Merge branch 'develop' into issue/1023

CHANGELOG.md

@@ -12,6 +12,7 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 - MFR policy to set global expiration for all local Create activities
 - OGP rich media parser merged with TwitterCard
 - Configuration: `:instance, rewrite_policy` moved to `:mrf, policies`, `:instance, :mrf_transparency` moved to `:mrf, :transparency`, `:instance, :mrf_transparency_exclusions` moved to `:mrf, :transparency_exclusions`. Old config namespace is deprecated.
+- Configuration: `:media_proxy, whitelist` format changed to host with scheme (e.g. `http://example.com` instead of `example.com`). Domain format is deprecated.
 
 <details>
   <summary>API Changes</summary>
@@ -24,6 +25,10 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 - Mastodon API: Added `pleroma.metadata.fields_limits` to /api/v1/instance
 - Mastodon API: On deletion, returns the original post text.
 - Mastodon API: Add `pleroma.unread_count` to the Marker entity.
+- **Breaking:** Notification Settings API for suppressing notifications
+  has been simplified down to `block_from_strangers`.
+- **Breaking:** Notification Settings API option for hiding push notification
+  contents has been renamed to `hide_notification_contents`
 </details>
 
 <details>

config/config.exs

@@ -172,7 +172,7 @@
   "application/ld+json" => ["activity+json"]
 }
 
-config :tesla, adapter: Tesla.Adapter.Hackney
+config :tesla, adapter: Tesla.Adapter.Gun
 
 # Configures http settings, upstream proxy etc.
 config :pleroma, :http,
@@ -512,6 +512,7 @@
     attachments_cleanup: 5,
     new_users_digest: 1
   ],
+  plugins: [Oban.Plugins.Pruner],
   crontab: [
     {"0 0 * * *", Pleroma.Workers.Cron.ClearOauthTokenWorker},
     {"0 * * * *", Pleroma.Workers.Cron.StatsWorker},
@@ -647,32 +648,30 @@
   prepare: :unnamed
 
 config :pleroma, :connections_pool,
-  checkin_timeout: 250,
+  reclaim_multiplier: 0.1,
+  connection_acquisition_wait: 250,
+  connection_acquisition_retries: 5,
   max_connections: 250,
-  retry: 1,
+  max_idle_time: 30_000,
-  retry_timeout: 1000,
+  retry: 0,
   await_up_timeout: 5_000
 
 config :pleroma, :pools,
   federation: [
     size: 50,
-    max_overflow: 10,
+    max_waiting: 10
-    timeout: 150_000
   ],
   media: [
     size: 50,
-    max_overflow: 10,
+    max_waiting: 10
-    timeout: 150_000
   ],
   upload: [
     size: 25,
-    max_overflow: 5,
+    max_waiting: 5
-    timeout: 300_000
   ],
   default: [
     size: 10,
-    max_overflow: 2,
+    max_waiting: 2
-    timeout: 10_000
   ]
 
 config :pleroma, :hackney_pools,

config/description.exs

@@ -1768,8 +1768,8 @@
       %{
         key: :whitelist,
         type: {:list, :string},
-        description: "List of domains to bypass the mediaproxy",
+        description: "List of hosts with scheme to bypass the mediaproxy",
-        suggestions: ["example.com"]
+        suggestions: ["http://example.com"]
       }
     ]
   },
@@ -2008,13 +2008,15 @@
     label: "Pleroma Admin Token",
     type: :group,
     description:
-      "Allows to set a token that can be used to authenticate with the admin api without using an actual user by giving it as the `admin_token` parameter",
+      "Allows setting a token that can be used to authenticate requests with admin privileges without a normal user account token. Append the `admin_token` parameter to requests to utilize it. (Please reconsider using HTTP Basic Auth or OAuth-based authentication if possible)",
     children: [
       %{
         key: :admin_token,
         type: :string,
         description: "Admin token",
-        suggestions: ["We recommend a secure random string or UUID"]
+        suggestions: [
+          "Please use a high entropy string or UUID"
+        ]
       }
     ]
   },
@@ -3159,36 +3161,37 @@
     description: "Advanced settings for `gun` connections pool",
     children: [
       %{
-        key: :checkin_timeout,
+        key: :connection_acquisition_wait,
         type: :integer,
-        description: "Timeout to checkin connection from pool. Default: 250ms.",
+        description:
+          "Timeout to acquire a connection from pool.The total max time is this value multiplied by the number of retries. Default: 250ms.",
         suggestions: [250]
       },
+      %{
+        key: :connection_acquisition_retries,
+        type: :integer,
+        description:
+          "Number of attempts to acquire the connection from the pool if it is overloaded. Default: 5",
+        suggestions: [5]
+      },
       %{
         key: :max_connections,
         type: :integer,
         description: "Maximum number of connections in the pool. Default: 250 connections.",
         suggestions: [250]
       },
-      %{
-        key: :retry,
-        type: :integer,
-        description:
-          "Number of retries, while `gun` will try to reconnect if connection goes down. Default: 1.",
-        suggestions: [1]
-      },
-      %{
-        key: :retry_timeout,
-        type: :integer,
-        description:
-          "Time between retries when `gun` will try to reconnect in milliseconds. Default: 1000ms.",
-        suggestions: [1000]
-      },
       %{
         key: :await_up_timeout,
         type: :integer,
         description: "Timeout while `gun` will wait until connection is up. Default: 5000ms.",
         suggestions: [5000]
+      },
+      %{
+        key: :reclaim_multiplier,
+        type: :integer,
+        description:
+          "Multiplier for the number of idle connection to be reclaimed if the pool is full. For example if the pool maxes out at 250 connections and this setting is set to 0.3, the pool will reclaim at most 75 idle connections if it's overloaded. Default: 0.1",
+        suggestions: [0.1]
       }
     ]
   },
@@ -3197,108 +3200,29 @@
     key: :pools,
     type: :group,
     description: "Advanced settings for `gun` workers pools",
-    children: [
+    children:
-      %{
+      Enum.map([:federation, :media, :upload, :default], fn pool_name ->
-        key: :federation,
+        %{
-        type: :keyword,
+          key: pool_name,
-        description: "Settings for federation pool.",
+          type: :keyword,
-        children: [
+          description: "Settings for #{pool_name} pool.",
-          %{
+          children: [
-            key: :size,
+            %{
-            type: :integer,
+              key: :size,
-            description: "Number workers in the pool.",
+              type: :integer,
-            suggestions: [50]
+              description: "Maximum number of concurrent requests in the pool.",
-          },
+              suggestions: [50]
-          %{
+            },
-            key: :max_overflow,
+            %{
-            type: :integer,
+              key: :max_waiting,
-            description: "Number of additional workers if pool is under load.",
+              type: :integer,
-            suggestions: [10]
+              description:
-          },
+                "Maximum number of requests waiting for other requests to finish. After this number is reached, the pool will start returning errrors when a new request is made",
-          %{
+              suggestions: [10]
-            key: :timeout,
+            }
-            type: :integer,
+          ]
-            description: "Timeout while `gun` will wait for response.",
+        }
-            suggestions: [150_000]
+      end)
-          }
-        ]
-      },
-      %{
-        key: :media,
-        type: :keyword,
-        description: "Settings for media pool.",
-        children: [
-          %{
-            key: :size,
-            type: :integer,
-            description: "Number workers in the pool.",
-            suggestions: [50]
-          },
-          %{
-            key: :max_overflow,
-            type: :integer,
-            description: "Number of additional workers if pool is under load.",
-            suggestions: [10]
-          },
-          %{
-            key: :timeout,
-            type: :integer,
-            description: "Timeout while `gun` will wait for response.",
-            suggestions: [150_000]
-          }
-        ]
-      },
-      %{
-        key: :upload,
-        type: :keyword,
-        description: "Settings for upload pool.",
-        children: [
-          %{
-            key: :size,
-            type: :integer,
-            description: "Number workers in the pool.",
-            suggestions: [25]
-          },
-          %{
-            key: :max_overflow,
-            type: :integer,
-            description: "Number of additional workers if pool is under load.",
-            suggestions: [5]
-          },
-          %{
-            key: :timeout,
-            type: :integer,
-            description: "Timeout while `gun` will wait for response.",
-            suggestions: [300_000]
-          }
-        ]
-      },
-      %{
-        key: :default,
-        type: :keyword,
-        description: "Settings for default pool.",
-        children: [
-          %{
-            key: :size,
-            type: :integer,
-            description: "Number workers in the pool.",
-            suggestions: [10]
-          },
-          %{
-            key: :max_overflow,
-            type: :integer,
-            description: "Number of additional workers if pool is under load.",
-            suggestions: [2]
-          },
-          %{
-            key: :timeout,
-            type: :integer,
-            description: "Timeout while `gun` will wait for response.",
-            suggestions: [10_000]
-          }
-        ]
-      }
-    ]
   },
   %{
     group: :pleroma,

config/test.exs

@@ -113,6 +113,11 @@
 
 config :pleroma, :instances_favicons, enabled: true
 
+config :pleroma, Pleroma.Uploaders.S3,
+  bucket: nil,
+  streaming_enabled: true,
+  public_endpoint: nil
+
 if File.exists?("./config/test.secret.exs") do
   import_config "test.secret.exs"
 else

docs/API/pleroma_api.md

@@ -287,11 +287,8 @@ See [Admin-API](admin_api.md)
 * Method `PUT`
 * Authentication: required
 * Params:
-    * `followers`: BOOLEAN field, receives notifications from followers
+    * `block_from_strangers`: BOOLEAN field, blocks notifications from accounts you do not follow
-    * `follows`: BOOLEAN field, receives notifications from people the user follows
+    * `hide_notification_contents`: BOOLEAN field. When set to true, it removes the contents of a message from the push notification.
-    * `remote`: BOOLEAN field, receives notifications from people on remote instances
-    * `local`: BOOLEAN field, receives notifications from people on the local instance
-    * `privacy_option`: BOOLEAN field. When set to true, it removes the contents of a message from the push notification.
 * Response: JSON. Returns `{"status": "success"}` if the update was successful, otherwise returns `{"error": "error_msg"}`
 
 ## `/api/pleroma/healthcheck`

docs/configuration/cheatsheet.md

@@ -252,6 +252,7 @@ This section describe PWA manifest instance-specific values. Currently this opti
 * `background_color`: Describe the background color of the app. (Example: `"#191b22"`, `"aliceblue"`).
 
 ## :emoji
+
 * `shortcode_globs`: Location of custom emoji files. `*` can be used as a wildcard. Example `["/emoji/custom/**/*.png"]`
 * `pack_extensions`: A list of file extensions for emojis, when no emoji.txt for a pack is present. Example `[".png", ".gif"]`
 * `groups`: Emojis are ordered in groups (tags). This is an array of key-value pairs where the key is the groupname and the value the location or array of locations. `*` can be used as a wildcard. Example `[Custom: ["/emoji/*.png", "/emoji/custom/*.png"]]`
@@ -260,13 +261,14 @@ This section describe PWA manifest instance-specific values. Currently this opti
   memory for this amount of seconds multiplied by the number of files.
 
 ## :media_proxy
+
 * `enabled`: Enables proxying of remote media to the instance’s proxy
 * `base_url`: The base URL to access a user-uploaded file. Useful when you want to proxy the media files via another host/CDN fronts.
 * `proxy_opts`: All options defined in `Pleroma.ReverseProxy` documentation, defaults to `[max_body_length: (25*1_048_576)]`.
-* `whitelist`: List of domains to bypass the mediaproxy
+* `whitelist`: List of hosts with scheme to bypass the mediaproxy (e.g. `https://example.com`)
 * `invalidation`: options for remove media from cache after delete object:
-    * `enabled`: Enables purge cache
+  * `enabled`: Enables purge cache
-    * `provider`: Which one of  the [purge cache strategy](#purge-cache-strategy) to use.
+  * `provider`: Which one of  the [purge cache strategy](#purge-cache-strategy) to use.
 
 ### Purge cache strategy
 
@@ -278,6 +280,7 @@ Urls of attachments pass to script as arguments.
 * `script_path`: path to external script.
 
 Example:
+
 ```elixir
 config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Script,
   script_path: "./installation/nginx-cache-purge.example"
@@ -445,36 +448,32 @@ For each pool, the options are:
 
 *For `gun` adapter*
 
-Advanced settings for connections pool. Pool with opened connections. These connections can be reused in worker pools.
+Settings for HTTP connection pool.
 
-For big instances it's recommended to increase `config :pleroma, :connections_pool, max_connections: 500` up to 500-1000.
+* `:connection_acquisition_wait` - Timeout to acquire a connection from pool.The total max time is this value multiplied by the number of retries.
-It will increase memory usage, but federation would work faster.
+* `connection_acquisition_retries` - Number of attempts to acquire the connection from the pool if it is overloaded. Each attempt is timed `:connection_acquisition_wait` apart.
-
+* `:max_connections` - Maximum number of connections in the pool.
-* `:checkin_timeout` - timeout to checkin connection from pool. Default: 250ms.
+* `:await_up_timeout` - Timeout to connect to the host.
-* `:max_connections` - maximum number of connections in the pool. Default: 250 connections.
+* `:reclaim_multiplier` - Multiplied by `:max_connections` this will be the maximum number of idle connections that will be reclaimed in case the pool is overloaded.
-* `:retry` - number of retries, while `gun` will try to reconnect if connection goes down. Default: 1.
-* `:retry_timeout` - time between retries when `gun` will try to reconnect in milliseconds. Default: 1000ms.
-* `:await_up_timeout` - timeout while `gun` will wait until connection is up. Default: 5000ms.
 
 ### :pools
 
 *For `gun` adapter*
 
-Advanced settings for workers pools.
+Settings for request pools. These pools are limited on top of `:connections_pool`.
 
 There are four pools used:
 
-* `:federation` for the federation jobs.
+* `:federation` for the federation jobs. You may want this pool's max_connections to be at least equal to the number of federator jobs + retry queue jobs.
-  You may want this pool max_connections to be at least equal to the number of federator jobs + retry queue jobs.
+* `:media` - for rich media, media proxy.
-* `:media` for rich media, media proxy
+* `:upload` - for proxying media when a remote uploader is used and `proxy_remote: true`.
-* `:upload` for uploaded media (if using a remote uploader and `proxy_remote: true`)
+* `:default` - for other requests.
-* `:default` for other requests
 
 For each pool, the options are:
 
-* `:size` - how much workers the pool can hold
+* `:size` - limit to how much requests can be concurrently executed.
 * `:timeout` - timeout while `gun` will wait for response
-* `:max_overflow` - additional workers if pool is under load
+* `:max_waiting` - limit to how much requests can be waiting for others to finish, after this is reached, subsequent requests will be dropped.
 
 ## Captcha
 
@@ -629,8 +628,7 @@ Email notifications settings.
 Configuration options described in [Oban readme](https://github.com/sorentwo/oban#usage):
 
 * `repo` - app's Ecto repo (`Pleroma.Repo`)
-* `verbose` - logs verbosity
+* `log` - logs verbosity
-* `prune` - non-retryable jobs [pruning settings](https://github.com/sorentwo/oban#pruning) (`:disabled` / `{:maxlen, value}` / `{:maxage, value}`)
 * `queues` - job queues (see below)
 * `crontab` - periodic jobs, see [`Oban.Cron`](#obancron)
 
@@ -815,6 +813,8 @@ or
 curl -H "X-Admin-Token: somerandomtoken" "http://localhost:4000/api/pleroma/admin/users/invites"
 ```
 
+Warning: it's discouraged to use this feature because of the associated security risk: static / rarely changed instance-wide token is much weaker compared to email-password pair of a real admin user; consider using HTTP Basic Auth or OAuth-based authentication instead.
+
 ### :auth
 
 * `Pleroma.Web.Auth.PleromaAuthenticator`: default database authenticator.

lib/mix/tasks/pleroma/notification_settings.ex

@@ -3,8 +3,8 @@ defmodule Mix.Tasks.Pleroma.NotificationSettings do
   @moduledoc """
   Example:
 
-  > mix pleroma.notification_settings --privacy-option=false --nickname-users="parallel588"  # set false only for parallel588 user
+  > mix pleroma.notification_settings --hide-notification-contents=false --nickname-users="parallel588"  # set false only for parallel588 user
-  > mix pleroma.notification_settings --privacy-option=true # set true for all users
+  > mix pleroma.notification_settings --hide-notification-contents=true # set true for all users
 
   """
 
@@ -19,16 +19,16 @@ def run(args) do
       OptionParser.parse(
         args,
         strict: [
-          privacy_option: :boolean,
+          hide_notification_contents: :boolean,
           email_users: :string,
           nickname_users: :string
         ]
       )
 
-    privacy_option = Keyword.get(options, :privacy_option)
+    hide_notification_contents = Keyword.get(options, :hide_notification_contents)
 
-    if not is_nil(privacy_option) do
+    if not is_nil(hide_notification_contents) do
-      privacy_option
+      hide_notification_contents
       |> build_query(options)
       |> Pleroma.Repo.update_all([])
     end
@@ -36,15 +36,15 @@ def run(args) do
     shell_info("Done")
   end
 
-  defp build_query(privacy_option, options) do
+  defp build_query(hide_notification_contents, options) do
     query =
       from(u in Pleroma.User,
         update: [
           set: [
             notification_settings:
               fragment(
-                "jsonb_set(notification_settings, '{privacy_option}', ?)",
+                "jsonb_set(notification_settings, '{hide_notification_contents}', ?)",
-                ^privacy_option
+                ^hide_notification_contents
               )
           ]
         ]

lib/pleroma/application.ex

@@ -35,6 +35,11 @@ def user_agent do
   # See http://elixir-lang.org/docs/stable/elixir/Application.html
   # for more information on OTP Applications
   def start(_type, _args) do
+    # Scrubbers are compiled at runtime and therefore will cause a conflict
+    # every time the application is restarted, so we disable module
+    # conflicts at runtime
+    Code.compiler_options(ignore_module_conflict: true)
+    Pleroma.Telemetry.Logger.attach()
     Config.Holder.save_default()
     Pleroma.HTML.compile_scrubbers()
     Config.DeprecationWarnings.warn()
@@ -219,9 +224,7 @@ defp task_children(_) do
 
