-26:noticeId=752596:objectType=note - - <a href="https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg" title="https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg" rel="nofollow noreferrer" class="attachment">https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg</a> - - http://activitystrea.ms/schema/1.0/post - 2017-04-26T06:15:07+00:00 - 2017-04-26T06:15:07+00:00 - - http://activitystrea.ms/schema/1.0/person - https://gs.archae.me/user/4687 - shpbot - - - - - - shpbot - shpbot - - - - http://activitystrea.ms/schema/1.0/note - tag:gs.archae.me,2017-04-26:noticeId=752596:objectType=note - New note by shpbot - <a href="https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg" title="https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg" rel="nofollow noreferrer" class="attachment">https://shitposter.club/file/718db06b564841331c72f9df767f8c9459e20c4dddbf0d4e61cd08ecbee7739d.jpg</a> - - - - - https://gs.archae.me/conversation/314010 - - - https://gs.archae.me/api/statuses/user_timeline/4687.atom - shpbot - - - https://social.heldscal.la/avatar/31581-original-20170405170019.jpeg - 2017-05-05T11:45:08+00:00 - - - - https://gs.archae.me/conversation/314010 - - - - - - - tag:social.heldscal.la,2017-04-26:fave:29191:note:1907341:2017-04-26T06:58:16+00:00 - Favorite - shp favorited something by moonman: <a href="https://shitposter.club/file/1377b0894e983599c11e739e406243cabed9f8af7961a2550ecaf97e32de8e60.jpg" title="https://shitposter.club/file/1377b0894e983599c11e739e406243cabed9f8af7961a2550ecaf97e32de8e60.jpg" class="attachment" rel="nofollow">https://shitposter.club/attachment/630989</a> - - http://activitystrea.ms/schema/1.0/favorite - 2017-04-26T06:58:16+00:00 - 2017-04-26T06:58:16+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2017-04-26:noticeId=2681941:objectType=note - New note by moonman - <a href="https://shitposter.club/file/1377b0894e983599c11e739e406243cabed9f8af7961a2550ecaf97e32de8e60.jpg" title="https://shitposter.club/file/1377b0894e983599c11e739e406243cabed9f8af7961a2550ecaf97e32de8e60.jpg" class="attachment" rel="nofollow">https://shitposter.club/attachment/630989</a> - - - - - - - https://shitposter.club/conversation/1300990 - - - - - - - tag:social.heldscal.la,2017-04-26:fave:29191:comment:1907412:2017-04-26T06:57:56+00:00 - Favorite - shp favorited something by lambadalambda: @<a href="https://gs.smuglo.li/user/2" class="h-card u-url p-nickname mention" title="nepfag">nepfag</a> <a href="https://cherubini.casa/why-i-shut-down-wizards-town-and-left-mastodon-6d4e631346b3?source=linkShare-89c2f851e979-1493184822&amp;gi=a6a47c5466a0" title="https://cherubini.casa/why-i-shut-down-wizards-town-and-left-mastodon-6d4e631346b3?source=linkShare-89c2f851e979-1493184822&amp;gi=a6a47c5466a0" rel="nofollow noreferrer" class="attachment">https://social.heldscal.la/url/402273</a> - - http://activitystrea.ms/schema/1.0/favorite - 2017-04-26T06:57:56+00:00 - 2017-04-26T06:57:56+00:00 - - http://activitystrea.ms/schema/1.0/comment - tag:social.heldscal.la,2017-04-26:noticeId=1907412:objectType=comment - New comment by lambadalambda - @<a href="https://gs.smuglo.li/user/2" class="h-card u-url p-nickname mention" title="nepfag">nepfag</a> <a href="https://cherubini.casa/why-i-shut-down-wizards-town-and-left-mastodon-6d4e631346b3?source=linkShare-89c2f851e979-1493184822&amp;gi=a6a47c5466a0" title="https://cherubini.casa/why-i-shut-down-wizards-town-and-left-mastodon-6d4e631346b3?source=linkShare-89c2f851e979-1493184822&amp;gi=a6a47c5466a0" rel="nofollow external noreferrer" class="attachment" id="attachment-402273">https://social.heldscal.la/url/402273</a> - - - - - - - tag:social.heldscal.la,2017-04-26:objectType=thread:nonce=85c21eda7aaa7259 - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:social.heldscal.la,2017-04-26:noticeId=1907942:objectType=note - New note by shp - #<span class="tag"><a href="https://social.heldscal.la/tag/cofe" rel="tag">cofe</a></span> time my friends <a href="https://social.heldscal.la/file/ec254b45b3a86ff74bc08bc7e065cb681d77cf7d4cedc9cdcf59e16adf311da3.png" title="https://social.heldscal.la/file/ec254b45b3a86ff74bc08bc7e065cb681d77cf7d4cedc9cdcf59e16adf311da3.png" rel="nofollow external noreferrer" class="attachment" id="attachment-402381">https://social.heldscal.la/attachment/402381</a> - - - http://activitystrea.ms/schema/1.0/post - 2017-04-26T06:57:18+00:00 - 2017-04-26T06:57:18+00:00 - - tag:social.heldscal.la,2017-04-26:objectType=thread:nonce=9c9d9373bccfaf70 - - - - - - - - diff --git a/test/fixtures/tesla_mock/peertube.moe-vid.json b/test/fixtures/tesla_mock/peertube.moe-vid.json index 76296eb7d..ceebb90b7 100644 --- a/test/fixtures/tesla_mock/peertube.moe-vid.json +++ b/test/fixtures/tesla_mock/peertube.moe-vid.json @@ -1 +1,187 @@ -{"type":"Video","id":"https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3","name":"Friday Night","duration":"PT29S","uuid":"df5f464b-be8d-46fb-ad81-2d4c2d1630e3","tag":[{"type":"Hashtag","name":"feels"}],"views":12,"sensitive":false,"commentsEnabled":true,"published":"2018-03-23T16:43:22.988Z","updated":"2018-03-24T16:28:46.002Z","mediaType":"text/markdown","content":"tfw\r\n\r\n\r\nsong is 'my old piano' by diana ross","support":null,"icon":{"type":"Image","url":"https://peertube.moe/static/thumbnails/df5f464b-be8d-46fb-ad81-2d4c2d1630e3.jpg","mediaType":"image/jpeg","width":200,"height":110},"url":[{"type":"Link","mimeType":"video/mp4","href":"https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4","width":480,"size":5015880},{"type":"Link","mimeType":"application/x-bittorrent","href":"https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.torrent","width":480},{"type":"Link","mimeType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.torrent&xt=urn:btih:11d3af6b5c812a376c2b29cdbd46e5fb42ee730e&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4","width":480},{"type":"Link","mimeType":"video/mp4","href":"https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.mp4","width":360,"size":3620040},{"type":"Link","mimeType":"application/x-bittorrent","href":"https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.torrent","width":360},{"type":"Link","mimeType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.torrent&xt=urn:btih:1c3885b4d7cdb46193b62b9b76e72b1409cfb297&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.mp4","width":360},{"type":"Link","mimeType":"video/mp4","href":"https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.mp4","width":240,"size":2305488},{"type":"Link","mimeType":"application/x-bittorrent","href":"https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.torrent","width":240},{"type":"Link","mimeType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.torrent&xt=urn:btih:ac5773352d9e26f982d2da63acfb244f01ccafa4&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.mp4","width":240},{"type":"Link","mimeType":"video/mp4","href":"https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.mp4","width":720,"size":7928231},{"type":"Link","mimeType":"application/x-bittorrent","href":"https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.torrent","width":720},{"type":"Link","mimeType":"application/x-bittorrent;x-scheme-handler/magnet","href":"magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.torrent&xt=urn:btih:b591068f4533c4e2865bb4cbb89887aecccdc523&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.mp4","width":720},{"type":"Link","mimeType":"text/html","href":"https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3"}],"likes":{"id":"https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/likes","type":"OrderedCollection","totalItems":0,"orderedItems":[]},"dislikes":{"id":"https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/dislikes","type":"OrderedCollection","totalItems":0,"orderedItems":[]},"shares":{"id":"https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/announces","type":"OrderedCollection","totalItems":2,"orderedItems":["https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/announces/465","https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/announces/1"]},"comments":{"id":"https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/comments","type":"OrderedCollection","totalItems":0,"orderedItems":[]},"attributedTo":[{"type":"Group","id":"https://peertube.moe/video-channels/5224869f-aa63-4c83-ab3a-87c3a5ac440e"},{"type":"Person","id":"https://peertube.moe/accounts/7even"}],"to":["https://www.w3.org/ns/activitystreams#Public"],"cc":[],"@context":["https://www.w3.org/ns/activitystreams","https://w3id.org/security/v1",{"RsaSignature2017":"https://w3id.org/security#RsaSignature2017","Hashtag":"as:Hashtag","uuid":"http://schema.org/identifier","category":"http://schema.org/category","licence":"http://schema.org/license","sensitive":"as:sensitive","language":"http://schema.org/inLanguage","views":"http://schema.org/Number","size":"http://schema.org/Number","commentsEnabled":"http://schema.org/Boolean","support":"http://schema.org/Text"},{"likes":{"@id":"as:likes","@type":"@id"},"dislikes":{"@id":"as:dislikes","@type":"@id"},"shares":{"@id":"as:shares","@type":"@id"},"comments":{"@id":"as:comments","@type":"@id"}}]} \ No newline at end of file +{ + "@context" : [ + "https://www.w3.org/ns/activitystreams", + "https://w3id.org/security/v1", + { + "Hashtag" : "as:Hashtag", + "RsaSignature2017" : "https://w3id.org/security#RsaSignature2017", + "category" : "http://schema.org/category", + "commentsEnabled" : "http://schema.org/Boolean", + "language" : "http://schema.org/inLanguage", + "licence" : "http://schema.org/license", + "sensitive" : "as:sensitive", + "size" : "http://schema.org/Number", + "support" : "http://schema.org/Text", + "uuid" : "http://schema.org/identifier", + "views" : "http://schema.org/Number" + }, + { + "comments" : { + "@id" : "as:comments", + "@type" : "@id" + }, + "dislikes" : { + "@id" : "as:dislikes", + "@type" : "@id" + }, + "likes" : { + "@id" : "as:likes", + "@type" : "@id" + }, + "shares" : { + "@id" : "as:shares", + "@type" : "@id" + } + } + ], + "attributedTo" : [ + { + "id" : "https://peertube.moe/video-channels/5224869f-aa63-4c83-ab3a-87c3a5ac440e", + "type" : "Group" + }, + { + "id" : "https://peertube.moe/accounts/7even", + "type" : "Person" + } + ], + "cc" : [], + "comments" : { + "id" : "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/comments", + "orderedItems" : [], + "totalItems" : 0, + "type" : "OrderedCollection" + }, + "commentsEnabled" : true, + "content" : "tfw\r\n\r\n\r\nsong is 'my old piano' by diana ross", + "dislikes" : { + "id" : "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/dislikes", + "orderedItems" : [], + "totalItems" : 0, + "type" : "OrderedCollection" + }, + "duration" : "PT29S", + "icon" : { + "height" : 110, + "mediaType" : "image/jpeg", + "type" : "Image", + "url" : "https://peertube.moe/static/thumbnails/df5f464b-be8d-46fb-ad81-2d4c2d1630e3.jpg", + "width" : 200 + }, + "id" : "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3", + "likes" : { + "id" : "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/likes", + "orderedItems" : [], + "totalItems" : 0, + "type" : "OrderedCollection" + }, + "mediaType" : "text/markdown", + "name" : "Friday Night", + "published" : "2018-03-23T16:43:22.988Z", + "sensitive" : false, + "shares" : { + "id" : "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/announces", + "orderedItems" : [ + "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/announces/465", + "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3/announces/1" + ], + "totalItems" : 2, + "type" : "OrderedCollection" + }, + "support" : null, + "tag" : [ + { + "name" : "feels", + "type" : "Hashtag" + } + ], + "to" : [ + "https://www.w3.org/ns/activitystreams#Public" + ], + "type" : "Video", + "updated" : "2018-03-24T16:28:46.002Z", + "url" : [ + { + "href" : "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4", + "mimeType" : "video/mp4", + "size" : 5015880, + "type" : "Link", + "width" : 480 + }, + { + "href" : "https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.torrent", + "mimeType" : "application/x-bittorrent", + "type" : "Link", + "width" : 480 + }, + { + "href" : "magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.torrent&xt=urn:btih:11d3af6b5c812a376c2b29cdbd46e5fb42ee730e&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4", + "mimeType" : "application/x-bittorrent;x-scheme-handler/magnet", + "type" : "Link", + "width" : 480 + }, + { + "href" : "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.mp4", + "mimeType" : "video/mp4", + "size" : 3620040, + "type" : "Link", + "width" : 360 + }, + { + "href" : "https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.torrent", + "mimeType" : "application/x-bittorrent", + "type" : "Link", + "width" : 360 + }, + { + "href" : "magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.torrent&xt=urn:btih:1c3885b4d7cdb46193b62b9b76e72b1409cfb297&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-360.mp4", + "mimeType" : "application/x-bittorrent;x-scheme-handler/magnet", + "type" : "Link", + "width" : 360 + }, + { + "href" : "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.mp4", + "mimeType" : "video/mp4", + "size" : 2305488, + "type" : "Link", + "width" : 240 + }, + { + "href" : "https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.torrent", + "mimeType" : "application/x-bittorrent", + "type" : "Link", + "width" : 240 + }, + { + "href" : "magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.torrent&xt=urn:btih:ac5773352d9e26f982d2da63acfb244f01ccafa4&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-240.mp4", + "mimeType" : "application/x-bittorrent;x-scheme-handler/magnet", + "type" : "Link", + "width" : 240 + }, + { + "href" : "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.mp4", + "mimeType" : "video/mp4", + "size" : 7928231, + "type" : "Link", + "width" : 720 + }, + { + "href" : "https://peertube.moe/static/torrents/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.torrent", + "mimeType" : "application/x-bittorrent", + "type" : "Link", + "width" : 720 + }, + { + "href" : "magnet:?xs=https%3A%2F%2Fpeertube.moe%2Fstatic%2Ftorrents%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.torrent&xt=urn:btih:b591068f4533c4e2865bb4cbb89887aecccdc523&dn=Friday+Night&tr=wss%3A%2F%2Fpeertube.moe%3A443%2Ftracker%2Fsocket&tr=https%3A%2F%2Fpeertube.moe%2Ftracker%2Fannounce&ws=https%3A%2F%2Fpeertube.moe%2Fstatic%2Fwebseed%2Fdf5f464b-be8d-46fb-ad81-2d4c2d1630e3-720.mp4", + "mimeType" : "application/x-bittorrent;x-scheme-handler/magnet", + "type" : "Link", + "width" : 720 + }, + { + "href" : "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3", + "mimeType" : "text/html", + "type" : "Link" + } + ], + "uuid" : "df5f464b-be8d-46fb-ad81-2d4c2d1630e3", + "views" : 12 +} diff --git a/test/fixtures/tesla_mock/poll_attachment.json b/test/fixtures/tesla_mock/poll_attachment.json new file mode 100644 index 000000000..92e822dc8 --- /dev/null +++ b/test/fixtures/tesla_mock/poll_attachment.json @@ -0,0 +1,99 @@ +{ + "@context": [ + "https://www.w3.org/ns/activitystreams", + "https://patch.cx/schemas/litepub-0.1.jsonld", + { + "@language": "und" + } + ], + "actor": "https://patch.cx/users/rin", + "anyOf": [], + "attachment": [ + { + "mediaType": "image/jpeg", + "name": "screenshot_mpv:Totoro@01:18:44.345.jpg", + "type": "Document", + "url": "https://shitposter.club/media/3bb4c4d402f8fdcc7f80963c3d7cf6f10f936897fd374922ade33199d2f86d87.jpg?name=screenshot_mpv%3ATotoro%4001%3A18%3A44.345.jpg" + } + ], + "attributedTo": "https://patch.cx/users/rin", + "cc": [ + "https://patch.cx/users/rin/followers" + ], + "closed": "2020-06-19T23:22:02.754678Z", + "content": "@rinpatch", + "closed": "2019-09-19T00:32:36.785333", + "content": "can you vote on this poll?", + "id": "https://patch.cx/objects/tesla_mock/poll_attachment", + "oneOf": [ + { + "name": "a", + "replies": { + "totalItems": 0, + "type": "Collection" + }, + "type": "Note" + }, + { + "name": "A", + "replies": { + "totalItems": 0, + "type": "Collection" + }, + "type": "Note" + }, + { + "name": "Aa", + "replies": { + "totalItems": 0, + "type": "Collection" + }, + "type": "Note" + }, + { + "name": "AA", + "replies": { + "totalItems": 0, + "type": "Collection" + }, + "type": "Note" + }, + { + "name": "AAa", + "replies": { + "totalItems": 1, + "type": "Collection" + }, + "type": "Note" + }, + { + "name": "AAA", + "replies": { + "totalItems": 3, + "type": "Collection" + }, + "type": "Note" + } + ], + "published": "2020-06-19T23:12:02.786113Z", + "sensitive": false, + "summary": "", + "tag": [ + { + "href": "https://mastodon.sdf.org/users/rinpatch", + "name": "@rinpatch@mastodon.sdf.org", + "type": "Mention" + } + ], + "to": [ + "https://www.w3.org/ns/activitystreams#Public", + "https://mastodon.sdf.org/users/rinpatch" + ], + "type": "Question", + "voters": [ + "https://shitposter.club/users/moonman", + "https://skippers-bin.com/users/7v1w1r8ce6", + "https://mastodon.sdf.org/users/rinpatch", + "https://mastodon.social/users/emelie" + ] +} diff --git a/test/fixtures/tesla_mock/sakamoto.atom b/test/fixtures/tesla_mock/sakamoto.atom deleted file mode 100644 index 648946795..000000000 --- a/test/fixtures/tesla_mock/sakamoto.atom +++ /dev/null @@ -1 +0,0 @@ -http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://social.sakamoto.gq/objects/0ccc1a2c-66b0-4305-b23a-7f7f2b040056New note by eal<a href='https://shitposter.club/user/5381'>@shpuld</a> <a href='https://pleroma.hjkos.com/users/hj'>@hj</a> IM NOT GAY DAD2017-08-04T12:51:26.130592Z2017-08-04T12:51:26.130592Zhttps://pleroma.hjkos.com/contexts/53093c74-2100-4bf4-aac6-66d1973d03efhttps://social.sakamoto.gq/users/ealhttp://activitystrea.ms/schema/1.0/personhttps://social.sakamoto.gq/users/ealeal坂本(・ヮ・)eal \ No newline at end of file diff --git a/test/fixtures/tesla_mock/sakamoto_eal_feed.atom b/test/fixtures/tesla_mock/sakamoto_eal_feed.atom deleted file mode 100644 index 9340d9038..000000000 --- a/test/fixtures/tesla_mock/sakamoto_eal_feed.atom +++ /dev/null @@ -1 +0,0 @@ -https://social.sakamoto.gq/users/eal/feed.atomeal's timeline2017-08-04T14:19:12.683854https://social.sakamoto.gq/users/ealhttp://activitystrea.ms/schema/1.0/personhttps://social.sakamoto.gq/users/ealeal坂本(・ヮ・)ealhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://social.sakamoto.gq/objects/b79a1721-23f3-45a5-9610-adb08c2afae5New note by ealHonestly, I like all smileys that are not emoji.2017-08-04T14:19:12.675999Z2017-08-04T14:19:12.675999Zhttps://social.sakamoto.gq/contexts/e05ede92-8db9-4963-8b8e-e71a5797d68fhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://social.sakamoto.gq/objects/45475bf3-2dfc-4d9e-8eae-1f4f86f48982New note by ealThen again, I like all smileys/emoticons that are not emoji.<br>2017-08-04T14:19:10.113373Z2017-08-04T14:19:10.113373Zhttps://social.sakamoto.gq/contexts/852d1605-4dcb-4ba7-9ba4-dfc37ed62fbchttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://social.sakamoto.gq/objects/8f8fd6d6-cc63-40c6-a5d0-1c0e4f919368New note by ealI love the russian-style smiley.2017-08-04T14:18:30.478552Z2017-08-04T14:18:30.478552Zhttps://social.sakamoto.gq/contexts/852d1605-4dcb-4ba7-9ba4-dfc37ed62fbchttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/6e69df95-f2ad-4b8e-af4a-e93ff93d64e1eal started following https://cybre.space/users/0x3Feal started following https://cybre.space/users/0x3F2017-08-04T14:17:24.942193Z2017-08-04T14:17:24.942193Zhttp://activitystrea.ms/schema/1.0/personhttps://cybre.space/users/0x3Fhttps://cybre.space/users/0x3Fhttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/54c5e260-0185-4267-a2a6-f5dd9c76c2c9eal started following https://niu.moe/users/ryeeal started following https://niu.moe/users/rye2017-08-04T14:16:35.604739Z2017-08-04T14:16:35.604739Zhttp://activitystrea.ms/schema/1.0/personhttps://niu.moe/users/ryehttps://niu.moe/users/ryehttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/092ca863-19a8-416c-85d7-d3f23b3c0203eal started following https://mastodon.xyz/users/rafudesueal started following https://mastodon.xyz/users/rafudesu2017-08-04T14:16:10.993429Z2017-08-04T14:16:10.993429Zhttp://activitystrea.ms/schema/1.0/personhttps://mastodon.xyz/users/rafudesuhttps://mastodon.xyz/users/rafudesuhttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/be5cf702-b127-423b-a6be-5f78f01a4289eal started following https://gs.kawa-kun.com/user/2eal started following https://gs.kawa-kun.com/user/22017-08-04T14:15:41.804611Z2017-08-04T14:15:41.804611Zhttp://activitystrea.ms/schema/1.0/personhttps://gs.kawa-kun.com/user/2https://gs.kawa-kun.com/user/2http://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/4951e2a1-9bae-4e87-8e98-e6d2f8a52338eal started following https://gs.kawa-kun.com/user/4885eal started following https://gs.kawa-kun.com/user/48852017-08-04T14:15:00.135352Z2017-08-04T14:15:00.135352Zhttp://activitystrea.ms/schema/1.0/personhttps://gs.kawa-kun.com/user/4885https://gs.kawa-kun.com/user/4885http://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/cadf8745-b9ee-4f6c-af32-bfddb70e4607eal started following https://mastodon.social/users/Murassaeal started following https://mastodon.social/users/Murassa2017-08-04T14:14:36.339560Z2017-08-04T14:14:36.339560Zhttp://activitystrea.ms/schema/1.0/personhttps://mastodon.social/users/Murassahttps://mastodon.social/users/Murassahttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/a52c9aab-f0e6-4ccb-8dd3-9f417e72a41ceal started following https://mastodon.social/users/rysiekeal started following https://mastodon.social/users/rysiek2017-08-04T14:13:04.061572Z2017-08-04T14:13:04.061572Zhttp://activitystrea.ms/schema/1.0/personhttps://mastodon.social/users/rysiekhttps://mastodon.social/users/rysiekhttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/738bc887-4cca-4b36-8c86-2b54d4c54732eal started following https://mastodon.hasameli.com/users/munineal started following https://mastodon.hasameli.com/users/munin2017-08-04T14:12:10.514155Z2017-08-04T14:12:10.514155Zhttp://activitystrea.ms/schema/1.0/personhttps://mastodon.hasameli.com/users/muninhttps://mastodon.hasameli.com/users/muninhttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/dc66ad5a-b776-4180-a8aa-e4c1bf7cb703eal started following https://cybre.space/users/nightpooleal started following https://cybre.space/users/nightpool2017-08-04T14:11:16.046148Z2017-08-04T14:11:16.046148Zhttp://activitystrea.ms/schema/1.0/personhttps://cybre.space/users/nightpoolhttps://cybre.space/users/nightpoolhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://social.sakamoto.gq/objects/9c5c00d7-3ce4-4c11-b965-dc5c2bda86c5New note by eal<a href='https://mastodon.zombocloud.com/users/staticsafe'>@staticsafe</a> privet )))2017-08-04T14:10:08.812247Z2017-08-04T14:10:08.812247Zhttps://social.sakamoto.gq/contexts/12a33823-0327-4c1c-a591-850ea79331b5http://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/49798053-1f40-4a71-ad33-106e90630863eal started following https://social.homunyan.com/users/animeirleal started following https://social.homunyan.com/users/animeirl2017-08-04T14:09:44.904792Z2017-08-04T14:09:44.904792Zhttp://activitystrea.ms/schema/1.0/personhttps://social.homunyan.com/users/animeirlhttps://social.homunyan.com/users/animeirlhttp://activitystrea.ms/schema/1.0/favoritehttps://social.sakamoto.gq/activities/2d83a1c5-70a6-45d3-9b84-59d6a70fbb17New favorite by ealeal favorited something2017-08-04T14:07:27.210044Z2017-08-04T14:07:27.210044Zhttp://activitystrea.ms/schema/1.0/notehttps://pleroma.soykaf.com/objects/b831e52f-4ed4-438e-95b4-888897f64f09https://pleroma.hjkos.com/contexts/3ed48205-1e72-4e19-a618-89a0d2ca811ehttp://activitystrea.ms/schema/1.0/favoritehttps://social.sakamoto.gq/activities/06d28bed-544a-496b-8414-1c6d439273b5New favorite by ealeal favorited something2017-08-04T14:05:37.280200Z2017-08-04T14:05:37.280200Zhttp://activitystrea.ms/schema/1.0/notetag:toot-lab.reclaim.technology,2017-08-04:objectId=1166030:objectType=Statustag:p2px.me,2017-08-04:objectType=thread:nonce=f8bfc4d13db6ce91http://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/72bf19d4-9ad4-4b2f-9cd0-f0d70f4e931beal started following https://mstdn.jp/users/nullkaleal started following https://mstdn.jp/users/nullkal2017-08-04T14:05:04.148904Z2017-08-04T14:05:04.148904Zhttp://activitystrea.ms/schema/1.0/personhttps://mstdn.jp/users/nullkalhttps://mstdn.jp/users/nullkalhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://social.sakamoto.gq/objects/b0e89515-7621-4e09-b23d-83e192324107New note by eal<a href='https://p2px.me/user/1'>@stitchxd</a> test also2017-08-04T14:04:38.699051Z2017-08-04T14:04:38.699051Ztag:p2px.me,2017-08-04:objectType=thread:nonce=f8bfc4d13db6ce91http://activitystrea.ms/schema/1.0/favoritehttps://social.sakamoto.gq/activities/d8d2006b-6b23-45d6-ba27-39d27587777dNew favorite by ealeal favorited something2017-08-04T14:04:32.106626Z2017-08-04T14:04:32.106626Zhttp://activitystrea.ms/schema/1.0/notetag:p2px.me,2017-08-04:noticeId=222109:objectType=notetag:p2px.me,2017-08-04:objectType=thread:nonce=f8bfc4d13db6ce91http://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://social.sakamoto.gq/activities/cb9db95d-ec27-41fa-bebd-5375fc13acb9eal started following https://mastodon.social/users/Gargroneal started following https://mastodon.social/users/Gargron2017-08-04T14:04:04.325531Z2017-08-04T14:04:04.325531Zhttp://activitystrea.ms/schema/1.0/personhttps://mastodon.social/users/Gargronhttps://mastodon.social/users/Gargron \ No newline at end of file diff --git a/test/fixtures/tesla_mock/shp@pleroma.soykaf.com.feed b/test/fixtures/tesla_mock/shp@pleroma.soykaf.com.feed deleted file mode 100644 index b24ef7ab6..000000000 --- a/test/fixtures/tesla_mock/shp@pleroma.soykaf.com.feed +++ /dev/null @@ -1 +0,0 @@ -https://pleroma.soykaf.com/users/shp/feed.atomshp's timeline2017-09-14T08:31:48.911686https://pleroma.soykaf.com/users/shphttp://activitystrea.ms/schema/1.0/personhttps://pleroma.soykaf.com/users/shpshpshpcofeshphttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://pleroma.soykaf.com/activities/0b5f5ef2-020a-4f9e-a92b-a2bf21224644shp started following https://pleroma.soykaf.com/users/goozshp started following https://pleroma.soykaf.com/users/gooz2017-09-14T08:31:48.911226Z2017-09-14T08:31:48.911226Zhttp://activitystrea.ms/schema/1.0/personhttps://pleroma.soykaf.com/users/goozhttps://pleroma.soykaf.com/users/goozhttp://activitystrea.ms/schema/1.0/activityhttp://activitystrea.ms/schema/1.0/followhttps://pleroma.soykaf.com/activities/d928b7f7-dc10-478c-859b-cd604770da60shp started following https://niu.moe/users/xiaoyongmaoshp started following https://niu.moe/users/xiaoyongmao2017-09-14T08:16:52.674253Z2017-09-14T08:16:52.674253Zhttp://activitystrea.ms/schema/1.0/personhttps://niu.moe/users/xiaoyongmaohttps://niu.moe/users/xiaoyongmaohttp://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/3f5089b3-f1e5-47b6-8bfe-a9c4a860e724New favorite by shpshp favorited something2017-09-14T08:12:18.213055Z2017-09-14T08:12:18.213055Zhttp://activitystrea.ms/schema/1.0/notehttps://mastodon.xyz/users/Azurolu/statuses/8346804tag:mastodon.xyz,2017-09-14:objectId=3669709:objectType=Conversationhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/0def9b19-6b0f-44e0-96b3-543fa06a4010New note by shp<a href='https://niu.moe/users/Pasty'>@Pasty</a> I love the peach<br><a href="https://pleroma.soykaf.com/media/7e8bd209-dbd4-481a-a62c-d302d68df16d/__hinanawi_tenshi_touhou_drawn_by_e_o__8c6824f52dd494f6026607570179265f.jpg" class='attachment'>__hinanawi_tenshi_touhou_drawn_…</a>2017-09-14T08:12:04.367142Z2017-09-14T08:12:04.367142Ztag:niu.moe,2017-09-14:objectId=1660781:objectType=Conversationhttp://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/a4170edf-d273-4b82-931d-662aaf3872f3New favorite by shpshp favorited something2017-09-14T08:10:26.205104Z2017-09-14T08:10:26.205104Zhttp://activitystrea.ms/schema/1.0/notehttps://niu.moe/users/NekoiNemo/statuses/3210992tag:niu.moe,2017-09-14:objectId=1660761:objectType=Conversationhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/c50c47a0-fac5-4781-a7e6-f20e7226d5fcNew note by shp<a href='https://freezepeach.xyz/user/3458'>@hakui</a> <a href='https://pleroma.soykaf.com/users/lain'>@lain</a> you guys are forgetting the pancakes jeez2017-09-14T08:09:30.088418Z2017-09-14T08:09:30.088418Zhttps://pleroma.soykaf.com/contexts/ac9c98ee-3eca-4b4b-9620-64b5e85e2623http://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/2af9f622-5986-483c-83a1-ac59a9035b50New favorite by shpshp favorited something2017-09-14T08:09:16.346235Z2017-09-14T08:09:16.346235Zhttp://activitystrea.ms/schema/1.0/notetag:freezepeach.xyz,2017-09-14:noticeId=3926191:objectType=commenthttps://pleroma.soykaf.com/contexts/ac9c98ee-3eca-4b4b-9620-64b5e85e2623http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/f52aad69-5828-4e0e-bb7b-f2f0869d3ff0New note by shp<a href='https://gs.smuglo.li/user/253'>@kro</a> I'll probs try some of those 2hu mangos2017-09-14T08:09:13.262835Z2017-09-14T08:09:13.262835Ztag:gs.smuglo.li,2017-09-14:objectType=thread:nonce=c4ac2016e07c4123http://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/35743658-efee-46cf-9cdf-487b95709cd5New favorite by shpshp favorited something2017-09-14T08:09:00.517534Z2017-09-14T08:09:00.517534Zhttp://activitystrea.ms/schema/1.0/notetag:gs.smuglo.li,2017-09-14:noticeId=4113226:objectType=commenttag:gs.smuglo.li,2017-09-14:objectType=thread:nonce=c4ac2016e07c4123http://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/22258ba8-58dc-4e09-b476-fe28d3307377New favorite by shpshp favorited something2017-09-14T08:08:38.087136Z2017-09-14T08:08:38.087136Zhttp://activitystrea.ms/schema/1.0/notehttps://pleroma.soykaf.com/objects/13d7809e-5dca-4117-8738-887759392f2chttps://pleroma.soykaf.com/contexts/ac9c98ee-3eca-4b4b-9620-64b5e85e2623http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/f56d640a-0dbd-48af-80b1-06d0dbd26774New note by shp<a href='https://social.sakamoto.gq/users/eal'>@eal</a> ...but neither does my phone<br><br>low brightness, very dark wallpaper (pic related, but even darker, couldn't find the actual version)<br><a href="https://pleroma.soykaf.com/media/6d1b8d57-80ae-41d6-bdea-58fea09ecdf4/phonewallpaper.png" class='attachment'>phonewallpaper.png</a>2017-09-14T08:07:23.081214Z2017-09-14T08:07:23.081214Zhttps://pleroma.soykaf.com/contexts/f4c5d56e-fc58-467b-a8a5-10515c012355http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/d313df1d-121c-4ab8-abd1-e6aedcf55cbdNew note by shp<a href='https://niu.moe/users/Pasty'>@Pasty</a> y-you too2017-09-14T07:55:26.153486Z2017-09-14T07:55:26.153486Ztag:niu.moe,2017-09-14:objectId=1660616:objectType=Conversationhttp://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/7b642424-4edb-48cc-8711-1eafb4745269New note by shp<a href='https://social.sakamoto.gq/users/eal'>@eal</a> bothers me more when sleeping, wore one for nearly 2 years2017-09-14T07:54:53.449227Z2017-09-14T07:54:53.449227Zhttps://pleroma.soykaf.com/contexts/f4c5d56e-fc58-467b-a8a5-10515c012355http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/5bc1bff1-88c3-489d-8efd-7e4755690a18New note by shpquick test2017-09-14T07:54:09.045525Z2017-09-14T07:54:09.045525Zhttps://pleroma.soykaf.com/contexts/cd770c2a-408e-4895-988c-60319298f219http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/956f1fb5-6f2f-433e-ab71-7f732b76f4beNew note by shphad some trouble getting sleep last night. only used phone to check the time a few times (v essential to have a near-black wallpaper to not blind yourself when you do that). can't rember the last time I rolled in the bed for longer than an hour like that2017-09-14T07:51:23.557775Z2017-09-14T07:51:23.557775Zhttps://pleroma.soykaf.com/contexts/f4c5d56e-fc58-467b-a8a5-10515c012355http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/d935d9f2-ebc7-4ff2-b65a-fbf418a60935New note by shp<a href='https://gs.smuglo.li/user/253'>@kro</a> doesn't sound like a bad idea at all2017-09-14T07:49:55.702555Z2017-09-14T07:49:55.702555Ztag:gs.smuglo.li,2017-09-14:objectType=thread:nonce=c4ac2016e07c4123http://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/342c8803-ee16-487d-9488-a39d763073f6New favorite by shpshp favorited something2017-09-14T07:49:41.875840Z2017-09-14T07:49:41.875840Zhttp://activitystrea.ms/schema/1.0/notetag:anticapitalist.party,2017-09-14:objectId=3322865:objectType=Statustag:anticapitalist.party,2017-09-14:objectId=1251751:objectType=Conversationhttp://activitystrea.ms/schema/1.0/favoritehttps://pleroma.soykaf.com/activities/5d98a19b-dd55-4077-9841-142937c613adNew favorite by shpshp favorited something2017-09-14T07:49:30.584265Z2017-09-14T07:49:30.584265Zhttp://activitystrea.ms/schema/1.0/notetag:gs.smuglo.li,2017-09-14:noticeId=4113170:objectType=commenttag:gs.smuglo.li,2017-09-14:objectType=thread:nonce=c4ac2016e07c4123http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/fdf3626a-50ba-458b-9bf7-b5f2cfa505fcNew note by shp<a href='https://pleroma.hjkos.com/users/hj'>@hj</a> c time2017-09-14T07:48:52.805422Z2017-09-14T07:48:52.805422Zhttps://pleroma.hjkos.com/contexts/dc4a3a3e-d366-4c0c-8789-8a9bee3537d9http://activitystrea.ms/schema/1.0/notehttp://activitystrea.ms/schema/1.0/posthttps://pleroma.soykaf.com/objects/c7c8eb17-b669-4827-9fbc-90f1fc54e4b1New note by shp<a href='https://sunshinegardens.org/users/tbny'>@tbny</a> err.. mediterranean from finnish*2017-09-14T07:46:52.764234Z2017-09-14T07:46:52.764234Zhttps://pleroma.soykaf.com/contexts/ac9c98ee-3eca-4b4b-9620-64b5e85e2623 \ No newline at end of file diff --git a/test/fixtures/tesla_mock/spc_5381.atom b/test/fixtures/tesla_mock/spc_5381.atom deleted file mode 100644 index c3288e97b..000000000 --- a/test/fixtures/tesla_mock/spc_5381.atom +++ /dev/null @@ -1,438 +0,0 @@ - - - GNU social - https://shitposter.club/api/statuses/user_timeline/5381.atom - shpuld timeline - Updates from shpuld on Shitposter Club! - https://shitposter.club/avatar/5381-96-20171230093854.png - 2018-02-23T13:42:22+00:00 - - http://activitystrea.ms/schema/1.0/person - https://shitposter.club/user/5381 - shpuld - - - - - - shpuld - shp - - - - - - - - - - - - - tag:shitposter.club,2018-02-23:fave:5381:comment:7387801:2018-02-23T13:39:40+00:00 - Favorite - shpuld favorited something by mayuutann: <p><span class="h-card"><a href="https://freezepeach.xyz/hakui" class="u-url mention">@<span>hakui</span></a></span> <span class="h-card"><a href="https://gs.smuglo.li/histoire" class="u-url mention">@<span>histoire</span></a></span> <span class="h-card"><a href="https://shitposter.club/shpuld" class="u-url mention">@<span>shpuld</span></a></span> <a href="https://mstdn.io/media/_Ee-x91XN0udpfZVO_U" rel="nofollow"><span class="invisible">https://</span><span class="ellipsis">mstdn.io/media/_Ee-x91XN0udpfZ</span><span class="invisible">VO_U</span></a></p> - - http://activitystrea.ms/schema/1.0/favorite - 2018-02-23T13:39:40+00:00 - 2018-02-23T13:39:40+00:00 - - http://activitystrea.ms/schema/1.0/comment - https://mstdn.io/users/mayuutann/statuses/99574950785668071 - New comment by mayuutann - <p><span class="h-card"><a href="https://freezepeach.xyz/hakui" class="u-url mention">@<span>hakui</span></a></span> <span class="h-card"><a href="https://gs.smuglo.li/histoire" class="u-url mention">@<span>histoire</span></a></span> <span class="h-card"><a href="https://shitposter.club/shpuld" class="u-url mention">@<span>shpuld</span></a></span> <a href="https://mstdn.io/media/_Ee-x91XN0udpfZVO_U" rel="nofollow"><span class="invisible">https://</span><span class="ellipsis">mstdn.io/media/_Ee-x91XN0udpfZ</span><span class="invisible">VO_U</span></a></p> - - - - - - - https://freezepeach.xyz/conversation/4182511 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387723:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> @<a href="https://pleroma.soykaf.com/users/lain" class="h-card mention" title="&#x2468; lain &#x2468;">lain</a> how naive~ - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:30:15+00:00 - 2018-02-23T13:30:15+00:00 - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=2f09acf104aebfe3 - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387703:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> @<a href="https://pleroma.soykaf.com/users/lain" class="h-card mention" title="&#x2468; lain &#x2468;">lain</a> you expect anyone to believe that?? - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:28:08+00:00 - 2018-02-23T13:28:08+00:00 - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=2f09acf104aebfe3 - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387639:objectType=comment - New comment by shpuld - @<a href="https://mstdn.io/users/mayuutann" class="h-card mention" title="Mayutan&#x2615;">mayuutann</a> @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> pacyuri!! <a href="https://shitposter.club/file/eea140be45df3f993c4533026bf9a78fe8facd296d2fa0c6d02b2e347c5dc30e.jpg" title="https://shitposter.club/file/eea140be45df3f993c4533026bf9a78fe8facd296d2fa0c6d02b2e347c5dc30e.jpg" class="attachment" id="attachment-1589462" rel="nofollow external">https://shitposter.club/attachment/1589462</a> - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:20:38+00:00 - 2018-02-23T13:20:38+00:00 - - - - https://freezepeach.xyz/conversation/4183220 - - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387611:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> why is pacyu eating a pizza so cute - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:18:07+00:00 - 2018-02-23T13:18:07+00:00 - - - - https://freezepeach.xyz/conversation/4183220 - - - - - - - - tag:shitposter.club,2018-02-23:fave:5381:comment:7387600:2018-02-23T13:17:52+00:00 - Favorite - shpuld favorited something by mayuutann: <p><span class="h-card"><a href="https://shitposter.club/shpuld" class="u-url mention">@<span>shpuld</span></a></span> <span class="h-card"><a href="https://gs.smuglo.li/histoire" class="u-url mention">@<span>histoire</span></a></span> <span class="h-card"><a href="https://freezepeach.xyz/hakui" class="u-url mention">@<span>hakui</span></a></span> pichu! <a href="https://mstdn.io/media/Crv5eubz1KO0dgBEulI" rel="nofollow"><span class="invisible">https://</span><span class="ellipsis">mstdn.io/media/Crv5eubz1KO0dgB</span><span class="invisible">EulI</span></a></p> - - http://activitystrea.ms/schema/1.0/favorite - 2018-02-23T13:17:52+00:00 - 2018-02-23T13:17:52+00:00 - - http://activitystrea.ms/schema/1.0/comment - https://mstdn.io/users/mayuutann/statuses/99574863865459283 - New comment by mayuutann - <p><span class="h-card"><a href="https://shitposter.club/shpuld" class="u-url mention">@<span>shpuld</span></a></span> <span class="h-card"><a href="https://gs.smuglo.li/histoire" class="u-url mention">@<span>histoire</span></a></span> <span class="h-card"><a href="https://freezepeach.xyz/hakui" class="u-url mention">@<span>hakui</span></a></span> pichu! <a href="https://mstdn.io/media/Crv5eubz1KO0dgBEulI" rel="nofollow"><span class="invisible">https://</span><span class="ellipsis">mstdn.io/media/Crv5eubz1KO0dgB</span><span class="invisible">EulI</span></a></p> - - - - - - - https://freezepeach.xyz/conversation/4182511 - - - - - - - tag:shitposter.club,2018-02-23:fave:5381:comment:7387544:2018-02-23T13:12:43+00:00 - Favorite - shpuld favorited something by mayuutann: <p><span class="h-card"><a href="https://shitposter.club/shpuld" class="u-url mention">@<span>shpuld</span></a></span> wa~~i!! :blobcheer:</p> - - http://activitystrea.ms/schema/1.0/favorite - 2018-02-23T13:12:43+00:00 - 2018-02-23T13:12:43+00:00 - - http://activitystrea.ms/schema/1.0/comment - https://mstdn.io/users/mayuutann/statuses/99574840290947233 - New comment by mayuutann - <p><span class="h-card"><a href="https://shitposter.club/shpuld" class="u-url mention">@<span>shpuld</span></a></span> wa~~i!! :blobcheer:</p> - - - - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=d05e2b056274c5ab - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387555:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> more!! - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:12:23+00:00 - 2018-02-23T13:12:23+00:00 - - - - https://freezepeach.xyz/conversation/4183220 - - - - - - - - tag:shitposter.club,2018-02-23:fave:5381:note:7387537:2018-02-23T13:12:19+00:00 - Favorite - shpuld favorited something by hakui: you have pacyupacyu'd for: 45 minutes 03 seconds - - http://activitystrea.ms/schema/1.0/favorite - 2018-02-23T13:12:19+00:00 - 2018-02-23T13:12:19+00:00 - - http://activitystrea.ms/schema/1.0/note - tag:freezepeach.xyz,2018-02-23:noticeId=6451332:objectType=note - New note by hakui - you have pacyupacyu'd for: 45 minutes 03 seconds - - - - - - - https://freezepeach.xyz/conversation/4183220 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387539:objectType=comment - New comment by shpuld - @<a href="https://mstdn.io/users/mayuutann" class="h-card mention" title="Mayutan&#x2615;">mayuutann</a> ndndnd~ - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:11:04+00:00 - 2018-02-23T13:11:04+00:00 - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=d05e2b056274c5ab - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387518:objectType=comment - New comment by shpuld - @<a href="https://mstdn.io/users/mayuutann" class="h-card mention" title="Mayutan&#x2615;">mayuutann</a> well done! mayumayu is so energetic - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:08:50+00:00 - 2018-02-23T13:08:50+00:00 - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=d05e2b056274c5ab - - - - - - - - tag:shitposter.club,2018-02-23:fave:5381:note:7387503:2018-02-23T13:08:00+00:00 - Favorite - shpuld favorited something by mayuutann: <p>done with FIGURE MAT!!<br /> (Posted with IFTTT)</p> - - http://activitystrea.ms/schema/1.0/favorite - 2018-02-23T13:08:00+00:00 - 2018-02-23T13:08:00+00:00 - - http://activitystrea.ms/schema/1.0/note - https://mstdn.io/users/mayuutann/statuses/99574825526201897 - New note by mayuutann - <p>done with FIGURE MAT!!<br /> (Posted with IFTTT)</p> - - - - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=c6aaa9b91e8d242f - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387486:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> @<a href="https://a.weirder.earth/users/mutstd" class="h-card mention" title="Mutant Standard">mutstd</a> @<a href="https://donphan.social/users/Siphonay" class="h-card mention" title="Siphonay">siphonay</a> jokes on you I'm oppressively shitposting myself - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:05:44+00:00 - 2018-02-23T13:05:44+00:00 - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=5d306467336c9661 - - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387466:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> @<a href="https://a.weirder.earth/users/mutstd" class="h-card mention" title="Mutant Standard">mutstd</a> @<a href="https://donphan.social/users/Siphonay" class="h-card mention" title="Siphonay">siphonay</a> how does it feel being hostile - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:04:10+00:00 - 2018-02-23T13:04:10+00:00 - - - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=5d306467336c9661 - - - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387459:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> gorogoro - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:03:32+00:00 - 2018-02-23T13:03:32+00:00 - - - - https://freezepeach.xyz/conversation/4181784 - - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387432:objectType=comment - New comment by shpuld - @<a href="https://freezepeach.xyz/user/3458" class="h-card mention" title="&#x5FA1;&#x5712;&#x306F;&#x304F;&#x3044;">hakui</a> ndnd - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T13:02:05+00:00 - 2018-02-23T13:02:05+00:00 - - - - https://freezepeach.xyz/conversation/4181784 - - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2018-02-23:noticeId=7387367:objectType=note - New note by shpuld - dear diary: I'm trying to do work but I can only think of tenshi eating a corndog - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T12:56:03+00:00 - 2018-02-23T12:56:03+00:00 - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=57f316da416743fc - - - - - - - http://activitystrea.ms/schema/1.0/note - tag:shitposter.club,2018-02-23:noticeId=7387354:objectType=note - New note by shpuld - jesus christ it's such a fridey at work - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T12:53:50+00:00 - 2018-02-23T12:53:50+00:00 - - tag:shitposter.club,2018-02-23:objectType=thread:nonce=c05eb5e91bdcbdb7 - - - - - - - http://activitystrea.ms/schema/1.0/comment - tag:shitposter.club,2018-02-23:noticeId=7387343:objectType=comment - New comment by shpuld - @<a href="https://gs.smuglo.li/user/589" class="h-card mention" title="&#x16DE;&#x16A9;&#x16B3;&#x16C1;&#x16DE;&#x16A9;&#x16B3;&#x16C1;">dokidoki</a> give them free upgrades to krokodil - - - http://activitystrea.ms/schema/1.0/post - 2018-02-23T12:53:15+00:00 - 2018-02-23T12:53:15+00:00 - - - - https://gs.smuglo.li/conversation/3934774 - - - - - - - diff --git a/test/fixtures/unfollow.xml b/test/fixtures/unfollow.xml deleted file mode 100644 index 7a8f8fd2e..000000000 --- a/test/fixtures/unfollow.xml +++ /dev/null @@ -1,68 +0,0 @@ - - - GNU social - https://social.heldscal.la/api/statuses/user_timeline/23211.atom - lambadalambda timeline - Updates from lambadalambda on social.heldscal.la! - https://social.heldscal.la/avatar/23211-96-20170416114255.jpeg - 2017-05-07T09:54:49+00:00 - - http://activitystrea.ms/schema/1.0/person - https://social.heldscal.la/user/23211 - lambadalambda - Call me Deacon Blues. - - - - - - lambadalambda - Constance Variable - Call me Deacon Blues. - - Berlin - - - homepage - https://heldscal.la - true - - - - - - - - - - - - - undo:tag:social.heldscal.la,2017-05-07:subscription:23211:person:44803:2017-05-07T09:54:48+00:00 - Constance Variable (lambadalambda@social.heldscal.la)'s status on Sunday, 07-May-2017 09:54:49 UTC - <a href="https://social.heldscal.la/lambadalambda">Constance Variable</a> stopped following <a href="https://pawoo.net/@pekorino">mono</a>. - - http://activitystrea.ms/schema/1.0/unfollow - 2017-05-07T09:54:49+00:00 - 2017-05-07T09:54:49+00:00 - - http://activitystrea.ms/schema/1.0/person - https://pawoo.net/users/pekorino - mono - http://shitposter.club/mono 孤独のグルメ - - - - - pekorino - mono - http://shitposter.club/mono 孤独のグルメ - - - tag:social.heldscal.la,2017-05-07:objectType=thread:nonce=6e80caf94e03029f - - - - - - diff --git a/test/formatter_test.exs b/test/formatter_test.exs index bef5a2c28..f066bd50a 100644 --- a/test/formatter_test.exs +++ b/test/formatter_test.exs @@ -10,6 +10,7 @@ defmodule Pleroma.FormatterTest do import Pleroma.Factory setup_all do + clear_config(Pleroma.Formatter) Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) :ok end @@ -255,6 +256,36 @@ test "it can parse mentions and return the relevant users" do assert {_text, ^expected_mentions, []} = Formatter.linkify(text) end + + test "it parses URL containing local mention" do + _user = insert(:user, %{nickname: "lain"}) + + text = "https://example.com/@lain" + + expected = ~S(https://example.com/@lain) + + assert {^expected, [], []} = Formatter.linkify(text) + end + + test "it correctly parses angry face D:< with mention" do + lain = + insert(:user, %{ + nickname: "lain@lain.com", + ap_id: "https://lain.com/users/lain", + id: "9qrWmR0cKniB0YU0TA" + }) + + text = "@lain@lain.com D:<" + + expected_text = + ~S(@lain D:<) + + expected_mentions = [ + {"@lain@lain.com", lain} + ] + + assert {^expected_text, ^expected_mentions, []} = Formatter.linkify(text) + end end describe ".parse_tags" do diff --git a/test/gun/conneciton_pool_test.exs b/test/gun/conneciton_pool_test.exs new file mode 100644 index 000000000..aea908fac --- /dev/null +++ b/test/gun/conneciton_pool_test.exs @@ -0,0 +1,101 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Gun.ConnectionPoolTest do + use Pleroma.DataCase + + import Mox + import ExUnit.CaptureLog + alias Pleroma.Config + alias Pleroma.Gun.ConnectionPool + + defp gun_mock(_) do + Pleroma.GunMock + |> stub(:open, fn _, _, _ -> Task.start_link(fn -> Process.sleep(100) end) end) + |> stub(:await_up, fn _, _ -> {:ok, :http} end) + |> stub(:set_owner, fn _, _ -> :ok end) + + :ok + end + + setup :set_mox_from_context + setup :gun_mock + + test "gives the same connection to 2 concurrent requests" do + Enum.map( + [ + "http://www.korean-books.com.kp/KBMbooks/en/periodic/pictorial/20200530163914.pdf", + "http://www.korean-books.com.kp/KBMbooks/en/periodic/pictorial/20200528183427.pdf" + ], + fn uri -> + uri = URI.parse(uri) + task_parent = self() + + Task.start_link(fn -> + {:ok, conn} = ConnectionPool.get_conn(uri, []) + ConnectionPool.release_conn(conn) + send(task_parent, conn) + end) + end + ) + + [pid, pid] = + for _ <- 1..2 do + receive do + pid -> pid + end + end + end + + test "connection limit is respected with concurrent requests" do + clear_config([:connections_pool, :max_connections]) do + Config.put([:connections_pool, :max_connections], 1) + # The supervisor needs a reboot to apply the new config setting + Process.exit(Process.whereis(Pleroma.Gun.ConnectionPool.WorkerSupervisor), :kill) + + on_exit(fn -> + Process.exit(Process.whereis(Pleroma.Gun.ConnectionPool.WorkerSupervisor), :kill) + end) + end + + capture_log(fn -> + Enum.map( + [ + "https://ninenines.eu/", + "https://youtu.be/PFGwMiDJKNY" + ], + fn uri -> + uri = URI.parse(uri) + task_parent = self() + + Task.start_link(fn -> + result = ConnectionPool.get_conn(uri, []) + # Sleep so that we don't end up with a situation, + # where request from the second process gets processed + # only after the first process already released the connection + Process.sleep(50) + + case result do + {:ok, pid} -> + ConnectionPool.release_conn(pid) + + _ -> + nil + end + + send(task_parent, result) + end) + end + ) + + [{:error, :pool_full}, {:ok, _pid}] = + for _ <- 1..2 do + receive do + result -> result + end + end + |> Enum.sort() + end) + end +end diff --git a/test/html_test.exs b/test/html_test.exs index 0a4b4ebbc..7d3756884 100644 --- a/test/html_test.exs +++ b/test/html_test.exs @@ -165,7 +165,7 @@ test "filters invalid microformats markup" do end end - describe "extract_first_external_url" do + describe "extract_first_external_url_from_object" do test "extracts the url" do user = insert(:user) @@ -176,7 +176,7 @@ test "extracts the url" do }) object = Object.normalize(activity) - {:ok, url} = HTML.extract_first_external_url(object, object.data["content"]) + {:ok, url} = HTML.extract_first_external_url_from_object(object) assert url == "https://github.com/komeiji-satori/Dress" end @@ -191,7 +191,7 @@ test "skips mentions" do }) object = Object.normalize(activity) - {:ok, url} = HTML.extract_first_external_url(object, object.data["content"]) + {:ok, url} = HTML.extract_first_external_url_from_object(object) assert url == "https://github.com/syuilo/misskey/blob/develop/docs/setup.en.md" @@ -207,7 +207,7 @@ test "skips hashtags" do }) object = Object.normalize(activity) - {:ok, url} = HTML.extract_first_external_url(object, object.data["content"]) + {:ok, url} = HTML.extract_first_external_url_from_object(object) assert url == "https://www.pixiv.net/member_illust.php?mode=medium&illust_id=72255140" end @@ -223,7 +223,7 @@ test "skips microformats hashtags" do }) object = Object.normalize(activity) - {:ok, url} = HTML.extract_first_external_url(object, object.data["content"]) + {:ok, url} = HTML.extract_first_external_url_from_object(object) assert url == "https://www.pixiv.net/member_illust.php?mode=medium&illust_id=72255140" end @@ -235,7 +235,21 @@ test "does not crash when there is an HTML entity in a link" do object = Object.normalize(activity) - assert {:ok, nil} = HTML.extract_first_external_url(object, object.data["content"]) + assert {:ok, nil} = HTML.extract_first_external_url_from_object(object) + end + + test "skips attachment links" do + user = insert(:user) + + {:ok, activity} = + CommonAPI.post(user, %{ + status: + "image.png" + }) + + object = Object.normalize(activity) + + assert {:ok, nil} = HTML.extract_first_external_url_from_object(object) end end end diff --git a/test/http/adapter_helper/gun_test.exs b/test/http/adapter_helper/gun_test.exs index 2e961826e..80589c73d 100644 --- a/test/http/adapter_helper/gun_test.exs +++ b/test/http/adapter_helper/gun_test.exs @@ -9,24 +9,10 @@ defmodule Pleroma.HTTP.AdapterHelper.GunTest do import Mox alias Pleroma.Config - alias Pleroma.Gun.Conn alias Pleroma.HTTP.AdapterHelper.Gun - alias Pleroma.Pool.Connections setup :verify_on_exit! - defp gun_mock(_) do - gun_mock() - :ok - end - - defp gun_mock do - Pleroma.GunMock - |> stub(:open, fn _, _, _ -> Task.start_link(fn -> Process.sleep(1000) end) end) - |> stub(:await_up, fn _, _ -> {:ok, :http} end) - |> stub(:set_owner, fn _, _ -> :ok end) - end - describe "options/1" do setup do: clear_config([:http, :adapter], a: 1, b: 2) @@ -35,7 +21,6 @@ test "https url with default port" do opts = Gun.options([receive_conn: false], uri) assert opts[:certificates_verification] - assert opts[:tls_opts][:log_level] == :warning end test "https ipv4 with default port" do @@ -43,7 +28,6 @@ test "https ipv4 with default port" do opts = Gun.options([receive_conn: false], uri) assert opts[:certificates_verification] - assert opts[:tls_opts][:log_level] == :warning end test "https ipv6 with default port" do @@ -51,7 +35,6 @@ test "https ipv6 with default port" do opts = Gun.options([receive_conn: false], uri) assert opts[:certificates_verification] - assert opts[:tls_opts][:log_level] == :warning end test "https url with non standart port" do @@ -62,46 +45,12 @@ test "https url with non standart port" do assert opts[:certificates_verification] end - test "get conn on next request" do - gun_mock() - level = Application.get_env(:logger, :level) - Logger.configure(level: :debug) - on_exit(fn -> Logger.configure(level: level) end) - uri = URI.parse("http://some-domain2.com") - - opts = Gun.options(uri) - - assert opts[:conn] == nil - assert opts[:close_conn] == nil - - Process.sleep(50) - opts = Gun.options(uri) - - assert is_pid(opts[:conn]) - assert opts[:close_conn] == false - end - test "merges with defaul http adapter config" do defaults = Gun.options([receive_conn: false], URI.parse("https://example.com")) assert Keyword.has_key?(defaults, :a) assert Keyword.has_key?(defaults, :b) end - test "default ssl adapter opts with connection" do - gun_mock() - uri = URI.parse("https://some-domain.com") - - :ok = Conn.open(uri, :gun_connections) - - opts = Gun.options(uri) - - assert opts[:certificates_verification] - refute opts[:tls_opts] == [] - - assert opts[:close_conn] == false - assert is_pid(opts[:conn]) - end - test "parses string proxy host & port" do proxy = Config.get([:http, :proxy_url]) Config.put([:http, :proxy_url], "localhost:8123") @@ -132,127 +81,4 @@ test "passed opts have more weight than defaults" do assert opts[:proxy] == {'example.com', 4321} end end - - describe "options/1 with receive_conn parameter" do - setup :gun_mock - - test "receive conn by default" do - uri = URI.parse("http://another-domain.com") - :ok = Conn.open(uri, :gun_connections) - - received_opts = Gun.options(uri) - assert received_opts[:close_conn] == false - assert is_pid(received_opts[:conn]) - end - - test "don't receive conn if receive_conn is false" do - uri = URI.parse("http://another-domain.com") - :ok = Conn.open(uri, :gun_connections) - - opts = [receive_conn: false] - received_opts = Gun.options(opts, uri) - assert received_opts[:close_conn] == nil - assert received_opts[:conn] == nil - end - end - - describe "after_request/1" do - setup :gun_mock - - test "body_as not chunks" do - uri = URI.parse("http://some-domain.com") - :ok = Conn.open(uri, :gun_connections) - opts = Gun.options(uri) - :ok = Gun.after_request(opts) - conn = opts[:conn] - - assert %Connections{ - conns: %{ - "http:some-domain.com:80" => %Pleroma.Gun.Conn{ - conn: ^conn, - conn_state: :idle, - used_by: [] - } - } - } = Connections.get_state(:gun_connections) - end - - test "body_as chunks" do - uri = URI.parse("http://some-domain.com") - :ok = Conn.open(uri, :gun_connections) - opts = Gun.options([body_as: :chunks], uri) - :ok = Gun.after_request(opts) - conn = opts[:conn] - self = self() - - assert %Connections{ - conns: %{ - "http:some-domain.com:80" => %Pleroma.Gun.Conn{ - conn: ^conn, - conn_state: :active, - used_by: [{^self, _}] - } - } - } = Connections.get_state(:gun_connections) - end - - test "with no connection" do - uri = URI.parse("http://uniq-domain.com") - - :ok = Conn.open(uri, :gun_connections) - - opts = Gun.options([body_as: :chunks], uri) - conn = opts[:conn] - opts = Keyword.delete(opts, :conn) - self = self() - - :ok = Gun.after_request(opts) - - assert %Connections{ - conns: %{ - "http:uniq-domain.com:80" => %Pleroma.Gun.Conn{ - conn: ^conn, - conn_state: :active, - used_by: [{^self, _}] - } - } - } = Connections.get_state(:gun_connections) - end - - test "with ipv4" do - uri = URI.parse("http://127.0.0.1") - :ok = Conn.open(uri, :gun_connections) - opts = Gun.options(uri) - :ok = Gun.after_request(opts) - conn = opts[:conn] - - assert %Connections{ - conns: %{ - "http:127.0.0.1:80" => %Pleroma.Gun.Conn{ - conn: ^conn, - conn_state: :idle, - used_by: [] - } - } - } = Connections.get_state(:gun_connections) - end - - test "with ipv6" do - uri = URI.parse("http://[2a03:2880:f10c:83:face:b00c:0:25de]") - :ok = Conn.open(uri, :gun_connections) - opts = Gun.options(uri) - :ok = Gun.after_request(opts) - conn = opts[:conn] - - assert %Connections{ - conns: %{ - "http:2a03:2880:f10c:83:face:b00c:0:25de:80" => %Pleroma.Gun.Conn{ - conn: ^conn, - conn_state: :idle, - used_by: [] - } - } - } = Connections.get_state(:gun_connections) - end - end end diff --git a/test/http/connection_test.exs b/test/http/connection_test.exs deleted file mode 100644 index 7c94a50b2..000000000 --- a/test/http/connection_test.exs +++ /dev/null @@ -1,135 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.HTTP.ConnectionTest do - use ExUnit.Case - use Pleroma.Tests.Helpers - - import ExUnit.CaptureLog - - alias Pleroma.Config - alias Pleroma.HTTP.Connection - - describe "parse_host/1" do - test "as atom to charlist" do - assert Connection.parse_host(:localhost) == 'localhost' - end - - test "as string to charlist" do - assert Connection.parse_host("localhost.com") == 'localhost.com' - end - - test "as string ip to tuple" do - assert Connection.parse_host("127.0.0.1") == {127, 0, 0, 1} - end - end - - describe "parse_proxy/1" do - test "ip with port" do - assert Connection.parse_proxy("127.0.0.1:8123") == {:ok, {127, 0, 0, 1}, 8123} - end - - test "host with port" do - assert Connection.parse_proxy("localhost:8123") == {:ok, 'localhost', 8123} - end - - test "as tuple" do - assert Connection.parse_proxy({:socks4, :localhost, 9050}) == - {:ok, :socks4, 'localhost', 9050} - end - - test "as tuple with string host" do - assert Connection.parse_proxy({:socks5, "localhost", 9050}) == - {:ok, :socks5, 'localhost', 9050} - end - end - - describe "parse_proxy/1 errors" do - test "ip without port" do - capture_log(fn -> - assert Connection.parse_proxy("127.0.0.1") == {:error, :invalid_proxy} - end) =~ "parsing proxy fail \"127.0.0.1\"" - end - - test "host without port" do - capture_log(fn -> - assert Connection.parse_proxy("localhost") == {:error, :invalid_proxy} - end) =~ "parsing proxy fail \"localhost\"" - end - - test "host with bad port" do - capture_log(fn -> - assert Connection.parse_proxy("localhost:port") == {:error, :invalid_proxy_port} - end) =~ "parsing port in proxy fail \"localhost:port\"" - end - - test "ip with bad port" do - capture_log(fn -> - assert Connection.parse_proxy("127.0.0.1:15.9") == {:error, :invalid_proxy_port} - end) =~ "parsing port in proxy fail \"127.0.0.1:15.9\"" - end - - test "as tuple without port" do - capture_log(fn -> - assert Connection.parse_proxy({:socks5, :localhost}) == {:error, :invalid_proxy} - end) =~ "parsing proxy fail {:socks5, :localhost}" - end - - test "with nil" do - assert Connection.parse_proxy(nil) == nil - end - end - - describe "options/3" do - setup do: clear_config([:http, :proxy_url]) - - test "without proxy_url in config" do - Config.delete([:http, :proxy_url]) - - opts = Connection.options(%URI{}) - refute Keyword.has_key?(opts, :proxy) - end - - test "parses string proxy host & port" do - Config.put([:http, :proxy_url], "localhost:8123") - - opts = Connection.options(%URI{}) - assert opts[:proxy] == {'localhost', 8123} - end - - test "parses tuple proxy scheme host and port" do - Config.put([:http, :proxy_url], {:socks, 'localhost', 1234}) - - opts = Connection.options(%URI{}) - assert opts[:proxy] == {:socks, 'localhost', 1234} - end - - test "passed opts have more weight than defaults" do - Config.put([:http, :proxy_url], {:socks5, 'localhost', 1234}) - - opts = Connection.options(%URI{}, proxy: {'example.com', 4321}) - - assert opts[:proxy] == {'example.com', 4321} - end - end - - describe "format_host/1" do - test "with domain" do - assert Connection.format_host("example.com") == 'example.com' - end - - test "with idna domain" do - assert Connection.format_host("ですexample.com") == 'xn--example-183fne.com' - end - - test "with ipv4" do - assert Connection.format_host("127.0.0.1") == '127.0.0.1' - end - - test "with ipv6" do - assert Connection.format_host("2a03:2880:f10c:83:face:b00c:0:25de") == - '2a03:2880:f10c:83:face:b00c:0:25de' - end - end -end diff --git a/test/http/ex_aws_test.exs b/test/http/ex_aws_test.exs new file mode 100644 index 000000000..d0b00ca26 --- /dev/null +++ b/test/http/ex_aws_test.exs @@ -0,0 +1,54 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.ExAwsTest do + use ExUnit.Case + + import Tesla.Mock + alias Pleroma.HTTP + + @url "https://s3.amazonaws.com/test_bucket/test_image.jpg" + + setup do + mock(fn + %{method: :get, url: @url, headers: [{"x-amz-bucket-region", "us-east-1"}]} -> + %Tesla.Env{ + status: 200, + body: "image-content", + headers: [{"x-amz-bucket-region", "us-east-1"}] + } + + %{method: :post, url: @url, body: "image-content-2"} -> + %Tesla.Env{status: 200, body: "image-content-2"} + end) + + :ok + end + + describe "request" do + test "get" do + assert HTTP.ExAws.request(:get, @url, "", [{"x-amz-bucket-region", "us-east-1"}]) == { + :ok, + %{ + body: "image-content", + headers: [{"x-amz-bucket-region", "us-east-1"}], + status_code: 200 + } + } + end + + test "post" do + assert HTTP.ExAws.request(:post, @url, "image-content-2", [ + {"x-amz-bucket-region", "us-east-1"} + ]) == { + :ok, + %{ + body: "image-content-2", + headers: [], + status_code: 200 + } + } + end + end +end diff --git a/test/http/tzdata_test.exs b/test/http/tzdata_test.exs new file mode 100644 index 000000000..3e605d33b --- /dev/null +++ b/test/http/tzdata_test.exs @@ -0,0 +1,35 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.HTTP.TzdataTest do + use ExUnit.Case + + import Tesla.Mock + alias Pleroma.HTTP + @url "https://data.iana.org/time-zones/tzdata-latest.tar.gz" + + setup do + mock(fn + %{method: :head, url: @url} -> + %Tesla.Env{status: 200, body: ""} + + %{method: :get, url: @url} -> + %Tesla.Env{status: 200, body: "hello"} + end) + + :ok + end + + describe "head/1" do + test "returns successfully result" do + assert HTTP.Tzdata.head(@url, [], []) == {:ok, {200, []}} + end + end + + describe "get/1" do + test "returns successfully result" do + assert HTTP.Tzdata.get(@url, [], []) == {:ok, {200, [], "hello"}} + end + end +end diff --git a/test/http_test.exs b/test/http_test.exs index 618485b55..d394bb942 100644 --- a/test/http_test.exs +++ b/test/http_test.exs @@ -17,6 +17,9 @@ defmodule Pleroma.HTTPTest do } -> json(%{"my" => "data"}) + %{method: :head, url: "http://example.com/hello"} -> + %Tesla.Env{status: 200, body: ""} + %{method: :get, url: "http://example.com/hello"} -> %Tesla.Env{status: 200, body: "hello"} @@ -27,6 +30,12 @@ defmodule Pleroma.HTTPTest do :ok end + describe "head/1" do + test "returns successfully result" do + assert HTTP.head("http://example.com/hello") == {:ok, %Tesla.Env{status: 200, body: ""}} + end + end + describe "get/1" do test "returns successfully result" do assert HTTP.get("http://example.com/hello") == { diff --git a/test/instance_static/emoji/test_pack/blank2.png b/test/instance_static/emoji/test_pack/blank2.png new file mode 100644 index 000000000..8f50fa023 Binary files /dev/null and b/test/instance_static/emoji/test_pack/blank2.png differ diff --git a/test/instance_static/emoji/test_pack/pack.json b/test/instance_static/emoji/test_pack/pack.json index 481891b08..5b33fbb32 100644 --- a/test/instance_static/emoji/test_pack/pack.json +++ b/test/instance_static/emoji/test_pack/pack.json @@ -1,6 +1,7 @@ { "files": { - "blank": "blank.png" + "blank": "blank.png", + "blank2": "blank2.png" }, "pack": { "description": "Test description", diff --git a/test/instance_static/emoji/test_pack_nonshared/nonshared.zip b/test/instance_static/emoji/test_pack_nonshared/nonshared.zip index 148446c64..59bff37f0 100644 Binary files a/test/instance_static/emoji/test_pack_nonshared/nonshared.zip and b/test/instance_static/emoji/test_pack_nonshared/nonshared.zip differ diff --git a/test/instance_static/emoji/test_pack_nonshared/pack.json b/test/instance_static/emoji/test_pack_nonshared/pack.json index 93d643a5f..09f6274d1 100644 --- a/test/instance_static/emoji/test_pack_nonshared/pack.json +++ b/test/instance_static/emoji/test_pack_nonshared/pack.json @@ -4,7 +4,7 @@ "homepage": "https://pleroma.social", "description": "Test description", "fallback-src": "https://nonshared-pack", - "fallback-src-sha256": "74409E2674DAA06C072729C6C8426C4CB3B7E0B85ED77792DB7A436E11D76DAF", + "fallback-src-sha256": "1967BB4E42BCC34BCC12D57BE7811D3B7BE52F965BCE45C87BD377B9499CE11D", "share-files": false }, "files": { diff --git a/test/integration/mastodon_websocket_test.exs b/test/integration/mastodon_websocket_test.exs index ea17e9feb..76fbc8bda 100644 --- a/test/integration/mastodon_websocket_test.exs +++ b/test/integration/mastodon_websocket_test.exs @@ -99,30 +99,30 @@ test "accepts valid tokens", state do test "accepts the 'user' stream", %{token: token} = _state do assert {:ok, _} = start_socket("?stream=user&access_token=#{token.token}") - assert capture_log(fn -> - assert {:error, {401, _}} = start_socket("?stream=user") - Process.sleep(30) - end) =~ ":badarg" + capture_log(fn -> + assert {:error, {401, _}} = start_socket("?stream=user") + Process.sleep(30) + end) end test "accepts the 'user:notification' stream", %{token: token} = _state do assert {:ok, _} = start_socket("?stream=user:notification&access_token=#{token.token}") - assert capture_log(fn -> - assert {:error, {401, _}} = start_socket("?stream=user:notification") - Process.sleep(30) - end) =~ ":badarg" + capture_log(fn -> + assert {:error, {401, _}} = start_socket("?stream=user:notification") + Process.sleep(30) + end) end test "accepts valid token on Sec-WebSocket-Protocol header", %{token: token} do assert {:ok, _} = start_socket("?stream=user", [{"Sec-WebSocket-Protocol", token.token}]) - assert capture_log(fn -> - assert {:error, {401, _}} = - start_socket("?stream=user", [{"Sec-WebSocket-Protocol", "I am a friend"}]) + capture_log(fn -> + assert {:error, {401, _}} = + start_socket("?stream=user", [{"Sec-WebSocket-Protocol", "I am a friend"}]) - Process.sleep(30) - end) =~ ":badarg" + Process.sleep(30) + end) end end end diff --git a/test/migrations/20200716195806_autolinker_to_linkify_test.exs b/test/migrations/20200716195806_autolinker_to_linkify_test.exs new file mode 100644 index 000000000..250d11c61 --- /dev/null +++ b/test/migrations/20200716195806_autolinker_to_linkify_test.exs @@ -0,0 +1,68 @@ +defmodule Pleroma.Repo.Migrations.AutolinkerToLinkifyTest do + use Pleroma.DataCase + import Pleroma.Factory + import Pleroma.Tests.Helpers + alias Pleroma.ConfigDB + + setup do: clear_config(Pleroma.Formatter) + setup_all do: require_migration("20200716195806_autolinker_to_linkify") + + test "change/0 converts auto_linker opts for Pleroma.Formatter", %{migration: migration} do + autolinker_opts = [ + extra: true, + validate_tld: true, + class: false, + strip_prefix: false, + new_window: false, + rel: "testing" + ] + + insert(:config, group: :auto_linker, key: :opts, value: autolinker_opts) + + migration.change() + + assert nil == ConfigDB.get_by_params(%{group: :auto_linker, key: :opts}) + + %{value: new_opts} = ConfigDB.get_by_params(%{group: :pleroma, key: Pleroma.Formatter}) + + assert new_opts == [ + class: false, + extra: true, + new_window: false, + rel: "testing", + strip_prefix: false + ] + + Pleroma.Config.put(Pleroma.Formatter, new_opts) + assert new_opts == Pleroma.Config.get(Pleroma.Formatter) + + {text, _mentions, []} = + Pleroma.Formatter.linkify( + "https://www.businessinsider.com/walmart-will-close-stores-on-thanksgiving-ending-black-friday-tradition-2020-7\n\nOmg will COVID finally end Black Friday???" + ) + + assert text == + "https://www.businessinsider.com/walmart-will-close-stores-on-thanksgiving-ending-black-friday-tradition-2020-7\n\nOmg will COVID finally end Black Friday???" + end + + test "transform_opts/1 returns a list of compatible opts", %{migration: migration} do + old_opts = [ + extra: true, + validate_tld: true, + class: false, + strip_prefix: false, + new_window: false, + rel: "qqq" + ] + + expected_opts = [ + class: false, + extra: true, + new_window: false, + rel: "qqq", + strip_prefix: false + ] + + assert migration.transform_opts(old_opts) == expected_opts + end +end diff --git a/test/migrations/20200722185515_fix_malformed_formatter_config_test.exs b/test/migrations/20200722185515_fix_malformed_formatter_config_test.exs new file mode 100644 index 000000000..d3490478e --- /dev/null +++ b/test/migrations/20200722185515_fix_malformed_formatter_config_test.exs @@ -0,0 +1,66 @@ +defmodule Pleroma.Repo.Migrations.FixMalformedFormatterConfigTest do + use Pleroma.DataCase + import Pleroma.Factory + import Pleroma.Tests.Helpers + alias Pleroma.ConfigDB + + setup do: clear_config(Pleroma.Formatter) + setup_all do: require_migration("20200722185515_fix_malformed_formatter_config") + + test "change/0 converts a map into a list", %{migration: migration} do + incorrect_opts = %{ + class: false, + extra: true, + new_window: false, + rel: "F", + strip_prefix: false + } + + insert(:config, group: :pleroma, key: Pleroma.Formatter, value: incorrect_opts) + + assert :ok == migration.change() + + %{value: new_opts} = ConfigDB.get_by_params(%{group: :pleroma, key: Pleroma.Formatter}) + + assert new_opts == [ + class: false, + extra: true, + new_window: false, + rel: "F", + strip_prefix: false + ] + + Pleroma.Config.put(Pleroma.Formatter, new_opts) + assert new_opts == Pleroma.Config.get(Pleroma.Formatter) + + {text, _mentions, []} = + Pleroma.Formatter.linkify( + "https://www.businessinsider.com/walmart-will-close-stores-on-thanksgiving-ending-black-friday-tradition-2020-7\n\nOmg will COVID finally end Black Friday???" + ) + + assert text == + "https://www.businessinsider.com/walmart-will-close-stores-on-thanksgiving-ending-black-friday-tradition-2020-7\n\nOmg will COVID finally end Black Friday???" + end + + test "change/0 skips if Pleroma.Formatter config is already a list", %{migration: migration} do + opts = [ + class: false, + extra: true, + new_window: false, + rel: "ugc", + strip_prefix: false + ] + + insert(:config, group: :pleroma, key: Pleroma.Formatter, value: opts) + + assert :skipped == migration.change() + + %{value: new_opts} = ConfigDB.get_by_params(%{group: :pleroma, key: Pleroma.Formatter}) + + assert new_opts == opts + end + + test "change/0 skips if Pleroma.Formatter is empty", %{migration: migration} do + assert :skipped == migration.change() + end +end diff --git a/test/migrations/20200724133313_move_welcome_settings_test.exs b/test/migrations/20200724133313_move_welcome_settings_test.exs new file mode 100644 index 000000000..739f24547 --- /dev/null +++ b/test/migrations/20200724133313_move_welcome_settings_test.exs @@ -0,0 +1,140 @@ +defmodule Pleroma.Repo.Migrations.MoveWelcomeSettingsTest do + use Pleroma.DataCase + import Pleroma.Factory + import Pleroma.Tests.Helpers + alias Pleroma.ConfigDB + + setup_all do: require_migration("20200724133313_move_welcome_settings") + + describe "up/0" do + test "converts welcome settings", %{migration: migration} do + insert(:config, + group: :pleroma, + key: :instance, + value: [ + welcome_message: "Test message", + welcome_user_nickname: "jimm", + name: "Pleroma" + ] + ) + + migration.up() + instance_config = ConfigDB.get_by_params(%{group: :pleroma, key: :instance}) + welcome_config = ConfigDB.get_by_params(%{group: :pleroma, key: :welcome}) + + assert instance_config.value == [name: "Pleroma"] + + assert welcome_config.value == [ + direct_message: %{ + enabled: true, + message: "Test message", + sender_nickname: "jimm" + }, + email: %{ + enabled: false, + html: "Welcome to <%= instance_name %>", + sender: nil, + subject: "Welcome to <%= instance_name %>", + text: "Welcome to <%= instance_name %>" + } + ] + end + + test "does nothing when message empty", %{migration: migration} do + insert(:config, + group: :pleroma, + key: :instance, + value: [ + welcome_message: "", + welcome_user_nickname: "jimm", + name: "Pleroma" + ] + ) + + migration.up() + instance_config = ConfigDB.get_by_params(%{group: :pleroma, key: :instance}) + refute ConfigDB.get_by_params(%{group: :pleroma, key: :welcome}) + assert instance_config.value == [name: "Pleroma"] + end + + test "does nothing when welcome_message not set", %{migration: migration} do + insert(:config, + group: :pleroma, + key: :instance, + value: [welcome_user_nickname: "jimm", name: "Pleroma"] + ) + + migration.up() + instance_config = ConfigDB.get_by_params(%{group: :pleroma, key: :instance}) + refute ConfigDB.get_by_params(%{group: :pleroma, key: :welcome}) + assert instance_config.value == [name: "Pleroma"] + end + end + + describe "down/0" do + test "revert new settings to old when instance setting not exists", %{migration: migration} do + insert(:config, + group: :pleroma, + key: :welcome, + value: [ + direct_message: %{ + enabled: true, + message: "Test message", + sender_nickname: "jimm" + }, + email: %{ + enabled: false, + html: "Welcome to <%= instance_name %>", + sender: nil, + subject: "Welcome to <%= instance_name %>", + text: "Welcome to <%= instance_name %>" + } + ] + ) + + migration.down() + + refute ConfigDB.get_by_params(%{group: :pleroma, key: :welcome}) + instance_config = ConfigDB.get_by_params(%{group: :pleroma, key: :instance}) + + assert instance_config.value == [ + welcome_user_nickname: "jimm", + welcome_message: "Test message" + ] + end + + test "revert new settings to old when instance setting exists", %{migration: migration} do + insert(:config, group: :pleroma, key: :instance, value: [name: "Pleroma App"]) + + insert(:config, + group: :pleroma, + key: :welcome, + value: [ + direct_message: %{ + enabled: true, + message: "Test message", + sender_nickname: "jimm" + }, + email: %{ + enabled: false, + html: "Welcome to <%= instance_name %>", + sender: nil, + subject: "Welcome to <%= instance_name %>", + text: "Welcome to <%= instance_name %>" + } + ] + ) + + migration.down() + + refute ConfigDB.get_by_params(%{group: :pleroma, key: :welcome}) + instance_config = ConfigDB.get_by_params(%{group: :pleroma, key: :instance}) + + assert instance_config.value == [ + name: "Pleroma App", + welcome_user_nickname: "jimm", + welcome_message: "Test message" + ] + end + end +end diff --git a/test/migrations/20200802170532_fix_legacy_tags_test.exs b/test/migrations/20200802170532_fix_legacy_tags_test.exs new file mode 100644 index 000000000..3b4dee407 --- /dev/null +++ b/test/migrations/20200802170532_fix_legacy_tags_test.exs @@ -0,0 +1,24 @@ +defmodule Pleroma.Repo.Migrations.FixLegacyTagsTest do + alias Pleroma.User + use Pleroma.DataCase + import Pleroma.Factory + import Pleroma.Tests.Helpers + + setup_all do: require_migration("20200802170532_fix_legacy_tags") + + test "change/0 converts legacy user tags into correct values", %{migration: migration} do + user = insert(:user, tags: ["force_nsfw", "force_unlisted", "verified"]) + user2 = insert(:user) + + assert :ok == migration.change() + + fixed_user = User.get_by_id(user.id) + fixed_user2 = User.get_by_id(user2.id) + + assert fixed_user.tags == ["mrf_tag:media-force-nsfw", "mrf_tag:force-unlisted", "verified"] + assert fixed_user2.tags == [] + + # user2 should not have been updated + assert fixed_user2.updated_at == fixed_user2.inserted_at + end +end diff --git a/test/notification_test.exs b/test/notification_test.exs index 526f43fab..a09b08675 100644 --- a/test/notification_test.exs +++ b/test/notification_test.exs @@ -22,6 +22,16 @@ defmodule Pleroma.NotificationTest do alias Pleroma.Web.Streamer describe "create_notifications" do + test "never returns nil" do + user = insert(:user) + other_user = insert(:user, %{invisible: true}) + + {:ok, activity} = CommonAPI.post(user, %{status: "yeah"}) + {:ok, activity} = CommonAPI.react_with_emoji(activity.id, other_user, "☕") + + refute {:ok, [nil]} == Notification.create_notifications(activity) + end + test "creates a notification for an emoji reaction" do user = insert(:user) other_user = insert(:user) @@ -207,7 +217,10 @@ test "it creates a notification for the user if the user mutes the activity auth muter = Repo.get(User, muter.id) {:ok, activity} = CommonAPI.post(muted, %{status: "Hi @#{muter.nickname}"}) - assert Notification.create_notification(activity, muter) + notification = Notification.create_notification(activity, muter) + + assert notification.id + assert notification.seen end test "notification created if user is muted without notifications" do @@ -233,52 +246,24 @@ test "it creates a notification for an activity from a muted thread" do in_reply_to_status_id: activity.id }) - assert Notification.create_notification(activity, muter) + notification = Notification.create_notification(activity, muter) + + assert notification.id + assert notification.seen end - test "it disables notifications from followers" do - follower = insert(:user) - - followed = - insert(:user, notification_settings: %Pleroma.User.NotificationSetting{followers: false}) - - User.follow(follower, followed) - {:ok, activity} = CommonAPI.post(follower, %{status: "hey @#{followed.nickname}"}) - refute Notification.create_notification(activity, followed) - end - - test "it disables notifications from non-followers" do + test "it disables notifications from strangers" do follower = insert(:user) followed = insert(:user, - notification_settings: %Pleroma.User.NotificationSetting{non_followers: false} + notification_settings: %Pleroma.User.NotificationSetting{block_from_strangers: true} ) {:ok, activity} = CommonAPI.post(follower, %{status: "hey @#{followed.nickname}"}) refute Notification.create_notification(activity, followed) end - test "it disables notifications from people the user follows" do - follower = - insert(:user, notification_settings: %Pleroma.User.NotificationSetting{follows: false}) - - followed = insert(:user) - User.follow(follower, followed) - follower = Repo.get(User, follower.id) - {:ok, activity} = CommonAPI.post(followed, %{status: "hey @#{follower.nickname}"}) - refute Notification.create_notification(activity, follower) - end - - test "it disables notifications from people the user does not follow" do - follower = - insert(:user, notification_settings: %Pleroma.User.NotificationSetting{non_follows: false}) - - followed = insert(:user) - {:ok, activity} = CommonAPI.post(followed, %{status: "hey @#{follower.nickname}"}) - refute Notification.create_notification(activity, follower) - end - test "it doesn't create a notification for user if he is the activity author" do activity = insert(:note_activity) author = User.get_cached_by_ap_id(activity.data["actor"]) @@ -314,6 +299,46 @@ test "it disables notifications from people who are invisible" do {:ok, status} = CommonAPI.post(author, %{status: "hey @#{user.nickname}"}) refute Notification.create_notification(status, user) end + + test "it doesn't create notifications if content matches with an irreversible filter" do + user = insert(:user) + subscriber = insert(:user) + + User.subscribe(subscriber, user) + insert(:filter, user: subscriber, phrase: "cofe", hide: true) + + {:ok, status} = CommonAPI.post(user, %{status: "got cofe?"}) + + assert {:ok, []} == Notification.create_notifications(status) + end + + test "it creates notifications if content matches with a not irreversible filter" do + user = insert(:user) + subscriber = insert(:user) + + User.subscribe(subscriber, user) + insert(:filter, user: subscriber, phrase: "cofe", hide: false) + + {:ok, status} = CommonAPI.post(user, %{status: "got cofe?"}) + {:ok, [notification]} = Notification.create_notifications(status) + + assert notification + refute notification.seen + end + + test "it creates notifications when someone likes user's status with a filtered word" do + user = insert(:user) + other_user = insert(:user) + insert(:filter, user: user, phrase: "tesla", hide: true) + + {:ok, activity_one} = CommonAPI.post(user, %{status: "wow tesla"}) + {:ok, activity_two} = CommonAPI.favorite(other_user, activity_one.id) + + {:ok, [notification]} = Notification.create_notifications(activity_two) + + assert notification + refute notification.seen + end end describe "follow / follow_request notifications" do @@ -980,8 +1005,13 @@ test "move activity generates a notification" do end describe "for_user" do - test "it returns notifications for muted user without notifications" do + setup do user = insert(:user) + + {:ok, %{user: user}} + end + + test "it returns notifications for muted user without notifications", %{user: user} do muted = insert(:user) {:ok, _user_relationships} = User.mute(user, muted, false) @@ -990,10 +1020,10 @@ test "it returns notifications for muted user without notifications" do [notification] = Notification.for_user(user) assert notification.activity.object + assert notification.seen end - test "it doesn't return notifications for muted user with notifications" do - user = insert(:user) + test "it doesn't return notifications for muted user with notifications", %{user: user} do muted = insert(:user) {:ok, _user_relationships} = User.mute(user, muted) @@ -1002,8 +1032,7 @@ test "it doesn't return notifications for muted user with notifications" do assert Notification.for_user(user) == [] end - test "it doesn't return notifications for blocked user" do - user = insert(:user) + test "it doesn't return notifications for blocked user", %{user: user} do blocked = insert(:user) {:ok, _user_relationship} = User.block(user, blocked) @@ -1012,8 +1041,7 @@ test "it doesn't return notifications for blocked user" do assert Notification.for_user(user) == [] end - test "it doesn't return notifications for domain-blocked non-followed user" do - user = insert(:user) + test "it doesn't return notifications for domain-blocked non-followed user", %{user: user} do blocked = insert(:user, ap_id: "http://some-domain.com") {:ok, user} = User.block_domain(user, "some-domain.com") @@ -1034,8 +1062,7 @@ test "it returns notifications for domain-blocked but followed user" do assert length(Notification.for_user(user)) == 1 end - test "it doesn't return notifications for muted thread" do - user = insert(:user) + test "it doesn't return notifications for muted thread", %{user: user} do another_user = insert(:user) {:ok, activity} = CommonAPI.post(another_user, %{status: "hey @#{user.nickname}"}) @@ -1044,8 +1071,7 @@ test "it doesn't return notifications for muted thread" do assert Notification.for_user(user) == [] end - test "it returns notifications from a muted user when with_muted is set" do - user = insert(:user) + test "it returns notifications from a muted user when with_muted is set", %{user: user} do muted = insert(:user) {:ok, _user_relationships} = User.mute(user, muted) @@ -1054,8 +1080,9 @@ test "it returns notifications from a muted user when with_muted is set" do assert length(Notification.for_user(user, %{with_muted: true})) == 1 end - test "it doesn't return notifications from a blocked user when with_muted is set" do - user = insert(:user) + test "it doesn't return notifications from a blocked user when with_muted is set", %{ + user: user + } do blocked = insert(:user) {:ok, _user_relationship} = User.block(user, blocked) @@ -1065,8 +1092,8 @@ test "it doesn't return notifications from a blocked user when with_muted is set end test "when with_muted is set, " <> - "it doesn't return notifications from a domain-blocked non-followed user" do - user = insert(:user) + "it doesn't return notifications from a domain-blocked non-followed user", + %{user: user} do blocked = insert(:user, ap_id: "http://some-domain.com") {:ok, user} = User.block_domain(user, "some-domain.com") @@ -1075,8 +1102,7 @@ test "when with_muted is set, " <> assert Enum.empty?(Notification.for_user(user, %{with_muted: true})) end - test "it returns notifications from muted threads when with_muted is set" do - user = insert(:user) + test "it returns notifications from muted threads when with_muted is set", %{user: user} do another_user = insert(:user) {:ok, activity} = CommonAPI.post(another_user, %{status: "hey @#{user.nickname}"}) @@ -1084,5 +1110,33 @@ test "it returns notifications from muted threads when with_muted is set" do {:ok, _} = Pleroma.ThreadMute.add_mute(user.id, activity.data["context"]) assert length(Notification.for_user(user, %{with_muted: true})) == 1 end + + test "it doesn't return notifications about mentions with filtered word", %{user: user} do + insert(:filter, user: user, phrase: "cofe", hide: true) + another_user = insert(:user) + + {:ok, _activity} = CommonAPI.post(another_user, %{status: "@#{user.nickname} got cofe?"}) + + assert Enum.empty?(Notification.for_user(user)) + end + + test "it returns notifications about mentions with not hidden filtered word", %{user: user} do + insert(:filter, user: user, phrase: "test", hide: false) + another_user = insert(:user) + + {:ok, _} = CommonAPI.post(another_user, %{status: "@#{user.nickname} test"}) + + assert length(Notification.for_user(user)) == 1 + end + + test "it returns notifications about favorites with filtered word", %{user: user} do + insert(:filter, user: user, phrase: "cofe", hide: true) + another_user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "Give me my cofe!"}) + {:ok, _} = CommonAPI.favorite(another_user, activity.id) + + assert length(Notification.for_user(user)) == 1 + end end end diff --git a/test/object/fetcher_test.exs b/test/object/fetcher_test.exs index c06e91f12..16cfa7f5c 100644 --- a/test/object/fetcher_test.exs +++ b/test/object/fetcher_test.exs @@ -26,6 +26,46 @@ defmodule Pleroma.Object.FetcherTest do :ok end + describe "error cases" do + setup do + mock(fn + %{method: :get, url: "https://social.sakamoto.gq/notice/9wTkLEnuq47B25EehM"} -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/fetch_mocks/9wTkLEnuq47B25EehM.json") + } + + %{method: :get, url: "https://social.sakamoto.gq/users/eal"} -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/fetch_mocks/eal.json") + } + + %{method: :get, url: "https://busshi.moe/users/tuxcrafting/statuses/104410921027210069"} -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/fetch_mocks/104410921027210069.json") + } + + %{method: :get, url: "https://busshi.moe/users/tuxcrafting"} -> + %Tesla.Env{ + status: 500 + } + end) + + :ok + end + + @tag capture_log: true + test "it works when fetching the OP actor errors out" do + # Here we simulate a case where the author of the OP can't be read + assert {:ok, _} = + Fetcher.fetch_object_from_id( + "https://social.sakamoto.gq/notice/9wTkLEnuq47B25EehM" + ) + end + end + describe "max thread distance restriction" do @ap_id "http://mastodon.example.org/@admin/99541947525187367" setup do: clear_config([:instance, :federation_incoming_replies_max_depth]) @@ -137,6 +177,13 @@ test "handle HTTP 404 response" do "https://mastodon.example.org/users/userisgone404" ) end + + test "it can fetch pleroma polls with attachments" do + {:ok, object} = + Fetcher.fetch_object_from_id("https://patch.cx/objects/tesla_mock/poll_attachment") + + assert object + end end describe "pruning" do diff --git a/test/pagination_test.exs b/test/pagination_test.exs index 9165427ae..e526f23e8 100644 --- a/test/pagination_test.exs +++ b/test/pagination_test.exs @@ -54,6 +54,20 @@ test "paginates by min_id & limit", %{notes: notes} do assert length(paginated) == 1 end + + test "handles id gracefully", %{notes: notes} do + id = Enum.at(notes, 1).id |> Integer.to_string() + + paginated = + Pagination.fetch_paginated(Object, %{ + id: "9s99Hq44Cnv8PKBwWG", + max_id: id, + limit: 20, + offset: 0 + }) + + assert length(paginated) == 1 + end end describe "offset" do diff --git a/test/plugs/admin_secret_authentication_plug_test.exs b/test/plugs/admin_secret_authentication_plug_test.exs index 100016c62..14094eda8 100644 --- a/test/plugs/admin_secret_authentication_plug_test.exs +++ b/test/plugs/admin_secret_authentication_plug_test.exs @@ -3,10 +3,15 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Plugs.AdminSecretAuthenticationPlugTest do - use Pleroma.Web.ConnCase, async: true + use Pleroma.Web.ConnCase + + import Mock import Pleroma.Factory alias Pleroma.Plugs.AdminSecretAuthenticationPlug + alias Pleroma.Plugs.OAuthScopesPlug + alias Pleroma.Plugs.PlugHelper + alias Pleroma.Plugs.RateLimiter test "does nothing if a user is assigned", %{conn: conn} do user = insert(:user) @@ -25,6 +30,10 @@ test "does nothing if a user is assigned", %{conn: conn} do describe "when secret set it assigns an admin user" do setup do: clear_config([:admin_token]) + setup_with_mocks([{RateLimiter, [:passthrough], []}]) do + :ok + end + test "with `admin_token` query parameter", %{conn: conn} do Pleroma.Config.put(:admin_token, "password123") @@ -33,12 +42,14 @@ test "with `admin_token` query parameter", %{conn: conn} do |> AdminSecretAuthenticationPlug.call(%{}) refute conn.assigns[:user] + assert called(RateLimiter.call(conn, name: :authentication)) conn = %{conn | params: %{"admin_token" => "password123"}} |> AdminSecretAuthenticationPlug.call(%{}) assert conn.assigns[:user].is_admin + assert PlugHelper.plug_skipped?(conn, OAuthScopesPlug) end test "with `x-admin-token` HTTP header", %{conn: conn} do @@ -50,6 +61,7 @@ test "with `x-admin-token` HTTP header", %{conn: conn} do |> AdminSecretAuthenticationPlug.call(%{}) refute conn.assigns[:user] + assert called(RateLimiter.call(conn, name: :authentication)) conn = conn @@ -57,6 +69,7 @@ test "with `x-admin-token` HTTP header", %{conn: conn} do |> AdminSecretAuthenticationPlug.call(%{}) assert conn.assigns[:user].is_admin + assert PlugHelper.plug_skipped?(conn, OAuthScopesPlug) end end end diff --git a/test/plugs/frontend_static_test.exs b/test/plugs/frontend_static_test.exs new file mode 100644 index 000000000..6f4923048 --- /dev/null +++ b/test/plugs/frontend_static_test.exs @@ -0,0 +1,57 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.FrontendStaticPlugTest do + alias Pleroma.Plugs.FrontendStatic + use Pleroma.Web.ConnCase + + @dir "test/tmp/instance_static" + + setup do + File.mkdir_p!(@dir) + on_exit(fn -> File.rm_rf(@dir) end) + end + + setup do: clear_config([:instance, :static_dir], @dir) + + test "init will give a static plug config + the frontend type" do + opts = + [ + at: "/admin", + frontend_type: :admin + ] + |> FrontendStatic.init() + + assert opts[:at] == ["admin"] + assert opts[:frontend_type] == :admin + end + + test "overrides existing static files", %{conn: conn} do + name = "pelmora" + ref = "uguu" + + clear_config([:frontends, :primary], %{"name" => name, "ref" => ref}) + path = "#{@dir}/frontends/#{name}/#{ref}" + + File.mkdir_p!(path) + File.write!("#{path}/index.html", "from frontend plug") + + index = get(conn, "/") + assert html_response(index, 200) == "from frontend plug" + end + + test "overrides existing static files for the `pleroma/admin` path", %{conn: conn} do + name = "pelmora" + ref = "uguu" + + clear_config([:frontends, :admin], %{"name" => name, "ref" => ref}) + path = "#{@dir}/frontends/#{name}/#{ref}" + + File.mkdir_p!(path) + File.write!("#{path}/index.html", "from frontend plug") + + index = get(conn, "/pleroma/admin/") + assert html_response(index, 200) == "from frontend plug" + end +end diff --git a/test/plugs/http_security_plug_test.exs b/test/plugs/http_security_plug_test.exs index 63b4d3f31..2297e3dac 100644 --- a/test/plugs/http_security_plug_test.exs +++ b/test/plugs/http_security_plug_test.exs @@ -4,17 +4,12 @@ defmodule Pleroma.Web.Plugs.HTTPSecurityPlugTest do use Pleroma.Web.ConnCase + alias Pleroma.Config alias Plug.Conn - setup do: clear_config([:http_securiy, :enabled]) - setup do: clear_config([:http_security, :sts]) - setup do: clear_config([:http_security, :referrer_policy]) - describe "http security enabled" do - setup do - Config.put([:http_security, :enabled], true) - end + setup do: clear_config([:http_security, :enabled], true) test "it sends CSP headers when enabled", %{conn: conn} do conn = get(conn, "/api/v1/instance") @@ -29,7 +24,7 @@ test "it sends CSP headers when enabled", %{conn: conn} do end test "it sends STS headers when enabled", %{conn: conn} do - Config.put([:http_security, :sts], true) + clear_config([:http_security, :sts], true) conn = get(conn, "/api/v1/instance") @@ -38,7 +33,7 @@ test "it sends STS headers when enabled", %{conn: conn} do end test "it does not send STS headers when disabled", %{conn: conn} do - Config.put([:http_security, :sts], false) + clear_config([:http_security, :sts], false) conn = get(conn, "/api/v1/instance") @@ -47,23 +42,19 @@ test "it does not send STS headers when disabled", %{conn: conn} do end test "referrer-policy header reflects configured value", %{conn: conn} do - conn = get(conn, "/api/v1/instance") + resp = get(conn, "/api/v1/instance") - assert Conn.get_resp_header(conn, "referrer-policy") == ["same-origin"] + assert Conn.get_resp_header(resp, "referrer-policy") == ["same-origin"] - Config.put([:http_security, :referrer_policy], "no-referrer") + clear_config([:http_security, :referrer_policy], "no-referrer") - conn = - build_conn() - |> get("/api/v1/instance") + resp = get(conn, "/api/v1/instance") - assert Conn.get_resp_header(conn, "referrer-policy") == ["no-referrer"] + assert Conn.get_resp_header(resp, "referrer-policy") == ["no-referrer"] end - test "it sends `report-to` & `report-uri` CSP response headers" do - conn = - build_conn() - |> get("/api/v1/instance") + test "it sends `report-to` & `report-uri` CSP response headers", %{conn: conn} do + conn = get(conn, "/api/v1/instance") [csp] = Conn.get_resp_header(conn, "content-security-policy") @@ -74,10 +65,67 @@ test "it sends `report-to` & `report-uri` CSP response headers" do assert reply_to == "{\"endpoints\":[{\"url\":\"https://endpoint.com\"}],\"group\":\"csp-endpoint\",\"max-age\":10886400}" end + + test "default values for img-src and media-src with disabled media proxy", %{conn: conn} do + conn = get(conn, "/api/v1/instance") + + [csp] = Conn.get_resp_header(conn, "content-security-policy") + assert csp =~ "media-src 'self' https:;" + assert csp =~ "img-src 'self' data: blob: https:;" + end + end + + describe "img-src and media-src" do + setup do + clear_config([:http_security, :enabled], true) + clear_config([:media_proxy, :enabled], true) + clear_config([:media_proxy, :proxy_opts, :redirect_on_failure], false) + end + + test "media_proxy with base_url", %{conn: conn} do + url = "https://example.com" + clear_config([:media_proxy, :base_url], url) + assert_media_img_src(conn, url) + end + + test "upload with base url", %{conn: conn} do + url = "https://example2.com" + clear_config([Pleroma.Upload, :base_url], url) + assert_media_img_src(conn, url) + end + + test "with S3 public endpoint", %{conn: conn} do + url = "https://example3.com" + clear_config([Pleroma.Uploaders.S3, :public_endpoint], url) + assert_media_img_src(conn, url) + end + + test "with captcha endpoint", %{conn: conn} do + clear_config([Pleroma.Captcha.Mock, :endpoint], "https://captcha.com") + assert_media_img_src(conn, "https://captcha.com") + end + + test "with media_proxy whitelist", %{conn: conn} do + clear_config([:media_proxy, :whitelist], ["https://example6.com", "https://example7.com"]) + assert_media_img_src(conn, "https://example7.com https://example6.com") + end + + # TODO: delete after removing support bare domains for media proxy whitelist + test "with media_proxy bare domains whitelist (deprecated)", %{conn: conn} do + clear_config([:media_proxy, :whitelist], ["example4.com", "example5.com"]) + assert_media_img_src(conn, "example5.com example4.com") + end + end + + defp assert_media_img_src(conn, url) do + conn = get(conn, "/api/v1/instance") + [csp] = Conn.get_resp_header(conn, "content-security-policy") + assert csp =~ "media-src 'self' #{url};" + assert csp =~ "img-src 'self' data: blob: #{url};" end test "it does not send CSP headers when disabled", %{conn: conn} do - Config.put([:http_security, :enabled], false) + clear_config([:http_security, :enabled], false) conn = get(conn, "/api/v1/instance") diff --git a/test/plugs/instance_static_test.exs b/test/plugs/instance_static_test.exs index b8f070d6a..d42ba817e 100644 --- a/test/plugs/instance_static_test.exs +++ b/test/plugs/instance_static_test.exs @@ -2,7 +2,7 @@ # Copyright © 2017-2020 Pleroma Authors # SPDX-License-Identifier: AGPL-3.0-only -defmodule Pleroma.Web.RuntimeStaticPlugTest do +defmodule Pleroma.Web.InstanceStaticPlugTest do use Pleroma.Web.ConnCase @dir "test/tmp/instance_static" @@ -16,7 +16,7 @@ defmodule Pleroma.Web.RuntimeStaticPlugTest do test "overrides index" do bundled_index = get(build_conn(), "/") - assert html_response(bundled_index, 200) == File.read!("priv/static/index.html") + refute html_response(bundled_index, 200) == "hello world" File.write!(@dir <> "/index.html", "hello world") @@ -24,6 +24,28 @@ test "overrides index" do assert html_response(index, 200) == "hello world" end + test "also overrides frontend files", %{conn: conn} do + name = "pelmora" + ref = "uguu" + + clear_config([:frontends, :primary], %{"name" => name, "ref" => ref}) + + bundled_index = get(conn, "/") + refute html_response(bundled_index, 200) == "from frontend plug" + + path = "#{@dir}/frontends/#{name}/#{ref}" + File.mkdir_p!(path) + File.write!("#{path}/index.html", "from frontend plug") + + index = get(conn, "/") + assert html_response(index, 200) == "from frontend plug" + + File.write!(@dir <> "/index.html", "from instance static") + + index = get(conn, "/") + assert html_response(index, 200) == "from instance static" + end + test "overrides any file in static/static" do bundled_index = get(build_conn(), "/static/terms-of-service.html") diff --git a/test/plugs/oauth_plug_test.exs b/test/plugs/oauth_plug_test.exs index f74c068cd..9d39d3153 100644 --- a/test/plugs/oauth_plug_test.exs +++ b/test/plugs/oauth_plug_test.exs @@ -16,7 +16,7 @@ defmodule Pleroma.Plugs.OAuthPlugTest do setup %{conn: conn} do user = insert(:user) - {:ok, %{token: token}} = Pleroma.Web.OAuth.Token.create_token(insert(:oauth_app), user) + {:ok, %{token: token}} = Pleroma.Web.OAuth.Token.create(insert(:oauth_app), user) %{user: user, token: token, conn: conn} end diff --git a/test/plugs/oauth_scopes_plug_test.exs b/test/plugs/oauth_scopes_plug_test.exs index 884de7b4d..334316043 100644 --- a/test/plugs/oauth_scopes_plug_test.exs +++ b/test/plugs/oauth_scopes_plug_test.exs @@ -3,7 +3,7 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Plugs.OAuthScopesPlugTest do - use Pleroma.Web.ConnCase, async: true + use Pleroma.Web.ConnCase alias Pleroma.Plugs.OAuthScopesPlug alias Pleroma.Repo diff --git a/test/plugs/user_is_admin_plug_test.exs b/test/plugs/user_is_admin_plug_test.exs index fd6a50e53..8bc00e444 100644 --- a/test/plugs/user_is_admin_plug_test.exs +++ b/test/plugs/user_is_admin_plug_test.exs @@ -8,112 +8,30 @@ defmodule Pleroma.Plugs.UserIsAdminPlugTest do alias Pleroma.Plugs.UserIsAdminPlug import Pleroma.Factory - describe "unless [:auth, :enforce_oauth_admin_scope_usage]," do - setup do: clear_config([:auth, :enforce_oauth_admin_scope_usage], false) + test "accepts a user that is an admin" do + user = insert(:user, is_admin: true) - test "accepts a user that is an admin" do - user = insert(:user, is_admin: true) + conn = assign(build_conn(), :user, user) - conn = assign(build_conn(), :user, user) + ret_conn = UserIsAdminPlug.call(conn, %{}) - ret_conn = UserIsAdminPlug.call(conn, %{}) - - assert conn == ret_conn - end - - test "denies a user that isn't an admin" do - user = insert(:user) - - conn = - build_conn() - |> assign(:user, user) - |> UserIsAdminPlug.call(%{}) - - assert conn.status == 403 - end - - test "denies when a user isn't set" do - conn = UserIsAdminPlug.call(build_conn(), %{}) - - assert conn.status == 403 - end + assert conn == ret_conn end - describe "with [:auth, :enforce_oauth_admin_scope_usage]," do - setup do: clear_config([:auth, :enforce_oauth_admin_scope_usage], true) + test "denies a user that isn't an admin" do + user = insert(:user) - setup do - admin_user = insert(:user, is_admin: true) - non_admin_user = insert(:user, is_admin: false) - blank_user = nil + conn = + build_conn() + |> assign(:user, user) + |> UserIsAdminPlug.call(%{}) - {:ok, %{users: [admin_user, non_admin_user, blank_user]}} - end + assert conn.status == 403 + end - test "if token has any of admin scopes, accepts a user that is an admin", %{conn: conn} do - user = insert(:user, is_admin: true) - token = insert(:oauth_token, user: user, scopes: ["admin:something"]) + test "denies when a user isn't set" do + conn = UserIsAdminPlug.call(build_conn(), %{}) - conn = - conn - |> assign(:user, user) - |> assign(:token, token) - - ret_conn = UserIsAdminPlug.call(conn, %{}) - - assert conn == ret_conn - end - - test "if token has any of admin scopes, denies a user that isn't an admin", %{conn: conn} do - user = insert(:user, is_admin: false) - token = insert(:oauth_token, user: user, scopes: ["admin:something"]) - - conn = - conn - |> assign(:user, user) - |> assign(:token, token) - |> UserIsAdminPlug.call(%{}) - - assert conn.status == 403 - end - - test "if token has any of admin scopes, denies when a user isn't set", %{conn: conn} do - token = insert(:oauth_token, scopes: ["admin:something"]) - - conn = - conn - |> assign(:user, nil) - |> assign(:token, token) - |> UserIsAdminPlug.call(%{}) - - assert conn.status == 403 - end - - test "if token lacks admin scopes, denies users regardless of is_admin flag", - %{users: users} do - for user <- users do - token = insert(:oauth_token, user: user) - - conn = - build_conn() - |> assign(:user, user) - |> assign(:token, token) - |> UserIsAdminPlug.call(%{}) - - assert conn.status == 403 - end - end - - test "if token is missing, denies users regardless of is_admin flag", %{users: users} do - for user <- users do - conn = - build_conn() - |> assign(:user, user) - |> assign(:token, nil) - |> UserIsAdminPlug.call(%{}) - - assert conn.status == 403 - end - end + assert conn.status == 403 end end diff --git a/test/pool/connections_test.exs b/test/pool/connections_test.exs deleted file mode 100644 index aeda54875..000000000 --- a/test/pool/connections_test.exs +++ /dev/null @@ -1,760 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Pool.ConnectionsTest do - use ExUnit.Case, async: true - use Pleroma.Tests.Helpers - - import ExUnit.CaptureLog - import Mox - - alias Pleroma.Gun.Conn - alias Pleroma.GunMock - alias Pleroma.Pool.Connections - - setup :verify_on_exit! - - setup_all do - name = :test_connections - {:ok, pid} = Connections.start_link({name, [checkin_timeout: 150]}) - {:ok, _} = Registry.start_link(keys: :unique, name: Pleroma.GunMock) - - on_exit(fn -> - if Process.alive?(pid), do: GenServer.stop(name) - end) - - {:ok, name: name} - end - - defp open_mock(num \\ 1) do - GunMock - |> expect(:open, num, &start_and_register(&1, &2, &3)) - |> expect(:await_up, num, fn _, _ -> {:ok, :http} end) - |> expect(:set_owner, num, fn _, _ -> :ok end) - end - - defp connect_mock(mock) do - mock - |> expect(:connect, &connect(&1, &2)) - |> expect(:await, &await(&1, &2)) - end - - defp info_mock(mock), do: expect(mock, :info, &info(&1)) - - defp start_and_register('gun-not-up.com', _, _), do: {:error, :timeout} - - defp start_and_register(host, port, _) do - {:ok, pid} = Task.start_link(fn -> Process.sleep(1000) end) - - scheme = - case port do - 443 -> "https" - _ -> "http" - end - - Registry.register(GunMock, pid, %{ - origin_scheme: scheme, - origin_host: host, - origin_port: port - }) - - {:ok, pid} - end - - defp info(pid) do - [{_, info}] = Registry.lookup(GunMock, pid) - info - end - - defp connect(pid, _) do - ref = make_ref() - Registry.register(GunMock, ref, pid) - ref - end - - defp await(pid, ref) do - [{_, ^pid}] = Registry.lookup(GunMock, ref) - {:response, :fin, 200, []} - end - - defp now, do: :os.system_time(:second) - - describe "alive?/2" do - test "is alive", %{name: name} do - assert Connections.alive?(name) - end - - test "returns false if not started" do - refute Connections.alive?(:some_random_name) - end - end - - test "opens connection and reuse it on next request", %{name: name} do - open_mock() - url = "http://some-domain.com" - key = "http:some-domain.com:80" - refute Connections.checkin(url, name) - :ok = Conn.open(url, name) - - conn = Connections.checkin(url, name) - assert is_pid(conn) - assert Process.alive?(conn) - - self = self() - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert conn == reused_conn - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}, {^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - - :ok = Connections.checkout(conn, self, name) - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - - :ok = Connections.checkout(conn, self, name) - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [], - conn_state: :idle - } - } - } = Connections.get_state(name) - end - - test "reuse connection for idna domains", %{name: name} do - open_mock() - url = "http://ですsome-domain.com" - refute Connections.checkin(url, name) - - :ok = Conn.open(url, name) - - conn = Connections.checkin(url, name) - assert is_pid(conn) - assert Process.alive?(conn) - - self = self() - - %Connections{ - conns: %{ - "http:ですsome-domain.com:80" => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert conn == reused_conn - end - - test "reuse for ipv4", %{name: name} do - open_mock() - url = "http://127.0.0.1" - - refute Connections.checkin(url, name) - - :ok = Conn.open(url, name) - - conn = Connections.checkin(url, name) - assert is_pid(conn) - assert Process.alive?(conn) - - self = self() - - %Connections{ - conns: %{ - "http:127.0.0.1:80" => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert conn == reused_conn - - :ok = Connections.checkout(conn, self, name) - :ok = Connections.checkout(reused_conn, self, name) - - %Connections{ - conns: %{ - "http:127.0.0.1:80" => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [], - conn_state: :idle - } - } - } = Connections.get_state(name) - end - - test "reuse for ipv6", %{name: name} do - open_mock() - url = "http://[2a03:2880:f10c:83:face:b00c:0:25de]" - - refute Connections.checkin(url, name) - - :ok = Conn.open(url, name) - - conn = Connections.checkin(url, name) - assert is_pid(conn) - assert Process.alive?(conn) - - self = self() - - %Connections{ - conns: %{ - "http:2a03:2880:f10c:83:face:b00c:0:25de:80" => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert conn == reused_conn - end - - test "up and down ipv4", %{name: name} do - open_mock() - |> info_mock() - |> allow(self(), name) - - self = self() - url = "http://127.0.0.1" - :ok = Conn.open(url, name) - conn = Connections.checkin(url, name) - send(name, {:gun_down, conn, nil, nil, nil}) - send(name, {:gun_up, conn, nil}) - - %Connections{ - conns: %{ - "http:127.0.0.1:80" => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - end - - test "up and down ipv6", %{name: name} do - self = self() - - open_mock() - |> info_mock() - |> allow(self, name) - - url = "http://[2a03:2880:f10c:83:face:b00c:0:25de]" - :ok = Conn.open(url, name) - conn = Connections.checkin(url, name) - send(name, {:gun_down, conn, nil, nil, nil}) - send(name, {:gun_up, conn, nil}) - - %Connections{ - conns: %{ - "http:2a03:2880:f10c:83:face:b00c:0:25de:80" => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}], - conn_state: :active - } - } - } = Connections.get_state(name) - end - - test "reuses connection based on protocol", %{name: name} do - open_mock(2) - http_url = "http://some-domain.com" - http_key = "http:some-domain.com:80" - https_url = "https://some-domain.com" - https_key = "https:some-domain.com:443" - - refute Connections.checkin(http_url, name) - :ok = Conn.open(http_url, name) - conn = Connections.checkin(http_url, name) - assert is_pid(conn) - assert Process.alive?(conn) - - refute Connections.checkin(https_url, name) - :ok = Conn.open(https_url, name) - https_conn = Connections.checkin(https_url, name) - - refute conn == https_conn - - reused_https = Connections.checkin(https_url, name) - - refute conn == reused_https - - assert reused_https == https_conn - - %Connections{ - conns: %{ - ^http_key => %Conn{ - conn: ^conn, - gun_state: :up - }, - ^https_key => %Conn{ - conn: ^https_conn, - gun_state: :up - } - } - } = Connections.get_state(name) - end - - test "connection can't get up", %{name: name} do - expect(GunMock, :open, &start_and_register(&1, &2, &3)) - url = "http://gun-not-up.com" - - assert capture_log(fn -> - refute Conn.open(url, name) - refute Connections.checkin(url, name) - end) =~ - "Opening connection to http://gun-not-up.com failed with error {:error, :timeout}" - end - - test "process gun_down message and then gun_up", %{name: name} do - self = self() - - open_mock() - |> info_mock() - |> allow(self, name) - - url = "http://gun-down-and-up.com" - key = "http:gun-down-and-up.com:80" - :ok = Conn.open(url, name) - conn = Connections.checkin(url, name) - - assert is_pid(conn) - assert Process.alive?(conn) - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: ^conn, - gun_state: :up, - used_by: [{^self, _}] - } - } - } = Connections.get_state(name) - - send(name, {:gun_down, conn, :http, nil, nil}) - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: ^conn, - gun_state: :down, - used_by: [{^self, _}] - } - } - } = Connections.get_state(name) - - send(name, {:gun_up, conn, :http}) - - conn2 = Connections.checkin(url, name) - assert conn == conn2 - - assert is_pid(conn2) - assert Process.alive?(conn2) - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: _, - gun_state: :up, - used_by: [{^self, _}, {^self, _}] - } - } - } = Connections.get_state(name) - end - - test "async processes get same conn for same domain", %{name: name} do - open_mock() - url = "http://some-domain.com" - :ok = Conn.open(url, name) - - tasks = - for _ <- 1..5 do - Task.async(fn -> - Connections.checkin(url, name) - end) - end - - tasks_with_results = Task.yield_many(tasks) - - results = - Enum.map(tasks_with_results, fn {task, res} -> - res || Task.shutdown(task, :brutal_kill) - end) - - conns = for {:ok, value} <- results, do: value - - %Connections{ - conns: %{ - "http:some-domain.com:80" => %Conn{ - conn: conn, - gun_state: :up - } - } - } = Connections.get_state(name) - - assert Enum.all?(conns, fn res -> res == conn end) - end - - test "remove frequently used and idle", %{name: name} do - open_mock(3) - self = self() - http_url = "http://some-domain.com" - https_url = "https://some-domain.com" - :ok = Conn.open(https_url, name) - :ok = Conn.open(http_url, name) - - conn1 = Connections.checkin(https_url, name) - - [conn2 | _conns] = - for _ <- 1..4 do - Connections.checkin(http_url, name) - end - - http_key = "http:some-domain.com:80" - - %Connections{ - conns: %{ - ^http_key => %Conn{ - conn: ^conn2, - gun_state: :up, - conn_state: :active, - used_by: [{^self, _}, {^self, _}, {^self, _}, {^self, _}] - }, - "https:some-domain.com:443" => %Conn{ - conn: ^conn1, - gun_state: :up, - conn_state: :active, - used_by: [{^self, _}] - } - } - } = Connections.get_state(name) - - :ok = Connections.checkout(conn1, self, name) - - another_url = "http://another-domain.com" - :ok = Conn.open(another_url, name) - conn = Connections.checkin(another_url, name) - - %Connections{ - conns: %{ - "http:another-domain.com:80" => %Conn{ - conn: ^conn, - gun_state: :up - }, - ^http_key => %Conn{ - conn: _, - gun_state: :up - } - } - } = Connections.get_state(name) - end - - describe "with proxy" do - test "as ip", %{name: name} do - open_mock() - |> connect_mock() - - url = "http://proxy-string.com" - key = "http:proxy-string.com:80" - :ok = Conn.open(url, name, proxy: {{127, 0, 0, 1}, 8123}) - - conn = Connections.checkin(url, name) - - %Connections{ - conns: %{ - ^key => %Conn{ - conn: ^conn, - gun_state: :up - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert reused_conn == conn - end - - test "as host", %{name: name} do - open_mock() - |> connect_mock() - - url = "http://proxy-tuple-atom.com" - :ok = Conn.open(url, name, proxy: {'localhost', 9050}) - conn = Connections.checkin(url, name) - - %Connections{ - conns: %{ - "http:proxy-tuple-atom.com:80" => %Conn{ - conn: ^conn, - gun_state: :up - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert reused_conn == conn - end - - test "as ip and ssl", %{name: name} do - open_mock() - |> connect_mock() - - url = "https://proxy-string.com" - - :ok = Conn.open(url, name, proxy: {{127, 0, 0, 1}, 8123}) - conn = Connections.checkin(url, name) - - %Connections{ - conns: %{ - "https:proxy-string.com:443" => %Conn{ - conn: ^conn, - gun_state: :up - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert reused_conn == conn - end - - test "as host and ssl", %{name: name} do - open_mock() - |> connect_mock() - - url = "https://proxy-tuple-atom.com" - :ok = Conn.open(url, name, proxy: {'localhost', 9050}) - conn = Connections.checkin(url, name) - - %Connections{ - conns: %{ - "https:proxy-tuple-atom.com:443" => %Conn{ - conn: ^conn, - gun_state: :up - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert reused_conn == conn - end - - test "with socks type", %{name: name} do - open_mock() - - url = "http://proxy-socks.com" - - :ok = Conn.open(url, name, proxy: {:socks5, 'localhost', 1234}) - - conn = Connections.checkin(url, name) - - %Connections{ - conns: %{ - "http:proxy-socks.com:80" => %Conn{ - conn: ^conn, - gun_state: :up - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert reused_conn == conn - end - - test "with socks4 type and ssl", %{name: name} do - open_mock() - url = "https://proxy-socks.com" - - :ok = Conn.open(url, name, proxy: {:socks4, 'localhost', 1234}) - - conn = Connections.checkin(url, name) - - %Connections{ - conns: %{ - "https:proxy-socks.com:443" => %Conn{ - conn: ^conn, - gun_state: :up - } - } - } = Connections.get_state(name) - - reused_conn = Connections.checkin(url, name) - - assert reused_conn == conn - end - end - - describe "crf/3" do - setup do - crf = Connections.crf(1, 10, 1) - {:ok, crf: crf} - end - - test "more used will have crf higher", %{crf: crf} do - # used 3 times - crf1 = Connections.crf(1, 10, crf) - crf1 = Connections.crf(1, 10, crf1) - - # used 2 times - crf2 = Connections.crf(1, 10, crf) - - assert crf1 > crf2 - end - - test "recently used will have crf higher on equal references", %{crf: crf} do - # used 3 sec ago - crf1 = Connections.crf(3, 10, crf) - - # used 4 sec ago - crf2 = Connections.crf(4, 10, crf) - - assert crf1 > crf2 - end - - test "equal crf on equal reference and time", %{crf: crf} do - # used 2 times - crf1 = Connections.crf(1, 10, crf) - - # used 2 times - crf2 = Connections.crf(1, 10, crf) - - assert crf1 == crf2 - end - - test "recently used will have higher crf", %{crf: crf} do - crf1 = Connections.crf(2, 10, crf) - crf1 = Connections.crf(1, 10, crf1) - - crf2 = Connections.crf(3, 10, crf) - crf2 = Connections.crf(4, 10, crf2) - assert crf1 > crf2 - end - end - - describe "get_unused_conns/1" do - test "crf is equalent, sorting by reference", %{name: name} do - Connections.add_conn(name, "1", %Conn{ - conn_state: :idle, - last_reference: now() - 1 - }) - - Connections.add_conn(name, "2", %Conn{ - conn_state: :idle, - last_reference: now() - }) - - assert [{"1", _unused_conn} | _others] = Connections.get_unused_conns(name) - end - - test "reference is equalent, sorting by crf", %{name: name} do - Connections.add_conn(name, "1", %Conn{ - conn_state: :idle, - crf: 1.999 - }) - - Connections.add_conn(name, "2", %Conn{ - conn_state: :idle, - crf: 2 - }) - - assert [{"1", _unused_conn} | _others] = Connections.get_unused_conns(name) - end - - test "higher crf and lower reference", %{name: name} do - Connections.add_conn(name, "1", %Conn{ - conn_state: :idle, - crf: 3, - last_reference: now() - 1 - }) - - Connections.add_conn(name, "2", %Conn{ - conn_state: :idle, - crf: 2, - last_reference: now() - }) - - assert [{"2", _unused_conn} | _others] = Connections.get_unused_conns(name) - end - - test "lower crf and lower reference", %{name: name} do - Connections.add_conn(name, "1", %Conn{ - conn_state: :idle, - crf: 1.99, - last_reference: now() - 1 - }) - - Connections.add_conn(name, "2", %Conn{ - conn_state: :idle, - crf: 2, - last_reference: now() - }) - - assert [{"1", _unused_conn} | _others] = Connections.get_unused_conns(name) - end - end - - test "count/1" do - name = :test_count - {:ok, _} = Connections.start_link({name, [checkin_timeout: 150]}) - assert Connections.count(name) == 0 - Connections.add_conn(name, "1", %Conn{conn: self()}) - assert Connections.count(name) == 1 - Connections.remove_conn(name, "1") - assert Connections.count(name) == 0 - end -end diff --git a/test/repo_test.exs b/test/repo_test.exs index daffc6542..92e827c95 100644 --- a/test/repo_test.exs +++ b/test/repo_test.exs @@ -4,9 +4,7 @@ defmodule Pleroma.RepoTest do use Pleroma.DataCase - import ExUnit.CaptureLog import Pleroma.Factory - import Mock alias Pleroma.User @@ -49,36 +47,4 @@ test "return error if has not assoc " do assert Repo.get_assoc(token, :user) == {:error, :not_found} end end - - describe "check_migrations_applied!" do - setup_with_mocks([ - {Ecto.Migrator, [], - [ - with_repo: fn repo, fun -> passthrough([repo, fun]) end, - migrations: fn Pleroma.Repo -> - [ - {:up, 20_191_128_153_944, "fix_missing_following_count"}, - {:up, 20_191_203_043_610, "create_report_notes"}, - {:down, 20_191_220_174_645, "add_scopes_to_pleroma_feo_auth_records"} - ] - end - ]} - ]) do - :ok - end - - setup do: clear_config([:i_am_aware_this_may_cause_data_loss, :disable_migration_check]) - - test "raises if it detects unapplied migrations" do - assert_raise Pleroma.Repo.UnappliedMigrationsError, fn -> - capture_log(&Repo.check_migrations_applied!/0) - end - end - - test "doesn't do anything if disabled" do - Pleroma.Config.put([:i_am_aware_this_may_cause_data_loss, :disable_migration_check], true) - - assert :ok == Repo.check_migrations_applied!() - end - end end diff --git a/test/report_note_test.exs b/test/report_note_test.exs new file mode 100644 index 000000000..25c1d6a61 --- /dev/null +++ b/test/report_note_test.exs @@ -0,0 +1,16 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.ReportNoteTest do + alias Pleroma.ReportNote + use Pleroma.DataCase + import Pleroma.Factory + + test "create/3" do + user = insert(:user) + report = insert(:report_activity) + assert {:ok, note} = ReportNote.create(user.id, report.id, "naughty boy") + assert note.content == "naughty boy" + end +end diff --git a/test/reverse_proxy/reverse_proxy_test.exs b/test/reverse_proxy/reverse_proxy_test.exs index c677066b3..8df63de65 100644 --- a/test/reverse_proxy/reverse_proxy_test.exs +++ b/test/reverse_proxy/reverse_proxy_test.exs @@ -314,7 +314,7 @@ defp disposition_headers_mock(headers) do test "not atachment", %{conn: conn} do disposition_headers_mock([ {"content-type", "image/gif"}, - {"content-length", 0} + {"content-length", "0"} ]) conn = ReverseProxy.call(conn, "/disposition") @@ -325,7 +325,7 @@ test "not atachment", %{conn: conn} do test "with content-disposition header", %{conn: conn} do disposition_headers_mock([ {"content-disposition", "attachment; filename=\"filename.jpg\""}, - {"content-length", 0} + {"content-length", "0"} ]) conn = ReverseProxy.call(conn, "/disposition") diff --git a/test/stats_test.exs b/test/stats_test.exs index 4b76e2e78..74bf785b0 100644 --- a/test/stats_test.exs +++ b/test/stats_test.exs @@ -4,7 +4,10 @@ defmodule Pleroma.StatsTest do use Pleroma.DataCase + import Pleroma.Factory + + alias Pleroma.Stats alias Pleroma.Web.CommonAPI describe "user count" do @@ -13,14 +16,15 @@ test "it ignores internal users" do _internal = insert(:user, local: true, nickname: nil) _internal = Pleroma.Web.ActivityPub.Relay.get_actor() - assert match?(%{stats: %{user_count: 1}}, Pleroma.Stats.calculate_stat_data()) + assert match?(%{stats: %{user_count: 1}}, Stats.calculate_stat_data()) end end - describe "status visibility count" do + describe "status visibility sum count" do test "on new status" do + instance2 = "instance2.tld" user = insert(:user) - other_user = insert(:user) + other_user = insert(:user, %{ap_id: "https://#{instance2}/@actor"}) CommonAPI.post(user, %{visibility: "public", status: "hey"}) @@ -45,24 +49,24 @@ test "on new status" do }) end) - assert %{direct: 3, private: 4, public: 1, unlisted: 2} = - Pleroma.Stats.get_status_visibility_count() + assert %{"direct" => 3, "private" => 4, "public" => 1, "unlisted" => 2} = + Stats.get_status_visibility_count() end test "on status delete" do user = insert(:user) {:ok, activity} = CommonAPI.post(user, %{visibility: "public", status: "hey"}) - assert %{public: 1} = Pleroma.Stats.get_status_visibility_count() + assert %{"public" => 1} = Stats.get_status_visibility_count() CommonAPI.delete(activity.id, user) - assert %{public: 0} = Pleroma.Stats.get_status_visibility_count() + assert %{"public" => 0} = Stats.get_status_visibility_count() end test "on status visibility update" do user = insert(:user) {:ok, activity} = CommonAPI.post(user, %{visibility: "public", status: "hey"}) - assert %{public: 1, private: 0} = Pleroma.Stats.get_status_visibility_count() + assert %{"public" => 1, "private" => 0} = Stats.get_status_visibility_count() {:ok, _} = CommonAPI.update_activity_scope(activity.id, %{visibility: "private"}) - assert %{public: 0, private: 1} = Pleroma.Stats.get_status_visibility_count() + assert %{"public" => 0, "private" => 1} = Stats.get_status_visibility_count() end test "doesn't count unrelated activities" do @@ -73,8 +77,46 @@ test "doesn't count unrelated activities" do CommonAPI.favorite(other_user, activity.id) CommonAPI.repeat(activity.id, other_user) - assert %{direct: 0, private: 0, public: 1, unlisted: 0} = - Pleroma.Stats.get_status_visibility_count() + assert %{"direct" => 0, "private" => 0, "public" => 1, "unlisted" => 0} = + Stats.get_status_visibility_count() + end + end + + describe "status visibility by instance count" do + test "single instance" do + local_instance = Pleroma.Web.Endpoint.url() |> String.split("//") |> Enum.at(1) + instance2 = "instance2.tld" + user1 = insert(:user) + user2 = insert(:user, %{ap_id: "https://#{instance2}/@actor"}) + + CommonAPI.post(user1, %{visibility: "public", status: "hey"}) + + Enum.each(1..5, fn _ -> + CommonAPI.post(user1, %{ + visibility: "unlisted", + status: "hey" + }) + end) + + Enum.each(1..10, fn _ -> + CommonAPI.post(user1, %{ + visibility: "direct", + status: "hey @#{user2.nickname}" + }) + end) + + Enum.each(1..20, fn _ -> + CommonAPI.post(user2, %{ + visibility: "private", + status: "hey" + }) + end) + + assert %{"direct" => 10, "private" => 0, "public" => 1, "unlisted" => 5} = + Stats.get_status_visibility_count(local_instance) + + assert %{"direct" => 0, "private" => 20, "public" => 0, "unlisted" => 0} = + Stats.get_status_visibility_count(instance2) end end end diff --git a/test/support/captcha_mock.ex b/test/support/captcha_mock.ex index 7b0c1d5af..2ed2ba3b4 100644 --- a/test/support/captcha_mock.ex +++ b/test/support/captcha_mock.ex @@ -16,7 +16,8 @@ def new, type: :mock, token: "afa1815e14e29355e6c8f6b143a39fa2", answer_data: @solution, - url: "https://example.org/captcha.png" + url: "https://example.org/captcha.png", + seconds_valid: 300 } @impl Service diff --git a/test/support/cluster.ex b/test/support/cluster.ex index deb37f361..524194cf4 100644 --- a/test/support/cluster.ex +++ b/test/support/cluster.ex @@ -97,7 +97,7 @@ def spawn_cluster(node_configs) do silence_logger_warnings(fn -> node_configs |> Enum.map(&Task.async(fn -> start_slave(&1) end)) - |> Enum.map(&Task.await(&1, 60_000)) + |> Enum.map(&Task.await(&1, 90_000)) end) end diff --git a/test/support/conn_case.ex b/test/support/conn_case.ex index b23918dd1..7ef681258 100644 --- a/test/support/conn_case.ex +++ b/test/support/conn_case.ex @@ -56,6 +56,13 @@ defp request_content_type(%{conn: conn}) do [conn: conn] end + defp empty_json_response(conn) do + body = response(conn, 204) + response_content_type(conn, :json) + + body + end + defp json_response_and_validate_schema( %{ private: %{ @@ -79,7 +86,7 @@ defp json_response_and_validate_schema( end schema = lookup[op_id].responses[status].content[content_type].schema - json = json_response(conn, status) + json = if status == 204, do: empty_json_response(conn), else: json_response(conn, status) case OpenApiSpex.cast_value(json, schema, spec) do {:ok, _data} -> diff --git a/test/support/factory.ex b/test/support/factory.ex index 6e3676aca..2fdfabbc5 100644 --- a/test/support/factory.ex +++ b/test/support/factory.ex @@ -42,7 +42,8 @@ def user_factory do user | ap_id: User.ap_id(user), follower_address: User.ap_followers(user), - following_address: User.ap_following(user) + following_address: User.ap_following(user), + raw_bio: user.bio } end @@ -66,6 +67,7 @@ def note_factory(attrs \\ %{}) do data = %{ "type" => "Note", "content" => text, + "source" => text, "id" => Pleroma.Web.ActivityPub.Utils.generate_object_id(), "actor" => user.ap_id, "to" => ["https://www.w3.org/ns/activitystreams#Public"], @@ -198,25 +200,6 @@ def note_activity_factory(attrs \\ %{}) do |> Map.merge(attrs) end - defp expiration_offset_by_minutes(attrs, minutes) do - scheduled_at = - NaiveDateTime.utc_now() - |> NaiveDateTime.add(:timer.minutes(minutes), :millisecond) - |> NaiveDateTime.truncate(:second) - - %Pleroma.ActivityExpiration{} - |> Map.merge(attrs) - |> Map.put(:scheduled_at, scheduled_at) - end - - def expiration_in_the_past_factory(attrs \\ %{}) do - expiration_offset_by_minutes(attrs, -60) - end - - def expiration_in_the_future_factory(attrs \\ %{}) do - expiration_offset_by_minutes(attrs, 61) - end - def article_activity_factory do article = insert(:article) @@ -295,6 +278,30 @@ def follow_activity_factory do } end + def report_activity_factory(attrs \\ %{}) do + user = attrs[:user] || insert(:user) + activity = attrs[:activity] || insert(:note_activity) + state = attrs[:state] || "open" + + data = %{ + "id" => Pleroma.Web.ActivityPub.Utils.generate_activity_id(), + "actor" => user.ap_id, + "type" => "Flag", + "object" => [activity.actor, activity.data["id"]], + "published" => DateTime.utc_now() |> DateTime.to_iso8601(), + "to" => [], + "cc" => [activity.actor], + "context" => activity.data["context"], + "state" => state + } + + %Pleroma.Activity{ + data: data, + actor: data["actor"], + recipients: data["to"] ++ data["cc"] + } + end + def oauth_app_factory do %Pleroma.Web.OAuth.App{ client_name: sequence(:client_name, &"Some client #{&1}"), @@ -396,24 +403,17 @@ def registration_factory do } end - def config_factory do + def config_factory(attrs \\ %{}) do %Pleroma.ConfigDB{ - key: - sequence(:key, fn key -> - # Atom dynamic registration hack in tests - "some_key_#{key}" - |> String.to_atom() - |> inspect() - end), - group: ":pleroma", + key: sequence(:key, &String.to_atom("some_key_#{&1}")), + group: :pleroma, value: sequence( :value, - fn key -> - :erlang.term_to_binary(%{another_key: "#{key}somevalue", another: "#{key}somevalue"}) - end + &%{another_key: "#{&1}somevalue", another: "#{&1}somevalue"} ) } + |> merge_attributes(attrs) end def marker_factory do @@ -433,4 +433,12 @@ def mfa_token_factory do user: build(:user) } end + + def filter_factory do + %Pleroma.Filter{ + user: build(:user), + filter_id: sequence(:filter_id, & &1), + phrase: "cofe" + } + end end diff --git a/test/support/helpers.ex b/test/support/helpers.ex index 26281b45e..ecd4b1e18 100644 --- a/test/support/helpers.ex +++ b/test/support/helpers.ex @@ -17,9 +17,19 @@ defmacro clear_config(config_path) do defmacro clear_config(config_path, do: yield) do quote do - initial_setting = Config.get(unquote(config_path)) + initial_setting = Config.fetch(unquote(config_path)) unquote(yield) - on_exit(fn -> Config.put(unquote(config_path), initial_setting) end) + + on_exit(fn -> + case initial_setting do + :error -> + Config.delete(unquote(config_path)) + + {:ok, value} -> + Config.put(unquote(config_path), value) + end + end) + :ok end end @@ -32,6 +42,11 @@ defmacro clear_config(config_path, temp_setting) do end end + def require_migration(migration_name) do + [{module, _}] = Code.require_file("#{migration_name}.exs", "priv/repo/migrations") + {:ok, %{migration: module}} + end + defmacro __using__(_opts) do quote do import Pleroma.Tests.Helpers, diff --git a/test/support/http_request_mock.ex b/test/support/http_request_mock.ex index 3d5128835..344e27f13 100644 --- a/test/support/http_request_mock.ex +++ b/test/support/http_request_mock.ex @@ -82,6 +82,14 @@ def get("https://mastodon.sdf.org/users/rinpatch", _, _, _) do }} end + def get("https://patch.cx/objects/tesla_mock/poll_attachment", _, _, _) do + {:ok, + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/poll_attachment.json") + }} + end + def get( "https://mastodon.social/.well-known/webfinger?resource=https://mastodon.social/users/emelie", _, @@ -95,14 +103,6 @@ def get( }} end - def get("https://mastodon.social/users/emelie.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/emelie.atom") - }} - end - def get( "https://osada.macgirvin.com/.well-known/webfinger?resource=acct:mike@osada.macgirvin.com", _, @@ -129,14 +129,6 @@ def get( }} end - def get("https://pawoo.net/users/pekorino.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/https___pawoo.net_users_pekorino.atom") - }} - end - def get( "https://pawoo.net/.well-known/webfinger?resource=acct:https://pawoo.net/users/pekorino", _, @@ -150,19 +142,6 @@ def get( }} end - def get( - "https://social.stopwatchingus-heidelberg.de/api/statuses/user_timeline/18330.atom", - _, - _, - _ - ) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/atarifrosch_feed.xml") - }} - end - def get( "https://social.stopwatchingus-heidelberg.de/.well-known/webfinger?resource=acct:https://social.stopwatchingus-heidelberg.de/user/18330", _, @@ -176,27 +155,6 @@ def get( }} end - def get("https://mamot.fr/users/Skruyb.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/https___mamot.fr_users_Skruyb.atom") - }} - end - - def get( - "https://mamot.fr/.well-known/webfinger?resource=acct:https://mamot.fr/users/Skruyb", - _, - _, - [{"accept", "application/xrd+xml,application/jrd+json"}] - ) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/skruyb@mamot.fr.atom") - }} - end - def get( "https://social.heldscal.la/.well-known/webfinger?resource=nonexistant@social.heldscal.la", _, @@ -308,6 +266,22 @@ def get("https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3" }} end + def get("https://framatube.org/accounts/framasoft", _, _, _) do + {:ok, + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/https___framatube.org_accounts_framasoft.json") + }} + end + + def get("https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206", _, _, _) do + {:ok, + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/framatube.org-video.json") + }} + end + def get("https://peertube.social/accounts/craigmaloney", _, _, _) do {:ok, %Tesla.Env{ @@ -483,19 +457,6 @@ def get("https://mamot.fr/.well-known/host-meta", _, _, _) do }} end - def get( - "https://mamot.fr/.well-known/webfinger?resource=https://mamot.fr/users/Skruyb", - _, - _, - _ - ) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/skruyb@mamot.fr.atom") - }} - end - def get("http://pawoo.net/.well-known/host-meta", _, _, _) do {:ok, %Tesla.Env{ @@ -623,17 +584,6 @@ def get( }} end - def get("https://pleroma.soykaf.com/users/lain/feed.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: - File.read!( - "test/fixtures/tesla_mock/https___pleroma.soykaf.com_users_lain_feed.atom.xml" - ) - }} - end - def get(url, _, _, [{"accept", "application/xrd+xml,application/jrd+json"}]) when url in [ "https://pleroma.soykaf.com/.well-known/webfinger?resource=acct:https://pleroma.soykaf.com/users/lain", @@ -646,17 +596,6 @@ def get(url, _, _, [{"accept", "application/xrd+xml,application/jrd+json"}]) }} end - def get("https://shitposter.club/api/statuses/user_timeline/1.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: - File.read!( - "test/fixtures/tesla_mock/https___shitposter.club_api_statuses_user_timeline_1.atom.xml" - ) - }} - end - def get( "https://shitposter.club/.well-known/webfinger?resource=https://shitposter.club/user/1", _, @@ -670,37 +609,10 @@ def get( }} end - def get("https://shitposter.club/notice/2827873", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/https___shitposter.club_notice_2827873.json") - }} - end - - def get("https://shitposter.club/api/statuses/show/2827873.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: - File.read!( - "test/fixtures/tesla_mock/https___shitposter.club_api_statuses_show_2827873.atom.xml" - ) - }} - end - def get("https://testing.pleroma.lol/objects/b319022a-4946-44c5-9de9-34801f95507b", _, _, _) do {:ok, %Tesla.Env{status: 200}} end - def get("https://shitposter.club/api/statuses/user_timeline/5381.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/spc_5381.atom") - }} - end - def get( "https://shitposter.club/.well-known/webfinger?resource=https://shitposter.club/user/5381", _, @@ -722,14 +634,6 @@ def get("http://shitposter.club/.well-known/host-meta", _, _, _) do }} end - def get("https://shitposter.club/api/statuses/show/7369654.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/7369654.atom") - }} - end - def get("https://shitposter.club/notice/4027863", _, _, _) do {:ok, %Tesla.Env{ @@ -738,14 +642,6 @@ def get("https://shitposter.club/notice/4027863", _, _, _) do }} end - def get("https://social.sakamoto.gq/users/eal/feed.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: File.read!("test/fixtures/tesla_mock/sakamoto_eal_feed.atom") - }} - end - def get("http://social.sakamoto.gq/.well-known/host-meta", _, _, _) do {:ok, %Tesla.Env{ @@ -767,15 +663,6 @@ def get( }} end - def get( - "https://social.sakamoto.gq/objects/0ccc1a2c-66b0-4305-b23a-7f7f2b040056", - _, - _, - [{"accept", "application/atom+xml"}] - ) do - {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/sakamoto.atom")}} - end - def get("http://mastodon.social/.well-known/host-meta", _, _, _) do {:ok, %Tesla.Env{ @@ -829,28 +716,6 @@ def get( {:ok, %Tesla.Env{status: 406, body: ""}} end - def get("http://gs.example.org/index.php/api/statuses/user_timeline/1.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: - File.read!( - "test/fixtures/tesla_mock/http__gs.example.org_index.php_api_statuses_user_timeline_1.atom.xml" - ) - }} - end - - def get("https://social.heldscal.la/api/statuses/user_timeline/29191.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: - File.read!( - "test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_29191.atom.xml" - ) - }} - end - def get("http://squeet.me/.well-known/host-meta", _, _, _) do {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/squeet.me_host_meta")}} @@ -972,17 +837,6 @@ def get( }} end - def get("https://social.heldscal.la/api/statuses/user_timeline/23211.atom", _, _, _) do - {:ok, - %Tesla.Env{ - status: 200, - body: - File.read!( - "test/fixtures/tesla_mock/https___social.heldscal.la_api_statuses_user_timeline_23211.atom.xml" - ) - }} - end - def get( "https://social.heldscal.la/.well-known/webfinger?resource=https://social.heldscal.la/user/23211", _, @@ -1012,10 +866,6 @@ def get("https://social.heldscal.la/.well-known/host-meta", _, _, _) do }} end - def get("https://mastodon.social/users/lambadalambda.atom", _, _, _) do - {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/lambadalambda.atom")}} - end - def get("https://mastodon.social/users/lambadalambda", _, _, _) do {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/lambadalambda.json")}} end @@ -1326,6 +1176,18 @@ def get("https://relay.mastodon.host/actor", _, _, _) do {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/relay/relay.json")}} end + def get("http://localhost:4001/", _, "", [{"accept", "text/html"}]) do + {:ok, %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/7369654.html")}} + end + + def get("https://osada.macgirvin.com/", _, "", [{"accept", "text/html"}]) do + {:ok, + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/https___osada.macgirvin.com.html") + }} + end + def get(url, query, body, headers) do {:error, "Mock response not implemented for GET #{inspect(url)}, #{query}, #{inspect(body)}, #{ diff --git a/test/support/oban_helpers.ex b/test/support/oban_helpers.ex index e96994c57..9f90a821c 100644 --- a/test/support/oban_helpers.ex +++ b/test/support/oban_helpers.ex @@ -20,7 +20,7 @@ def perform_all do end def perform(%Oban.Job{} = job) do - res = apply(String.to_existing_atom("Elixir." <> job.worker), :perform, [job.args, job]) + res = apply(String.to_existing_atom("Elixir." <> job.worker), :perform, [job]) Repo.delete(job) res end diff --git a/test/tasks/app_test.exs b/test/tasks/app_test.exs index b8f03566d..71a84ac8e 100644 --- a/test/tasks/app_test.exs +++ b/test/tasks/app_test.exs @@ -50,13 +50,13 @@ test "with errors" do defp assert_app(name, redirect, scopes) do app = Repo.get_by(Pleroma.Web.OAuth.App, client_name: name) - assert_received {:mix_shell, :info, [message]} + assert_receive {:mix_shell, :info, [message]} assert message == "#{name} successfully created:" - assert_received {:mix_shell, :info, [message]} + assert_receive {:mix_shell, :info, [message]} assert message == "App client_id: #{app.client_id}" - assert_received {:mix_shell, :info, [message]} + assert_receive {:mix_shell, :info, [message]} assert message == "App client_secret: #{app.client_secret}" assert app.scopes == scopes diff --git a/test/tasks/config_test.exs b/test/tasks/config_test.exs index 04bc947a9..fb12e7fb3 100644 --- a/test/tasks/config_test.exs +++ b/test/tasks/config_test.exs @@ -5,6 +5,8 @@ defmodule Mix.Tasks.Pleroma.ConfigTest do use Pleroma.DataCase + import Pleroma.Factory + alias Pleroma.ConfigDB alias Pleroma.Repo @@ -48,25 +50,21 @@ test "filtered settings are migrated to db" do config3 = ConfigDB.get_by_params(%{group: ":quack", key: ":level"}) refute ConfigDB.get_by_params(%{group: ":pleroma", key: "Pleroma.Repo"}) refute ConfigDB.get_by_params(%{group: ":postgrex", key: ":json_library"}) + refute ConfigDB.get_by_params(%{group: ":pleroma", key: ":database"}) - assert ConfigDB.from_binary(config1.value) == [key: "value", key2: [Repo]] - assert ConfigDB.from_binary(config2.value) == [key: "value2", key2: ["Activity"]] - assert ConfigDB.from_binary(config3.value) == :info + assert config1.value == [key: "value", key2: [Repo]] + assert config2.value == [key: "value2", key2: ["Activity"]] + assert config3.value == :info end test "config table is truncated before migration" do - ConfigDB.create(%{ - group: ":pleroma", - key: ":first_setting", - value: [key: "value", key2: ["Activity"]] - }) - + insert(:config, key: :first_setting, value: [key: "value", key2: ["Activity"]]) assert Repo.aggregate(ConfigDB, :count, :id) == 1 Mix.Tasks.Pleroma.Config.migrate_to_db("test/fixtures/config/temp.secret.exs") config = ConfigDB.get_by_params(%{group: ":pleroma", key: ":first_setting"}) - assert ConfigDB.from_binary(config.value) == [key: "value", key2: [Repo]] + assert config.value == [key: "value", key2: [Repo]] end end @@ -82,19 +80,9 @@ test "config table is truncated before migration" do end test "settings are migrated to file and deleted from db", %{temp_file: temp_file} do - ConfigDB.create(%{ - group: ":pleroma", - key: ":setting_first", - value: [key: "value", key2: ["Activity"]] - }) - - ConfigDB.create(%{ - group: ":pleroma", - key: ":setting_second", - value: [key: "value2", key2: [Repo]] - }) - - ConfigDB.create(%{group: ":quack", key: ":level", value: :info}) + insert(:config, key: :setting_first, value: [key: "value", key2: ["Activity"]]) + insert(:config, key: :setting_second, value: [key: "value2", key2: [Repo]]) + insert(:config, group: :quack, key: :level, value: :info) Mix.Tasks.Pleroma.Config.run(["migrate_from_db", "--env", "temp", "-d"]) @@ -107,9 +95,8 @@ test "settings are migrated to file and deleted from db", %{temp_file: temp_file end test "load a settings with large values and pass to file", %{temp_file: temp_file} do - ConfigDB.create(%{ - group: ":pleroma", - key: ":instance", + insert(:config, + key: :instance, value: [ name: "Pleroma", email: "example@example.com", @@ -134,19 +121,14 @@ test "load a settings with large values and pass to file", %{temp_file: temp_fil federation_reachability_timeout_days: 7, federation_publisher_modules: [Pleroma.Web.ActivityPub.Publisher], allow_relay: true, - rewrite_policy: Pleroma.Web.ActivityPub.MRF.NoOpPolicy, public: true, quarantined_instances: [], managed_config: true, static_dir: "instance/static/", allowed_post_formats: ["text/plain", "text/html", "text/markdown", "text/bbcode"], - mrf_transparency: true, - mrf_transparency_exclusions: [], autofollowed_nicknames: [], max_pinned_statuses: 1, attachment_links: false, - welcome_user_nickname: nil, - welcome_message: nil, max_report_comment_size: 1000, safe_dm_mentions: false, healthcheck: false, @@ -163,7 +145,6 @@ test "load a settings with large values and pass to file", %{temp_file: temp_fil extended_nickname_format: true, multi_factor_authentication: [ totp: [ - # digits 6 or 8 digits: 6, period: 30 ], @@ -173,7 +154,7 @@ test "load a settings with large values and pass to file", %{temp_file: temp_fil ] ] ] - }) + ) Mix.Tasks.Pleroma.Config.run(["migrate_from_db", "--env", "temp", "-d"]) @@ -189,7 +170,7 @@ test "load a settings with large values and pass to file", %{temp_file: temp_fil end assert file == - "#{header}\n\nconfig :pleroma, :instance,\n name: \"Pleroma\",\n email: \"example@example.com\",\n notify_email: \"noreply@example.com\",\n description: \"A Pleroma instance, an alternative fediverse server\",\n limit: 5000,\n chat_limit: 5000,\n remote_limit: 100_000,\n upload_limit: 16_000_000,\n avatar_upload_limit: 2_000_000,\n background_upload_limit: 4_000_000,\n banner_upload_limit: 4_000_000,\n poll_limits: %{\n max_expiration: 31_536_000,\n max_option_chars: 200,\n max_options: 20,\n min_expiration: 0\n },\n registrations_open: true,\n federating: true,\n federation_incoming_replies_max_depth: 100,\n federation_reachability_timeout_days: 7,\n federation_publisher_modules: [Pleroma.Web.ActivityPub.Publisher],\n allow_relay: true,\n rewrite_policy: Pleroma.Web.ActivityPub.MRF.NoOpPolicy,\n public: true,\n quarantined_instances: [],\n managed_config: true,\n static_dir: \"instance/static/\",\n allowed_post_formats: [\"text/plain\", \"text/html\", \"text/markdown\", \"text/bbcode\"],\n mrf_transparency: true,\n mrf_transparency_exclusions: [],\n autofollowed_nicknames: [],\n max_pinned_statuses: 1,\n attachment_links: false,\n welcome_user_nickname: nil,\n welcome_message: nil,\n max_report_comment_size: 1000,\n safe_dm_mentions: false,\n healthcheck: false,\n remote_post_retention_days: 90,\n skip_thread_containment: true,\n limit_to_local_content: :unauthenticated,\n user_bio_length: 5000,\n user_name_length: 100,\n max_account_fields: 10,\n max_remote_account_fields: 20,\n account_field_name_length: 512,\n account_field_value_length: 2048,\n external_user_synchronization: true,\n extended_nickname_format: true,\n multi_factor_authentication: [\n totp: [digits: 6, period: 30],\n backup_codes: [number: 2, length: 6]\n ]\n" + "#{header}\n\nconfig :pleroma, :instance,\n name: \"Pleroma\",\n email: \"example@example.com\",\n notify_email: \"noreply@example.com\",\n description: \"A Pleroma instance, an alternative fediverse server\",\n limit: 5000,\n chat_limit: 5000,\n remote_limit: 100_000,\n upload_limit: 16_000_000,\n avatar_upload_limit: 2_000_000,\n background_upload_limit: 4_000_000,\n banner_upload_limit: 4_000_000,\n poll_limits: %{\n max_expiration: 31_536_000,\n max_option_chars: 200,\n max_options: 20,\n min_expiration: 0\n },\n registrations_open: true,\n federating: true,\n federation_incoming_replies_max_depth: 100,\n federation_reachability_timeout_days: 7,\n federation_publisher_modules: [Pleroma.Web.ActivityPub.Publisher],\n allow_relay: true,\n public: true,\n quarantined_instances: [],\n managed_config: true,\n static_dir: \"instance/static/\",\n allowed_post_formats: [\"text/plain\", \"text/html\", \"text/markdown\", \"text/bbcode\"],\n autofollowed_nicknames: [],\n max_pinned_statuses: 1,\n attachment_links: false,\n max_report_comment_size: 1000,\n safe_dm_mentions: false,\n healthcheck: false,\n remote_post_retention_days: 90,\n skip_thread_containment: true,\n limit_to_local_content: :unauthenticated,\n user_bio_length: 5000,\n user_name_length: 100,\n max_account_fields: 10,\n max_remote_account_fields: 20,\n account_field_name_length: 512,\n account_field_value_length: 2048,\n external_user_synchronization: true,\n extended_nickname_format: true,\n multi_factor_authentication: [\n totp: [digits: 6, period: 30],\n backup_codes: [number: 2, length: 6]\n ]\n" end end end diff --git a/test/tasks/database_test.exs b/test/tasks/database_test.exs index 883828d77..292a5ef5f 100644 --- a/test/tasks/database_test.exs +++ b/test/tasks/database_test.exs @@ -3,14 +3,15 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Mix.Tasks.Pleroma.DatabaseTest do + use Pleroma.DataCase + use Oban.Testing, repo: Pleroma.Repo + alias Pleroma.Activity alias Pleroma.Object alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web.CommonAPI - use Pleroma.DataCase - import Pleroma.Factory setup_all do @@ -127,4 +128,48 @@ test "it turns OrderedCollection likes into empty arrays" do assert Enum.empty?(Object.get_by_id(object2.id).data["likes"]) end end + + describe "ensure_expiration" do + test "it adds to expiration old statuses" do + activity1 = insert(:note_activity) + + {:ok, inserted_at, 0} = DateTime.from_iso8601("2015-01-23T23:50:07Z") + activity2 = insert(:note_activity, %{inserted_at: inserted_at}) + + %{id: activity_id3} = insert(:note_activity) + + expires_at = DateTime.add(DateTime.utc_now(), 60 * 61) + + Pleroma.Workers.PurgeExpiredActivity.enqueue(%{ + activity_id: activity_id3, + expires_at: expires_at + }) + + Mix.Tasks.Pleroma.Database.run(["ensure_expiration"]) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: activity1.id}, + scheduled_at: + activity1.inserted_at + |> DateTime.from_naive!("Etc/UTC") + |> Timex.shift(days: 365) + ) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: activity2.id}, + scheduled_at: + activity2.inserted_at + |> DateTime.from_naive!("Etc/UTC") + |> Timex.shift(days: 365) + ) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: activity_id3}, + scheduled_at: expires_at + ) + end + end end diff --git a/test/tasks/digest_test.exs b/test/tasks/digest_test.exs index eefbc8936..0b444c86d 100644 --- a/test/tasks/digest_test.exs +++ b/test/tasks/digest_test.exs @@ -17,6 +17,8 @@ defmodule Mix.Tasks.Pleroma.DigestTest do :ok end + setup do: clear_config([Pleroma.Emails.Mailer, :enabled], true) + describe "pleroma.digest test" do test "Sends digest to the given user" do user1 = insert(:user) diff --git a/test/tasks/email_test.exs b/test/tasks/email_test.exs index 944c07064..c3af7ef68 100644 --- a/test/tasks/email_test.exs +++ b/test/tasks/email_test.exs @@ -16,6 +16,8 @@ defmodule Mix.Tasks.Pleroma.EmailTest do :ok end + setup do: clear_config([Pleroma.Emails.Mailer, :enabled], true) + describe "pleroma.email test" do test "Sends test email with no given address" do mail_to = Config.get([:instance, :email]) diff --git a/test/tasks/frontend_test.exs b/test/tasks/frontend_test.exs new file mode 100644 index 000000000..022ae51be --- /dev/null +++ b/test/tasks/frontend_test.exs @@ -0,0 +1,85 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.FrontendTest do + use Pleroma.DataCase + alias Mix.Tasks.Pleroma.Frontend + + import ExUnit.CaptureIO, only: [capture_io: 1] + + @dir "test/frontend_static_test" + + setup do + File.mkdir_p!(@dir) + clear_config([:instance, :static_dir], @dir) + + on_exit(fn -> + File.rm_rf(@dir) + end) + end + + test "it downloads and unzips a known frontend" do + clear_config([:frontends, :available], %{ + "pleroma" => %{ + "ref" => "fantasy", + "name" => "pleroma", + "build_url" => "http://gensokyo.2hu/builds/${ref}" + } + }) + + Tesla.Mock.mock(fn %{url: "http://gensokyo.2hu/builds/fantasy"} -> + %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/frontend_dist.zip")} + end) + + capture_io(fn -> + Frontend.run(["install", "pleroma"]) + end) + + assert File.exists?(Path.join([@dir, "frontends", "pleroma", "fantasy", "test.txt"])) + end + + test "it also works given a file" do + clear_config([:frontends, :available], %{ + "pleroma" => %{ + "ref" => "fantasy", + "name" => "pleroma", + "build_dir" => "" + } + }) + + folder = Path.join([@dir, "frontends", "pleroma", "fantasy"]) + previously_existing = Path.join([folder, "temp"]) + File.mkdir_p!(folder) + File.write!(previously_existing, "yey") + assert File.exists?(previously_existing) + + capture_io(fn -> + Frontend.run(["install", "pleroma", "--file", "test/fixtures/tesla_mock/frontend.zip"]) + end) + + assert File.exists?(Path.join([folder, "test.txt"])) + refute File.exists?(previously_existing) + end + + test "it downloads and unzips unknown frontends" do + Tesla.Mock.mock(fn %{url: "http://gensokyo.2hu/madeup.zip"} -> + %Tesla.Env{status: 200, body: File.read!("test/fixtures/tesla_mock/frontend.zip")} + end) + + capture_io(fn -> + Frontend.run([ + "install", + "unknown", + "--ref", + "baka", + "--build-url", + "http://gensokyo.2hu/madeup.zip", + "--build-dir", + "" + ]) + end) + + assert File.exists?(Path.join([@dir, "frontends", "unknown", "baka", "test.txt"])) + end +end diff --git a/test/tasks/refresh_counter_cache_test.exs b/test/tasks/refresh_counter_cache_test.exs index 851971a77..6a1a9ac17 100644 --- a/test/tasks/refresh_counter_cache_test.exs +++ b/test/tasks/refresh_counter_cache_test.exs @@ -37,7 +37,7 @@ test "counts statuses" do assert capture_io(fn -> Mix.Tasks.Pleroma.RefreshCounterCache.run([]) end) =~ "Done\n" - assert %{direct: 3, private: 4, public: 1, unlisted: 2} = + assert %{"direct" => 3, "private" => 4, "public" => 1, "unlisted" => 2} = Pleroma.Stats.get_status_visibility_count() end end diff --git a/test/tasks/relay_test.exs b/test/tasks/relay_test.exs index a8ba0658d..e5225b64c 100644 --- a/test/tasks/relay_test.exs +++ b/test/tasks/relay_test.exs @@ -10,6 +10,8 @@ defmodule Mix.Tasks.Pleroma.RelayTest do alias Pleroma.Web.ActivityPub.Utils use Pleroma.DataCase + import Pleroma.Factory + setup_all do Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) @@ -40,13 +42,18 @@ test "relay is followed" do assert activity.data["object"] == target_user.ap_id :ok = Mix.Tasks.Pleroma.Relay.run(["list"]) - assert_receive {:mix_shell, :info, ["mastodon.example.org (no Accept received)"]} + + assert_receive {:mix_shell, :info, + [ + "http://mastodon.example.org/users/admin - no Accept received (relay didn't follow back)" + ]} end end describe "running unfollow" do test "relay is unfollowed" do - target_instance = "http://mastodon.example.org/users/admin" + user = insert(:user) + target_instance = user.ap_id Mix.Tasks.Pleroma.Relay.run(["follow", target_instance]) @@ -71,7 +78,7 @@ test "relay is unfollowed" do assert undo_activity.data["type"] == "Undo" assert undo_activity.data["actor"] == local_user.ap_id - assert undo_activity.data["object"] == cancelled_activity.data + assert undo_activity.data["object"]["id"] == cancelled_activity.data["id"] refute "#{target_instance}/followers" in User.following(local_user) end end @@ -92,8 +99,8 @@ test "Prints relay subscription list" do :ok = Mix.Tasks.Pleroma.Relay.run(["list"]) - assert_receive {:mix_shell, :info, ["mstdn.io"]} - assert_receive {:mix_shell, :info, ["mastodon.example.org"]} + assert_receive {:mix_shell, :info, ["https://mstdn.io/users/mayuutann"]} + assert_receive {:mix_shell, :info, ["http://mastodon.example.org/users/admin"]} end end end diff --git a/test/tasks/user_test.exs b/test/tasks/user_test.exs index 9220d23fc..ce43a9cc7 100644 --- a/test/tasks/user_test.exs +++ b/test/tasks/user_test.exs @@ -110,7 +110,23 @@ test "user is deleted" do test "a remote user's create activity is deleted when the object has been pruned" do user = insert(:user) + user2 = insert(:user) + {:ok, post} = CommonAPI.post(user, %{status: "uguu"}) + {:ok, post2} = CommonAPI.post(user2, %{status: "test"}) + obj = Object.normalize(post2) + + {:ok, like_object, meta} = Pleroma.Web.ActivityPub.Builder.like(user, obj) + + {:ok, like_activity, _meta} = + Pleroma.Web.ActivityPub.Pipeline.common_pipeline( + like_object, + Keyword.put(meta, :local, true) + ) + + like_activity.data["object"] + |> Pleroma.Object.get_by_ap_id() + |> Repo.delete() clear_config([:instance, :federating], true) @@ -127,6 +143,7 @@ test "a remote user's create activity is deleted when the object has been pruned assert %{deactivated: true} = User.get_by_nickname(user.nickname) assert called(Pleroma.Web.Federator.publish(:_)) + refute Pleroma.Repo.get(Pleroma.Activity, like_activity.id) end refute Activity.get_by_id(post.id) @@ -464,17 +481,17 @@ test "it returns users matching" do moot = insert(:user, nickname: "moot") kawen = insert(:user, nickname: "kawen", name: "fediverse expert moon") - {:ok, user} = User.follow(user, kawen) + {:ok, user} = User.follow(user, moon) assert [moon.id, kawen.id] == User.Search.search("moon") |> Enum.map(& &1.id) - res = User.search("moo") |> Enum.map(& &1.id) - assert moon.id in res - assert moot.id in res - assert kawen.id in res - assert [moon.id, kawen.id] == User.Search.search("moon fediverse") |> Enum.map(& &1.id) - assert [kawen.id, moon.id] == - User.Search.search("moon fediverse", for_user: user) |> Enum.map(& &1.id) + res = User.search("moo") |> Enum.map(& &1.id) + assert Enum.sort([moon.id, moot.id, kawen.id]) == Enum.sort(res) + + assert [kawen.id, moon.id] == User.Search.search("expert fediverse") |> Enum.map(& &1.id) + + assert [moon.id, kawen.id] == + User.Search.search("expert fediverse", for_user: user) |> Enum.map(& &1.id) end end diff --git a/test/upload/filter/anonymize_filename_test.exs b/test/upload/filter/anonymize_filename_test.exs index 2d5c580f1..19b915cc8 100644 --- a/test/upload/filter/anonymize_filename_test.exs +++ b/test/upload/filter/anonymize_filename_test.exs @@ -9,6 +9,8 @@ defmodule Pleroma.Upload.Filter.AnonymizeFilenameTest do alias Pleroma.Upload setup do + File.cp!("test/fixtures/image.jpg", "test/fixtures/image_tmp.jpg") + upload_file = %Upload{ name: "an… image.jpg", content_type: "image/jpg", @@ -22,18 +24,18 @@ defmodule Pleroma.Upload.Filter.AnonymizeFilenameTest do test "it replaces filename on pre-defined text", %{upload_file: upload_file} do Config.put([Upload.Filter.AnonymizeFilename, :text], "custom-file.png") - {:ok, %Upload{name: name}} = Upload.Filter.AnonymizeFilename.filter(upload_file) + {:ok, :filtered, %Upload{name: name}} = Upload.Filter.AnonymizeFilename.filter(upload_file) assert name == "custom-file.png" end test "it replaces filename on pre-defined text expression", %{upload_file: upload_file} do Config.put([Upload.Filter.AnonymizeFilename, :text], "custom-file.{extension}") - {:ok, %Upload{name: name}} = Upload.Filter.AnonymizeFilename.filter(upload_file) + {:ok, :filtered, %Upload{name: name}} = Upload.Filter.AnonymizeFilename.filter(upload_file) assert name == "custom-file.jpg" end test "it replaces filename on random text", %{upload_file: upload_file} do - {:ok, %Upload{name: name}} = Upload.Filter.AnonymizeFilename.filter(upload_file) + {:ok, :filtered, %Upload{name: name}} = Upload.Filter.AnonymizeFilename.filter(upload_file) assert <<_::bytes-size(14)>> <> ".jpg" = name refute name == "an… image.jpg" end diff --git a/test/upload/filter/dedupe_test.exs b/test/upload/filter/dedupe_test.exs index 966c353f7..75c7198e1 100644 --- a/test/upload/filter/dedupe_test.exs +++ b/test/upload/filter/dedupe_test.exs @@ -25,6 +25,7 @@ test "adds shasum" do assert { :ok, + :filtered, %Pleroma.Upload{id: @shasum, path: @shasum <> ".jpg"} } = Dedupe.filter(upload) end diff --git a/test/upload/filter/exiftool_test.exs b/test/upload/filter/exiftool_test.exs new file mode 100644 index 000000000..d4cd4ba11 --- /dev/null +++ b/test/upload/filter/exiftool_test.exs @@ -0,0 +1,42 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Upload.Filter.ExiftoolTest do + use Pleroma.DataCase + alias Pleroma.Upload.Filter + + test "apply exiftool filter" do + assert Pleroma.Utils.command_available?("exiftool") + + File.cp!( + "test/fixtures/DSCN0010.jpg", + "test/fixtures/DSCN0010_tmp.jpg" + ) + + upload = %Pleroma.Upload{ + name: "image_with_GPS_data.jpg", + content_type: "image/jpg", + path: Path.absname("test/fixtures/DSCN0010.jpg"), + tempfile: Path.absname("test/fixtures/DSCN0010_tmp.jpg") + } + + assert Filter.Exiftool.filter(upload) == {:ok, :filtered} + + {exif_original, 0} = System.cmd("exiftool", ["test/fixtures/DSCN0010.jpg"]) + {exif_filtered, 0} = System.cmd("exiftool", ["test/fixtures/DSCN0010_tmp.jpg"]) + + refute exif_original == exif_filtered + assert String.match?(exif_original, ~r/GPS/) + refute String.match?(exif_filtered, ~r/GPS/) + end + + test "verify webp files are skipped" do + upload = %Pleroma.Upload{ + name: "sample.webp", + content_type: "image/webp" + } + + assert Filter.Exiftool.filter(upload) == {:ok, :noop} + end +end diff --git a/test/upload/filter/mogrifun_test.exs b/test/upload/filter/mogrifun_test.exs index 2426a8496..dc1e9e78f 100644 --- a/test/upload/filter/mogrifun_test.exs +++ b/test/upload/filter/mogrifun_test.exs @@ -36,7 +36,7 @@ test "apply mogrify filter" do save: fn _f, _o -> :ok end ]} ]) do - assert Filter.Mogrifun.filter(upload) == :ok + assert Filter.Mogrifun.filter(upload) == {:ok, :filtered} end Task.await(task) diff --git a/test/upload/filter/mogrify_test.exs b/test/upload/filter/mogrify_test.exs index b6a463e8c..bf64b96b3 100644 --- a/test/upload/filter/mogrify_test.exs +++ b/test/upload/filter/mogrify_test.exs @@ -6,21 +6,17 @@ defmodule Pleroma.Upload.Filter.MogrifyTest do use Pleroma.DataCase import Mock - alias Pleroma.Config - alias Pleroma.Upload alias Pleroma.Upload.Filter - setup do: clear_config([Filter.Mogrify, :args]) - test "apply mogrify filter" do - Config.put([Filter.Mogrify, :args], [{"tint", "40"}]) + clear_config(Filter.Mogrify, args: [{"tint", "40"}]) File.cp!( "test/fixtures/image.jpg", "test/fixtures/image_tmp.jpg" ) - upload = %Upload{ + upload = %Pleroma.Upload{ name: "an… image.jpg", content_type: "image/jpg", path: Path.absname("test/fixtures/image_tmp.jpg"), @@ -37,7 +33,7 @@ test "apply mogrify filter" do custom: fn _m, _a -> :ok end, custom: fn m, a, o -> send(task.pid, {:apply_filter, {m, a, o}}) end, save: fn _f, _o -> :ok end do - assert Filter.Mogrify.filter(upload) == :ok + assert Filter.Mogrify.filter(upload) == {:ok, :filtered} end Task.await(task) diff --git a/test/upload_test.exs b/test/upload_test.exs index c7ad177d9..4280bfcac 100644 --- a/test/upload_test.exs +++ b/test/upload_test.exs @@ -107,6 +107,19 @@ test "it returns error" do describe "Storing a file with the Local uploader" do setup [:ensure_local_uploader] + test "does not allow descriptions longer than the post limit" do + clear_config([:instance, :description_limit], 2) + File.cp!("test/fixtures/image.jpg", "test/fixtures/image_tmp.jpg") + + file = %Plug.Upload{ + content_type: "image/jpg", + path: Path.absname("test/fixtures/image_tmp.jpg"), + filename: "image.jpg" + } + + {:error, :description_too_long} = Upload.store(file, description: "123") + end + test "returns a media url" do File.cp!("test/fixtures/image.jpg", "test/fixtures/image_tmp.jpg") diff --git a/test/uploaders/local_test.exs b/test/uploaders/local_test.exs index ae2cfef94..18122ff6c 100644 --- a/test/uploaders/local_test.exs +++ b/test/uploaders/local_test.exs @@ -14,6 +14,7 @@ test "it returns path to local folder for files" do describe "put_file/1" do test "put file to local folder" do + File.cp!("test/fixtures/image.jpg", "test/fixtures/image_tmp.jpg") file_path = "local_upload/files/image.jpg" file = %Pleroma.Upload{ @@ -32,6 +33,7 @@ test "put file to local folder" do describe "delete_file/1" do test "deletes local file" do + File.cp!("test/fixtures/image.jpg", "test/fixtures/image_tmp.jpg") file_path = "local_upload/files/image.jpg" file = %Pleroma.Upload{ diff --git a/test/user/notification_setting_test.exs b/test/user/notification_setting_test.exs index 95bca22c4..308da216a 100644 --- a/test/user/notification_setting_test.exs +++ b/test/user/notification_setting_test.exs @@ -8,11 +8,11 @@ defmodule Pleroma.User.NotificationSettingTest do alias Pleroma.User.NotificationSetting describe "changeset/2" do - test "sets valid privacy option" do + test "sets option to hide notification contents" do changeset = NotificationSetting.changeset( %NotificationSetting{}, - %{"privacy_option" => true} + %{"hide_notification_contents" => true} ) assert %Ecto.Changeset{valid?: true} = changeset diff --git a/test/user/welcome_chat_massage_test.exs b/test/user/welcome_chat_massage_test.exs new file mode 100644 index 000000000..fe26d6e4d --- /dev/null +++ b/test/user/welcome_chat_massage_test.exs @@ -0,0 +1,35 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.User.WelcomeChatMessageTest do + use Pleroma.DataCase + + alias Pleroma.Config + alias Pleroma.User.WelcomeChatMessage + + import Pleroma.Factory + + setup do: clear_config([:welcome]) + + describe "post_message/1" do + test "send a chat welcome message" do + welcome_user = insert(:user, name: "mewmew") + user = insert(:user) + + Config.put([:welcome, :chat_message, :enabled], true) + Config.put([:welcome, :chat_message, :sender_nickname], welcome_user.nickname) + + Config.put( + [:welcome, :chat_message, :message], + "Hello, welcome to Blob/Cat!" + ) + + {:ok, %Pleroma.Activity{} = activity} = WelcomeChatMessage.post_message(user) + + assert user.ap_id in activity.recipients + assert Pleroma.Object.normalize(activity).data["type"] == "ChatMessage" + assert Pleroma.Object.normalize(activity).data["content"] == "Hello, welcome to Blob/Cat!" + end + end +end diff --git a/test/user/welcome_email_test.exs b/test/user/welcome_email_test.exs new file mode 100644 index 000000000..d005d11b2 --- /dev/null +++ b/test/user/welcome_email_test.exs @@ -0,0 +1,61 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.User.WelcomeEmailTest do + use Pleroma.DataCase + + alias Pleroma.Config + alias Pleroma.Tests.ObanHelpers + alias Pleroma.User.WelcomeEmail + + import Pleroma.Factory + import Swoosh.TestAssertions + + setup do: clear_config([:welcome]) + + describe "send_email/1" do + test "send a welcome email" do + user = insert(:user, name: "Jimm") + + Config.put([:welcome, :email, :enabled], true) + Config.put([:welcome, :email, :sender], "welcome@pleroma.app") + + Config.put( + [:welcome, :email, :subject], + "Hello, welcome to pleroma: <%= instance_name %>" + ) + + Config.put( + [:welcome, :email, :html], + "