   # start hackney and gun pools in tests
   defp http_children(_, :test) do
-    hackney_options = Config.get([:hackney_pools, :federation])
+    http_children(Tesla.Adapter.Hackney, nil) ++ http_children(Tesla.Adapter.Gun, nil)
-    hackney_pool = :hackney_pool.child_spec(:federation, hackney_options)
-    [hackney_pool, Pleroma.Pool.Supervisor]
   end
 
   defp http_children(Tesla.Adapter.Hackney, _) do
@@ -240,7 +243,10 @@ defp http_children(Tesla.Adapter.Hackney, _) do
     end
   end
 
-  defp http_children(Tesla.Adapter.Gun, _), do: [Pleroma.Pool.Supervisor]
+  defp http_children(Tesla.Adapter.Gun, _) do
+    Pleroma.Gun.ConnectionPool.children() ++
+      [{Task, &Pleroma.HTTP.AdapterHelper.Gun.limiter_setup/0}]
+  end
 
   defp http_children(_, _), do: []
 end

lib/pleroma/config/deprecation_warnings.ex

@@ -54,6 +54,7 @@ def warn do
     check_hellthread_threshold()
     mrf_user_allowlist()
     check_old_mrf_config()
+    check_media_proxy_whitelist_config()
   end
 
   def check_old_mrf_config do
@@ -65,7 +66,7 @@ def check_old_mrf_config do
     move_namespace_and_warn(@mrf_config_map, warning_preface)
   end
 
-  @spec move_namespace_and_warn([config_map()], String.t()) :: :ok
+  @spec move_namespace_and_warn([config_map()], String.t()) :: :ok | nil
   def move_namespace_and_warn(config_map, warning_preface) do
     warning =
       Enum.reduce(config_map, "", fn
@@ -84,4 +85,16 @@ def move_namespace_and_warn(config_map, warning_preface) do
       Logger.warn(warning_preface <> warning)
     end
   end
+
+  @spec check_media_proxy_whitelist_config() :: :ok | nil
+  def check_media_proxy_whitelist_config do
+    whitelist = Config.get([:media_proxy, :whitelist])
+
+    if Enum.any?(whitelist, &(not String.starts_with?(&1, "http"))) do
+      Logger.warn("""
+      !!!DEPRECATION WARNING!!!
+      Your config is using old format (only domain) for MediaProxy whitelist option. Setting should work for now, but you are advised to change format to scheme with port to prevent possible issues later.
+      """)
+    end
+  end
 end

lib/pleroma/gun/api.ex

@@ -19,7 +19,8 @@ defmodule Pleroma.Gun.API do
     :tls_opts,
     :tcp_opts,
     :socks_opts,
-    :ws_opts
+    :ws_opts,
+    :supervise
   ]
 
   @impl Gun

lib/pleroma/gun/conn.ex

@@ -3,85 +3,33 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 
 defmodule Pleroma.Gun.Conn do
-  @moduledoc """
-  Struct for gun connection data
-  """
   alias Pleroma.Gun
-  alias Pleroma.Pool.Connections
 
   require Logger
 
-  @type gun_state :: :up | :down
+  def open(%URI{} = uri, opts) do
-  @type conn_state :: :active | :idle
-
-  @type t :: %__MODULE__{
-          conn: pid(),
-          gun_state: gun_state(),
-          conn_state: conn_state(),
-          used_by: [pid()],
-          last_reference: pos_integer(),
-          crf: float(),
-          retries: pos_integer()
-        }
-
-  defstruct conn: nil,
-            gun_state: :open,
-            conn_state: :init,
-            used_by: [],
-            last_reference: 0,
-            crf: 1,
-            retries: 0
-
-  @spec open(String.t() | URI.t(), atom(), keyword()) :: :ok | nil
-  def open(url, name, opts \\ [])
-  def open(url, name, opts) when is_binary(url), do: open(URI.parse(url), name, opts)
-
-  def open(%URI{} = uri, name, opts) do
     pool_opts = Pleroma.Config.get([:connections_pool], [])
 
     opts =
       opts
       |> Enum.into(%{})
-      |> Map.put_new(:retry, pool_opts[:retry] || 1)
-      |> Map.put_new(:retry_timeout, pool_opts[:retry_timeout] || 1000)
       |> Map.put_new(:await_up_timeout, pool_opts[:await_up_timeout] || 5_000)
+      |> Map.put_new(:supervise, false)
       |> maybe_add_tls_opts(uri)
 
-    key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
+    do_open(uri, opts)
-
-    max_connections = pool_opts[:max_connections] || 250
-
-    conn_pid =
-      if Connections.count(name) < max_connections do
-        do_open(uri, opts)
-      else
-        close_least_used_and_do_open(name, uri, opts)
-      end
-
-    if is_pid(conn_pid) do
-      conn = %Pleroma.Gun.Conn{
-        conn: conn_pid,
-        gun_state: :up,
-        conn_state: :active,
-        last_reference: :os.system_time(:second)
-      }
-
-      :ok = Gun.set_owner(conn_pid, Process.whereis(name))
-      Connections.add_conn(name, key, conn)
-    end
   end
 
   defp maybe_add_tls_opts(opts, %URI{scheme: "http"}), do: opts
 
-  defp maybe_add_tls_opts(opts, %URI{scheme: "https", host: host}) do
+  defp maybe_add_tls_opts(opts, %URI{scheme: "https"}) do
     tls_opts = [
       verify: :verify_peer,
       cacertfile: CAStore.file_path(),
       depth: 20,
       reuse_sessions: false,
-      verify_fun:
+      log_level: :warning,
-        {&:ssl_verify_hostname.verify_fun/3,
+      customize_hostname_check: [match_fun: :public_key.pkix_verify_hostname_match_fun(:https)]
-         [check_hostname: Pleroma.HTTP.Connection.format_host(host)]}
     ]
 
     tls_opts =
@@ -105,7 +53,7 @@ defp do_open(uri, %{proxy: {proxy_host, proxy_port}} = opts) do
          {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]),
          stream <- Gun.connect(conn, connect_opts),
          {:response, :fin, 200, _} <- Gun.await(conn, stream) do
-      conn
+      {:ok, conn}
     else
       error ->
         Logger.warn(
@@ -141,7 +89,7 @@ defp do_open(uri, %{proxy: {proxy_type, proxy_host, proxy_port}} = opts) do
 
     with {:ok, conn} <- Gun.open(proxy_host, proxy_port, opts),
          {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do
-      conn
+      {:ok, conn}
     else
       error ->
         Logger.warn(
@@ -155,11 +103,11 @@ defp do_open(uri, %{proxy: {proxy_type, proxy_host, proxy_port}} = opts) do
   end
 
   defp do_open(%URI{host: host, port: port} = uri, opts) do
-    host = Pleroma.HTTP.Connection.parse_host(host)
+    host = Pleroma.HTTP.AdapterHelper.parse_host(host)
 
     with {:ok, conn} <- Gun.open(host, port, opts),
          {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do
-      conn
+      {:ok, conn}
     else
       error ->
         Logger.warn(
@@ -171,7 +119,7 @@ defp do_open(%URI{host: host, port: port} = uri, opts) do
   end
 
   defp destination_opts(%URI{host: host, port: port}) do
-    host = Pleroma.HTTP.Connection.parse_host(host)
+    host = Pleroma.HTTP.AdapterHelper.parse_host(host)
     %{host: host, port: port}
   end
 
@@ -181,17 +129,6 @@ defp add_http2_opts(opts, "https", tls_opts) do
 
   defp add_http2_opts(opts, _, _), do: opts
 
-  defp close_least_used_and_do_open(name, uri, opts) do
-    with [{key, conn} | _conns] <- Connections.get_unused_conns(name),
-         :ok <- Gun.close(conn.conn) do
-      Connections.remove_conn(name, key)
-
-      do_open(uri, opts)
-    else
-      [] -> {:error, :pool_overflowed}
-    end
-  end
-
   def compose_uri_log(%URI{scheme: scheme, host: host, path: path}) do
     "#{scheme}://#{host}#{path}"
   end

lib/pleroma/gun/connection_pool.ex

@@ -0,0 +1,79 @@
+defmodule Pleroma.Gun.ConnectionPool do
+  @registry __MODULE__
+
+  alias Pleroma.Gun.ConnectionPool.WorkerSupervisor
+
+  def children do
+    [
+      {Registry, keys: :unique, name: @registry},
+      Pleroma.Gun.ConnectionPool.WorkerSupervisor
+    ]
+  end
+
+  def get_conn(uri, opts) do
+    key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
+
+    case Registry.lookup(@registry, key) do
+      # The key has already been registered, but connection is not up yet
+      [{worker_pid, nil}] ->
+        get_gun_pid_from_worker(worker_pid, true)
+
+      [{worker_pid, {gun_pid, _used_by, _crf, _last_reference}}] ->
+        GenServer.cast(worker_pid, {:add_client, self(), false})
+        {:ok, gun_pid}
+
+      [] ->
+        # :gun.set_owner fails in :connected state for whatevever reason,
+        # so we open the connection in the process directly and send it's pid back
+        # We trust gun to handle timeouts by itself
+        case WorkerSupervisor.start_worker([key, uri, opts, self()]) do
+          {:ok, worker_pid} ->
+            get_gun_pid_from_worker(worker_pid, false)
+
+          {:error, {:already_started, worker_pid}} ->
+            get_gun_pid_from_worker(worker_pid, true)
+
+          err ->
+            err
+        end
+    end
+  end
+
+  defp get_gun_pid_from_worker(worker_pid, register) do
+    # GenServer.call will block the process for timeout length if
+    # the server crashes on startup (which will happen if gun fails to connect)
+    # so instead we use cast + monitor
+
+    ref = Process.monitor(worker_pid)
+    if register, do: GenServer.cast(worker_pid, {:add_client, self(), true})
+
+    receive do
+      {:conn_pid, pid} ->
+        Process.demonitor(ref)
+        {:ok, pid}
+
+      {:DOWN, ^ref, :process, ^worker_pid, reason} ->
+        case reason do
+          {:shutdown, error} -> error
+          _ -> {:error, reason}
+        end
+    end
+  end
+
+  def release_conn(conn_pid) do
+    # :ets.fun2ms(fn {_, {worker_pid, {gun_pid, _, _, _}}} when gun_pid == conn_pid ->
+    #    worker_pid end)
+    query_result =
+      Registry.select(@registry, [
+        {{:_, :"$1", {:"$2", :_, :_, :_}}, [{:==, :"$2", conn_pid}], [:"$1"]}
+      ])
+
+    case query_result do
+      [worker_pid] ->
+        GenServer.cast(worker_pid, {:remove_client, self()})
+
+      [] ->
+        :ok
+    end
+  end
+end

lib/pleroma/gun/connection_pool/reclaimer.ex

@@ -0,0 +1,85 @@
+defmodule Pleroma.Gun.ConnectionPool.Reclaimer do
+  use GenServer, restart: :temporary
+
+  @registry Pleroma.Gun.ConnectionPool
+
+  def start_monitor do
+    pid =
+      case :gen_server.start(__MODULE__, [], name: {:via, Registry, {@registry, "reclaimer"}}) do
+        {:ok, pid} ->
+          pid
+
+        {:error, {:already_registered, pid}} ->
+          pid
+      end
+
+    {pid, Process.monitor(pid)}
+  end
+
+  @impl true
+  def init(_) do
+    {:ok, nil, {:continue, :reclaim}}
+  end
+
+  @impl true
+  def handle_continue(:reclaim, _) do
+    max_connections = Pleroma.Config.get([:connections_pool, :max_connections])
+
+    reclaim_max =
+      [:connections_pool, :reclaim_multiplier]
+      |> Pleroma.Config.get()
+      |> Kernel.*(max_connections)
+      |> round
+      |> max(1)
+
+    :telemetry.execute([:pleroma, :connection_pool, :reclaim, :start], %{}, %{
+      max_connections: max_connections,
+      reclaim_max: reclaim_max
+    })
+
+    # :ets.fun2ms(
+    # fn {_, {worker_pid, {_, used_by, crf, last_reference}}} when used_by == [] ->
+    #   {worker_pid, crf, last_reference} end)
+    unused_conns =
+      Registry.select(
+        @registry,
+        [
+          {{:_, :"$1", {:_, :"$2", :"$3", :"$4"}}, [{:==, :"$2", []}], [{{:"$1", :"$3", :"$4"}}]}
+        ]
+      )
+
+    case unused_conns do
+      [] ->
+        :telemetry.execute(
+          [:pleroma, :connection_pool, :reclaim, :stop],
+          %{reclaimed_count: 0},
+          %{
+            max_connections: max_connections
+          }
+        )
+
+        {:stop, :no_unused_conns, nil}
+
+      unused_conns ->
+        reclaimed =
+          unused_conns
+          |> Enum.sort(fn {_pid1, crf1, last_reference1}, {_pid2, crf2, last_reference2} ->
+            crf1 <= crf2 and last_reference1 <= last_reference2
+          end)
+          |> Enum.take(reclaim_max)
+
+        reclaimed
+        |> Enum.each(fn {pid, _, _} ->
+          DynamicSupervisor.terminate_child(Pleroma.Gun.ConnectionPool.WorkerSupervisor, pid)
+        end)
+
+        :telemetry.execute(
+          [:pleroma, :connection_pool, :reclaim, :stop],
+          %{reclaimed_count: Enum.count(reclaimed)},
+          %{max_connections: max_connections}
+        )
+
+        {:stop, :normal, nil}
+    end
+  end
+end

lib/pleroma/gun/connection_pool/worker.ex

@@ -0,0 +1,127 @@
+defmodule Pleroma.Gun.ConnectionPool.Worker do
+  alias Pleroma.Gun
+  use GenServer, restart: :temporary
+
+  @registry Pleroma.Gun.ConnectionPool
+
+  def start_link([key | _] = opts) do
+    GenServer.start_link(__MODULE__, opts, name: {:via, Registry, {@registry, key}})
+  end
+
+  @impl true
+  def init([_key, _uri, _opts, _client_pid] = opts) do
+    {:ok, nil, {:continue, {:connect, opts}}}
+  end
+
+  @impl true
+  def handle_continue({:connect, [key, uri, opts, client_pid]}, _) do
+    with {:ok, conn_pid} <- Gun.Conn.open(uri, opts),
+         Process.link(conn_pid) do
+      time = :erlang.monotonic_time(:millisecond)
+
+      {_, _} =
+        Registry.update_value(@registry, key, fn _ ->
+          {conn_pid, [client_pid], 1, time}
+        end)
+
+      send(client_pid, {:conn_pid, conn_pid})
+
+      {:noreply,
+       %{key: key, timer: nil, client_monitors: %{client_pid => Process.monitor(client_pid)}},
+       :hibernate}
+    else
+      err ->
+        {:stop, {:shutdown, err}, nil}
+    end
+  end
+
+  @impl true
+  def handle_cast({:add_client, client_pid, send_pid_back}, %{key: key} = state) do
+    time = :erlang.monotonic_time(:millisecond)
+
+    {{conn_pid, _, _, _}, _} =
+      Registry.update_value(@registry, key, fn {conn_pid, used_by, crf, last_reference} ->
+        {conn_pid, [client_pid | used_by], crf(time - last_reference, crf), time}
+      end)
+
+    if send_pid_back, do: send(client_pid, {:conn_pid, conn_pid})
+
+    state =
+      if state.timer != nil do
+        Process.cancel_timer(state[:timer])
+        %{state | timer: nil}
+      else
+        state
+      end
+
+    ref = Process.monitor(client_pid)
+
+    state = put_in(state.client_monitors[client_pid], ref)
+    {:noreply, state, :hibernate}
+  end
+
+  @impl true
+  def handle_cast({:remove_client, client_pid}, %{key: key} = state) do
+    {{_conn_pid, used_by, _crf, _last_reference}, _} =
+      Registry.update_value(@registry, key, fn {conn_pid, used_by, crf, last_reference} ->
+        {conn_pid, List.delete(used_by, client_pid), crf, last_reference}
+      end)
+
+    {ref, state} = pop_in(state.client_monitors[client_pid])
+    Process.demonitor(ref)
+
+    timer =
+      if used_by == [] do
+        max_idle = Pleroma.Config.get([:connections_pool, :max_idle_time], 30_000)
+        Process.send_after(self(), :idle_close, max_idle)
+      else
+        nil
+      end
+
+    {:noreply, %{state | timer: timer}, :hibernate}
+  end
+
+  @impl true
+  def handle_info(:idle_close, state) do
+    # Gun monitors the owner process, and will close the connection automatically
+    # when it's terminated
+    {:stop, :normal, state}
+  end
+
+  # Gracefully shutdown if the connection got closed without any streams left
+  @impl true
+  def handle_info({:gun_down, _pid, _protocol, _reason, []}, state) do
+    {:stop, :normal, state}
+  end
+
+  # Otherwise, shutdown with an error
+  @impl true
+  def handle_info({:gun_down, _pid, _protocol, _reason, _killed_streams} = down_message, state) do
+    {:stop, {:error, down_message}, state}
+  end
+
+  @impl true
+  def handle_info({:DOWN, _ref, :process, pid, reason}, state) do
+    # Sometimes the client is dead before we demonitor it in :remove_client, so the message
+    # arrives anyway
+
+    case state.client_monitors[pid] do
+      nil ->
+        {:noreply, state, :hibernate}
+
+      _ref ->
+        :telemetry.execute(
+          [:pleroma, :connection_pool, :client_death],
+          %{client_pid: pid, reason: reason},
+          %{key: state.key}
+        )
+
+        handle_cast({:remove_client, pid}, state)
+    end
+  end
+
+  # LRFU policy: https://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.55.1478
+  defp crf(time_delta, prev_crf) do
+    1 + :math.pow(0.5, 0.0001 * time_delta) * prev_crf
+  end
+end

lib/pleroma/gun/connection_pool/worker_supervisor.ex

@@ -0,0 +1,45 @@
+defmodule Pleroma.Gun.ConnectionPool.WorkerSupervisor do
+  @moduledoc "Supervisor for pool workers. Does not do anything except enforce max connection limit"
+
+  use DynamicSupervisor
+
+  def start_link(opts) do
+    DynamicSupervisor.start_link(__MODULE__, opts, name: __MODULE__)
+  end
+
+  def init(_opts) do
+    DynamicSupervisor.init(
+      strategy: :one_for_one,
+      max_children: Pleroma.Config.get([:connections_pool, :max_connections])
+    )
+  end
+
+  def start_worker(opts, retry \\ false) do
+    case DynamicSupervisor.start_child(__MODULE__, {Pleroma.Gun.ConnectionPool.Worker, opts}) do
+      {:error, :max_children} ->
+        if retry or free_pool() == :error do
+          :telemetry.execute([:pleroma, :connection_pool, :provision_failure], %{opts: opts})
+          {:error, :pool_full}
+        else
+          start_worker(opts, true)
+        end
+
+      res ->
+        res
+    end
+  end
+
+  defp free_pool do
+    wait_for_reclaimer_finish(Pleroma.Gun.ConnectionPool.Reclaimer.start_monitor())
+  end
+
+  defp wait_for_reclaimer_finish({pid, mon}) do
+    receive do
+      {:DOWN, ^mon, :process, ^pid, :no_unused_conns} ->
+        :error
+
+      {:DOWN, ^mon, :process, ^pid, :normal} ->
+        :ok
+    end
+  end
+end

lib/pleroma/http/adapter_helper.ex

@@ -3,32 +3,30 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 
 defmodule Pleroma.HTTP.AdapterHelper do
-  alias Pleroma.HTTP.Connection
+  @moduledoc """
+  Configure Tesla.Client with default and customized adapter options.
+  """
+  @defaults [pool: :federation]
+
+  @type proxy_type() :: :socks4 | :socks5
+  @type host() :: charlist() | :inet.ip_address()
+
+  alias Pleroma.Config
+  alias Pleroma.HTTP.AdapterHelper
+  require Logger
 
   @type proxy ::
           {Connection.host(), pos_integer()}
           | {Connection.proxy_type(), Connection.host(), pos_integer()}
 
   @callback options(keyword(), URI.t()) :: keyword()
-  @callback after_request(keyword()) :: :ok
+  @callback get_conn(URI.t(), keyword()) :: {:ok, term()} | {:error, term()}
-
-  @spec options(keyword(), URI.t()) :: keyword()
-  def options(opts, _uri) do
-    proxy = Pleroma.Config.get([:http, :proxy_url], nil)
-    maybe_add_proxy(opts, format_proxy(proxy))
-  end
-
-  @spec maybe_get_conn(URI.t(), keyword()) :: keyword()
-  def maybe_get_conn(_uri, opts), do: opts
-
-  @spec after_request(keyword()) :: :ok
-  def after_request(_opts), do: :ok
 
   @spec format_proxy(String.t() | tuple() | nil) :: proxy() | nil
   def format_proxy(nil), do: nil
 
   def format_proxy(proxy_url) do
-    case Connection.parse_proxy(proxy_url) do
+    case parse_proxy(proxy_url) do
       {:ok, host, port} -> {host, port}
       {:ok, type, host, port} -> {type, host, port}
       _ -> nil
@@ -38,4 +36,105 @@ def format_proxy(proxy_url) do
   @spec maybe_add_proxy(keyword(), proxy() | nil) :: keyword()
   def maybe_add_proxy(opts, nil), do: opts
   def maybe_add_proxy(opts, proxy), do: Keyword.put_new(opts, :proxy, proxy)
+
+  @doc """
+  Merge default connection & adapter options with received ones.
+  """
+
+  @spec options(URI.t(), keyword()) :: keyword()
+  def options(%URI{} = uri, opts \\ []) do
+    @defaults
+    |> put_timeout()
+    |> Keyword.merge(opts)
+    |> adapter_helper().options(uri)
+  end
+
+  # For Hackney, this is the time a connection can stay idle in the pool.
+  # For Gun, this is the timeout to receive a message from Gun.
+  defp put_timeout(opts) do
+    {config_key, default} =
+      if adapter() == Tesla.Adapter.Gun do
+        {:pools, Config.get([:pools, :default, :timeout], 5_000)}
+      else
+        {:hackney_pools, 10_000}
+      end
+
+    timeout = Config.get([config_key, opts[:pool], :timeout], default)
+
+    Keyword.merge(opts, timeout: timeout)
+  end
+
+  def get_conn(uri, opts), do: adapter_helper().get_conn(uri, opts)
+  defp adapter, do: Application.get_env(:tesla, :adapter)
+
+  defp adapter_helper do
+    case adapter() do
+      Tesla.Adapter.Gun -> AdapterHelper.Gun
+      Tesla.Adapter.Hackney -> AdapterHelper.Hackney
+      _ -> AdapterHelper.Default
+    end
+  end
+
+  @spec parse_proxy(String.t() | tuple() | nil) ::
+          {:ok, host(), pos_integer()}
+          | {:ok, proxy_type(), host(), pos_integer()}
+          | {:error, atom()}
+          | nil
+
+  def parse_proxy(nil), do: nil
+
+  def parse_proxy(proxy) when is_binary(proxy) do
+    with [host, port] <- String.split(proxy, ":"),
+         {port, ""} <- Integer.parse(port) do
+      {:ok, parse_host(host), port}
+    else
+      {_, _} ->
+        Logger.warn("Parsing port failed #{inspect(proxy)}")
+        {:error, :invalid_proxy_port}
+
+      :error ->
+        Logger.warn("Parsing port failed #{inspect(proxy)}")
+        {:error, :invalid_proxy_port}
+
+      _ ->
+        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
+        {:error, :invalid_proxy}
+    end
+  end
+
+  def parse_proxy(proxy) when is_tuple(proxy) do
+    with {type, host, port} <- proxy do
+      {:ok, type, parse_host(host), port}
+    else
+      _ ->
+        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
+        {:error, :invalid_proxy}
+    end
+  end
+
+  @spec parse_host(String.t() | atom() | charlist()) :: charlist() | :inet.ip_address()
+  def parse_host(host) when is_list(host), do: host
+  def parse_host(host) when is_atom(host), do: to_charlist(host)
+
+  def parse_host(host) when is_binary(host) do
+    host = to_charlist(host)
+
+    case :inet.parse_address(host) do
+      {:error, :einval} -> host
+      {:ok, ip} -> ip
+    end
+  end
+
+  @spec format_host(String.t()) :: charlist()
+  def format_host(host) do
+    host_charlist = to_charlist(host)
+
+    case :inet.parse_address(host_charlist) do
+      {:error, :einval} ->
+        :idna.encode(host_charlist)
+
+      {:ok, _ip} ->
+        host_charlist
+    end
+  end
 end

lib/pleroma/http/adapter_helper/default.ex

@@ -0,0 +1,14 @@
+defmodule Pleroma.HTTP.AdapterHelper.Default do
+  alias Pleroma.HTTP.AdapterHelper
+
+  @behaviour Pleroma.HTTP.AdapterHelper
+
+  @spec options(keyword(), URI.t()) :: keyword()
+  def options(opts, _uri) do
+    proxy = Pleroma.Config.get([:http, :proxy_url], nil)
+    AdapterHelper.maybe_add_proxy(opts, AdapterHelper.format_proxy(proxy))
+  end
+
+  @spec get_conn(URI.t(), keyword()) :: {:ok, keyword()}
+  def get_conn(_uri, opts), do: {:ok, opts}
+end

lib/pleroma/http/adapter_helper/gun.ex

@@ -5,8 +5,8 @@
 defmodule Pleroma.HTTP.AdapterHelper.Gun do
   @behaviour Pleroma.HTTP.AdapterHelper
 
+  alias Pleroma.Gun.ConnectionPool
   alias Pleroma.HTTP.AdapterHelper
-  alias Pleroma.Pool.Connections
 
   require Logger
 
@@ -14,7 +14,7 @@ defmodule Pleroma.HTTP.AdapterHelper.Gun do
     connect_timeout: 5_000,
     domain_lookup_timeout: 5_000,
     tls_handshake_timeout: 5_000,
-    retry: 1,
+    retry: 0,
     retry_timeout: 1000,
     await_up_timeout: 5_000
   ]
@@ -31,16 +31,7 @@ def options(incoming_opts \\ [], %URI{} = uri) do
     |> Keyword.merge(config_opts)
     |> add_scheme_opts(uri)
     |> AdapterHelper.maybe_add_proxy(proxy)
-    |> maybe_get_conn(uri, incoming_opts)
+    |> Keyword.merge(incoming_opts)
-  end
-
-  @spec after_request(keyword()) :: :ok
-  def after_request(opts) do
-    if opts[:conn] && opts[:body_as] != :chunks do
-      Connections.checkout(opts[:conn], self(), :gun_connections)
-    end
-
-    :ok
   end
 
   defp add_scheme_opts(opts, %{scheme: "http"}), do: opts
@@ -48,30 +39,40 @@ defp add_scheme_opts(opts, %{scheme: "http"}), do: opts
   defp add_scheme_opts(opts, %{scheme: "https"}) do
     opts
     |> Keyword.put(:certificates_verification, true)
-    |> Keyword.put(:tls_opts, log_level: :warning)
   end
 
-  defp maybe_get_conn(adapter_opts, uri, incoming_opts) do
+  @spec get_conn(URI.t(), keyword()) :: {:ok, keyword()} | {:error, atom()}
-    {receive_conn?, opts} =
+  def get_conn(uri, opts) do
-      adapter_opts
+    case ConnectionPool.get_conn(uri, opts) do
-      |> Keyword.merge(incoming_opts)
+      {:ok, conn_pid} -> {:ok, Keyword.merge(opts, conn: conn_pid, close_conn: false)}
-      |> Keyword.pop(:receive_conn, true)
+      err -> err
-
-    if Connections.alive?(:gun_connections) and receive_conn? do
-      checkin_conn(uri, opts)
-    else
-      opts
     end
   end
 
-  defp checkin_conn(uri, opts) do
+  @prefix Pleroma.Gun.ConnectionPool
-    case Connections.checkin(uri, :gun_connections) do
+  def limiter_setup do
-      nil ->
+    wait = Pleroma.Config.get([:connections_pool, :connection_acquisition_wait])
-        Task.start(Pleroma.Gun.Conn, :open, [uri, :gun_connections, opts])
+    retries = Pleroma.Config.get([:connections_pool, :connection_acquisition_retries])
-        opts
 
-      conn when is_pid(conn) ->
+    :pools
-        Keyword.merge(opts, conn: conn, close_conn: false)
+    |> Pleroma.Config.get([])
-    end
+    |> Enum.each(fn {name, opts} ->
+      max_running = Keyword.get(opts, :size, 50)
+      max_waiting = Keyword.get(opts, :max_waiting, 10)
+
+      result =
+        ConcurrentLimiter.new(:"#{@prefix}.#{name}", max_running, max_waiting,
+          wait: wait,
+          max_retries: retries
+        )
+
+      case result do
+        :ok -> :ok
+        {:error, :existing} -> :ok
+        e -> raise e
+      end
+    end)
+
+    :ok
   end
 end

lib/pleroma/http/adapter_helper/hackney.ex

@@ -24,5 +24,6 @@ def options(connection_opts \\ [], %URI{} = uri) do
 
   defp add_scheme_opts(opts, _), do: opts
 
-  def after_request(_), do: :ok
+  @spec get_conn(URI.t(), keyword()) :: {:ok, keyword()}
+  def get_conn(_uri, opts), do: {:ok, opts}
 end

lib/pleroma/http/connection.ex

@@ -1,124 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.HTTP.Connection do
-  @moduledoc """
-  Configure Tesla.Client with default and customized adapter options.
-  """
-
-  alias Pleroma.Config
-  alias Pleroma.HTTP.AdapterHelper
-
-  require Logger
-
-  @defaults [pool: :federation]
-
-  @type ip_address :: ipv4_address() | ipv6_address()
-  @type ipv4_address :: {0..255, 0..255, 0..255, 0..255}
-  @type ipv6_address ::
-          {0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535}
-  @type proxy_type() :: :socks4 | :socks5
-  @type host() :: charlist() | ip_address()
-
-  @doc """
-  Merge default connection & adapter options with received ones.
-  """
-
-  @spec options(URI.t(), keyword()) :: keyword()
-  def options(%URI{} = uri, opts \\ []) do
-    @defaults
-    |> pool_timeout()
-    |> Keyword.merge(opts)
-    |> adapter_helper().options(uri)
-  end
-
-  defp pool_timeout(opts) do
-    {config_key, default} =
-      if adapter() == Tesla.Adapter.Gun do
-        {:pools, Config.get([:pools, :default, :timeout])}
-      else
-        {:hackney_pools, 10_000}
-      end
-
-    timeout = Config.get([config_key, opts[:pool], :timeout], default)
-
-    Keyword.merge(opts, timeout: timeout)
-  end
-
-  @spec after_request(keyword()) :: :ok
-  def after_request(opts), do: adapter_helper().after_request(opts)
-
-  defp adapter, do: Application.get_env(:tesla, :adapter)
-
-  defp adapter_helper do
-    case adapter() do
-      Tesla.Adapter.Gun -> AdapterHelper.Gun
-      Tesla.Adapter.Hackney -> AdapterHelper.Hackney
-      _ -> AdapterHelper
-    end
-  end
-
-  @spec parse_proxy(String.t() | tuple() | nil) ::
-          {:ok, host(), pos_integer()}
-          | {:ok, proxy_type(), host(), pos_integer()}
-          | {:error, atom()}
-          | nil
-
-  def parse_proxy(nil), do: nil
-
-  def parse_proxy(proxy) when is_binary(proxy) do
-    with [host, port] <- String.split(proxy, ":"),
-         {port, ""} <- Integer.parse(port) do
-      {:ok, parse_host(host), port}
-    else
-      {_, _} ->
-        Logger.warn("Parsing port failed #{inspect(proxy)}")
-        {:error, :invalid_proxy_port}
-
-      :error ->
-        Logger.warn("Parsing port failed #{inspect(proxy)}")
-        {:error, :invalid_proxy_port}
-
-      _ ->
-        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
-        {:error, :invalid_proxy}
-    end
-  end
-
-  def parse_proxy(proxy) when is_tuple(proxy) do
-    with {type, host, port} <- proxy do
-      {:ok, type, parse_host(host), port}
-    else
-      _ ->
-        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
-        {:error, :invalid_proxy}
-    end
-  end
-
-  @spec parse_host(String.t() | atom() | charlist()) :: charlist() | ip_address()
-  def parse_host(host) when is_list(host), do: host
-  def parse_host(host) when is_atom(host), do: to_charlist(host)
-
-  def parse_host(host) when is_binary(host) do
-    host = to_charlist(host)
-
-    case :inet.parse_address(host) do
-      {:error, :einval} -> host
-      {:ok, ip} -> ip
-    end
-  end
-
-  @spec format_host(String.t()) :: charlist()
-  def format_host(host) do
-    host_charlist = to_charlist(host)
-
-    case :inet.parse_address(host_charlist) do
-      {:error, :einval} ->
-        :idna.encode(host_charlist)
-
-      {:ok, _ip} ->
-        host_charlist
-    end
-  end
-end

lib/pleroma/http/http.ex

@@ -7,7 +7,7 @@ defmodule Pleroma.HTTP do
     Wrapper for `Tesla.request/2`.
   """
 
-  alias Pleroma.HTTP.Connection
+  alias Pleroma.HTTP.AdapterHelper
   alias Pleroma.HTTP.Request
   alias Pleroma.HTTP.RequestBuilder, as: Builder
   alias Tesla.Client
@@ -60,49 +60,29 @@ def post(url, body, headers \\ [], options \\ []),
           {:ok, Env.t()} | {:error, any()}
   def request(method, url, body, headers, options) when is_binary(url) do
     uri = URI.parse(url)
-    adapter_opts = Connection.options(uri, options[:adapter] || [])
+    adapter_opts = AdapterHelper.options(uri, options[:adapter] || [])
-    options = put_in(options[:adapter], adapter_opts)
-    params = options[:params] || []
-    request = build_request(method, headers, options, url, body, params)
 
-    adapter = Application.get_env(:tesla, :adapter)
+    case AdapterHelper.get_conn(uri, adapter_opts) do
-    client = Tesla.client([Tesla.Middleware.FollowRedirects], adapter)
+      {:ok, adapter_opts} ->
+        options = put_in(options[:adapter], adapter_opts)
+        params = options[:params] || []
+        request = build_request(method, headers, options, url, body, params)
 
-    pid = Process.whereis(adapter_opts[:pool])
+        adapter = Application.get_env(:tesla, :adapter)
+        client = Tesla.client([Pleroma.HTTP.Middleware.FollowRedirects], adapter)
 
-    pool_alive? =
+        maybe_limit(
-      if adapter == Tesla.Adapter.Gun && pid do
+          fn ->
-        Process.alive?(pid)
+            request(client, request)
-      else
+          end,
-        false
+          adapter,
-      end
+          adapter_opts
+        )
 
-    request_opts =
+      # Connection release is handled in a custom FollowRedirects middleware
-      adapter_opts
+      err ->
-      |> Enum.into(%{})
+        err
-      |> Map.put(:env, Pleroma.Config.get([:env]))
+    end
-      |> Map.put(:pool_alive?, pool_alive?)
-
-    response = request(client, request, request_opts)
-
-    Connection.after_request(adapter_opts)
-
-    response
-  end
-
-  @spec request(Client.t(), keyword(), map()) :: {:ok, Env.t()} | {:error, any()}
-  def request(%Client{} = client, request, %{env: :test}), do: request(client, request)
-
-  def request(%Client{} = client, request, %{body_as: :chunks}), do: request(client, request)
-
-  def request(%Client{} = client, request, %{pool_alive?: false}), do: request(client, request)
-
-  def request(%Client{} = client, request, %{pool: pool, timeout: timeout}) do
-    :poolboy.transaction(
-      pool,
-      &Pleroma.Pool.Request.execute(&1, client, request, timeout),
-      timeout
-    )
   end
 