Hello <%= user.name %>.

Welcome to <%= instance_name %>

" + ) + + instance_name = Config.get([:instance, :name]) + + {:ok, _job} = WelcomeEmail.send_email(user) + + ObanHelpers.perform_all() + + assert_email_sent( + from: {instance_name, "welcome@pleroma.app"}, + to: {user.name, user.email}, + subject: "Hello, welcome to pleroma: #{instance_name}", + html_body: "

Hello #{user.name}.

Welcome to #{instance_name}

" + ) + + Config.put([:welcome, :email, :sender], {"Pleroma App", "welcome@pleroma.app"}) + + {:ok, _job} = WelcomeEmail.send_email(user) + + ObanHelpers.perform_all() + + assert_email_sent( + from: {"Pleroma App", "welcome@pleroma.app"}, + to: {user.name, user.email}, + subject: "Hello, welcome to pleroma: #{instance_name}", + html_body: "

Hello #{user.name}.

Welcome to #{instance_name}

" + ) + end + end +end diff --git a/test/user/welcome_message_test.exs b/test/user/welcome_message_test.exs new file mode 100644 index 000000000..3cd6f5cb7 --- /dev/null +++ b/test/user/welcome_message_test.exs @@ -0,0 +1,34 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.User.WelcomeMessageTest do + use Pleroma.DataCase + + alias Pleroma.Config + alias Pleroma.User.WelcomeMessage + + import Pleroma.Factory + + setup do: clear_config([:welcome]) + + describe "post_message/1" do + test "send a direct welcome message" do + welcome_user = insert(:user) + user = insert(:user, name: "Jimm") + + Config.put([:welcome, :direct_message, :enabled], true) + Config.put([:welcome, :direct_message, :sender_nickname], welcome_user.nickname) + + Config.put( + [:welcome, :direct_message, :message], + "Hello. Welcome to Pleroma" + ) + + {:ok, %Pleroma.Activity{} = activity} = WelcomeMessage.post_message(user) + assert user.ap_id in activity.recipients + assert activity.data["directMessage"] == true + assert Pleroma.Object.normalize(activity).data["content"] =~ "Hello. Welcome to Pleroma" + end + end +end diff --git a/test/user_search_test.exs b/test/user_search_test.exs index 17c63322a..01976bf58 100644 --- a/test/user_search_test.exs +++ b/test/user_search_test.exs @@ -17,7 +17,7 @@ defmodule Pleroma.UserSearchTest do describe "User.search" do setup do: clear_config([:instance, :limit_to_local_content]) - test "excluded invisible users from results" do + test "excludes invisible users from results" do user = insert(:user, %{nickname: "john t1000"}) insert(:user, %{invisible: true, nickname: "john t800"}) @@ -25,6 +25,15 @@ test "excluded invisible users from results" do assert found_user.id == user.id end + test "excludes service actors from results" do + insert(:user, actor_type: "Application", nickname: "user1") + service = insert(:user, actor_type: "Service", nickname: "user2") + person = insert(:user, actor_type: "Person", nickname: "user3") + + assert [found_user1, found_user2] = User.search("user") + assert [found_user1.id, found_user2.id] -- [service.id, person.id] == [] + end + test "accepts limit parameter" do Enum.each(0..4, &insert(:user, %{nickname: "john#{&1}"})) assert length(User.search("john", limit: 3)) == 3 @@ -37,30 +46,49 @@ test "accepts offset parameter" do assert length(User.search("john", limit: 3, offset: 3)) == 2 end - test "finds a user by full or partial nickname" do + defp clear_virtual_fields(user) do + Map.merge(user, %{search_rank: nil, search_type: nil}) + end + + test "finds a user by full nickname or its leading fragment" do user = insert(:user, %{nickname: "john"}) Enum.each(["john", "jo", "j"], fn query -> assert user == User.search(query) |> List.first() - |> Map.put(:search_rank, nil) - |> Map.put(:search_type, nil) + |> clear_virtual_fields() end) end - test "finds a user by full or partial name" do + test "finds a user by full name or leading fragment(s) of its words" do user = insert(:user, %{name: "John Doe"}) Enum.each(["John Doe", "JOHN", "doe", "j d", "j", "d"], fn query -> assert user == User.search(query) |> List.first() - |> Map.put(:search_rank, nil) - |> Map.put(:search_type, nil) + |> clear_virtual_fields() end) end + test "matches by leading fragment of user domain" do + user = insert(:user, %{nickname: "arandom@dude.com"}) + insert(:user, %{nickname: "iamthedude"}) + + assert [user.id] == User.search("dud") |> Enum.map(& &1.id) + end + + test "ranks full nickname match higher than full name match" do + nicknamed_user = insert(:user, %{nickname: "hj@shigusegubu.club"}) + named_user = insert(:user, %{nickname: "xyz@sample.com", name: "HJ"}) + + results = User.search("hj") + + assert [nicknamed_user.id, named_user.id] == Enum.map(results, & &1.id) + assert Enum.at(results, 0).search_rank > Enum.at(results, 1).search_rank + end + test "finds users, considering density of matched tokens" do u1 = insert(:user, %{name: "Bar Bar plus Word Word"}) u2 = insert(:user, %{name: "Word Word Bar Bar Bar"}) @@ -81,22 +109,22 @@ test "finds users, boosting ranks of friends and followers" do Enum.map(User.search("doe", resolve: false, for_user: u1), & &1.id) == [] end - test "finds followers of user by partial name" do - u1 = insert(:user) - u2 = insert(:user, %{name: "Jimi"}) - follower_jimi = insert(:user, %{name: "Jimi Hendrix"}) - follower_lizz = insert(:user, %{name: "Lizz Wright"}) - friend = insert(:user, %{name: "Jimi"}) + test "finds followings of user by partial name" do + lizz = insert(:user, %{name: "Lizz"}) + jimi = insert(:user, %{name: "Jimi"}) + following_lizz = insert(:user, %{name: "Jimi Hendrix"}) + following_jimi = insert(:user, %{name: "Lizz Wright"}) + follower_lizz = insert(:user, %{name: "Jimi"}) - {:ok, follower_jimi} = User.follow(follower_jimi, u1) - {:ok, _follower_lizz} = User.follow(follower_lizz, u2) - {:ok, u1} = User.follow(u1, friend) + {:ok, lizz} = User.follow(lizz, following_lizz) + {:ok, _jimi} = User.follow(jimi, following_jimi) + {:ok, _follower_lizz} = User.follow(follower_lizz, lizz) - assert Enum.map(User.search("jimi", following: true, for_user: u1), & &1.id) == [ - follower_jimi.id + assert Enum.map(User.search("jimi", following: true, for_user: lizz), & &1.id) == [ + following_lizz.id ] - assert User.search("lizz", following: true, for_user: u1) == [] + assert User.search("lizz", following: true, for_user: lizz) == [] end test "find local and remote users for authenticated users" do diff --git a/test/user_test.exs b/test/user_test.exs index 98c79da4f..50f72549e 100644 --- a/test/user_test.exs +++ b/test/user_test.exs @@ -17,6 +17,7 @@ defmodule Pleroma.UserTest do import Pleroma.Factory import ExUnit.CaptureLog + import Swoosh.TestAssertions setup_all do Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) @@ -199,6 +200,16 @@ test "doesn't return already accepted or duplicate follow requests" do assert [^pending_follower] = User.get_follow_requests(locked) end + test "doesn't return follow requests for deactivated accounts" do + locked = insert(:user, locked: true) + pending_follower = insert(:user, %{deactivated: true}) + + CommonAPI.follow(pending_follower, locked) + + assert true == pending_follower.deactivated + assert [] = User.get_follow_requests(locked) + end + test "clears follow requests when requester is blocked" do followed = insert(:user, locked: true) follower = insert(:user) @@ -375,9 +386,10 @@ test "fetches correct profile for nickname beginning with number" do password_confirmation: "test", email: "email@example.com" } + setup do: clear_config([:instance, :autofollowed_nicknames]) - setup do: clear_config([:instance, :welcome_message]) - setup do: clear_config([:instance, :welcome_user_nickname]) + setup do: clear_config([:welcome]) + setup do: clear_config([:instance, :account_activation_required]) test "it autofollows accounts that are set for it" do user = insert(:user) @@ -398,20 +410,68 @@ test "it autofollows accounts that are set for it" do test "it sends a welcome message if it is set" do welcome_user = insert(:user) - - Pleroma.Config.put([:instance, :welcome_user_nickname], welcome_user.nickname) - Pleroma.Config.put([:instance, :welcome_message], "Hello, this is a cool site") + Pleroma.Config.put([:welcome, :direct_message, :enabled], true) + Pleroma.Config.put([:welcome, :direct_message, :sender_nickname], welcome_user.nickname) + Pleroma.Config.put([:welcome, :direct_message, :message], "Hello, this is a direct message") cng = User.register_changeset(%User{}, @full_user_data) {:ok, registered_user} = User.register(cng) + ObanHelpers.perform_all() activity = Repo.one(Pleroma.Activity) assert registered_user.ap_id in activity.recipients - assert Object.normalize(activity).data["content"] =~ "cool site" + assert Object.normalize(activity).data["content"] =~ "direct message" assert activity.actor == welcome_user.ap_id end - setup do: clear_config([:instance, :account_activation_required]) + test "it sends a welcome chat message if it is set" do + welcome_user = insert(:user) + Pleroma.Config.put([:welcome, :chat_message, :enabled], true) + Pleroma.Config.put([:welcome, :chat_message, :sender_nickname], welcome_user.nickname) + Pleroma.Config.put([:welcome, :chat_message, :message], "Hello, this is a chat message") + + cng = User.register_changeset(%User{}, @full_user_data) + {:ok, registered_user} = User.register(cng) + ObanHelpers.perform_all() + + activity = Repo.one(Pleroma.Activity) + assert registered_user.ap_id in activity.recipients + assert Object.normalize(activity).data["content"] =~ "chat message" + assert activity.actor == welcome_user.ap_id + end + + test "it sends a welcome email message if it is set" do + welcome_user = insert(:user) + Pleroma.Config.put([:welcome, :email, :enabled], true) + Pleroma.Config.put([:welcome, :email, :sender], welcome_user.email) + + Pleroma.Config.put( + [:welcome, :email, :subject], + "Hello, welcome to cool site: <%= instance_name %>" + ) + + instance_name = Pleroma.Config.get([:instance, :name]) + + cng = User.register_changeset(%User{}, @full_user_data) + {:ok, registered_user} = User.register(cng) + ObanHelpers.perform_all() + + assert_email_sent( + from: {instance_name, welcome_user.email}, + to: {registered_user.name, registered_user.email}, + subject: "Hello, welcome to cool site: #{instance_name}", + html_body: "Welcome to #{instance_name}" + ) + end + + test "it sends a confirm email" do + Pleroma.Config.put([:instance, :account_activation_required], true) + + cng = User.register_changeset(%User{}, @full_user_data) + {:ok, registered_user} = User.register(cng) + ObanHelpers.perform_all() + assert_email_sent(Pleroma.Emails.UserEmail.account_confirmation_email(registered_user)) + end test "it requires an email, name, nickname and password, bio is optional when account_activation_required is enabled" do Pleroma.Config.put([:instance, :account_activation_required], true) @@ -453,6 +513,29 @@ test "it restricts certain nicknames" do refute changeset.valid? end + test "it blocks blacklisted email domains" do + clear_config([User, :email_blacklist], ["trolling.world"]) + + # Block with match + params = Map.put(@full_user_data, :email, "troll@trolling.world") + changeset = User.register_changeset(%User{}, params) + refute changeset.valid? + + # Block with subdomain match + params = Map.put(@full_user_data, :email, "troll@gnomes.trolling.world") + changeset = User.register_changeset(%User{}, params) + refute changeset.valid? + + # Pass with different domains that are similar + params = Map.put(@full_user_data, :email, "troll@gnomestrolling.world") + changeset = User.register_changeset(%User{}, params) + assert changeset.valid? + + params = Map.put(@full_user_data, :email, "troll@trolling.world.us") + changeset = User.register_changeset(%User{}, params) + assert changeset.valid? + end + test "it sets the password_hash and ap_id" do changeset = User.register_changeset(%User{}, @full_user_data) @@ -463,6 +546,24 @@ test "it sets the password_hash and ap_id" do assert changeset.changes.follower_address == "#{changeset.changes.ap_id}/followers" end + + test "it sets the 'accepts_chat_messages' set to true" do + changeset = User.register_changeset(%User{}, @full_user_data) + assert changeset.valid? + + {:ok, user} = Repo.insert(changeset) + + assert user.accepts_chat_messages + end + + test "it creates a confirmed user" do + changeset = User.register_changeset(%User{}, @full_user_data) + assert changeset.valid? + + {:ok, user} = Repo.insert(changeset) + + refute user.confirmation_pending + end end describe "user registration, with :account_activation_required" do @@ -497,6 +598,46 @@ test "it creates confirmed user if :confirmed option is given" do end end + describe "user registration, with :account_approval_required" do + @full_user_data %{ + bio: "A guy", + name: "my name", + nickname: "nick", + password: "test", + password_confirmation: "test", + email: "email@example.com", + registration_reason: "I'm a cool guy :)" + } + setup do: clear_config([:instance, :account_approval_required], true) + + test "it creates unapproved user" do + changeset = User.register_changeset(%User{}, @full_user_data) + assert changeset.valid? + + {:ok, user} = Repo.insert(changeset) + + assert user.approval_pending + assert user.registration_reason == "I'm a cool guy :)" + end + + test "it restricts length of registration reason" do + reason_limit = Pleroma.Config.get([:instance, :registration_reason_length]) + + assert is_integer(reason_limit) + + params = + @full_user_data + |> Map.put( + :registration_reason, + "Quia et nesciunt dolores numquam ipsam nisi sapiente soluta. Ullam repudiandae nisi quam porro officiis officiis ad. Consequatur animi velit ex quia. Odit voluptatem perferendis quia ut nisi. Dignissimos sit soluta atque aliquid dolorem ut dolorum ut. Labore voluptates iste iusto amet voluptatum earum. Ad fugit illum nam eos ut nemo. Pariatur ea fuga non aspernatur. Dignissimos debitis officia corporis est nisi ab et. Atque itaque alias eius voluptas minus. Accusamus numquam tempore occaecati in." + ) + + changeset = User.register_changeset(%User{}, params) + + refute changeset.valid? + end + end + describe "get_or_fetch/1" do test "gets an existing user by nickname" do user = insert(:user) @@ -587,6 +728,31 @@ test "updates an existing user, if stale" do refute user.last_refreshed_at == orig_user.last_refreshed_at end + test "if nicknames clash, the old user gets a prefix with the old id to the nickname" do + a_week_ago = NaiveDateTime.add(NaiveDateTime.utc_now(), -604_800) + + orig_user = + insert( + :user, + local: false, + nickname: "admin@mastodon.example.org", + ap_id: "http://mastodon.example.org/users/harinezumigari", + last_refreshed_at: a_week_ago + ) + + assert orig_user.last_refreshed_at == a_week_ago + + {:ok, user} = User.get_or_fetch_by_ap_id("http://mastodon.example.org/users/admin") + + assert user.inbox + + refute user.id == orig_user.id + + orig_user = User.get_by_id(orig_user.id) + + assert orig_user.nickname == "#{orig_user.id}.admin@mastodon.example.org" + end + @tag capture_log: true test "it returns the old user if stale, but unfetchable" do a_week_ago = NaiveDateTime.add(NaiveDateTime.utc_now(), -604_800) @@ -1137,6 +1303,31 @@ test "hide a user's statuses from timelines and notifications" do end end + describe "approve" do + test "approves a user" do + user = insert(:user, approval_pending: true) + assert true == user.approval_pending + {:ok, user} = User.approve(user) + assert false == user.approval_pending + end + + test "approves a list of users" do + unapproved_users = [ + insert(:user, approval_pending: true), + insert(:user, approval_pending: true), + insert(:user, approval_pending: true) + ] + + {:ok, users} = User.approve(unapproved_users) + + assert Enum.count(users) == 3 + + Enum.each(users, fn user -> + assert false == user.approval_pending + end) + end + end + describe "delete" do setup do {:ok, user} = insert(:user) |> User.set_cache() @@ -1224,6 +1415,95 @@ test "deactivates user when activation is not required", %{user: user} do end end + test "delete/1 when approval is pending deletes the user" do + user = insert(:user, approval_pending: true) + + {:ok, job} = User.delete(user) + {:ok, _} = ObanHelpers.perform(job) + + refute User.get_cached_by_id(user.id) + refute User.get_by_id(user.id) + end + + test "delete/1 purges a user when they wouldn't be fully deleted" do + user = + insert(:user, %{ + bio: "eyy lmao", + name: "qqqqqqq", + password_hash: "pdfk2$1b3n159001", + keys: "RSA begin buplic key", + public_key: "--PRIVATE KEYE--", + avatar: %{"a" => "b"}, + tags: ["qqqqq"], + banner: %{"a" => "b"}, + background: %{"a" => "b"}, + note_count: 9, + follower_count: 9, + following_count: 9001, + locked: true, + confirmation_pending: true, + password_reset_pending: true, + approval_pending: true, + registration_reason: "ahhhhh", + confirmation_token: "qqqq", + domain_blocks: ["lain.com"], + deactivated: true, + ap_enabled: true, + is_moderator: true, + is_admin: true, + mastofe_settings: %{"a" => "b"}, + mascot: %{"a" => "b"}, + emoji: %{"a" => "b"}, + pleroma_settings_store: %{"q" => "x"}, + fields: [%{"gg" => "qq"}], + raw_fields: [%{"gg" => "qq"}], + discoverable: true, + also_known_as: ["https://lol.olo/users/loll"] + }) + + {:ok, job} = User.delete(user) + {:ok, _} = ObanHelpers.perform(job) + user = User.get_by_id(user.id) + + assert %User{ + bio: "", + raw_bio: nil, + email: nil, + name: nil, + password_hash: nil, + keys: nil, + public_key: nil, + avatar: %{}, + tags: [], + last_refreshed_at: nil, + last_digest_emailed_at: nil, + banner: %{}, + background: %{}, + note_count: 0, + follower_count: 0, + following_count: 0, + locked: false, + confirmation_pending: false, + password_reset_pending: false, + approval_pending: false, + registration_reason: nil, + confirmation_token: nil, + domain_blocks: [], + deactivated: true, + ap_enabled: false, + is_moderator: false, + is_admin: false, + mastofe_settings: nil, + mascot: nil, + emoji: %{}, + pleroma_settings_store: %{}, + fields: [], + raw_fields: [], + discoverable: false, + also_known_as: [] + } = user + end + test "get_public_key_for_ap_id fetches a user that's not in the db" do assert {:ok, _key} = User.get_public_key_for_ap_id("http://mastodon.example.org/users/admin") end @@ -1298,6 +1578,14 @@ test "returns :deactivated for deactivated user" do user = insert(:user, local: true, confirmation_pending: false, deactivated: true) assert User.account_status(user) == :deactivated end + + test "returns :approval_pending for unapproved user" do + user = insert(:user, local: true, approval_pending: true) + assert User.account_status(user) == :approval_pending + + user = insert(:user, local: true, confirmation_pending: true, approval_pending: true) + assert User.account_status(user) == :approval_pending + end end describe "superuser?/1" do @@ -1342,11 +1630,11 @@ test "returns false for a non-invisible user" do end end - describe "visible_for?/2" do + describe "visible_for/2" do test "returns true when the account is itself" do user = insert(:user, local: true) - assert User.visible_for?(user, user) + assert User.visible_for(user, user) == :visible end test "returns false when the account is unauthenticated and auth is required" do @@ -1355,14 +1643,14 @@ test "returns false when the account is unauthenticated and auth is required" do user = insert(:user, local: true, confirmation_pending: true) other_user = insert(:user, local: true) - refute User.visible_for?(user, other_user) + refute User.visible_for(user, other_user) == :visible end test "returns true when the account is unauthenticated and auth is not required" do user = insert(:user, local: true, confirmation_pending: true) other_user = insert(:user, local: true) - assert User.visible_for?(user, other_user) + assert User.visible_for(user, other_user) == :visible end test "returns true when the account is unauthenticated and being viewed by a privileged account (auth required)" do @@ -1371,7 +1659,7 @@ test "returns true when the account is unauthenticated and being viewed by a pri user = insert(:user, local: true, confirmation_pending: true) other_user = insert(:user, local: true, is_admin: true) - assert User.visible_for?(user, other_user) + assert User.visible_for(user, other_user) == :visible end end diff --git a/test/web/activity_pub/activity_pub_controller_test.exs b/test/web/activity_pub/activity_pub_controller_test.exs index 8c6ee68b2..b11e2f961 100644 --- a/test/web/activity_pub/activity_pub_controller_test.exs +++ b/test/web/activity_pub/activity_pub_controller_test.exs @@ -533,9 +533,10 @@ test "accept follow activity", %{conn: conn} do end) :ok = Mix.Tasks.Pleroma.Relay.run(["list"]) - assert_receive {:mix_shell, :info, ["relay.mastodon.host"]} + assert_receive {:mix_shell, :info, ["https://relay.mastodon.host/actor"]} end + @tag capture_log: true test "without valid signature, " <> "it only accepts Create activities and requires enabled federation", %{conn: conn} do @@ -648,11 +649,14 @@ test "it accepts messages with bcc as string instead of array", %{conn: conn, da test "it accepts announces with to as string instead of array", %{conn: conn} do user = insert(:user) + {:ok, post} = CommonAPI.post(user, %{status: "hey"}) + announcer = insert(:user, local: false) + data = %{ "@context" => "https://www.w3.org/ns/activitystreams", - "actor" => "http://mastodon.example.org/users/admin", - "id" => "http://mastodon.example.org/users/admin/statuses/19512778738411822/activity", - "object" => "https://mastodon.social/users/emelie/statuses/101849165031453009", + "actor" => announcer.ap_id, + "id" => "#{announcer.ap_id}/statuses/19512778738411822/activity", + "object" => post.data["object"], "to" => "https://www.w3.org/ns/activitystreams#Public", "cc" => [user.ap_id], "type" => "Announce" @@ -901,6 +905,8 @@ test "it requires authentication if instance is NOT federating", %{ end describe "POST /users/:nickname/outbox (C2S)" do + setup do: clear_config([:instance, :limit]) + setup do [ activity: %{ @@ -1078,6 +1084,59 @@ test "it increases like count when receiving a like action", %{conn: conn} do assert object = Object.get_by_ap_id(note_object.data["id"]) assert object.data["like_count"] == 1 end + + test "it doesn't spreads faulty attributedTo or actor fields", %{ + conn: conn, + activity: activity + } do + reimu = insert(:user, nickname: "reimu") + cirno = insert(:user, nickname: "cirno") + + assert reimu.ap_id + assert cirno.ap_id + + activity = + activity + |> put_in(["object", "actor"], reimu.ap_id) + |> put_in(["object", "attributedTo"], reimu.ap_id) + |> put_in(["actor"], reimu.ap_id) + |> put_in(["attributedTo"], reimu.ap_id) + + _reimu_outbox = + conn + |> assign(:user, cirno) + |> put_req_header("content-type", "application/activity+json") + |> post("/users/#{reimu.nickname}/outbox", activity) + |> json_response(403) + + cirno_outbox = + conn + |> assign(:user, cirno) + |> put_req_header("content-type", "application/activity+json") + |> post("/users/#{cirno.nickname}/outbox", activity) + |> json_response(201) + + assert cirno_outbox["attributedTo"] == nil + assert cirno_outbox["actor"] == cirno.ap_id + + assert cirno_object = Object.normalize(cirno_outbox["object"]) + assert cirno_object.data["actor"] == cirno.ap_id + assert cirno_object.data["attributedTo"] == cirno.ap_id + end + + test "Character limitation", %{conn: conn, activity: activity} do + Pleroma.Config.put([:instance, :limit], 5) + user = insert(:user) + + result = + conn + |> assign(:user, user) + |> put_req_header("content-type", "application/activity+json") + |> post("/users/#{user.nickname}/outbox", activity) + |> json_response(400) + + assert result == "Note is over the character limit" + end end describe "/relay/followers" do diff --git a/test/web/activity_pub/activity_pub_test.exs b/test/web/activity_pub/activity_pub_test.exs index 7693f6400..d8caa0b00 100644 --- a/test/web/activity_pub/activity_pub_test.exs +++ b/test/web/activity_pub/activity_pub_test.exs @@ -184,38 +184,45 @@ test "it returns a user that is invisible" do assert User.invisible?(user) end - test "it fetches the appropriate tag-restricted posts" do - user = insert(:user) + test "it returns a user that accepts chat messages" do + user_id = "http://mastodon.example.org/users/admin" + {:ok, user} = ActivityPub.make_user_from_ap_id(user_id) - {:ok, status_one} = CommonAPI.post(user, %{status: ". #test"}) - {:ok, status_two} = CommonAPI.post(user, %{status: ". #essais"}) - {:ok, status_three} = CommonAPI.post(user, %{status: ". #test #reject"}) - - fetch_one = ActivityPub.fetch_activities([], %{type: "Create", tag: "test"}) - - fetch_two = ActivityPub.fetch_activities([], %{type: "Create", tag: ["test", "essais"]}) - - fetch_three = - ActivityPub.fetch_activities([], %{ - type: "Create", - tag: ["test", "essais"], - tag_reject: ["reject"] - }) - - fetch_four = - ActivityPub.fetch_activities([], %{ - type: "Create", - tag: ["test"], - tag_all: ["test", "reject"] - }) - - assert fetch_one == [status_one, status_three] - assert fetch_two == [status_one, status_two, status_three] - assert fetch_three == [status_one, status_two] - assert fetch_four == [status_three] + assert user.accepts_chat_messages end end + test "it fetches the appropriate tag-restricted posts" do + user = insert(:user) + + {:ok, status_one} = CommonAPI.post(user, %{status: ". #test"}) + {:ok, status_two} = CommonAPI.post(user, %{status: ". #essais"}) + {:ok, status_three} = CommonAPI.post(user, %{status: ". #test #reject"}) + + fetch_one = ActivityPub.fetch_activities([], %{type: "Create", tag: "test"}) + + fetch_two = ActivityPub.fetch_activities([], %{type: "Create", tag: ["test", "essais"]}) + + fetch_three = + ActivityPub.fetch_activities([], %{ + type: "Create", + tag: ["test", "essais"], + tag_reject: ["reject"] + }) + + fetch_four = + ActivityPub.fetch_activities([], %{ + type: "Create", + tag: ["test"], + tag_all: ["test", "reject"] + }) + + assert fetch_one == [status_one, status_three] + assert fetch_two == [status_one, status_two, status_three] + assert fetch_three == [status_one, status_two] + assert fetch_four == [status_three] + end + describe "insertion" do test "drops activities beyond a certain limit" do limit = Config.get([:instance, :remote_limit]) @@ -232,7 +239,7 @@ test "drops activities beyond a certain limit" do } } - assert {:error, {:remote_limit_error, _}} = ActivityPub.insert(data) + assert {:error, :remote_limit} = ActivityPub.insert(data) end test "doesn't drop activities with content being null" do @@ -379,9 +386,11 @@ test "can be fetched into a timeline" do end describe "create activities" do - test "it reverts create" do - user = insert(:user) + setup do + [user: insert(:user)] + end + test "it reverts create", %{user: user} do with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do assert {:error, :reverted} = ActivityPub.create(%{ @@ -400,9 +409,47 @@ test "it reverts create" do assert Repo.aggregate(Object, :count, :id) == 0 end - test "removes doubled 'to' recipients" do - user = insert(:user) + test "creates activity if expiration is not configured and expires_at is not passed", %{ + user: user + } do + clear_config([Pleroma.Workers.PurgeExpiredActivity, :enabled], false) + assert {:ok, _} = + ActivityPub.create(%{ + to: ["user1", "user2"], + actor: user, + context: "", + object: %{ + "to" => ["user1", "user2"], + "type" => "Note", + "content" => "testing" + } + }) + end + + test "rejects activity if expires_at present but expiration is not configured", %{user: user} do + clear_config([Pleroma.Workers.PurgeExpiredActivity, :enabled], false) + + assert {:error, :expired_activities_disabled} = + ActivityPub.create(%{ + to: ["user1", "user2"], + actor: user, + context: "", + object: %{ + "to" => ["user1", "user2"], + "type" => "Note", + "content" => "testing" + }, + additional: %{ + "expires_at" => DateTime.utc_now() + } + }) + + assert Repo.aggregate(Activity, :count, :id) == 0 + assert Repo.aggregate(Object, :count, :id) == 0 + end + + test "removes doubled 'to' recipients", %{user: user} do {:ok, activity} = ActivityPub.create(%{ to: ["user1", "user1", "user2"], @@ -420,9 +467,7 @@ test "removes doubled 'to' recipients" do assert activity.recipients == ["user1", "user2", user.ap_id] end - test "increases user note count only for public activities" do - user = insert(:user) - + test "increases user note count only for public activities", %{user: user} do {:ok, _} = CommonAPI.post(User.get_cached_by_id(user.id), %{ status: "1", @@ -451,8 +496,7 @@ test "increases user note count only for public activities" do assert user.note_count == 2 end - test "increases replies count" do - user = insert(:user) + test "increases replies count", %{user: user} do user2 = insert(:user) {:ok, activity} = CommonAPI.post(user, %{status: "1", visibility: "public"}) @@ -507,6 +551,33 @@ test "retrieves activities that have a given context" do activities = ActivityPub.fetch_activities_for_context("2hu", %{blocking_user: user}) assert activities == [activity_two, activity] end + + test "doesn't return activities with filtered words" do + user = insert(:user) + user_two = insert(:user) + insert(:filter, user: user, phrase: "test", hide: true) + + {:ok, %{id: id1, data: %{"context" => context}}} = CommonAPI.post(user, %{status: "1"}) + + {:ok, %{id: id2}} = CommonAPI.post(user_two, %{status: "2", in_reply_to_status_id: id1}) + + {:ok, %{id: id3} = user_activity} = + CommonAPI.post(user, %{status: "3 test?", in_reply_to_status_id: id2}) + + {:ok, %{id: id4} = filtered_activity} = + CommonAPI.post(user_two, %{status: "4 test!", in_reply_to_status_id: id3}) + + {:ok, _} = CommonAPI.post(user, %{status: "5", in_reply_to_status_id: id4}) + + activities = + context + |> ActivityPub.fetch_activities_for_context(%{user: user}) + |> Enum.map(& &1.id) + + assert length(activities) == 4 + assert user_activity.id in activities + refute filtered_activity.id in activities + end end test "doesn't return blocked activities" do @@ -642,7 +713,7 @@ test "doesn't return activities from blocked domains" do refute activity in activities followed_user = insert(:user) - ActivityPub.follow(user, followed_user) + CommonAPI.follow(user, followed_user) {:ok, repeat_activity} = CommonAPI.repeat(activity.id, followed_user) activities = ActivityPub.fetch_activities([], %{blocking_user: user, skip_preload: true}) @@ -785,6 +856,75 @@ test "excludes reblogs on request" do assert activity == expected_activity end + describe "irreversible filters" do + setup do + user = insert(:user) + user_two = insert(:user) + + insert(:filter, user: user_two, phrase: "cofe", hide: true) + insert(:filter, user: user_two, phrase: "ok boomer", hide: true) + insert(:filter, user: user_two, phrase: "test", hide: false) + + params = %{ + type: ["Create", "Announce"], + user: user_two + } + + {:ok, %{user: user, user_two: user_two, params: params}} + end + + test "it returns statuses if they don't contain exact filter words", %{ + user: user, + params: params + } do + {:ok, _} = CommonAPI.post(user, %{status: "hey"}) + {:ok, _} = CommonAPI.post(user, %{status: "got cofefe?"}) + {:ok, _} = CommonAPI.post(user, %{status: "I am not a boomer"}) + {:ok, _} = CommonAPI.post(user, %{status: "ok boomers"}) + {:ok, _} = CommonAPI.post(user, %{status: "ccofee is not a word"}) + {:ok, _} = CommonAPI.post(user, %{status: "this is a test"}) + + activities = ActivityPub.fetch_activities([], params) + + assert Enum.count(activities) == 6 + end + + test "it does not filter user's own statuses", %{user_two: user_two, params: params} do + {:ok, _} = CommonAPI.post(user_two, %{status: "Give me some cofe!"}) + {:ok, _} = CommonAPI.post(user_two, %{status: "ok boomer"}) + + activities = ActivityPub.fetch_activities([], params) + + assert Enum.count(activities) == 2 + end + + test "it excludes statuses with filter words", %{user: user, params: params} do + {:ok, _} = CommonAPI.post(user, %{status: "Give me some cofe!"}) + {:ok, _} = CommonAPI.post(user, %{status: "ok boomer"}) + {:ok, _} = CommonAPI.post(user, %{status: "is it a cOfE?"}) + {:ok, _} = CommonAPI.post(user, %{status: "cofe is all I need"}) + {:ok, _} = CommonAPI.post(user, %{status: "— ok BOOMER\n"}) + + activities = ActivityPub.fetch_activities([], params) + + assert Enum.empty?(activities) + end + + test "it returns all statuses if user does not have any filters" do + another_user = insert(:user) + {:ok, _} = CommonAPI.post(another_user, %{status: "got cofe?"}) + {:ok, _} = CommonAPI.post(another_user, %{status: "test!"}) + + activities = + ActivityPub.fetch_activities([], %{ + type: ["Create", "Announce"], + user: another_user + }) + + assert Enum.count(activities) == 2 + end + end + describe "public fetch activities" do test "doesn't retrieve unlisted activities" do user = insert(:user) @@ -887,13 +1027,39 @@ test "returns reblogs for users for whom reblogs have not been muted" do end describe "uploading files" do - test "copies the file to the configured folder" do - file = %Plug.Upload{ + setup do + test_file = %Plug.Upload{ content_type: "image/jpg", path: Path.absname("test/fixtures/image.jpg"), filename: "an_image.jpg" } + %{test_file: test_file} + end + + test "sets a description if given", %{test_file: file} do + {:ok, %Object{} = object} = ActivityPub.upload(file, description: "a cool file") + assert object.data["name"] == "a cool file" + end + + test "it sets the default description depending on the configuration", %{test_file: file} do + clear_config([Pleroma.Upload, :default_description]) + + Pleroma.Config.put([Pleroma.Upload, :default_description], nil) + {:ok, %Object{} = object} = ActivityPub.upload(file) + assert object.data["name"] == "" + + Pleroma.Config.put([Pleroma.Upload, :default_description], :filename) + {:ok, %Object{} = object} = ActivityPub.upload(file) + assert object.data["name"] == "an_image.jpg" + + Pleroma.Config.put([Pleroma.Upload, :default_description], "unnamed attachment") + {:ok, %Object{} = object} = ActivityPub.upload(file) + assert object.data["name"] == "unnamed attachment" + end + + test "copies the file to the configured folder", %{test_file: file} do + clear_config([Pleroma.Upload, :default_description], :filename) {:ok, %Object{} = object} = ActivityPub.upload(file) assert object.data["name"] == "an_image.jpg" end @@ -917,24 +1083,12 @@ test "fetches the latest Follow activity" do end end - describe "following / unfollowing" do - test "it reverts follow activity" do - follower = insert(:user) - followed = insert(:user) - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.follow(follower, followed) - end - - assert Repo.aggregate(Activity, :count, :id) == 0 - assert Repo.aggregate(Object, :count, :id) == 0 - end - + describe "unfollowing" do test "it reverts unfollow activity" do follower = insert(:user) followed = insert(:user) - {:ok, follow_activity} = ActivityPub.follow(follower, followed) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, followed) with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do assert {:error, :reverted} = ActivityPub.unfollow(follower, followed) @@ -947,21 +1101,11 @@ test "it reverts unfollow activity" do assert activity.data["object"] == followed.ap_id end - test "creates a follow activity" do - follower = insert(:user) - followed = insert(:user) - - {:ok, activity} = ActivityPub.follow(follower, followed) - assert activity.data["type"] == "Follow" - assert activity.data["actor"] == follower.ap_id - assert activity.data["object"] == followed.ap_id - end - test "creates an undo activity for the last follow" do follower = insert(:user) followed = insert(:user) - {:ok, follow_activity} = ActivityPub.follow(follower, followed) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, followed) {:ok, activity} = ActivityPub.unfollow(follower, followed) assert activity.data["type"] == "Undo" @@ -978,7 +1122,7 @@ test "creates an undo activity for a pending follow request" do follower = insert(:user) followed = insert(:user, %{locked: true}) - {:ok, follow_activity} = ActivityPub.follow(follower, followed) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, followed) {:ok, activity} = ActivityPub.unfollow(follower, followed) assert activity.data["type"] == "Undo" @@ -992,54 +1136,6 @@ test "creates an undo activity for a pending follow request" do end end - describe "blocking" do - test "reverts block activity on error" do - [blocker, blocked] = insert_list(2, :user) - - with_mock(Utils, [:passthrough], maybe_federate: fn _ -> {:error, :reverted} end) do - assert {:error, :reverted} = ActivityPub.block(blocker, blocked) - end - - assert Repo.aggregate(Activity, :count, :id) == 0 - assert Repo.aggregate(Object, :count, :id) == 0 - end - - test "creates a block activity" do - clear_config([:instance, :federating], true) - blocker = insert(:user) - blocked = insert(:user) - - with_mock Pleroma.Web.Federator, - publish: fn _ -> nil end do - {:ok, activity} = ActivityPub.block(blocker, blocked) - - assert activity.data["type"] == "Block" - assert activity.data["actor"] == blocker.ap_id - assert activity.data["object"] == blocked.ap_id - - assert called(Pleroma.Web.Federator.publish(activity)) - end - end - - test "works with outgoing blocks disabled, but doesn't federate" do - clear_config([:instance, :federating], true) - clear_config([:activitypub, :outgoing_blocks], false) - blocker = insert(:user) - blocked = insert(:user) - - with_mock Pleroma.Web.Federator, - publish: fn _ -> nil end do - {:ok, activity} = ActivityPub.block(blocker, blocked) - - assert activity.data["type"] == "Block" - assert activity.data["actor"] == blocker.ap_id - assert activity.data["object"] == blocked.ap_id - - refute called(Pleroma.Web.Federator.publish(:_)) - end - end - end - describe "timeline post-processing" do test "it filters broken threads" do user1 = insert(:user) @@ -1092,52 +1188,6 @@ test "it filters broken threads" do end end - describe "update" do - setup do: clear_config([:instance, :max_pinned_statuses]) - - test "it creates an update activity with the new user data" do - user = insert(:user) - {:ok, user} = User.ensure_keys_present(user) - user_data = Pleroma.Web.ActivityPub.UserView.render("user.json", %{user: user}) - - {:ok, update} = - ActivityPub.update(%{ - actor: user_data["id"], - to: [user.follower_address], - cc: [], - object: user_data - }) - - assert update.data["actor"] == user.ap_id - assert update.data["to"] == [user.follower_address] - assert embedded_object = update.data["object"] - assert embedded_object["id"] == user_data["id"] - assert embedded_object["type"] == user_data["type"] - end - end - - test "returned pinned statuses" do - Config.put([:instance, :max_pinned_statuses], 3) - user = insert(:user) - - {:ok, activity_one} = CommonAPI.post(user, %{status: "HI!!!"}) - {:ok, activity_two} = CommonAPI.post(user, %{status: "HI!!!"}) - {:ok, activity_three} = CommonAPI.post(user, %{status: "HI!!!"}) - - CommonAPI.pin(activity_one.id, user) - user = refresh_record(user) - - CommonAPI.pin(activity_two.id, user) - user = refresh_record(user) - - CommonAPI.pin(activity_three.id, user) - user = refresh_record(user) - - activities = ActivityPub.fetch_user_activities(user, nil, %{pinned: true}) - - assert 3 = length(activities) - end - describe "flag/1" do setup do reporter = insert(:user) @@ -1192,7 +1242,8 @@ test "it can create a Flag activity", "id" => activity_ap_id, "content" => content, "published" => activity_with_object.object.data["published"], - "actor" => AccountView.render("show.json", %{user: target_account}) + "actor" => + AccountView.render("show.json", %{user: target_account, skip_visibility_check: true}) } assert %Activity{ @@ -1457,7 +1508,7 @@ test "create" do assert_enqueued(worker: Pleroma.Workers.BackgroundWorker, args: params) - Pleroma.Workers.BackgroundWorker.perform(params, nil) + Pleroma.Workers.BackgroundWorker.perform(%Oban.Job{args: params}) refute User.following?(follower, old_user) assert User.following?(follower, new_user) @@ -2055,18 +2106,67 @@ test "it just returns the input if the user has no following/follower addresses" end describe "global activity expiration" do - setup do: clear_config([:instance, :rewrite_policy]) - test "creates an activity expiration for local Create activities" do - Pleroma.Config.put( - [:instance, :rewrite_policy], - Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicy + clear_config([:mrf, :policies], Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicy) + + {:ok, activity} = ActivityBuilder.insert(%{"type" => "Create", "context" => "3hu"}) + {:ok, follow} = ActivityBuilder.insert(%{"type" => "Follow", "context" => "3hu"}) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: activity.id}, + scheduled_at: + activity.inserted_at + |> DateTime.from_naive!("Etc/UTC") + |> Timex.shift(days: 365) ) - {:ok, %{id: id_create}} = ActivityBuilder.insert(%{"type" => "Create", "context" => "3hu"}) - {:ok, _follow} = ActivityBuilder.insert(%{"type" => "Follow", "context" => "3hu"}) + refute_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: follow.id} + ) + end + end - assert [%{activity_id: ^id_create}] = Pleroma.ActivityExpiration |> Repo.all() + describe "handling of clashing nicknames" do + test "renames an existing user with a clashing nickname and a different ap id" do + orig_user = + insert( + :user, + local: false, + nickname: "admin@mastodon.example.org", + ap_id: "http://mastodon.example.org/users/harinezumigari" + ) + + %{ + nickname: orig_user.nickname, + ap_id: orig_user.ap_id <> "part_2" + } + |> ActivityPub.maybe_handle_clashing_nickname() + + user = User.get_by_id(orig_user.id) + + assert user.nickname == "#{orig_user.id}.admin@mastodon.example.org" + end + + test "does nothing with a clashing nickname and the same ap id" do + orig_user = + insert( + :user, + local: false, + nickname: "admin@mastodon.example.org", + ap_id: "http://mastodon.example.org/users/harinezumigari" + ) + + %{ + nickname: orig_user.nickname, + ap_id: orig_user.ap_id + } + |> ActivityPub.maybe_handle_clashing_nickname() + + user = User.get_by_id(orig_user.id) + + assert user.nickname == orig_user.nickname end end end diff --git a/test/web/activity_pub/mrf/activity_expiration_policy_test.exs b/test/web/activity_pub/mrf/activity_expiration_policy_test.exs index 8babf49e7..e7370d4ef 100644 --- a/test/web/activity_pub/mrf/activity_expiration_policy_test.exs +++ b/test/web/activity_pub/mrf/activity_expiration_policy_test.exs @@ -7,24 +7,27 @@ defmodule Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicyTest do alias Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicy @id Pleroma.Web.Endpoint.url() <> "/activities/cofe" + @local_actor Pleroma.Web.Endpoint.url() <> "/users/cofe" test "adds `expires_at` property" do assert {:ok, %{"type" => "Create", "expires_at" => expires_at}} = ActivityExpirationPolicy.filter(%{ "id" => @id, + "actor" => @local_actor, "type" => "Create", "object" => %{"type" => "Note"} }) - assert Timex.diff(expires_at, NaiveDateTime.utc_now(), :days) == 364 + assert Timex.diff(expires_at, DateTime.utc_now(), :days) == 364 end test "keeps existing `expires_at` if it less than the config setting" do - expires_at = NaiveDateTime.utc_now() |> Timex.shift(days: 1) + expires_at = DateTime.utc_now() |> Timex.shift(days: 1) assert {:ok, %{"type" => "Create", "expires_at" => ^expires_at}} = ActivityExpirationPolicy.filter(%{ "id" => @id, + "actor" => @local_actor, "type" => "Create", "expires_at" => expires_at, "object" => %{"type" => "Note"} @@ -32,23 +35,25 @@ test "keeps existing `expires_at` if it less than the config setting" do end test "overwrites existing `expires_at` if it greater than the config setting" do - too_distant_future = NaiveDateTime.utc_now() |> Timex.shift(years: 2) + too_distant_future = DateTime.utc_now() |> Timex.shift(years: 2) assert {:ok, %{"type" => "Create", "expires_at" => expires_at}} = ActivityExpirationPolicy.filter(%{ "id" => @id, + "actor" => @local_actor, "type" => "Create", "expires_at" => too_distant_future, "object" => %{"type" => "Note"} }) - assert Timex.diff(expires_at, NaiveDateTime.utc_now(), :days) == 364 + assert Timex.diff(expires_at, DateTime.utc_now(), :days) == 364 end test "ignores remote activities" do assert {:ok, activity} = ActivityExpirationPolicy.filter(%{ "id" => "https://example.com/123", + "actor" => "https://example.com/users/cofe", "type" => "Create", "object" => %{"type" => "Note"} }) @@ -60,6 +65,7 @@ test "ignores non-Create/Note activities" do assert {:ok, activity} = ActivityExpirationPolicy.filter(%{ "id" => "https://example.com/123", + "actor" => "https://example.com/users/cofe", "type" => "Follow" }) @@ -68,6 +74,7 @@ test "ignores non-Create/Note activities" do assert {:ok, activity} = ActivityExpirationPolicy.filter(%{ "id" => "https://example.com/123", + "actor" => "https://example.com/users/cofe", "type" => "Create", "object" => %{"type" => "Cofe"} }) diff --git a/test/web/activity_pub/mrf/anti_followbot_policy_test.exs b/test/web/activity_pub/mrf/anti_followbot_policy_test.exs index fca0de7c6..3c795f5ac 100644 --- a/test/web/activity_pub/mrf/anti_followbot_policy_test.exs +++ b/test/web/activity_pub/mrf/anti_followbot_policy_test.exs @@ -21,7 +21,7 @@ test "matches followbots by nickname" do "id" => "https://example.com/activities/1234" } - {:reject, nil} = AntiFollowbotPolicy.filter(message) + assert {:reject, "[AntiFollowbotPolicy]" <> _} = AntiFollowbotPolicy.filter(message) end test "matches followbots by display name" do @@ -36,7 +36,7 @@ test "matches followbots by display name" do "id" => "https://example.com/activities/1234" } - {:reject, nil} = AntiFollowbotPolicy.filter(message) + assert {:reject, "[AntiFollowbotPolicy]" <> _} = AntiFollowbotPolicy.filter(message) end end diff --git a/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs b/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs index 1a13699be..6867c9853 100644 --- a/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs +++ b/test/web/activity_pub/mrf/anti_link_spam_policy_test.exs @@ -33,7 +33,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.AntiLinkSpamPolicyTest do describe "with new user" do test "it allows posts without links" do - user = insert(:user) + user = insert(:user, local: false) assert user.note_count == 0 @@ -45,7 +45,7 @@ test "it allows posts without links" do end test "it disallows posts with links" do - user = insert(:user) + user = insert(:user, local: false) assert user.note_count == 0 @@ -55,6 +55,18 @@ test "it disallows posts with links" do {:reject, _} = AntiLinkSpamPolicy.filter(message) end + + test "it allows posts with links for local users" do + user = insert(:user) + + assert user.note_count == 0 + + message = + @linkful_message + |> Map.put("actor", user.ap_id) + + {:ok, _message} = AntiLinkSpamPolicy.filter(message) + end end describe "with old user" do diff --git a/test/web/activity_pub/mrf/ensure_re_prepended_test.exs b/test/web/activity_pub/mrf/ensure_re_prepended_test.exs index 38ddec5bb..9a283f27d 100644 --- a/test/web/activity_pub/mrf/ensure_re_prepended_test.exs +++ b/test/web/activity_pub/mrf/ensure_re_prepended_test.exs @@ -78,5 +78,15 @@ test "it skip if parent and child summary isn't equal" do assert {:ok, res} = EnsureRePrepended.filter(message) assert res == message end + + test "it skips if the object is only a reference" do + message = %{ + "type" => "Create", + "object" => "somereference" + } + + assert {:ok, res} = EnsureRePrepended.filter(message) + assert res == message + end end end diff --git a/test/web/activity_pub/mrf/force_bot_unlisted_policy_test.exs b/test/web/activity_pub/mrf/force_bot_unlisted_policy_test.exs new file mode 100644 index 000000000..86dd9ddae --- /dev/null +++ b/test/web/activity_pub/mrf/force_bot_unlisted_policy_test.exs @@ -0,0 +1,60 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.MRF.ForceBotUnlistedPolicyTest do + use Pleroma.DataCase + import Pleroma.Factory + + alias Pleroma.Web.ActivityPub.MRF.ForceBotUnlistedPolicy + @public "https://www.w3.org/ns/activitystreams#Public" + + defp generate_messages(actor) do + {%{ + "actor" => actor.ap_id, + "type" => "Create", + "object" => %{}, + "to" => [@public, "f"], + "cc" => [actor.follower_address, "d"] + }, + %{ + "actor" => actor.ap_id, + "type" => "Create", + "object" => %{"to" => ["f", actor.follower_address], "cc" => ["d", @public]}, + "to" => ["f", actor.follower_address], + "cc" => ["d", @public] + }} + end + + test "removes from the federated timeline by nickname heuristics 1" do + actor = insert(:user, %{nickname: "annoying_ebooks@example.com"}) + + {message, except_message} = generate_messages(actor) + + assert ForceBotUnlistedPolicy.filter(message) == {:ok, except_message} + end + + test "removes from the federated timeline by nickname heuristics 2" do + actor = insert(:user, %{nickname: "cirnonewsnetworkbot@meow.cat"}) + + {message, except_message} = generate_messages(actor) + + assert ForceBotUnlistedPolicy.filter(message) == {:ok, except_message} + end + + test "removes from the federated timeline by actor type Application" do + actor = insert(:user, %{actor_type: "Application"}) + + {message, except_message} = generate_messages(actor) + + assert ForceBotUnlistedPolicy.filter(message) == {:ok, except_message} + end + + test "removes from the federated timeline by actor type Service" do + actor = insert(:user, %{actor_type: "Service"}) + + {message, except_message} = generate_messages(actor) + + assert ForceBotUnlistedPolicy.filter(message) == {:ok, except_message} + end +end diff --git a/test/web/activity_pub/mrf/hellthread_policy_test.exs b/test/web/activity_pub/mrf/hellthread_policy_test.exs index 95ef0b168..26f5bcdaa 100644 --- a/test/web/activity_pub/mrf/hellthread_policy_test.exs +++ b/test/web/activity_pub/mrf/hellthread_policy_test.exs @@ -8,6 +8,8 @@ defmodule Pleroma.Web.ActivityPub.MRF.HellthreadPolicyTest do import Pleroma.Web.ActivityPub.MRF.HellthreadPolicy + alias Pleroma.Web.CommonAPI + setup do user = insert(:user) @@ -20,7 +22,10 @@ defmodule Pleroma.Web.ActivityPub.MRF.HellthreadPolicyTest do "https://instance.tld/users/user1", "https://instance.tld/users/user2", "https://instance.tld/users/user3" - ] + ], + "object" => %{ + "type" => "Note" + } } [user: user, message: message] @@ -28,13 +33,25 @@ defmodule Pleroma.Web.ActivityPub.MRF.HellthreadPolicyTest do setup do: clear_config(:mrf_hellthread) + test "doesn't die on chat messages" do + Pleroma.Config.put([:mrf_hellthread], %{delist_threshold: 2, reject_threshold: 0}) + + user = insert(:user) + other_user = insert(:user) + + {:ok, activity} = CommonAPI.post_chat_message(user, other_user, "moin") + + assert {:ok, _} = filter(activity.data) + end + describe "reject" do test "rejects the message if the recipient count is above reject_threshold", %{ message: message } do Pleroma.Config.put([:mrf_hellthread], %{delist_threshold: 0, reject_threshold: 2}) - {:reject, nil} = filter(message) + assert {:reject, "[HellthreadPolicy] 3 recipients is over the limit of 2"} == + filter(message) end test "does not reject the message if the recipient count is below reject_threshold", %{ diff --git a/test/web/activity_pub/mrf/keyword_policy_test.exs b/test/web/activity_pub/mrf/keyword_policy_test.exs index fd1f7aec8..b3d0f3d90 100644 --- a/test/web/activity_pub/mrf/keyword_policy_test.exs +++ b/test/web/activity_pub/mrf/keyword_policy_test.exs @@ -25,7 +25,8 @@ test "rejects if string matches in content" do } } - assert {:reject, nil} == KeywordPolicy.filter(message) + assert {:reject, "[KeywordPolicy] Matches with rejected keyword"} = + KeywordPolicy.filter(message) end test "rejects if string matches in summary" do @@ -39,7 +40,8 @@ test "rejects if string matches in summary" do } } - assert {:reject, nil} == KeywordPolicy.filter(message) + assert {:reject, "[KeywordPolicy] Matches with rejected keyword"} = + KeywordPolicy.filter(message) end test "rejects if regex matches in content" do @@ -55,7 +57,8 @@ test "rejects if regex matches in content" do } } - {:reject, nil} == KeywordPolicy.filter(message) + {:reject, "[KeywordPolicy] Matches with rejected keyword"} == + KeywordPolicy.filter(message) end) end @@ -72,7 +75,8 @@ test "rejects if regex matches in summary" do } } - {:reject, nil} == KeywordPolicy.filter(message) + {:reject, "[KeywordPolicy] Matches with rejected keyword"} == + KeywordPolicy.filter(message) end) end end diff --git a/test/web/activity_pub/mrf/mention_policy_test.exs b/test/web/activity_pub/mrf/mention_policy_test.exs index aa003bef5..220309cc9 100644 --- a/test/web/activity_pub/mrf/mention_policy_test.exs +++ b/test/web/activity_pub/mrf/mention_policy_test.exs @@ -76,7 +76,8 @@ test "to" do "to" => ["https://example.com/blocked"] } - assert MentionPolicy.filter(message) == {:reject, nil} + assert MentionPolicy.filter(message) == + {:reject, "[MentionPolicy] Rejected for mention of https://example.com/blocked"} end test "cc" do @@ -88,7 +89,8 @@ test "cc" do "cc" => ["https://example.com/blocked"] } - assert MentionPolicy.filter(message) == {:reject, nil} + assert MentionPolicy.filter(message) == + {:reject, "[MentionPolicy] Rejected for mention of https://example.com/blocked"} end end end diff --git a/test/web/activity_pub/mrf/mrf_test.exs b/test/web/activity_pub/mrf/mrf_test.exs index c941066f2..a63b25423 100644 --- a/test/web/activity_pub/mrf/mrf_test.exs +++ b/test/web/activity_pub/mrf/mrf_test.exs @@ -60,8 +60,6 @@ test "matches are case-insensitive" do end describe "describe/0" do - setup do: clear_config([:instance, :rewrite_policy]) - test "it works as expected with noop policy" do expected = %{ mrf_policies: ["NoOpPolicy"], @@ -72,7 +70,7 @@ test "it works as expected with noop policy" do end test "it works as expected with mock policy" do - Pleroma.Config.put([:instance, :rewrite_policy], [MRFModuleMock]) + clear_config([:mrf, :policies], [MRFModuleMock]) expected = %{ mrf_policies: ["MRFModuleMock"], diff --git a/test/web/activity_pub/mrf/object_age_policy_test.exs b/test/web/activity_pub/mrf/object_age_policy_test.exs index b0fb753bd..cf6acc9a2 100644 --- a/test/web/activity_pub/mrf/object_age_policy_test.exs +++ b/test/web/activity_pub/mrf/object_age_policy_test.exs @@ -38,6 +38,17 @@ defp get_new_message do end describe "with reject action" do + test "works with objects with empty to or cc fields" do + Config.put([:mrf_object_age, :actions], [:reject]) + + data = + get_old_message() + |> Map.put("cc", nil) + |> Map.put("to", nil) + + assert match?({:reject, _}, ObjectAgePolicy.filter(data)) + end + test "it rejects an old post" do Config.put([:mrf_object_age, :actions], [:reject]) @@ -56,6 +67,21 @@ test "it allows a new post" do end describe "with delist action" do + test "works with objects with empty to or cc fields" do + Config.put([:mrf_object_age, :actions], [:delist]) + + data = + get_old_message() + |> Map.put("cc", nil) + |> Map.put("to", nil) + + {:ok, _u} = User.get_or_fetch_by_ap_id(data["actor"]) + + {:ok, data} = ObjectAgePolicy.filter(data) + + assert Visibility.get_visibility(%{data: data}) == "unlisted" + end + test "it delists an old post" do Config.put([:mrf_object_age, :actions], [:delist]) @@ -80,6 +106,22 @@ test "it allows a new post" do end describe "with strip_followers action" do + test "works with objects with empty to or cc fields" do + Config.put([:mrf_object_age, :actions], [:strip_followers]) + + data = + get_old_message() + |> Map.put("cc", nil) + |> Map.put("to", nil) + + {:ok, user} = User.get_or_fetch_by_ap_id(data["actor"]) + + {:ok, data} = ObjectAgePolicy.filter(data) + + refute user.follower_address in data["to"] + refute user.follower_address in data["cc"] + end + test "it strips followers collections from an old post" do Config.put([:mrf_object_age, :actions], [:strip_followers]) diff --git a/test/web/activity_pub/mrf/reject_non_public_test.exs b/test/web/activity_pub/mrf/reject_non_public_test.exs index f36299b86..58b46b9a2 100644 --- a/test/web/activity_pub/mrf/reject_non_public_test.exs +++ b/test/web/activity_pub/mrf/reject_non_public_test.exs @@ -64,7 +64,7 @@ test "it's rejected when addrer of message in the follower addresses of user and } Pleroma.Config.put([:mrf_rejectnonpublic, :allow_followersonly], false) - assert {:reject, nil} = RejectNonPublic.filter(message) + assert {:reject, _} = RejectNonPublic.filter(message) end end @@ -94,7 +94,7 @@ test "it's reject when direct messages aren't allow" do } Pleroma.Config.put([:mrf_rejectnonpublic, :allow_direct], false) - assert {:reject, nil} = RejectNonPublic.filter(message) + assert {:reject, _} = RejectNonPublic.filter(message) end end end diff --git a/test/web/activity_pub/mrf/simple_policy_test.exs b/test/web/activity_pub/mrf/simple_policy_test.exs index b7b9bc6a2..d7dde62c4 100644 --- a/test/web/activity_pub/mrf/simple_policy_test.exs +++ b/test/web/activity_pub/mrf/simple_policy_test.exs @@ -7,6 +7,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicyTest do import Pleroma.Factory alias Pleroma.Config alias Pleroma.Web.ActivityPub.MRF.SimplePolicy + alias Pleroma.Web.CommonAPI setup do: clear_config(:mrf_simple, @@ -15,6 +16,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicyTest do federated_timeline_removal: [], report_removal: [], reject: [], + followers_only: [], accept: [], avatar_removal: [], banner_removal: [], @@ -124,7 +126,7 @@ test "has a matching host" do report_message = build_report_message() local_message = build_local_message() - assert SimplePolicy.filter(report_message) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(report_message) assert SimplePolicy.filter(local_message) == {:ok, local_message} end @@ -133,7 +135,7 @@ test "match with wildcard domain" do report_message = build_report_message() local_message = build_local_message() - assert SimplePolicy.filter(report_message) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(report_message) assert SimplePolicy.filter(local_message) == {:ok, local_message} end end @@ -241,7 +243,7 @@ test "activity has a matching host" do remote_message = build_remote_message() - assert SimplePolicy.filter(remote_message) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(remote_message) end test "activity matches with wildcard domain" do @@ -249,7 +251,7 @@ test "activity matches with wildcard domain" do remote_message = build_remote_message() - assert SimplePolicy.filter(remote_message) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(remote_message) end test "actor has a matching host" do @@ -257,7 +259,65 @@ test "actor has a matching host" do remote_user = build_remote_user() - assert SimplePolicy.filter(remote_user) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(remote_user) + end + end + + describe "when :followers_only" do + test "is empty" do + Config.put([:mrf_simple, :followers_only], []) + {_, ftl_message} = build_ftl_actor_and_message() + local_message = build_local_message() + + assert SimplePolicy.filter(ftl_message) == {:ok, ftl_message} + assert SimplePolicy.filter(local_message) == {:ok, local_message} + end + + test "has a matching host" do + actor = insert(:user) + following_user = insert(:user) + non_following_user = insert(:user) + + {:ok, _, _, _} = CommonAPI.follow(following_user, actor) + + activity = %{ + "actor" => actor.ap_id, + "to" => [ + "https://www.w3.org/ns/activitystreams#Public", + following_user.ap_id, + non_following_user.ap_id + ], + "cc" => [actor.follower_address, "http://foo.bar/qux"] + } + + dm_activity = %{ + "actor" => actor.ap_id, + "to" => [ + following_user.ap_id, + non_following_user.ap_id + ], + "cc" => [] + } + + actor_domain = + activity + |> Map.fetch!("actor") + |> URI.parse() + |> Map.fetch!(:host) + + Config.put([:mrf_simple, :followers_only], [actor_domain]) + + assert {:ok, new_activity} = SimplePolicy.filter(activity) + assert actor.follower_address in new_activity["cc"] + assert following_user.ap_id in new_activity["to"] + refute "https://www.w3.org/ns/activitystreams#Public" in new_activity["to"] + refute "https://www.w3.org/ns/activitystreams#Public" in new_activity["cc"] + refute non_following_user.ap_id in new_activity["to"] + refute non_following_user.ap_id in new_activity["cc"] + + assert {:ok, new_dm_activity} = SimplePolicy.filter(dm_activity) + assert new_dm_activity["to"] == [following_user.ap_id] + assert new_dm_activity["cc"] == [] end end @@ -279,7 +339,7 @@ test "is not empty but activity doesn't have a matching host" do remote_message = build_remote_message() assert SimplePolicy.filter(local_message) == {:ok, local_message} - assert SimplePolicy.filter(remote_message) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(remote_message) end test "activity has a matching host" do @@ -429,7 +489,7 @@ test "it accepts deletions even from non-whitelisted servers" do test "it rejects the deletion" do deletion_message = build_remote_deletion_message() - assert SimplePolicy.filter(deletion_message) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(deletion_message) end end @@ -439,7 +499,7 @@ test "it rejects the deletion" do test "it rejects the deletion" do deletion_message = build_remote_deletion_message() - assert SimplePolicy.filter(deletion_message) == {:reject, nil} + assert {:reject, _} = SimplePolicy.filter(deletion_message) end end diff --git a/test/web/activity_pub/mrf/tag_policy_test.exs b/test/web/activity_pub/mrf/tag_policy_test.exs index e7793641a..6ff71d640 100644 --- a/test/web/activity_pub/mrf/tag_policy_test.exs +++ b/test/web/activity_pub/mrf/tag_policy_test.exs @@ -12,8 +12,8 @@ defmodule Pleroma.Web.ActivityPub.MRF.TagPolicyTest do describe "mrf_tag:disable-any-subscription" do test "rejects message" do actor = insert(:user, tags: ["mrf_tag:disable-any-subscription"]) - message = %{"object" => actor.ap_id, "type" => "Follow"} - assert {:reject, nil} = TagPolicy.filter(message) + message = %{"object" => actor.ap_id, "type" => "Follow", "actor" => actor.ap_id} + assert {:reject, _} = TagPolicy.filter(message) end end @@ -22,7 +22,7 @@ test "rejects non-local follow requests" do actor = insert(:user, tags: ["mrf_tag:disable-remote-subscription"]) follower = insert(:user, tags: ["mrf_tag:disable-remote-subscription"], local: false) message = %{"object" => actor.ap_id, "type" => "Follow", "actor" => follower.ap_id} - assert {:reject, nil} = TagPolicy.filter(message) + assert {:reject, _} = TagPolicy.filter(message) end test "allows non-local follow requests" do diff --git a/test/web/activity_pub/mrf/user_allowlist_policy_test.exs b/test/web/activity_pub/mrf/user_allowlist_policy_test.exs index ba1b69658..8e1ad5bc8 100644 --- a/test/web/activity_pub/mrf/user_allowlist_policy_test.exs +++ b/test/web/activity_pub/mrf/user_allowlist_policy_test.exs @@ -26,6 +26,6 @@ test "rejected if allow list isn't empty and user not in allow list" do actor = insert(:user) Pleroma.Config.put([:mrf_user_allowlist], %{"localhost" => ["test-ap-id"]}) message = %{"actor" => actor.ap_id} - assert UserAllowListPolicy.filter(message) == {:reject, nil} + assert {:reject, _} = UserAllowListPolicy.filter(message) end end diff --git a/test/web/activity_pub/mrf/vocabulary_policy_test.exs b/test/web/activity_pub/mrf/vocabulary_policy_test.exs index 69f22bb77..2bceb67ee 100644 --- a/test/web/activity_pub/mrf/vocabulary_policy_test.exs +++ b/test/web/activity_pub/mrf/vocabulary_policy_test.exs @@ -46,7 +46,7 @@ test "it does not accept disallowed child objects" do } } - {:reject, nil} = VocabularyPolicy.filter(message) + {:reject, _} = VocabularyPolicy.filter(message) end test "it does not accept disallowed parent types" do @@ -60,7 +60,7 @@ test "it does not accept disallowed parent types" do } } - {:reject, nil} = VocabularyPolicy.filter(message) + {:reject, _} = VocabularyPolicy.filter(message) end end @@ -75,7 +75,7 @@ test "it rejects based on parent activity type" do "object" => "whatever" } - {:reject, nil} = VocabularyPolicy.filter(message) + {:reject, _} = VocabularyPolicy.filter(message) end test "it rejects based on child object type" do @@ -89,7 +89,7 @@ test "it rejects based on child object type" do } } - {:reject, nil} = VocabularyPolicy.filter(message) + {:reject, _} = VocabularyPolicy.filter(message) end test "it passes through objects that aren't disallowed" do diff --git a/test/web/activity_pub/object_validator_test.exs b/test/web/activity_pub/object_validator_test.exs deleted file mode 100644 index ee1e1bcfe..000000000 --- a/test/web/activity_pub/object_validator_test.exs +++ /dev/null @@ -1,625 +0,0 @@ -defmodule Pleroma.Web.ActivityPub.ObjectValidatorTest do - use Pleroma.DataCase - - alias Pleroma.Object - alias Pleroma.Web.ActivityPub.ActivityPub - alias Pleroma.Web.ActivityPub.Builder - alias Pleroma.Web.ActivityPub.ObjectValidator - alias Pleroma.Web.ActivityPub.ObjectValidators.AttachmentValidator - alias Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator - alias Pleroma.Web.ActivityPub.Utils - alias Pleroma.Web.CommonAPI - - import Pleroma.Factory - - describe "attachments" do - test "works with honkerific attachments" do - attachment = %{ - "mediaType" => "", - "name" => "", - "summary" => "298p3RG7j27tfsZ9RQ.jpg", - "type" => "Document", - "url" => "https://honk.tedunangst.com/d/298p3RG7j27tfsZ9RQ.jpg" - } - - assert {:ok, attachment} = - AttachmentValidator.cast_and_validate(attachment) - |> Ecto.Changeset.apply_action(:insert) - - assert attachment.mediaType == "application/octet-stream" - end - - test "it turns mastodon attachments into our attachments" do - attachment = %{ - "url" => - "http://mastodon.example.org/system/media_attachments/files/000/000/002/original/334ce029e7bfb920.jpg", - "type" => "Document", - "name" => nil, - "mediaType" => "image/jpeg" - } - - {:ok, attachment} = - AttachmentValidator.cast_and_validate(attachment) - |> Ecto.Changeset.apply_action(:insert) - - assert [ - %{ - href: - "http://mastodon.example.org/system/media_attachments/files/000/000/002/original/334ce029e7bfb920.jpg", - type: "Link", - mediaType: "image/jpeg" - } - ] = attachment.url - - assert attachment.mediaType == "image/jpeg" - end - - test "it handles our own uploads" do - user = insert(:user) - - file = %Plug.Upload{ - content_type: "image/jpeg", - path: Path.absname("test/fixtures/image.jpg"), - filename: "an_image.jpg" - } - - {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) - - {:ok, attachment} = - attachment.data - |> AttachmentValidator.cast_and_validate() - |> Ecto.Changeset.apply_action(:insert) - - assert attachment.mediaType == "image/jpeg" - end - end - - describe "chat message create activities" do - test "it is invalid if the object already exists" do - user = insert(:user) - recipient = insert(:user) - {:ok, activity} = CommonAPI.post_chat_message(user, recipient, "hey") - object = Object.normalize(activity, false) - - {:ok, create_data, _} = Builder.create(user, object.data, [recipient.ap_id]) - - {:error, cng} = ObjectValidator.validate(create_data, []) - - assert {:object, {"The object to create already exists", []}} in cng.errors - end - - test "it is invalid if the object data has a different `to` or `actor` field" do - user = insert(:user) - recipient = insert(:user) - {:ok, object_data, _} = Builder.chat_message(recipient, user.ap_id, "Hey") - - {:ok, create_data, _} = Builder.create(user, object_data, [recipient.ap_id]) - - {:error, cng} = ObjectValidator.validate(create_data, []) - - assert {:to, {"Recipients don't match with object recipients", []}} in cng.errors - assert {:actor, {"Actor doesn't match with object actor", []}} in cng.errors - end - end - - describe "chat messages" do - setup do - clear_config([:instance, :remote_limit]) - user = insert(:user) - recipient = insert(:user, local: false) - - {:ok, valid_chat_message, _} = Builder.chat_message(user, recipient.ap_id, "hey :firefox:") - - %{user: user, recipient: recipient, valid_chat_message: valid_chat_message} - end - - test "let's through some basic html", %{user: user, recipient: recipient} do - {:ok, valid_chat_message, _} = - Builder.chat_message( - user, - recipient.ap_id, - "hey example " - ) - - assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) - - assert object["content"] == - "hey example alert('uguu')" - end - - test "validates for a basic object we build", %{valid_chat_message: valid_chat_message} do - assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) - - assert Map.put(valid_chat_message, "attachment", nil) == object - end - - test "validates for a basic object with an attachment", %{ - valid_chat_message: valid_chat_message, - user: user - } do - file = %Plug.Upload{ - content_type: "image/jpg", - path: Path.absname("test/fixtures/image.jpg"), - filename: "an_image.jpg" - } - - {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) - - valid_chat_message = - valid_chat_message - |> Map.put("attachment", attachment.data) - - assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) - - assert object["attachment"] - end - - test "validates for a basic object with an attachment in an array", %{ - valid_chat_message: valid_chat_message, - user: user - } do - file = %Plug.Upload{ - content_type: "image/jpg", - path: Path.absname("test/fixtures/image.jpg"), - filename: "an_image.jpg" - } - - {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) - - valid_chat_message = - valid_chat_message - |> Map.put("attachment", [attachment.data]) - - assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) - - assert object["attachment"] - end - - test "validates for a basic object with an attachment but without content", %{ - valid_chat_message: valid_chat_message, - user: user - } do - file = %Plug.Upload{ - content_type: "image/jpg", - path: Path.absname("test/fixtures/image.jpg"), - filename: "an_image.jpg" - } - - {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) - - valid_chat_message = - valid_chat_message - |> Map.put("attachment", attachment.data) - |> Map.delete("content") - - assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) - - assert object["attachment"] - end - - test "does not validate if the message has no content", %{ - valid_chat_message: valid_chat_message - } do - contentless = - valid_chat_message - |> Map.delete("content") - - refute match?({:ok, _object, _meta}, ObjectValidator.validate(contentless, [])) - end - - test "does not validate if the message is longer than the remote_limit", %{ - valid_chat_message: valid_chat_message - } do - Pleroma.Config.put([:instance, :remote_limit], 2) - refute match?({:ok, _object, _meta}, ObjectValidator.validate(valid_chat_message, [])) - end - - test "does not validate if the recipient is blocking the actor", %{ - valid_chat_message: valid_chat_message, - user: user, - recipient: recipient - } do - Pleroma.User.block(recipient, user) - refute match?