   @spec request(Client.t(), keyword()) :: {:ok, Env.t()} | {:error, any()}
@@ -118,4 +98,13 @@ defp build_request(method, headers, options, url, body, params) do
     |> Builder.add_param(:query, :query, params)
     |> Builder.convert_to_keyword()
   end
+
+  @prefix Pleroma.Gun.ConnectionPool
+  defp maybe_limit(fun, Tesla.Adapter.Gun, opts) do
+    ConcurrentLimiter.limit(:"#{@prefix}.#{opts[:pool] || :default}", fun)
+  end
+
+  defp maybe_limit(fun, _, _) do
+    fun.()
+  end
 end

lib/pleroma/notification.ex

@@ -571,10 +571,7 @@ def skip?(%Activity{} = activity, %User{} = user) do
     [
       :self,
       :invisible,
-      :followers,
+      :block_from_strangers,
-      :follows,
-      :non_followers,
-      :non_follows,
       :recently_followed,
       :filtered
     ]
@@ -595,45 +592,15 @@ def skip?(:invisible, %Activity{} = activity, _) do
   end
 
   def skip?(
-        :followers,
+        :block_from_strangers,
         %Activity{} = activity,
-        %User{notification_settings: %{followers: false}} = user
+        %User{notification_settings: %{block_from_strangers: true}} = user
-      ) do
-    actor = activity.data["actor"]
-    follower = User.get_cached_by_ap_id(actor)
-    User.following?(follower, user)
-  end
-
-  def skip?(
-        :non_followers,
-        %Activity{} = activity,
-        %User{notification_settings: %{non_followers: false}} = user
       ) do
     actor = activity.data["actor"]
     follower = User.get_cached_by_ap_id(actor)
     !User.following?(follower, user)
   end
 
-  def skip?(
-        :follows,
-        %Activity{} = activity,
-        %User{notification_settings: %{follows: false}} = user
-      ) do
-    actor = activity.data["actor"]
-    followed = User.get_cached_by_ap_id(actor)
-    User.following?(user, followed)
-  end
-
-  def skip?(
-        :non_follows,
-        %Activity{} = activity,
-        %User{notification_settings: %{non_follows: false}} = user
-      ) do
-    actor = activity.data["actor"]
-    followed = User.get_cached_by_ap_id(actor)
-    !User.following?(user, followed)
-  end
-
   # To do: consider defining recency in hours and checking FollowingRelationship with a single SQL
   def skip?(:recently_followed, %Activity{data: %{"type" => "Follow"}} = activity, %User{} = user) do
     actor = activity.data["actor"]

lib/pleroma/plugs/admin_secret_authentication_plug.ex

@@ -4,6 +4,9 @@
 
 defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do
   import Plug.Conn
+
+  alias Pleroma.Plugs.OAuthScopesPlug
+  alias Pleroma.Plugs.RateLimiter
   alias Pleroma.User
 
   def init(options) do
@@ -11,7 +14,10 @@ def init(options) do
   end
 
   def secret_token do
-    Pleroma.Config.get(:admin_token)
+    case Pleroma.Config.get(:admin_token) do
+      blank when blank in [nil, ""] -> nil
+      token -> token
+    end
   end
 
   def call(%{assigns: %{user: %User{}}} = conn, _), do: conn
@@ -26,9 +32,9 @@ def call(conn, _) do
 
   def authenticate(%{params: %{"admin_token" => admin_token}} = conn) do
     if admin_token == secret_token() do
-      assign(conn, :user, %User{is_admin: true})
+      assign_admin_user(conn)
     else
-      conn
+      handle_bad_token(conn)
     end
   end
 
@@ -36,8 +42,19 @@ def authenticate(conn) do
     token = secret_token()
 
     case get_req_header(conn, "x-admin-token") do
-      [^token] -> assign(conn, :user, %User{is_admin: true})
+      blank when blank in [[], [""]] -> conn
-      _ -> conn
+      [^token] -> assign_admin_user(conn)
+      _ -> handle_bad_token(conn)
     end
   end
+
+  defp assign_admin_user(conn) do
+    conn
+    |> assign(:user, %User{is_admin: true})
+    |> OAuthScopesPlug.skip_plug()
+  end
+
+  defp handle_bad_token(conn) do
+    RateLimiter.call(conn, name: :authentication)
+  end
 end

lib/pleroma/plugs/http_security_plug.ex

@@ -108,31 +108,48 @@ defp csp_string do
     |> :erlang.iolist_to_binary()
   end
 
+  defp build_csp_from_whitelist([], acc), do: acc
+
+  defp build_csp_from_whitelist([last], acc) do
+    [build_csp_param_from_whitelist(last) | acc]
+  end
+
+  defp build_csp_from_whitelist([head | tail], acc) do
+    build_csp_from_whitelist(tail, [[?\s, build_csp_param_from_whitelist(head)] | acc])
+  end
+
+  # TODO: use `build_csp_param/1` after removing support bare domains for media proxy whitelist
+  defp build_csp_param_from_whitelist("http" <> _ = url) do
+    build_csp_param(url)
+  end
+
+  defp build_csp_param_from_whitelist(url), do: url
+
   defp build_csp_multimedia_source_list do
     media_proxy_whitelist =
-      Enum.reduce(Config.get([:media_proxy, :whitelist]), [], fn host, acc ->
+      [:media_proxy, :whitelist]
-        add_source(acc, host)
+      |> Config.get()
-      end)
+      |> build_csp_from_whitelist([])
-
-    media_proxy_base_url = build_csp_param(Config.get([:media_proxy, :base_url]))
-
-    upload_base_url = build_csp_param(Config.get([Pleroma.Upload, :base_url]))
-
-    s3_endpoint = build_csp_param(Config.get([Pleroma.Uploaders.S3, :public_endpoint]))
 
     captcha_method = Config.get([Pleroma.Captcha, :method])
+    captcha_endpoint = Config.get([captcha_method, :endpoint])
 
-    captcha_endpoint = build_csp_param(Config.get([captcha_method, :endpoint]))
+    base_endpoints =
+      [
+        [:media_proxy, :base_url],
+        [Pleroma.Upload, :base_url],
+        [Pleroma.Uploaders.S3, :public_endpoint]
+      ]
+      |> Enum.map(&Config.get/1)
 
-    []
+    [captcha_endpoint | base_endpoints]
-    |> add_source(media_proxy_base_url)
+    |> Enum.map(&build_csp_param/1)
-    |> add_source(upload_base_url)
+    |> Enum.reduce([], &add_source(&2, &1))
-    |> add_source(s3_endpoint)
     |> add_source(media_proxy_whitelist)
-    |> add_source(captcha_endpoint)
   end
 
   defp add_source(iodata, nil), do: iodata
+  defp add_source(iodata, []), do: iodata
   defp add_source(iodata, source), do: [[?\s, source] | iodata]
 
   defp add_csp_param(csp_iodata, nil), do: csp_iodata

lib/pleroma/plugs/user_is_admin_plug.ex

@@ -7,37 +7,18 @@ defmodule Pleroma.Plugs.UserIsAdminPlug do
   import Plug.Conn
 
   alias Pleroma.User
-  alias Pleroma.Web.OAuth
 
   def init(options) do
     options
   end
 
-  def call(%{assigns: %{user: %User{is_admin: true}} = assigns} = conn, _) do
+  def call(%{assigns: %{user: %User{is_admin: true}}} = conn, _) do
-    token = assigns[:token]
+    conn
-
-    cond do
-      not Pleroma.Config.enforce_oauth_admin_scope_usage?() ->
-        conn
-
-      token && OAuth.Scopes.contains_admin_scopes?(token.scopes) ->
-        # Note: checking for _any_ admin scope presence, not necessarily fitting requested action.
-        #   Thus, controller must explicitly invoke OAuthScopesPlug to verify scope requirements.
-        #   Admin might opt out of admin scope for some apps to block any admin actions from them.
-        conn
-
-      true ->
-        fail(conn)
-    end
   end
 
   def call(conn, _) do
-    fail(conn)
-  end
-
-  defp fail(conn) do
     conn
-    |> render_error(:forbidden, "User is not an admin or OAuth admin scope is not granted.")
+    |> render_error(:forbidden, "User is not an admin.")
     |> halt()
   end
 end

lib/pleroma/pool/connections.ex

@@ -1,283 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool.Connections do
-  use GenServer
-
-  alias Pleroma.Config
-  alias Pleroma.Gun
-
-  require Logger
-
-  @type domain :: String.t()
-  @type conn :: Pleroma.Gun.Conn.t()
-
-  @type t :: %__MODULE__{
-          conns: %{domain() => conn()},
-          opts: keyword()
-        }
-
-  defstruct conns: %{}, opts: []
-
-  @spec start_link({atom(), keyword()}) :: {:ok, pid()}
-  def start_link({name, opts}) do
-    GenServer.start_link(__MODULE__, opts, name: name)
-  end
-
-  @impl true
-  def init(opts), do: {:ok, %__MODULE__{conns: %{}, opts: opts}}
-
-  @spec checkin(String.t() | URI.t(), atom()) :: pid() | nil
-  def checkin(url, name)
-  def checkin(url, name) when is_binary(url), do: checkin(URI.parse(url), name)
-
-  def checkin(%URI{} = uri, name) do
-    timeout = Config.get([:connections_pool, :checkin_timeout], 250)
-
-    GenServer.call(name, {:checkin, uri}, timeout)
-  end
-
-  @spec alive?(atom()) :: boolean()
-  def alive?(name) do
-    if pid = Process.whereis(name) do
-      Process.alive?(pid)
-    else
-      false
-    end
-  end
-
-  @spec get_state(atom()) :: t()
-  def get_state(name) do
-    GenServer.call(name, :state)
-  end
-
-  @spec count(atom()) :: pos_integer()
-  def count(name) do
-    GenServer.call(name, :count)
-  end
-
-  @spec get_unused_conns(atom()) :: [{domain(), conn()}]
-  def get_unused_conns(name) do
-    GenServer.call(name, :unused_conns)
-  end
-
-  @spec checkout(pid(), pid(), atom()) :: :ok
-  def checkout(conn, pid, name) do
-    GenServer.cast(name, {:checkout, conn, pid})
-  end
-
-  @spec add_conn(atom(), String.t(), Pleroma.Gun.Conn.t()) :: :ok
-  def add_conn(name, key, conn) do
-    GenServer.cast(name, {:add_conn, key, conn})
-  end
-
-  @spec remove_conn(atom(), String.t()) :: :ok
-  def remove_conn(name, key) do
-    GenServer.cast(name, {:remove_conn, key})
-  end
-
-  @impl true
-  def handle_cast({:add_conn, key, conn}, state) do
-    state = put_in(state.conns[key], conn)
-
-    Process.monitor(conn.conn)
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_cast({:checkout, conn_pid, pid}, state) do
-    state =
-      with true <- Process.alive?(conn_pid),
-           {key, conn} <- find_conn(state.conns, conn_pid),
-           used_by <- List.keydelete(conn.used_by, pid, 0) do
-        conn_state = if used_by == [], do: :idle, else: conn.conn_state
-
-        put_in(state.conns[key], %{conn | conn_state: conn_state, used_by: used_by})
-      else
-        false ->
-          Logger.debug("checkout for closed conn #{inspect(conn_pid)}")
-          state
-
-        nil ->
-          Logger.debug("checkout for alive conn #{inspect(conn_pid)}, but is not in state")
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_cast({:remove_conn, key}, state) do
-    state = put_in(state.conns, Map.delete(state.conns, key))
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_call({:checkin, uri}, from, state) do
-    key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
-
-    case state.conns[key] do
-      %{conn: pid, gun_state: :up} = conn ->
-        time = :os.system_time(:second)
-        last_reference = time - conn.last_reference
-        crf = crf(last_reference, 100, conn.crf)
-
-        state =
-          put_in(state.conns[key], %{
-            conn
-            | last_reference: time,
-              crf: crf,
-              conn_state: :active,
-              used_by: [from | conn.used_by]
-          })
-
-        {:reply, pid, state}
-
-      %{gun_state: :down} ->
-        {:reply, nil, state}
-
-      nil ->
-        {:reply, nil, state}
-    end
-  end
-
-  @impl true
-  def handle_call(:state, _from, state), do: {:reply, state, state}
-
-  @impl true
-  def handle_call(:count, _from, state) do
-    {:reply, Enum.count(state.conns), state}
-  end
-
-  @impl true
-  def handle_call(:unused_conns, _from, state) do
-    unused_conns =
-      state.conns
-      |> Enum.filter(&filter_conns/1)
-      |> Enum.sort(&sort_conns/2)
-
-    {:reply, unused_conns, state}
-  end
-
-  defp filter_conns({_, %{conn_state: :idle, used_by: []}}), do: true
-  defp filter_conns(_), do: false
-
-  defp sort_conns({_, c1}, {_, c2}) do
-    c1.crf <= c2.crf and c1.last_reference <= c2.last_reference
-  end
-
-  @impl true
-  def handle_info({:gun_up, conn_pid, _protocol}, state) do
-    %{origin_host: host, origin_scheme: scheme, origin_port: port} = Gun.info(conn_pid)
-
-    host =
-      case :inet.ntoa(host) do
-        {:error, :einval} -> host
-        ip -> ip
-      end
-
-    key = "#{scheme}:#{host}:#{port}"
-
-    state =
-      with {key, conn} <- find_conn(state.conns, conn_pid, key),
-           {true, key} <- {Process.alive?(conn_pid), key} do
-        put_in(state.conns[key], %{
-          conn
-          | gun_state: :up,
-            conn_state: :active,
-            retries: 0
-        })
-      else
-        {false, key} ->
-          put_in(
-            state.conns,
-            Map.delete(state.conns, key)
-          )
-
-        nil ->
-          :ok = Gun.close(conn_pid)
-
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_down, conn_pid, _protocol, _reason, _killed}, state) do
-    retries = Config.get([:connections_pool, :retry], 1)
-    # we can't get info on this pid, because pid is dead
-    state =
-      with {key, conn} <- find_conn(state.conns, conn_pid),
-           {true, key} <- {Process.alive?(conn_pid), key} do
-        if conn.retries == retries do
-          :ok = Gun.close(conn.conn)
-
-          put_in(
-            state.conns,
-            Map.delete(state.conns, key)
-          )
-        else
-          put_in(state.conns[key], %{
-            conn
-            | gun_state: :down,
-              retries: conn.retries + 1
-          })
-        end
-      else
-        {false, key} ->
-          put_in(
-            state.conns,
-            Map.delete(state.conns, key)
-          )
-
-        nil ->
-          Logger.debug(":gun_down for conn which isn't found in state")
-
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:DOWN, _ref, :process, conn_pid, reason}, state) do
-    Logger.debug("received DOWN message for #{inspect(conn_pid)} reason -> #{inspect(reason)}")
-
-    state =
-      with {key, conn} <- find_conn(state.conns, conn_pid) do
-        Enum.each(conn.used_by, fn {pid, _ref} ->
-          Process.exit(pid, reason)
-        end)
-
-        put_in(
-          state.conns,
-          Map.delete(state.conns, key)
-        )
-      else
-        nil ->
-          Logger.debug(":DOWN for conn which isn't found in state")
-
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  defp find_conn(conns, conn_pid) do
-    Enum.find(conns, fn {_key, conn} ->
-      conn.conn == conn_pid
-    end)
-  end
-
-  defp find_conn(conns, conn_pid, conn_key) do
-    Enum.find(conns, fn {key, conn} ->
-      key == conn_key and conn.conn == conn_pid
-    end)
-  end
-
-  def crf(current, steps, crf) do
-    1 + :math.pow(0.5, current / steps) * crf
-  end
-end

lib/pleroma/pool/pool.ex

@@ -1,22 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool do
-  def child_spec(opts) do
-    poolboy_opts =
-      opts
-      |> Keyword.put(:worker_module, Pleroma.Pool.Request)
-      |> Keyword.put(:name, {:local, opts[:name]})
-      |> Keyword.put(:size, opts[:size])
-      |> Keyword.put(:max_overflow, opts[:max_overflow])
-
-    %{
-      id: opts[:id] || {__MODULE__, make_ref()},
-      start: {:poolboy, :start_link, [poolboy_opts, [name: opts[:name]]]},
-      restart: :permanent,
-      shutdown: 5000,
-      type: :worker
-    }
-  end
-end

lib/pleroma/pool/request.ex

@@ -1,65 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool.Request do
-  use GenServer
-
-  require Logger
-
-  def start_link(args) do
-    GenServer.start_link(__MODULE__, args)
-  end
-
-  @impl true
-  def init(_), do: {:ok, []}
-
-  @spec execute(pid() | atom(), Tesla.Client.t(), keyword(), pos_integer()) ::
-          {:ok, Tesla.Env.t()} | {:error, any()}
-  def execute(pid, client, request, timeout) do
-    GenServer.call(pid, {:execute, client, request}, timeout)
-  end
-
-  @impl true
-  def handle_call({:execute, client, request}, _from, state) do
-    response = Pleroma.HTTP.request(client, request)
-
-    {:reply, response, state}
-  end
-
-  @impl true
-  def handle_info({:gun_data, _conn, _stream, _, _}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_up, _conn, _protocol}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_down, _conn, _protocol, _reason, _killed}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_error, _conn, _stream, _error}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_push, _conn, _stream, _new_stream, _method, _uri, _headers}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_response, _conn, _stream, _, _status, _headers}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info(msg, state) do
-    Logger.warn("Received unexpected message #{inspect(__MODULE__)} #{inspect(msg)}")
-    {:noreply, state}
-  end
-end

lib/pleroma/pool/supervisor.ex

@@ -1,42 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool.Supervisor do
-  use Supervisor
-
-  alias Pleroma.Config
-  alias Pleroma.Pool
-
-  def start_link(args) do
-    Supervisor.start_link(__MODULE__, args, name: __MODULE__)
-  end
-
-  def init(_) do
-    conns_child = %{
-      id: Pool.Connections,
-      start:
-        {Pool.Connections, :start_link, [{:gun_connections, Config.get([:connections_pool])}]}
-    }
-
-    Supervisor.init([conns_child | pools()], strategy: :one_for_one)
-  end
-
-  defp pools do
-    pools = Config.get(:pools)
-
-    pools =
-      if Config.get([Pleroma.Upload, :proxy_remote]) == false do
-        Keyword.delete(pools, :upload)
-      else
-        pools
-      end
-
-    for {pool_name, pool_opts} <- pools do
-      pool_opts
-      |> Keyword.put(:id, {Pool, pool_name})
-      |> Keyword.put(:name, pool_name)
-      |> Pool.child_spec()
-    end
-  end
-end

lib/pleroma/reverse_proxy/client/tesla.ex

@@ -48,7 +48,7 @@ def stream_body(%{pid: pid, opts: opts, fin: true}) do
     # if there were redirects we need to checkout old conn
     conn = opts[:old_conn] || opts[:conn]
 