({:ok, _object, _meta}, ObjectValidator.validate(valid_chat_message, [])) - end - - test "does not validate if the actor or the recipient is not in our system", %{ - valid_chat_message: valid_chat_message - } do - chat_message = - valid_chat_message - |> Map.put("actor", "https://raymoo.com/raymoo") - - {:error, _} = ObjectValidator.validate(chat_message, []) - - chat_message = - valid_chat_message - |> Map.put("to", ["https://raymoo.com/raymoo"]) - - {:error, _} = ObjectValidator.validate(chat_message, []) - end - - test "does not validate for a message with multiple recipients", %{ - valid_chat_message: valid_chat_message, - user: user, - recipient: recipient - } do - chat_message = - valid_chat_message - |> Map.put("to", [user.ap_id, recipient.ap_id]) - - assert {:error, _} = ObjectValidator.validate(chat_message, []) - end - - test "does not validate if it doesn't concern local users" do - user = insert(:user, local: false) - recipient = insert(:user, local: false) - - {:ok, valid_chat_message, _} = Builder.chat_message(user, recipient.ap_id, "hey") - assert {:error, _} = ObjectValidator.validate(valid_chat_message, []) - end - end - - describe "EmojiReacts" do - setup do - user = insert(:user) - {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) - - object = Pleroma.Object.get_by_ap_id(post_activity.data["object"]) - - {:ok, valid_emoji_react, []} = Builder.emoji_react(user, object, "👌") - - %{user: user, post_activity: post_activity, valid_emoji_react: valid_emoji_react} - end - - test "it validates a valid EmojiReact", %{valid_emoji_react: valid_emoji_react} do - assert {:ok, _, _} = ObjectValidator.validate(valid_emoji_react, []) - end - - test "it is not valid without a 'content' field", %{valid_emoji_react: valid_emoji_react} do - without_content = - valid_emoji_react - |> Map.delete("content") - - {:error, cng} = ObjectValidator.validate(without_content, []) - - refute cng.valid? - assert {:content, {"can't be blank", [validation: :required]}} in cng.errors - end - - test "it is not valid with a non-emoji content field", %{valid_emoji_react: valid_emoji_react} do - without_emoji_content = - valid_emoji_react - |> Map.put("content", "x") - - {:error, cng} = ObjectValidator.validate(without_emoji_content, []) - - refute cng.valid? - - assert {:content, {"must be a single character emoji", []}} in cng.errors - end - end - - describe "Undos" do - setup do - user = insert(:user) - {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) - {:ok, like} = CommonAPI.favorite(user, post_activity.id) - {:ok, valid_like_undo, []} = Builder.undo(user, like) - - %{user: user, like: like, valid_like_undo: valid_like_undo} - end - - test "it validates a basic like undo", %{valid_like_undo: valid_like_undo} do - assert {:ok, _, _} = ObjectValidator.validate(valid_like_undo, []) - end - - test "it does not validate if the actor of the undo is not the actor of the object", %{ - valid_like_undo: valid_like_undo - } do - other_user = insert(:user, ap_id: "https://gensokyo.2hu/users/raymoo") - - bad_actor = - valid_like_undo - |> Map.put("actor", other_user.ap_id) - - {:error, cng} = ObjectValidator.validate(bad_actor, []) - - assert {:actor, {"not the same as object actor", []}} in cng.errors - end - - test "it does not validate if the object is missing", %{valid_like_undo: valid_like_undo} do - missing_object = - valid_like_undo - |> Map.put("object", "https://gensokyo.2hu/objects/1") - - {:error, cng} = ObjectValidator.validate(missing_object, []) - - assert {:object, {"can't find object", []}} in cng.errors - assert length(cng.errors) == 1 - end - end - - describe "deletes" do - setup do - user = insert(:user) - {:ok, post_activity} = CommonAPI.post(user, %{status: "cancel me daddy"}) - - {:ok, valid_post_delete, _} = Builder.delete(user, post_activity.data["object"]) - {:ok, valid_user_delete, _} = Builder.delete(user, user.ap_id) - - %{user: user, valid_post_delete: valid_post_delete, valid_user_delete: valid_user_delete} - end - - test "it is valid for a post deletion", %{valid_post_delete: valid_post_delete} do - {:ok, valid_post_delete, _} = ObjectValidator.validate(valid_post_delete, []) - - assert valid_post_delete["deleted_activity_id"] - end - - test "it is invalid if the object isn't in a list of certain types", %{ - valid_post_delete: valid_post_delete - } do - object = Object.get_by_ap_id(valid_post_delete["object"]) - - data = - object.data - |> Map.put("type", "Like") - - {:ok, _object} = - object - |> Ecto.Changeset.change(%{data: data}) - |> Object.update_and_set_cache() - - {:error, cng} = ObjectValidator.validate(valid_post_delete, []) - assert {:object, {"object not in allowed types", []}} in cng.errors - end - - test "it is valid for a user deletion", %{valid_user_delete: valid_user_delete} do - assert match?({:ok, _, _}, ObjectValidator.validate(valid_user_delete, [])) - end - - test "it's invalid if the id is missing", %{valid_post_delete: valid_post_delete} do - no_id = - valid_post_delete - |> Map.delete("id") - - {:error, cng} = ObjectValidator.validate(no_id, []) - - assert {:id, {"can't be blank", [validation: :required]}} in cng.errors - end - - test "it's invalid if the object doesn't exist", %{valid_post_delete: valid_post_delete} do - missing_object = - valid_post_delete - |> Map.put("object", "http://does.not/exist") - - {:error, cng} = ObjectValidator.validate(missing_object, []) - - assert {:object, {"can't find object", []}} in cng.errors - end - - test "it's invalid if the actor of the object and the actor of delete are from different domains", - %{valid_post_delete: valid_post_delete} do - valid_user = insert(:user) - - valid_other_actor = - valid_post_delete - |> Map.put("actor", valid_user.ap_id) - - assert match?({:ok, _, _}, ObjectValidator.validate(valid_other_actor, [])) - - invalid_other_actor = - valid_post_delete - |> Map.put("actor", "https://gensokyo.2hu/users/raymoo") - - {:error, cng} = ObjectValidator.validate(invalid_other_actor, []) - - assert {:actor, {"is not allowed to delete object", []}} in cng.errors - end - - test "it's valid if the actor of the object is a local superuser", - %{valid_post_delete: valid_post_delete} do - user = - insert(:user, local: true, is_moderator: true, ap_id: "https://gensokyo.2hu/users/raymoo") - - valid_other_actor = - valid_post_delete - |> Map.put("actor", user.ap_id) - - {:ok, _, meta} = ObjectValidator.validate(valid_other_actor, []) - assert meta[:do_not_federate] - end - end - - describe "likes" do - setup do - user = insert(:user) - {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) - - valid_like = %{ - "to" => [user.ap_id], - "cc" => [], - "type" => "Like", - "id" => Utils.generate_activity_id(), - "object" => post_activity.data["object"], - "actor" => user.ap_id, - "context" => "a context" - } - - %{valid_like: valid_like, user: user, post_activity: post_activity} - end - - test "returns ok when called in the ObjectValidator", %{valid_like: valid_like} do - {:ok, object, _meta} = ObjectValidator.validate(valid_like, []) - - assert "id" in Map.keys(object) - end - - test "is valid for a valid object", %{valid_like: valid_like} do - assert LikeValidator.cast_and_validate(valid_like).valid? - end - - test "sets the 'to' field to the object actor if no recipients are given", %{ - valid_like: valid_like, - user: user - } do - without_recipients = - valid_like - |> Map.delete("to") - - {:ok, object, _meta} = ObjectValidator.validate(without_recipients, []) - - assert object["to"] == [user.ap_id] - end - - test "sets the context field to the context of the object if no context is given", %{ - valid_like: valid_like, - post_activity: post_activity - } do - without_context = - valid_like - |> Map.delete("context") - - {:ok, object, _meta} = ObjectValidator.validate(without_context, []) - - assert object["context"] == post_activity.data["context"] - end - - test "it errors when the actor is missing or not known", %{valid_like: valid_like} do - without_actor = Map.delete(valid_like, "actor") - - refute LikeValidator.cast_and_validate(without_actor).valid? - - with_invalid_actor = Map.put(valid_like, "actor", "invalidactor") - - refute LikeValidator.cast_and_validate(with_invalid_actor).valid? - end - - test "it errors when the object is missing or not known", %{valid_like: valid_like} do - without_object = Map.delete(valid_like, "object") - - refute LikeValidator.cast_and_validate(without_object).valid? - - with_invalid_object = Map.put(valid_like, "object", "invalidobject") - - refute LikeValidator.cast_and_validate(with_invalid_object).valid? - end - - test "it errors when the actor has already like the object", %{ - valid_like: valid_like, - user: user, - post_activity: post_activity - } do - _like = CommonAPI.favorite(user, post_activity.id) - - refute LikeValidator.cast_and_validate(valid_like).valid? - end - - test "it works when actor or object are wrapped in maps", %{valid_like: valid_like} do - wrapped_like = - valid_like - |> Map.put("actor", %{"id" => valid_like["actor"]}) - |> Map.put("object", %{"id" => valid_like["object"]}) - - validated = LikeValidator.cast_and_validate(wrapped_like) - - assert validated.valid? - - assert {:actor, valid_like["actor"]} in validated.changes - assert {:object, valid_like["object"]} in validated.changes - end - end - - describe "announces" do - setup do - user = insert(:user) - announcer = insert(:user) - {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) - - object = Object.normalize(post_activity, false) - {:ok, valid_announce, []} = Builder.announce(announcer, object) - - %{ - valid_announce: valid_announce, - user: user, - post_activity: post_activity, - announcer: announcer - } - end - - test "returns ok for a valid announce", %{valid_announce: valid_announce} do - assert {:ok, _object, _meta} = ObjectValidator.validate(valid_announce, []) - end - - test "returns an error if the object can't be found", %{valid_announce: valid_announce} do - without_object = - valid_announce - |> Map.delete("object") - - {:error, cng} = ObjectValidator.validate(without_object, []) - - assert {:object, {"can't be blank", [validation: :required]}} in cng.errors - - nonexisting_object = - valid_announce - |> Map.put("object", "https://gensokyo.2hu/objects/99999999") - - {:error, cng} = ObjectValidator.validate(nonexisting_object, []) - - assert {:object, {"can't find object", []}} in cng.errors - end - - test "returns an error if we don't have the actor", %{valid_announce: valid_announce} do - nonexisting_actor = - valid_announce - |> Map.put("actor", "https://gensokyo.2hu/users/raymoo") - - {:error, cng} = ObjectValidator.validate(nonexisting_actor, []) - - assert {:actor, {"can't find user", []}} in cng.errors - end - - test "returns an error if the actor already announced the object", %{ - valid_announce: valid_announce, - announcer: announcer, - post_activity: post_activity - } do - _announce = CommonAPI.repeat(post_activity.id, announcer) - - {:error, cng} = ObjectValidator.validate(valid_announce, []) - - assert {:actor, {"already announced this object", []}} in cng.errors - assert {:object, {"already announced by this actor", []}} in cng.errors - end - - test "returns an error if the actor can't announce the object", %{ - announcer: announcer, - user: user - } do - {:ok, post_activity} = - CommonAPI.post(user, %{status: "a secret post", visibility: "private"}) - - object = Object.normalize(post_activity, false) - - # Another user can't announce it - {:ok, announce, []} = Builder.announce(announcer, object, public: false) - - {:error, cng} = ObjectValidator.validate(announce, []) - - assert {:actor, {"can not announce this object", []}} in cng.errors - - # The actor of the object can announce it - {:ok, announce, []} = Builder.announce(user, object, public: false) - - assert {:ok, _, _} = ObjectValidator.validate(announce, []) - - # The actor of the object can not announce it publicly - {:ok, announce, []} = Builder.announce(user, object, public: true) - - {:error, cng} = ObjectValidator.validate(announce, []) - - assert {:actor, {"can not announce this object publicly", []}} in cng.errors - end - end -end diff --git a/test/web/activity_pub/object_validators/accept_validation_test.exs b/test/web/activity_pub/object_validators/accept_validation_test.exs new file mode 100644 index 000000000..d6111ba41 --- /dev/null +++ b/test/web/activity_pub/object_validators/accept_validation_test.exs @@ -0,0 +1,56 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.AcceptValidationTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.ActivityPub.Pipeline + + import Pleroma.Factory + + setup do + follower = insert(:user) + followed = insert(:user, local: false) + + {:ok, follow_data, _} = Builder.follow(follower, followed) + {:ok, follow_activity, _} = Pipeline.common_pipeline(follow_data, local: true) + + {:ok, accept_data, _} = Builder.accept(followed, follow_activity) + + %{accept_data: accept_data, followed: followed} + end + + test "it validates a basic 'accept'", %{accept_data: accept_data} do + assert {:ok, _, _} = ObjectValidator.validate(accept_data, []) + end + + test "it fails when the actor doesn't exist", %{accept_data: accept_data} do + accept_data = + accept_data + |> Map.put("actor", "https://gensokyo.2hu/users/raymoo") + + assert {:error, _} = ObjectValidator.validate(accept_data, []) + end + + test "it fails when the accepted activity doesn't exist", %{accept_data: accept_data} do + accept_data = + accept_data + |> Map.put("object", "https://gensokyo.2hu/users/raymoo/follows/1") + + assert {:error, _} = ObjectValidator.validate(accept_data, []) + end + + test "for an accepted follow, it only validates if the actor of the accept is the followed actor", + %{accept_data: accept_data} do + stranger = insert(:user) + + accept_data = + accept_data + |> Map.put("actor", stranger.ap_id) + + assert {:error, _} = ObjectValidator.validate(accept_data, []) + end +end diff --git a/test/web/activity_pub/object_validators/announce_validation_test.exs b/test/web/activity_pub/object_validators/announce_validation_test.exs new file mode 100644 index 000000000..623342f76 --- /dev/null +++ b/test/web/activity_pub/object_validators/announce_validation_test.exs @@ -0,0 +1,106 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.AnnouncValidationTest do + use Pleroma.DataCase + + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + describe "announces" do + setup do + user = insert(:user) + announcer = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) + + object = Object.normalize(post_activity, false) + {:ok, valid_announce, []} = Builder.announce(announcer, object) + + %{ + valid_announce: valid_announce, + user: user, + post_activity: post_activity, + announcer: announcer + } + end + + test "returns ok for a valid announce", %{valid_announce: valid_announce} do + assert {:ok, _object, _meta} = ObjectValidator.validate(valid_announce, []) + end + + test "returns an error if the object can't be found", %{valid_announce: valid_announce} do + without_object = + valid_announce + |> Map.delete("object") + + {:error, cng} = ObjectValidator.validate(without_object, []) + + assert {:object, {"can't be blank", [validation: :required]}} in cng.errors + + nonexisting_object = + valid_announce + |> Map.put("object", "https://gensokyo.2hu/objects/99999999") + + {:error, cng} = ObjectValidator.validate(nonexisting_object, []) + + assert {:object, {"can't find object", []}} in cng.errors + end + + test "returns an error if we don't have the actor", %{valid_announce: valid_announce} do + nonexisting_actor = + valid_announce + |> Map.put("actor", "https://gensokyo.2hu/users/raymoo") + + {:error, cng} = ObjectValidator.validate(nonexisting_actor, []) + + assert {:actor, {"can't find user", []}} in cng.errors + end + + test "returns an error if the actor already announced the object", %{ + valid_announce: valid_announce, + announcer: announcer, + post_activity: post_activity + } do + _announce = CommonAPI.repeat(post_activity.id, announcer) + + {:error, cng} = ObjectValidator.validate(valid_announce, []) + + assert {:actor, {"already announced this object", []}} in cng.errors + assert {:object, {"already announced by this actor", []}} in cng.errors + end + + test "returns an error if the actor can't announce the object", %{ + announcer: announcer, + user: user + } do + {:ok, post_activity} = + CommonAPI.post(user, %{status: "a secret post", visibility: "private"}) + + object = Object.normalize(post_activity, false) + + # Another user can't announce it + {:ok, announce, []} = Builder.announce(announcer, object, public: false) + + {:error, cng} = ObjectValidator.validate(announce, []) + + assert {:actor, {"can not announce this object", []}} in cng.errors + + # The actor of the object can announce it + {:ok, announce, []} = Builder.announce(user, object, public: false) + + assert {:ok, _, _} = ObjectValidator.validate(announce, []) + + # The actor of the object can not announce it publicly + {:ok, announce, []} = Builder.announce(user, object, public: true) + + {:error, cng} = ObjectValidator.validate(announce, []) + + assert {:actor, {"can not announce this object publicly", []}} in cng.errors + end + end +end diff --git a/test/web/activity_pub/object_validators/attachment_validator_test.exs b/test/web/activity_pub/object_validators/attachment_validator_test.exs new file mode 100644 index 000000000..558bb3131 --- /dev/null +++ b/test/web/activity_pub/object_validators/attachment_validator_test.exs @@ -0,0 +1,74 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.AttachmentValidatorTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.ObjectValidators.AttachmentValidator + + import Pleroma.Factory + + describe "attachments" do + test "works with honkerific attachments" do + attachment = %{ + "mediaType" => "", + "name" => "", + "summary" => "298p3RG7j27tfsZ9RQ.jpg", + "type" => "Document", + "url" => "https://honk.tedunangst.com/d/298p3RG7j27tfsZ9RQ.jpg" + } + + assert {:ok, attachment} = + AttachmentValidator.cast_and_validate(attachment) + |> Ecto.Changeset.apply_action(:insert) + + assert attachment.mediaType == "application/octet-stream" + end + + test "it turns mastodon attachments into our attachments" do + attachment = %{ + "url" => + "http://mastodon.example.org/system/media_attachments/files/000/000/002/original/334ce029e7bfb920.jpg", + "type" => "Document", + "name" => nil, + "mediaType" => "image/jpeg" + } + + {:ok, attachment} = + AttachmentValidator.cast_and_validate(attachment) + |> Ecto.Changeset.apply_action(:insert) + + assert [ + %{ + href: + "http://mastodon.example.org/system/media_attachments/files/000/000/002/original/334ce029e7bfb920.jpg", + type: "Link", + mediaType: "image/jpeg" + } + ] = attachment.url + + assert attachment.mediaType == "image/jpeg" + end + + test "it handles our own uploads" do + user = insert(:user) + + file = %Plug.Upload{ + content_type: "image/jpg", + path: Path.absname("test/fixtures/image.jpg"), + filename: "an_image.jpg" + } + + {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) + + {:ok, attachment} = + attachment.data + |> AttachmentValidator.cast_and_validate() + |> Ecto.Changeset.apply_action(:insert) + + assert attachment.mediaType == "image/jpeg" + end + end +end diff --git a/test/web/activity_pub/object_validators/block_validation_test.exs b/test/web/activity_pub/object_validators/block_validation_test.exs new file mode 100644 index 000000000..c08d4b2e8 --- /dev/null +++ b/test/web/activity_pub/object_validators/block_validation_test.exs @@ -0,0 +1,39 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.BlockValidationTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + + import Pleroma.Factory + + describe "blocks" do + setup do + user = insert(:user, local: false) + blocked = insert(:user) + + {:ok, valid_block, []} = Builder.block(user, blocked) + + %{user: user, valid_block: valid_block} + end + + test "validates a basic object", %{ + valid_block: valid_block + } do + assert {:ok, _block, []} = ObjectValidator.validate(valid_block, []) + end + + test "returns an error if we don't know the blocked user", %{ + valid_block: valid_block + } do + block = + valid_block + |> Map.put("object", "https://gensokyo.2hu/users/raymoo") + + assert {:error, _cng} = ObjectValidator.validate(block, []) + end + end +end diff --git a/test/web/activity_pub/object_validators/chat_validation_test.exs b/test/web/activity_pub/object_validators/chat_validation_test.exs new file mode 100644 index 000000000..16e4808e5 --- /dev/null +++ b/test/web/activity_pub/object_validators/chat_validation_test.exs @@ -0,0 +1,212 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.ChatValidationTest do + use Pleroma.DataCase + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + describe "chat message create activities" do + test "it is invalid if the object already exists" do + user = insert(:user) + recipient = insert(:user) + {:ok, activity} = CommonAPI.post_chat_message(user, recipient, "hey") + object = Object.normalize(activity, false) + + {:ok, create_data, _} = Builder.create(user, object.data, [recipient.ap_id]) + + {:error, cng} = ObjectValidator.validate(create_data, []) + + assert {:object, {"The object to create already exists", []}} in cng.errors + end + + test "it is invalid if the object data has a different `to` or `actor` field" do + user = insert(:user) + recipient = insert(:user) + {:ok, object_data, _} = Builder.chat_message(recipient, user.ap_id, "Hey") + + {:ok, create_data, _} = Builder.create(user, object_data, [recipient.ap_id]) + + {:error, cng} = ObjectValidator.validate(create_data, []) + + assert {:to, {"Recipients don't match with object recipients", []}} in cng.errors + assert {:actor, {"Actor doesn't match with object actor", []}} in cng.errors + end + end + + describe "chat messages" do + setup do + clear_config([:instance, :remote_limit]) + user = insert(:user) + recipient = insert(:user, local: false) + + {:ok, valid_chat_message, _} = Builder.chat_message(user, recipient.ap_id, "hey :firefox:") + + %{user: user, recipient: recipient, valid_chat_message: valid_chat_message} + end + + test "let's through some basic html", %{user: user, recipient: recipient} do + {:ok, valid_chat_message, _} = + Builder.chat_message( + user, + recipient.ap_id, + "hey example " + ) + + assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) + + assert object["content"] == + "hey example alert('uguu')" + end + + test "validates for a basic object we build", %{valid_chat_message: valid_chat_message} do + assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) + + assert Map.put(valid_chat_message, "attachment", nil) == object + assert match?(%{"firefox" => _}, object["emoji"]) + end + + test "validates for a basic object with an attachment", %{ + valid_chat_message: valid_chat_message, + user: user + } do + file = %Plug.Upload{ + content_type: "image/jpg", + path: Path.absname("test/fixtures/image.jpg"), + filename: "an_image.jpg" + } + + {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) + + valid_chat_message = + valid_chat_message + |> Map.put("attachment", attachment.data) + + assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) + + assert object["attachment"] + end + + test "validates for a basic object with an attachment in an array", %{ + valid_chat_message: valid_chat_message, + user: user + } do + file = %Plug.Upload{ + content_type: "image/jpg", + path: Path.absname("test/fixtures/image.jpg"), + filename: "an_image.jpg" + } + + {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) + + valid_chat_message = + valid_chat_message + |> Map.put("attachment", [attachment.data]) + + assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) + + assert object["attachment"] + end + + test "validates for a basic object with an attachment but without content", %{ + valid_chat_message: valid_chat_message, + user: user + } do + file = %Plug.Upload{ + content_type: "image/jpg", + path: Path.absname("test/fixtures/image.jpg"), + filename: "an_image.jpg" + } + + {:ok, attachment} = ActivityPub.upload(file, actor: user.ap_id) + + valid_chat_message = + valid_chat_message + |> Map.put("attachment", attachment.data) + |> Map.delete("content") + + assert {:ok, object, _meta} = ObjectValidator.validate(valid_chat_message, []) + + assert object["attachment"] + end + + test "does not validate if the message has no content", %{ + valid_chat_message: valid_chat_message + } do + contentless = + valid_chat_message + |> Map.delete("content") + + refute match?({:ok, _object, _meta}, ObjectValidator.validate(contentless, [])) + end + + test "does not validate if the message is longer than the remote_limit", %{ + valid_chat_message: valid_chat_message + } do + Pleroma.Config.put([:instance, :remote_limit], 2) + refute match?({:ok, _object, _meta}, ObjectValidator.validate(valid_chat_message, [])) + end + + test "does not validate if the recipient is blocking the actor", %{ + valid_chat_message: valid_chat_message, + user: user, + recipient: recipient + } do + Pleroma.User.block(recipient, user) + refute match?({:ok, _object, _meta}, ObjectValidator.validate(valid_chat_message, [])) + end + + test "does not validate if the recipient is not accepting chat messages", %{ + valid_chat_message: valid_chat_message, + recipient: recipient + } do + recipient + |> Ecto.Changeset.change(%{accepts_chat_messages: false}) + |> Pleroma.Repo.update!() + + refute match?({:ok, _object, _meta}, ObjectValidator.validate(valid_chat_message, [])) + end + + test "does not validate if the actor or the recipient is not in our system", %{ + valid_chat_message: valid_chat_message + } do + chat_message = + valid_chat_message + |> Map.put("actor", "https://raymoo.com/raymoo") + + {:error, _} = ObjectValidator.validate(chat_message, []) + + chat_message = + valid_chat_message + |> Map.put("to", ["https://raymoo.com/raymoo"]) + + {:error, _} = ObjectValidator.validate(chat_message, []) + end + + test "does not validate for a message with multiple recipients", %{ + valid_chat_message: valid_chat_message, + user: user, + recipient: recipient + } do + chat_message = + valid_chat_message + |> Map.put("to", [user.ap_id, recipient.ap_id]) + + assert {:error, _} = ObjectValidator.validate(chat_message, []) + end + + test "does not validate if it doesn't concern local users" do + user = insert(:user, local: false) + recipient = insert(:user, local: false) + + {:ok, valid_chat_message, _} = Builder.chat_message(user, recipient.ap_id, "hey") + assert {:error, _} = ObjectValidator.validate(valid_chat_message, []) + end + end +end diff --git a/test/web/activity_pub/object_validators/delete_validation_test.exs b/test/web/activity_pub/object_validators/delete_validation_test.exs new file mode 100644 index 000000000..02683b899 --- /dev/null +++ b/test/web/activity_pub/object_validators/delete_validation_test.exs @@ -0,0 +1,106 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidationTest do + use Pleroma.DataCase + + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + describe "deletes" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "cancel me daddy"}) + + {:ok, valid_post_delete, _} = Builder.delete(user, post_activity.data["object"]) + {:ok, valid_user_delete, _} = Builder.delete(user, user.ap_id) + + %{user: user, valid_post_delete: valid_post_delete, valid_user_delete: valid_user_delete} + end + + test "it is valid for a post deletion", %{valid_post_delete: valid_post_delete} do + {:ok, valid_post_delete, _} = ObjectValidator.validate(valid_post_delete, []) + + assert valid_post_delete["deleted_activity_id"] + end + + test "it is invalid if the object isn't in a list of certain types", %{ + valid_post_delete: valid_post_delete + } do + object = Object.get_by_ap_id(valid_post_delete["object"]) + + data = + object.data + |> Map.put("type", "Like") + + {:ok, _object} = + object + |> Ecto.Changeset.change(%{data: data}) + |> Object.update_and_set_cache() + + {:error, cng} = ObjectValidator.validate(valid_post_delete, []) + assert {:object, {"object not in allowed types", []}} in cng.errors + end + + test "it is valid for a user deletion", %{valid_user_delete: valid_user_delete} do + assert match?({:ok, _, _}, ObjectValidator.validate(valid_user_delete, [])) + end + + test "it's invalid if the id is missing", %{valid_post_delete: valid_post_delete} do + no_id = + valid_post_delete + |> Map.delete("id") + + {:error, cng} = ObjectValidator.validate(no_id, []) + + assert {:id, {"can't be blank", [validation: :required]}} in cng.errors + end + + test "it's invalid if the object doesn't exist", %{valid_post_delete: valid_post_delete} do + missing_object = + valid_post_delete + |> Map.put("object", "http://does.not/exist") + + {:error, cng} = ObjectValidator.validate(missing_object, []) + + assert {:object, {"can't find object", []}} in cng.errors + end + + test "it's invalid if the actor of the object and the actor of delete are from different domains", + %{valid_post_delete: valid_post_delete} do + valid_user = insert(:user) + + valid_other_actor = + valid_post_delete + |> Map.put("actor", valid_user.ap_id) + + assert match?({:ok, _, _}, ObjectValidator.validate(valid_other_actor, [])) + + invalid_other_actor = + valid_post_delete + |> Map.put("actor", "https://gensokyo.2hu/users/raymoo") + + {:error, cng} = ObjectValidator.validate(invalid_other_actor, []) + + assert {:actor, {"is not allowed to modify object", []}} in cng.errors + end + + test "it's valid if the actor of the object is a local superuser", + %{valid_post_delete: valid_post_delete} do + user = + insert(:user, local: true, is_moderator: true, ap_id: "https://gensokyo.2hu/users/raymoo") + + valid_other_actor = + valid_post_delete + |> Map.put("actor", user.ap_id) + + {:ok, _, meta} = ObjectValidator.validate(valid_other_actor, []) + assert meta[:do_not_federate] + end + end +end diff --git a/test/web/activity_pub/object_validators/emoji_react_validation_test.exs b/test/web/activity_pub/object_validators/emoji_react_validation_test.exs new file mode 100644 index 000000000..582e6d785 --- /dev/null +++ b/test/web/activity_pub/object_validators/emoji_react_validation_test.exs @@ -0,0 +1,53 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + describe "EmojiReacts" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) + + object = Pleroma.Object.get_by_ap_id(post_activity.data["object"]) + + {:ok, valid_emoji_react, []} = Builder.emoji_react(user, object, "👌") + + %{user: user, post_activity: post_activity, valid_emoji_react: valid_emoji_react} + end + + test "it validates a valid EmojiReact", %{valid_emoji_react: valid_emoji_react} do + assert {:ok, _, _} = ObjectValidator.validate(valid_emoji_react, []) + end + + test "it is not valid without a 'content' field", %{valid_emoji_react: valid_emoji_react} do + without_content = + valid_emoji_react + |> Map.delete("content") + + {:error, cng} = ObjectValidator.validate(without_content, []) + + refute cng.valid? + assert {:content, {"can't be blank", [validation: :required]}} in cng.errors + end + + test "it is not valid with a non-emoji content field", %{valid_emoji_react: valid_emoji_react} do + without_emoji_content = + valid_emoji_react + |> Map.put("content", "x") + + {:error, cng} = ObjectValidator.validate(without_emoji_content, []) + + refute cng.valid? + + assert {:content, {"must be a single character emoji", []}} in cng.errors + end + end +end diff --git a/test/web/activity_pub/object_validators/follow_validation_test.exs b/test/web/activity_pub/object_validators/follow_validation_test.exs new file mode 100644 index 000000000..6e1378be2 --- /dev/null +++ b/test/web/activity_pub/object_validators/follow_validation_test.exs @@ -0,0 +1,26 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.FollowValidationTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + + import Pleroma.Factory + + describe "Follows" do + setup do + follower = insert(:user) + followed = insert(:user) + + {:ok, valid_follow, []} = Builder.follow(follower, followed) + %{follower: follower, followed: followed, valid_follow: valid_follow} + end + + test "validates a basic follow object", %{valid_follow: valid_follow} do + assert {:ok, _follow, []} = ObjectValidator.validate(valid_follow, []) + end + end +end diff --git a/test/web/activity_pub/object_validators/like_validation_test.exs b/test/web/activity_pub/object_validators/like_validation_test.exs new file mode 100644 index 000000000..2c033b7e2 --- /dev/null +++ b/test/web/activity_pub/object_validators/like_validation_test.exs @@ -0,0 +1,113 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.LikeValidationTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator + alias Pleroma.Web.ActivityPub.Utils + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + describe "likes" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) + + valid_like = %{ + "to" => [user.ap_id], + "cc" => [], + "type" => "Like", + "id" => Utils.generate_activity_id(), + "object" => post_activity.data["object"], + "actor" => user.ap_id, + "context" => "a context" + } + + %{valid_like: valid_like, user: user, post_activity: post_activity} + end + + test "returns ok when called in the ObjectValidator", %{valid_like: valid_like} do + {:ok, object, _meta} = ObjectValidator.validate(valid_like, []) + + assert "id" in Map.keys(object) + end + + test "is valid for a valid object", %{valid_like: valid_like} do + assert LikeValidator.cast_and_validate(valid_like).valid? + end + + test "sets the 'to' field to the object actor if no recipients are given", %{ + valid_like: valid_like, + user: user + } do + without_recipients = + valid_like + |> Map.delete("to") + + {:ok, object, _meta} = ObjectValidator.validate(without_recipients, []) + + assert object["to"] == [user.ap_id] + end + + test "sets the context field to the context of the object if no context is given", %{ + valid_like: valid_like, + post_activity: post_activity + } do + without_context = + valid_like + |> Map.delete("context") + + {:ok, object, _meta} = ObjectValidator.validate(without_context, []) + + assert object["context"] == post_activity.data["context"] + end + + test "it errors when the actor is missing or not known", %{valid_like: valid_like} do + without_actor = Map.delete(valid_like, "actor") + + refute LikeValidator.cast_and_validate(without_actor).valid? + + with_invalid_actor = Map.put(valid_like, "actor", "invalidactor") + + refute LikeValidator.cast_and_validate(with_invalid_actor).valid? + end + + test "it errors when the object is missing or not known", %{valid_like: valid_like} do + without_object = Map.delete(valid_like, "object") + + refute LikeValidator.cast_and_validate(without_object).valid? + + with_invalid_object = Map.put(valid_like, "object", "invalidobject") + + refute LikeValidator.cast_and_validate(with_invalid_object).valid? + end + + test "it errors when the actor has already like the object", %{ + valid_like: valid_like, + user: user, + post_activity: post_activity + } do + _like = CommonAPI.favorite(user, post_activity.id) + + refute LikeValidator.cast_and_validate(valid_like).valid? + end + + test "it works when actor or object are wrapped in maps", %{valid_like: valid_like} do + wrapped_like = + valid_like + |> Map.put("actor", %{"id" => valid_like["actor"]}) + |> Map.put("object", %{"id" => valid_like["object"]}) + + validated = LikeValidator.cast_and_validate(wrapped_like) + + assert validated.valid? + + assert {:actor, valid_like["actor"]} in validated.changes + assert {:object, valid_like["object"]} in validated.changes + end + end +end diff --git a/test/web/activity_pub/object_validators/reject_validation_test.exs b/test/web/activity_pub/object_validators/reject_validation_test.exs new file mode 100644 index 000000000..370bb6e5c --- /dev/null +++ b/test/web/activity_pub/object_validators/reject_validation_test.exs @@ -0,0 +1,56 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.RejectValidationTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.ActivityPub.Pipeline + + import Pleroma.Factory + + setup do + follower = insert(:user) + followed = insert(:user, local: false) + + {:ok, follow_data, _} = Builder.follow(follower, followed) + {:ok, follow_activity, _} = Pipeline.common_pipeline(follow_data, local: true) + + {:ok, reject_data, _} = Builder.reject(followed, follow_activity) + + %{reject_data: reject_data, followed: followed} + end + + test "it validates a basic 'reject'", %{reject_data: reject_data} do + assert {:ok, _, _} = ObjectValidator.validate(reject_data, []) + end + + test "it fails when the actor doesn't exist", %{reject_data: reject_data} do + reject_data = + reject_data + |> Map.put("actor", "https://gensokyo.2hu/users/raymoo") + + assert {:error, _} = ObjectValidator.validate(reject_data, []) + end + + test "it fails when the rejected activity doesn't exist", %{reject_data: reject_data} do + reject_data = + reject_data + |> Map.put("object", "https://gensokyo.2hu/users/raymoo/follows/1") + + assert {:error, _} = ObjectValidator.validate(reject_data, []) + end + + test "for an rejected follow, it only validates if the actor of the reject is the followed actor", + %{reject_data: reject_data} do + stranger = insert(:user) + + reject_data = + reject_data + |> Map.put("actor", stranger.ap_id) + + assert {:error, _} = ObjectValidator.validate(reject_data, []) + end +end diff --git a/test/web/activity_pub/object_validators/types/date_time_test.exs b/test/web/activity_pub/object_validators/types/date_time_test.exs index 3e17a9497..43be8e936 100644 --- a/test/web/activity_pub/object_validators/types/date_time_test.exs +++ b/test/web/activity_pub/object_validators/types/date_time_test.exs @@ -1,5 +1,5 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.DateTimeTest do - alias Pleroma.Web.ActivityPub.ObjectValidators.Types.DateTime + alias Pleroma.EctoType.ActivityPub.ObjectValidators.DateTime use Pleroma.DataCase test "it validates an xsd:Datetime" do diff --git a/test/web/activity_pub/object_validators/types/object_id_test.exs b/test/web/activity_pub/object_validators/types/object_id_test.exs index c8911948e..e0ab76379 100644 --- a/test/web/activity_pub/object_validators/types/object_id_test.exs +++ b/test/web/activity_pub/object_validators/types/object_id_test.exs @@ -3,7 +3,7 @@ # SPDX-License-Identifier: AGPL-3.0-only defmodule Pleroma.Web.ObjectValidators.Types.ObjectIDTest do - alias Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID + alias Pleroma.EctoType.ActivityPub.ObjectValidators.ObjectID use Pleroma.DataCase @uris [ diff --git a/test/web/activity_pub/object_validators/types/recipients_test.exs b/test/web/activity_pub/object_validators/types/recipients_test.exs index f278f039b..053916bdd 100644 --- a/test/web/activity_pub/object_validators/types/recipients_test.exs +++ b/test/web/activity_pub/object_validators/types/recipients_test.exs @@ -1,5 +1,5 @@ defmodule Pleroma.Web.ObjectValidators.Types.RecipientsTest do - alias Pleroma.Web.ActivityPub.ObjectValidators.Types.Recipients + alias Pleroma.EctoType.ActivityPub.ObjectValidators.Recipients use Pleroma.DataCase test "it asserts that all elements of the list are object ids" do diff --git a/test/web/activity_pub/object_validators/types/safe_text_test.exs b/test/web/activity_pub/object_validators/types/safe_text_test.exs index d4a574554..9c08606f6 100644 --- a/test/web/activity_pub/object_validators/types/safe_text_test.exs +++ b/test/web/activity_pub/object_validators/types/safe_text_test.exs @@ -5,7 +5,7 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.SafeTextTest do use Pleroma.DataCase - alias Pleroma.Web.ActivityPub.ObjectValidators.Types.SafeText + alias Pleroma.EctoType.ActivityPub.ObjectValidators.SafeText test "it lets normal text go through" do text = "hey how are you" diff --git a/test/web/activity_pub/object_validators/undo_validation_test.exs b/test/web/activity_pub/object_validators/undo_validation_test.exs new file mode 100644 index 000000000..75bbcc4b6 --- /dev/null +++ b/test/web/activity_pub/object_validators/undo_validation_test.exs @@ -0,0 +1,53 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.UndoHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + describe "Undos" do + setup do + user = insert(:user) + {:ok, post_activity} = CommonAPI.post(user, %{status: "uguu"}) + {:ok, like} = CommonAPI.favorite(user, post_activity.id) + {:ok, valid_like_undo, []} = Builder.undo(user, like) + + %{user: user, like: like, valid_like_undo: valid_like_undo} + end + + test "it validates a basic like undo", %{valid_like_undo: valid_like_undo} do + assert {:ok, _, _} = ObjectValidator.validate(valid_like_undo, []) + end + + test "it does not validate if the actor of the undo is not the actor of the object", %{ + valid_like_undo: valid_like_undo + } do + other_user = insert(:user, ap_id: "https://gensokyo.2hu/users/raymoo") + + bad_actor = + valid_like_undo + |> Map.put("actor", other_user.ap_id) + + {:error, cng} = ObjectValidator.validate(bad_actor, []) + + assert {:actor, {"not the same as object actor", []}} in cng.errors + end + + test "it does not validate if the object is missing", %{valid_like_undo: valid_like_undo} do + missing_object = + valid_like_undo + |> Map.put("object", "https://gensokyo.2hu/objects/1") + + {:error, cng} = ObjectValidator.validate(missing_object, []) + + assert {:object, {"can't find object", []}} in cng.errors + assert length(cng.errors) == 1 + end + end +end diff --git a/test/web/activity_pub/object_validators/update_validation_test.exs b/test/web/activity_pub/object_validators/update_validation_test.exs new file mode 100644 index 000000000..5e80cf731 --- /dev/null +++ b/test/web/activity_pub/object_validators/update_validation_test.exs @@ -0,0 +1,44 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.ObjectValidators.UpdateHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Web.ActivityPub.Builder + alias Pleroma.Web.ActivityPub.ObjectValidator + + import Pleroma.Factory + + describe "updates" do + setup do + user = insert(:user) + + object = %{ + "id" => user.ap_id, + "name" => "A new name", + "summary" => "A new bio" + } + + {:ok, valid_update, []} = Builder.update(user, object) + + %{user: user, valid_update: valid_update} + end + + test "validates a basic object", %{valid_update: valid_update} do + assert {:ok, _update, []} = ObjectValidator.validate(valid_update, []) + end + + test "returns an error if the object can't be updated by the actor", %{ + valid_update: valid_update + } do + other_user = insert(:user) + + update = + valid_update + |> Map.put("actor", other_user.ap_id) + + assert {:error, _cng} = ObjectValidator.validate(update, []) + end + end +end diff --git a/test/web/activity_pub/pipeline_test.exs b/test/web/activity_pub/pipeline_test.exs index 8deb64501..f2a231eaf 100644 --- a/test/web/activity_pub/pipeline_test.exs +++ b/test/web/activity_pub/pipeline_test.exs @@ -14,6 +14,51 @@ defmodule Pleroma.Web.ActivityPub.PipelineTest do :ok end + test "when given an `object_data` in meta, Federation will receive a the original activity with the `object` field set to this embedded object" do + activity = insert(:note_activity) + object = %{"id" => "1", "type" => "Love"} + meta = [local: true, object_data: object] + + activity_with_object = %{activity | data: Map.put(activity.data, "object", object)} + + with_mocks([ + {Pleroma.Web.ActivityPub.ObjectValidator, [], [validate: fn o, m -> {:ok, o, m} end]}, + { + Pleroma.Web.ActivityPub.MRF, + [], + [filter: fn o -> {:ok, o} end] + }, + { + Pleroma.Web.ActivityPub.ActivityPub, + [], + [persist: fn o, m -> {:ok, o, m} end] + }, + { + Pleroma.Web.ActivityPub.SideEffects, + [], + [ + handle: fn o, m -> {:ok, o, m} end, + handle_after_transaction: fn m -> m end + ] + }, + { + Pleroma.Web.Federator, + [], + [publish: fn _o -> :ok end] + } + ]) do + assert {:ok, ^activity, ^meta} = + Pleroma.Web.ActivityPub.Pipeline.common_pipeline(activity, meta) + + assert_called(Pleroma.Web.ActivityPub.ObjectValidator.validate(activity, meta)) + assert_called(Pleroma.Web.ActivityPub.MRF.filter(activity)) + assert_called(Pleroma.Web.ActivityPub.ActivityPub.persist(activity, meta)) + assert_called(Pleroma.Web.ActivityPub.SideEffects.handle(activity, meta)) + refute called(Pleroma.Web.Federator.publish(activity)) + assert_called(Pleroma.Web.Federator.publish(activity_with_object)) + end + end + test "it goes through validation, filtering, persisting, side effects and federation for local activities" do activity = insert(:note_activity) meta = [local: true] diff --git a/test/web/activity_pub/publisher_test.exs b/test/web/activity_pub/publisher_test.exs index c2bc38d52..b9388b966 100644 --- a/test/web/activity_pub/publisher_test.exs +++ b/test/web/activity_pub/publisher_test.exs @@ -123,6 +123,39 @@ test "it returns inbox for messages involving single recipients in total" do end describe "publish_one/1" do + test "publish to url with with different ports" do + inbox80 = "http://42.site/users/nick1/inbox" + inbox42 = "http://42.site:42/users/nick1/inbox" + + mock(fn + %{method: :post, url: "http://42.site:42/users/nick1/inbox"} -> + {:ok, %Tesla.Env{status: 200, body: "port 42"}} + + %{method: :post, url: "http://42.site/users/nick1/inbox"} -> + {:ok, %Tesla.Env{status: 200, body: "port 80"}} + end) + + actor = insert(:user) + + assert {:ok, %{body: "port 42"}} = + Publisher.publish_one(%{ + inbox: inbox42, + json: "{}", + actor: actor, + id: 1, + unreachable_since: true + }) + + assert {:ok, %{body: "port 80"}} = + Publisher.publish_one(%{ + inbox: inbox80, + json: "{}", + actor: actor, + id: 1, + unreachable_since: true + }) + end + test_with_mock "calls `Instances.set_reachable` on successful federation if `unreachable_since` is not specified", Instances, [:passthrough], @@ -131,7 +164,6 @@ test "it returns inbox for messages involving single recipients in total" do inbox = "http://200.site/users/nick1/inbox" assert {:ok, _} = Publisher.publish_one(%{inbox: inbox, json: "{}", actor: actor, id: 1}) - assert called(Instances.set_reachable(inbox)) end diff --git a/test/web/activity_pub/relay_test.exs b/test/web/activity_pub/relay_test.exs index b3b573c9b..9d657ac4f 100644 --- a/test/web/activity_pub/relay_test.exs +++ b/test/web/activity_pub/relay_test.exs @@ -7,8 +7,8 @@ defmodule Pleroma.Web.ActivityPub.RelayTest do alias Pleroma.Activity alias Pleroma.User - alias Pleroma.Web.ActivityPub.ActivityPub alias Pleroma.Web.ActivityPub.Relay + alias Pleroma.Web.CommonAPI import ExUnit.CaptureLog import Pleroma.Factory @@ -53,8 +53,7 @@ test "returns errors when user not found" do test "returns activity" do user = insert(:user) service_actor = Relay.get_actor() - ActivityPub.follow(service_actor, user) - Pleroma.User.follow(service_actor, user) + CommonAPI.follow(service_actor, user) assert "#{user.ap_id}/followers" in User.following(service_actor) assert {:ok, %Activity{} = activity} = Relay.unfollow(user.ap_id) assert activity.actor == "#{Pleroma.Web.Endpoint.url()}/relay" @@ -74,6 +73,7 @@ test "returns error when activity not `Create` type" do assert Relay.publish(activity) == {:error, "Not implemented"} end + @tag capture_log: true test "returns error when activity not public" do activity = insert(:direct_note_activity) assert Relay.publish(activity) == {:error, false} diff --git a/test/web/activity_pub/side_effects_test.exs b/test/web/activity_pub/side_effects_test.exs index 6bbbaae87..9efbaad04 100644 --- a/test/web/activity_pub/side_effects_test.exs +++ b/test/web/activity_pub/side_effects_test.exs @@ -19,8 +19,9 @@ defmodule Pleroma.Web.ActivityPub.SideEffectsTest do alias Pleroma.Web.ActivityPub.SideEffects alias Pleroma.Web.CommonAPI - import Pleroma.Factory + import ExUnit.CaptureLog import Mock + import Pleroma.Factory describe "handle_after_transaction" do test "it streams out notifications and streams" do @@ -64,6 +65,72 @@ test "it streams out notifications and streams" do end end + describe "blocking users" do + setup do + user = insert(:user) + blocked = insert(:user) + User.follow(blocked, user) + User.follow(user, blocked) + + {:ok, block_data, []} = Builder.block(user, blocked) + {:ok, block, _meta} = ActivityPub.persist(block_data, local: true) + + %{user: user, blocked: blocked, block: block} + end + + test "it unfollows and blocks", %{user: user, blocked: blocked, block: block} do + assert User.following?(user, blocked) + assert User.following?(blocked, user) + + {:ok, _, _} = SideEffects.handle(block) + + refute User.following?(user, blocked) + refute User.following?(blocked, user) + assert User.blocks?(user, blocked) + end + + test "it blocks but does not unfollow if the relevant setting is set", %{ + user: user, + blocked: blocked, + block: block + } do + clear_config([:activitypub, :unfollow_blocked], false) + assert User.following?(user, blocked) + assert User.following?(blocked, user) + + {:ok, _, _} = SideEffects.handle(block) + + refute User.following?(user, blocked) + assert User.following?(blocked, user) + assert User.blocks?(user, blocked) + end + end + + describe "update users" do + setup do + user = insert(:user) + {:ok, update_data, []} = Builder.update(user, %{"id" => user.ap_id, "name" => "new name!"}) + {:ok, update, _meta} = ActivityPub.persist(update_data, local: true) + + %{user: user, update_data: update_data, update: update} + end + + test "it updates the user", %{user: user, update: update} do + {:ok, _, _} = SideEffects.handle(update) + user = User.get_by_id(user.id) + assert user.name == "new name!" + end + + test "it uses a given changeset to update", %{user: user, update: update} do + changeset = Ecto.Changeset.change(user, %{default_scope: "direct"}) + + assert user.default_scope == "public" + {:ok, _, _} = SideEffects.handle(update, user_update_changeset: changeset) + user = User.get_by_id(user.id) + assert user.default_scope == "direct" + end + end + describe "delete objects" do setup do user = insert(:user) @@ -155,6 +222,22 @@ test "it handles user deletions", %{delete_user: delete, user: user} do assert User.get_cached_by_ap_id(user.ap_id).deactivated end + + test "it logs issues with objects deletion", %{ + delete: delete, + object: object + } do + {:ok, object} = + object + |> Object.change(%{data: Map.delete(object.data, "actor")}) + |> Repo.update() + + Object.invalid_object_cache(object) + + assert capture_log(fn -> + {:error, :no_object_actor} = SideEffects.handle(delete) + end) =~ "object doesn't have an actor" + end end describe "EmojiReact objects" do @@ -217,8 +300,7 @@ test "when activation is required", %{delete: delete, user: user} do {:ok, like} = CommonAPI.favorite(user, post.id) {:ok, reaction} = CommonAPI.react_with_emoji(post.id, user, "👍") {:ok, announce} = CommonAPI.repeat(post.id, user) - {:ok, block} = ActivityPub.block(user, poster) - User.block(user, poster) + {:ok, block} = CommonAPI.block(user, poster) {:ok, undo_data, _meta} = Builder.undo(user, like) {:ok, like_undo, _meta} = ActivityPub.persist(undo_data, local: true) @@ -247,8 +329,12 @@ test "when activation is required", %{delete: delete, user: user} do } end - test "deletes the original block", %{block_undo: block_undo, block: block} do - {:ok, _block_undo, _} = SideEffects.handle(block_undo) + test "deletes the original block", %{ + block_undo: block_undo, + block: block + } do + {:ok, _block_undo, _meta} = SideEffects.handle(block_undo) + refute Activity.get_by_id(block.id) end @@ -524,10 +610,29 @@ test "creates a notification", %{announce: announce, poster: poster} do end test "it streams out the announce", %{announce: announce} do - with_mock Pleroma.Web.ActivityPub.ActivityPub, [:passthrough], stream_out: fn _ -> nil end do + with_mocks([ + { + Pleroma.Web.Streamer, + [], + [ + stream: fn _, _ -> nil end + ] + }, + { + Pleroma.Web.Push, + [], + [ + send: fn _ -> nil end + ] + } + ]) do {:ok, announce, _} = SideEffects.handle(announce) - assert called(Pleroma.Web.ActivityPub.ActivityPub.stream_out(announce)) + assert called( + Pleroma.Web.Streamer.stream(["user", "list", "public", "public:local"], announce) + ) + + assert called(Pleroma.Web.Push.send(:_)) end end end diff --git a/test/web/activity_pub/transmogrifier/accept_handling_test.exs b/test/web/activity_pub/transmogrifier/accept_handling_test.exs new file mode 100644 index 000000000..77d468f5c --- /dev/null +++ b/test/web/activity_pub/transmogrifier/accept_handling_test.exs @@ -0,0 +1,91 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.AcceptHandlingTest do + use Pleroma.DataCase + + alias Pleroma.User + alias Pleroma.Web.ActivityPub.Transmogrifier + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + test "it works for incoming accepts which were pre-accepted" do + follower = insert(:user) + followed = insert(:user) + + {:ok, follower} = User.follow(follower, followed) + assert User.following?(follower, followed) == true + + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, followed) + + accept_data = + File.read!("test/fixtures/mastodon-accept-activity.json") + |> Poison.decode!() + |> Map.put("actor", followed.ap_id) + + object = + accept_data["object"] + |> Map.put("actor", follower.ap_id) + |> Map.put("id", follow_activity.data["id"]) + + accept_data = Map.put(accept_data, "object", object) + + {:ok, activity} = Transmogrifier.handle_incoming(accept_data) + refute activity.local + + assert activity.data["object"] == follow_activity.data["id"] + + assert activity.data["id"] == accept_data["id"] + + follower = User.get_cached_by_id(follower.id) + + assert User.following?(follower, followed) == true + end + + test "it works for incoming accepts which are referenced by IRI only" do + follower = insert(:user) + followed = insert(:user, locked: true) + + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, followed) + + accept_data = + File.read!("test/fixtures/mastodon-accept-activity.json") + |> Poison.decode!() + |> Map.put("actor", followed.ap_id) + |> Map.put("object", follow_activity.data["id"]) + + {:ok, activity} = Transmogrifier.handle_incoming(accept_data) + assert activity.data["object"] == follow_activity.data["id"] + + follower = User.get_cached_by_id(follower.id) + + assert User.following?(follower, followed) == true + + follower = User.get_by_id(follower.id) + assert follower.following_count == 1 + + followed = User.get_by_id(followed.id) + assert followed.follower_count == 1 + end + + test "it fails for incoming accepts which cannot be correlated" do + follower = insert(:user) + followed = insert(:user, locked: true) + + accept_data = + File.read!("test/fixtures/mastodon-accept-activity.json") + |> Poison.decode!() + |> Map.put("actor", followed.ap_id) + + accept_data = + Map.put(accept_data, "object", Map.put(accept_data["object"], "actor", follower.ap_id)) + + {:error, _} = Transmogrifier.handle_incoming(accept_data) + + follower = User.get_cached_by_id(follower.id) + + refute User.following?(follower, followed) == true + end +end diff --git a/test/web/activity_pub/transmogrifier/answer_handling_test.exs b/test/web/activity_pub/transmogrifier/answer_handling_test.exs new file mode 100644 index 000000000..0f6605c3f --- /dev/null +++ b/test/web/activity_pub/transmogrifier/answer_handling_test.exs @@ -0,0 +1,78 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.AnswerHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.Transmogrifier + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + setup_all do + Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) + :ok + end + + test "incoming, rewrites Note to Answer and increments vote counters" do + user = insert(:user) + + {:ok, activity} = + CommonAPI.post(user, %{ + status: "suya...", + poll: %{options: ["suya", "suya.", "suya.."], expires_in: 10} + }) + + object = Object.normalize(activity) + + data = + File.read!("test/fixtures/mastodon-vote.json") + |> Poison.decode!() + |> Kernel.put_in(["to"], user.ap_id) + |> Kernel.put_in(["object", "inReplyTo"], object.data["id"]) + |> Kernel.put_in(["object", "to"], user.ap_id) + + {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + answer_object = Object.normalize(activity) + assert answer_object.data["type"] == "Answer" + assert answer_object.data["inReplyTo"] == object.data["id"] + + new_object = Object.get_by_ap_id(object.data["id"]) + assert new_object.data["replies_count"] == object.data["replies_count"] + + assert Enum.any?( + new_object.data["oneOf"], + fn + %{"name" => "suya..", "replies" => %{"totalItems" => 1}} -> true + _ -> false + end + ) + end + + test "outgoing, rewrites Answer to Note" do + user = insert(:user) + + {:ok, poll_activity} = + CommonAPI.post(user, %{ + status: "suya...", + poll: %{options: ["suya", "suya.", "suya.."], expires_in: 10} + }) + + poll_object = Object.normalize(poll_activity) + # TODO: Replace with CommonAPI vote creation when implemented + data = + File.read!("test/fixtures/mastodon-vote.json") + |> Poison.decode!() + |> Kernel.put_in(["to"], user.ap_id) + |> Kernel.put_in(["object", "inReplyTo"], poll_object.data["id"]) + |> Kernel.put_in(["object", "to"], user.ap_id) + + {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + {:ok, data} = Transmogrifier.prepare_outgoing(activity.data) + + assert data["object"]["type"] == "Note" + end +end diff --git a/test/web/activity_pub/transmogrifier/audio_handling_test.exs b/test/web/activity_pub/transmogrifier/audio_handling_test.exs new file mode 100644 index 000000000..0636d00c5 --- /dev/null +++ b/test/web/activity_pub/transmogrifier/audio_handling_test.exs @@ -0,0 +1,83 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.AudioHandlingTest do + use Oban.Testing, repo: Pleroma.Repo + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.Transmogrifier + + import Pleroma.Factory + + test "it works for incoming listens" do + _user = insert(:user, ap_id: "http://mastodon.example.org/users/admin") + + data = %{ + "@context" => "https://www.w3.org/ns/activitystreams", + "to" => ["https://www.w3.org/ns/activitystreams#Public"], + "cc" => [], + "type" => "Listen", + "id" => "http://mastodon.example.org/users/admin/listens/1234/activity", + "actor" => "http://mastodon.example.org/users/admin", + "object" => %{ + "type" => "Audio", + "id" => "http://mastodon.example.org/users/admin/listens/1234", + "attributedTo" => "http://mastodon.example.org/users/admin", + "title" => "lain radio episode 1", + "artist" => "lain", + "album" => "lain radio", + "length" => 180_000 + } + } + + {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + + object = Object.normalize(activity) + + assert object.data["title"] == "lain radio episode 1" + assert object.data["artist"] == "lain" + assert object.data["album"] == "lain radio" + assert object.data["length"] == 180_000 + end + + test "Funkwhale Audio object" do + Tesla.Mock.mock(fn + %{url: "https://channels.tests.funkwhale.audio/federation/actors/compositions"} -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/funkwhale_channel.json") + } + end) + + data = File.read!("test/fixtures/tesla_mock/funkwhale_create_audio.json") |> Poison.decode!() + + {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + + assert object = Object.normalize(activity, false) + + assert object.data["to"] == ["https://www.w3.org/ns/activitystreams#Public"] + + assert object.data["cc"] == [] + + assert object.data["url"] == "https://channels.tests.funkwhale.audio/library/tracks/74" + + assert object.data["attachment"] == [ + %{ + "mediaType" => "audio/ogg", + "type" => "Link", + "name" => nil, + "url" => [ + %{ + "href" => + "https://channels.tests.funkwhale.audio/api/v1/listen/3901e5d8-0445-49d5-9711-e096cf32e515/?upload=42342395-0208-4fee-a38d-259a6dae0871&download=false", + "mediaType" => "audio/ogg", + "type" => "Link" + } + ] + } + ] + end +end diff --git a/test/web/activity_pub/transmogrifier/block_handling_test.exs b/test/web/activity_pub/transmogrifier/block_handling_test.exs new file mode 100644 index 000000000..71f1a0ed5 --- /dev/null +++ b/test/web/activity_pub/transmogrifier/block_handling_test.exs @@ -0,0 +1,63 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.BlockHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.User + alias Pleroma.Web.ActivityPub.Transmogrifier + + import Pleroma.Factory + + test "it works for incoming blocks" do + user = insert(:user) + + data = + File.read!("test/fixtures/mastodon-block-activity.json") + |> Poison.decode!() + |> Map.put("object", user.ap_id) + + blocker = insert(:user, ap_id: data["actor"]) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["type"] == "Block" + assert data["object"] == user.ap_id + assert data["actor"] == "http://mastodon.example.org/users/admin" + + assert User.blocks?(blocker, user) + end + + test "incoming blocks successfully tear down any follow relationship" do + blocker = insert(:user) + blocked = insert(:user) + + data = + File.read!("test/fixtures/mastodon-block-activity.json") + |> Poison.decode!() + |> Map.put("object", blocked.ap_id) + |> Map.put("actor", blocker.ap_id) + + {:ok, blocker} = User.follow(blocker, blocked) + {:ok, blocked} = User.follow(blocked, blocker) + + assert User.following?(blocker, blocked) + assert User.following?(blocked, blocker) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["type"] == "Block" + assert data["object"] == blocked.ap_id + assert data["actor"] == blocker.ap_id + + blocker = User.get_cached_by_ap_id(data["actor"]) + blocked = User.get_cached_by_ap_id(data["object"]) + + assert User.blocks?(blocker, blocked) + + refute User.following?(blocker, blocked) + refute User.following?(blocked, blocker) + end +end diff --git a/test/web/activity_pub/transmogrifier/chat_message_test.exs b/test/web/activity_pub/transmogrifier/chat_message_test.exs index d6736dc3e..31274c067 100644 --- a/test/web/activity_pub/transmogrifier/chat_message_test.exs +++ b/test/web/activity_pub/transmogrifier/chat_message_test.exs @@ -124,6 +124,24 @@ test "it fetches the actor if they aren't in our system" do {:ok, %Activity{} = _activity} = Transmogrifier.handle_incoming(data) end + test "it doesn't work for deactivated users" do + data = + File.read!("test/fixtures/create-chat-message.json") + |> Poison.decode!() + + _author = + insert(:user, + ap_id: data["actor"], + local: false, + last_refreshed_at: DateTime.utc_now(), + deactivated: true + ) + + _recipient = insert(:user, ap_id: List.first(data["to"]), local: true) + + assert {:error, _} = Transmogrifier.handle_incoming(data) + end + test "it inserts it and creates a chat" do data = File.read!("test/fixtures/create-chat-message.json") diff --git a/test/web/activity_pub/transmogrifier/event_handling_test.exs b/test/web/activity_pub/transmogrifier/event_handling_test.exs new file mode 100644 index 000000000..7f1ef2cbd --- /dev/null +++ b/test/web/activity_pub/transmogrifier/event_handling_test.exs @@ -0,0 +1,40 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.EventHandlingTest do + use Oban.Testing, repo: Pleroma.Repo + use Pleroma.DataCase + + alias Pleroma.Object.Fetcher + + test "Mobilizon Event object" do + Tesla.Mock.mock(fn + %{url: "https://mobilizon.org/events/252d5816-00a3-4a89-a66f-15bf65c33e39"} -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/mobilizon.org-event.json") + } + + %{url: "https://mobilizon.org/@tcit"} -> + %Tesla.Env{ + status: 200, + body: File.read!("test/fixtures/tesla_mock/mobilizon.org-user.json") + } + end) + + assert {:ok, object} = + Fetcher.fetch_object_from_id( + "https://mobilizon.org/events/252d5816-00a3-4a89-a66f-15bf65c33e39" + ) + + assert object.data["to"] == ["https://www.w3.org/ns/activitystreams#Public"] + assert object.data["cc"] == [] + + assert object.data["url"] == + "https://mobilizon.org/events/252d5816-00a3-4a89-a66f-15bf65c33e39" + + assert object.data["published"] == "2019-12-17T11:33:56Z" + assert object.data["name"] == "Mobilizon Launching Party" + end +end diff --git a/test/web/activity_pub/transmogrifier/follow_handling_test.exs b/test/web/activity_pub/transmogrifier/follow_handling_test.exs index 06c39eed6..757d90941 100644 --- a/test/web/activity_pub/transmogrifier/follow_handling_test.exs +++ b/test/web/activity_pub/transmogrifier/follow_handling_test.exs @@ -160,7 +160,7 @@ test "it rejects incoming follow requests if the following errors for some reaso |> Poison.decode!() |> Map.put("object", user.ap_id) - with_mock Pleroma.User, [:passthrough], follow: fn _, _ -> {:error, :testing} end do + with_mock Pleroma.User, [:passthrough], follow: fn _, _, _ -> {:error, :testing} end do {:ok, %Activity{data: %{"id" => id}}} = Transmogrifier.handle_incoming(data) %Activity{} = activity = Activity.get_by_ap_id(id) @@ -185,5 +185,24 @@ test "it works for incoming follow requests from hubzilla" do assert data["id"] == "https://hubzilla.example.org/channel/kaniini#follows/2" assert User.following?(User.get_cached_by_ap_id(data["actor"]), user) end + + test "it works for incoming follows to locked account" do + pending_follower = insert(:user, ap_id: "http://mastodon.example.org/users/admin") + user = insert(:user, locked: true) + + data = + File.read!("test/fixtures/mastodon-follow-activity.json") + |> Poison.decode!() + |> Map.put("object", user.ap_id) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) + + assert data["type"] == "Follow" + assert data["object"] == user.ap_id + assert data["state"] == "pending" + assert data["actor"] == "http://mastodon.example.org/users/admin" + + assert [^pending_follower] = User.get_follow_requests(user) + end end end diff --git a/test/web/activity_pub/transmogrifier/question_handling_test.exs b/test/web/activity_pub/transmogrifier/question_handling_test.exs new file mode 100644 index 000000000..74ee79543 --- /dev/null +++ b/test/web/activity_pub/transmogrifier/question_handling_test.exs @@ -0,0 +1,176 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.QuestionHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.Object + alias Pleroma.Web.ActivityPub.Transmogrifier + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + setup_all do + Tesla.Mock.mock_global(fn env -> apply(HttpRequestMock, :request, [env]) end) + :ok + end + + test "Mastodon Question activity" do + data = File.read!("test/fixtures/mastodon-question-activity.json") |> Poison.decode!() + + {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + + object = Object.normalize(activity, false) + + assert object.data["url"] == "https://mastodon.sdf.org/@rinpatch/102070944809637304" + + assert object.data["closed"] == "2019-05-11T09:03:36Z" + + assert object.data["context"] == activity.data["context"] + + assert object.data["context"] == + "tag:mastodon.sdf.org,2019-05-10:objectId=15095122:objectType=Conversation" + + assert object.data["context_id"] + + assert object.data["anyOf"] == [] + + assert Enum.sort(object.data["oneOf"]) == + Enum.sort([ + %{ + "name" => "25 char limit is dumb", + "replies" => %{"totalItems" => 0, "type" => "Collection"}, + "type" => "Note" + }, + %{ + "name" => "Dunno", + "replies" => %{"totalItems" => 0, "type" => "Collection"}, + "type" => "Note" + }, + %{ + "name" => "Everyone knows that!", + "replies" => %{"totalItems" => 1, "type" => "Collection"}, + "type" => "Note" + }, + %{ + "name" => "I can't even fit a funny", + "replies" => %{"totalItems" => 1, "type" => "Collection"}, + "type" => "Note" + } + ]) + + user = insert(:user) + + {:ok, reply_activity} = CommonAPI.post(user, %{status: "hewwo", in_reply_to_id: activity.id}) + + reply_object = Object.normalize(reply_activity, false) + + assert reply_object.data["context"] == object.data["context"] + assert reply_object.data["context_id"] == object.data["context_id"] + end + + test "Mastodon Question activity with HTML tags in plaintext" do + options = [ + %{ + "type" => "Note", + "name" => "", + "replies" => %{"totalItems" => 0, "type" => "Collection"} + }, + %{ + "type" => "Note", + "name" => "", + "replies" => %{"totalItems" => 0, "type" => "Collection"} + }, + %{ + "type" => "Note", + "name" => "", + "replies" => %{"totalItems" => 1, "type" => "Collection"} + }, + %{ + "type" => "Note", + "name" => "", + "replies" => %{"totalItems" => 1, "type" => "Collection"} + } + ] + + data = + File.read!("test/fixtures/mastodon-question-activity.json") + |> Poison.decode!() + |> Kernel.put_in(["object", "oneOf"], options) + + {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + object = Object.normalize(activity, false) + + assert Enum.sort(object.data["oneOf"]) == Enum.sort(options) + end + + test "Mastodon Question activity with custom emojis" do + options = [ + %{ + "type" => "Note", + "name" => ":blobcat:", + "replies" => %{"totalItems" => 0, "type" => "Collection"} + }, + %{ + "type" => "Note", + "name" => ":blobfox:", + "replies" => %{"totalItems" => 0, "type" => "Collection"} + } + ] + + tag = [ + %{ + "icon" => %{ + "type" => "Image", + "url" => "https://blob.cat/emoji/custom/blobcats/blobcat.png" + }, + "id" => "https://blob.cat/emoji/custom/blobcats/blobcat.png", + "name" => ":blobcat:", + "type" => "Emoji", + "updated" => "1970-01-01T00:00:00Z" + }, + %{ + "icon" => %{"type" => "Image", "url" => "https://blob.cat/emoji/blobfox/blobfox.png"}, + "id" => "https://blob.cat/emoji/blobfox/blobfox.png", + "name" => ":blobfox:", + "type" => "Emoji", + "updated" => "1970-01-01T00:00:00Z" + } + ] + + data = + File.read!("test/fixtures/mastodon-question-activity.json") + |> Poison.decode!() + |> Kernel.put_in(["object", "oneOf"], options) + |> Kernel.put_in(["object", "tag"], tag) + + {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + object = Object.normalize(activity, false) + + assert object.data["oneOf"] == options + + assert object.data["emoji"] == %{ + "blobcat" => "https://blob.cat/emoji/custom/blobcats/blobcat.png", + "blobfox" => "https://blob.cat/emoji/blobfox/blobfox.png" + } + end + + test "returns an error if received a second time" do + data = File.read!("test/fixtures/mastodon-question-activity.json") |> Poison.decode!() + + assert {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) + + assert {:error, {:validate_object, {:error, _}}} = Transmogrifier.handle_incoming(data) + end + + test "accepts a Question with no content" do + data = + File.read!("test/fixtures/mastodon-question-activity.json") + |> Poison.decode!() + |> Kernel.put_in(["object", "content"], "") + + assert {:ok, %Activity{local: false}} = Transmogrifier.handle_incoming(data) + end +end diff --git a/test/web/activity_pub/transmogrifier/reject_handling_test.exs b/test/web/activity_pub/transmogrifier/reject_handling_test.exs new file mode 100644 index 000000000..7592fbe1c --- /dev/null +++ b/test/web/activity_pub/transmogrifier/reject_handling_test.exs @@ -0,0 +1,67 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.RejectHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.User + alias Pleroma.Web.ActivityPub.Transmogrifier + alias Pleroma.Web.CommonAPI + + import Pleroma.Factory + + test "it fails for incoming rejects which cannot be correlated" do + follower = insert(:user) + followed = insert(:user, locked: true) + + accept_data = + File.read!("test/fixtures/mastodon-reject-activity.json") + |> Poison.decode!() + |> Map.put("actor", followed.ap_id) + + accept_data = + Map.put(accept_data, "object", Map.put(accept_data["object"], "actor", follower.ap_id)) + + {:error, _} = Transmogrifier.handle_incoming(accept_data) + + follower = User.get_cached_by_id(follower.id) + + refute User.following?(follower, followed) == true + end + + test "it works for incoming rejects which are referenced by IRI only" do + follower = insert(:user) + followed = insert(:user, locked: true) + + {:ok, follower} = User.follow(follower, followed) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, followed) + + assert User.following?(follower, followed) == true + + reject_data = + File.read!("test/fixtures/mastodon-reject-activity.json") + |> Poison.decode!() + |> Map.put("actor", followed.ap_id) + |> Map.put("object", follow_activity.data["id"]) + + {:ok, %Activity{data: _}} = Transmogrifier.handle_incoming(reject_data) + + follower = User.get_cached_by_id(follower.id) + + assert User.following?(follower, followed) == false + end + + test "it rejects activities without a valid ID" do + user = insert(:user) + + data = + File.read!("test/fixtures/mastodon-follow-activity.json") + |> Poison.decode!() + |> Map.put("object", user.ap_id) + |> Map.put("id", "") + + :error = Transmogrifier.handle_incoming(data) + end +end diff --git a/test/web/activity_pub/transmogrifier/undo_handling_test.exs b/test/web/activity_pub/transmogrifier/undo_handling_test.exs index 01dd6c370..8683f7135 100644 --- a/test/web/activity_pub/transmogrifier/undo_handling_test.exs +++ b/test/web/activity_pub/transmogrifier/undo_handling_test.exs @@ -130,7 +130,7 @@ test "it works for incoming unannounces with an existing notice" do "http://mastodon.example.org/users/admin/statuses/99542391527669785/activity" end - test "it works for incomming unfollows with an existing follow" do + test "it works for incoming unfollows with an existing follow" do user = insert(:user) follow_data = diff --git a/test/web/activity_pub/transmogrifier/user_update_handling_test.exs b/test/web/activity_pub/transmogrifier/user_update_handling_test.exs new file mode 100644 index 000000000..64636656c --- /dev/null +++ b/test/web/activity_pub/transmogrifier/user_update_handling_test.exs @@ -0,0 +1,159 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.ActivityPub.Transmogrifier.UserUpdateHandlingTest do + use Pleroma.DataCase + + alias Pleroma.Activity + alias Pleroma.User + alias Pleroma.Web.ActivityPub.Transmogrifier + + import Pleroma.Factory + + test "it works for incoming update activities" do + user = insert(:user, local: false) + + update_data = File.read!("test/fixtures/mastodon-update.json") |> Poison.decode!() + + object = + update_data["object"] + |> Map.put("actor", user.ap_id) + |> Map.put("id", user.ap_id) + + update_data = + update_data + |> Map.put("actor", user.ap_id) + |> Map.put("object", object) + + {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(update_data) + + assert data["id"] == update_data["id"] + + user = User.get_cached_by_ap_id(data["actor"]) + assert user.name == "gargle" + + assert user.avatar["url"] == [ + %{ + "href" => + "https://cd.niu.moe/accounts/avatars/000/033/323/original/fd7f8ae0b3ffedc9.jpeg" + } + ] + + assert user.banner["url"] == [ + %{ + "href" => + "https://cd.niu.moe/accounts/headers/000/033/323/original/850b3448fa5fd477.png" + } + ] + + assert user.bio == "

Some bio

" + end + + test "it works with alsoKnownAs" do + %{ap_id: actor} = insert(:user, local: false) + + assert User.get_cached_by_ap_id(actor).also_known_as == [] + + {:ok, _activity} = + "test/fixtures/mastodon-update.json" + |> File.read!() + |> Poison.decode!() + |> Map.put("actor", actor) + |> Map.update!("object", fn object -> + object + |> Map.put("actor", actor) + |> Map.put("id", actor) + |> Map.put("alsoKnownAs", [ + "http://mastodon.example.org/users/foo", + "http://example.org/users/bar" + ]) + end) + |> Transmogrifier.handle_incoming() + + assert User.get_cached_by_ap_id(actor).also_known_as == [ + "http://mastodon.example.org/users/foo", + "http://example.org/users/bar" + ] + end + + test "it works with custom profile fields" do + user = insert(:user, local: false) + + assert user.fields == [] + + update_data = File.read!("test/fixtures/mastodon-update.json") |> Poison.decode!() + + object = + update_data["object"] + |> Map.put("actor", user.ap_id) + |> Map.put("id", user.ap_id) + + update_data = + update_data + |> Map.put("actor", user.ap_id) + |> Map.put("object", object) + + {:ok, _update_activity} = Transmogrifier.handle_incoming(update_data) + + user = User.get_cached_by_ap_id(user.ap_id) + + assert user.fields == [ + %{"name" => "foo", "value" => "updated"}, + %{"name" => "foo1", "value" => "updated"} + ] + + Pleroma.Config.put([:instance, :max_remote_account_fields], 2) + + update_data = + update_data + |> put_in(["object", "attachment"], [ + %{"name" => "foo", "type" => "PropertyValue", "value" => "bar"}, + %{"name" => "foo11", "type" => "PropertyValue", "value" => "bar11"}, + %{"name" => "foo22", "type" => "PropertyValue", "value" => "bar22"} + ]) + |> Map.put("id", update_data["id"] <> ".") + + {:ok, _} = Transmogrifier.handle_incoming(update_data) + + user = User.get_cached_by_ap_id(user.ap_id) + + assert user.fields == [ + %{"name" => "foo", "value" => "updated"}, + %{"name" => "foo1", "value" => "updated"} + ] + + update_data = + update_data + |> put_in(["object", "attachment"], []) + |> Map.put("id", update_data["id"] <> ".") + + {:ok, _} = Transmogrifier.handle_incoming(update_data) + + user = User.get_cached_by_ap_id(user.ap_id) + + assert user.fields == [] + end + + test "it works for incoming update activities which lock the account" do + user = insert(:user, local: false) + + update_data = File.read!("test/fixtures/mastodon-update.json") |> Poison.decode!() + + object = + update_data["object"] + |> Map.put("actor", user.ap_id) + |> Map.put("id", user.ap_id) + |> Map.put("manuallyApprovesFollowers", true) + + update_data = + update_data + |> Map.put("actor", user.ap_id) + |> Map.put("object", object) + + {:ok, %Activity{local: false}} = Transmogrifier.handle_incoming(update_data) + + user = User.get_cached_by_ap_id(user.ap_id) + assert user.locked == true + end +end diff --git a/test/web/activity_pub/transmogrifier_test.exs b/test/web/activity_pub/transmogrifier_test.exs index 94d8552e8..cc55a7be7 100644 --- a/test/web/activity_pub/transmogrifier_test.exs +++ b/test/web/activity_pub/transmogrifier_test.exs @@ -11,7 +11,6 @@ defmodule Pleroma.Web.ActivityPub.TransmogrifierTest do alias Pleroma.Object.Fetcher alias Pleroma.Tests.ObanHelpers alias Pleroma.User - alias Pleroma.Web.ActivityPub.ActivityPub alias Pleroma.Web.ActivityPub.Transmogrifier alias Pleroma.Web.AdminAPI.AccountView alias Pleroma.Web.CommonAPI @@ -106,7 +105,7 @@ test "it fetches reply-to activities if we don't have them" do object = data["object"] - |> Map.put("inReplyTo", "https://shitposter.club/notice/2827873") + |> Map.put("inReplyTo", "https://mstdn.io/users/mayuutann/statuses/99568293732299394") data = Map.put(data, "object", object) {:ok, returned_activity} = Transmogrifier.handle_incoming(data) @@ -114,10 +113,11 @@ test "it fetches reply-to activities if we don't have them" do assert activity = Activity.get_create_by_object_ap_id( - "tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment" + "https://mstdn.io/users/mayuutann/statuses/99568293732299394" ) - assert returned_object.data["inReplyToAtomUri"] == "https://shitposter.club/notice/2827873" + assert returned_object.data["inReplyTo"] == + "https://mstdn.io/users/mayuutann/statuses/99568293732299394" end test "it does not fetch reply-to activities beyond max replies depth limit" do @@ -141,8 +141,7 @@ test "it does not fetch reply-to activities beyond max replies depth limit" do "tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment" ) - assert returned_object.data["inReplyToAtomUri"] == - "https://shitposter.club/notice/2827873" + assert returned_object.data["inReplyTo"] == "https://shitposter.club/notice/2827873" end end @@ -161,7 +160,15 @@ test "it does not crash if the object in inReplyTo can't be fetched" do assert capture_log(fn -> {:ok, _returned_activity} = Transmogrifier.handle_incoming(data) - end) =~ "[error] Couldn't fetch \"https://404.site/whatever\", error: nil" + end) =~ "[warn] Couldn't fetch \"https://404.site/whatever\", error: nil" + end + + test "it does not work for deactivated users" do + data = File.read!("test/fixtures/mastodon-post-activity.json") |> Poison.decode!() + + insert(:user, ap_id: data["actor"], deactivated: true) + + assert {:error, _} = Transmogrifier.handle_incoming(data) end test "it works for incoming notices" do @@ -218,84 +225,6 @@ test "it works for incoming notices with hashtags" do assert Enum.at(object.data["tag"], 2) == "moo" end - test "it works for incoming questions" do - data = File.read!("test/fixtures/mastodon-question-activity.json") |> Poison.decode!() - - {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) - - object = Object.normalize(activity) - - assert Enum.all?(object.data["oneOf"], fn choice -> - choice["name"] in [ - "Dunno", - "Everyone knows that!", - "25 char limit is dumb", - "I can't even fit a funny" - ] - end) - end - - test "it works for incoming listens" do - data = %{ - "@context" => "https://www.w3.org/ns/activitystreams", - "to" => ["https://www.w3.org/ns/activitystreams#Public"], - "cc" => [], - "type" => "Listen", - "id" => "http://mastodon.example.org/users/admin/listens/1234/activity", - "actor" => "http://mastodon.example.org/users/admin", - "object" => %{ - "type" => "Audio", - "id" => "http://mastodon.example.org/users/admin/listens/1234", - "attributedTo" => "http://mastodon.example.org/users/admin", - "title" => "lain radio episode 1", - "artist" => "lain", - "album" => "lain radio", - "length" => 180_000 - } - } - - {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) - - object = Object.normalize(activity) - - assert object.data["title"] == "lain radio episode 1" - assert object.data["artist"] == "lain" - assert object.data["album"] == "lain radio" - assert object.data["length"] == 180_000 - end - - test "it rewrites Note votes to Answers and increments vote counters on question activities" do - user = insert(:user) - - {:ok, activity} = - CommonAPI.post(user, %{ - status: "suya...", - poll: %{options: ["suya", "suya.", "suya.."], expires_in: 10} - }) - - object = Object.normalize(activity) - - data = - File.read!("test/fixtures/mastodon-vote.json") - |> Poison.decode!() - |> Kernel.put_in(["to"], user.ap_id) - |> Kernel.put_in(["object", "inReplyTo"], object.data["id"]) - |> Kernel.put_in(["object", "to"], user.ap_id) - - {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) - answer_object = Object.normalize(activity) - assert answer_object.data["type"] == "Answer" - object = Object.get_by_ap_id(object.data["id"]) - - assert Enum.any?( - object.data["oneOf"], - fn - %{"name" => "suya..", "replies" => %{"totalItems" => 1}} -> true - _ -> false - end - ) - end - test "it works for incoming notices with contentMap" do data = File.read!("test/fixtures/mastodon-post-activity-contentmap.json") |> Poison.decode!() @@ -401,163 +330,7 @@ test "it strips internal reactions" do refute Map.has_key?(object_data, "reaction_count") end - test "it works for incoming update activities" do - data = File.read!("test/fixtures/mastodon-post-activity.json") |> Poison.decode!() - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - update_data = File.read!("test/fixtures/mastodon-update.json") |> Poison.decode!() - - object = - update_data["object"] - |> Map.put("actor", data["actor"]) - |> Map.put("id", data["actor"]) - - update_data = - update_data - |> Map.put("actor", data["actor"]) - |> Map.put("object", object) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(update_data) - - assert data["id"] == update_data["id"] - - user = User.get_cached_by_ap_id(data["actor"]) - assert user.name == "gargle" - - assert user.avatar["url"] == [ - %{ - "href" => - "https://cd.niu.moe/accounts/avatars/000/033/323/original/fd7f8ae0b3ffedc9.jpeg" - } - ] - - assert user.banner["url"] == [ - %{ - "href" => - "https://cd.niu.moe/accounts/headers/000/033/323/original/850b3448fa5fd477.png" - } - ] - - assert user.bio == "