-    if conn, do: :ok = Pleroma.Pool.Connections.checkout(conn, self(), :gun_connections)
+    if conn, do: :ok = Pleroma.Gun.ConnectionPool.release_conn(conn)
 
     :done
   end

lib/pleroma/telemetry/logger.ex

@@ -0,0 +1,76 @@
+defmodule Pleroma.Telemetry.Logger do
+  @moduledoc "Transforms Pleroma telemetry events to logs"
+
+  require Logger
+
+  @events [
+    [:pleroma, :connection_pool, :reclaim, :start],
+    [:pleroma, :connection_pool, :reclaim, :stop],
+    [:pleroma, :connection_pool, :provision_failure],
+    [:pleroma, :connection_pool, :client_death]
+  ]
+  def attach do
+    :telemetry.attach_many("pleroma-logger", @events, &handle_event/4, [])
+  end
+
+  # Passing anonymous functions instead of strings to logger is intentional,
+  # that way strings won't be concatenated if the message is going to be thrown
+  # out anyway due to higher log level configured
+
+  def handle_event(
+        [:pleroma, :connection_pool, :reclaim, :start],
+        _,
+        %{max_connections: max_connections, reclaim_max: reclaim_max},
+        _
+      ) do
+    Logger.debug(fn ->
+      "Connection pool is exhausted (reached #{max_connections} connections). Starting idle connection cleanup to reclaim as much as #{
+        reclaim_max
+      } connections"
+    end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :reclaim, :stop],
+        %{reclaimed_count: 0},
+        _,
+        _
+      ) do
+    Logger.error(fn ->
+      "Connection pool failed to reclaim any connections due to all of them being in use. It will have to drop requests for opening connections to new hosts"
+    end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :reclaim, :stop],
+        %{reclaimed_count: reclaimed_count},
+        _,
+        _
+      ) do
+    Logger.debug(fn -> "Connection pool cleaned up #{reclaimed_count} idle connections" end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :provision_failure],
+        %{opts: [key | _]},
+        _,
+        _
+      ) do
+    Logger.error(fn ->
+      "Connection pool had to refuse opening a connection to #{key} due to connection limit exhaustion"
+    end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :client_death],
+        %{client_pid: client_pid, reason: reason},
+        %{key: key},
+        _
+      ) do
+    Logger.warn(fn ->
+      "Pool worker for #{key}: Client #{inspect(client_pid)} died before releasing the connection with #{
+        inspect(reason)
+      }"
+    end)
+  end
+end

lib/pleroma/tesla/middleware/follow_redirects.ex

@@ -0,0 +1,110 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2015-2020 Tymon Tobolski <https://github.com/teamon/tesla/blob/master/lib/tesla/middleware/follow_redirects.ex>
+# Copyright © 2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.HTTP.Middleware.FollowRedirects do
+  @moduledoc """
+  Pool-aware version of https://github.com/teamon/tesla/blob/master/lib/tesla/middleware/follow_redirects.ex
+
+  Follow 3xx redirects
+  ## Options
+  - `:max_redirects` - limit number of redirects (default: `5`)
+  """
+
+  alias Pleroma.Gun.ConnectionPool
+
+  @behaviour Tesla.Middleware
+
+  @max_redirects 5
+  @redirect_statuses [301, 302, 303, 307, 308]
+
+  @impl Tesla.Middleware
+  def call(env, next, opts \\ []) do
+    max = Keyword.get(opts, :max_redirects, @max_redirects)
+
+    redirect(env, next, max)
+  end
+
+  defp redirect(env, next, left) do
+    opts = env.opts[:adapter]
+
+    case Tesla.run(env, next) do
+      {:ok, %{status: status} = res} when status in @redirect_statuses and left > 0 ->
+        release_conn(opts)
+
+        case Tesla.get_header(res, "location") do
+          nil ->
+            {:ok, res}
+
+          location ->
+            location = parse_location(location, res)
+
+            case get_conn(location, opts) do
+              {:ok, opts} ->
+                %{env | opts: Keyword.put(env.opts, :adapter, opts)}
+                |> new_request(res.status, location)
+                |> redirect(next, left - 1)
+
+              e ->
+                e
+            end
+        end
+
+      {:ok, %{status: status}} when status in @redirect_statuses ->
+        release_conn(opts)
+        {:error, {__MODULE__, :too_many_redirects}}
+
+      {:error, _} = e ->
+        release_conn(opts)
+        e
+
+      other ->
+        unless opts[:body_as] == :chunks do
+          release_conn(opts)
+        end
+
+        other
+    end
+  end
+
+  defp get_conn(location, opts) do
+    uri = URI.parse(location)
+
+    case ConnectionPool.get_conn(uri, opts) do
+      {:ok, conn} ->
+        {:ok, Keyword.merge(opts, conn: conn)}
+
+      e ->
+        e
+    end
+  end
+
+  defp release_conn(opts) do
+    ConnectionPool.release_conn(opts[:conn])
+  end
+
+  # The 303 (See Other) redirect was added in HTTP/1.1 to indicate that the originally
+  # requested resource is not available, however a related resource (or another redirect)
+  # available via GET is available at the specified location.
+  # https://tools.ietf.org/html/rfc7231#section-6.4.4
+  defp new_request(env, 303, location), do: %{env | url: location, method: :get, query: []}
+
+  # The 307 (Temporary Redirect) status code indicates that the target
+  # resource resides temporarily under a different URI and the user agent
+  # MUST NOT change the request method (...)
+  # https://tools.ietf.org/html/rfc7231#section-6.4.7
+  defp new_request(env, 307, location), do: %{env | url: location}
+
+  defp new_request(env, _, location), do: %{env | url: location, query: []}
+
+  defp parse_location("https://" <> _rest = location, _env), do: location
+  defp parse_location("http://" <> _rest = location, _env), do: location
+
+  defp parse_location(location, env) do
+    env.url
+    |> URI.parse()
+    |> URI.merge(location)
+    |> URI.to_string()
+  end
+end

lib/pleroma/user/notification_setting.ex

@@ -10,21 +10,15 @@ defmodule Pleroma.User.NotificationSetting do
   @primary_key false
 
   embedded_schema do
-    field(:followers, :boolean, default: true)
+    field(:block_from_strangers, :boolean, default: false)
-    field(:follows, :boolean, default: true)
+    field(:hide_notification_contents, :boolean, default: false)
-    field(:non_follows, :boolean, default: true)
-    field(:non_followers, :boolean, default: true)
-    field(:privacy_option, :boolean, default: false)
   end
 
   def changeset(schema, params) do
     schema
     |> cast(prepare_attrs(params), [
-      :followers,
+      :block_from_strangers,
-      :follows,
+      :hide_notification_contents
-      :non_follows,
-      :non_followers,
-      :privacy_option
     ])
   end
 

lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex

@@ -60,7 +60,7 @@ def filter(%{"type" => "Follow", "actor" => actor_id} = message) do
     if score < 0.8 do
       {:ok, message}
     else
-      {:reject, nil}
+      {:reject, "[AntiFollowbotPolicy] Scored #{actor_id} as #{score}"}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex

@@ -39,14 +39,13 @@ def filter(%{"type" => "Create", "actor" => actor, "object" => object} = message
         {:ok, message}
 
       {:old_user, false} ->
-        {:reject, nil}
+        {:reject, "[AntiLinkSpamPolicy] User has no posts nor followers"}
 
       {:error, _} ->
-        {:reject, nil}
+        {:reject, "[AntiLinkSpamPolicy] Failed to get or fetch user by ap_id"}
 
       e ->
-        Logger.warn("[MRF anti-link-spam] WTF: unhandled error #{inspect(e)}")
+        {:reject, "[AntiLinkSpamPolicy] Unhandled error #{inspect(e)}"}
-        {:reject, nil}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex

@@ -43,7 +43,7 @@ defp delist_message(message, _threshold), do: {:ok, message}
   defp reject_message(message, threshold) when threshold > 0 do
     with {_, recipients} <- get_recipient_count(message) do
       if recipients > threshold do
-        {:reject, nil}
+        {:reject, "[HellthreadPolicy] #{recipients} recipients is over the limit of #{threshold}"}
       else
         {:ok, message}
       end
@@ -87,7 +87,7 @@ def filter(%{"type" => "Create", "object" => %{"type" => object_type}} = message
          {:ok, message} <- delist_message(message, delist_threshold) do
       {:ok, message}
     else
-      _e -> {:reject, nil}
+      e -> e
     end
   end
 

lib/pleroma/web/activity_pub/mrf/keyword_policy.ex

@@ -24,7 +24,7 @@ defp check_reject(%{"object" => %{"content" => content, "summary" => summary}} =
     if Enum.any?(Pleroma.Config.get([:mrf_keyword, :reject]), fn pattern ->
          string_matches?(content, pattern) or string_matches?(summary, pattern)
        end) do
-      {:reject, nil}
+      {:reject, "[KeywordPolicy] Matches with rejected keyword"}
     else
       {:ok, message}
     end
@@ -89,8 +89,9 @@ def filter(%{"type" => "Create", "object" => %{"content" => _content}} = message
          {:ok, message} <- check_replace(message) do
       {:ok, message}
     else
-      _e ->
+      {:reject, nil} -> {:reject, "[KeywordPolicy] "}
-        {:reject, nil}
+      {:reject, _} = e -> e
+      _e -> {:reject, "[KeywordPolicy] "}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/mention_policy.ex

@@ -12,8 +12,9 @@ def filter(%{"type" => "Create"} = message) do
     reject_actors = Pleroma.Config.get([:mrf_mention, :actors], [])
     recipients = (message["to"] || []) ++ (message["cc"] || [])
 
-    if Enum.any?(recipients, fn recipient -> Enum.member?(reject_actors, recipient) end) do
+    if rejected_mention =
-      {:reject, nil}
+         Enum.find(recipients, fn recipient -> Enum.member?(reject_actors, recipient) end) do
+      {:reject, "[MentionPolicy] Rejected for mention of #{rejected_mention}"}
     else
       {:ok, message}
     end

lib/pleroma/web/activity_pub/mrf/object_age_policy.ex

@@ -28,7 +28,7 @@ defp check_date(%{"object" => %{"published" => published}} = message) do
 
   defp check_reject(message, actions) do
     if :reject in actions do
-      {:reject, nil}
+      {:reject, "[ObjectAgePolicy]"}
     else
       {:ok, message}
     end
@@ -47,9 +47,8 @@ defp check_delist(message, actions) do
 
         {:ok, message}
       else
-        # Unhandleable error: somebody is messing around, just drop the message.
         _e ->
-          {:reject, nil}
+          {:reject, "[ObjectAgePolicy] Unhandled error"}
       end
     else
       {:ok, message}
@@ -69,9 +68,8 @@ defp check_strip_followers(message, actions) do
 
         {:ok, message}
       else
-        # Unhandleable error: somebody is messing around, just drop the message.
         _e ->
-          {:reject, nil}
+          {:reject, "[ObjectAgePolicy] Unhandled error"}
       end
     else
       {:ok, message}

lib/pleroma/web/activity_pub/mrf/reject_non_public.ex

@@ -38,7 +38,7 @@ def filter(%{"type" => "Create"} = object) do
         {:ok, object}
 
       true ->
-        {:reject, nil}
+        {:reject, "[RejectNonPublic] visibility: #{visibility}"}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/simple_policy.ex

@@ -21,7 +21,7 @@ defp check_accept(%{host: actor_host} = _actor_info, object) do
       accepts == [] -> {:ok, object}
       actor_host == Config.get([Pleroma.Web.Endpoint, :url, :host]) -> {:ok, object}
       MRF.subdomain_match?(accepts, actor_host) -> {:ok, object}
-      true -> {:reject, nil}
+      true -> {:reject, "[SimplePolicy] host not in accept list"}
     end
   end
 
@@ -31,7 +31,7 @@ defp check_reject(%{host: actor_host} = _actor_info, object) do
       |> MRF.subdomains_regex()
 
     if MRF.subdomain_match?(rejects, actor_host) do
-      {:reject, nil}
+      {:reject, "[SimplePolicy] host in reject list"}
     else
       {:ok, object}
     end
@@ -114,7 +114,7 @@ defp check_report_removal(%{host: actor_host} = _actor_info, %{"type" => "Flag"}
       |> MRF.subdomains_regex()
 
     if MRF.subdomain_match?(report_removal, actor_host) do
-      {:reject, nil}
+      {:reject, "[SimplePolicy] host in report_removal list"}
     else
       {:ok, object}
     end
@@ -159,7 +159,7 @@ def filter(%{"type" => "Delete", "actor" => actor} = object) do
       |> MRF.subdomains_regex()
 
     if MRF.subdomain_match?(reject_deletes, actor_host) do
-      {:reject, nil}
+      {:reject, "[SimplePolicy] host in reject_deletes list"}
     else
       {:ok, object}
     end
@@ -177,7 +177,9 @@ def filter(%{"actor" => actor} = object) do
          {:ok, object} <- check_report_removal(actor_info, object) do
       {:ok, object}
     else
-      _e -> {:reject, nil}
+      {:reject, nil} -> {:reject, "[SimplePolicy]"}
+      {:reject, _} = e -> e
+      _ -> {:reject, "[SimplePolicy]"}
     end
   end
 
@@ -191,7 +193,9 @@ def filter(%{"id" => actor, "type" => obj_type} = object)
          {:ok, object} <- check_banner_removal(actor_info, object) do
       {:ok, object}
     else
-      _e -> {:reject, nil}
+      {:reject, nil} -> {:reject, "[SimplePolicy]"}
+      {:reject, _} = e -> e
+      _ -> {:reject, "[SimplePolicy]"}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/tag_policy.ex

@@ -134,12 +134,13 @@ defp process_tag(
     if user.local == true do
       {:ok, message}
     else
-      {:reject, nil}
+      {:reject,
+       "[TagPolicy] Follow from #{actor} tagged with mrf_tag:disable-remote-subscription"}
     end
   end
 
-  defp process_tag("mrf_tag:disable-any-subscription", %{"type" => "Follow"}),
+  defp process_tag("mrf_tag:disable-any-subscription", %{"type" => "Follow", "actor" => actor}),
-    do: {:reject, nil}
+    do: {:reject, "[TagPolicy] Follow from #{actor} tagged with mrf_tag:disable-any-subscription"}
 
   defp process_tag(_, message), do: {:ok, message}
 

lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex

@@ -14,7 +14,7 @@ defp filter_by_list(%{"actor" => actor} = object, allow_list) do
     if actor in allow_list do
       {:ok, object}
     else
-      {:reject, nil}
+      {:reject, "[UserAllowListPolicy] #{actor} not in the list"}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex

@@ -11,22 +11,26 @@ def filter(%{"type" => "Undo", "object" => child_message} = message) do
     with {:ok, _} <- filter(child_message) do
       {:ok, message}
     else
-      {:reject, nil} ->
+      {:reject, _} = e -> e
-        {:reject, nil}
     end
   end
 
   def filter(%{"type" => message_type} = message) do
     with accepted_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :accept]),
          rejected_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :reject]),
-         true <-
+         {_, true} <-
-           Enum.empty?(accepted_vocabulary) || Enum.member?(accepted_vocabulary, message_type),
+           {:accepted,
-         false <-
+            Enum.empty?(accepted_vocabulary) || Enum.member?(accepted_vocabulary, message_type)},
-           length(rejected_vocabulary) > 0 && Enum.member?(rejected_vocabulary, message_type),
+         {_, false} <-
+           {:rejected,
+            length(rejected_vocabulary) > 0 && Enum.member?(rejected_vocabulary, message_type)},
          {:ok, _} <- filter(message["object"]) do
       {:ok, message}
     else
-      _ -> {:reject, nil}
+      {:reject, _} = e -> e
+      {:accepted, _} -> {:reject, "[VocabularyPolicy] #{message_type} not in accept list"}
+      {:rejected, _} -> {:reject, "[VocabularyPolicy] #{message_type} in reject list"}
+      _ -> {:reject, "[VocabularyPolicy]"}
     end
   end
 

lib/pleroma/web/activity_pub/publisher.ex

@@ -49,7 +49,8 @@ def is_representable?(%Activity{} = activity) do
   """
   def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = params) do
     Logger.debug("Federating #{id} to #{inbox}")
-    %{host: host, path: path} = URI.parse(inbox)
+
+    uri = URI.parse(inbox)
 
     digest = "SHA-256=" <> (:crypto.hash(:sha256, json) |> Base.encode64())
 
@@ -57,8 +58,8 @@ def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = pa
 
     signature =
       Pleroma.Signature.sign(actor, %{
-        "(request-target)": "post #{path}",
+        "(request-target)": "post #{uri.path}",
-        host: host,
+        host: signature_host(uri),
         "content-length": byte_size(json),
         digest: digest,
         date: date
@@ -76,8 +77,9 @@ def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = pa
                  {"digest", digest}
                ]
              ) do
-      if !Map.has_key?(params, :unreachable_since) || params[:unreachable_since],
+      if not Map.has_key?(params, :unreachable_since) || params[:unreachable_since] do
-        do: Instances.set_reachable(inbox)
+        Instances.set_reachable(inbox)
+      end
 
       result
     else
@@ -96,6 +98,14 @@ def publish_one(%{actor_id: actor_id} = params) do
     |> publish_one()
   end
 