Some bio

" - end - - test "it works with alsoKnownAs" do - {:ok, %Activity{data: %{"actor" => actor}}} = - "test/fixtures/mastodon-post-activity.json" - |> File.read!() - |> Poison.decode!() - |> Transmogrifier.handle_incoming() - - assert User.get_cached_by_ap_id(actor).also_known_as == ["http://example.org/users/foo"] - - {:ok, _activity} = - "test/fixtures/mastodon-update.json" - |> File.read!() - |> Poison.decode!() - |> Map.put("actor", actor) - |> Map.update!("object", fn object -> - object - |> Map.put("actor", actor) - |> Map.put("id", actor) - |> Map.put("alsoKnownAs", [ - "http://mastodon.example.org/users/foo", - "http://example.org/users/bar" - ]) - end) - |> Transmogrifier.handle_incoming() - - assert User.get_cached_by_ap_id(actor).also_known_as == [ - "http://mastodon.example.org/users/foo", - "http://example.org/users/bar" - ] - end - - test "it works with custom profile fields" do - {:ok, activity} = - "test/fixtures/mastodon-post-activity.json" - |> File.read!() - |> Poison.decode!() - |> Transmogrifier.handle_incoming() - - user = User.get_cached_by_ap_id(activity.actor) - - assert user.fields == [ - %{"name" => "foo", "value" => "bar"}, - %{"name" => "foo1", "value" => "bar1"} - ] - - update_data = File.read!("test/fixtures/mastodon-update.json") |> Poison.decode!() - - object = - update_data["object"] - |> Map.put("actor", user.ap_id) - |> Map.put("id", user.ap_id) - - update_data = - update_data - |> Map.put("actor", user.ap_id) - |> Map.put("object", object) - - {:ok, _update_activity} = Transmogrifier.handle_incoming(update_data) - - user = User.get_cached_by_ap_id(user.ap_id) - - assert user.fields == [ - %{"name" => "foo", "value" => "updated"}, - %{"name" => "foo1", "value" => "updated"} - ] - - Pleroma.Config.put([:instance, :max_remote_account_fields], 2) - - update_data = - put_in(update_data, ["object", "attachment"], [ - %{"name" => "foo", "type" => "PropertyValue", "value" => "bar"}, - %{"name" => "foo11", "type" => "PropertyValue", "value" => "bar11"}, - %{"name" => "foo22", "type" => "PropertyValue", "value" => "bar22"} - ]) - - {:ok, _} = Transmogrifier.handle_incoming(update_data) - - user = User.get_cached_by_ap_id(user.ap_id) - - assert user.fields == [ - %{"name" => "foo", "value" => "updated"}, - %{"name" => "foo1", "value" => "updated"} - ] - - update_data = put_in(update_data, ["object", "attachment"], []) - - {:ok, _} = Transmogrifier.handle_incoming(update_data) - - user = User.get_cached_by_ap_id(user.ap_id) - - assert user.fields == [] - end - - test "it works for incoming update activities which lock the account" do - data = File.read!("test/fixtures/mastodon-post-activity.json") |> Poison.decode!() - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - update_data = File.read!("test/fixtures/mastodon-update.json") |> Poison.decode!() - - object = - update_data["object"] - |> Map.put("actor", data["actor"]) - |> Map.put("id", data["actor"]) - |> Map.put("manuallyApprovesFollowers", true) - - update_data = - update_data - |> Map.put("actor", data["actor"]) - |> Map.put("object", object) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(update_data) - - user = User.get_cached_by_ap_id(data["actor"]) - assert user.locked == true - end - - test "it works for incomming unfollows with an existing follow" do + test "it works for incoming unfollows with an existing follow" do user = insert(:user) follow_data = @@ -582,254 +355,6 @@ test "it works for incomming unfollows with an existing follow" do refute User.following?(User.get_cached_by_ap_id(data["actor"]), user) end - test "it works for incoming follows to locked account" do - pending_follower = insert(:user, ap_id: "http://mastodon.example.org/users/admin") - user = insert(:user, locked: true) - - data = - File.read!("test/fixtures/mastodon-follow-activity.json") - |> Poison.decode!() - |> Map.put("object", user.ap_id) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["type"] == "Follow" - assert data["object"] == user.ap_id - assert data["state"] == "pending" - assert data["actor"] == "http://mastodon.example.org/users/admin" - - assert [^pending_follower] = User.get_follow_requests(user) - end - - test "it works for incoming blocks" do - user = insert(:user) - - data = - File.read!("test/fixtures/mastodon-block-activity.json") - |> Poison.decode!() - |> Map.put("object", user.ap_id) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["type"] == "Block" - assert data["object"] == user.ap_id - assert data["actor"] == "http://mastodon.example.org/users/admin" - - blocker = User.get_cached_by_ap_id(data["actor"]) - - assert User.blocks?(blocker, user) - end - - test "incoming blocks successfully tear down any follow relationship" do - blocker = insert(:user) - blocked = insert(:user) - - data = - File.read!("test/fixtures/mastodon-block-activity.json") - |> Poison.decode!() - |> Map.put("object", blocked.ap_id) - |> Map.put("actor", blocker.ap_id) - - {:ok, blocker} = User.follow(blocker, blocked) - {:ok, blocked} = User.follow(blocked, blocker) - - assert User.following?(blocker, blocked) - assert User.following?(blocked, blocker) - - {:ok, %Activity{data: data, local: false}} = Transmogrifier.handle_incoming(data) - - assert data["type"] == "Block" - assert data["object"] == blocked.ap_id - assert data["actor"] == blocker.ap_id - - blocker = User.get_cached_by_ap_id(data["actor"]) - blocked = User.get_cached_by_ap_id(data["object"]) - - assert User.blocks?(blocker, blocked) - - refute User.following?(blocker, blocked) - refute User.following?(blocked, blocker) - end - - test "it works for incoming accepts which were pre-accepted" do - follower = insert(:user) - followed = insert(:user) - - {:ok, follower} = User.follow(follower, followed) - assert User.following?(follower, followed) == true - - {:ok, follow_activity} = ActivityPub.follow(follower, followed) - - accept_data = - File.read!("test/fixtures/mastodon-accept-activity.json") - |> Poison.decode!() - |> Map.put("actor", followed.ap_id) - - object = - accept_data["object"] - |> Map.put("actor", follower.ap_id) - |> Map.put("id", follow_activity.data["id"]) - - accept_data = Map.put(accept_data, "object", object) - - {:ok, activity} = Transmogrifier.handle_incoming(accept_data) - refute activity.local - - assert activity.data["object"] == follow_activity.data["id"] - - assert activity.data["id"] == accept_data["id"] - - follower = User.get_cached_by_id(follower.id) - - assert User.following?(follower, followed) == true - end - - test "it works for incoming accepts which were orphaned" do - follower = insert(:user) - followed = insert(:user, locked: true) - - {:ok, follow_activity} = ActivityPub.follow(follower, followed) - - accept_data = - File.read!("test/fixtures/mastodon-accept-activity.json") - |> Poison.decode!() - |> Map.put("actor", followed.ap_id) - - accept_data = - Map.put(accept_data, "object", Map.put(accept_data["object"], "actor", follower.ap_id)) - - {:ok, activity} = Transmogrifier.handle_incoming(accept_data) - assert activity.data["object"] == follow_activity.data["id"] - - follower = User.get_cached_by_id(follower.id) - - assert User.following?(follower, followed) == true - end - - test "it works for incoming accepts which are referenced by IRI only" do - follower = insert(:user) - followed = insert(:user, locked: true) - - {:ok, follow_activity} = ActivityPub.follow(follower, followed) - - accept_data = - File.read!("test/fixtures/mastodon-accept-activity.json") - |> Poison.decode!() - |> Map.put("actor", followed.ap_id) - |> Map.put("object", follow_activity.data["id"]) - - {:ok, activity} = Transmogrifier.handle_incoming(accept_data) - assert activity.data["object"] == follow_activity.data["id"] - - follower = User.get_cached_by_id(follower.id) - - assert User.following?(follower, followed) == true - - follower = User.get_by_id(follower.id) - assert follower.following_count == 1 - - followed = User.get_by_id(followed.id) - assert followed.follower_count == 1 - end - - test "it fails for incoming accepts which cannot be correlated" do - follower = insert(:user) - followed = insert(:user, locked: true) - - accept_data = - File.read!("test/fixtures/mastodon-accept-activity.json") - |> Poison.decode!() - |> Map.put("actor", followed.ap_id) - - accept_data = - Map.put(accept_data, "object", Map.put(accept_data["object"], "actor", follower.ap_id)) - - :error = Transmogrifier.handle_incoming(accept_data) - - follower = User.get_cached_by_id(follower.id) - - refute User.following?(follower, followed) == true - end - - test "it fails for incoming rejects which cannot be correlated" do - follower = insert(:user) - followed = insert(:user, locked: true) - - accept_data = - File.read!("test/fixtures/mastodon-reject-activity.json") - |> Poison.decode!() - |> Map.put("actor", followed.ap_id) - - accept_data = - Map.put(accept_data, "object", Map.put(accept_data["object"], "actor", follower.ap_id)) - - :error = Transmogrifier.handle_incoming(accept_data) - - follower = User.get_cached_by_id(follower.id) - - refute User.following?(follower, followed) == true - end - - test "it works for incoming rejects which are orphaned" do - follower = insert(:user) - followed = insert(:user, locked: true) - - {:ok, follower} = User.follow(follower, followed) - {:ok, _follow_activity} = ActivityPub.follow(follower, followed) - - assert User.following?(follower, followed) == true - - reject_data = - File.read!("test/fixtures/mastodon-reject-activity.json") - |> Poison.decode!() - |> Map.put("actor", followed.ap_id) - - reject_data = - Map.put(reject_data, "object", Map.put(reject_data["object"], "actor", follower.ap_id)) - - {:ok, activity} = Transmogrifier.handle_incoming(reject_data) - refute activity.local - assert activity.data["id"] == reject_data["id"] - - follower = User.get_cached_by_id(follower.id) - - assert User.following?(follower, followed) == false - end - - test "it works for incoming rejects which are referenced by IRI only" do - follower = insert(:user) - followed = insert(:user, locked: true) - - {:ok, follower} = User.follow(follower, followed) - {:ok, follow_activity} = ActivityPub.follow(follower, followed) - - assert User.following?(follower, followed) == true - - reject_data = - File.read!("test/fixtures/mastodon-reject-activity.json") - |> Poison.decode!() - |> Map.put("actor", followed.ap_id) - |> Map.put("object", follow_activity.data["id"]) - - {:ok, %Activity{data: _}} = Transmogrifier.handle_incoming(reject_data) - - follower = User.get_cached_by_id(follower.id) - - assert User.following?(follower, followed) == false - end - - test "it rejects activities without a valid ID" do - user = insert(:user) - - data = - File.read!("test/fixtures/mastodon-follow-activity.json") - |> Poison.decode!() - |> Map.put("object", user.ap_id) - |> Map.put("id", "") - - :error = Transmogrifier.handle_incoming(data) - end - test "skip converting the content when it is nil" do object_id = "https://peertube.social/videos/watch/278d2b7c-0f38-4aaa-afe6-9ecc0c4a34fe" @@ -865,22 +390,46 @@ test "it remaps video URLs as attachments if necessary" do "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3" ) - attachment = %{ - "type" => "Link", - "mediaType" => "video/mp4", - "url" => [ - %{ - "href" => - "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4", - "mediaType" => "video/mp4" - } - ] - } - assert object.data["url"] == "https://peertube.moe/videos/watch/df5f464b-be8d-46fb-ad81-2d4c2d1630e3" - assert object.data["attachment"] == [attachment] + assert object.data["attachment"] == [ + %{ + "type" => "Link", + "mediaType" => "video/mp4", + "url" => [ + %{ + "href" => + "https://peertube.moe/static/webseed/df5f464b-be8d-46fb-ad81-2d4c2d1630e3-480.mp4", + "mediaType" => "video/mp4", + "type" => "Link" + } + ] + } + ] + + {:ok, object} = + Fetcher.fetch_object_from_id( + "https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206" + ) + + assert object.data["attachment"] == [ + %{ + "type" => "Link", + "mediaType" => "video/mp4", + "url" => [ + %{ + "href" => + "https://framatube.org/static/webseed/6050732a-8a7a-43d4-a6cd-809525a1d206-1080.mp4", + "mediaType" => "video/mp4", + "type" => "Link" + } + ] + } + ] + + assert object.data["url"] == + "https://framatube.org/videos/watch/6050732a-8a7a-43d4-a6cd-809525a1d206" end test "it accepts Flag activities" do @@ -895,7 +444,7 @@ test "it accepts Flag activities" do "id" => activity.data["id"], "content" => "test post", "published" => object.data["published"], - "actor" => AccountView.render("show.json", %{user: user}) + "actor" => AccountView.render("show.json", %{user: user, skip_visibility_check: true}) } message = %{ @@ -959,6 +508,29 @@ test "it correctly processes messages with non-array cc field" do assert [user.follower_address] == activity.data["to"] end + test "it correctly processes messages with weirdness in address fields" do + user = insert(:user) + + message = %{ + "@context" => "https://www.w3.org/ns/activitystreams", + "to" => [nil, user.follower_address], + "cc" => ["https://www.w3.org/ns/activitystreams#Public", ["¿"]], + "type" => "Create", + "object" => %{ + "content" => "…", + "type" => "Note", + "attributedTo" => user.ap_id, + "inReplyTo" => nil + }, + "actor" => user.ap_id + } + + assert {:ok, activity} = Transmogrifier.handle_incoming(message) + + assert ["https://www.w3.org/ns/activitystreams#Public"] == activity.data["cc"] + assert [user.follower_address] == activity.data["to"] + end + test "it accepts Move activities" do old_user = insert(:user) new_user = insert(:user) @@ -1423,30 +995,6 @@ test "successfully reserializes a message with AS2 objects in IR" do end end - test "Rewrites Answers to Notes" do - user = insert(:user) - - {:ok, poll_activity} = - CommonAPI.post(user, %{ - status: "suya...", - poll: %{options: ["suya", "suya.", "suya.."], expires_in: 10} - }) - - poll_object = Object.normalize(poll_activity) - # TODO: Replace with CommonAPI vote creation when implemented - data = - File.read!("test/fixtures/mastodon-vote.json") - |> Poison.decode!() - |> Kernel.put_in(["to"], user.ap_id) - |> Kernel.put_in(["object", "inReplyTo"], poll_object.data["id"]) - |> Kernel.put_in(["object", "to"], user.ap_id) - - {:ok, %Activity{local: false} = activity} = Transmogrifier.handle_incoming(data) - {:ok, data} = Transmogrifier.prepare_outgoing(activity.data) - - assert data["object"]["type"] == "Note" - end - describe "fix_explicit_addressing" do setup do user = insert(:user) @@ -1524,7 +1072,7 @@ test "returns not modified object when hasn't containts inReplyTo field", %{data assert Transmogrifier.fix_in_reply_to(data) == data end - test "returns object with inReplyToAtomUri when denied incoming reply", %{data: data} do + test "returns object with inReplyTo when denied incoming reply", %{data: data} do Pleroma.Config.put([:instance, :federation_incoming_replies_max_depth], 0) object_with_reply = @@ -1532,26 +1080,22 @@ test "returns object with inReplyToAtomUri when denied incoming reply", %{data: modified_object = Transmogrifier.fix_in_reply_to(object_with_reply) assert modified_object["inReplyTo"] == "https://shitposter.club/notice/2827873" - assert modified_object["inReplyToAtomUri"] == "https://shitposter.club/notice/2827873" object_with_reply = Map.put(data["object"], "inReplyTo", %{"id" => "https://shitposter.club/notice/2827873"}) modified_object = Transmogrifier.fix_in_reply_to(object_with_reply) assert modified_object["inReplyTo"] == %{"id" => "https://shitposter.club/notice/2827873"} - assert modified_object["inReplyToAtomUri"] == "https://shitposter.club/notice/2827873" object_with_reply = Map.put(data["object"], "inReplyTo", ["https://shitposter.club/notice/2827873"]) modified_object = Transmogrifier.fix_in_reply_to(object_with_reply) assert modified_object["inReplyTo"] == ["https://shitposter.club/notice/2827873"] - assert modified_object["inReplyToAtomUri"] == "https://shitposter.club/notice/2827873" object_with_reply = Map.put(data["object"], "inReplyTo", []) modified_object = Transmogrifier.fix_in_reply_to(object_with_reply) assert modified_object["inReplyTo"] == [] - assert modified_object["inReplyToAtomUri"] == "" end @tag capture_log: true @@ -1560,22 +1104,17 @@ test "returns modified object when allowed incoming reply", %{data: data} do Map.put( data["object"], "inReplyTo", - "https://shitposter.club/notice/2827873" + "https://mstdn.io/users/mayuutann/statuses/99568293732299394" ) Pleroma.Config.put([:instance, :federation_incoming_replies_max_depth], 5) modified_object = Transmogrifier.fix_in_reply_to(object_with_reply) assert modified_object["inReplyTo"] == - "tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment" - - assert modified_object["inReplyToAtomUri"] == "https://shitposter.club/notice/2827873" - - assert modified_object["conversation"] == - "tag:shitposter.club,2017-05-05:objectType=thread:nonce=3c16e9c2681f6d26" + "https://mstdn.io/users/mayuutann/statuses/99568293732299394" assert modified_object["context"] == - "tag:shitposter.club,2017-05-05:objectType=thread:nonce=3c16e9c2681f6d26" + "tag:shitposter.club,2018-02-22:objectType=thread:nonce=e5a7c72d60a9c0e4" end end @@ -1677,7 +1216,9 @@ test "returns nil when cannot normalize object" do @tag capture_log: true test "returns {:ok, %Object{}} for success case" do assert {:ok, %Object{}} = - Transmogrifier.get_obj_helper("https://shitposter.club/notice/2827873") + Transmogrifier.get_obj_helper( + "https://mstdn.io/users/mayuutann/statuses/99568293732299394" + ) end end @@ -1697,8 +1238,13 @@ test "returns modified object when attachment is map" do "attachment" => [ %{ "mediaType" => "video/mp4", + "type" => "Document", "url" => [ - %{"href" => "https://peertube.moe/stat-480.mp4", "mediaType" => "video/mp4"} + %{ + "href" => "https://peertube.moe/stat-480.mp4", + "mediaType" => "video/mp4", + "type" => "Link" + } ] } ] @@ -1715,14 +1261,24 @@ test "returns modified object when attachment is list" do "attachment" => [ %{ "mediaType" => "video/mp4", + "type" => "Document", "url" => [ - %{"href" => "https://pe.er/stat-480.mp4", "mediaType" => "video/mp4"} + %{ + "href" => "https://pe.er/stat-480.mp4", + "mediaType" => "video/mp4", + "type" => "Link" + } ] }, %{ "mediaType" => "video/mp4", + "type" => "Document", "url" => [ - %{"href" => "https://pe.er/stat-480.mp4", "mediaType" => "video/mp4"} + %{ + "href" => "https://pe.er/stat-480.mp4", + "mediaType" => "video/mp4", + "type" => "Link" + } ] } ] diff --git a/test/web/activity_pub/utils_test.exs b/test/web/activity_pub/utils_test.exs index 15f03f193..d50213545 100644 --- a/test/web/activity_pub/utils_test.exs +++ b/test/web/activity_pub/utils_test.exs @@ -8,7 +8,6 @@ defmodule Pleroma.Web.ActivityPub.UtilsTest do alias Pleroma.Object alias Pleroma.Repo alias Pleroma.User - alias Pleroma.Web.ActivityPub.ActivityPub alias Pleroma.Web.ActivityPub.Utils alias Pleroma.Web.AdminAPI.AccountView alias Pleroma.Web.CommonAPI @@ -27,16 +26,6 @@ test "fetches the latest Follow activity" do end end - describe "fetch the latest Block" do - test "fetches the latest Block activity" do - blocker = insert(:user) - blocked = insert(:user) - {:ok, activity} = ActivityPub.block(blocker, blocked) - - assert activity == Utils.fetch_latest_block(blocker, blocked) - end - end - describe "determine_explicit_mentions()" do test "works with an object that has mentions" do object = %{ @@ -207,8 +196,8 @@ test "updates the state of all Follow activities with the same actor and object" user = insert(:user, locked: true) follower = insert(:user) - {:ok, follow_activity} = ActivityPub.follow(follower, user) - {:ok, follow_activity_two} = ActivityPub.follow(follower, user) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, user) + {:ok, _, _, follow_activity_two} = CommonAPI.follow(follower, user) data = follow_activity_two.data @@ -231,8 +220,8 @@ test "updates the state of the given follow activity" do user = insert(:user, locked: true) follower = insert(:user) - {:ok, follow_activity} = ActivityPub.follow(follower, user) - {:ok, follow_activity_two} = ActivityPub.follow(follower, user) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, user) + {:ok, _, _, follow_activity_two} = CommonAPI.follow(follower, user) data = follow_activity_two.data @@ -344,9 +333,9 @@ test "fetches last block activities" do user1 = insert(:user) user2 = insert(:user) - assert {:ok, %Activity{} = _} = ActivityPub.block(user1, user2) - assert {:ok, %Activity{} = _} = ActivityPub.block(user1, user2) - assert {:ok, %Activity{} = activity} = ActivityPub.block(user1, user2) + assert {:ok, %Activity{} = _} = CommonAPI.block(user1, user2) + assert {:ok, %Activity{} = _} = CommonAPI.block(user1, user2) + assert {:ok, %Activity{} = activity} = CommonAPI.block(user1, user2) assert Utils.fetch_latest_block(user1, user2) == activity end @@ -493,7 +482,8 @@ test "returns map with Flag object" do "id" => activity_ap_id, "content" => content, "published" => activity.object.data["published"], - "actor" => AccountView.render("show.json", %{user: target_account}) + "actor" => + AccountView.render("show.json", %{user: target_account, skip_visibility_check: true}) } assert %{ diff --git a/test/web/activity_pub/views/user_view_test.exs b/test/web/activity_pub/views/user_view_test.exs index bec15a996..98c7c9d09 100644 --- a/test/web/activity_pub/views/user_view_test.exs +++ b/test/web/activity_pub/views/user_view_test.exs @@ -158,4 +158,23 @@ test "sets correct totalItems when follows are hidden but the follow counter is assert %{"totalItems" => 1} = UserView.render("following.json", %{user: user}) end end + + describe "acceptsChatMessages" do + test "it returns this value if it is set" do + true_user = insert(:user, accepts_chat_messages: true) + false_user = insert(:user, accepts_chat_messages: false) + nil_user = insert(:user, accepts_chat_messages: nil) + + assert %{"capabilities" => %{"acceptsChatMessages" => true}} = + UserView.render("user.json", user: true_user) + + assert %{"capabilities" => %{"acceptsChatMessages" => false}} = + UserView.render("user.json", user: false_user) + + refute Map.has_key?( + UserView.render("user.json", user: nil_user)["capabilities"], + "acceptsChatMessages" + ) + end + end end diff --git a/test/web/admin_api/controllers/admin_api_controller_test.exs b/test/web/admin_api/controllers/admin_api_controller_test.exs index e3d3ccb8d..3bc88c6a9 100644 --- a/test/web/admin_api/controllers/admin_api_controller_test.exs +++ b/test/web/admin_api/controllers/admin_api_controller_test.exs @@ -9,6 +9,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIControllerTest do import ExUnit.CaptureLog import Mock import Pleroma.Factory + import Swoosh.TestAssertions alias Pleroma.Activity alias Pleroma.Config @@ -41,6 +42,16 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIControllerTest do {:ok, %{admin: admin, token: token, conn: conn}} end + test "with valid `admin_token` query parameter, skips OAuth scopes check" do + clear_config([:admin_token], "password123") + + user = insert(:user) + + conn = get(build_conn(), "/api/pleroma/admin/users/#{user.nickname}?admin_token=password123") + + assert json_response(conn, 200) + end + describe "with [:auth, :enforce_oauth_admin_scope_usage]," do setup do: clear_config([:auth, :enforce_oauth_admin_scope_usage], true) @@ -144,11 +155,30 @@ test "GET /api/pleroma/admin/users/:nickname requires " <> describe "DELETE /api/pleroma/admin/users" do test "single user", %{admin: admin, conn: conn} do - user = insert(:user) clear_config([:instance, :federating], true) + user = + insert(:user, + avatar: %{"url" => [%{"href" => "https://someurl"}]}, + banner: %{"url" => [%{"href" => "https://somebanner"}]}, + bio: "Hello world!", + name: "A guy" + ) + + # Create some activities to check they got deleted later + follower = insert(:user) + {:ok, _} = CommonAPI.post(user, %{status: "test"}) + {:ok, _, _, _} = CommonAPI.follow(user, follower) + {:ok, _, _, _} = CommonAPI.follow(follower, user) + user = Repo.get(User, user.id) + assert user.note_count == 1 + assert user.follower_count == 1 + assert user.following_count == 1 + refute user.deactivated + with_mock Pleroma.Web.Federator, - publish: fn _ -> nil end do + publish: fn _ -> nil end, + perform: fn _, _ -> nil end do conn = conn |> put_req_header("accept", "application/json") @@ -165,6 +195,17 @@ test "single user", %{admin: admin, conn: conn} do assert json_response(conn, 200) == [user.nickname] + user = Repo.get(User, user.id) + assert user.deactivated + + assert user.avatar == %{} + assert user.banner == %{} + assert user.note_count == 0 + assert user.follower_count == 0 + assert user.following_count == 0 + assert user.bio == "" + assert user.name == nil + assert called(Pleroma.Web.Federator.publish(:_)) end end @@ -338,7 +379,10 @@ test "Show", %{conn: conn} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } assert expected == json_response(conn, 200) @@ -426,7 +470,7 @@ test "it appends specified tags to users with specified nicknames", %{ user1: user1, user2: user2 } do - assert json_response(conn, :no_content) + assert empty_json_response(conn) assert User.get_cached_by_id(user1.id).tags == ["x", "foo", "bar"] assert User.get_cached_by_id(user2.id).tags == ["y", "foo", "bar"] @@ -444,7 +488,7 @@ test "it appends specified tags to users with specified nicknames", %{ end test "it does not modify tags of not specified users", %{conn: conn, user3: user3} do - assert json_response(conn, :no_content) + assert empty_json_response(conn) assert User.get_cached_by_id(user3.id).tags == ["unchanged"] end end @@ -472,7 +516,7 @@ test "it removes specified tags from users with specified nicknames", %{ user1: user1, user2: user2 } do - assert json_response(conn, :no_content) + assert empty_json_response(conn) assert User.get_cached_by_id(user1.id).tags == [] assert User.get_cached_by_id(user2.id).tags == ["y"] @@ -490,7 +534,7 @@ test "it removes specified tags from users with specified nicknames", %{ end test "it does not modify tags of not specified users", %{conn: conn, user3: user3} do - assert json_response(conn, :no_content) + assert empty_json_response(conn) assert User.get_cached_by_id(user3.id).tags == ["unchanged"] end end @@ -602,6 +646,8 @@ test "/api/pleroma/admin/users/:nickname/password_reset", %{conn: conn} do describe "GET /api/pleroma/admin/users" do test "renders users array for the first page", %{conn: conn, admin: admin} do user = insert(:user, local: false, tags: ["foo", "bar"]) + user2 = insert(:user, approval_pending: true, registration_reason: "I'm a chill dude") + conn = get(conn, "/api/pleroma/admin/users?page=1") users = @@ -616,7 +662,10 @@ test "renders users array for the first page", %{conn: conn, admin: admin} do "avatar" => User.avatar_url(admin) |> MediaProxy.url(), "display_name" => HTML.strip_tags(admin.name || admin.nickname), "confirmation_pending" => false, - "url" => admin.ap_id + "approval_pending" => false, + "url" => admin.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" }, %{ "deactivated" => user.deactivated, @@ -628,13 +677,31 @@ test "renders users array for the first page", %{conn: conn, admin: admin} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" + }, + %{ + "deactivated" => user2.deactivated, + "id" => user2.id, + "nickname" => user2.nickname, + "roles" => %{"admin" => false, "moderator" => false}, + "local" => true, + "tags" => [], + "avatar" => User.avatar_url(user2) |> MediaProxy.url(), + "display_name" => HTML.strip_tags(user2.name || user2.nickname), + "confirmation_pending" => false, + "approval_pending" => true, + "url" => user2.ap_id, + "registration_reason" => "I'm a chill dude", + "actor_type" => "Person" } ] |> Enum.sort_by(& &1["nickname"]) assert json_response(conn, 200) == %{ - "count" => 2, + "count" => 3, "page_size" => 50, "users" => users } @@ -701,7 +768,10 @@ test "regular search", %{conn: conn} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -727,7 +797,10 @@ test "search by domain", %{conn: conn} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -753,7 +826,10 @@ test "search by full nickname", %{conn: conn} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -779,7 +855,10 @@ test "search by display name", %{conn: conn} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -805,7 +884,10 @@ test "search by email", %{conn: conn} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -831,7 +913,10 @@ test "regular search with page size", %{conn: conn} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -852,7 +937,10 @@ test "regular search with page size", %{conn: conn} do "avatar" => User.avatar_url(user2) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user2.name || user2.nickname), "confirmation_pending" => false, - "url" => user2.ap_id + "approval_pending" => false, + "url" => user2.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -885,7 +973,10 @@ test "only local users" do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -911,7 +1002,10 @@ test "only local users with no query", %{conn: conn, admin: old_admin} do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" }, %{ "deactivated" => admin.deactivated, @@ -923,7 +1017,10 @@ test "only local users with no query", %{conn: conn, admin: old_admin} do "avatar" => User.avatar_url(admin) |> MediaProxy.url(), "display_name" => HTML.strip_tags(admin.name || admin.nickname), "confirmation_pending" => false, - "url" => admin.ap_id + "approval_pending" => false, + "url" => admin.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" }, %{ "deactivated" => false, @@ -935,7 +1032,10 @@ test "only local users with no query", %{conn: conn, admin: old_admin} do "avatar" => User.avatar_url(old_admin) |> MediaProxy.url(), "display_name" => HTML.strip_tags(old_admin.name || old_admin.nickname), "confirmation_pending" => false, - "url" => old_admin.ap_id + "approval_pending" => false, + "url" => old_admin.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] |> Enum.sort_by(& &1["nickname"]) @@ -947,6 +1047,45 @@ test "only local users with no query", %{conn: conn, admin: old_admin} do } end + test "only unapproved users", %{conn: conn} do + user = + insert(:user, + nickname: "sadboy", + approval_pending: true, + registration_reason: "Plz let me in!" + ) + + insert(:user, nickname: "happyboy", approval_pending: false) + + conn = get(conn, "/api/pleroma/admin/users?filters=need_approval") + + users = + [ + %{ + "deactivated" => user.deactivated, + "id" => user.id, + "nickname" => user.nickname, + "roles" => %{"admin" => false, "moderator" => false}, + "local" => true, + "tags" => [], + "avatar" => User.avatar_url(user) |> MediaProxy.url(), + "display_name" => HTML.strip_tags(user.name || user.nickname), + "confirmation_pending" => false, + "approval_pending" => true, + "url" => user.ap_id, + "registration_reason" => "Plz let me in!", + "actor_type" => "Person" + } + ] + |> Enum.sort_by(& &1["nickname"]) + + assert json_response(conn, 200) == %{ + "count" => 1, + "page_size" => 50, + "users" => users + } + end + test "load only admins", %{conn: conn, admin: admin} do second_admin = insert(:user, is_admin: true) insert(:user) @@ -966,7 +1105,10 @@ test "load only admins", %{conn: conn, admin: admin} do "avatar" => User.avatar_url(admin) |> MediaProxy.url(), "display_name" => HTML.strip_tags(admin.name || admin.nickname), "confirmation_pending" => false, - "url" => admin.ap_id + "approval_pending" => false, + "url" => admin.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" }, %{ "deactivated" => false, @@ -978,7 +1120,10 @@ test "load only admins", %{conn: conn, admin: admin} do "avatar" => User.avatar_url(second_admin) |> MediaProxy.url(), "display_name" => HTML.strip_tags(second_admin.name || second_admin.nickname), "confirmation_pending" => false, - "url" => second_admin.ap_id + "approval_pending" => false, + "url" => second_admin.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] |> Enum.sort_by(& &1["nickname"]) @@ -1011,7 +1156,10 @@ test "load only moderators", %{conn: conn} do "avatar" => User.avatar_url(moderator) |> MediaProxy.url(), "display_name" => HTML.strip_tags(moderator.name || moderator.nickname), "confirmation_pending" => false, - "url" => moderator.ap_id + "approval_pending" => false, + "url" => moderator.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -1037,7 +1185,10 @@ test "load users with tags list", %{conn: conn} do "avatar" => User.avatar_url(user1) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user1.name || user1.nickname), "confirmation_pending" => false, - "url" => user1.ap_id + "approval_pending" => false, + "url" => user1.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" }, %{ "deactivated" => false, @@ -1049,7 +1200,10 @@ test "load users with tags list", %{conn: conn} do "avatar" => User.avatar_url(user2) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user2.name || user2.nickname), "confirmation_pending" => false, - "url" => user2.ap_id + "approval_pending" => false, + "url" => user2.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] |> Enum.sort_by(& &1["nickname"]) @@ -1061,6 +1215,27 @@ test "load users with tags list", %{conn: conn} do } end + test "`active` filters out users pending approval", %{token: token} do + insert(:user, approval_pending: true) + %{id: user_id} = insert(:user, approval_pending: false) + %{id: admin_id} = token.user + + conn = + build_conn() + |> assign(:user, token.user) + |> assign(:token, token) + |> get("/api/pleroma/admin/users?filters=active") + + assert %{ + "count" => 2, + "page_size" => 50, + "users" => [ + %{"id" => ^admin_id}, + %{"id" => ^user_id} + ] + } = json_response(conn, 200) + end + test "it works with multiple filters" do admin = insert(:user, nickname: "john", is_admin: true) token = insert(:oauth_admin_token, user: admin) @@ -1089,7 +1264,10 @@ test "it works with multiple filters" do "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -1114,7 +1292,10 @@ test "it omits relay user", %{admin: admin, conn: conn} do "avatar" => User.avatar_url(admin) |> MediaProxy.url(), "display_name" => HTML.strip_tags(admin.name || admin.nickname), "confirmation_pending" => false, - "url" => admin.ap_id + "approval_pending" => false, + "url" => admin.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } ] } @@ -1161,6 +1342,26 @@ test "PATCH /api/pleroma/admin/users/deactivate", %{admin: admin, conn: conn} do "@#{admin.nickname} deactivated users: @#{user_one.nickname}, @#{user_two.nickname}" end + test "PATCH /api/pleroma/admin/users/approve", %{admin: admin, conn: conn} do + user_one = insert(:user, approval_pending: true) + user_two = insert(:user, approval_pending: true) + + conn = + patch( + conn, + "/api/pleroma/admin/users/approve", + %{nicknames: [user_one.nickname, user_two.nickname]} + ) + + response = json_response(conn, 200) + assert Enum.map(response["users"], & &1["approval_pending"]) == [false, false] + + log_entry = Repo.one(ModerationLog) + + assert ModerationLog.get_log_entry_message(log_entry) == + "@#{admin.nickname} approved users: @#{user_one.nickname}, @#{user_two.nickname}" + end + test "PATCH /api/pleroma/admin/users/:nickname/toggle_activation", %{admin: admin, conn: conn} do user = insert(:user) @@ -1177,7 +1378,10 @@ test "PATCH /api/pleroma/admin/users/:nickname/toggle_activation", %{admin: admi "avatar" => User.avatar_url(user) |> MediaProxy.url(), "display_name" => HTML.strip_tags(user.name || user.nickname), "confirmation_pending" => false, - "url" => user.ap_id + "approval_pending" => false, + "url" => user.ap_id, + "registration_reason" => nil, + "actor_type" => "Person" } log_entry = Repo.one(ModerationLog) @@ -1514,6 +1718,15 @@ test "returns log filtered by search", %{conn: conn, moderator: moderator} do end end + test "gets a remote users when [:instance, :limit_to_local_content] is set to :unauthenticated", + %{conn: conn} do + clear_config(Pleroma.Config.get([:instance, :limit_to_local_content]), :unauthenticated) + user = insert(:user, %{local: false, nickname: "u@peer1.com"}) + conn = get(conn, "/api/pleroma/admin/users/#{user.nickname}/credentials") + + assert json_response(conn, 200) + end + describe "GET /users/:nickname/credentials" do test "gets the user credentials", %{conn: conn} do user = insert(:user) @@ -1599,14 +1812,14 @@ test "changes actor type from permitted list", %{conn: conn, user: user} do assert patch(conn, "/api/pleroma/admin/users/#{user.nickname}/credentials", %{ "actor_type" => "Application" }) - |> json_response(200) == %{"errors" => %{"actor_type" => "is invalid"}} + |> json_response(400) == %{"errors" => %{"actor_type" => "is invalid"}} end test "update non existing user", %{conn: conn} do assert patch(conn, "/api/pleroma/admin/users/non-existing/credentials", %{ "password" => "new_password" }) - |> json_response(200) == %{"error" => "Unable to update user."} + |> json_response(404) == %{"error" => "Not found"} end end @@ -1618,7 +1831,7 @@ test "sets password_reset_pending to true", %{conn: conn} do conn = patch(conn, "/api/pleroma/admin/users/force_password_reset", %{nicknames: [user.nickname]}) - assert json_response(conn, 204) == "" + assert empty_json_response(conn) == "" ObanHelpers.perform_all() @@ -1712,6 +1925,9 @@ test "it resend emails for two users", %{conn: conn, admin: admin} do "@#{admin.nickname} re-sent confirmation email for users: @#{first_user.nickname}, @#{ second_user.nickname }" + + ObanHelpers.perform_all() + assert_email_sent(Pleroma.Emails.UserEmail.account_confirmation_email(first_user)) end end @@ -1732,6 +1948,26 @@ test "status visibility count", %{conn: conn} do assert %{"direct" => 0, "private" => 0, "public" => 1, "unlisted" => 2} = response["status_visibility"] end + + test "by instance", %{conn: conn} do + admin = insert(:user, is_admin: true) + user1 = insert(:user) + instance2 = "instance2.tld" + user2 = insert(:user, %{ap_id: "https://#{instance2}/@actor"}) + + CommonAPI.post(user1, %{visibility: "public", status: "hey"}) + CommonAPI.post(user2, %{visibility: "unlisted", status: "hey"}) + CommonAPI.post(user2, %{visibility: "private", status: "hey"}) + + response = + conn + |> assign(:user, admin) + |> get("/api/pleroma/admin/stats", instance: instance2) + |> json_response(200) + + assert %{"direct" => 0, "private" => 1, "public" => 0, "unlisted" => 1} = + response["status_visibility"] + end end end diff --git a/test/web/admin_api/controllers/config_controller_test.exs b/test/web/admin_api/controllers/config_controller_test.exs index 780de8d18..4e897455f 100644 --- a/test/web/admin_api/controllers/config_controller_test.exs +++ b/test/web/admin_api/controllers/config_controller_test.exs @@ -57,12 +57,12 @@ test "with settings only in db", %{conn: conn} do ] } = json_response_and_validate_schema(conn, 200) - assert key1 == config1.key - assert key2 == config2.key + assert key1 == inspect(config1.key) + assert key2 == inspect(config2.key) end test "db is added to settings that are in db", %{conn: conn} do - _config = insert(:config, key: ":instance", value: ConfigDB.to_binary(name: "Some name")) + _config = insert(:config, key: ":instance", value: [name: "Some name"]) %{"configs" => configs} = conn @@ -83,7 +83,7 @@ test "merged default setting with db settings", %{conn: conn} do config3 = insert(:config, - value: ConfigDB.to_binary(k1: :v1, k2: :v2) + value: [k1: :v1, k2: :v2] ) %{"configs" => configs} = @@ -93,42 +93,45 @@ test "merged default setting with db settings", %{conn: conn} do assert length(configs) > 3 + saved_configs = [config1, config2, config3] + keys = Enum.map(saved_configs, &inspect(&1.key)) + received_configs = Enum.filter(configs, fn %{"group" => group, "key" => key} -> - group == ":pleroma" and key in [config1.key, config2.key, config3.key] + group == ":pleroma" and key in keys end) assert length(received_configs) == 3 db_keys = config3.value - |> ConfigDB.from_binary() |> Keyword.keys() - |> ConfigDB.convert() + |> ConfigDB.to_json_types() + + keys = Enum.map(saved_configs -- [config3], &inspect(&1.key)) + + values = Enum.map(saved_configs, &ConfigDB.to_json_types(&1.value)) + + mapset_keys = MapSet.new(keys ++ db_keys) Enum.each(received_configs, fn %{"value" => value, "db" => db} -> - assert db in [[config1.key], [config2.key], db_keys] + db = MapSet.new(db) + assert MapSet.subset?(db, mapset_keys) - assert value in [ - ConfigDB.from_binary_with_convert(config1.value), - ConfigDB.from_binary_with_convert(config2.value), - ConfigDB.from_binary_with_convert(config3.value) - ] + assert value in values end) end test "subkeys with full update right merge", %{conn: conn} do - config1 = - insert(:config, - key: ":emoji", - value: ConfigDB.to_binary(groups: [a: 1, b: 2], key: [a: 1]) - ) + insert(:config, + key: ":emoji", + value: [groups: [a: 1, b: 2], key: [a: 1]] + ) - config2 = - insert(:config, - key: ":assets", - value: ConfigDB.to_binary(mascots: [a: 1, b: 2], key: [a: 1]) - ) + insert(:config, + key: ":assets", + value: [mascots: [a: 1, b: 2], key: [a: 1]] + ) %{"configs" => configs} = conn @@ -137,18 +140,26 @@ test "subkeys with full update right merge", %{conn: conn} do vals = Enum.filter(configs, fn %{"group" => group, "key" => key} -> - group == ":pleroma" and key in [config1.key, config2.key] + group == ":pleroma" and key in [":emoji", ":assets"] end) emoji = Enum.find(vals, fn %{"key" => key} -> key == ":emoji" end) assets = Enum.find(vals, fn %{"key" => key} -> key == ":assets" end) - emoji_val = ConfigDB.transform_with_out_binary(emoji["value"]) - assets_val = ConfigDB.transform_with_out_binary(assets["value"]) + emoji_val = ConfigDB.to_elixir_types(emoji["value"]) + assets_val = ConfigDB.to_elixir_types(assets["value"]) assert emoji_val[:groups] == [a: 1, b: 2] assert assets_val[:mascots] == [a: 1, b: 2] end + + test "with valid `admin_token` query parameter, skips OAuth scopes check" do + clear_config([:admin_token], "password123") + + build_conn() + |> get("/api/pleroma/admin/config?admin_token=password123") + |> json_response_and_validate_schema(200) + end end test "POST /api/pleroma/admin/config error", %{conn: conn} do @@ -277,7 +288,8 @@ test "create new config setting in db", %{conn: conn} do "value" => %{"tuple" => ["string", "Pleroma.Captcha.NotReal", []]}, "db" => [":key5"] } - ] + ], + "need_reboot" => false } assert Application.get_env(:pleroma, :key1) == "value1" @@ -357,7 +369,8 @@ test "save configs setting without explicit key", %{conn: conn} do "value" => "https://hooks.slack.com/services/KEY", "db" => [":webhook_url"] } - ] + ], + "need_reboot" => false } assert Application.get_env(:quack, :level) == :info @@ -366,14 +379,14 @@ test "save configs setting without explicit key", %{conn: conn} do end test "saving config with partial update", %{conn: conn} do - config = insert(:config, key: ":key1", value: :erlang.term_to_binary(key1: 1, key2: 2)) + insert(:config, key: ":key1", value: :erlang.term_to_binary(key1: 1, key2: 2)) conn = conn |> put_req_header("content-type", "application/json") |> post("/api/pleroma/admin/config", %{ configs: [ - %{group: config.group, key: config.key, value: [%{"tuple" => [":key3", 3]}]} + %{group: ":pleroma", key: ":key1", value: [%{"tuple" => [":key3", 3]}]} ] }) @@ -389,7 +402,8 @@ test "saving config with partial update", %{conn: conn} do ], "db" => [":key1", ":key2", ":key3"] } - ] + ], + "need_reboot" => false } end @@ -500,8 +514,7 @@ test "update setting which need reboot, don't change reboot flag until reboot", end test "saving config with nested merge", %{conn: conn} do - config = - insert(:config, key: ":key1", value: :erlang.term_to_binary(key1: 1, key2: [k1: 1, k2: 2])) + insert(:config, key: :key1, value: [key1: 1, key2: [k1: 1, k2: 2]]) conn = conn @@ -509,8 +522,8 @@ test "saving config with nested merge", %{conn: conn} do |> post("/api/pleroma/admin/config", %{ configs: [ %{ - group: config.group, - key: config.key, + group: ":pleroma", + key: ":key1", value: [ %{"tuple" => [":key3", 3]}, %{ @@ -548,7 +561,8 @@ test "saving config with nested merge", %{conn: conn} do ], "db" => [":key1", ":key3", ":key2"] } - ] + ], + "need_reboot" => false } end @@ -588,7 +602,8 @@ test "saving special atoms", %{conn: conn} do ], "db" => [":ssl_options"] } - ] + ], + "need_reboot" => false } assert Application.get_env(:pleroma, :key1) == [ @@ -600,12 +615,11 @@ test "saving full setting if value is in full_key_update list", %{conn: conn} do backends = Application.get_env(:logger, :backends) on_exit(fn -> Application.put_env(:logger, :backends, backends) end) - config = - insert(:config, - group: ":logger", - key: ":backends", - value: :erlang.term_to_binary([]) - ) + insert(:config, + group: :logger, + key: :backends, + value: [] + ) Pleroma.Config.TransferTask.load_and_update_env([], false) @@ -617,8 +631,8 @@ test "saving full setting if value is in full_key_update list", %{conn: conn} do |> post("/api/pleroma/admin/config", %{ configs: [ %{ - group: config.group, - key: config.key, + group: ":logger", + key: ":backends", value: [":console"] } ] @@ -634,7 +648,8 @@ test "saving full setting if value is in full_key_update list", %{conn: conn} do ], "db" => [":backends"] } - ] + ], + "need_reboot" => false } assert Application.get_env(:logger, :backends) == [ @@ -643,19 +658,18 @@ test "saving full setting if value is in full_key_update list", %{conn: conn} do end test "saving full setting if value is not keyword", %{conn: conn} do - config = - insert(:config, - group: ":tesla", - key: ":adapter", - value: :erlang.term_to_binary(Tesla.Adapter.Hackey) - ) + insert(:config, + group: :tesla, + key: :adapter, + value: Tesla.Adapter.Hackey + ) conn = conn |> put_req_header("content-type", "application/json") |> post("/api/pleroma/admin/config", %{ configs: [ - %{group: config.group, key: config.key, value: "Tesla.Adapter.Httpc"} + %{group: ":tesla", key: ":adapter", value: "Tesla.Adapter.Httpc"} ] }) @@ -667,7 +681,8 @@ test "saving full setting if value is not keyword", %{conn: conn} do "value" => "Tesla.Adapter.Httpc", "db" => [":adapter"] } - ] + ], + "need_reboot" => false } end @@ -677,13 +692,13 @@ test "update config setting & delete with fallback to default value", %{ token: token } do ueberauth = Application.get_env(:ueberauth, Ueberauth) - config1 = insert(:config, key: ":keyaa1") - config2 = insert(:config, key: ":keyaa2") + insert(:config, key: :keyaa1) + insert(:config, key: :keyaa2) config3 = insert(:config, - group: ":ueberauth", - key: "Ueberauth" + group: :ueberauth, + key: Ueberauth ) conn = @@ -691,8 +706,8 @@ test "update config setting & delete with fallback to default value", %{ |> put_req_header("content-type", "application/json") |> post("/api/pleroma/admin/config", %{ configs: [ - %{group: config1.group, key: config1.key, value: "another_value"}, - %{group: config2.group, key: config2.key, value: "another_value"} + %{group: ":pleroma", key: ":keyaa1", value: "another_value"}, + %{group: ":pleroma", key: ":keyaa2", value: "another_value"} ] }) @@ -700,22 +715,23 @@ test "update config setting & delete with fallback to default value", %{ "configs" => [ %{ "group" => ":pleroma", - "key" => config1.key, + "key" => ":keyaa1", "value" => "another_value", "db" => [":keyaa1"] }, %{ "group" => ":pleroma", - "key" => config2.key, + "key" => ":keyaa2", "value" => "another_value", "db" => [":keyaa2"] } - ] + ], + "need_reboot" => false } assert Application.get_env(:pleroma, :keyaa1) == "another_value" assert Application.get_env(:pleroma, :keyaa2) == "another_value" - assert Application.get_env(:ueberauth, Ueberauth) == ConfigDB.from_binary(config3.value) + assert Application.get_env(:ueberauth, Ueberauth) == config3.value conn = build_conn() @@ -724,7 +740,7 @@ test "update config setting & delete with fallback to default value", %{ |> put_req_header("content-type", "application/json") |> post("/api/pleroma/admin/config", %{ configs: [ - %{group: config2.group, key: config2.key, delete: true}, + %{group: ":pleroma", key: ":keyaa2", delete: true}, %{ group: ":ueberauth", key: "Ueberauth", @@ -734,7 +750,8 @@ test "update config setting & delete with fallback to default value", %{ }) assert json_response_and_validate_schema(conn, 200) == %{ - "configs" => [] + "configs" => [], + "need_reboot" => false } assert Application.get_env(:ueberauth, Ueberauth) == ueberauth @@ -801,7 +818,8 @@ test "common config example", %{conn: conn} do ":name" ] } - ] + ], + "need_reboot" => false } end @@ -935,7 +953,8 @@ test "tuples with more than two values", %{conn: conn} do ], "db" => [":http"] } - ] + ], + "need_reboot" => false } end @@ -1000,7 +1019,8 @@ test "settings with nesting map", %{conn: conn} do ], "db" => [":key2", ":key3"] } - ] + ], + "need_reboot" => false } end @@ -1027,7 +1047,8 @@ test "value as map", %{conn: conn} do "value" => %{"key" => "some_val"}, "db" => [":key1"] } - ] + ], + "need_reboot" => false } end @@ -1077,16 +1098,16 @@ test "queues key as atom", %{conn: conn} do ":background" ] } - ] + ], + "need_reboot" => false } end test "delete part of settings by atom subkeys", %{conn: conn} do - config = - insert(:config, - key: ":keyaa1", - value: :erlang.term_to_binary(subkey1: "val1", subkey2: "val2", subkey3: "val3") - ) + insert(:config, + key: :keyaa1, + value: [subkey1: "val1", subkey2: "val2", subkey3: "val3"] + ) conn = conn @@ -1094,8 +1115,8 @@ test "delete part of settings by atom subkeys", %{conn: conn} do |> post("/api/pleroma/admin/config", %{ configs: [ %{ - group: config.group, - key: config.key, + group: ":pleroma", + key: ":keyaa1", subkeys: [":subkey1", ":subkey3"], delete: true } @@ -1110,7 +1131,8 @@ test "delete part of settings by atom subkeys", %{conn: conn} do "value" => [%{"tuple" => [":subkey2", "val2"]}], "db" => [":subkey2"] } - ] + ], + "need_reboot" => false } end @@ -1236,6 +1258,159 @@ test "doesn't set keys not in the whitelist", %{conn: conn} do assert Application.get_env(:pleroma, Pleroma.Captcha.NotReal) == "value5" assert Application.get_env(:not_real, :anything) == "value6" end + + test "args for Pleroma.Upload.Filter.Mogrify with custom tuples", %{conn: conn} do + clear_config(Pleroma.Upload.Filter.Mogrify) + + assert conn + |> put_req_header("content-type", "application/json") + |> post("/api/pleroma/admin/config", %{ + configs: [ + %{ + group: ":pleroma", + key: "Pleroma.Upload.Filter.Mogrify", + value: [ + %{"tuple" => [":args", ["auto-orient", "strip"]]} + ] + } + ] + }) + |> json_response_and_validate_schema(200) == %{ + "configs" => [ + %{ + "group" => ":pleroma", + "key" => "Pleroma.Upload.Filter.Mogrify", + "value" => [ + %{"tuple" => [":args", ["auto-orient", "strip"]]} + ], + "db" => [":args"] + } + ], + "need_reboot" => false + } + + assert Config.get(Pleroma.Upload.Filter.Mogrify) == [args: ["auto-orient", "strip"]] + + assert conn + |> put_req_header("content-type", "application/json") + |> post("/api/pleroma/admin/config", %{ + configs: [ + %{ + group: ":pleroma", + key: "Pleroma.Upload.Filter.Mogrify", + value: [ + %{ + "tuple" => [ + ":args", + [ + "auto-orient", + "strip", + "{\"implode\", \"1\"}", + "{\"resize\", \"3840x1080>\"}" + ] + ] + } + ] + } + ] + }) + |> json_response(200) == %{ + "configs" => [ + %{ + "group" => ":pleroma", + "key" => "Pleroma.Upload.Filter.Mogrify", + "value" => [ + %{ + "tuple" => [ + ":args", + [ + "auto-orient", + "strip", + "{\"implode\", \"1\"}", + "{\"resize\", \"3840x1080>\"}" + ] + ] + } + ], + "db" => [":args"] + } + ], + "need_reboot" => false + } + + assert Config.get(Pleroma.Upload.Filter.Mogrify) == [ + args: ["auto-orient", "strip", {"implode", "1"}, {"resize", "3840x1080>"}] + ] + end + + test "enables the welcome messages", %{conn: conn} do + clear_config([:welcome]) + + params = %{ + "group" => ":pleroma", + "key" => ":welcome", + "value" => [ + %{ + "tuple" => [ + ":direct_message", + [ + %{"tuple" => [":enabled", true]}, + %{"tuple" => [":message", "Welcome to Pleroma!"]}, + %{"tuple" => [":sender_nickname", "pleroma"]} + ] + ] + }, + %{ + "tuple" => [ + ":chat_message", + [ + %{"tuple" => [":enabled", true]}, + %{"tuple" => [":message", "Welcome to Pleroma!"]}, + %{"tuple" => [":sender_nickname", "pleroma"]} + ] + ] + }, + %{ + "tuple" => [ + ":email", + [ + %{"tuple" => [":enabled", true]}, + %{"tuple" => [":sender", %{"tuple" => ["pleroma@dev.dev", "Pleroma"]}]}, + %{"tuple" => [":subject", "Welcome to <%= instance_name %>!"]}, + %{"tuple" => [":html", "Welcome to <%= instance_name %>!"]}, + %{"tuple" => [":text", "Welcome to <%= instance_name %>!"]} + ] + ] + } + ] + } + + refute Pleroma.User.WelcomeEmail.enabled?() + refute Pleroma.User.WelcomeMessage.enabled?() + refute Pleroma.User.WelcomeChatMessage.enabled?() + + res = + assert conn + |> put_req_header("content-type", "application/json") + |> post("/api/pleroma/admin/config", %{"configs" => [params]}) + |> json_response_and_validate_schema(200) + + assert Pleroma.User.WelcomeEmail.enabled?() + assert Pleroma.User.WelcomeMessage.enabled?() + assert Pleroma.User.WelcomeChatMessage.enabled?() + + assert res == %{ + "configs" => [ + %{ + "db" => [":direct_message", ":chat_message", ":email"], + "group" => ":pleroma", + "key" => ":welcome", + "value" => params["value"] + } + ], + "need_reboot" => false + } + end end describe "GET /api/pleroma/admin/config/descriptions" do diff --git a/test/web/admin_api/controllers/media_proxy_cache_controller_test.exs b/test/web/admin_api/controllers/media_proxy_cache_controller_test.exs new file mode 100644 index 000000000..f243d1fb2 --- /dev/null +++ b/test/web/admin_api/controllers/media_proxy_cache_controller_test.exs @@ -0,0 +1,167 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.AdminAPI.MediaProxyCacheControllerTest do + use Pleroma.Web.ConnCase + + import Pleroma.Factory + import Mock + + alias Pleroma.Web.MediaProxy + + setup do: clear_config([:media_proxy]) + + setup do + on_exit(fn -> Cachex.clear(:banned_urls_cache) end) + end + + setup do + admin = insert(:user, is_admin: true) + token = insert(:oauth_admin_token, user: admin) + + conn = + build_conn() + |> assign(:user, admin) + |> assign(:token, token) + + Config.put([:media_proxy, :enabled], true) + Config.put([:media_proxy, :invalidation, :enabled], true) + Config.put([:media_proxy, :invalidation, :provider], MediaProxy.Invalidation.Script) + + {:ok, %{admin: admin, token: token, conn: conn}} + end + + describe "GET /api/pleroma/admin/media_proxy_caches" do + test "shows banned MediaProxy URLs", %{conn: conn} do + MediaProxy.put_in_banned_urls([ + "http://localhost:4001/media/a688346.jpg", + "http://localhost:4001/media/fb1f4d.jpg" + ]) + + MediaProxy.put_in_banned_urls("http://localhost:4001/media/gb1f44.jpg") + MediaProxy.put_in_banned_urls("http://localhost:4001/media/tb13f47.jpg") + MediaProxy.put_in_banned_urls("http://localhost:4001/media/wb1f46.jpg") + + response = + conn + |> get("/api/pleroma/admin/media_proxy_caches?page_size=2") + |> json_response_and_validate_schema(200) + + assert response["page_size"] == 2 + assert response["count"] == 5 + + assert response["urls"] == [ + "http://localhost:4001/media/fb1f4d.jpg", + "http://localhost:4001/media/a688346.jpg" + ] + + response = + conn + |> get("/api/pleroma/admin/media_proxy_caches?page_size=2&page=2") + |> json_response_and_validate_schema(200) + + assert response["urls"] == [ + "http://localhost:4001/media/gb1f44.jpg", + "http://localhost:4001/media/tb13f47.jpg" + ] + + assert response["page_size"] == 2 + assert response["count"] == 5 + + response = + conn + |> get("/api/pleroma/admin/media_proxy_caches?page_size=2&page=3") + |> json_response_and_validate_schema(200) + + assert response["urls"] == ["http://localhost:4001/media/wb1f46.jpg"] + end + + test "search banned MediaProxy URLs", %{conn: conn} do + MediaProxy.put_in_banned_urls([ + "http://localhost:4001/media/a688346.jpg", + "http://localhost:4001/media/ff44b1f4d.jpg" + ]) + + MediaProxy.put_in_banned_urls("http://localhost:4001/media/gb1f44.jpg") + MediaProxy.put_in_banned_urls("http://localhost:4001/media/tb13f47.jpg") + MediaProxy.put_in_banned_urls("http://localhost:4001/media/wb1f46.jpg") + + response = + conn + |> get("/api/pleroma/admin/media_proxy_caches?page_size=2&query=F44") + |> json_response_and_validate_schema(200) + + assert response["urls"] == [ + "http://localhost:4001/media/gb1f44.jpg", + "http://localhost:4001/media/ff44b1f4d.jpg" + ] + + assert response["page_size"] == 2 + assert response["count"] == 2 + end + end + + describe "POST /api/pleroma/admin/media_proxy_caches/delete" do + test "deleted MediaProxy URLs from banned", %{conn: conn} do + MediaProxy.put_in_banned_urls([ + "http://localhost:4001/media/a688346.jpg", + "http://localhost:4001/media/fb1f4d.jpg" + ]) + + conn + |> put_req_header("content-type", "application/json") + |> post("/api/pleroma/admin/media_proxy_caches/delete", %{ + urls: ["http://localhost:4001/media/a688346.jpg"] + }) + |> json_response_and_validate_schema(200) + + refute MediaProxy.in_banned_urls("http://localhost:4001/media/a688346.jpg") + assert MediaProxy.in_banned_urls("http://localhost:4001/media/fb1f4d.jpg") + end + end + + describe "POST /api/pleroma/admin/media_proxy_caches/purge" do + test "perform invalidates cache of MediaProxy", %{conn: conn} do + urls = [ + "http://example.com/media/a688346.jpg", + "http://example.com/media/fb1f4d.jpg" + ] + + with_mocks [ + {MediaProxy.Invalidation.Script, [], + [ + purge: fn _, _ -> {"ok", 0} end + ]} + ] do + conn + |> put_req_header("content-type", "application/json") + |> post("/api/pleroma/admin/media_proxy_caches/purge", %{urls: urls, ban: false}) + |> json_response_and_validate_schema(200) + + refute MediaProxy.in_banned_urls("http://example.com/media/a688346.jpg") + refute MediaProxy.in_banned_urls("http://example.com/media/fb1f4d.jpg") + end + end + + test "perform invalidates cache of MediaProxy and adds url to banned", %{conn: conn} do + urls = [ + "http://example.com/media/a688346.jpg", + "http://example.com/media/fb1f4d.jpg" + ] + + with_mocks [{MediaProxy.Invalidation.Script, [], [purge: fn _, _ -> {"ok", 0} end]}] do + conn + |> put_req_header("content-type", "application/json") + |> post( + "/api/pleroma/admin/media_proxy_caches/purge", + %{urls: urls, ban: true} + ) + |> json_response_and_validate_schema(200) + + assert MediaProxy.in_banned_urls("http://example.com/media/a688346.jpg") + assert MediaProxy.in_banned_urls("http://example.com/media/fb1f4d.jpg") + end + end + end +end diff --git a/test/web/admin_api/controllers/relay_controller_test.exs b/test/web/admin_api/controllers/relay_controller_test.exs index 64086adc5..adadf2b5c 100644 --- a/test/web/admin_api/controllers/relay_controller_test.exs +++ b/test/web/admin_api/controllers/relay_controller_test.exs @@ -39,8 +39,10 @@ test "POST /relay", %{conn: conn, admin: admin} do relay_url: "http://mastodon.example.org/users/admin" }) - assert json_response_and_validate_schema(conn, 200) == - "http://mastodon.example.org/users/admin" + assert json_response_and_validate_schema(conn, 200) == %{ + "actor" => "http://mastodon.example.org/users/admin", + "followed_back" => false + } log_entry = Repo.one(ModerationLog) @@ -59,8 +61,13 @@ test "GET /relay", %{conn: conn} do conn = get(conn, "/api/pleroma/admin/relay") - assert json_response_and_validate_schema(conn, 200)["relays"] -- - ["mastodon.example.org", "mstdn.io"] == [] + assert json_response_and_validate_schema(conn, 200)["relays"] == [ + %{ + "actor" => "http://mastodon.example.org/users/admin", + "followed_back" => true + }, + %{"actor" => "https://mstdn.io/users/mayuutann", "followed_back" => true} + ] end test "DELETE /relay", %{conn: conn, admin: admin} do diff --git a/test/web/admin_api/controllers/report_controller_test.exs b/test/web/admin_api/controllers/report_controller_test.exs index 940bce340..57946e6bb 100644 --- a/test/web/admin_api/controllers/report_controller_test.exs +++ b/test/web/admin_api/controllers/report_controller_test.exs @@ -204,7 +204,7 @@ test "updates state of multiple reports", %{ test "returns empty response when no reports created", %{conn: conn} do response = conn - |> get("/api/pleroma/admin/reports") + |> get(report_path(conn, :index)) |> json_response_and_validate_schema(:ok) assert Enum.empty?(response["reports"]) @@ -224,7 +224,7 @@ test "returns reports", %{conn: conn} do response = conn - |> get("/api/pleroma/admin/reports") + |> get(report_path(conn, :index)) |> json_response_and_validate_schema(:ok) [report] = response["reports"] @@ -256,7 +256,7 @@ test "returns reports with specified state", %{conn: conn} do response = conn - |> get("/api/pleroma/admin/reports?state=open") + |> get(report_path(conn, :index, %{state: "open"})) |> json_response_and_validate_schema(:ok) assert [open_report] = response["reports"] @@ -268,7 +268,7 @@ test "returns reports with specified state", %{conn: conn} do response = conn - |> get("/api/pleroma/admin/reports?state=closed") + |> get(report_path(conn, :index, %{state: "closed"})) |> json_response_and_validate_schema(:ok) assert [closed_report] = response["reports"] @@ -280,9 +280,7 @@ test "returns reports with specified state", %{conn: conn} do assert %{"total" => 0, "reports" => []} == conn - |> get("/api/pleroma/admin/reports?state=resolved", %{ - "" => "" - }) + |> get(report_path(conn, :index, %{state: "resolved"})) |> json_response_and_validate_schema(:ok) end @@ -297,7 +295,7 @@ test "returns 403 when requested by a non-admin" do |> get("/api/pleroma/admin/reports") assert json_response(conn, :forbidden) == - %{"error" => "User is not an admin or OAuth admin scope is not granted."} + %{"error" => "User is not an admin."} end test "returns 403 when requested by anonymous" do diff --git a/test/web/admin_api/search_test.exs b/test/web/admin_api/search_test.exs index e0e3d4153..b974cedd5 100644 --- a/test/web/admin_api/search_test.exs +++ b/test/web/admin_api/search_test.exs @@ -166,5 +166,16 @@ test "it returns user by email" do assert total == 3 assert count == 1 end + + test "it returns unapproved user" do + unapproved = insert(:user, approval_pending: true) + insert(:user) + insert(:user) + + {:ok, _results, total} = Search.user() + {:ok, [^unapproved], count} = Search.user(%{need_approval: true}) + assert total == 3 + assert count == 1 + end end end diff --git a/test/web/admin_api/views/report_view_test.exs b/test/web/admin_api/views/report_view_test.exs index f00b0afb2..5a02292be 100644 --- a/test/web/admin_api/views/report_view_test.exs +++ b/test/web/admin_api/views/report_view_test.exs @@ -4,11 +4,14 @@ defmodule Pleroma.Web.AdminAPI.ReportViewTest do use Pleroma.DataCase + import Pleroma.Factory + + alias Pleroma.Web.AdminAPI alias Pleroma.Web.AdminAPI.Report alias Pleroma.Web.AdminAPI.ReportView alias Pleroma.Web.CommonAPI - alias Pleroma.Web.MastodonAPI.AccountView + alias Pleroma.Web.MastodonAPI alias Pleroma.Web.MastodonAPI.StatusView test "renders a report" do @@ -21,13 +24,16 @@ test "renders a report" do content: nil, actor: Map.merge( - AccountView.render("show.json", %{user: user}), - Pleroma.Web.AdminAPI.AccountView.render("show.json", %{user: user}) + MastodonAPI.AccountView.render("show.json", %{user: user, skip_visibility_check: true}), + AdminAPI.AccountView.render("show.json", %{user: user}) ), account: Map.merge( - AccountView.render("show.json", %{user: other_user}), - Pleroma.Web.AdminAPI.AccountView.render("show.json", %{user: other_user}) + MastodonAPI.AccountView.render("show.json", %{ + user: other_user, + skip_visibility_check: true + }), + AdminAPI.AccountView.render("show.json", %{user: other_user}) ), statuses: [], notes: [], @@ -56,13 +62,16 @@ test "includes reported statuses" do content: nil, actor: Map.merge( - AccountView.render("show.json", %{user: user}), - Pleroma.Web.AdminAPI.AccountView.render("show.json", %{user: user}) + MastodonAPI.AccountView.render("show.json", %{user: user, skip_visibility_check: true}), + AdminAPI.AccountView.render("show.json", %{user: user}) ), account: Map.merge( - AccountView.render("show.json", %{user: other_user}), - Pleroma.Web.AdminAPI.AccountView.render("show.json", %{user: other_user}) + MastodonAPI.AccountView.render("show.json", %{ + user: other_user, + skip_visibility_check: true + }), + AdminAPI.AccountView.render("show.json", %{user: other_user}) ), statuses: [StatusView.render("show.json", %{activity: activity})], state: "open", diff --git a/test/web/common_api/common_api_test.exs b/test/web/common_api/common_api_test.exs index 6bd26050e..5afb0a6dc 100644 --- a/test/web/common_api/common_api_test.exs +++ b/test/web/common_api/common_api_test.exs @@ -4,11 +4,14 @@ defmodule Pleroma.Web.CommonAPITest do use Pleroma.DataCase + use Oban.Testing, repo: Pleroma.Repo + alias Pleroma.Activity alias Pleroma.Chat alias Pleroma.Conversation.Participation alias Pleroma.Notification alias Pleroma.Object + alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub alias Pleroma.Web.ActivityPub.Transmogrifier @@ -18,6 +21,7 @@ defmodule Pleroma.Web.CommonAPITest do import Pleroma.Factory import Mock + import Ecto.Query, only: [from: 2] require Pleroma.Constants @@ -25,6 +29,52 @@ defmodule Pleroma.Web.CommonAPITest do setup do: clear_config([:instance, :limit]) setup do: clear_config([:instance, :max_pinned_statuses]) + describe "blocking" do + setup do + blocker = insert(:user) + blocked = insert(:user) + User.follow(blocker, blocked) + User.follow(blocked, blocker) + %{blocker: blocker, blocked: blocked} + end + + test "it blocks and federates", %{blocker: blocker, blocked: blocked} do + clear_config([:instance, :federating], true) + + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + assert {:ok, block} = CommonAPI.block(blocker, blocked) + + assert block.local + assert User.blocks?(blocker, blocked) + refute User.following?(blocker, blocked) + refute User.following?(blocked, blocker) + + assert called(Pleroma.Web.Federator.publish(block)) + end + end + + test "it blocks and does not federate if outgoing blocks are disabled", %{ + blocker: blocker, + blocked: blocked + } do + clear_config([:instance, :federating], true) + clear_config([:activitypub, :outgoing_blocks], false) + + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + assert {:ok, block} = CommonAPI.block(blocker, blocked) + + assert block.local + assert User.blocks?(blocker, blocked) + refute User.following?(blocker, blocked) + refute User.following?(blocked, blocker) + + refute called(Pleroma.Web.Federator.publish(block)) + end + end + end + describe "posting chat messages" do setup do: clear_config([:instance, :chat_limit]) @@ -412,6 +462,11 @@ test "it adds emoji in the object" do end describe "posting" do + test "deactivated users can't post" do + user = insert(:user, deactivated: true) + assert {:error, _} = CommonAPI.post(user, %{status: "ye"}) + end + test "it supports explicit addressing" do user = insert(:user) user_two = insert(:user) @@ -445,6 +500,7 @@ test "it filters out obviously bad tags when accepting a post as HTML" do object = Object.normalize(activity) assert object.data["content"] == "

2hu

alert('xss')" + assert object.data["source"] == post end test "it filters out obviously bad tags when accepting a post as Markdown" do @@ -461,6 +517,7 @@ test "it filters out obviously bad tags when accepting a post as Markdown" do object = Object.normalize(activity) assert object.data["content"] == "

2hu

alert('xss')" + assert object.data["source"] == post end test "it does not allow replies to direct messages that are not direct messages themselves" do @@ -543,15 +600,15 @@ test "it validates character limits are correctly enforced" do test "it can handle activities that expire" do user = insert(:user) - expires_at = - NaiveDateTime.utc_now() - |> NaiveDateTime.truncate(:second) - |> NaiveDateTime.add(1_000_000, :second) + expires_at = DateTime.add(DateTime.utc_now(), 1_000_000) assert {:ok, activity} = CommonAPI.post(user, %{status: "chai", expires_in: 1_000_000}) - assert expiration = Pleroma.ActivityExpiration.get_by_activity_id(activity.id) - assert expiration.scheduled_at == expires_at + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: activity.id}, + scheduled_at: expires_at + ) end end @@ -576,14 +633,27 @@ test "unreacting to a status with an emoji" do user = insert(:user) other_user = insert(:user) - {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) - {:ok, reaction} = CommonAPI.react_with_emoji(activity.id, user, "👍") + clear_config([:instance, :federating], true) - {:ok, unreaction} = CommonAPI.unreact_with_emoji(activity.id, user, "👍") + with_mock Pleroma.Web.Federator, + publish: fn _ -> nil end do + {:ok, activity} = CommonAPI.post(other_user, %{status: "cofe"}) + {:ok, reaction} = CommonAPI.react_with_emoji(activity.id, user, "👍") - assert unreaction.data["type"] == "Undo" - assert unreaction.data["object"] == reaction.data["id"] - assert unreaction.local + {:ok, unreaction} = CommonAPI.unreact_with_emoji(activity.id, user, "👍") + + assert unreaction.data["type"] == "Undo" + assert unreaction.data["object"] == reaction.data["id"] + assert unreaction.local + + # On federation, it contains the undone (and deleted) object + unreaction_with_object = %{ + unreaction + | data: Map.put(unreaction.data, "object", reaction.data) + } + + assert called(Pleroma.Web.Federator.publish(unreaction_with_object)) + end end test "repeating a status" do @@ -742,6 +812,69 @@ test "should unpin when deleting a status", %{user: user, activity: activity} do [user: user, activity: activity] end + test "marks notifications as read after mute" do + author = insert(:user) + activity = insert(:note_activity, user: author) + + friend1 = insert(:user) + friend2 = insert(:user) + + {:ok, reply_activity} = + CommonAPI.post( + friend2, + %{ + status: "@#{author.nickname} @#{friend1.nickname} test reply", + in_reply_to_status_id: activity.id + } + ) + + {:ok, favorite_activity} = CommonAPI.favorite(friend2, activity.id) + {:ok, repeat_activity} = CommonAPI.repeat(activity.id, friend1) + + assert Repo.aggregate( + from(n in Notification, where: n.seen == false and n.user_id == ^friend1.id), + :count + ) == 1 + + unread_notifications = + Repo.all(from(n in Notification, where: n.seen == false, where: n.user_id == ^author.id)) + + assert Enum.any?(unread_notifications, fn n -> + n.type == "favourite" && n.activity_id == favorite_activity.id + end) + + assert Enum.any?(unread_notifications, fn n -> + n.type == "reblog" && n.activity_id == repeat_activity.id + end) + + assert Enum.any?(unread_notifications, fn n -> + n.type == "mention" && n.activity_id == reply_activity.id + end) + + {:ok, _} = CommonAPI.add_mute(author, activity) + assert CommonAPI.thread_muted?(author, activity) + + assert Repo.aggregate( + from(n in Notification, where: n.seen == false and n.user_id == ^friend1.id), + :count + ) == 1 + + read_notifications = + Repo.all(from(n in Notification, where: n.seen == true, where: n.user_id == ^author.id)) + + assert Enum.any?(read_notifications, fn n -> + n.type == "favourite" && n.activity_id == favorite_activity.id + end) + + assert Enum.any?(read_notifications, fn n -> + n.type == "reblog" && n.activity_id == repeat_activity.id + end) + + assert Enum.any?(read_notifications, fn n -> + n.type == "mention" && n.activity_id == reply_activity.id + end) + end + test "add mute", %{user: user, activity: activity} do {:ok, _} = CommonAPI.add_mute(user, activity) assert CommonAPI.thread_muted?(user, activity) @@ -886,6 +1019,15 @@ test "remove a reblog mute", %{muter: muter, muted: muted} do end end + describe "follow/2" do + test "directly follows a non-locked local user" do + [follower, followed] = insert_pair(:user) + {:ok, follower, followed, _} = CommonAPI.follow(follower, followed) + + assert User.following?(follower, followed) + end + end + describe "unfollow/2" do test "also unsubscribes a user" do [follower, followed] = insert_pair(:user) @@ -950,9 +1092,9 @@ test "after acceptance, it sets all existing pending follow request states to 'a follower = insert(:user) follower_two = insert(:user) - {:ok, follow_activity} = ActivityPub.follow(follower, user) - {:ok, follow_activity_two} = ActivityPub.follow(follower, user) - {:ok, follow_activity_three} = ActivityPub.follow(follower_two, user) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, user) + {:ok, _, _, follow_activity_two} = CommonAPI.follow(follower, user) + {:ok, _, _, follow_activity_three} = CommonAPI.follow(follower_two, user) assert follow_activity.data["state"] == "pending" assert follow_activity_two.data["state"] == "pending" @@ -970,9 +1112,9 @@ test "after rejection, it sets all existing pending follow request states to 're follower = insert(:user) follower_two = insert(:user) - {:ok, follow_activity} = ActivityPub.follow(follower, user) - {:ok, follow_activity_two} = ActivityPub.follow(follower, user) - {:ok, follow_activity_three} = ActivityPub.follow(follower_two, user) + {:ok, _, _, follow_activity} = CommonAPI.follow(follower, user) + {:ok, _, _, follow_activity_two} = CommonAPI.follow(follower, user) + {:ok, _, _, follow_activity_three} = CommonAPI.follow(follower_two, user) assert follow_activity.data["state"] == "pending" assert follow_activity_two.data["state"] == "pending" diff --git a/test/web/fallback_test.exs b/test/web/fallback_test.exs index 3919ef93a..a65865860 100644 --- a/test/web/fallback_test.exs +++ b/test/web/fallback_test.exs @@ -6,22 +6,56 @@ defmodule Pleroma.Web.FallbackTest do use Pleroma.Web.ConnCase import Pleroma.Factory - test "GET /registration/:token", %{conn: conn} do - assert conn - |> get("/registration/foo") - |> html_response(200) =~ "" + describe "neither preloaded data nor metadata attached to" do + test "GET /registration/:token", %{conn: conn} do + response = get(conn, "/registration/foo") + + assert html_response(response, 200) =~ "" + end + + test "GET /*path", %{conn: conn} do + assert conn + |> get("/foo") + |> html_response(200) =~ "" + end end - test "GET /:maybe_nickname_or_id", %{conn: conn} do - user = insert(:user) + describe "preloaded data and metadata attached to" do + test "GET /:maybe_nickname_or_id", %{conn: conn} do + user = insert(:user) + user_missing = get(conn, "/foo") + user_present = get(conn, "/#{user.nickname}") - assert conn - |> get("/foo") - |> html_response(200) =~ "" + assert(html_response(user_missing, 200) =~ "") + refute html_response(user_present, 200) =~ "" + assert html_response(user_present, 200) =~ "initial-results" + end - refute conn - |> get("/" <> user.nickname) - |> html_response(200) =~ "" + test "GET /*path", %{conn: conn} do + assert conn + |> get("/foo") + |> html_response(200) =~ "" + + refute conn + |> get("/foo/bar") + |> html_response(200) =~ "" + end + end + + describe "preloaded data is attached to" do + test "GET /main/public", %{conn: conn} do + public_page = get(conn, "/main/public") + + refute html_response(public_page, 200) =~ "" + assert html_response(public_page, 200) =~ "initial-results" + end + + test "GET /main/all", %{conn: conn} do + public_page = get(conn, "/main/all") + + refute html_response(public_page, 200) =~ "" + assert html_response(public_page, 200) =~ "initial-results" + end end test "GET /api*path", %{conn: conn} do @@ -34,16 +68,6 @@ test "GET /pleroma/admin -> /pleroma/admin/", %{conn: conn} do assert redirected_to(get(conn, "/pleroma/admin")) =~ "/pleroma/admin/" end - test "GET /*path", %{conn: conn} do - assert conn - |> get("/foo") - |> html_response(200) =~ "" - - assert conn - |> get("/foo/bar") - |> html_response(200) =~ "" - end - test "OPTIONS /*path", %{conn: conn} do assert conn |> options("/foo") diff --git a/test/web/federator_test.exs b/test/web/federator_test.exs index de90aa6e0..592fdccd1 100644 --- a/test/web/federator_test.exs +++ b/test/web/federator_test.exs @@ -23,7 +23,7 @@ defmodule Pleroma.Web.FederatorTest do setup_all do: clear_config([:instance, :federating], true) setup do: clear_config([:instance, :allow_relay]) - setup do: clear_config([:instance, :rewrite_policy]) + setup do: clear_config([:mrf, :policies]) setup do: clear_config([:mrf_keyword]) describe "Publish an activity" do @@ -158,7 +158,7 @@ test "it does not crash if MRF rejects the post" do Pleroma.Config.put([:mrf_keyword, :reject], ["lain"]) Pleroma.Config.put( - [:instance, :rewrite_policy], + [:mrf, :policies], Pleroma.Web.ActivityPub.MRF.KeywordPolicy ) diff --git a/test/web/feed/tag_controller_test.exs b/test/web/feed/tag_controller_test.exs index 3c29cd94f..868e40965 100644 --- a/test/web/feed/tag_controller_test.exs +++ b/test/web/feed/tag_controller_test.exs @@ -181,4 +181,17 @@ test "gets a feed (RSS)", %{conn: conn} do 'yeah #PleromaArt' ] end + + describe "private instance" do + setup do: clear_config([:instance, :public]) + + test "returns 404 for tags feed", %{conn: conn} do + Config.put([:instance, :public], false) + + conn + |> put_req_header("accept", "application/rss+xml") + |> get(tag_feed_path(conn, :feed, "pleromaart")) + |> response(404) + end + end end diff --git a/test/web/feed/user_controller_test.exs b/test/web/feed/user_controller_test.exs index fa2ed1ea5..9a5610baa 100644 --- a/test/web/feed/user_controller_test.exs +++ b/test/web/feed/user_controller_test.exs @@ -181,6 +181,17 @@ test "returns feed with public and unlisted activities", %{conn: conn} do assert activity_titles == ['public', 'unlisted'] end + + test "returns 404 when the user is remote", %{conn: conn} do + user = insert(:user, local: false) + + {:ok, _} = CommonAPI.post(user, %{status: "test"}) + + assert conn + |> put_req_header("accept", "application/atom+xml") + |> get(user_feed_path(conn, :feed, user.nickname)) + |> response(404) + end end # Note: see ActivityPubControllerTest for JSON format tests @@ -235,4 +246,20 @@ test "with non-html / non-json format, it returns error when user is not found", assert response == ~S({"error":"Not found"}) end end + + describe "private instance" do + setup do: clear_config([:instance, :public]) + + test "returns 404 for user feed", %{conn: conn} do + Config.put([:instance, :public], false) + user = insert(:user) + + {:ok, _} = CommonAPI.post(user, %{status: "test"}) + + assert conn + |> put_req_header("accept", "application/atom+xml") + |> get(user_feed_path(conn, :feed, user.nickname)) + |> response(404) + end + end end diff --git a/test/web/instances/instance_test.exs b/test/web/instances/instance_test.exs index e463200ca..dc6ace843 100644 --- a/test/web/instances/instance_test.exs +++ b/test/web/instances/instance_test.exs @@ -8,6 +8,7 @@ defmodule Pleroma.Instances.InstanceTest do use Pleroma.DataCase + import ExUnit.CaptureLog import Pleroma.Factory setup_all do: clear_config([:instance, :federation_reachability_timeout_days], 1) @@ -97,4 +98,36 @@ test "does NOT modify `unreachable_since` value of existing record in case it's assert initial_value == instance.unreachable_since end end + + test "Scrapes favicon URLs" do + Tesla.Mock.mock(fn %{url: "https://favicon.example.org/"} -> + %Tesla.Env{ + status: 200, + body: ~s[] + } + end) + + assert "https://favicon.example.org/favicon.png" == + Instance.get_or_update_favicon(URI.parse("https://favicon.example.org/")) + end + + test "Returns nil on too long favicon URLs" do + long_favicon_url = + "https://Lorem.ipsum.dolor.sit.amet/consecteturadipiscingelit/Praesentpharetrapurusutaliquamtempus/Mauriseulaoreetarcu/atfacilisisorci/Nullamporttitor/nequesedfeugiatmollis/dolormagnaefficiturlorem/nonpretiumsapienorcieurisus/Nullamveleratsem/Maecenassedaccumsanexnam/favicon.png" + + Tesla.Mock.mock(fn %{url: "https://long-favicon.example.org/"} -> + %Tesla.Env{ + status: 200, + body: ~s[] + } + end) + + assert capture_log(fn -> + assert nil == + Instance.get_or_update_favicon( + URI.parse("https://long-favicon.example.org/") + ) + end) =~ + "Instance.get_or_update_favicon(\"long-favicon.example.org\") error: %Postgrex.Error{" + end end diff --git a/test/web/masto_fe_controller_test.exs b/test/web/masto_fe_controller_test.exs index 1d107d56c..f3b54b5f2 100644 --- a/test/web/masto_fe_controller_test.exs +++ b/test/web/masto_fe_controller_test.exs @@ -24,7 +24,7 @@ test "put settings", %{conn: conn} do assert _result = json_response(conn, 200) user = User.get_cached_by_ap_id(user.ap_id) - assert user.settings == %{"programming" => "socks"} + assert user.mastofe_settings == %{"programming" => "socks"} end describe "index/2 redirections" do diff --git a/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs b/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs index 7c420985d..2e6704726 100644 --- a/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs +++ b/test/web/mastodon_api/controllers/account_controller/update_credentials_test.exs @@ -83,10 +83,9 @@ test "sets user settings in a generic way", %{conn: conn} do test "updates the user's bio", %{conn: conn} do user2 = insert(:user) - conn = - patch(conn, "/api/v1/accounts/update_credentials", %{ - "note" => "I drink #cofe with @#{user2.nickname}\n\nsuya.." - }) + raw_bio = "I drink #cofe with @#{user2.nickname}\n\nsuya.." + + conn = patch(conn, "/api/v1/accounts/update_credentials", %{"note" => raw_bio}) assert user_data = json_response_and_validate_schema(conn, 200) @@ -94,6 +93,12 @@ test "updates the user's bio", %{conn: conn} do ~s(I drink #cofe with @#{user2.nickname}

suya..) + + assert user_data["source"]["note"] == raw_bio + + user = Repo.get(User, user_data["id"]) + + assert user.raw_bio == raw_bio end test "updates the user's locking status", %{conn: conn} do @@ -103,6 +108,13 @@ test "updates the user's locking status", %{conn: conn} do assert user_data["locked"] == true end + test "updates the user's chat acceptance status", %{conn: conn} do + conn = patch(conn, "/api/v1/accounts/update_credentials", %{accepts_chat_messages: "false"}) + + assert user_data = json_response_and_validate_schema(conn, 200) + assert user_data["pleroma"]["accepts_chat_messages"] == false + end + test "updates the user's allow_following_move", %{user: user, conn: conn} do assert user.allow_following_move == true @@ -202,6 +214,10 @@ test "updates the user's name", %{conn: conn} do assert user_data = json_response_and_validate_schema(conn, 200) assert user_data["display_name"] == "markorepairs" + + update_activity = Repo.one(Pleroma.Activity) + assert update_activity.data["type"] == "Update" + assert update_activity.data["object"]["name"] == "markorepairs" end test "updates the user's avatar", %{user: user, conn: conn} do @@ -211,10 +227,21 @@ test "updates the user's avatar", %{user: user, conn: conn} do filename: "an_image.jpg" } - conn = patch(conn, "/api/v1/accounts/update_credentials", %{"avatar" => new_avatar}) + assert user.avatar == %{} - assert user_response = json_response_and_validate_schema(conn, 200) + res = patch(conn, "/api/v1/accounts/update_credentials", %{"avatar" => new_avatar}) + + assert user_response = json_response_and_validate_schema(res, 200) assert user_response["avatar"] != User.avatar_url(user) + + user = User.get_by_id(user.id) + refute user.avatar == %{} + + # Also resets it + _res = patch(conn, "/api/v1/accounts/update_credentials", %{"avatar" => ""}) + + user = User.get_by_id(user.id) + assert user.avatar == nil end test "updates the user's banner", %{user: user, conn: conn} do @@ -224,26 +251,39 @@ test "updates the user's banner", %{user: user, conn: conn} do filename: "an_image.jpg" } - conn = patch(conn, "/api/v1/accounts/update_credentials", %{"header" => new_header}) + res = patch(conn, "/api/v1/accounts/update_credentials", %{"header" => new_header}) - assert user_response = json_response_and_validate_schema(conn, 200) + assert user_response = json_response_and_validate_schema(res, 200) assert user_response["header"] != User.banner_url(user) + + # Also resets it + _res = patch(conn, "/api/v1/accounts/update_credentials", %{"header" => ""}) + + user = User.get_by_id(user.id) + assert user.banner == nil end - test "updates the user's background", %{conn: conn} do + test "updates the user's background", %{conn: conn, user: user} do new_header = %Plug.Upload{ content_type: "image/jpg", path: Path.absname("test/fixtures/image.jpg"), filename: "an_image.jpg" } - conn = + res = patch(conn, "/api/v1/accounts/update_credentials", %{ "pleroma_background_image" => new_header }) - assert user_response = json_response_and_validate_schema(conn, 200) + assert user_response = json_response_and_validate_schema(res, 200) assert user_response["pleroma"]["background_image"] + # + # Also resets it + _res = + patch(conn, "/api/v1/accounts/update_credentials", %{"pleroma_background_image" => ""}) + + user = User.get_by_id(user.id) + assert user.background == nil end test "requires 'write:accounts' permission" do @@ -315,6 +355,30 @@ test "update fields", %{conn: conn} do ] end + test "emojis in fields labels", %{conn: conn} do + fields = [ + %{"name" => ":firefox:", "value" => "is best 2hu"}, + %{"name" => "they wins", "value" => ":blank:"} + ] + + account_data = + conn + |> patch("/api/v1/accounts/update_credentials", %{"fields_attributes" => fields}) + |> json_response_and_validate_schema(200) + + assert account_data["fields"] == [ + %{"name" => ":firefox:", "value" => "is best 2hu"}, + %{"name" => "they wins", "value" => ":blank:"} + ] + + assert account_data["source"]["fields"] == [ + %{"name" => ":firefox:", "value" => "is best 2hu"}, + %{"name" => "they wins", "value" => ":blank:"} + ] + + assert [%{"shortcode" => "blank"}, %{"shortcode" => "firefox"}] = account_data["emojis"] + end + test "update fields via x-www-form-urlencoded", %{conn: conn} do fields = [ @@ -395,4 +459,71 @@ test "update fields when invalid request", %{conn: conn} do |> json_response_and_validate_schema(403) end end + + describe "Mark account as bot" do + setup do: oauth_access(["write:accounts"]) + setup :request_content_type + + test "changing actor_type to Service makes account a bot", %{conn: conn} do + account = + conn + |> patch("/api/v1/accounts/update_credentials", %{actor_type: "Service"}) + |> json_response_and_validate_schema(200) + + assert account["bot"] + assert account["source"]["pleroma"]["actor_type"] == "Service" + end + + test "changing actor_type to Person makes account a human", %{conn: conn} do + account = + conn + |> patch("/api/v1/accounts/update_credentials", %{actor_type: "Person"}) + |> json_response_and_validate_schema(200) + + refute account["bot"] + assert account["source"]["pleroma"]["actor_type"] == "Person" + end + + test "changing actor_type to Application causes error", %{conn: conn} do + response = + conn + |> patch("/api/v1/accounts/update_credentials", %{actor_type: "Application"}) + |> json_response_and_validate_schema(403) + + assert %{"error" => "Invalid request"} == response + end + + test "changing bot field to true changes actor_type to Service", %{conn: conn} do + account = + conn + |> patch("/api/v1/accounts/update_credentials", %{bot: "true"}) + |> json_response_and_validate_schema(200) + + assert account["bot"] + assert account["source"]["pleroma"]["actor_type"] == "Service" + end + + test "changing bot field to false changes actor_type to Person", %{conn: conn} do + account = + conn + |> patch("/api/v1/accounts/update_credentials", %{bot: "false"}) + |> json_response_and_validate_schema(200) + + refute account["bot"] + assert account["source"]["pleroma"]["actor_type"] == "Person" + end + + test "actor_type field has a higher priority than bot", %{conn: conn} do + account = + conn + |> patch("/api/v1/accounts/update_credentials", %{ + actor_type: "Person", + bot: "true" + }) + |> json_response_and_validate_schema(200) + + refute account["bot"] + assert account["source"]["pleroma"]["actor_type"] == "Person" + end + end end diff --git a/test/web/mastodon_api/controllers/account_controller_test.exs b/test/web/mastodon_api/controllers/account_controller_test.exs index 1ce97378d..17a1e7d66 100644 --- a/test/web/mastodon_api/controllers/account_controller_test.exs +++ b/test/web/mastodon_api/controllers/account_controller_test.exs @@ -5,7 +5,6 @@ defmodule Pleroma.Web.MastodonAPI.AccountControllerTest do use Pleroma.Web.ConnCase - alias Pleroma.Config alias Pleroma.Repo alias Pleroma.User alias Pleroma.Web.ActivityPub.ActivityPub @@ -16,8 +15,6 @@ defmodule Pleroma.Web.MastodonAPI.AccountControllerTest do import Pleroma.Factory describe "account fetching" do - setup do: clear_config([:instance, :limit_to_local_content]) - test "works by id" do %User{id: user_id} = insert(:user) @@ -42,7 +39,7 @@ test "works by nickname" do end test "works by nickname for remote users" do - Config.put([:instance, :limit_to_local_content], false) + clear_config([:instance, :limit_to_local_content], false) user = insert(:user, nickname: "user@example.com", local: false) @@ -53,7 +50,7 @@ test "works by nickname for remote users" do end test "respects limit_to_local_content == :all for remote user nicknames" do - Config.put([:instance, :limit_to_local_content], :all) + clear_config([:instance, :limit_to_local_content], :all) user = insert(:user, nickname: "user@example.com", local: false) @@ -63,7 +60,7 @@ test "respects limit_to_local_content == :all for remote user nicknames" do end test "respects limit_to_local_content == :unauthenticated for remote user nicknames" do - Config.put([:instance, :limit_to_local_content], :unauthenticated) + clear_config([:instance, :limit_to_local_content], :unauthenticated) user = insert(:user, nickname: "user@example.com", local: false) reading_user = insert(:user) @@ -127,6 +124,15 @@ test "returns 404 for internal.fetch actor", %{conn: conn} do |> get("/api/v1/accounts/internal.fetch") |> json_response_and_validate_schema(404) end + + test "returns 404 for deactivated user", %{conn: conn} do + user = insert(:user, deactivated: true) + + assert %{"error" => "Can't find user"} = + conn + |> get("/api/v1/accounts/#{user.id}") + |> json_response_and_validate_schema(:not_found) + end end defp local_and_remote_users do @@ -143,15 +149,15 @@ defp local_and_remote_users do setup do: clear_config([:restrict_unauthenticated, :profiles, :remote], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - assert %{"error" => "Can't find user"} == + assert %{"error" => "This API requires an authenticated user"} == conn |> get("/api/v1/accounts/#{local.id}") - |> json_response_and_validate_schema(:not_found) + |> json_response_and_validate_schema(:unauthorized) - assert %{"error" => "Can't find user"} == + assert %{"error" => "This API requires an authenticated user"} == conn |> get("/api/v1/accounts/#{remote.id}") - |> json_response_and_validate_schema(:not_found) + |> json_response_and_validate_schema(:unauthorized) end test "if user is authenticated", %{local: local, remote: remote} do @@ -173,8 +179,8 @@ test "if user is authenticated", %{local: local, remote: remote} do test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do res_conn = get(conn, "/api/v1/accounts/#{local.id}") - assert json_response_and_validate_schema(res_conn, :not_found) == %{ - "error" => "Can't find user" + assert json_response_and_validate_schema(res_conn, :unauthorized) == %{ + "error" => "This API requires an authenticated user" } res_conn = get(conn, "/api/v1/accounts/#{remote.id}") @@ -203,8 +209,8 @@ test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} d res_conn = get(conn, "/api/v1/accounts/#{remote.id}") - assert json_response_and_validate_schema(res_conn, :not_found) == %{ - "error" => "Can't find user" + assert json_response_and_validate_schema(res_conn, :unauthorized) == %{ + "error" => "This API requires an authenticated user" } end @@ -249,6 +255,24 @@ test "works with announces that are just addressed to public", %{conn: conn} do assert id == announce.id end + test "deactivated user", %{conn: conn} do + user = insert(:user, deactivated: true) + + assert %{"error" => "Can't find user"} == + conn + |> get("/api/v1/accounts/#{user.id}/statuses") + |> json_response_and_validate_schema(:not_found) + end + + test "returns 404 when user is invisible", %{conn: conn} do + user = insert(:user, %{invisible: true}) + + assert %{"error" => "Can't find user"} = + conn + |> get("/api/v1/accounts/#{user.id}") + |> json_response_and_validate_schema(404) + end + test "respects blocks", %{user: user_one, conn: conn} do user_two = insert(:user) user_three = insert(:user) @@ -350,9 +374,10 @@ test "unimplemented pinned statuses feature", %{conn: conn} do assert json_response_and_validate_schema(conn, 200) == [] end - test "gets an users media", %{conn: conn} do + test "gets an users media, excludes reblogs", %{conn: conn} do note = insert(:note_activity) user = User.get_cached_by_ap_id(note.data["actor"]) + other_user = insert(:user) file = %Plug.Upload{ content_type: "image/jpg", @@ -364,6 +389,13 @@ test "gets an users media", %{conn: conn} do {:ok, %{id: image_post_id}} = CommonAPI.post(user, %{status: "cofe", media_ids: [media_id]}) + {:ok, %{id: media_id}} = ActivityPub.upload(file, actor: other_user.ap_id) + + {:ok, %{id: other_image_post_id}} = + CommonAPI.post(other_user, %{status: "cofe2", media_ids: [media_id]}) + + {:ok, _announce} = CommonAPI.repeat(other_image_post_id, user) + conn = get(conn, "/api/v1/accounts/#{user.id}/statuses?only_media=true") assert [%{"id" => ^image_post_id}] = json_response_and_validate_schema(conn, 200) @@ -422,15 +454,15 @@ defp local_and_remote_activities(%{local: local, remote: remote}) do setup do: clear_config([:restrict_unauthenticated, :profiles, :remote], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - assert %{"error" => "Can't find user"} == + assert %{"error" => "This API requires an authenticated user"} == conn |> get("/api/v1/accounts/#{local.id}/statuses") - |> json_response_and_validate_schema(:not_found) + |> json_response_and_validate_schema(:unauthorized) - assert %{"error" => "Can't find user"} == + assert %{"error" => "This API requires an authenticated user"} == conn |> get("/api/v1/accounts/#{remote.id}/statuses") - |> json_response_and_validate_schema(:not_found) + |> json_response_and_validate_schema(:unauthorized) end test "if user is authenticated", %{local: local, remote: remote} do @@ -451,10 +483,10 @@ test "if user is authenticated", %{local: local, remote: remote} do setup do: clear_config([:restrict_unauthenticated, :profiles, :local], true) test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} do - assert %{"error" => "Can't find user"} == + assert %{"error" => "This API requires an authenticated user"} == conn |> get("/api/v1/accounts/#{local.id}/statuses") - |> json_response_and_validate_schema(:not_found) + |> json_response_and_validate_schema(:unauthorized) res_conn = get(conn, "/api/v1/accounts/#{remote.id}/statuses") assert length(json_response_and_validate_schema(res_conn, 200)) == 1 @@ -481,10 +513,10 @@ test "if user is unauthenticated", %{conn: conn, local: local, remote: remote} d res_conn = get(conn, "/api/v1/accounts/#{local.id}/statuses") assert length(json_response_and_validate_schema(res_conn, 200)) == 1 - assert %{"error" => "Can't find user"} == + assert %{"error" => "This API requires an authenticated user"} == conn |> get("/api/v1/accounts/#{remote.id}/statuses") - |> json_response_and_validate_schema(:not_found) + |> json_response_and_validate_schema(:unauthorized) end test "if user is authenticated", %{local: local, remote: remote} do @@ -548,6 +580,15 @@ test "getting followers, pagination", %{user: user, conn: conn} do |> get("/api/v1/accounts/#{user.id}/followers?max_id=#{follower3_id}") |> json_response_and_validate_schema(200) + assert [%{"id" => ^follower2_id}, %{"id" => ^follower1_id}] = + conn + |> get( + "/api/v1/accounts/#{user.id}/followers?id=#{user.id}&limit=20&max_id=#{ + follower3_id + }" + ) + |> json_response_and_validate_schema(200) + res_conn = get(conn, "/api/v1/accounts/#{user.id}/followers?limit=1&max_id=#{follower3_id}") assert [%{"id" => ^follower2_id}] = json_response_and_validate_schema(res_conn, 200) @@ -619,6 +660,16 @@ test "getting following, pagination", %{user: user, conn: conn} do assert id2 == following2.id assert id1 == following1.id + res_conn = + get( + conn, + "/api/v1/accounts/#{user.id}/following?id=#{user.id}&limit=20&max_id=#{following3.id}" + ) + + assert [%{"id" => id2}, %{"id" => id1}] = json_response_and_validate_schema(res_conn, 200) + assert id2 == following2.id + assert id1 == following1.id + res_conn = get(conn, "/api/v1/accounts/#{user.id}/following?limit=1&max_id=#{following3.id}") @@ -673,7 +724,10 @@ test "following without reblogs" do followed = insert(:user) other_user = insert(:user) - ret_conn = post(conn, "/api/v1/accounts/#{followed.id}/follow?reblogs=false") + ret_conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/accounts/#{followed.id}/follow", %{reblogs: false}) assert %{"showing_reblogs" => false} = json_response_and_validate_schema(ret_conn, 200) @@ -687,7 +741,8 @@ test "following without reblogs" do assert %{"showing_reblogs" => true} = conn - |> post("/api/v1/accounts/#{followed.id}/follow?reblogs=true") + |> put_req_header("content-type", "application/json") + |> post("/api/v1/accounts/#{followed.id}/follow", %{reblogs: true}) |> json_response_and_validate_schema(200) assert [%{"id" => ^reblog_id}] = @@ -696,6 +751,35 @@ test "following without reblogs" do |> json_response(200) end + test "following with reblogs" do + %{conn: conn} = oauth_access(["follow", "read:statuses"]) + followed = insert(:user) + other_user = insert(:user) + + ret_conn = post(conn, "/api/v1/accounts/#{followed.id}/follow") + + assert %{"showing_reblogs" => true} = json_response_and_validate_schema(ret_conn, 200) + + {:ok, activity} = CommonAPI.post(other_user, %{status: "hey"}) + {:ok, %{id: reblog_id}} = CommonAPI.repeat(activity.id, followed) + + assert [%{"id" => ^reblog_id}] = + conn + |> get("/api/v1/timelines/home") + |> json_response(200) + + assert %{"showing_reblogs" => false} = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/accounts/#{followed.id}/follow", %{reblogs: false}) + |> json_response_and_validate_schema(200) + + assert [] == + conn + |> get("/api/v1/timelines/home") + |> json_response(200) + end + test "following / unfollowing errors", %{user: user, conn: conn} do # self follow conn_res = post(conn, "/api/v1/accounts/#{user.id}/follow") @@ -745,7 +829,6 @@ test "with notifications", %{conn: conn} do assert %{"id" => _id, "muting" => true, "muting_notifications" => true} = conn - |> put_req_header("content-type", "application/json") |> post("/api/v1/accounts/#{other_user.id}/mute") |> json_response_and_validate_schema(200) @@ -817,9 +900,93 @@ test "blocking / unblocking a user" do [valid_params: valid_params] end - setup do: clear_config([:instance, :account_activation_required]) + test "registers and logs in without :account_activation_required / :account_approval_required", + %{conn: conn} do + clear_config([:instance, :account_activation_required], false) + clear_config([:instance, :account_approval_required], false) + + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/apps", %{ + client_name: "client_name", + redirect_uris: "urn:ietf:wg:oauth:2.0:oob", + scopes: "read, write, follow" + }) + + assert %{ + "client_id" => client_id, + "client_secret" => client_secret, + "id" => _, + "name" => "client_name", + "redirect_uri" => "urn:ietf:wg:oauth:2.0:oob", + "vapid_key" => _, + "website" => nil + } = json_response_and_validate_schema(conn, 200) + + conn = + post(conn, "/oauth/token", %{ + grant_type: "client_credentials", + client_id: client_id, + client_secret: client_secret + }) + + assert %{"access_token" => token, "refresh_token" => refresh, "scope" => scope} = + json_response(conn, 200) + + assert token + token_from_db = Repo.get_by(Token, token: token) + assert token_from_db + assert refresh + assert scope == "read write follow" + + clear_config([User, :email_blacklist], ["example.org"]) + + params = %{ + username: "lain", + email: "lain@example.org", + password: "PlzDontHackLain", + bio: "Test Bio", + agreement: true + } + + conn = + build_conn() + |> put_req_header("content-type", "multipart/form-data") + |> put_req_header("authorization", "Bearer " <> token) + |> post("/api/v1/accounts", params) + + assert %{"error" => "{\"email\":[\"Invalid email\"]}"} = + json_response_and_validate_schema(conn, 400) + + Pleroma.Config.put([User, :email_blacklist], []) + + conn = + build_conn() + |> put_req_header("content-type", "multipart/form-data") + |> put_req_header("authorization", "Bearer " <> token) + |> post("/api/v1/accounts", params) + + %{ + "access_token" => token, + "created_at" => _created_at, + "scope" => ^scope, + "token_type" => "Bearer" + } = json_response_and_validate_schema(conn, 200) + + token_from_db = Repo.get_by(Token, token: token) + assert token_from_db + user = Repo.preload(token_from_db, :user).user + + assert user + refute user.confirmation_pending + refute user.approval_pending + end + + test "registers but does not log in with :account_activation_required", %{conn: conn} do + clear_config([:instance, :account_activation_required], true) + clear_config([:instance, :account_approval_required], false) - test "Account registration via Application", %{conn: conn} do conn = conn |> put_req_header("content-type", "application/json") @@ -867,19 +1034,76 @@ test "Account registration via Application", %{conn: conn} do agreement: true }) - %{ - "access_token" => token, - "created_at" => _created_at, - "scope" => _scope, - "token_type" => "Bearer" - } = json_response_and_validate_schema(conn, 200) + response = json_response_and_validate_schema(conn, 200) + assert %{"identifier" => "missing_confirmed_email"} = response + refute response["access_token"] + refute response["token_type"] + user = Repo.get_by(User, email: "lain@example.org") + assert user.confirmation_pending + end + + test "registers but does not log in with :account_approval_required", %{conn: conn} do + clear_config([:instance, :account_approval_required], true) + clear_config([:instance, :account_activation_required], false) + + conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/apps", %{ + client_name: "client_name", + redirect_uris: "urn:ietf:wg:oauth:2.0:oob", + scopes: "read, write, follow" + }) + + assert %{ + "client_id" => client_id, + "client_secret" => client_secret, + "id" => _, + "name" => "client_name", + "redirect_uri" => "urn:ietf:wg:oauth:2.0:oob", + "vapid_key" => _, + "website" => nil + } = json_response_and_validate_schema(conn, 200) + + conn = + post(conn, "/oauth/token", %{ + grant_type: "client_credentials", + client_id: client_id, + client_secret: client_secret + }) + + assert %{"access_token" => token, "refresh_token" => refresh, "scope" => scope} = + json_response(conn, 200) + + assert token token_from_db = Repo.get_by(Token, token: token) assert token_from_db - token_from_db = Repo.preload(token_from_db, :user) - assert token_from_db.user + assert refresh + assert scope == "read write follow" - assert token_from_db.user.confirmation_pending + conn = + build_conn() + |> put_req_header("content-type", "multipart/form-data") + |> put_req_header("authorization", "Bearer " <> token) + |> post("/api/v1/accounts", %{ + username: "lain", + email: "lain@example.org", + password: "PlzDontHackLain", + bio: "Test Bio", + agreement: true, + reason: "I'm a cool dude, bro" + }) + + response = json_response_and_validate_schema(conn, 200) + assert %{"identifier" => "awaiting_approval"} = response + refute response["access_token"] + refute response["token_type"] + + user = Repo.get_by(User, email: "lain@example.org") + + assert user.approval_pending + assert user.registration_reason == "I'm a cool dude, bro" end test "returns error when user already registred", %{conn: conn, valid_params: valid_params} do @@ -933,11 +1157,9 @@ test "returns bad_request if missing required params", %{ end) end - setup do: clear_config([:instance, :account_activation_required]) - test "returns bad_request if missing email params when :account_activation_required is enabled", %{conn: conn, valid_params: valid_params} do - Pleroma.Config.put([:instance, :account_activation_required], true) + clear_config([:instance, :account_activation_required], true) app_token = insert(:oauth_token, user: nil) @@ -1032,7 +1254,7 @@ test "registration from trusted app" do assert %{ "access_token" => access_token, "created_at" => _, - "scope" => ["read", "write", "follow", "push"], + "scope" => "read write follow push", "token_type" => "Bearer" } = response @@ -1102,8 +1324,6 @@ test "respects rate limit setting", %{conn: conn} do assert token_from_db token_from_db = Repo.preload(token_from_db, :user) assert token_from_db.user - - assert token_from_db.user.confirmation_pending end conn = @@ -1150,7 +1370,7 @@ test "creates an account and returns 200 if captcha is valid", %{conn: conn} do assert %{ "access_token" => access_token, "created_at" => _, - "scope" => ["read"], + "scope" => "read", "token_type" => "Bearer" } = conn diff --git a/test/web/mastodon_api/controllers/auth_controller_test.exs b/test/web/mastodon_api/controllers/auth_controller_test.exs index a485f8e41..4fa95fce1 100644 --- a/test/web/mastodon_api/controllers/auth_controller_test.exs +++ b/test/web/mastodon_api/controllers/auth_controller_test.exs @@ -122,17 +122,27 @@ test "it doesn't fail when a user has no email", %{conn: conn} do {:ok, user: user} end - test "it returns 404 when user is not found", %{conn: conn, user: user} do + test "it returns 204 when user is not found", %{conn: conn, user: user} do conn = post(conn, "/auth/password?email=nonexisting_#{user.email}") - assert conn.status == 404 - assert conn.resp_body == "" + + assert conn + |> json_response(:no_content) end - test "it returns 400 when user is not local", %{conn: conn, user: user} do + test "it returns 204 when user is not local", %{conn: conn, user: user} do {:ok, user} = Repo.update(Ecto.Changeset.change(user, local: false)) conn = post(conn, "/auth/password?email=#{user.email}") - assert conn.status == 400 - assert conn.resp_body == "" + + assert conn + |> json_response(:no_content) + end + + test "it returns 204 when user is deactivated", %{conn: conn, user: user} do + {:ok, user} = Repo.update(Ecto.Changeset.change(user, deactivated: true, local: true)) + conn = post(conn, "/auth/password?email=#{user.email}") + + assert conn + |> json_response(:no_content) end end diff --git a/test/web/mastodon_api/controllers/domain_block_controller_test.exs b/test/web/mastodon_api/controllers/domain_block_controller_test.exs index 01a24afcf..664654500 100644 --- a/test/web/mastodon_api/controllers/domain_block_controller_test.exs +++ b/test/web/mastodon_api/controllers/domain_block_controller_test.exs @@ -32,6 +32,38 @@ test "blocking / unblocking a domain" do refute User.blocks?(user, other_user) end + test "blocking a domain via query params" do + %{user: user, conn: conn} = oauth_access(["write:blocks"]) + other_user = insert(:user, %{ap_id: "https://dogwhistle.zone/@pundit"}) + + ret_conn = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/domain_blocks?domain=dogwhistle.zone") + + assert %{} == json_response_and_validate_schema(ret_conn, 200) + user = User.get_cached_by_ap_id(user.ap_id) + assert User.blocks?(user, other_user) + end + + test "unblocking a domain via query params" do + %{user: user, conn: conn} = oauth_access(["write:blocks"]) + other_user = insert(:user, %{ap_id: "https://dogwhistle.zone/@pundit"}) + + User.block_domain(user, "dogwhistle.zone") + user = refresh_record(user) + assert User.blocks?(user, other_user) + + ret_conn = + conn + |> put_req_header("content-type", "application/json") + |> delete("/api/v1/domain_blocks?domain=dogwhistle.zone") + + assert %{} == json_response_and_validate_schema(ret_conn, 200) + user = User.get_cached_by_ap_id(user.ap_id) + refute User.blocks?(user, other_user) + end + test "getting a list of domain blocks" do %{user: user, conn: conn} = oauth_access(["read:blocks"]) diff --git a/test/web/mastodon_api/controllers/filter_controller_test.exs b/test/web/mastodon_api/controllers/filter_controller_test.exs index f29547d13..0d426ec34 100644 --- a/test/web/mastodon_api/controllers/filter_controller_test.exs +++ b/test/web/mastodon_api/controllers/filter_controller_test.exs @@ -64,11 +64,13 @@ test "fetching a list of filters" do test "get a filter" do %{user: user, conn: conn} = oauth_access(["read:filters"]) + # check whole_word false query = %Pleroma.Filter{ user_id: user.id, filter_id: 2, phrase: "knight", - context: ["home"] + context: ["home"], + whole_word: false } {:ok, filter} = Pleroma.Filter.create(query) @@ -76,6 +78,25 @@ test "get a filter" do conn = get(conn, "/api/v1/filters/#{filter.filter_id}") assert response = json_response_and_validate_schema(conn, 200) + assert response["whole_word"] == false + + # check whole_word true + %{user: user, conn: conn} = oauth_access(["read:filters"]) + + query = %Pleroma.Filter{ + user_id: user.id, + filter_id: 3, + phrase: "knight", + context: ["home"], + whole_word: true + } + + {:ok, filter} = Pleroma.Filter.create(query) + + conn = get(conn, "/api/v1/filters/#{filter.filter_id}") + + assert response = json_response_and_validate_schema(conn, 200) + assert response["whole_word"] == true end test "update a filter" do @@ -86,7 +107,8 @@ test "update a filter" do filter_id: 2, phrase: "knight", context: ["home"], - hide: true + hide: true, + whole_word: true } {:ok, _filter} = Pleroma.Filter.create(query) @@ -108,6 +130,7 @@ test "update a filter" do assert response["phrase"] == new.phrase assert response["context"] == new.context assert response["irreversible"] == true + assert response["whole_word"] == true end test "delete a filter" do diff --git a/test/web/mastodon_api/controllers/follow_request_controller_test.exs b/test/web/mastodon_api/controllers/follow_request_controller_test.exs index 44e12d15a..6749e0e83 100644 --- a/test/web/mastodon_api/controllers/follow_request_controller_test.exs +++ b/test/web/mastodon_api/controllers/follow_request_controller_test.exs @@ -6,7 +6,7 @@ defmodule Pleroma.Web.MastodonAPI.FollowRequestControllerTest do use Pleroma.Web.ConnCase alias Pleroma.User - alias Pleroma.Web.ActivityPub.ActivityPub + alias Pleroma.Web.CommonAPI import Pleroma.Factory @@ -20,7 +20,7 @@ defmodule Pleroma.Web.MastodonAPI.FollowRequestControllerTest do test "/api/v1/follow_requests works", %{user: user, conn: conn} do other_user = insert(:user) - {:ok, _activity} = ActivityPub.follow(other_user, user) + {:ok, _, _, _activity} = CommonAPI.follow(other_user, user) {:ok, other_user} = User.follow(other_user, user, :follow_pending) assert User.following?(other_user, user) == false @@ -34,7 +34,7 @@ test "/api/v1/follow_requests works", %{user: user, conn: conn} do test "/api/v1/follow_requests/:id/authorize works", %{user: user, conn: conn} do other_user = insert(:user) - {:ok, _activity} = ActivityPub.follow(other_user, user) + {:ok, _, _, _activity} = CommonAPI.follow(other_user, user) {:ok, other_user} = User.follow(other_user, user, :follow_pending) user = User.get_cached_by_id(user.id) @@ -56,7 +56,7 @@ test "/api/v1/follow_requests/:id/authorize works", %{user: user, conn: conn} do test "/api/v1/follow_requests/:id/reject works", %{user: user, conn: conn} do other_user = insert(:user) - {:ok, _activity} = ActivityPub.follow(other_user, user) + {:ok, _, _, _activity} = CommonAPI.follow(other_user, user) user = User.get_cached_by_id(user.id) diff --git a/test/web/mastodon_api/controllers/instance_controller_test.exs b/test/web/mastodon_api/controllers/instance_controller_test.exs index 8bdfdddd1..6a9ccd979 100644 --- a/test/web/mastodon_api/controllers/instance_controller_test.exs +++ b/test/web/mastodon_api/controllers/instance_controller_test.exs @@ -27,16 +27,21 @@ test "get instance information", %{conn: conn} do "thumbnail" => _, "languages" => _, "registrations" => _, + "approval_required" => _, "poll_limits" => _, "upload_limit" => _, "avatar_upload_limit" => _, "background_upload_limit" => _, "banner_upload_limit" => _, - "background_image" => _ + "background_image" => _, + "chat_limit" => _, + "description_limit" => _ } = result + assert result["pleroma"]["metadata"]["account_activation_required"] != nil assert result["pleroma"]["metadata"]["features"] assert result["pleroma"]["metadata"]["federation"] + assert result["pleroma"]["metadata"]["fields_limits"] assert result["pleroma"]["vapid_public_key"] assert email == from_config_email diff --git a/test/web/mastodon_api/controllers/list_controller_test.exs b/test/web/mastodon_api/controllers/list_controller_test.exs index 57a9ef4a4..091ec006c 100644 --- a/test/web/mastodon_api/controllers/list_controller_test.exs +++ b/test/web/mastodon_api/controllers/list_controller_test.exs @@ -67,7 +67,7 @@ test "adding users to a list" do assert following == [other_user.follower_address] end - test "removing users from a list" do + test "removing users from a list, body params" do %{user: user, conn: conn} = oauth_access(["write:lists"]) other_user = insert(:user) third_user = insert(:user) @@ -85,6 +85,24 @@ test "removing users from a list" do assert following == [third_user.follower_address] end + test "removing users from a list, query params" do + %{user: user, conn: conn} = oauth_access(["write:lists"]) + other_user = insert(:user) + third_user = insert(:user) + {:ok, list} = Pleroma.List.create("name", user) + {:ok, list} = Pleroma.List.follow(list, other_user) + {:ok, list} = Pleroma.List.follow(list, third_user) + + assert %{} == + conn + |> put_req_header("content-type", "application/json") + |> delete("/api/v1/lists/#{list.id}/accounts?account_ids[]=#{other_user.id}") + |> json_response_and_validate_schema(:ok) + + %Pleroma.List{following: following} = Pleroma.List.get(list.id, user) + assert following == [third_user.follower_address] + end + test "listing users in a list" do %{user: user, conn: conn} = oauth_access(["read:lists"]) other_user = insert(:user) diff --git a/test/web/mastodon_api/controllers/search_controller_test.exs b/test/web/mastodon_api/controllers/search_controller_test.exs index c605957b1..04dc6f445 100644 --- a/test/web/mastodon_api/controllers/search_controller_test.exs +++ b/test/web/mastodon_api/controllers/search_controller_test.exs @@ -79,6 +79,7 @@ test "search", %{conn: conn} do assert status["id"] == to_string(activity.id) end + @tag capture_log: true test "constructs hashtags from search query", %{conn: conn} do results = conn @@ -151,6 +152,22 @@ test "constructs hashtags from search query", %{conn: conn} do ] end + test "supports pagination of hashtags search results", %{conn: conn} do + results = + conn + |> get( + "/api/v2/search?#{ + URI.encode_query(%{q: "#some #text #with #hashtags", limit: 2, offset: 1}) + }" + ) + |> json_response_and_validate_schema(200) + + assert results["hashtags"] == [ + %{"name" => "text", "url" => "#{Web.base_url()}/tag/text"}, + %{"name" => "with", "url" => "#{Web.base_url()}/tag/with"} + ] + end + test "excludes a blocked users from search results", %{conn: conn} do user = insert(:user) user_smith = insert(:user, %{nickname: "Agent", name: "I love 2hu"}) @@ -265,18 +282,18 @@ test "search fetches remote statuses and prefers them over other results", %{con capture_log(fn -> {:ok, %{id: activity_id}} = CommonAPI.post(insert(:user), %{ - status: "check out https://shitposter.club/notice/2827873" + status: "check out http://mastodon.example.org/@admin/99541947525187367" }) results = conn - |> get("/api/v1/search?q=https://shitposter.club/notice/2827873") + |> get("/api/v1/search?q=http://mastodon.example.org/@admin/99541947525187367") |> json_response_and_validate_schema(200) - [status, %{"id" => ^activity_id}] = results["statuses"] - - assert status["uri"] == - "tag:shitposter.club,2017-05-05:noticeId=2827873:objectType=comment" + assert [ + %{"url" => "http://mastodon.example.org/@admin/99541947525187367"}, + %{"id" => ^activity_id} + ] = results["statuses"] end) end @@ -302,11 +319,13 @@ test "search doesn't show statuses that it shouldn't", %{conn: conn} do test "search fetches remote accounts", %{conn: conn} do user = insert(:user) + query = URI.encode_query(%{q: " mike@osada.macgirvin.com ", resolve: true}) + results = conn |> assign(:user, user) |> assign(:token, insert(:oauth_token, user: user, scopes: ["read"])) - |> get("/api/v1/search?q=mike@osada.macgirvin.com&resolve=true") + |> get("/api/v1/search?#{query}") |> json_response_and_validate_schema(200) [account] = results["accounts"] diff --git a/test/web/mastodon_api/controllers/status_controller_test.exs b/test/web/mastodon_api/controllers/status_controller_test.exs index 648e6f2ce..633a25e50 100644 --- a/test/web/mastodon_api/controllers/status_controller_test.exs +++ b/test/web/mastodon_api/controllers/status_controller_test.exs @@ -4,9 +4,9 @@ defmodule Pleroma.Web.MastodonAPI.StatusControllerTest do use Pleroma.Web.ConnCase + use Oban.Testing, repo: Pleroma.Repo alias Pleroma.Activity - alias Pleroma.ActivityExpiration alias Pleroma.Config alias Pleroma.Conversation.Participation alias Pleroma.Object @@ -22,13 +22,15 @@ defmodule Pleroma.Web.MastodonAPI.StatusControllerTest do setup do: clear_config([:instance, :federating]) setup do: clear_config([:instance, :allow_relay]) setup do: clear_config([:rich_media, :enabled]) + setup do: clear_config([:mrf, :policies]) + setup do: clear_config([:mrf_keyword, :reject]) describe "posting statuses" do setup do: oauth_access(["write:statuses"]) test "posting a status does not increment reblog_count when relaying", %{conn: conn} do - Pleroma.Config.put([:instance, :federating], true) - Pleroma.Config.get([:instance, :allow_relay], true) + Config.put([:instance, :federating], true) + Config.get([:instance, :allow_relay], true) response = conn @@ -101,7 +103,9 @@ test "posting a status", %{conn: conn} do # An activity that will expire: # 2 hours - expires_in = 120 * 60 + expires_in = 2 * 60 * 60 + + expires_at = DateTime.add(DateTime.utc_now(), expires_in) conn_four = conn @@ -111,29 +115,22 @@ test "posting a status", %{conn: conn} do "expires_in" => expires_in }) - assert fourth_response = - %{"id" => fourth_id} = json_response_and_validate_schema(conn_four, 200) + assert %{"id" => fourth_id} = json_response_and_validate_schema(conn_four, 200) - assert activity = Activity.get_by_id(fourth_id) - assert expiration = ActivityExpiration.get_by_activity_id(fourth_id) + assert Activity.get_by_id(fourth_id) - estimated_expires_at = - NaiveDateTime.utc_now() - |> NaiveDateTime.add(expires_in) - |> NaiveDateTime.truncate(:second) - - # This assert will fail if the test takes longer than a minute. I sure hope it never does: - assert abs(NaiveDateTime.diff(expiration.scheduled_at, estimated_expires_at, :second)) < 60 - - assert fourth_response["pleroma"]["expires_at"] == - NaiveDateTime.to_iso8601(expiration.scheduled_at) + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: fourth_id}, + scheduled_at: expires_at + ) end test "it fails to create a status if `expires_in` is less or equal than an hour", %{ conn: conn } do - # 1 hour - expires_in = 60 * 60 + # 1 minute + expires_in = 1 * 60 assert %{"error" => "Expiry date is too soon"} = conn @@ -144,8 +141,8 @@ test "it fails to create a status if `expires_in` is less or equal than an hour" }) |> json_response_and_validate_schema(422) - # 30 minutes - expires_in = 30 * 60 + # 5 minutes + expires_in = 5 * 60 assert %{"error" => "Expiry date is too soon"} = conn @@ -157,6 +154,17 @@ test "it fails to create a status if `expires_in` is less or equal than an hour" |> json_response_and_validate_schema(422) end + test "Get MRF reason when posting a status is rejected by one", %{conn: conn} do + Config.put([:mrf_keyword, :reject], ["GNO"]) + Config.put([:mrf, :policies], [Pleroma.Web.ActivityPub.MRF.KeywordPolicy]) + + assert %{"error" => "[KeywordPolicy] Matches with rejected keyword"} = + conn + |> put_req_header("content-type", "application/json") + |> post("api/v1/statuses", %{"status" => "GNO/Linux"}) + |> json_response_and_validate_schema(422) + end + test "posting an undefined status with an attachment", %{user: user, conn: conn} do file = %Plug.Upload{ content_type: "image/jpg", @@ -283,9 +291,45 @@ test "posting a fake status", %{conn: conn} do assert real_status == fake_status end + test "fake statuses' preview card is not cached", %{conn: conn} do + clear_config([:rich_media, :enabled], true) + + Tesla.Mock.mock(fn + %{ + method: :get, + url: "https://example.com/twitter-card" + } -> + %Tesla.Env{status: 200, body: File.read!("test/fixtures/rich_media/twitter_card.html")} + + env -> + apply(HttpRequestMock, :request, [env]) + end) + + conn1 = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ + "status" => "https://example.com/ogp", + "preview" => true + }) + + conn2 = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses", %{ + "status" => "https://example.com/twitter-card", + "preview" => true + }) + + assert %{"card" => %{"title" => "The Rock"}} = json_response_and_validate_schema(conn1, 200) + + assert %{"card" => %{"title" => "Small Island Developing States Photo Submission"}} = + json_response_and_validate_schema(conn2, 200) + end + test "posting a status with OGP link preview", %{conn: conn} do Tesla.Mock.mock(fn env -> apply(HttpRequestMock, :request, [env]) end) - Config.put([:rich_media, :enabled], true) + clear_config([:rich_media, :enabled], true) conn = conn @@ -760,13 +804,18 @@ test "if user is authenticated", %{local: local, remote: remote} do test "when you created it" do %{user: author, conn: conn} = oauth_access(["write:statuses"]) activity = insert(:note_activity, user: author) + object = Object.normalize(activity) - conn = + content = object.data["content"] + source = object.data["source"] + + result = conn |> assign(:user, author) |> delete("/api/v1/statuses/#{activity.id}") + |> json_response_and_validate_schema(200) - assert %{} = json_response_and_validate_schema(conn, 200) + assert match?(%{"content" => ^content, "text" => ^source}, result) refute Activity.get_by_id(activity.id) end @@ -789,7 +838,7 @@ test "when you didn't create it" do conn = delete(conn, "/api/v1/statuses/#{activity.id}") - assert %{"error" => _} = json_response_and_validate_schema(conn, 403) + assert %{"error" => "Record not found"} == json_response_and_validate_schema(conn, 404) assert Activity.get_by_id(activity.id) == activity end @@ -1092,6 +1141,52 @@ test "max pinned statuses", %{conn: conn, user: user, activity: activity_one} do |> post("/api/v1/statuses/#{activity_two.id}/pin") |> json_response_and_validate_schema(400) end + + test "on pin removes deletion job, on unpin reschedule deletion" do + %{conn: conn} = oauth_access(["write:accounts", "write:statuses"]) + expires_in = 2 * 60 * 60 + + expires_at = DateTime.add(DateTime.utc_now(), expires_in) + + assert %{"id" => id} = + conn + |> put_req_header("content-type", "application/json") + |> post("api/v1/statuses", %{ + "status" => "oolong", + "expires_in" => expires_in + }) + |> json_response_and_validate_schema(200) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: id}, + scheduled_at: expires_at + ) + + assert %{"id" => ^id, "pinned" => true} = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{id}/pin") + |> json_response_and_validate_schema(200) + + refute_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: id}, + scheduled_at: expires_at + ) + + assert %{"id" => ^id, "pinned" => false} = + conn + |> put_req_header("content-type", "application/json") + |> post("/api/v1/statuses/#{id}/unpin") + |> json_response_and_validate_schema(200) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: id}, + scheduled_at: expires_at + ) + end end describe "cards" do @@ -1414,6 +1509,20 @@ test "requires authentication for private posts", %{user: user} do [%{"id" => id}] = response assert id == other_user.id end + + test "returns empty array when :show_reactions is disabled", %{conn: conn, activity: activity} do + clear_config([:instance, :show_reactions], false) + + other_user = insert(:user) + {:ok, _} = CommonAPI.favorite(other_user, activity.id) + + response = + conn + |> get("/api/v1/statuses/#{activity.id}/favourited_by") + |> json_response_and_validate_schema(:ok) + + assert Enum.empty?(response) + end end describe "GET /api/v1/statuses/:id/reblogged_by" do @@ -1561,7 +1670,7 @@ test "favorites paginate correctly" do # Using the header for pagination works correctly [next, _] = get_resp_header(result, "link") |> hd() |> String.split(", ") - [_, max_id] = Regex.run(~r/max_id=(.*)>;/, next) + [_, max_id] = Regex.run(~r/max_id=([^&]+)/, next) assert max_id == third_favorite.id @@ -1613,19 +1722,17 @@ test "returns the favorites of a user" do test "expires_at is nil for another user" do %{conn: conn, user: user} = oauth_access(["read:statuses"]) + expires_at = DateTime.add(DateTime.utc_now(), 1_000_000) {:ok, activity} = CommonAPI.post(user, %{status: "foobar", expires_in: 1_000_000}) - expires_at = - activity.id - |> ActivityExpiration.get_by_activity_id() - |> Map.get(:scheduled_at) - |> NaiveDateTime.to_iso8601() - - assert %{"pleroma" => %{"expires_at" => ^expires_at}} = + assert %{"pleroma" => %{"expires_at" => a_expires_at}} = conn |> get("/api/v1/statuses/#{activity.id}") |> json_response_and_validate_schema(:ok) + {:ok, a_expires_at, 0} = DateTime.from_iso8601(a_expires_at) + assert DateTime.diff(expires_at, a_expires_at) == 0 + %{conn: conn} = oauth_access(["read:statuses"]) assert %{"pleroma" => %{"expires_at" => nil}} = diff --git a/test/web/mastodon_api/controllers/timeline_controller_test.exs b/test/web/mastodon_api/controllers/timeline_controller_test.exs index f069390c1..517cabcff 100644 --- a/test/web/mastodon_api/controllers/timeline_controller_test.exs +++ b/test/web/mastodon_api/controllers/timeline_controller_test.exs @@ -333,6 +333,46 @@ test "doesn't include DMs from blocked users" do describe "list" do setup do: oauth_access(["read:lists"]) + test "does not contain retoots", %{user: user, conn: conn} do + other_user = insert(:user) + {:ok, activity_one} = CommonAPI.post(user, %{status: "Marisa is cute."}) + {:ok, activity_two} = CommonAPI.post(other_user, %{status: "Marisa is stupid."}) + {:ok, _} = CommonAPI.repeat(activity_one.id, other_user) + + {:ok, list} = Pleroma.List.create("name", user) + {:ok, list} = Pleroma.List.follow(list, other_user) + + conn = get(conn, "/api/v1/timelines/list/#{list.id}") + + assert [%{"id" => id}] = json_response_and_validate_schema(conn, :ok) + + assert id == to_string(activity_two.id) + end + + test "works with pagination", %{user: user, conn: conn} do + other_user = insert(:user) + {:ok, list} = Pleroma.List.create("name", user) + {:ok, list} = Pleroma.List.follow(list, other_user) + + Enum.each(1..30, fn i -> + CommonAPI.post(other_user, %{status: "post number #{i}"}) + end) + + res = + get(conn, "/api/v1/timelines/list/#{list.id}?limit=1") + |> json_response_and_validate_schema(:ok) + + assert length(res) == 1 + + [first] = res + + res = + get(conn, "/api/v1/timelines/list/#{list.id}?max_id=#{first["id"]}&limit=30") + |> json_response_and_validate_schema(:ok) + + assert length(res) == 29 + end + test "list timeline", %{user: user, conn: conn} do other_user = insert(:user) {:ok, _activity_one} = CommonAPI.post(user, %{status: "Marisa is cute."}) @@ -418,4 +458,95 @@ test "multi-hashtag timeline", %{conn: conn} do assert [status_none] == json_response_and_validate_schema(all_test, :ok) end end + + describe "hashtag timeline handling of :restrict_unauthenticated setting" do + setup do + user = insert(:user) + {:ok, activity1} = CommonAPI.post(user, %{status: "test #tag1"}) + {:ok, _activity2} = CommonAPI.post(user, %{status: "test #tag1"}) + + activity1 + |> Ecto.Changeset.change(%{local: false}) + |> Pleroma.Repo.update() + + base_uri = "/api/v1/timelines/tag/tag1" + error_response = %{"error" => "authorization required for timeline view"} + + %{base_uri: base_uri, error_response: error_response} + end + + defp ensure_authenticated_access(base_uri) do + %{conn: auth_conn} = oauth_access(["read:statuses"]) + + res_conn = get(auth_conn, "#{base_uri}?local=true") + assert length(json_response(res_conn, 200)) == 1 + + res_conn = get(auth_conn, "#{base_uri}?local=false") + assert length(json_response(res_conn, 200)) == 2 + end + + test "with default settings on private instances, returns 403 for unauthenticated users", %{ + conn: conn, + base_uri: base_uri, + error_response: error_response + } do + clear_config([:instance, :public], false) + clear_config([:restrict_unauthenticated, :timelines]) + + for local <- [true, false] do + res_conn = get(conn, "#{base_uri}?local=#{local}") + + assert json_response(res_conn, :unauthorized) == error_response + end + + ensure_authenticated_access(base_uri) + end + + test "with `%{local: true, federated: true}`, returns 403 for unauthenticated users", %{ + conn: conn, + base_uri: base_uri, + error_response: error_response + } do + clear_config([:restrict_unauthenticated, :timelines, :local], true) + clear_config([:restrict_unauthenticated, :timelines, :federated], true) + + for local <- [true, false] do + res_conn = get(conn, "#{base_uri}?local=#{local}") + + assert json_response(res_conn, :unauthorized) == error_response + end + + ensure_authenticated_access(base_uri) + end + + test "with `%{local: false, federated: true}`, forbids unauthenticated access to federated timeline", + %{conn: conn, base_uri: base_uri, error_response: error_response} do + clear_config([:restrict_unauthenticated, :timelines, :local], false) + clear_config([:restrict_unauthenticated, :timelines, :federated], true) + + res_conn = get(conn, "#{base_uri}?local=true") + assert length(json_response(res_conn, 200)) == 1 + + res_conn = get(conn, "#{base_uri}?local=false") + assert json_response(res_conn, :unauthorized) == error_response + + ensure_authenticated_access(base_uri) + end + + test "with `%{local: true, federated: false}`, forbids unauthenticated access to public timeline" <> + "(but not to local public activities which are delivered as part of federated timeline)", + %{conn: conn, base_uri: base_uri, error_response: error_response} do + clear_config([:restrict_unauthenticated, :timelines, :local], true) + clear_config([:restrict_unauthenticated, :timelines, :federated], false) + + res_conn = get(conn, "#{base_uri}?local=true") + assert json_response(res_conn, :unauthorized) == error_response + + # Note: local activities get delivered as part of federated timeline + res_conn = get(conn, "#{base_uri}?local=false") + assert length(json_response(res_conn, 200)) == 2 + + ensure_authenticated_access(base_uri) + end + end end diff --git a/test/web/mastodon_api/mastodon_api_test.exs b/test/web/mastodon_api/mastodon_api_test.exs index a7f9c5205..0c5a38bf6 100644 --- a/test/web/mastodon_api/mastodon_api_test.exs +++ b/test/web/mastodon_api/mastodon_api_test.exs @@ -17,8 +17,7 @@ defmodule Pleroma.Web.MastodonAPI.MastodonAPITest do test "returns error when followed user is deactivated" do follower = insert(:user) user = insert(:user, local: true, deactivated: true) - {:error, error} = MastodonAPI.follow(follower, user) - assert error == "Could not follow user: #{user.nickname} is deactivated." + assert {:error, _error} = MastodonAPI.follow(follower, user) end test "following for user" do diff --git a/test/web/mastodon_api/views/account_view_test.exs b/test/web/mastodon_api/views/account_view_test.exs index 044f088a4..9f22f9dcf 100644 --- a/test/web/mastodon_api/views/account_view_test.exs +++ b/test/web/mastodon_api/views/account_view_test.exs @@ -33,7 +33,8 @@ test "Represent a user account" do bio: "valid html. a
b
c
d
f '&<>\"", inserted_at: ~N[2017-08-15 15:47:06.597036], - emoji: %{"karjalanpiirakka" => "/file.png"} + emoji: %{"karjalanpiirakka" => "/file.png"}, + raw_bio: "valid html. a\nb\nc\nd\nf '&<>\"" }) expected = %{ @@ -74,6 +75,7 @@ test "Represent a user account" do pleroma: %{ ap_id: user.ap_id, background_image: "https://example.com/images/asuka_hospital.png", + favicon: nil, confirmation_pending: false, tags: [], is_admin: false, @@ -84,22 +86,42 @@ test "Represent a user account" do hide_followers_count: false, hide_follows_count: false, relationship: %{}, - skip_thread_containment: false + skip_thread_containment: false, + accepts_chat_messages: nil } } - assert expected == AccountView.render("show.json", %{user: user}) + assert expected == AccountView.render("show.json", %{user: user, skip_visibility_check: true}) + end + + describe "favicon" do + setup do + [user: insert(:user)] + end + + test "is parsed when :instance_favicons is enabled", %{user: user} do + clear_config([:instances_favicons, :enabled], true) + + assert %{ + pleroma: %{ + favicon: + "https://shitposter.club/plugins/Qvitter/img/gnusocial-favicons/favicon-16x16.png" + } + } = AccountView.render("show.json", %{user: user, skip_visibility_check: true}) + end + + test "is nil when :instances_favicons is disabled", %{user: user} do + assert %{pleroma: %{favicon: nil}} = + AccountView.render("show.json", %{user: user, skip_visibility_check: true}) + end end test "Represent the user account for the account owner" do user = insert(:user) notification_settings = %{ - followers: true, - follows: true, - non_followers: true, - non_follows: true, - privacy_option: false + block_from_strangers: false, + hide_notification_contents: false } privacy = user.default_scope @@ -151,6 +173,7 @@ test "Represent a Service(bot) account" do pleroma: %{ ap_id: user.ap_id, background_image: nil, + favicon: nil, confirmation_pending: false, tags: [], is_admin: false, @@ -161,11 +184,12 @@ test "Represent a Service(bot) account" do hide_followers_count: false, hide_follows_count: false, relationship: %{}, - skip_thread_containment: false + skip_thread_containment: false, + accepts_chat_messages: nil } } - assert expected == AccountView.render("show.json", %{user: user}) + assert expected == AccountView.render("show.json", %{user: user, skip_visibility_check: true}) end test "Represent a Funkwhale channel" do @@ -174,7 +198,9 @@ test "Represent a Funkwhale channel" do "https://channels.tests.funkwhale.audio/federation/actors/compositions" ) - assert represented = AccountView.render("show.json", %{user: user}) + assert represented = + AccountView.render("show.json", %{user: user, skip_visibility_check: true}) + assert represented.acct == "compositions@channels.tests.funkwhale.audio" assert represented.url == "https://channels.tests.funkwhale.audio/channels/compositions" end @@ -199,6 +225,23 @@ test "Represent a smaller mention" do assert expected == AccountView.render("mention.json", %{user: user}) end + test "demands :for or :skip_visibility_check option for account rendering" do + clear_config([:restrict_unauthenticated, :profiles, :local], false) + + user = insert(:user) + user_id = user.id + + assert %{id: ^user_id} = AccountView.render("show.json", %{user: user, for: nil}) + assert %{id: ^user_id} = AccountView.render("show.json", %{user: user, for: user}) + + assert %{id: ^user_id} = + AccountView.render("show.json", %{user: user, skip_visibility_check: true}) + + assert_raise RuntimeError, ~r/:skip_visibility_check or :for option is required/, fn -> + AccountView.render("show.json", %{user: user}) + end + end + describe "relationship" do defp test_relationship_rendering(user, other_user, expected_result) do opts = %{user: user, target: other_user, relationships: nil} @@ -312,7 +355,7 @@ test "returns the settings store if the requesting user is the represented user assert result.pleroma.settings_store == %{:fe => "test"} - result = AccountView.render("show.json", %{user: user, with_pleroma_settings: true}) + result = AccountView.render("show.json", %{user: user, for: nil, with_pleroma_settings: true}) assert result.pleroma[:settings_store] == nil result = AccountView.render("show.json", %{user: user, for: user}) @@ -321,13 +364,13 @@ test "returns the settings store if the requesting user is the represented user test "doesn't sanitize display names" do user = insert(:user, name: " username ") - result = AccountView.render("show.json", %{user: user}) + result = AccountView.render("show.json", %{user: user, skip_visibility_check: true}) assert result.display_name == " username " end test "never display nil user follow counts" do user = insert(:user, following_count: 0, follower_count: 0) - result = AccountView.render("show.json", %{user: user}) + result = AccountView.render("show.json", %{user: user, skip_visibility_check: true}) assert result.following_count == 0 assert result.followers_count == 0 @@ -351,7 +394,7 @@ test "shows when follows/followers stats are hidden and sets follow/follower cou followers_count: 0, following_count: 0, pleroma: %{hide_follows_count: true, hide_followers_count: true} - } = AccountView.render("show.json", %{user: user}) + } = AccountView.render("show.json", %{user: user, skip_visibility_check: true}) end test "shows when follows/followers are hidden" do @@ -364,13 +407,16 @@ test "shows when follows/followers are hidden" do followers_count: 1, following_count: 1, pleroma: %{hide_follows: true, hide_followers: true} - } = AccountView.render("show.json", %{user: user}) + } = AccountView.render("show.json", %{user: user, skip_visibility_check: true}) end test "shows actual follower/following count to the account owner" do user = insert(:user, hide_followers: true, hide_follows: true) other_user = insert(:user) {:ok, user, other_user, _activity} = CommonAPI.follow(user, other_user) + + assert User.following?(user, other_user) + assert Pleroma.FollowingRelationship.follower_count(other_user) == 1 {:ok, _other_user, user, _activity} = CommonAPI.follow(other_user, user) assert %{ @@ -504,7 +550,7 @@ test "uses mediaproxy urls when it's enabled" do emoji: %{"joker_smile" => "https://evil.website/society.png"} ) - AccountView.render("show.json", %{user: user}) + AccountView.render("show.json", %{user: user, skip_visibility_check: true}) |> Enum.all?(fn {key, url} when key in [:avatar, :avatar_static, :header, :header_static] -> String.starts_with?(url, Pleroma.Web.base_url()) diff --git a/test/web/mastodon_api/views/conversation_view_test.exs b/test/web/mastodon_api/views/conversation_view_test.exs index 6f84366f8..2e8203c9b 100644 --- a/test/web/mastodon_api/views/conversation_view_test.exs +++ b/test/web/mastodon_api/views/conversation_view_test.exs @@ -15,8 +15,17 @@ test "represents a Mastodon Conversation entity" do user = insert(:user) other_user = insert(:user) + {:ok, parent} = CommonAPI.post(user, %{status: "parent"}) + {:ok, activity} = - CommonAPI.post(user, %{status: "hey @#{other_user.nickname}", visibility: "direct"}) + CommonAPI.post(user, %{ + status: "hey @#{other_user.nickname}", + visibility: "direct", + in_reply_to_id: parent.id + }) + + {:ok, _reply_activity} = + CommonAPI.post(user, %{status: "hu", visibility: "public", in_reply_to_id: parent.id}) [participation] = Participation.for_user_with_last_activity_id(user) diff --git a/test/web/mastodon_api/views/notification_view_test.exs b/test/web/mastodon_api/views/notification_view_test.exs index 9c399b2df..2f6a808f1 100644 --- a/test/web/mastodon_api/views/notification_view_test.exs +++ b/test/web/mastodon_api/views/notification_view_test.exs @@ -49,7 +49,7 @@ test "ChatMessage notification" do expected = %{ id: to_string(notification.id), - pleroma: %{is_seen: false}, + pleroma: %{is_seen: false, is_muted: false}, type: "pleroma:chat_mention", account: AccountView.render("show.json", %{user: user, for: recipient}), chat_message: MessageReferenceView.render("show.json", %{chat_message_reference: cm_ref}), @@ -68,7 +68,7 @@ test "Mention notification" do expected = %{ id: to_string(notification.id), - pleroma: %{is_seen: false}, + pleroma: %{is_seen: false, is_muted: false}, type: "mention", account: AccountView.render("show.json", %{ @@ -92,7 +92,7 @@ test "Favourite notification" do expected = %{ id: to_string(notification.id), - pleroma: %{is_seen: false}, + pleroma: %{is_seen: false, is_muted: false}, type: "favourite", account: AccountView.render("show.json", %{user: another_user, for: user}), status: StatusView.render("show.json", %{activity: create_activity, for: user}), @@ -112,7 +112,7 @@ test "Reblog notification" do expected = %{ id: to_string(notification.id), - pleroma: %{is_seen: false}, + pleroma: %{is_seen: false, is_muted: false}, type: "reblog", account: AccountView.render("show.json", %{user: another_user, for: user}), status: StatusView.render("show.json", %{activity: reblog_activity, for: user}), @@ -130,7 +130,7 @@ test "Follow notification" do expected = %{ id: to_string(notification.id), - pleroma: %{is_seen: false}, + pleroma: %{is_seen: false, is_muted: false}, type: "follow", account: AccountView.render("show.json", %{user: follower, for: followed}), created_at: Utils.to_masto_date(notification.inserted_at) @@ -171,7 +171,7 @@ test "Move notification" do expected = %{ id: to_string(notification.id), - pleroma: %{is_seen: false}, + pleroma: %{is_seen: false, is_muted: false}, type: "move", account: AccountView.render("show.json", %{user: old_user, for: follower}), target: AccountView.render("show.json", %{user: new_user, for: follower}), @@ -196,7 +196,7 @@ test "EmojiReact notification" do expected = %{ id: to_string(notification.id), - pleroma: %{is_seen: false}, + pleroma: %{is_seen: false, is_muted: false}, type: "pleroma:emoji_reaction", emoji: "☕", account: AccountView.render("show.json", %{user: other_user, for: user}), @@ -206,4 +206,26 @@ test "EmojiReact notification" do test_notifications_rendering([notification], user, [expected]) end + + test "muted notification" do + user = insert(:user) + another_user = insert(:user) + + {:ok, _} = Pleroma.UserRelationship.create_mute(user, another_user) + {:ok, create_activity} = CommonAPI.post(user, %{status: "hey"}) + {:ok, favorite_activity} = CommonAPI.favorite(another_user, create_activity.id) + {:ok, [notification]} = Notification.create_notifications(favorite_activity) + create_activity = Activity.get_by_id(create_activity.id) + + expected = %{ + id: to_string(notification.id), + pleroma: %{is_seen: true, is_muted: true}, + type: "favourite", + account: AccountView.render("show.json", %{user: another_user, for: user}), + status: StatusView.render("show.json", %{activity: create_activity, for: user}), + created_at: Utils.to_masto_date(notification.inserted_at) + } + + test_notifications_rendering([notification], user, [expected]) + end end diff --git a/test/web/mastodon_api/views/poll_view_test.exs b/test/web/mastodon_api/views/poll_view_test.exs index 76672f36c..b7e2f17ef 100644 --- a/test/web/mastodon_api/views/poll_view_test.exs +++ b/test/web/mastodon_api/views/poll_view_test.exs @@ -135,4 +135,33 @@ test "does not crash on polls with no end date" do assert result[:expires_at] == nil assert result[:expired] == false end + + test "doesn't strips HTML tags" do + user = insert(:user) + + {:ok, activity} = + CommonAPI.post(user, %{ + status: "What's with the smug face?", + poll: %{ + options: [ + "", + "", + "", + "" + ], + expires_in: 20 + } + }) + + object = Object.normalize(activity) + + assert %{ + options: [ + %{title: "", votes_count: 0}, + %{title: "", votes_count: 0}, + %{title: "", votes_count: 0}, + %{title: "", votes_count: 0} + ] + } = PollView.render("show.json", %{object: object}) + end end diff --git a/test/web/mastodon_api/views/status_view_test.exs b/test/web/mastodon_api/views/status_view_test.exs index 5cbadf0fc..70d829979 100644 --- a/test/web/mastodon_api/views/status_view_test.exs +++ b/test/web/mastodon_api/views/status_view_test.exs @@ -56,6 +56,23 @@ test "has an emoji reaction list" do ] end + test "works correctly with badly formatted emojis" do + user = insert(:user) + {:ok, activity} = CommonAPI.post(user, %{status: "yo"}) + + activity + |> Object.normalize(false) + |> Object.update_data(%{"reactions" => %{"☕" => [user.ap_id], "x" => 1}}) + + activity = Activity.get_by_id(activity.id) + + status = StatusView.render("show.json", activity: activity, for: user) + + assert status[:pleroma][:emoji_reactions] == [ + %{name: "☕", count: 1, me: true} + ] + end + test "loads and returns the direct conversation id when given the `with_direct_conversation_id` option" do user = insert(:user) @@ -177,12 +194,13 @@ test "a note activity" do id: to_string(note.id), uri: object_data["id"], url: Pleroma.Web.Router.Helpers.o_status_url(Pleroma.Web.Endpoint, :notice, note), - account: AccountView.render("show.json", %{user: user}), + account: AccountView.render("show.json", %{user: user, skip_visibility_check: true}), in_reply_to_id: nil, in_reply_to_account_id: nil, card: nil, reblog: nil, content: HTML.filter_tags(object_data["content"]), + text: nil, created_at: created_at, reblogs_count: 0, replies_count: 0, @@ -226,7 +244,8 @@ test "a note activity" do expires_at: nil, direct_conversation_id: nil, thread_muted: false, - emoji_reactions: [] + emoji_reactions: [], + parent_visible: false } } @@ -498,6 +517,12 @@ test "a Mobilizon event" do represented = StatusView.render("show.json", %{for: user, activity: activity}) assert represented[:id] == to_string(activity.id) + + assert represented[:url] == + "https://mobilizon.org/events/252d5816-00a3-4a89-a66f-15bf65c33e39" + + assert represented[:content] == + "

Mobilizon Launching Party

Mobilizon is now federated! 🎉

You can view this event from other instances if they are subscribed to mobilizon.org, and soon directly from Mastodon and Pleroma. It is possible that you may see some comments from other instances, including Mastodon ones, just below.

With a Mobilizon account on an instance, you may participate at events from other instances and add comments on events.

Of course, it's still a work in progress: if reports made from an instance on events and comments can be federated, you can't block people right now, and moderators actions are rather limited, but this will definitely get fixed over time until first stable version next year.

Anyway, if you want to come up with some feedback, head over to our forum or - if you feel you have technical skills and are familiar with it - on our Gitlab repository.

Also, to people that want to set Mobilizon themselves even though we really don't advise to do that for now, we have a little documentation but it's quite the early days and you'll probably need some help. No worries, you can chat with us on our Forum or though our Matrix channel.

Check our website for more informations and follow us on Twitter or Mastodon.