+  defp signature_host(%URI{port: port, scheme: scheme, host: host}) do
+    if port == URI.default_port(scheme) do
+      host
+    else
+      "#{host}:#{port}"
+    end
+  end
+
   defp should_federate?(inbox, public) do
     if public do
       true

lib/pleroma/web/activity_pub/transmogrifier.ex

@@ -62,15 +62,17 @@ def fix_summary(%{"summary" => _} = object) do
   def fix_summary(object), do: Map.put(object, "summary", "")
 
   def fix_addressing_list(map, field) do
-    cond do
+    addrs = map[field]
-      is_binary(map[field]) ->
-        Map.put(map, field, [map[field]])
 
-      is_nil(map[field]) ->
+    cond do
-        Map.put(map, field, [])
+      is_list(addrs) ->
+        Map.put(map, field, Enum.filter(addrs, &is_binary/1))
+
+      is_binary(addrs) ->
+        Map.put(map, field, [addrs])
 
       true ->
-        map
+        Map.put(map, field, [])
     end
   end
 

lib/pleroma/web/api_spec/helpers.ex

@@ -29,6 +29,10 @@ def request_body(description, schema_ref, opts \\ []) do
     }
   end
 
+  def admin_api_params do
+    [Operation.parameter(:admin_token, :query, :string, "Allows authorization via admin token.")]
+  end
+
   def pagination_params do
     [
       Operation.parameter(:max_id, :query, :string, "Return items older than this ID"),

lib/pleroma/web/api_spec/operations/admin/config_operation.ex

@@ -26,6 +26,7 @@ def show_operation do
           %Schema{type: :boolean, default: false},
           "Get only saved in database settings"
         )
+        | admin_api_params()
       ],
       security: [%{"oAuth" => ["read"]}],
       responses: %{
@@ -41,6 +42,7 @@ def update_operation do
       summary: "Update config settings",
       operationId: "AdminAPI.ConfigController.update",
       security: [%{"oAuth" => ["write"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -73,6 +75,7 @@ def descriptions_operation do
       summary: "Get JSON with config descriptions.",
       operationId: "AdminAPI.ConfigController.descriptions",
       security: [%{"oAuth" => ["read"]}],
+      parameters: admin_api_params(),
       responses: %{
         200 =>
           Operation.response("Config Descriptions", "application/json", %Schema{

lib/pleroma/web/api_spec/operations/admin/invite_operation.ex

@@ -20,6 +20,7 @@ def index_operation do
       summary: "Get a list of generated invites",
       operationId: "AdminAPI.InviteController.index",
       security: [%{"oAuth" => ["read:invites"]}],
+      parameters: admin_api_params(),
       responses: %{
         200 =>
           Operation.response("Invites", "application/json", %Schema{
@@ -51,6 +52,7 @@ def create_operation do
       summary: "Create an account registration invite token",
       operationId: "AdminAPI.InviteController.create",
       security: [%{"oAuth" => ["write:invites"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -71,6 +73,7 @@ def revoke_operation do
       summary: "Revoke invite by token",
       operationId: "AdminAPI.InviteController.revoke",
       security: [%{"oAuth" => ["write:invites"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",
@@ -97,6 +100,7 @@ def email_operation do
       summary: "Sends registration invite via email",
       operationId: "AdminAPI.InviteController.email",
       security: [%{"oAuth" => ["write:invites"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",

lib/pleroma/web/api_spec/operations/admin/media_proxy_cache_operation.ex

@@ -33,6 +33,7 @@ def index_operation do
           %Schema{type: :integer, default: 50},
           "Number of statuses to return"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 => success_response()
@@ -46,6 +47,7 @@ def delete_operation do
       summary: "Remove a banned MediaProxy URL from Cachex",
       operationId: "AdminAPI.MediaProxyCacheController.delete",
       security: [%{"oAuth" => ["write:media_proxy_caches"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",
@@ -71,6 +73,7 @@ def purge_operation do
       summary: "Purge and optionally ban a MediaProxy URL",
       operationId: "AdminAPI.MediaProxyCacheController.purge",
       security: [%{"oAuth" => ["write:media_proxy_caches"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",

lib/pleroma/web/api_spec/operations/admin/oauth_app_operation.ex

@@ -36,6 +36,7 @@ def index_operation do
           %Schema{type: :integer, default: 50},
           "Number of apps to return"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 =>
@@ -72,6 +73,7 @@ def create_operation do
       summary: "Create OAuth App",
       operationId: "AdminAPI.OAuthAppController.create",
       requestBody: request_body("Parameters", create_request()),
+      parameters: admin_api_params(),
       security: [%{"oAuth" => ["write"]}],
       responses: %{
         200 => Operation.response("App", "application/json", oauth_app()),
@@ -85,7 +87,7 @@ def update_operation do
       tags: ["Admin", "oAuth Apps"],
       summary: "Update OAuth App",
       operationId: "AdminAPI.OAuthAppController.update",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write"]}],
       requestBody: request_body("Parameters", update_request()),
       responses: %{
@@ -103,7 +105,7 @@ def delete_operation do
       tags: ["Admin", "oAuth Apps"],
       summary: "Delete OAuth App",
       operationId: "AdminAPI.OAuthAppController.delete",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write"]}],
       responses: %{
         204 => no_content_response(),

lib/pleroma/web/api_spec/operations/admin/relay_operation.ex

@@ -19,6 +19,7 @@ def index_operation do
       summary: "List Relays",
       operationId: "AdminAPI.RelayController.index",
       security: [%{"oAuth" => ["read"]}],
+      parameters: admin_api_params(),
       responses: %{
         200 =>
           Operation.response("Response", "application/json", %Schema{
@@ -41,6 +42,7 @@ def follow_operation do
       summary: "Follow a Relay",
       operationId: "AdminAPI.RelayController.follow",
       security: [%{"oAuth" => ["write:follows"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -64,6 +66,7 @@ def unfollow_operation do
       summary: "Unfollow a Relay",
       operationId: "AdminAPI.RelayController.unfollow",
       security: [%{"oAuth" => ["write:follows"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,

lib/pleroma/web/api_spec/operations/admin/report_operation.ex

@@ -48,6 +48,7 @@ def index_operation do
           %Schema{type: :integer, default: 50},
           "Number number of log entries per page"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 =>
@@ -71,7 +72,7 @@ def show_operation do
       tags: ["Admin", "Reports"],
       summary: "Get an individual report",
       operationId: "AdminAPI.ReportController.show",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["read:reports"]}],
       responses: %{
         200 => Operation.response("Report", "application/json", report()),
@@ -86,6 +87,7 @@ def update_operation do
       summary: "Change the state of one or multiple reports",
       operationId: "AdminAPI.ReportController.update",
       security: [%{"oAuth" => ["write:reports"]}],
+      parameters: admin_api_params(),
       requestBody: request_body("Parameters", update_request(), required: true),
       responses: %{
         204 => no_content_response(),
@@ -100,7 +102,7 @@ def notes_create_operation do
       tags: ["Admin", "Reports"],
       summary: "Create report note",
       operationId: "AdminAPI.ReportController.notes_create",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -124,6 +126,7 @@ def notes_delete_operation do
       parameters: [
         Operation.parameter(:report_id, :path, :string, "Report ID"),
         Operation.parameter(:id, :path, :string, "Note ID")
+        | admin_api_params()
       ],
       security: [%{"oAuth" => ["write:reports"]}],
       responses: %{

lib/pleroma/web/api_spec/operations/admin/status_operation.ex

@@ -55,6 +55,7 @@ def index_operation do
           %Schema{type: :integer, default: 50},
           "Number of statuses to return"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 =>
@@ -71,7 +72,7 @@ def show_operation do
       tags: ["Admin", "Statuses"],
       summary: "Show Status",
       operationId: "AdminAPI.StatusController.show",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["read:statuses"]}],
       responses: %{
         200 => Operation.response("Status", "application/json", status()),
@@ -85,7 +86,7 @@ def update_operation do
       tags: ["Admin", "Statuses"],
       summary: "Change the scope of an individual reported status",
       operationId: "AdminAPI.StatusController.update",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write:statuses"]}],
       requestBody: request_body("Parameters", update_request(), required: true),
       responses: %{
@@ -100,7 +101,7 @@ def delete_operation do
       tags: ["Admin", "Statuses"],
       summary: "Delete an individual reported status",
       operationId: "AdminAPI.StatusController.delete",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write:statuses"]}],
       responses: %{
         200 => empty_object_response(),

lib/pleroma/web/api_spec/schemas/account.ex

@@ -90,11 +90,8 @@ defmodule Pleroma.Web.ApiSpec.Schemas.Account do
           notification_settings: %Schema{
             type: :object,
             properties: %{
-              followers: %Schema{type: :boolean},
+              block_from_strangers: %Schema{type: :boolean},
-              follows: %Schema{type: :boolean},
+              hide_notification_contents: %Schema{type: :boolean}
-              non_followers: %Schema{type: :boolean},
-              non_follows: %Schema{type: :boolean},
-              privacy_option: %Schema{type: :boolean}
             }
           },
           relationship: AccountRelationship,
@@ -182,11 +179,8 @@ defmodule Pleroma.Web.ApiSpec.Schemas.Account do
         "unread_conversation_count" => 0,
         "tags" => [],
         "notification_settings" => %{
-          "followers" => true,
+          "block_from_strangers" => false,
-          "follows" => true,
+          "hide_notification_contents" => false
-          "non_followers" => true,
-          "non_follows" => true,
-          "privacy_option" => false
         },
         "relationship" => %{
           "blocked_by" => false,

lib/pleroma/web/mastodon_api/controllers/status_controller.ex

@@ -172,6 +172,11 @@ def create(%{assigns: %{user: user}, body_params: %{status: _} = params} = conn,
         with_direct_conversation_id: true
       )
     else
+      {:error, {:reject, message}} ->
+        conn
+        |> put_status(:unprocessable_entity)
+        |> json(%{error: message})
+
       {:error, message} ->
         conn
         |> put_status(:unprocessable_entity)

lib/pleroma/web/media_proxy/media_proxy.ex

@@ -60,22 +60,28 @@ defp local?(url), do: String.starts_with?(url, Pleroma.Web.base_url())
   defp whitelisted?(url) do
     %{host: domain} = URI.parse(url)
 
-    mediaproxy_whitelist = Config.get([:media_proxy, :whitelist])
+    mediaproxy_whitelist_domains =
+      [:media_proxy, :whitelist]
+      |> Config.get()
+      |> Enum.map(&maybe_get_domain_from_url/1)
 
-    upload_base_url_domain =
+    whitelist_domains =
-      if !is_nil(Config.get([Upload, :base_url])) do
+      if base_url = Config.get([Upload, :base_url]) do
-        [URI.parse(Config.get([Upload, :base_url])).host]
+        %{host: base_domain} = URI.parse(base_url)
+        [base_domain | mediaproxy_whitelist_domains]
       else
-        []
+        mediaproxy_whitelist_domains
       end
 
-    whitelist = mediaproxy_whitelist ++ upload_base_url_domain
+    domain in whitelist_domains
-
-    Enum.any?(whitelist, fn pattern ->
-      String.equivalent?(domain, pattern)
-    end)
   end
 
+  defp maybe_get_domain_from_url("http" <> _ = url) do
+    URI.parse(url).host
+  end
+
+  defp maybe_get_domain_from_url(domain), do: domain
+
   def encode_url(url) do
     base64 = Base.url_encode64(url, @base64_opts)
 

lib/pleroma/web/push/impl.ex

@@ -104,7 +104,7 @@ def build_content(notification, actor, object, mastodon_type \\ nil)
 
   def build_content(
         %{
-          user: %{notification_settings: %{privacy_option: true}}
+          user: %{notification_settings: %{hide_notification_contents: true}}
         } = notification,
         _actor,
         _object,

mix.exs

@@ -90,8 +90,6 @@ defp elixirc_paths(:test), do: ["lib", "test/support"]
   defp elixirc_paths(_), do: ["lib"]
 
   defp warnings_as_errors(:prod), do: false
-  # Uncomment this if you need testing configurable_from_database logic
-  # defp warnings_as_errors(:dev), do: false
   defp warnings_as_errors(_), do: true
 
   # Specifies OAuth dependencies.
@@ -137,13 +135,11 @@ defp deps do
       {:poison, "~> 3.0", override: true},
       # {:tesla, "~> 1.3", override: true},
       {:tesla,
-       git: "https://git.pleroma.social/pleroma/elixir-libraries/tesla.git",
+       github: "teamon/tesla", ref: "af3707078b10793f6a534938e56b963aff82fe3c", override: true},
-       ref: "61b7503cef33f00834f78ddfafe0d5d9dec2270b",
-       override: true},
       {:castore, "~> 0.1"},
       {:cowlib, "~> 2.8", override: true},
       {:gun,
-       github: "ninenines/gun", ref: "e1a69b36b180a574c0ac314ced9613fdd52312cc", override: true},
+       github: "ninenines/gun", ref: "921c47146b2d9567eac7e9a4d2ccc60fffd4f327", override: true},
       {:jason, "~> 1.0"},
       {:mogrify, "~> 0.6.1"},
       {:ex_aws, "~> 2.1"},
@@ -193,6 +189,9 @@ defp deps do
       {:plug_static_index_html, "~> 1.0.0"},
       {:excoveralls, "~> 0.12.1", only: :test},
       {:flake_id, "~> 0.1.0"},
+      {:concurrent_limiter,
+       git: "https://git.pleroma.social/pleroma/elixir-libraries/concurrent_limiter",
+       ref: "8eee96c6ba39b9286ec44c51c52d9f2758951365"},
       {:remote_ip,
        git: "https://git.pleroma.social/pleroma/remote_ip.git",
        ref: "b647d0deecaa3acb140854fe4bda5b7e1dc6d1c8"},

mix.lock

@@ -15,6 +15,7 @@
   "certifi": {:hex, :certifi, "2.5.2", "b7cfeae9d2ed395695dd8201c57a2d019c0c43ecaf8b8bcb9320b40d6662f340", [:rebar3], [{:parse_trans, "~>3.3", [hex: :parse_trans, repo: "hexpm", optional: false]}], "hexpm", "3b3b5f36493004ac3455966991eaf6e768ce9884693d9968055aeeeb1e575040"},
   "combine": {:hex, :combine, "0.10.0", "eff8224eeb56498a2af13011d142c5e7997a80c8f5b97c499f84c841032e429f", [:mix], [], "hexpm", "1b1dbc1790073076580d0d1d64e42eae2366583e7aecd455d1215b0d16f2451b"},
   "comeonin": {:hex, :comeonin, "5.3.1", "7fe612b739c78c9c1a75186ef2d322ce4d25032d119823269d0aa1e2f1e20025", [:mix], [], "hexpm", "d6222483060c17f0977fad1b7401ef0c5863c985a64352755f366aee3799c245"},
+  "concurrent_limiter": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/concurrent_limiter", "8eee96c6ba39b9286ec44c51c52d9f2758951365", [ref: "8eee96c6ba39b9286ec44c51c52d9f2758951365"]},
   "connection": {:hex, :connection, "1.0.4", "a1cae72211f0eef17705aaededacac3eb30e6625b04a6117c1b2db6ace7d5976", [:mix], [], "hexpm", "4a0850c9be22a43af9920a71ab17c051f5f7d45c209e40269a1938832510e4d9"},
   "cors_plug": {:hex, :cors_plug, "1.5.2", "72df63c87e4f94112f458ce9d25800900cc88608c1078f0e4faddf20933eda6e", [:mix], [{:plug, "~> 1.3 or ~> 1.4 or ~> 1.5", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "9af027d20dc12dd0c4345a6b87247e0c62965871feea0bfecf9764648b02cc69"},
   "cowboy": {:hex, :cowboy, "2.7.0", "91ed100138a764355f43316b1d23d7ff6bdb0de4ea618cb5d8677c93a7a2f115", [:rebar3], [{:cowlib, "~> 2.8.0", [hex: :cowlib, repo: "hexpm", optional: false]}, {:ranch, "~> 1.7.1", [hex: :ranch, repo: "hexpm", optional: false]}], "hexpm", "04fd8c6a39edc6aaa9c26123009200fc61f92a3a94f3178c527b70b767c6e605"},
@@ -49,7 +50,7 @@
   "gen_stage": {:hex, :gen_stage, "0.14.3", "d0c66f1c87faa301c1a85a809a3ee9097a4264b2edf7644bf5c123237ef732bf", [:mix], [], "hexpm"},
   "gen_state_machine": {:hex, :gen_state_machine, "2.0.5", "9ac15ec6e66acac994cc442dcc2c6f9796cf380ec4b08267223014be1c728a95", [:mix], [], "hexpm"},
   "gettext": {:hex, :gettext, "0.17.4", "f13088e1ec10ce01665cf25f5ff779e7df3f2dc71b37084976cf89d1aa124d5c", [:mix], [], "hexpm", "3c75b5ea8288e2ee7ea503ff9e30dfe4d07ad3c054576a6e60040e79a801e14d"},
-  "gun": {:git, "https://github.com/ninenines/gun.git", "e1a69b36b180a574c0ac314ced9613fdd52312cc", [ref: "e1a69b36b180a574c0ac314ced9613fdd52312cc"]},
+  "gun": {:git, "https://github.com/ninenines/gun.git", "921c47146b2d9567eac7e9a4d2ccc60fffd4f327", [ref: "921c47146b2d9567eac7e9a4d2ccc60fffd4f327"]},
   "hackney": {:hex, :hackney, "1.16.0", "5096ac8e823e3a441477b2d187e30dd3fff1a82991a806b2003845ce72ce2d84", [:rebar3], [{:certifi, "2.5.2", [hex: :certifi, repo: "hexpm", optional: false]}, {:idna, "6.0.1", [hex: :idna, repo: "hexpm", optional: false]}, {:metrics, "1.0.1", [hex: :metrics, repo: "hexpm", optional: false]}, {:mimerl, "~>1.1", [hex: :mimerl, repo: "hexpm", optional: false]}, {:parse_trans, "3.3.0", [hex: :parse_trans, repo: "hexpm", optional: false]}, {:ssl_verify_fun, "1.1.6", [hex: :ssl_verify_fun, repo: "hexpm", optional: false]}], "hexpm", "3bf0bebbd5d3092a3543b783bf065165fa5d3ad4b899b836810e513064134e18"},
   "html_entities": {:hex, :html_entities, "0.5.1", "1c9715058b42c35a2ab65edc5b36d0ea66dd083767bef6e3edb57870ef556549", [:mix], [], "hexpm", "30efab070904eb897ff05cd52fa61c1025d7f8ef3a9ca250bc4e6513d16c32de"},
   "html_sanitize_ex": {:hex, :html_sanitize_ex, "1.3.0", "f005ad692b717691203f940c686208aa3d8ffd9dd4bb3699240096a51fa9564e", [:mix], [{:mochiweb, "~> 2.15", [hex: :mochiweb, repo: "hexpm", optional: false]}], "hexpm"},
@@ -107,7 +108,7 @@
   "swoosh": {:git, "https://github.com/swoosh/swoosh", "c96e0ca8a00d8f211ec1f042a4626b09f249caa5", [ref: "c96e0ca8a00d8f211ec1f042a4626b09f249caa5"]},
   "syslog": {:hex, :syslog, "1.1.0", "6419a232bea84f07b56dc575225007ffe34d9fdc91abe6f1b2f254fd71d8efc2", [:rebar3], [], "hexpm", "4c6a41373c7e20587be33ef841d3de6f3beba08519809329ecc4d27b15b659e1"},
   "telemetry": {:hex, :telemetry, "0.4.2", "2808c992455e08d6177322f14d3bdb6b625fbcfd233a73505870d8738a2f4599", [:rebar3], [], "hexpm", "2d1419bd9dda6a206d7b5852179511722e2b18812310d304620c7bd92a13fcef"},
-  "tesla": {:git, "https://git.pleroma.social/pleroma/elixir-libraries/tesla.git", "61b7503cef33f00834f78ddfafe0d5d9dec2270b", [ref: "61b7503cef33f00834f78ddfafe0d5d9dec2270b"]},
+  "tesla": {:git, "https://github.com/teamon/tesla.git", "af3707078b10793f6a534938e56b963aff82fe3c", [ref: "af3707078b10793f6a534938e56b963aff82fe3c"]},
   "timex": {:hex, :timex, "3.6.1", "efdf56d0e67a6b956cc57774353b0329c8ab7726766a11547e529357ffdc1d56", [:mix], [{:combine, "~> 0.10", [hex: :combine, repo: "hexpm", optional: false]}, {:gettext, "~> 0.10", [hex: :gettext, repo: "hexpm", optional: false]}, {:tzdata, "~> 0.1.8 or ~> 0.5 or ~> 1.0.0", [hex: :tzdata, repo: "hexpm", optional: false]}], "hexpm", "f354efb2400dd7a80fd9eb6c8419068c4f632da4ac47f3d8822d6e33f08bc852"},
   "trailing_format_plug": {:hex, :trailing_format_plug, "0.0.7", "64b877f912cf7273bed03379936df39894149e35137ac9509117e59866e10e45", [:mix], [{:plug, "> 0.12.0", [hex: :plug, repo: "hexpm", optional: false]}], "hexpm", "bd4fde4c15f3e993a999e019d64347489b91b7a9096af68b2bdadd192afa693f"},
   "tzdata": {:hex, :tzdata, "1.0.3", "73470ad29dde46e350c60a66e6b360d3b99d2d18b74c4c349dbebbc27a09a3eb", [:mix], [{:hackney, "~> 1.0", [hex: :hackney, repo: "hexpm", optional: false]}], "hexpm", "a6e1ee7003c4d04ecbd21dd3ec690d4c6662db5d3bbdd7262d53cdf5e7c746c1"},