" end describe "build_tags/1" do @@ -620,4 +645,20 @@ test "visibility/list" do assert status.visibility == "list" end + + test "has a field for parent visibility" do + user = insert(:user) + poster = insert(:user) + + {:ok, invisible} = CommonAPI.post(poster, %{status: "hey", visibility: "private"}) + + {:ok, visible} = + CommonAPI.post(poster, %{status: "hey", visibility: "private", in_reply_to_id: invisible.id}) + + status = StatusView.render("show.json", activity: visible, for: user) + refute status.pleroma.parent_visible + + status = StatusView.render("show.json", activity: visible, for: poster) + assert status.pleroma.parent_visible + end end diff --git a/test/web/media_proxy/invalidation_test.exs b/test/web/media_proxy/invalidation_test.exs new file mode 100644 index 000000000..926ae74ca --- /dev/null +++ b/test/web/media_proxy/invalidation_test.exs @@ -0,0 +1,64 @@ +defmodule Pleroma.Web.MediaProxy.InvalidationTest do + use ExUnit.Case + use Pleroma.Tests.Helpers + + alias Pleroma.Config + alias Pleroma.Web.MediaProxy.Invalidation + + import ExUnit.CaptureLog + import Mock + import Tesla.Mock + + setup do: clear_config([:media_proxy]) + + setup do + on_exit(fn -> Cachex.clear(:banned_urls_cache) end) + end + + describe "Invalidation.Http" do + test "perform request to clear cache" do + Config.put([:media_proxy, :enabled], false) + Config.put([:media_proxy, :invalidation, :enabled], true) + Config.put([:media_proxy, :invalidation, :provider], Invalidation.Http) + + Config.put([Invalidation.Http], method: :purge, headers: [{"x-refresh", 1}]) + image_url = "http://example.com/media/example.jpg" + Pleroma.Web.MediaProxy.put_in_banned_urls(image_url) + + mock(fn + %{ + method: :purge, + url: "http://example.com/media/example.jpg", + headers: [{"x-refresh", 1}] + } -> + %Tesla.Env{status: 200} + end) + + assert capture_log(fn -> + assert Pleroma.Web.MediaProxy.in_banned_urls(image_url) + assert Invalidation.purge([image_url]) == {:ok, [image_url]} + assert Pleroma.Web.MediaProxy.in_banned_urls(image_url) + end) =~ "Running cache purge: [\"#{image_url}\"]" + end + end + + describe "Invalidation.Script" do + test "run script to clear cache" do + Config.put([:media_proxy, :enabled], false) + Config.put([:media_proxy, :invalidation, :enabled], true) + Config.put([:media_proxy, :invalidation, :provider], Invalidation.Script) + Config.put([Invalidation.Script], script_path: "purge-nginx") + + image_url = "http://example.com/media/example.jpg" + Pleroma.Web.MediaProxy.put_in_banned_urls(image_url) + + with_mocks [{System, [], [cmd: fn _, _ -> {"ok", 0} end]}] do + assert capture_log(fn -> + assert Pleroma.Web.MediaProxy.in_banned_urls(image_url) + assert Invalidation.purge([image_url]) == {:ok, [image_url]} + assert Pleroma.Web.MediaProxy.in_banned_urls(image_url) + end) =~ "Running cache purge: [\"#{image_url}\"]" + end + end + end +end diff --git a/test/web/media_proxy/invalidations/http_test.exs b/test/web/media_proxy/invalidations/http_test.exs index 8a3b4141c..a1bef5237 100644 --- a/test/web/media_proxy/invalidations/http_test.exs +++ b/test/web/media_proxy/invalidations/http_test.exs @@ -5,6 +5,10 @@ defmodule Pleroma.Web.MediaProxy.Invalidation.HttpTest do import ExUnit.CaptureLog import Tesla.Mock + setup do + on_exit(fn -> Cachex.clear(:banned_urls_cache) end) + end + test "logs hasn't error message when request is valid" do mock(fn %{method: :purge, url: "http://example.com/media/example.jpg"} -> @@ -14,8 +18,8 @@ test "logs hasn't error message when request is valid" do refute capture_log(fn -> assert Invalidation.Http.purge( ["http://example.com/media/example.jpg"], - %{} - ) == {:ok, "success"} + [] + ) == {:ok, ["http://example.com/media/example.jpg"]} end) =~ "Error while cache purge" end @@ -28,8 +32,8 @@ test "it write error message in logs when request invalid" do assert capture_log(fn -> assert Invalidation.Http.purge( ["http://example.com/media/example1.jpg"], - %{} - ) == {:ok, "success"} + [] + ) == {:ok, ["http://example.com/media/example1.jpg"]} end) =~ "Error while cache purge: url - http://example.com/media/example1.jpg" end end diff --git a/test/web/media_proxy/invalidations/script_test.exs b/test/web/media_proxy/invalidations/script_test.exs index 1358963ab..51833ab18 100644 --- a/test/web/media_proxy/invalidations/script_test.exs +++ b/test/web/media_proxy/invalidations/script_test.exs @@ -4,17 +4,23 @@ defmodule Pleroma.Web.MediaProxy.Invalidation.ScriptTest do import ExUnit.CaptureLog + setup do + on_exit(fn -> Cachex.clear(:banned_urls_cache) end) + end + test "it logger error when script not found" do assert capture_log(fn -> assert Invalidation.Script.purge( ["http://example.com/media/example.jpg"], - %{script_path: "./example"} - ) == {:error, "\"%ErlangError{original: :enoent}\""} - end) =~ "Error while cache purge: \"%ErlangError{original: :enoent}\"" + script_path: "./example" + ) == {:error, "%ErlangError{original: :enoent}"} + end) =~ "Error while cache purge: %ErlangError{original: :enoent}" - assert Invalidation.Script.purge( - ["http://example.com/media/example.jpg"], - %{} - ) == {:error, "not found script path"} + capture_log(fn -> + assert Invalidation.Script.purge( + ["http://example.com/media/example.jpg"], + [] + ) == {:error, "\"not found script path\""} + end) end end diff --git a/test/web/media_proxy/media_proxy_controller_test.exs b/test/web/media_proxy/media_proxy_controller_test.exs index da79d38a5..d4db44c63 100644 --- a/test/web/media_proxy/media_proxy_controller_test.exs +++ b/test/web/media_proxy/media_proxy_controller_test.exs @@ -4,66 +4,118 @@ defmodule Pleroma.Web.MediaProxy.MediaProxyControllerTest do use Pleroma.Web.ConnCase - import Mock - alias Pleroma.Config - setup do: clear_config(:media_proxy) - setup do: clear_config([Pleroma.Web.Endpoint, :secret_key_base]) + import Mock + + alias Pleroma.Web.MediaProxy + alias Pleroma.Web.MediaProxy.MediaProxyController + alias Plug.Conn + + setup do + on_exit(fn -> Cachex.clear(:banned_urls_cache) end) + end test "it returns 404 when MediaProxy disabled", %{conn: conn} do - Config.put([:media_proxy, :enabled], false) + clear_config([:media_proxy, :enabled], false) - assert %Plug.Conn{ + assert %Conn{ status: 404, resp_body: "Not Found" } = get(conn, "/proxy/hhgfh/eeeee") - assert %Plug.Conn{ + assert %Conn{ status: 404, resp_body: "Not Found" } = get(conn, "/proxy/hhgfh/eeee/fff") end - test "it returns 403 when signature invalidated", %{conn: conn} do - Config.put([:media_proxy, :enabled], true) - Config.put([Pleroma.Web.Endpoint, :secret_key_base], "00000000000") - path = URI.parse(Pleroma.Web.MediaProxy.encode_url("https://google.fn")).path - Config.put([Pleroma.Web.Endpoint, :secret_key_base], "000") + describe "" do + setup do + clear_config([:media_proxy, :enabled], true) + clear_config([Pleroma.Web.Endpoint, :secret_key_base], "00000000000") + [url: MediaProxy.encode_url("https://google.fn/test.png")] + end - assert %Plug.Conn{ - status: 403, - resp_body: "Forbidden" - } = get(conn, path) + test "it returns 403 for invalid signature", %{conn: conn, url: url} do + Pleroma.Config.put([Pleroma.Web.Endpoint, :secret_key_base], "000") + %{path: path} = URI.parse(url) - assert %Plug.Conn{ - status: 403, - resp_body: "Forbidden" - } = get(conn, "/proxy/hhgfh/eeee") + assert %Conn{ + status: 403, + resp_body: "Forbidden" + } = get(conn, path) - assert %Plug.Conn{ - status: 403, - resp_body: "Forbidden" - } = get(conn, "/proxy/hhgfh/eeee/fff") + assert %Conn{ + status: 403, + resp_body: "Forbidden" + } = get(conn, "/proxy/hhgfh/eeee") + + assert %Conn{ + status: 403, + resp_body: "Forbidden" + } = get(conn, "/proxy/hhgfh/eeee/fff") + end + + test "redirects on valid url when filename is invalidated", %{conn: conn, url: url} do + invalid_url = String.replace(url, "test.png", "test-file.png") + response = get(conn, invalid_url) + assert response.status == 302 + assert redirected_to(response) == url + end + + test "it performs ReverseProxy.call with valid signature", %{conn: conn, url: url} do + with_mock Pleroma.ReverseProxy, + call: fn _conn, _url, _opts -> %Conn{status: :success} end do + assert %Conn{status: :success} = get(conn, url) + end + end + + test "it returns 404 when url is in banned_urls cache", %{conn: conn, url: url} do + MediaProxy.put_in_banned_urls("https://google.fn/test.png") + + with_mock Pleroma.ReverseProxy, + call: fn _conn, _url, _opts -> %Conn{status: :success} end do + assert %Conn{status: 404, resp_body: "Not Found"} = get(conn, url) + end + end end - test "redirects on valid url when filename invalidated", %{conn: conn} do - Config.put([:media_proxy, :enabled], true) - Config.put([Pleroma.Web.Endpoint, :secret_key_base], "00000000000") - url = Pleroma.Web.MediaProxy.encode_url("https://google.fn/test.png") - invalid_url = String.replace(url, "test.png", "test-file.png") - response = get(conn, invalid_url) - assert response.status == 302 - assert redirected_to(response) == url - end + describe "filename_matches/3" do + test "preserves the encoded or decoded path" do + assert MediaProxyController.filename_matches( + %{"filename" => "/Hello world.jpg"}, + "/Hello world.jpg", + "http://pleroma.social/Hello world.jpg" + ) == :ok - test "it performs ReverseProxy.call when signature valid", %{conn: conn} do - Config.put([:media_proxy, :enabled], true) - Config.put([Pleroma.Web.Endpoint, :secret_key_base], "00000000000") - url = Pleroma.Web.MediaProxy.encode_url("https://google.fn/test.png") + assert MediaProxyController.filename_matches( + %{"filename" => "/Hello%20world.jpg"}, + "/Hello%20world.jpg", + "http://pleroma.social/Hello%20world.jpg" + ) == :ok - with_mock Pleroma.ReverseProxy, - call: fn _conn, _url, _opts -> %Plug.Conn{status: :success} end do - assert %Plug.Conn{status: :success} = get(conn, url) + assert MediaProxyController.filename_matches( + %{"filename" => "/my%2Flong%2Furl%2F2019%2F07%2FS.jpg"}, + "/my%2Flong%2Furl%2F2019%2F07%2FS.jpg", + "http://pleroma.social/my%2Flong%2Furl%2F2019%2F07%2FS.jpg" + ) == :ok + + assert MediaProxyController.filename_matches( + %{"filename" => "/my%2Flong%2Furl%2F2019%2F07%2FS.jp"}, + "/my%2Flong%2Furl%2F2019%2F07%2FS.jp", + "http://pleroma.social/my%2Flong%2Furl%2F2019%2F07%2FS.jpg" + ) == {:wrong_filename, "my%2Flong%2Furl%2F2019%2F07%2FS.jpg"} + end + + test "encoded url are tried to match for proxy as `conn.request_path` encodes the url" do + # conn.request_path will return encoded url + request_path = "/ANALYSE-DAI-_-LE-STABLECOIN-100-D%C3%89CENTRALIS%C3%89-BQ.jpg" + + assert MediaProxyController.filename_matches( + true, + request_path, + "https://mydomain.com/uploads/2019/07/ANALYSE-DAI-_-LE-STABLECOIN-100-DÉCENTRALISÉ-BQ.jpg" + ) == :ok end end end diff --git a/test/web/media_proxy/media_proxy_test.exs b/test/web/media_proxy/media_proxy_test.exs index 69d2a71a6..72885cfdd 100644 --- a/test/web/media_proxy/media_proxy_test.exs +++ b/test/web/media_proxy/media_proxy_test.exs @@ -5,38 +5,33 @@ defmodule Pleroma.Web.MediaProxyTest do use ExUnit.Case use Pleroma.Tests.Helpers - import Pleroma.Web.MediaProxy - alias Pleroma.Web.MediaProxy.MediaProxyController - setup do: clear_config([:media_proxy, :enabled]) - setup do: clear_config(Pleroma.Upload) + alias Pleroma.Web.Endpoint + alias Pleroma.Web.MediaProxy describe "when enabled" do - setup do - Pleroma.Config.put([:media_proxy, :enabled], true) - :ok - end + setup do: clear_config([:media_proxy, :enabled], true) test "ignores invalid url" do - assert url(nil) == nil - assert url("") == nil + assert MediaProxy.url(nil) == nil + assert MediaProxy.url("") == nil end test "ignores relative url" do - assert url("/local") == "/local" - assert url("/") == "/" + assert MediaProxy.url("/local") == "/local" + assert MediaProxy.url("/") == "/" end test "ignores local url" do - local_url = Pleroma.Web.Endpoint.url() <> "/hello" - local_root = Pleroma.Web.Endpoint.url() - assert url(local_url) == local_url - assert url(local_root) == local_root + local_url = Endpoint.url() <> "/hello" + local_root = Endpoint.url() + assert MediaProxy.url(local_url) == local_url + assert MediaProxy.url(local_root) == local_root end test "encodes and decodes URL" do url = "https://pleroma.soykaf.com/static/logo.png" - encoded = url(url) + encoded = MediaProxy.url(url) assert String.starts_with?( encoded, @@ -50,86 +45,44 @@ test "encodes and decodes URL" do test "encodes and decodes URL without a path" do url = "https://pleroma.soykaf.com" - encoded = url(url) + encoded = MediaProxy.url(url) assert decode_result(encoded) == url end test "encodes and decodes URL without an extension" do url = "https://pleroma.soykaf.com/path/" - encoded = url(url) + encoded = MediaProxy.url(url) assert String.ends_with?(encoded, "/path") assert decode_result(encoded) == url end test "encodes and decodes URL and ignores query params for the path" do url = "https://pleroma.soykaf.com/static/logo.png?93939393939&bunny=true" - encoded = url(url) + encoded = MediaProxy.url(url) assert String.ends_with?(encoded, "/logo.png") assert decode_result(encoded) == url end test "validates signature" do - secret_key_base = Pleroma.Config.get([Pleroma.Web.Endpoint, :secret_key_base]) + encoded = MediaProxy.url("https://pleroma.social") - on_exit(fn -> - Pleroma.Config.put([Pleroma.Web.Endpoint, :secret_key_base], secret_key_base) - end) - - encoded = url("https://pleroma.social") - - Pleroma.Config.put( - [Pleroma.Web.Endpoint, :secret_key_base], + clear_config( + [Endpoint, :secret_key_base], "00000000000000000000000000000000000000000000000" ) [_, "proxy", sig, base64 | _] = URI.parse(encoded).path |> String.split("/") - assert decode_url(sig, base64) == {:error, :invalid_signature} - end - - test "filename_matches preserves the encoded or decoded path" do - assert MediaProxyController.filename_matches( - %{"filename" => "/Hello world.jpg"}, - "/Hello world.jpg", - "http://pleroma.social/Hello world.jpg" - ) == :ok - - assert MediaProxyController.filename_matches( - %{"filename" => "/Hello%20world.jpg"}, - "/Hello%20world.jpg", - "http://pleroma.social/Hello%20world.jpg" - ) == :ok - - assert MediaProxyController.filename_matches( - %{"filename" => "/my%2Flong%2Furl%2F2019%2F07%2FS.jpg"}, - "/my%2Flong%2Furl%2F2019%2F07%2FS.jpg", - "http://pleroma.social/my%2Flong%2Furl%2F2019%2F07%2FS.jpg" - ) == :ok - - assert MediaProxyController.filename_matches( - %{"filename" => "/my%2Flong%2Furl%2F2019%2F07%2FS.jp"}, - "/my%2Flong%2Furl%2F2019%2F07%2FS.jp", - "http://pleroma.social/my%2Flong%2Furl%2F2019%2F07%2FS.jpg" - ) == {:wrong_filename, "my%2Flong%2Furl%2F2019%2F07%2FS.jpg"} - end - - test "encoded url are tried to match for proxy as `conn.request_path` encodes the url" do - # conn.request_path will return encoded url - request_path = "/ANALYSE-DAI-_-LE-STABLECOIN-100-D%C3%89CENTRALIS%C3%89-BQ.jpg" - - assert MediaProxyController.filename_matches( - true, - request_path, - "https://mydomain.com/uploads/2019/07/ANALYSE-DAI-_-LE-STABLECOIN-100-DÉCENTRALISÉ-BQ.jpg" - ) == :ok + assert MediaProxy.decode_url(sig, base64) == {:error, :invalid_signature} end test "uses the configured base_url" do - clear_config([:media_proxy, :base_url], "https://cache.pleroma.social") + base_url = "https://cache.pleroma.social" + clear_config([:media_proxy, :base_url], base_url) url = "https://pleroma.soykaf.com/static/logo.png" - encoded = url(url) + encoded = MediaProxy.url(url) - assert String.starts_with?(encoded, Pleroma.Config.get([:media_proxy, :base_url])) + assert String.starts_with?(encoded, base_url) end # Some sites expect ASCII encoded characters in the URL to be preserved even if @@ -140,7 +93,7 @@ test "preserve ASCII encoding" do url = "https://pleroma.com/%20/%21/%22/%23/%24/%25/%26/%27/%28/%29/%2A/%2B/%2C/%2D/%2E/%2F/%30/%31/%32/%33/%34/%35/%36/%37/%38/%39/%3A/%3B/%3C/%3D/%3E/%3F/%40/%41/%42/%43/%44/%45/%46/%47/%48/%49/%4A/%4B/%4C/%4D/%4E/%4F/%50/%51/%52/%53/%54/%55/%56/%57/%58/%59/%5A/%5B/%5C/%5D/%5E/%5F/%60/%61/%62/%63/%64/%65/%66/%67/%68/%69/%6A/%6B/%6C/%6D/%6E/%6F/%70/%71/%72/%73/%74/%75/%76/%77/%78/%79/%7A/%7B/%7C/%7D/%7E/%7F/%80/%81/%82/%83/%84/%85/%86/%87/%88/%89/%8A/%8B/%8C/%8D/%8E/%8F/%90/%91/%92/%93/%94/%95/%96/%97/%98/%99/%9A/%9B/%9C/%9D/%9E/%9F/%C2%A0/%A1/%A2/%A3/%A4/%A5/%A6/%A7/%A8/%A9/%AA/%AB/%AC/%C2%AD/%AE/%AF/%B0/%B1/%B2/%B3/%B4/%B5/%B6/%B7/%B8/%B9/%BA/%BB/%BC/%BD/%BE/%BF/%C0/%C1/%C2/%C3/%C4/%C5/%C6/%C7/%C8/%C9/%CA/%CB/%CC/%CD/%CE/%CF/%D0/%D1/%D2/%D3/%D4/%D5/%D6/%D7/%D8/%D9/%DA/%DB/%DC/%DD/%DE/%DF/%E0/%E1/%E2/%E3/%E4/%E5/%E6/%E7/%E8/%E9/%EA/%EB/%EC/%ED/%EE/%EF/%F0/%F1/%F2/%F3/%F4/%F5/%F6/%F7/%F8/%F9/%FA/%FB/%FC/%FD/%FE/%FF" - encoded = url(url) + encoded = MediaProxy.url(url) assert decode_result(encoded) == url end @@ -151,56 +104,49 @@ test "preserve non-unicode characters per RFC3986" do url = "https://pleroma.com/ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz1234567890-._~:/?#[]@!$&'()*+,;=|^`{}" - encoded = url(url) + encoded = MediaProxy.url(url) assert decode_result(encoded) == url end test "preserve unicode characters" do url = "https://ko.wikipedia.org/wiki/위키백과:대문" - encoded = url(url) + encoded = MediaProxy.url(url) assert decode_result(encoded) == url end end describe "when disabled" do - setup do - enabled = Pleroma.Config.get([:media_proxy, :enabled]) - - if enabled do - Pleroma.Config.put([:media_proxy, :enabled], false) - - on_exit(fn -> - Pleroma.Config.put([:media_proxy, :enabled], enabled) - :ok - end) - end - - :ok - end + setup do: clear_config([:media_proxy, :enabled], false) test "does not encode remote urls" do - assert url("https://google.fr") == "https://google.fr" + assert MediaProxy.url("https://google.fr") == "https://google.fr" end end defp decode_result(encoded) do [_, "proxy", sig, base64 | _] = URI.parse(encoded).path |> String.split("/") - {:ok, decoded} = decode_url(sig, base64) + {:ok, decoded} = MediaProxy.decode_url(sig, base64) decoded end describe "whitelist" do - setup do - Pleroma.Config.put([:media_proxy, :enabled], true) - :ok - end + setup do: clear_config([:media_proxy, :enabled], true) test "mediaproxy whitelist" do - Pleroma.Config.put([:media_proxy, :whitelist], ["google.com", "feld.me"]) + clear_config([:media_proxy, :whitelist], ["https://google.com", "https://feld.me"]) url = "https://feld.me/foo.png" - unencoded = url(url) + unencoded = MediaProxy.url(url) + assert unencoded == url + end + + # TODO: delete after removing support bare domains for media proxy whitelist + test "mediaproxy whitelist bare domains whitelist (deprecated)" do + clear_config([:media_proxy, :whitelist], ["google.com", "feld.me"]) + url = "https://feld.me/foo.png" + + unencoded = MediaProxy.url(url) assert unencoded == url end @@ -211,17 +157,17 @@ test "does not change whitelisted urls" do media_url = "https://mycdn.akamai.com" url = "#{media_url}/static/logo.png" - encoded = url(url) + encoded = MediaProxy.url(url) assert String.starts_with?(encoded, media_url) end test "ensure Pleroma.Upload base_url is always whitelisted" do media_url = "https://media.pleroma.social" - Pleroma.Config.put([Pleroma.Upload, :base_url], media_url) + clear_config([Pleroma.Upload, :base_url], media_url) url = "#{media_url}/static/logo.png" - encoded = url(url) + encoded = MediaProxy.url(url) assert String.starts_with?(encoded, media_url) end diff --git a/test/web/metadata/metadata_test.exs b/test/web/metadata/metadata_test.exs index 3f8b29e58..9d3121b7b 100644 --- a/test/web/metadata/metadata_test.exs +++ b/test/web/metadata/metadata_test.exs @@ -22,4 +22,13 @@ test "for local user" do "" end end + + describe "no metadata for private instances" do + test "for local user" do + clear_config([:instance, :public], false) + user = insert(:user, bio: "This is my secret fedi account bio") + + assert "" = Pleroma.Web.Metadata.build_tags(%{user: user}) + end + end end diff --git a/test/web/metadata/rel_me_test.exs b/test/web/metadata/rel_me_test.exs index 4107a8459..2293d6e13 100644 --- a/test/web/metadata/rel_me_test.exs +++ b/test/web/metadata/rel_me_test.exs @@ -9,13 +9,12 @@ defmodule Pleroma.Web.Metadata.Providers.RelMeTest do test "it renders all links with rel='me' from user bio" do bio = - ~s(https://some-link.com https://another-link.com - https://some-link.com https://another-link.com ) user = insert(:user, %{bio: bio}) assert RelMe.build_tags(%{user: user}) == [ - {:link, [rel: "me", href: "http://some3.com>"], []}, + {:link, [rel: "me", href: "http://some3.com"], []}, {:link, [rel: "me", href: "https://another-link.com"], []} ] end diff --git a/test/web/node_info_test.exs b/test/web/node_info_test.exs index 00925caad..06b33607f 100644 --- a/test/web/node_info_test.exs +++ b/test/web/node_info_test.exs @@ -67,10 +67,10 @@ test "returns software.repository field in nodeinfo 2.1", %{conn: conn} do end test "returns fieldsLimits field", %{conn: conn} do - Config.put([:instance, :max_account_fields], 10) - Config.put([:instance, :max_remote_account_fields], 15) - Config.put([:instance, :account_field_name_length], 255) - Config.put([:instance, :account_field_value_length], 2048) + clear_config([:instance, :max_account_fields], 10) + clear_config([:instance, :max_remote_account_fields], 15) + clear_config([:instance, :account_field_name_length], 255) + clear_config([:instance, :account_field_value_length], 2048) response = conn @@ -84,8 +84,7 @@ test "returns fieldsLimits field", %{conn: conn} do end test "it returns the safe_dm_mentions feature if enabled", %{conn: conn} do - option = Config.get([:instance, :safe_dm_mentions]) - Config.put([:instance, :safe_dm_mentions], true) + clear_config([:instance, :safe_dm_mentions], true) response = conn @@ -102,8 +101,6 @@ test "it returns the safe_dm_mentions feature if enabled", %{conn: conn} do |> json_response(:ok) refute "safe_dm_mentions" in response["metadata"]["features"] - - Config.put([:instance, :safe_dm_mentions], option) end describe "`metadata/federation/enabled`" do @@ -156,14 +153,11 @@ test "it shows default features flags", %{conn: conn} do end test "it shows MRF transparency data if enabled", %{conn: conn} do - config = Config.get([:instance, :rewrite_policy]) - Config.put([:instance, :rewrite_policy], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) - - option = Config.get([:instance, :mrf_transparency]) - Config.put([:instance, :mrf_transparency], true) + clear_config([:mrf, :policies], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) + clear_config([:mrf, :transparency], true) simple_config = %{"reject" => ["example.com"]} - Config.put(:mrf_simple, simple_config) + clear_config(:mrf_simple, simple_config) response = conn @@ -171,26 +165,17 @@ test "it shows MRF transparency data if enabled", %{conn: conn} do |> json_response(:ok) assert response["metadata"]["federation"]["mrf_simple"] == simple_config - - Config.put([:instance, :rewrite_policy], config) - Config.put([:instance, :mrf_transparency], option) - Config.put(:mrf_simple, %{}) end test "it performs exclusions from MRF transparency data if configured", %{conn: conn} do - config = Config.get([:instance, :rewrite_policy]) - Config.put([:instance, :rewrite_policy], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) - - option = Config.get([:instance, :mrf_transparency]) - Config.put([:instance, :mrf_transparency], true) - - exclusions = Config.get([:instance, :mrf_transparency_exclusions]) - Config.put([:instance, :mrf_transparency_exclusions], ["other.site"]) + clear_config([:mrf, :policies], [Pleroma.Web.ActivityPub.MRF.SimplePolicy]) + clear_config([:mrf, :transparency], true) + clear_config([:mrf, :transparency_exclusions], ["other.site"]) simple_config = %{"reject" => ["example.com", "other.site"]} - expected_config = %{"reject" => ["example.com"]} + clear_config(:mrf_simple, simple_config) - Config.put(:mrf_simple, simple_config) + expected_config = %{"reject" => ["example.com"]} response = conn @@ -199,10 +184,5 @@ test "it performs exclusions from MRF transparency data if configured", %{conn: assert response["metadata"]["federation"]["mrf_simple"] == expected_config assert response["metadata"]["federation"]["exclusions"] == true - - Config.put([:instance, :rewrite_policy], config) - Config.put([:instance, :mrf_transparency], option) - Config.put([:instance, :mrf_transparency_exclusions], exclusions) - Config.put(:mrf_simple, %{}) end end diff --git a/test/web/oauth/app_test.exs b/test/web/oauth/app_test.exs index 899af648e..993a490e0 100644 --- a/test/web/oauth/app_test.exs +++ b/test/web/oauth/app_test.exs @@ -29,5 +29,16 @@ test "gets exist app and updates scopes" do assert exist_app.id == app.id assert exist_app.scopes == ["read", "write", "follow", "push"] end + + test "has unique client_id" do + insert(:oauth_app, client_name: "", redirect_uris: "", client_id: "boop") + + error = + catch_error(insert(:oauth_app, client_name: "", redirect_uris: "", client_id: "boop")) + + assert %Ecto.ConstraintError{} = error + assert error.constraint == "apps_client_id_index" + assert error.type == :unique + end end end diff --git a/test/web/oauth/ldap_authorization_test.exs b/test/web/oauth/ldap_authorization_test.exs index 011642c08..63b1c0eb8 100644 --- a/test/web/oauth/ldap_authorization_test.exs +++ b/test/web/oauth/ldap_authorization_test.exs @@ -7,7 +7,6 @@ defmodule Pleroma.Web.OAuth.LDAPAuthorizationTest do alias Pleroma.Repo alias Pleroma.Web.OAuth.Token import Pleroma.Factory - import ExUnit.CaptureLog import Mock @skip if !Code.ensure_loaded?(:eldap), do: :skip @@ -72,9 +71,7 @@ test "creates a new user after successful LDAP authorization" do equalityMatch: fn _type, _value -> :ok end, wholeSubtree: fn -> :ok end, search: fn _connection, _options -> - {:ok, - {:eldap_search_result, [{:eldap_entry, '', [{'mail', [to_charlist(user.email)]}]}], - []}} + {:ok, {:eldap_search_result, [{:eldap_entry, '', []}], []}} end, close: fn _connection -> send(self(), :close_connection) @@ -101,50 +98,6 @@ test "creates a new user after successful LDAP authorization" do end end - @tag @skip - test "falls back to the default authorization when LDAP is unavailable" do - password = "testpassword" - user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt(password)) - app = insert(:oauth_app, scopes: ["read", "write"]) - - host = Pleroma.Config.get([:ldap, :host]) |> to_charlist - port = Pleroma.Config.get([:ldap, :port]) - - with_mocks [ - {:eldap, [], - [ - open: fn [^host], [{:port, ^port}, {:ssl, false} | _] -> {:error, 'connect failed'} end, - simple_bind: fn _connection, _dn, ^password -> :ok end, - close: fn _connection -> - send(self(), :close_connection) - :ok - end - ]} - ] do - log = - capture_log(fn -> - conn = - build_conn() - |> post("/oauth/token", %{ - "grant_type" => "password", - "username" => user.nickname, - "password" => password, - "client_id" => app.client_id, - "client_secret" => app.client_secret - }) - - assert %{"access_token" => token} = json_response(conn, 200) - - token = Repo.get_by(Token, token: token) - - assert token.user_id == user.id - end) - - assert log =~ "Could not open LDAP connection: 'connect failed'" - refute_received :close_connection - end - end - @tag @skip test "disallow authorization for wrong LDAP credentials" do password = "testpassword" diff --git a/test/web/oauth/oauth_controller_test.exs b/test/web/oauth/oauth_controller_test.exs index d389e4ce0..1200126b8 100644 --- a/test/web/oauth/oauth_controller_test.exs +++ b/test/web/oauth/oauth_controller_test.exs @@ -19,7 +19,10 @@ defmodule Pleroma.Web.OAuth.OAuthControllerTest do key: "_test", signing_salt: "cooldude" ] - setup do: clear_config([:instance, :account_activation_required]) + setup do + clear_config([:instance, :account_activation_required]) + clear_config([:instance, :account_approval_required]) + end describe "in OAuth consumer mode, " do setup do @@ -995,6 +998,30 @@ test "rejects token exchange for user with confirmation_pending set to true" do } end + test "rejects token exchange for valid credentials belonging to an unapproved user" do + password = "testpassword" + + user = insert(:user, password_hash: Pbkdf2.hash_pwd_salt(password), approval_pending: true) + + refute Pleroma.User.account_status(user) == :active + + app = insert(:oauth_app) + + conn = + build_conn() + |> post("/oauth/token", %{ + "grant_type" => "password", + "username" => user.nickname, + "password" => password, + "client_id" => app.client_id, + "client_secret" => app.client_secret + }) + + assert resp = json_response(conn, 403) + assert %{"error" => _} = resp + refute Map.has_key?(resp, "access_token") + end + test "rejects an invalid authorization code" do app = insert(:oauth_app) diff --git a/test/web/oauth/token_test.exs b/test/web/oauth/token_test.exs index 40d71eb59..c88b9cc98 100644 --- a/test/web/oauth/token_test.exs +++ b/test/web/oauth/token_test.exs @@ -69,17 +69,4 @@ test "deletes all tokens of a user" do assert tokens == 2 end - - test "deletes expired tokens" do - insert(:oauth_token, valid_until: Timex.shift(Timex.now(), days: -3)) - insert(:oauth_token, valid_until: Timex.shift(Timex.now(), days: -3)) - t3 = insert(:oauth_token) - t4 = insert(:oauth_token, valid_until: Timex.shift(Timex.now(), minutes: 10)) - {tokens, _} = Token.delete_expired_tokens() - assert tokens == 2 - available_tokens = Pleroma.Repo.all(Token) - - token_ids = available_tokens |> Enum.map(& &1.id) - assert token_ids == [t3.id, t4.id] - end end diff --git a/test/web/pleroma_api/controllers/account_controller_test.exs b/test/web/pleroma_api/controllers/account_controller_test.exs index 103997c31..07909d48b 100644 --- a/test/web/pleroma_api/controllers/account_controller_test.exs +++ b/test/web/pleroma_api/controllers/account_controller_test.exs @@ -13,8 +13,6 @@ defmodule Pleroma.Web.PleromaAPI.AccountControllerTest do import Pleroma.Factory import Swoosh.TestAssertions - @image "data:image/gif;base64,R0lGODlhEAAQAMQAAORHHOVSKudfOulrSOp3WOyDZu6QdvCchPGolfO0o/XBs/fNwfjZ0frl3/zy7////wAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAACH5BAkAABAALAAAAAAQABAAAAVVICSOZGlCQAosJ6mu7fiyZeKqNKToQGDsM8hBADgUXoGAiqhSvp5QAnQKGIgUhwFUYLCVDFCrKUE1lBavAViFIDlTImbKC5Gm2hB0SlBCBMQiB0UjIQA7" - describe "POST /api/v1/pleroma/accounts/confirmation_resend" do setup do {:ok, user} = @@ -68,103 +66,6 @@ test "resend account confirmation email (with nickname)", %{conn: conn, user: us end end - describe "PATCH /api/v1/pleroma/accounts/update_avatar" do - setup do: oauth_access(["write:accounts"]) - - test "user avatar can be set", %{user: user, conn: conn} do - avatar_image = File.read!("test/fixtures/avatar_data_uri") - - conn = - conn - |> put_req_header("content-type", "multipart/form-data") - |> patch("/api/v1/pleroma/accounts/update_avatar", %{img: avatar_image}) - - user = refresh_record(user) - - assert %{ - "name" => _, - "type" => _, - "url" => [ - %{ - "href" => _, - "mediaType" => _, - "type" => _ - } - ] - } = user.avatar - - assert %{"url" => _} = json_response_and_validate_schema(conn, 200) - end - - test "user avatar can be reset", %{user: user, conn: conn} do - conn = - conn - |> put_req_header("content-type", "multipart/form-data") - |> patch("/api/v1/pleroma/accounts/update_avatar", %{img: ""}) - - user = User.get_cached_by_id(user.id) - - assert user.avatar == nil - - assert %{"url" => nil} = json_response_and_validate_schema(conn, 200) - end - end - - describe "PATCH /api/v1/pleroma/accounts/update_banner" do - setup do: oauth_access(["write:accounts"]) - - test "can set profile banner", %{user: user, conn: conn} do - conn = - conn - |> put_req_header("content-type", "multipart/form-data") - |> patch("/api/v1/pleroma/accounts/update_banner", %{"banner" => @image}) - - user = refresh_record(user) - assert user.banner["type"] == "Image" - - assert %{"url" => _} = json_response_and_validate_schema(conn, 200) - end - - test "can reset profile banner", %{user: user, conn: conn} do - conn = - conn - |> put_req_header("content-type", "multipart/form-data") - |> patch("/api/v1/pleroma/accounts/update_banner", %{"banner" => ""}) - - user = refresh_record(user) - assert user.banner == %{} - - assert %{"url" => nil} = json_response_and_validate_schema(conn, 200) - end - end - - describe "PATCH /api/v1/pleroma/accounts/update_background" do - setup do: oauth_access(["write:accounts"]) - - test "background image can be set", %{user: user, conn: conn} do - conn = - conn - |> put_req_header("content-type", "multipart/form-data") - |> patch("/api/v1/pleroma/accounts/update_background", %{"img" => @image}) - - user = refresh_record(user) - assert user.background["type"] == "Image" - # assert %{"url" => _} = json_response(conn, 200) - assert %{"url" => _} = json_response_and_validate_schema(conn, 200) - end - - test "background image can be reset", %{user: user, conn: conn} do - conn = - conn - |> put_req_header("content-type", "multipart/form-data") - |> patch("/api/v1/pleroma/accounts/update_background", %{"img" => ""}) - - user = refresh_record(user) - assert user.background == %{} - assert %{"url" => nil} = json_response_and_validate_schema(conn, 200) - end - end - describe "getting favorites timeline of specified user" do setup do [current_user, user] = insert_pair(:user, hide_favorites: false) diff --git a/test/web/pleroma_api/controllers/chat_controller_test.exs b/test/web/pleroma_api/controllers/chat_controller_test.exs index 82e16741d..7be5fe09c 100644 --- a/test/web/pleroma_api/controllers/chat_controller_test.exs +++ b/test/web/pleroma_api/controllers/chat_controller_test.exs @@ -267,6 +267,21 @@ test "it returns a chat", %{conn: conn, user: user} do describe "GET /api/v1/pleroma/chats" do setup do: oauth_access(["read:chats"]) + test "it does not return chats with deleted users", %{conn: conn, user: user} do + recipient = insert(:user) + {:ok, _} = Chat.get_or_create(user.id, recipient.ap_id) + + Pleroma.Repo.delete(recipient) + User.invalidate_cache(recipient) + + result = + conn + |> get("/api/v1/pleroma/chats") + |> json_response_and_validate_schema(200) + + assert length(result) == 0 + end + test "it does not return chats with users you blocked", %{conn: conn, user: user} do recipient = insert(:user) @@ -332,5 +347,27 @@ test "it return a list of chats the current user is participating in, in descend chat_1.id |> to_string() ] end + + test "it is not affected by :restrict_unauthenticated setting (issue #1973)", %{ + conn: conn, + user: user + } do + clear_config([:restrict_unauthenticated, :profiles, :local], true) + clear_config([:restrict_unauthenticated, :profiles, :remote], true) + + user2 = insert(:user) + user3 = insert(:user, local: false) + + {:ok, _chat_12} = Chat.get_or_create(user.id, user2.ap_id) + {:ok, _chat_13} = Chat.get_or_create(user.id, user3.ap_id) + + result = + conn + |> get("/api/v1/pleroma/chats") + |> json_response_and_validate_schema(200) + + account_ids = Enum.map(result, &get_in(&1, ["account", "id"])) + assert Enum.sort(account_ids) == Enum.sort([user2.id, user3.id]) + end end end diff --git a/test/web/pleroma_api/controllers/emoji_pack_controller_test.exs b/test/web/pleroma_api/controllers/emoji_pack_controller_test.exs index ee3d281a0..e113bb15f 100644 --- a/test/web/pleroma_api/controllers/emoji_pack_controller_test.exs +++ b/test/web/pleroma_api/controllers/emoji_pack_controller_test.exs @@ -14,6 +14,8 @@ defmodule Pleroma.Web.PleromaAPI.EmojiPackControllerTest do ) setup do: clear_config([:auth, :enforce_oauth_admin_scope_usage], false) + setup do: clear_config([:instance, :public], true) + setup do admin = insert(:user, is_admin: true) token = insert(:oauth_admin_token, user: admin) @@ -27,18 +29,63 @@ defmodule Pleroma.Web.PleromaAPI.EmojiPackControllerTest do {:ok, %{admin_conn: admin_conn}} end + test "GET /api/pleroma/emoji/packs when :public: false", %{conn: conn} do + Config.put([:instance, :public], false) + conn |> get("/api/pleroma/emoji/packs") |> json_response_and_validate_schema(200) + end + test "GET /api/pleroma/emoji/packs", %{conn: conn} do resp = conn |> get("/api/pleroma/emoji/packs") |> json_response_and_validate_schema(200) - shared = resp["test_pack"] - assert shared["files"] == %{"blank" => "blank.png"} + assert resp["count"] == 3 + + assert resp["packs"] + |> Map.keys() + |> length() == 3 + + shared = resp["packs"]["test_pack"] + assert shared["files"] == %{"blank" => "blank.png", "blank2" => "blank2.png"} assert Map.has_key?(shared["pack"], "download-sha256") assert shared["pack"]["can-download"] assert shared["pack"]["share-files"] - non_shared = resp["test_pack_nonshared"] + non_shared = resp["packs"]["test_pack_nonshared"] assert non_shared["pack"]["share-files"] == false assert non_shared["pack"]["can-download"] == false + + resp = + conn + |> get("/api/pleroma/emoji/packs?page_size=1") + |> json_response_and_validate_schema(200) + + assert resp["count"] == 3 + + packs = Map.keys(resp["packs"]) + + assert length(packs) == 1 + + [pack1] = packs + + resp = + conn + |> get("/api/pleroma/emoji/packs?page_size=1&page=2") + |> json_response_and_validate_schema(200) + + assert resp["count"] == 3 + packs = Map.keys(resp["packs"]) + assert length(packs) == 1 + [pack2] = packs + + resp = + conn + |> get("/api/pleroma/emoji/packs?page_size=1&page=3") + |> json_response_and_validate_schema(200) + + assert resp["count"] == 3 + packs = Map.keys(resp["packs"]) + assert length(packs) == 1 + [pack3] = packs + assert [pack1, pack2, pack3] |> Enum.uniq() |> length() == 3 end describe "GET /api/pleroma/emoji/packs/remote" do @@ -332,7 +379,7 @@ test "for a pack with a fallback source", ctx do Map.put( new_data, "fallback-src-sha256", - "74409E2674DAA06C072729C6C8426C4CB3B7E0B85ED77792DB7A436E11D76DAF" + "1967BB4E42BCC34BCC12D57BE7811D3B7BE52F965BCE45C87BD377B9499CE11D" ) assert ctx[:admin_conn] @@ -398,7 +445,7 @@ test "don't rewrite old emoji", %{admin_conn: admin_conn} do assert admin_conn |> put_req_header("content-type", "multipart/form-data") |> post("/api/pleroma/emoji/packs/test_pack/files", %{ - shortcode: "blank2", + shortcode: "blank3", filename: "dir/blank.png", file: %Plug.Upload{ filename: "blank.png", @@ -407,7 +454,8 @@ test "don't rewrite old emoji", %{admin_conn: admin_conn} do }) |> json_response_and_validate_schema(200) == %{ "blank" => "blank.png", - "blank2" => "dir/blank.png" + "blank2" => "blank2.png", + "blank3" => "dir/blank.png" } assert File.exists?("#{@emoji_path}/test_pack/dir/blank.png") @@ -431,7 +479,7 @@ test "rewrite old emoji with force option", %{admin_conn: admin_conn} do assert admin_conn |> put_req_header("content-type", "multipart/form-data") |> post("/api/pleroma/emoji/packs/test_pack/files", %{ - shortcode: "blank2", + shortcode: "blank3", filename: "dir/blank.png", file: %Plug.Upload{ filename: "blank.png", @@ -440,7 +488,8 @@ test "rewrite old emoji with force option", %{admin_conn: admin_conn} do }) |> json_response_and_validate_schema(200) == %{ "blank" => "blank.png", - "blank2" => "dir/blank.png" + "blank2" => "blank2.png", + "blank3" => "dir/blank.png" } assert File.exists?("#{@emoji_path}/test_pack/dir/blank.png") @@ -448,14 +497,15 @@ test "rewrite old emoji with force option", %{admin_conn: admin_conn} do assert admin_conn |> put_req_header("content-type", "multipart/form-data") |> patch("/api/pleroma/emoji/packs/test_pack/files", %{ - shortcode: "blank2", - new_shortcode: "blank3", + shortcode: "blank3", + new_shortcode: "blank4", new_filename: "dir_2/blank_3.png", force: true }) |> json_response_and_validate_schema(200) == %{ "blank" => "blank.png", - "blank3" => "dir_2/blank_3.png" + "blank2" => "blank2.png", + "blank4" => "dir_2/blank_3.png" } assert File.exists?("#{@emoji_path}/test_pack/dir_2/blank_3.png") @@ -481,7 +531,7 @@ test "add file with not loaded pack", %{admin_conn: admin_conn} do assert admin_conn |> put_req_header("content-type", "multipart/form-data") |> post("/api/pleroma/emoji/packs/not_loaded/files", %{ - shortcode: "blank2", + shortcode: "blank3", filename: "dir/blank.png", file: %Plug.Upload{ filename: "blank.png", @@ -535,7 +585,8 @@ test "new with shortcode as file with update", %{admin_conn: admin_conn} do }) |> json_response_and_validate_schema(200) == %{ "blank" => "blank.png", - "blank4" => "dir/blank.png" + "blank4" => "dir/blank.png", + "blank2" => "blank2.png" } assert File.exists?("#{@emoji_path}/test_pack/dir/blank.png") @@ -549,7 +600,8 @@ test "new with shortcode as file with update", %{admin_conn: admin_conn} do }) |> json_response_and_validate_schema(200) == %{ "blank3" => "dir_2/blank_3.png", - "blank" => "blank.png" + "blank" => "blank.png", + "blank2" => "blank2.png" } refute File.exists?("#{@emoji_path}/test_pack/dir/") @@ -557,7 +609,10 @@ test "new with shortcode as file with update", %{admin_conn: admin_conn} do assert admin_conn |> delete("/api/pleroma/emoji/packs/test_pack/files?shortcode=blank3") - |> json_response_and_validate_schema(200) == %{"blank" => "blank.png"} + |> json_response_and_validate_schema(200) == %{ + "blank" => "blank.png", + "blank2" => "blank2.png" + } refute File.exists?("#{@emoji_path}/test_pack/dir_2/") @@ -581,7 +636,8 @@ test "new with shortcode from url", %{admin_conn: admin_conn} do }) |> json_response_and_validate_schema(200) == %{ "blank_url" => "blank_url.png", - "blank" => "blank.png" + "blank" => "blank.png", + "blank2" => "blank2.png" } assert File.exists?("#{@emoji_path}/test_pack/blank_url.png") @@ -602,15 +658,16 @@ test "new without shortcode", %{admin_conn: admin_conn} do }) |> json_response_and_validate_schema(200) == %{ "shortcode" => "shortcode.png", - "blank" => "blank.png" + "blank" => "blank.png", + "blank2" => "blank2.png" } end test "remove non existing shortcode in pack.json", %{admin_conn: admin_conn} do assert admin_conn - |> delete("/api/pleroma/emoji/packs/test_pack/files?shortcode=blank2") + |> delete("/api/pleroma/emoji/packs/test_pack/files?shortcode=blank3") |> json_response_and_validate_schema(:bad_request) == %{ - "error" => "Emoji \"blank2\" does not exist" + "error" => "Emoji \"blank3\" does not exist" } end @@ -618,12 +675,12 @@ test "update non existing emoji", %{admin_conn: admin_conn} do assert admin_conn |> put_req_header("content-type", "multipart/form-data") |> patch("/api/pleroma/emoji/packs/test_pack/files", %{ - shortcode: "blank2", - new_shortcode: "blank3", + shortcode: "blank3", + new_shortcode: "blank4", new_filename: "dir_2/blank_3.png" }) |> json_response_and_validate_schema(:bad_request) == %{ - "error" => "Emoji \"blank2\" does not exist" + "error" => "Emoji \"blank3\" does not exist" } end @@ -651,7 +708,8 @@ test "creating and deleting a pack", %{admin_conn: admin_conn} do assert Jason.decode!(File.read!("#{@emoji_path}/test_created/pack.json")) == %{ "pack" => %{}, - "files" => %{} + "files" => %{}, + "files_count" => 0 } assert admin_conn @@ -709,14 +767,14 @@ test "filesystem import", %{admin_conn: admin_conn, conn: conn} do resp = conn |> get("/api/pleroma/emoji/packs") |> json_response_and_validate_schema(200) - refute Map.has_key?(resp, "test_pack_for_import") + refute Map.has_key?(resp["packs"], "test_pack_for_import") assert admin_conn |> get("/api/pleroma/emoji/packs/import") |> json_response_and_validate_schema(200) == ["test_pack_for_import"] resp = conn |> get("/api/pleroma/emoji/packs") |> json_response_and_validate_schema(200) - assert resp["test_pack_for_import"]["files"] == %{"blank" => "blank.png"} + assert resp["packs"]["test_pack_for_import"]["files"] == %{"blank" => "blank.png"} File.rm!("#{@emoji_path}/test_pack_for_import/pack.json") refute File.exists?("#{@emoji_path}/test_pack_for_import/pack.json") @@ -736,7 +794,7 @@ test "filesystem import", %{admin_conn: admin_conn, conn: conn} do resp = conn |> get("/api/pleroma/emoji/packs") |> json_response_and_validate_schema(200) - assert resp["test_pack_for_import"]["files"] == %{ + assert resp["packs"]["test_pack_for_import"]["files"] == %{ "blank" => "blank.png", "blank2" => "blank.png", "foo" => "blank.png" @@ -746,7 +804,8 @@ test "filesystem import", %{admin_conn: admin_conn, conn: conn} do describe "GET /api/pleroma/emoji/packs/:name" do test "shows pack.json", %{conn: conn} do assert %{ - "files" => %{"blank" => "blank.png"}, + "files" => files, + "files_count" => 2, "pack" => %{ "can-download" => true, "description" => "Test description", @@ -759,6 +818,28 @@ test "shows pack.json", %{conn: conn} do conn |> get("/api/pleroma/emoji/packs/test_pack") |> json_response_and_validate_schema(200) + + assert files == %{"blank" => "blank.png", "blank2" => "blank2.png"} + + assert %{ + "files" => files, + "files_count" => 2 + } = + conn + |> get("/api/pleroma/emoji/packs/test_pack?page_size=1") + |> json_response_and_validate_schema(200) + + assert files |> Map.keys() |> length() == 1 + + assert %{ + "files" => files, + "files_count" => 2 + } = + conn + |> get("/api/pleroma/emoji/packs/test_pack?page_size=1&page=2") + |> json_response_and_validate_schema(200) + + assert files |> Map.keys() |> length() == 1 end test "non existing pack", %{conn: conn} do diff --git a/test/web/pleroma_api/controllers/emoji_reaction_controller_test.exs b/test/web/pleroma_api/controllers/emoji_reaction_controller_test.exs index e1bb5ebfe..3deab30d1 100644 --- a/test/web/pleroma_api/controllers/emoji_reaction_controller_test.exs +++ b/test/web/pleroma_api/controllers/emoji_reaction_controller_test.exs @@ -106,6 +106,23 @@ test "GET /api/v1/pleroma/statuses/:id/reactions", %{conn: conn} do result end + test "GET /api/v1/pleroma/statuses/:id/reactions with :show_reactions disabled", %{conn: conn} do + clear_config([:instance, :show_reactions], false) + + user = insert(:user) + other_user = insert(:user) + + {:ok, activity} = CommonAPI.post(user, %{status: "#cofe"}) + {:ok, _} = CommonAPI.react_with_emoji(activity.id, other_user, "🎅") + + result = + conn + |> get("/api/v1/pleroma/statuses/#{activity.id}/reactions") + |> json_response_and_validate_schema(200) + + assert result == [] + end + test "GET /api/v1/pleroma/statuses/:id/reactions/:emoji", %{conn: conn} do user = insert(:user) other_user = insert(:user) diff --git a/test/web/pleroma_api/views/chat/message_reference_view_test.exs b/test/web/pleroma_api/views/chat/message_reference_view_test.exs index e5b165255..40dbae3cd 100644 --- a/test/web/pleroma_api/views/chat/message_reference_view_test.exs +++ b/test/web/pleroma_api/views/chat/message_reference_view_test.exs @@ -43,7 +43,17 @@ test "it displays a chat message" do assert chat_message[:unread] == false assert match?([%{shortcode: "firefox"}], chat_message[:emojis]) - {:ok, activity} = CommonAPI.post_chat_message(recipient, user, "gkgkgk", media_id: upload.id) + clear_config([:rich_media, :enabled], true) + + Tesla.Mock.mock(fn + %{url: "https://example.com/ogp"} -> + %Tesla.Env{status: 200, body: File.read!("test/fixtures/rich_media/ogp.html")} + end) + + {:ok, activity} = + CommonAPI.post_chat_message(recipient, user, "gkgkgk https://example.com/ogp", + media_id: upload.id + ) object = Object.normalize(activity) @@ -52,10 +62,11 @@ test "it displays a chat message" do chat_message_two = MessageReferenceView.render("show.json", chat_message_reference: cm_ref) assert chat_message_two[:id] == cm_ref.id - assert chat_message_two[:content] == "gkgkgk" + assert chat_message_two[:content] == object.data["content"] assert chat_message_two[:account_id] == recipient.id assert chat_message_two[:chat_id] == chat_message[:chat_id] assert chat_message_two[:attachment] assert chat_message_two[:unread] == true + assert chat_message_two[:card] end end diff --git a/test/web/pleroma_api/views/chat_view_test.exs b/test/web/pleroma_api/views/chat_view_test.exs index 14eecb1bd..02484b705 100644 --- a/test/web/pleroma_api/views/chat_view_test.exs +++ b/test/web/pleroma_api/views/chat_view_test.exs @@ -26,7 +26,8 @@ test "it represents a chat" do assert represented_chat == %{ id: "#{chat.id}", - account: AccountView.render("show.json", user: recipient), + account: + AccountView.render("show.json", user: recipient, skip_visibility_check: true), unread: 0, last_message: nil, updated_at: Utils.to_masto_date(chat.updated_at) diff --git a/test/web/preload/instance_test.exs b/test/web/preload/instance_test.exs new file mode 100644 index 000000000..a46f28312 --- /dev/null +++ b/test/web/preload/instance_test.exs @@ -0,0 +1,48 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload.Providers.InstanceTest do + use Pleroma.DataCase + alias Pleroma.Web.Preload.Providers.Instance + + setup do: {:ok, Instance.generate_terms(nil)} + + test "it renders the info", %{"/api/v1/instance" => info} do + assert %{ + description: description, + email: "admin@example.com", + registrations: true + } = info + + assert String.equivalent?(description, "Pleroma: An efficient and flexible fediverse server") + end + + test "it renders the panel", %{"/instance/panel.html" => panel} do + assert String.contains?( + panel, + "

Welcome to Pleroma!

" + ) + end + + test "it works with overrides" do + clear_config([:instance, :static_dir], "test/fixtures/preload_static") + + %{"/instance/panel.html" => panel} = Instance.generate_terms(nil) + + assert String.contains?( + panel, + "HEY!" + ) + end + + test "it renders the node_info", %{"/nodeinfo/2.0.json" => nodeinfo} do + %{ + metadata: metadata, + version: "2.0" + } = nodeinfo + + assert metadata.private == false + assert metadata.suggestions == %{enabled: false} + end +end diff --git a/test/web/preload/timeline_test.exs b/test/web/preload/timeline_test.exs new file mode 100644 index 000000000..3b1f2f1aa --- /dev/null +++ b/test/web/preload/timeline_test.exs @@ -0,0 +1,56 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload.Providers.TimelineTest do + use Pleroma.DataCase + import Pleroma.Factory + + alias Pleroma.Web.CommonAPI + alias Pleroma.Web.Preload.Providers.Timelines + + @public_url "/api/v1/timelines/public" + + describe "unauthenticated timeliness when restricted" do + setup do: clear_config([:restrict_unauthenticated, :timelines, :local], true) + setup do: clear_config([:restrict_unauthenticated, :timelines, :federated], true) + + test "return nothing" do + tl_data = Timelines.generate_terms(%{}) + + refute Map.has_key?(tl_data, "/api/v1/timelines/public") + end + end + + describe "unauthenticated timeliness when unrestricted" do + setup do: clear_config([:restrict_unauthenticated, :timelines, :local], false) + setup do: clear_config([:restrict_unauthenticated, :timelines, :federated], false) + + setup do: {:ok, user: insert(:user)} + + test "returns the timeline when not restricted" do + assert Timelines.generate_terms(%{}) + |> Map.has_key?(@public_url) + end + + test "returns public items", %{user: user} do + {:ok, _} = CommonAPI.post(user, %{status: "it's post 1!"}) + {:ok, _} = CommonAPI.post(user, %{status: "it's post 2!"}) + {:ok, _} = CommonAPI.post(user, %{status: "it's post 3!"}) + + assert Timelines.generate_terms(%{}) + |> Map.fetch!(@public_url) + |> Enum.count() == 3 + end + + test "does not return non-public items", %{user: user} do + {:ok, _} = CommonAPI.post(user, %{status: "it's post 1!", visibility: "unlisted"}) + {:ok, _} = CommonAPI.post(user, %{status: "it's post 2!", visibility: "direct"}) + {:ok, _} = CommonAPI.post(user, %{status: "it's post 3!"}) + + assert Timelines.generate_terms(%{}) + |> Map.fetch!(@public_url) + |> Enum.count() == 1 + end + end +end diff --git a/test/web/preload/user_test.exs b/test/web/preload/user_test.exs new file mode 100644 index 000000000..83f065e27 --- /dev/null +++ b/test/web/preload/user_test.exs @@ -0,0 +1,33 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Web.Preload.Providers.UserTest do + use Pleroma.DataCase + import Pleroma.Factory + alias Pleroma.Web.Preload.Providers.User + + describe "returns empty when user doesn't exist" do + test "nil user specified" do + assert User.generate_terms(%{user: nil}) == %{} + end + + test "missing user specified" do + assert User.generate_terms(%{user: :not_a_user}) == %{} + end + end + + describe "specified user exists" do + setup do + user = insert(:user) + + terms = User.generate_terms(%{user: user}) + %{terms: terms, user: user} + end + + test "account is rendered", %{terms: terms, user: user} do + account = terms["/api/v1/accounts/#{user.id}"] + assert %{acct: user, username: user} = account + end + end +end diff --git a/test/web/push/impl_test.exs b/test/web/push/impl_test.exs index b48952b29..aeb5c1fbd 100644 --- a/test/web/push/impl_test.exs +++ b/test/web/push/impl_test.exs @@ -238,9 +238,11 @@ test "builds content for chat messages with no content" do } end - test "hides details for notifications when privacy option enabled" do + test "hides contents of notifications when option enabled" do user = insert(:user, nickname: "Bob") - user2 = insert(:user, nickname: "Rob", notification_settings: %{privacy_option: true}) + + user2 = + insert(:user, nickname: "Rob", notification_settings: %{hide_notification_contents: true}) {:ok, activity} = CommonAPI.post(user, %{ @@ -284,9 +286,11 @@ test "hides details for notifications when privacy option enabled" do } end - test "returns regular content for notifications with privacy option disabled" do + test "returns regular content when hiding contents option disabled" do user = insert(:user, nickname: "Bob") - user2 = insert(:user, nickname: "Rob", notification_settings: %{privacy_option: false}) + + user2 = + insert(:user, nickname: "Rob", notification_settings: %{hide_notification_contents: false}) {:ok, activity} = CommonAPI.post(user, %{ diff --git a/test/web/rich_media/aws_signed_url_test.exs b/test/web/rich_media/aws_signed_url_test.exs index b30f4400e..1ceae1a31 100644 --- a/test/web/rich_media/aws_signed_url_test.exs +++ b/test/web/rich_media/aws_signed_url_test.exs @@ -21,7 +21,7 @@ test "s3 signed url is parsed correct for expiration time" do expire_time = Timex.parse!(timestamp, "{ISO:Basic:Z}") |> Timex.to_unix() |> Kernel.+(valid_till) - assert expire_time == Pleroma.Web.RichMedia.Parser.TTL.AwsSignedUrl.ttl(metadata, url) + assert {:ok, expire_time} == Pleroma.Web.RichMedia.Parser.TTL.AwsSignedUrl.ttl(metadata, url) end test "s3 signed url is parsed and correct ttl is set for rich media" do @@ -55,7 +55,7 @@ test "s3 signed url is parsed and correct ttl is set for rich media" do Cachex.put(:rich_media_cache, url, metadata) - Pleroma.Web.RichMedia.Parser.set_ttl_based_on_image({:ok, metadata}, url) + Pleroma.Web.RichMedia.Parser.set_ttl_based_on_image(metadata, url) {:ok, cache_ttl} = Cachex.ttl(:rich_media_cache, url) diff --git a/test/web/rich_media/parser_test.exs b/test/web/rich_media/parser_test.exs index 420a612c6..21ae35f8b 100644 --- a/test/web/rich_media/parser_test.exs +++ b/test/web/rich_media/parser_test.exs @@ -5,6 +5,8 @@ defmodule Pleroma.Web.RichMedia.ParserTest do use ExUnit.Case, async: true + alias Pleroma.Web.RichMedia.Parser + setup do Tesla.Mock.mock(fn %{ @@ -48,23 +50,27 @@ defmodule Pleroma.Web.RichMedia.ParserTest do %{method: :get, url: "http://example.com/empty"} -> %Tesla.Env{status: 200, body: "hello"} + + %{method: :get, url: "http://example.com/malformed"} -> + %Tesla.Env{status: 200, body: File.read!("test/fixtures/rich_media/malformed-data.html")} + + %{method: :get, url: "http://example.com/error"} -> + {:error, :overload} end) :ok end test "returns error when no metadata present" do - assert {:error, _} = Pleroma.Web.RichMedia.Parser.parse("http://example.com/empty") + assert {:error, _} = Parser.parse("http://example.com/empty") end test "doesn't just add a title" do - assert Pleroma.Web.RichMedia.Parser.parse("http://example.com/non-ogp") == - {:error, - "Found metadata was invalid or incomplete: %{\"url\" => \"http://example.com/non-ogp\"}"} + assert {:error, {:invalid_metadata, _}} = Parser.parse("http://example.com/non-ogp") end test "parses ogp" do - assert Pleroma.Web.RichMedia.Parser.parse("http://example.com/ogp") == + assert Parser.parse("http://example.com/ogp") == {:ok, %{ "image" => "http://ia.media-imdb.com/images/rock.jpg", @@ -77,7 +83,7 @@ test "parses ogp" do end test "falls back to when ogp:title is missing" do - assert Pleroma.Web.RichMedia.Parser.parse("http://example.com/ogp-missing-title") == + assert Parser.parse("http://example.com/ogp-missing-title") == {:ok, %{ "image" => "http://ia.media-imdb.com/images/rock.jpg", @@ -90,7 +96,7 @@ test "falls back to <title> when ogp:title is missing" do end test "parses twitter card" do - assert Pleroma.Web.RichMedia.Parser.parse("http://example.com/twitter-card") == + assert Parser.parse("http://example.com/twitter-card") == {:ok, %{ "card" => "summary", @@ -103,7 +109,7 @@ test "parses twitter card" do end test "parses OEmbed" do - assert Pleroma.Web.RichMedia.Parser.parse("http://example.com/oembed") == + assert Parser.parse("http://example.com/oembed") == {:ok, %{ "author_name" => "‮‭‬bees‬", @@ -132,6 +138,10 @@ test "parses OEmbed" do end test "rejects invalid OGP data" do - assert {:error, _} = Pleroma.Web.RichMedia.Parser.parse("http://example.com/malformed") + assert {:error, _} = Parser.parse("http://example.com/malformed") + end + + test "returns error if getting page was not successful" do + assert {:error, :overload} = Parser.parse("http://example.com/error") end end diff --git a/test/web/static_fe/static_fe_controller_test.exs b/test/web/static_fe/static_fe_controller_test.exs index a49ab002f..1598bf675 100644 --- a/test/web/static_fe/static_fe_controller_test.exs +++ b/test/web/static_fe/static_fe_controller_test.exs @@ -87,6 +87,20 @@ test "single notice page", %{conn: conn, user: user} do assert html =~ "testing a thing!" end + test "redirects to json if requested", %{conn: conn, user: user} do + {:ok, activity} = CommonAPI.post(user, %{status: "testing a thing!"}) + + conn = + conn + |> put_req_header( + "accept", + "Accept: application/activity+json, application/ld+json; profile=\"https://www.w3.org/ns/activitystreams\", text/html" + ) + |> get("/notice/#{activity.id}") + + assert redirected_to(conn, 302) =~ activity.data["object"] + end + test "filters HTML tags", %{conn: conn} do user = insert(:user) {:ok, activity} = CommonAPI.post(user, %{status: "<script>alert('xss')</script>"}) diff --git a/test/web/streamer/streamer_test.exs b/test/web/streamer/streamer_test.exs index 245f6e63f..d56d74464 100644 --- a/test/web/streamer/streamer_test.exs +++ b/test/web/streamer/streamer_test.exs @@ -116,6 +116,35 @@ test "it streams boosts of the user in the 'user' stream", %{user: user} do refute Streamer.filtered_by_user?(user, announce) end + test "it does not stream announces of the user's own posts in the 'user' stream", %{ + user: user + } do + Streamer.get_topic_and_add_socket("user", user) + + other_user = insert(:user) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) + {:ok, announce} = CommonAPI.repeat(activity.id, other_user) + + assert Streamer.filtered_by_user?(user, announce) + end + + test "it does stream notifications announces of the user's own posts in the 'user' stream", %{ + user: user + } do + Streamer.get_topic_and_add_socket("user", user) + + other_user = insert(:user) + {:ok, activity} = CommonAPI.post(user, %{status: "hey"}) + {:ok, announce} = CommonAPI.repeat(activity.id, other_user) + + notification = + Pleroma.Notification + |> Repo.get_by(%{user_id: user.id, activity_id: announce.id}) + |> Repo.preload(:activity) + + refute Streamer.filtered_by_user?(user, notification) + end + test "it streams boosts of mastodon user in the 'user' stream", %{user: user} do Streamer.get_topic_and_add_socket("user", user) diff --git a/test/web/twitter_api/password_controller_test.exs b/test/web/twitter_api/password_controller_test.exs index 231a46c67..a5e9e2178 100644 --- a/test/web/twitter_api/password_controller_test.exs +++ b/test/web/twitter_api/password_controller_test.exs @@ -37,7 +37,7 @@ test "it shows password reset form", %{conn: conn} do test "it returns HTTP 200", %{conn: conn} do user = insert(:user) {:ok, token} = PasswordResetToken.create_token(user) - {:ok, _access_token} = Token.create_token(insert(:oauth_app), user, %{}) + {:ok, _access_token} = Token.create(insert(:oauth_app), user, %{}) params = %{ "password" => "test", @@ -62,7 +62,7 @@ test "it sets password_reset_pending to false", %{conn: conn} do user = insert(:user, password_reset_pending: true) {:ok, token} = PasswordResetToken.create_token(user) - {:ok, _access_token} = Token.create_token(insert(:oauth_app), user, %{}) + {:ok, _access_token} = Token.create(insert(:oauth_app), user, %{}) params = %{ "password" => "test", diff --git a/test/web/twitter_api/remote_follow_controller_test.exs b/test/web/twitter_api/remote_follow_controller_test.exs index f7e54c26a..3852c7ce9 100644 --- a/test/web/twitter_api/remote_follow_controller_test.exs +++ b/test/web/twitter_api/remote_follow_controller_test.exs @@ -227,7 +227,7 @@ test "follows", %{conn: conn} do } ) - {:ok, %{token: token}} = MFA.Token.create_token(user) + {:ok, %{token: token}} = MFA.Token.create(user) user2 = insert(:user) otp_token = TOTP.generate_token(otp_secret) @@ -256,7 +256,7 @@ test "returns error when auth code is incorrect", %{conn: conn} do } ) - {:ok, %{token: token}} = MFA.Token.create_token(user) + {:ok, %{token: token}} = MFA.Token.create(user) user2 = insert(:user) otp_token = TOTP.generate_token(TOTP.generate_secret()) diff --git a/test/web/twitter_api/twitter_api_test.exs b/test/web/twitter_api/twitter_api_test.exs index 368533292..20a45cb6f 100644 --- a/test/web/twitter_api/twitter_api_test.exs +++ b/test/web/twitter_api/twitter_api_test.exs @@ -4,11 +4,11 @@ defmodule Pleroma.Web.TwitterAPI.TwitterAPITest do use Pleroma.DataCase + import Pleroma.Factory alias Pleroma.Repo alias Pleroma.Tests.ObanHelpers alias Pleroma.User alias Pleroma.UserInviteToken - alias Pleroma.Web.MastodonAPI.AccountView alias Pleroma.Web.TwitterAPI.TwitterAPI setup_all do @@ -27,13 +27,10 @@ test "it registers a new user and returns the user." do {:ok, user} = TwitterAPI.register_user(data) - fetched_user = User.get_cached_by_nickname("lain") - - assert AccountView.render("show.json", %{user: user}) == - AccountView.render("show.json", %{user: fetched_user}) + assert user == User.get_cached_by_nickname("lain") end - test "it registers a new user with empty string in bio and returns the user." do + test "it registers a new user with empty string in bio and returns the user" do data = %{ :username => "lain", :email => "lain@wired.jp", @@ -45,10 +42,7 @@ test "it registers a new user with empty string in bio and returns the user." do {:ok, user} = TwitterAPI.register_user(data) - fetched_user = User.get_cached_by_nickname("lain") - - assert AccountView.render("show.json", %{user: user}) == - AccountView.render("show.json", %{user: fetched_user}) + assert user == User.get_cached_by_nickname("lain") end test "it sends confirmation email if :account_activation_required is specified in instance config" do @@ -85,6 +79,42 @@ test "it sends confirmation email if :account_activation_required is specified i ) end + test "it sends an admin email if :account_approval_required is specified in instance config" do + admin = insert(:user, is_admin: true) + setting = Pleroma.Config.get([:instance, :account_approval_required]) + + unless setting do + Pleroma.Config.put([:instance, :account_approval_required], true) + on_exit(fn -> Pleroma.Config.put([:instance, :account_approval_required], setting) end) + end + + data = %{ + :username => "lain", + :email => "lain@wired.jp", + :fullname => "lain iwakura", + :bio => "", + :password => "bear", + :confirm => "bear", + :reason => "I love anime" + } + + {:ok, user} = TwitterAPI.register_user(data) + ObanHelpers.perform_all() + + assert user.approval_pending + + email = Pleroma.Emails.AdminEmail.new_unapproved_registration(admin, user) + + notify_email = Pleroma.Config.get([:instance, :notify_email]) + instance_name = Pleroma.Config.get([:instance, :name]) + + Swoosh.TestAssertions.assert_email_sent( + from: {instance_name, notify_email}, + to: {admin.name, admin.email}, + html_body: email.html_body + ) + end + test "it registers a new user and parses mentions in the bio" do data1 = %{ :username => "john", @@ -134,13 +164,10 @@ test "returns user on success" do {:ok, user} = TwitterAPI.register_user(data) - fetched_user = User.get_cached_by_nickname("vinny") + assert user == User.get_cached_by_nickname("vinny") + invite = Repo.get_by(UserInviteToken, token: invite.token) - assert invite.used == true - - assert AccountView.render("show.json", %{user: user}) == - AccountView.render("show.json", %{user: fetched_user}) end test "returns error on invalid token" do @@ -197,10 +224,8 @@ test "returns error on expired token" do check_fn = fn invite -> data = Map.put(data, :token, invite.token) {:ok, user} = TwitterAPI.register_user(data) - fetched_user = User.get_cached_by_nickname("vinny") - assert AccountView.render("show.json", %{user: user}) == - AccountView.render("show.json", %{user: fetched_user}) + assert user == User.get_cached_by_nickname("vinny") end {:ok, data: data, check_fn: check_fn} @@ -260,14 +285,11 @@ test "returns user on success, after him registration fails" do } {:ok, user} = TwitterAPI.register_user(data) - fetched_user = User.get_cached_by_nickname("vinny") + assert user == User.get_cached_by_nickname("vinny") + invite = Repo.get_by(UserInviteToken, token: invite.token) - assert invite.used == true - assert AccountView.render("show.json", %{user: user}) == - AccountView.render("show.json", %{user: fetched_user}) - data = %{ :username => "GrimReaper", :email => "death@reapers.afterlife", @@ -302,13 +324,10 @@ test "returns user on success" do } {:ok, user} = TwitterAPI.register_user(data) - fetched_user = User.get_cached_by_nickname("vinny") + assert user == User.get_cached_by_nickname("vinny") + invite = Repo.get_by(UserInviteToken, token: invite.token) - refute invite.used - - assert AccountView.render("show.json", %{user: user}) == - AccountView.render("show.json", %{user: fetched_user}) end test "error after max uses" do @@ -327,13 +346,11 @@ test "error after max uses" do } {:ok, user} = TwitterAPI.register_user(data) - fetched_user = User.get_cached_by_nickname("vinny") + assert user == User.get_cached_by_nickname("vinny") + invite = Repo.get_by(UserInviteToken, token: invite.token) assert invite.used == true - assert AccountView.render("show.json", %{user: user}) == - AccountView.render("show.json", %{user: fetched_user}) - data = %{ :username => "GrimReaper", :email => "death@reapers.afterlife", diff --git a/test/web/twitter_api/util_controller_test.exs b/test/web/twitter_api/util_controller_test.exs index ad919d341..d164127ee 100644 --- a/test/web/twitter_api/util_controller_test.exs +++ b/test/web/twitter_api/util_controller_test.exs @@ -191,7 +191,7 @@ test "it imports blocks with different nickname variations", %{conn: conn} do test "it updates notification settings", %{user: user, conn: conn} do conn |> put("/api/pleroma/notification_settings", %{ - "followers" => false, + "block_from_strangers" => true, "bar" => 1 }) |> json_response(:ok) @@ -199,130 +199,25 @@ test "it updates notification settings", %{user: user, conn: conn} do user = refresh_record(user) assert %Pleroma.User.NotificationSetting{ - followers: false, - follows: true, - non_follows: true, - non_followers: true, - privacy_option: false + block_from_strangers: true, + hide_notification_contents: false } == user.notification_settings end - test "it updates notification privacy option", %{user: user, conn: conn} do + test "it updates notification settings to enable hiding contents", %{user: user, conn: conn} do conn - |> put("/api/pleroma/notification_settings", %{"privacy_option" => "1"}) + |> put("/api/pleroma/notification_settings", %{"hide_notification_contents" => "1"}) |> json_response(:ok) user = refresh_record(user) assert %Pleroma.User.NotificationSetting{ - followers: true, - follows: true, - non_follows: true, - non_followers: true, - privacy_option: true + block_from_strangers: false, + hide_notification_contents: true } == user.notification_settings end end - describe "GET /api/statusnet/config" do - test "it returns config in xml format", %{conn: conn} do - instance = Config.get(:instance) - - response = - conn - |> put_req_header("accept", "application/xml") - |> get("/api/statusnet/config") - |> response(:ok) - - assert response == - "<config>\n<site>\n<name>#{Keyword.get(instance, :name)}</name>\n<site>#{ - Pleroma.Web.base_url() - }</site>\n<textlimit>#{Keyword.get(instance, :limit)}</textlimit>\n<closed>#{ - !Keyword.get(instance, :registrations_open) - }</closed>\n</site>\n</config>\n" - end - - test "it returns config in json format", %{conn: conn} do - instance = Config.get(:instance) - Config.put([:instance, :managed_config], true) - Config.put([:instance, :registrations_open], false) - Config.put([:instance, :invites_enabled], true) - Config.put([:instance, :public], false) - Config.put([:frontend_configurations, :pleroma_fe], %{theme: "asuka-hospital"}) - - response = - conn - |> put_req_header("accept", "application/json") - |> get("/api/statusnet/config") - |> json_response(:ok) - - expected_data = %{ - "site" => %{ - "accountActivationRequired" => "0", - "closed" => "1", - "description" => Keyword.get(instance, :description), - "invitesEnabled" => "1", - "name" => Keyword.get(instance, :name), - "pleromafe" => %{"theme" => "asuka-hospital"}, - "private" => "1", - "safeDMMentionsEnabled" => "0", - "server" => Pleroma.Web.base_url(), - "textlimit" => to_string(Keyword.get(instance, :limit)), - "uploadlimit" => %{ - "avatarlimit" => to_string(Keyword.get(instance, :avatar_upload_limit)), - "backgroundlimit" => to_string(Keyword.get(instance, :background_upload_limit)), - "bannerlimit" => to_string(Keyword.get(instance, :banner_upload_limit)), - "uploadlimit" => to_string(Keyword.get(instance, :upload_limit)) - }, - "vapidPublicKey" => Keyword.get(Pleroma.Web.Push.vapid_config(), :public_key) - } - } - - assert response == expected_data - end - - test "returns the state of safe_dm_mentions flag", %{conn: conn} do - Config.put([:instance, :safe_dm_mentions], true) - - response = - conn - |> get("/api/statusnet/config.json") - |> json_response(:ok) - - assert response["site"]["safeDMMentionsEnabled"] == "1" - - Config.put([:instance, :safe_dm_mentions], false) - - response = - conn - |> get("/api/statusnet/config.json") - |> json_response(:ok) - - assert response["site"]["safeDMMentionsEnabled"] == "0" - end - - test "it returns the managed config", %{conn: conn} do - Config.put([:instance, :managed_config], false) - Config.put([:frontend_configurations, :pleroma_fe], %{theme: "asuka-hospital"}) - - response = - conn - |> get("/api/statusnet/config.json") - |> json_response(:ok) - - refute response["site"]["pleromafe"] - - Config.put([:instance, :managed_config], true) - - response = - conn - |> get("/api/statusnet/config.json") - |> json_response(:ok) - - assert response["site"]["pleromafe"] == %{"theme" => "asuka-hospital"} - end - end - describe "GET /api/pleroma/frontend_configurations" do test "returns everything in :pleroma, :frontend_configurations", %{conn: conn} do config = [ @@ -451,28 +346,6 @@ test "with valid permissions and invalid password, it returns an error", %{conn: end end - describe "GET /api/statusnet/version" do - test "it returns version in xml format", %{conn: conn} do - response = - conn - |> put_req_header("accept", "application/xml") - |> get("/api/statusnet/version") - |> response(:ok) - - assert response == "<version>#{Pleroma.Application.named_version()}</version>" - end - - test "it returns version in json format", %{conn: conn} do - response = - conn - |> put_req_header("accept", "application/json") - |> get("/api/statusnet/version") - |> json_response(:ok) - - assert response == "#{Pleroma.Application.named_version()}" - end - end - describe "POST /main/ostatus - remote_subscribe/2" do setup do: clear_config([:instance, :federating], true) @@ -713,10 +586,16 @@ test "with proper permissions and wrong or missing password", %{conn: conn} do end end - test "with proper permissions and valid password", %{conn: conn} do + test "with proper permissions and valid password", %{conn: conn, user: user} do conn = post(conn, "/api/pleroma/delete_account", %{"password" => "test"}) - + ObanHelpers.perform_all() assert json_response(conn, 200) == %{"status" => "success"} + + user = User.get_by_id(user.id) + assert user.deactivated == true + assert user.name == nil + assert user.bio == "" + assert user.password_hash == nil end end end diff --git a/test/web/web_finger/web_finger_test.exs b/test/web/web_finger/web_finger_test.exs index f4884e0a2..96fc0bbaa 100644 --- a/test/web/web_finger/web_finger_test.exs +++ b/test/web/web_finger/web_finger_test.exs @@ -40,6 +40,11 @@ test "works for ap_ids" do end describe "fingering" do + test "returns error for nonsensical input" do + assert {:error, _} = WebFinger.finger("bliblablu") + assert {:error, _} = WebFinger.finger("pleroma.social") + end + test "returns error when fails parse xml or json" do user = "invalid_content@social.heldscal.la" assert {:error, %Jason.DecodeError{}} = WebFinger.finger(user) diff --git a/test/workers/cron/clear_oauth_token_worker_test.exs b/test/workers/cron/clear_oauth_token_worker_test.exs deleted file mode 100644 index df82dc75d..000000000 --- a/test/workers/cron/clear_oauth_token_worker_test.exs +++ /dev/null @@ -1,22 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/> -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Workers.Cron.ClearOauthTokenWorkerTest do - use Pleroma.DataCase - - import Pleroma.Factory - alias Pleroma.Workers.Cron.ClearOauthTokenWorker - - setup do: clear_config([:oauth2, :clean_expired_tokens]) - - test "deletes expired tokens" do - insert(:oauth_token, - valid_until: NaiveDateTime.add(NaiveDateTime.utc_now(), -60 * 10) - ) - - Pleroma.Config.put([:oauth2, :clean_expired_tokens], true) - ClearOauthTokenWorker.perform(:opts, :job) - assert Pleroma.Repo.all(Pleroma.Web.OAuth.Token) == [] - end -end diff --git a/test/workers/cron/digest_emails_worker_test.exs b/test/workers/cron/digest_emails_worker_test.exs index f9bc50db5..65887192e 100644 --- a/test/workers/cron/digest_emails_worker_test.exs +++ b/test/workers/cron/digest_emails_worker_test.exs @@ -35,7 +35,7 @@ defmodule Pleroma.Workers.Cron.DigestEmailsWorkerTest do end test "it sends digest emails", %{user2: user2} do - Pleroma.Workers.Cron.DigestEmailsWorker.perform(:opts, :pid) + Pleroma.Workers.Cron.DigestEmailsWorker.perform(%Oban.Job{}) # Performing job(s) enqueued at previous step ObanHelpers.perform_all() @@ -47,7 +47,7 @@ test "it sends digest emails", %{user2: user2} do test "it doesn't fail when a user has no email", %{user2: user2} do {:ok, _} = user2 |> Ecto.Changeset.change(%{email: nil}) |> Pleroma.Repo.update() - Pleroma.Workers.Cron.DigestEmailsWorker.perform(:opts, :pid) + Pleroma.Workers.Cron.DigestEmailsWorker.perform(%Oban.Job{}) # Performing job(s) enqueued at previous step ObanHelpers.perform_all() end diff --git a/test/workers/cron/new_users_digest_worker_test.exs b/test/workers/cron/new_users_digest_worker_test.exs index ee589bb55..129534cb1 100644 --- a/test/workers/cron/new_users_digest_worker_test.exs +++ b/test/workers/cron/new_users_digest_worker_test.exs @@ -17,7 +17,7 @@ test "it sends new users digest emails" do user2 = insert(:user, %{inserted_at: yesterday}) CommonAPI.post(user, %{status: "cofe"}) - NewUsersDigestWorker.perform(nil, nil) + NewUsersDigestWorker.perform(%Oban.Job{}) ObanHelpers.perform_all() assert_received {:email, email} @@ -39,7 +39,7 @@ test "it doesn't fail when admin has no email" do CommonAPI.post(user, %{status: "cofe"}) - NewUsersDigestWorker.perform(nil, nil) + NewUsersDigestWorker.perform(%Oban.Job{}) ObanHelpers.perform_all() end end diff --git a/test/workers/cron/purge_expired_activities_worker_test.exs b/test/workers/cron/purge_expired_activities_worker_test.exs deleted file mode 100644 index 6d2991a60..000000000 --- a/test/workers/cron/purge_expired_activities_worker_test.exs +++ /dev/null @@ -1,88 +0,0 @@ -# Pleroma: A lightweight social networking server -# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/> -# SPDX-License-Identifier: AGPL-3.0-only - -defmodule Pleroma.Workers.Cron.PurgeExpiredActivitiesWorkerTest do - use Pleroma.DataCase - - alias Pleroma.ActivityExpiration - alias Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker - - import Pleroma.Factory - import ExUnit.CaptureLog - - setup do - clear_config([ActivityExpiration, :enabled]) - clear_config([:instance, :rewrite_policy]) - end - - test "deletes an expiration activity" do - Pleroma.Config.put([ActivityExpiration, :enabled], true) - activity = insert(:note_activity) - - naive_datetime = - NaiveDateTime.add( - NaiveDateTime.utc_now(), - -:timer.minutes(2), - :millisecond - ) - - expiration = - insert( - :expiration_in_the_past, - %{activity_id: activity.id, scheduled_at: naive_datetime} - ) - - Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker.perform(:ops, :pid) - - refute Pleroma.Repo.get(Pleroma.Activity, activity.id) - refute Pleroma.Repo.get(Pleroma.ActivityExpiration, expiration.id) - end - - test "works with ActivityExpirationPolicy" do - Pleroma.Config.put([ActivityExpiration, :enabled], true) - - Pleroma.Config.put( - [:instance, :rewrite_policy], - Pleroma.Web.ActivityPub.MRF.ActivityExpirationPolicy - ) - - user = insert(:user) - - days = Pleroma.Config.get([:mrf_activity_expiration, :days], 365) - - {:ok, %{id: id} = activity} = Pleroma.Web.CommonAPI.post(user, %{status: "cofe"}) - - past_date = - NaiveDateTime.utc_now() |> Timex.shift(days: -days) |> NaiveDateTime.truncate(:second) - - activity - |> Repo.preload(:expiration) - |> Map.get(:expiration) - |> Ecto.Changeset.change(%{scheduled_at: past_date}) - |> Repo.update!() - - Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker.perform(:ops, :pid) - - assert [%{data: %{"type" => "Delete", "deleted_activity_id" => ^id}}] = - Pleroma.Repo.all(Pleroma.Activity) - end - - describe "delete_activity/1" do - test "adds log message if activity isn't find" do - assert capture_log([level: :error], fn -> - PurgeExpiredActivitiesWorker.delete_activity(%ActivityExpiration{ - activity_id: "test-activity" - }) - end) =~ "Couldn't delete expired activity: not found activity" - end - - test "adds log message if actor isn't find" do - assert capture_log([level: :error], fn -> - PurgeExpiredActivitiesWorker.delete_activity(%ActivityExpiration{ - activity_id: "test-activity" - }) - end) =~ "Couldn't delete expired activity: not found activity" - end - end -end diff --git a/test/workers/purge_expired_activity_test.exs b/test/workers/purge_expired_activity_test.exs new file mode 100644 index 000000000..b5938776d --- /dev/null +++ b/test/workers/purge_expired_activity_test.exs @@ -0,0 +1,59 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/> +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Workers.PurgeExpiredActivityTest do + use Pleroma.DataCase, async: true + use Oban.Testing, repo: Pleroma.Repo + + import Pleroma.Factory + + alias Pleroma.Workers.PurgeExpiredActivity + + test "enqueue job" do + activity = insert(:note_activity) + + assert {:ok, _} = + PurgeExpiredActivity.enqueue(%{ + activity_id: activity.id, + expires_at: DateTime.add(DateTime.utc_now(), 3601) + }) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredActivity, + args: %{activity_id: activity.id} + ) + + assert {:ok, _} = + perform_job(Pleroma.Workers.PurgeExpiredActivity, %{activity_id: activity.id}) + + assert %Oban.Job{} = Pleroma.Workers.PurgeExpiredActivity.get_expiration(activity.id) + end + + test "error if user was not found" do + activity = insert(:note_activity) + + assert {:ok, _} = + PurgeExpiredActivity.enqueue(%{ + activity_id: activity.id, + expires_at: DateTime.add(DateTime.utc_now(), 3601) + }) + + user = Pleroma.User.get_by_ap_id(activity.actor) + Pleroma.Repo.delete(user) + + assert {:error, :user_not_found} = + perform_job(Pleroma.Workers.PurgeExpiredActivity, %{activity_id: activity.id}) + end + + test "error if actiivity was not found" do + assert {:ok, _} = + PurgeExpiredActivity.enqueue(%{ + activity_id: "some_id", + expires_at: DateTime.add(DateTime.utc_now(), 3601) + }) + + assert {:error, :activity_not_found} = + perform_job(Pleroma.Workers.PurgeExpiredActivity, %{activity_id: "some_if"}) + end +end diff --git a/test/workers/purge_expired_token_test.exs b/test/workers/purge_expired_token_test.exs new file mode 100644 index 000000000..fb7708c3f --- /dev/null +++ b/test/workers/purge_expired_token_test.exs @@ -0,0 +1,51 @@ +# Pleroma: A lightweight social networking server +# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/> +# SPDX-License-Identifier: AGPL-3.0-only + +defmodule Pleroma.Workers.PurgeExpiredTokenTest do + use Pleroma.DataCase, async: true + use Oban.Testing, repo: Pleroma.Repo + + import Pleroma.Factory + + setup do: clear_config([:oauth2, :clean_expired_tokens], true) + + test "purges expired oauth token" do + user = insert(:user) + app = insert(:oauth_app) + + {:ok, %{id: id}} = Pleroma.Web.OAuth.Token.create(app, user) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredToken, + args: %{token_id: id, mod: Pleroma.Web.OAuth.Token} + ) + + assert {:ok, %{id: ^id}} = + perform_job(Pleroma.Workers.PurgeExpiredToken, %{ + token_id: id, + mod: Pleroma.Web.OAuth.Token + }) + + assert Repo.aggregate(Pleroma.Web.OAuth.Token, :count, :id) == 0 + end + + test "purges expired mfa token" do + authorization = insert(:oauth_authorization) + + {:ok, %{id: id}} = Pleroma.MFA.Token.create(authorization.user, authorization) + + assert_enqueued( + worker: Pleroma.Workers.PurgeExpiredToken, + args: %{token_id: id, mod: Pleroma.MFA.Token} + ) + + assert {:ok, %{id: ^id}} = + perform_job(Pleroma.Workers.PurgeExpiredToken, %{ + token_id: id, + mod: Pleroma.MFA.Token + }) + + assert Repo.aggregate(Pleroma.MFA.Token, :count, :id) == 0 + end +end diff --git a/test/workers/scheduled_activity_worker_test.exs b/test/workers/scheduled_activity_worker_test.exs index b312d975b..f3eddf7b1 100644 --- a/test/workers/scheduled_activity_worker_test.exs +++ b/test/workers/scheduled_activity_worker_test.exs @@ -32,10 +32,7 @@ test "creates a status from the scheduled activity" do params: %{status: "hi"} ) - ScheduledActivityWorker.perform( - %{"activity_id" => scheduled_activity.id}, - :pid - ) + ScheduledActivityWorker.perform(%Oban.Job{args: %{"activity_id" => scheduled_activity.id}}) refute Repo.get(ScheduledActivity, scheduled_activity.id) activity = Repo.all(Pleroma.Activity) |> Enum.find(&(&1.actor == user.ap_id)) @@ -46,7 +43,7 @@ test "adds log message if ScheduledActivity isn't find" do Pleroma.Config.put([ScheduledActivity, :enabled], true) assert capture_log([level: :error], fn -> - ScheduledActivityWorker.perform(%{"activity_id" => 42}, :pid) + ScheduledActivityWorker.perform(%Oban.Job{args: %{"activity_id" => 42}}) end) =~ "Couldn't find scheduled activity" end end