priv/gettext/errors.pot

@@ -90,110 +90,100 @@ msgid "must be equal to %{number}"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:421
+#: lib/pleroma/web/common_api/common_api.ex:505
 msgid "Account not found"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:249
+#: lib/pleroma/web/common_api/common_api.ex:339
 msgid "Already voted"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:360
+#: lib/pleroma/web/oauth/oauth_controller.ex:359
 msgid "Bad request"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:425
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:426
 msgid "Can't delete object"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:196
+#: lib/pleroma/web/controller_helper.ex:105
-msgid "Can't delete this post"
+#: lib/pleroma/web/controller_helper.ex:111
-msgstr ""
-
-#, elixir-format
-#: lib/pleroma/web/controller_helper.ex:95
-#: lib/pleroma/web/controller_helper.ex:101
 msgid "Can't display this activity"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:227
+#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:285
-#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:254
 msgid "Can't find user"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:114
+#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:61
 msgid "Can't get favorites"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:437
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:438
 msgid "Can't like object"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/utils.ex:556
+#: lib/pleroma/web/common_api/utils.ex:563
 msgid "Cannot post an empty status without attachments"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/utils.ex:504
+#: lib/pleroma/web/common_api/utils.ex:511
 msgid "Comment must be up to %{max_size} characters"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/config/config_db.ex:222
+#: lib/pleroma/config/config_db.ex:191
 msgid "Config with params %{params} not found"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:95
+#: lib/pleroma/web/common_api/common_api.ex:181
+#: lib/pleroma/web/common_api/common_api.ex:185
 msgid "Could not delete"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:141
+#: lib/pleroma/web/common_api/common_api.ex:231
 msgid "Could not favorite"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:370
+#: lib/pleroma/web/common_api/common_api.ex:453
 msgid "Could not pin"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:112
+#: lib/pleroma/web/common_api/common_api.ex:278
-msgid "Could not repeat"
-msgstr ""
-
-#, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:188
 msgid "Could not unfavorite"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:380
+#: lib/pleroma/web/common_api/common_api.ex:463
 msgid "Could not unpin"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:126
+#: lib/pleroma/web/common_api/common_api.ex:216
 msgid "Could not unrepeat"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:428
+#: lib/pleroma/web/common_api/common_api.ex:512
-#: lib/pleroma/web/common_api/common_api.ex:437
+#: lib/pleroma/web/common_api/common_api.ex:521
 msgid "Could not update state"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:202
+#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:207
 msgid "Error."
 msgstr ""
 
@@ -203,8 +193,8 @@ msgid "Invalid CAPTCHA"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:117
+#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:116
-#: lib/pleroma/web/oauth/oauth_controller.ex:569
+#: lib/pleroma/web/oauth/oauth_controller.ex:568
 msgid "Invalid credentials"
 msgstr ""
 
@@ -214,22 +204,22 @@ msgid "Invalid credentials."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:265
+#: lib/pleroma/web/common_api/common_api.ex:355
 msgid "Invalid indices"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/admin_api/admin_api_controller.ex:1147
+#: lib/pleroma/web/admin_api/controllers/fallback_controller.ex:29
 msgid "Invalid parameters"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/utils.ex:411
+#: lib/pleroma/web/common_api/utils.ex:414
 msgid "Invalid password."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:187
+#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:220
 msgid "Invalid request"
 msgstr ""
 
@@ -239,44 +229,44 @@ msgid "Kocaptcha service unavailable"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:113
+#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:112
 msgid "Missing parameters"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/utils.ex:540
+#: lib/pleroma/web/common_api/utils.ex:547
 msgid "No such conversation"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/admin_api/admin_api_controller.ex:439
+#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:388
-#: lib/pleroma/web/admin_api/admin_api_controller.ex:465 lib/pleroma/web/admin_api/admin_api_controller.ex:507
+#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:414 lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:456
 msgid "No such permission_group"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/plugs/uploaded_media.ex:74
+#: lib/pleroma/plugs/uploaded_media.ex:84
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:485 lib/pleroma/web/admin_api/admin_api_controller.ex:1135
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:486 lib/pleroma/web/admin_api/controllers/fallback_controller.ex:11
-#: lib/pleroma/web/feed/user_controller.ex:73 lib/pleroma/web/ostatus/ostatus_controller.ex:143
+#: lib/pleroma/web/feed/user_controller.ex:71 lib/pleroma/web/ostatus/ostatus_controller.ex:143
 msgid "Not found"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:241
+#: lib/pleroma/web/common_api/common_api.ex:331
 msgid "Poll's author can't vote"
 msgstr ""
 
 #, elixir-format
 #: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:20
 #: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:37 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:49
-#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:290
+#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:50 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:306
 #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:71
 msgid "Record not found"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/admin_api/admin_api_controller.ex:1153
+#: lib/pleroma/web/admin_api/controllers/fallback_controller.ex:35
-#: lib/pleroma/web/feed/user_controller.ex:79 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:32
+#: lib/pleroma/web/feed/user_controller.ex:77 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:36
 #: lib/pleroma/web/ostatus/ostatus_controller.ex:149
 msgid "Something went wrong"
 msgstr ""
@@ -287,7 +277,7 @@ msgid "The message visibility must be direct"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/utils.ex:566
+#: lib/pleroma/web/common_api/utils.ex:573
 msgid "The status is over the character limit"
 msgstr ""
 
@@ -302,65 +292,65 @@ msgid "Throttled"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:266
+#: lib/pleroma/web/common_api/common_api.ex:356
 msgid "Too many choices"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:442
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:443
 msgid "Unhandled activity type"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/admin_api/admin_api_controller.ex:536
+#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:485
 msgid "You can't revoke your own admin status."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:218
+#: lib/pleroma/web/oauth/oauth_controller.ex:221
-#: lib/pleroma/web/oauth/oauth_controller.ex:309
+#: lib/pleroma/web/oauth/oauth_controller.ex:308
 msgid "Your account is currently disabled"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:180
+#: lib/pleroma/web/oauth/oauth_controller.ex:183
-#: lib/pleroma/web/oauth/oauth_controller.ex:332
+#: lib/pleroma/web/oauth/oauth_controller.ex:331
 msgid "Your login is missing a confirmed e-mail address"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:389
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:390
 msgid "can't read inbox of %{nickname} as %{as_nickname}"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:472
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:473
 msgid "can't update outbox of %{nickname} as %{as_nickname}"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:388
+#: lib/pleroma/web/common_api/common_api.ex:471
 msgid "conversation is already muted"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:316
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:314
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:491
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:492
 msgid "error"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:29
+#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:32
 msgid "mascots can only be images"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:60
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:62
 msgid "not found"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:395
+#: lib/pleroma/web/oauth/oauth_controller.ex:394
 msgid "Bad OAuth request."
 msgstr ""
 
@@ -375,17 +365,17 @@ msgid "CAPTCHA expired"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/plugs/uploaded_media.ex:55
+#: lib/pleroma/plugs/uploaded_media.ex:57
 msgid "Failed"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:411
+#: lib/pleroma/web/oauth/oauth_controller.ex:410
 msgid "Failed to authenticate: %{message}."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:442
+#: lib/pleroma/web/oauth/oauth_controller.ex:441
 msgid "Failed to set up user account."
 msgstr ""
 
@@ -395,7 +385,7 @@ msgid "Insufficient permissions: %{permissions}."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/plugs/uploaded_media.ex:94
+#: lib/pleroma/plugs/uploaded_media.ex:104
 msgid "Internal Error"
 msgstr ""
 
@@ -411,12 +401,12 @@ msgid "Invalid answer data"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:128
+#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:33
 msgid "Nodeinfo schema version not handled"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:169
+#: lib/pleroma/web/oauth/oauth_controller.ex:172
 msgid "This action is outside the authorized scopes"
 msgstr ""
 
@@ -426,13 +416,13 @@ msgid "Unknown error, please check the details and try again."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:116
+#: lib/pleroma/web/oauth/oauth_controller.ex:119
-#: lib/pleroma/web/oauth/oauth_controller.ex:155
+#: lib/pleroma/web/oauth/oauth_controller.ex:158
 msgid "Unlisted redirect_uri."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:391
+#: lib/pleroma/web/oauth/oauth_controller.ex:390
 msgid "Unsupported OAuth provider: %{provider}."
 msgstr ""
 
@@ -452,12 +442,12 @@ msgid "CAPTCHA Error"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:200
+#: lib/pleroma/web/common_api/common_api.ex:290
 msgid "Could not add reaction emoji"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/common_api/common_api.ex:211
+#: lib/pleroma/web/common_api/common_api.ex:301
 msgid "Could not remove reaction emoji"
 msgstr ""
 
@@ -472,39 +462,45 @@ msgid "List not found"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:124
+#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:123
 msgid "Missing parameter: %{name}"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/oauth/oauth_controller.ex:207
+#: lib/pleroma/web/oauth/oauth_controller.ex:210
-#: lib/pleroma/web/oauth/oauth_controller.ex:322
+#: lib/pleroma/web/oauth/oauth_controller.ex:321
 msgid "Password reset is required"
 msgstr ""
 
 #, elixir-format
 #: lib/pleroma/tests/auth_test_controller.ex:9
-#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/admin_api_controller.ex:6
+#: lib/pleroma/web/activity_pub/activity_pub_controller.ex:6 lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:6
-#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/fallback_redirect_controller.ex:6
+#: lib/pleroma/web/admin_api/controllers/config_controller.ex:6 lib/pleroma/web/admin_api/controllers/fallback_controller.ex:6
-#: lib/pleroma/web/feed/tag_controller.ex:6 lib/pleroma/web/feed/user_controller.ex:6
+#: lib/pleroma/web/admin_api/controllers/invite_controller.ex:6 lib/pleroma/web/admin_api/controllers/media_proxy_cache_controller.ex:6
-#: lib/pleroma/web/mailer/subscription_controller.ex:2 lib/pleroma/web/masto_fe_controller.ex:6
+#: lib/pleroma/web/admin_api/controllers/oauth_app_controller.ex:6 lib/pleroma/web/admin_api/controllers/relay_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6
+#: lib/pleroma/web/admin_api/controllers/report_controller.ex:6 lib/pleroma/web/admin_api/controllers/status_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6
+#: lib/pleroma/web/controller_helper.ex:6 lib/pleroma/web/embed_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6
+#: lib/pleroma/web/fallback_redirect_controller.ex:6 lib/pleroma/web/feed/tag_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6
+#: lib/pleroma/web/feed/user_controller.ex:6 lib/pleroma/web/mailer/subscription_controller.ex:2
-#: lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6
+#: lib/pleroma/web/masto_fe_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/account_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/app_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/auth_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14 lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8 lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/filter_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/instance_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/list_controller.ex:6
-#: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7 lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/marker_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex:14
-#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6 lib/pleroma/web/media_proxy/media_proxy_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/media_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/notification_controller.ex:6
-#: lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6 lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/poll_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/report_controller.ex:8
-#: lib/pleroma/web/oauth/fallback_controller.ex:6 lib/pleroma/web/oauth/mfa_controller.ex:10
+#: lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/search_controller.ex:6
-#: lib/pleroma/web/oauth/oauth_controller.ex:6 lib/pleroma/web/ostatus/ostatus_controller.ex:6
+#: lib/pleroma/web/mastodon_api/controllers/status_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:7
-#: lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:2
+#: lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex:6 lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:6
-#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex:6
+#: lib/pleroma/web/media_proxy/media_proxy_controller.ex:6 lib/pleroma/web/mongooseim/mongoose_im_controller.ex:6
+#: lib/pleroma/web/nodeinfo/nodeinfo_controller.ex:6 lib/pleroma/web/oauth/fallback_controller.ex:6
+#: lib/pleroma/web/oauth/mfa_controller.ex:10 lib/pleroma/web/oauth/oauth_controller.ex:6
+#: lib/pleroma/web/ostatus/ostatus_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/account_controller.ex:6
+#: lib/pleroma/web/pleroma_api/controllers/chat_controller.ex:5 lib/pleroma/web/pleroma_api/controllers/conversation_controller.ex:6
+#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:2 lib/pleroma/web/pleroma_api/controllers/emoji_reaction_controller.ex:6
+#: lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex:6 lib/pleroma/web/pleroma_api/controllers/notification_controller.ex:6
 #: lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex:6
 #: lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex:7 lib/pleroma/web/static_fe/static_fe_controller.ex:6
 #: lib/pleroma/web/twitter_api/controllers/password_controller.ex:10 lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex:6
@@ -519,46 +515,56 @@ msgid "Two-factor authentication enabled, you must use a access token."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:210
+#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:210
 msgid "Unexpected error occurred while adding file to pack."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:138
+#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:138
 msgid "Unexpected error occurred while creating pack."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:278
+#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:278
 msgid "Unexpected error occurred while removing file from pack."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:250
+#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:250
 msgid "Unexpected error occurred while updating file in pack."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex:179
+#: lib/pleroma/web/pleroma_api/controllers/emoji_pack_controller.ex:179
 msgid "Unexpected error occurred while updating pack metadata."
 msgstr ""
 
-#, elixir-format
-#: lib/pleroma/plugs/user_is_admin_plug.ex:40
-msgid "User is not an admin or OAuth admin scope is not granted."
-msgstr ""
-
 #, elixir-format
 #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61
 msgid "Web push subscription is disabled on this Pleroma instance"
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/admin_api/admin_api_controller.ex:502
+#: lib/pleroma/web/admin_api/controllers/admin_api_controller.ex:451
 msgid "You can't revoke your own admin/moderator status."
 msgstr ""
 
 #, elixir-format
-#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:105
+#: lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex:126
 msgid "authorization required for timeline view"
 msgstr ""
+
+#, elixir-format
+#: lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex:24
+msgid "Access denied"
+msgstr ""
+
+#, elixir-format
+#: lib/pleroma/web/mastodon_api/controllers/account_controller.ex:282
+msgid "This API requires an authenticated user"
+msgstr ""
+
+#, elixir-format
+#: lib/pleroma/plugs/user_is_admin_plug.ex:21
+msgid "User is not an admin."
+msgstr ""

priv/gettext/it/LC_MESSAGES/errors.po

@@ -562,11 +562,11 @@ msgstr "Errore inaspettato durante l'aggiornamento del file nel pacchetto."
 msgid "Unexpected error occurred while updating pack metadata."
 msgstr "Errore inaspettato durante l'aggiornamento dei metadati del pacchetto."
 
-#: lib/pleroma/plugs/user_is_admin_plug.ex:40
+#: lib/pleroma/plugs/user_is_admin_plug.ex:21
 #, elixir-format
-msgid "User is not an admin or OAuth admin scope is not granted."
+msgid "User is not an admin."
 msgstr ""
-"L'utente non è un amministratore o non ha ricevuto questa autorizzazione "
+"L'utente non è un amministratore."
 "OAuth."
 
 #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61

priv/gettext/nl/LC_MESSAGES/errors.po

@@ -559,9 +559,9 @@ msgstr ""
 msgid "Unexpected error occurred while updating pack metadata."
 msgstr ""
 
-#: lib/pleroma/plugs/user_is_admin_plug.ex:40
+#: lib/pleroma/plugs/user_is_admin_plug.ex:21
 #, elixir-format
-msgid "User is not an admin or OAuth admin scope is not granted."
+msgid "User is not an admin."
 msgstr ""
 
 #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61

priv/gettext/pl/LC_MESSAGES/errors.po

@@ -566,9 +566,9 @@ msgstr "Nieoczekiwany błąd podczas zmieniania pliku w paczce."
 msgid "Unexpected error occurred while updating pack metadata."
 msgstr "Nieoczekiwany błąd podczas zmieniania metadanych paczki."
 
-#: lib/pleroma/plugs/user_is_admin_plug.ex:40
+#: lib/pleroma/plugs/user_is_admin_plug.ex:21
 #, elixir-format
-msgid "User is not an admin or OAuth admin scope is not granted."
+msgid "User is not an admin."
 msgstr ""
 
 #: lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex:61

priv/repo/migrations/20200626163359_rename_notification_privacy_option.exs

@@ -0,0 +1,19 @@
+defmodule Pleroma.Repo.Migrations.RenameNotificationPrivacyOption do
+  use Ecto.Migration
+
+  def up do
+    execute(
+      "UPDATE users SET notification_settings = notification_settings - 'privacy_option' || jsonb_build_object('hide_notification_contents', notification_settings->'privacy_option')
+where notification_settings ? 'privacy_option'
+and local"
+    )
+  end
+
+  def down do
+    execute(
+      "UPDATE users SET notification_settings = notification_settings - 'hide_notification_contents' || jsonb_build_object('privacy_option', notification_settings->'hide_notification_contents')
+where notification_settings ? 'hide_notification_contents'
+and local"
+    )
+  end
+end

priv/repo/migrations/20200714081657_oban_2_0_config_changes.exs

@@ -0,0 +1,27 @@
+defmodule Elixir.Pleroma.Repo.Migrations.Oban20ConfigChanges do
+  use Ecto.Migration
+  import Ecto.Query
+  alias Pleroma.ConfigDB
+  alias Pleroma.Repo
+
+  def change do
+    config_entry =
+      from(c in ConfigDB, where: c.group == ^":pleroma" and c.key == ^"Oban")
+      |> select([c], struct(c, [:value, :id]))
+      |> Repo.one()
+
+    if config_entry do
+      %{value: value} = config_entry
+
+      value =
+        case Keyword.fetch(value, :verbose) do
+          {:ok, log} -> Keyword.put_new(value, :log, log)
+          _ -> value
+        end
+        |> Keyword.drop([:verbose, :prune])
+
+      Ecto.Changeset.change(config_entry, %{value: value})
+      |> Repo.update()
+    end
+  end
+end

priv/static/index.html

@@ -1 +1 @@
-<!DOCTYPE html><html lang=en><head><meta charset=utf-8><meta name=viewport content="width=device-width,initial-scale=1,user-scalable=no"><title>Pleroma</title><!--server-generated-meta--><link rel=icon type=image/png href=/favicon.png><link href=/static/css/app.77b1644622e3bae24b6b.css rel=stylesheet><link href=/static/fontello.1594374054351.css rel=stylesheet></head><body class=hidden><noscript>To use Pleroma, please enable JavaScript.</noscript><div id=app></div><script type=text/javascript src=/static/js/vendors~app.247dc52c7abe6a0dab87.js></script><script type=text/javascript src=/static/js/app.1e68e208590653dab5aa.js></script></body></html>
+<!DOCTYPE html><html lang=en><head><meta charset=utf-8><meta name=viewport content="width=device-width,initial-scale=1,user-scalable=no"><title>Pleroma</title><!--server-generated-meta--><link rel=icon type=image/png href=/favicon.png><link href=/static/css/app.6dbc7dea4fc148c85860.css rel=stylesheet><link href=/static/fontello.1594823398494.css rel=stylesheet></head><body class=hidden><noscript>To use Pleroma, please enable JavaScript.</noscript><div id=app></div><script type=text/javascript src=/static/js/vendors~app.9e24ed238da5a8538f50.js></script><script type=text/javascript src=/static/js/app.31bba9f1e242ff273dcb.js></script></body></html>

priv/static/static/css/app.6dbc7dea4fc148c85860.css

@@ -243,4 +243,4 @@ .with-load-more-footer a {
   cursor: pointer;
 }
 
-/*# sourceMappingURL=app.77b1644622e3bae24b6b.css.map*/
+/*# sourceMappingURL=app.6dbc7dea4fc148c85860.css.map*/

priv/static/static/fontello.1589385935077.css

@@ -1,144 +0,0 @@
-@font-face {
-	font-family: "Icons";
-	src: url("./font/fontello.1589385935077.eot");
-	src: url("./font/fontello.1589385935077.eot") format("embedded-opentype"),
-		url("./font/fontello.1589385935077.woff2") format("woff2"),
-		url("./font/fontello.1589385935077.woff") format("woff"),
-		url("./font/fontello.1589385935077.ttf") format("truetype"),
-		url("./font/fontello.1589385935077.svg") format("svg");
-	font-weight: normal;
-	font-style: normal;
-}
-
-[class^="icon-"]::before,
-[class*=" icon-"]::before {
-	font-family: "Icons";
-	font-style: normal;
-	font-weight: normal;
-	speak: none;
-	display: inline-block;
-	text-decoration: inherit;
-	width: 1em;
-	margin-right: .2em;
-	text-align: center;
-	font-variant: normal;
-	text-transform: none;
-	line-height: 1em;
-	margin-left: .2em;
-	-webkit-font-smoothing: antialiased;
-	-moz-osx-font-smoothing: grayscale;
-}
-
-.icon-spin4::before { content: "\e834"; }
-
-.icon-cancel::before { content: "\e800"; }
-
-.icon-upload::before { content: "\e801"; }
-
-.icon-spin3::before { content: "\e832"; }
-
-.icon-reply::before { content: "\f112"; }
-
-.icon-star::before { content: "\e802"; }
-
-.icon-star-empty::before { content: "\e803"; }
-
-.icon-retweet::before { content: "\e804"; }
-
-.icon-eye-off::before { content: "\e805"; }
-
-.icon-binoculars::before { content: "\f1e5"; }
-
-.icon-cog::before { content: "\e807"; }
-
-.icon-user-plus::before { content: "\f234"; }
-
-.icon-menu::before { content: "\f0c9"; }
-
-.icon-logout::before { content: "\e808"; }
-
-.icon-down-open::before { content: "\e809"; }
-
-.icon-attach::before { content: "\e80a"; }
-
-.icon-link-ext::before { content: "\f08e"; }
-
-.icon-link-ext-alt::before { content: "\f08f"; }
-
-.icon-picture::before { content: "\e80b"; }
-
-.icon-video::before { content: "\e80c"; }
-
-.icon-right-open::before { content: "\e80d"; }
-
-.icon-left-open::before { content: "\e80e"; }
-
-.icon-up-open::before { content: "\e80f"; }
-
-.icon-comment-empty::before { content: "\f0e5"; }
-
-.icon-mail-alt::before { content: "\f0e0"; }
-
-.icon-lock::before { content: "\e811"; }
-
-.icon-lock-open-alt::before { content: "\f13e"; }
-
-.icon-globe::before { content: "\e812"; }
-
-.icon-brush::before { content: "\e813"; }
-
-.icon-search::before { content: "\e806"; }
-
-.icon-adjust::before { content: "\e816"; }
-
-.icon-thumbs-up-alt::before { content: "\f164"; }
-
-.icon-attention::before { content: "\e814"; }
-
-.icon-plus-squared::before { content: "\f0fe"; }
-
-.icon-plus::before { content: "\e815"; }
-
-.icon-edit::before { content: "\e817"; }
-
-.icon-play-circled::before { content: "\f144"; }
-
-.icon-pencil::before { content: "\e818"; }
-
-.icon-chart-bar::before { content: "\e81b"; }
-
-.icon-smile::before { content: "\f118"; }
-
-.icon-bell-alt::before { content: "\f0f3"; }
-
-.icon-wrench::before { content: "\e81a"; }
-
-.icon-pin::before { content: "\e819"; }
-
-.icon-ellipsis::before { content: "\f141"; }
-
-.icon-bell-ringing-o::before { content: "\e810"; }
-
-.icon-zoom-in::before { content: "\e81c"; }
-
-.icon-gauge::before { content: "\f0e4"; }
-
-.icon-users::before { content: "\e81d"; }
-
-.icon-info-circled::before { content: "\e81f"; }
-
-.icon-home-2::before { content: "\e821"; }
-
-.icon-chat::before { content: "\e81e"; }
-
-.icon-login::before { content: "\e820"; }
-
-.icon-arrow-curved::before { content: "\e822"; }
-
-.icon-link::before { content: "\e823"; }
-
-.icon-share::before { content: "\f1e0"; }
-
-.icon-user::before { content: "\e824"; }
-
-.icon-ok::before { content: "\e827"; }

priv/static/static/fontello.1594030805019.css

@@ -1,152 +0,0 @@
-@font-face {
-	font-family: "Icons";
-	src: url("./font/fontello.1594030805019.eot");
-	src: url("./font/fontello.1594030805019.eot") format("embedded-opentype"),
-		url("./font/fontello.1594030805019.woff2") format("woff2"),
-		url("./font/fontello.1594030805019.woff") format("woff"),
-		url("./font/fontello.1594030805019.ttf") format("truetype"),
-		url("./font/fontello.1594030805019.svg") format("svg");
-	font-weight: normal;
-	font-style: normal;
-}
-
-[class^="icon-"]::before,
-[class*=" icon-"]::before {
-	font-family: "Icons";
-	font-style: normal;
-	font-weight: normal;
-	speak: none;
-	display: inline-block;
-	text-decoration: inherit;
-	width: 1em;
-	margin-right: .2em;
-	text-align: center;
-	font-variant: normal;
-	text-transform: none;
-	line-height: 1em;
-	margin-left: .2em;
-	-webkit-font-smoothing: antialiased;
-	-moz-osx-font-smoothing: grayscale;
-}
-
-.icon-spin4::before { content: "\e834"; }
-
-.icon-cancel::before { content: "\e800"; }
-
-.icon-upload::before { content: "\e801"; }
-
-.icon-spin3::before { content: "\e832"; }
-
-.icon-reply::before { content: "\f112"; }
-
-.icon-star::before { content: "\e802"; }
-
-.icon-star-empty::before { content: "\e803"; }
-
-.icon-retweet::before { content: "\e804"; }
-
-.icon-eye-off::before { content: "\e805"; }
-
-.icon-binoculars::before { content: "\f1e5"; }
-
-.icon-cog::before { content: "\e807"; }
-
-.icon-user-plus::before { content: "\f234"; }
-
-.icon-menu::before { content: "\f0c9"; }
-
-.icon-logout::before { content: "\e808"; }
-
-.icon-down-open::before { content: "\e809"; }
-
-.icon-attach::before { content: "\e80a"; }
-
-.icon-link-ext::before { content: "\f08e"; }
-
-.icon-link-ext-alt::before { content: "\f08f"; }
-
-.icon-picture::before { content: "\e80b"; }
-
-.icon-video::before { content: "\e80c"; }
-
-.icon-right-open::before { content: "\e80d"; }
-
-.icon-left-open::before { content: "\e80e"; }
-
-.icon-up-open::before { content: "\e80f"; }
-
-.icon-comment-empty::before { content: "\f0e5"; }
-
-.icon-mail-alt::before { content: "\f0e0"; }
-
-.icon-lock::before { content: "\e811"; }
-
-.icon-lock-open-alt::before { content: "\f13e"; }
-
-.icon-globe::before { content: "\e812"; }
-
-.icon-brush::before { content: "\e813"; }
-
-.icon-search::before { content: "\e806"; }
-
-.icon-adjust::before { content: "\e816"; }
-
-.icon-thumbs-up-alt::before { content: "\f164"; }
-
-.icon-attention::before { content: "\e814"; }
-
-.icon-plus-squared::before { content: "\f0fe"; }
-
-.icon-plus::before { content: "\e815"; }
-
-.icon-edit::before { content: "\e817"; }
-
-.icon-play-circled::before { content: "\f144"; }
-
-.icon-pencil::before { content: "\e818"; }
-
-.icon-chart-bar::before { content: "\e81b"; }
-
-.icon-smile::before { content: "\f118"; }
-
-.icon-bell-alt::before { content: "\f0f3"; }
-
-.icon-wrench::before { content: "\e81a"; }
-
-.icon-pin::before { content: "\e819"; }
-
-.icon-ellipsis::before { content: "\f141"; }
-
-.icon-bell-ringing-o::before { content: "\e810"; }
-
-.icon-zoom-in::before { content: "\e81c"; }
-
-.icon-gauge::before { content: "\f0e4"; }
-
-.icon-users::before { content: "\e81d"; }
-
-.icon-info-circled::before { content: "\e81f"; }
-
-.icon-home-2::before { content: "\e821"; }
-
-.icon-chat::before { content: "\e81e"; }
-
-.icon-login::before { content: "\e820"; }
-
-.icon-arrow-curved::before { content: "\e822"; }
-
-.icon-link::before { content: "\e823"; }
-
-.icon-share::before { content: "\f1e0"; }
-
-.icon-user::before { content: "\e824"; }
-
-.icon-ok::before { content: "\e827"; }
-
-.icon-filter::before { content: "\f0b0"; }
-
-.icon-download::before { content: "\e825"; }
-
-.icon-bookmark::before { content: "\e826"; }
-
-.icon-bookmark-empty::before { content: "\f097"; }

priv/static/static/fontello.1594134783339.css

@@ -1,156 +0,0 @@
-@font-face {
-	font-family: "Icons";
-	src: url("./font/fontello.1594134783339.eot");
-	src: url("./font/fontello.1594134783339.eot") format("embedded-opentype"),
-		url("./font/fontello.1594134783339.woff2") format("woff2"),
-		url("./font/fontello.1594134783339.woff") format("woff"),
-		url("./font/fontello.1594134783339.ttf") format("truetype"),
-		url("./font/fontello.1594134783339.svg") format("svg");
-	font-weight: normal;
-	font-style: normal;
-}
-
-[class^="icon-"]::before,
-[class*=" icon-"]::before {
-	font-family: "Icons";
-	font-style: normal;
-	font-weight: normal;
-	speak: none;
-	display: inline-block;
-	text-decoration: inherit;
-	width: 1em;
-	margin-right: .2em;
-	text-align: center;
-	font-variant: normal;
-	text-transform: none;
-	line-height: 1em;
-	margin-left: .2em;
-	-webkit-font-smoothing: antialiased;
-	-moz-osx-font-smoothing: grayscale;
-}
-
-.icon-spin4::before { content: "\e834"; }
-
-.icon-cancel::before { content: "\e800"; }
-
-.icon-upload::before { content: "\e801"; }
-
-.icon-spin3::before { content: "\e832"; }
-
-.icon-reply::before { content: "\f112"; }
-
-.icon-star::before { content: "\e802"; }
-
-.icon-star-empty::before { content: "\e803"; }
-
-.icon-retweet::before { content: "\e804"; }
-
-.icon-eye-off::before { content: "\e805"; }
-
-.icon-binoculars::before { content: "\f1e5"; }
-
-.icon-cog::before { content: "\e807"; }
-
-.icon-user-plus::before { content: "\f234"; }
-
-.icon-menu::before { content: "\f0c9"; }
-
-.icon-logout::before { content: "\e808"; }
-
-.icon-down-open::before { content: "\e809"; }
-
-.icon-attach::before { content: "\e80a"; }
-
-.icon-link-ext::before { content: "\f08e"; }
-
-.icon-link-ext-alt::before { content: "\f08f"; }
-
-.icon-picture::before { content: "\e80b"; }
-
-.icon-video::before { content: "\e80c"; }
-
-.icon-right-open::before { content: "\e80d"; }
-
-.icon-left-open::before { content: "\e80e"; }
-
-.icon-up-open::before { content: "\e80f"; }
-
-.icon-comment-empty::before { content: "\f0e5"; }
-
-.icon-mail-alt::before { content: "\f0e0"; }
-
-.icon-lock::before { content: "\e811"; }
-
-.icon-lock-open-alt::before { content: "\f13e"; }
-
-.icon-globe::before { content: "\e812"; }
-
-.icon-brush::before { content: "\e813"; }
-
-.icon-search::before { content: "\e806"; }
-
-.icon-adjust::before { content: "\e816"; }
-
-.icon-thumbs-up-alt::before { content: "\f164"; }
-
-.icon-attention::before { content: "\e814"; }
-
-.icon-plus-squared::before { content: "\f0fe"; }
-
-.icon-plus::before { content: "\e815"; }
-
-.icon-edit::before { content: "\e817"; }
-
-.icon-play-circled::before { content: "\f144"; }
-
-.icon-pencil::before { content: "\e818"; }
-
-.icon-chart-bar::before { content: "\e81b"; }
-
-.icon-smile::before { content: "\f118"; }
-
-.icon-bell-alt::before { content: "\f0f3"; }
-
-.icon-wrench::before { content: "\e81a"; }
-
-.icon-pin::before { content: "\e819"; }
-
-.icon-ellipsis::before { content: "\f141"; }
-
-.icon-bell-ringing-o::before { content: "\e810"; }
-
-.icon-zoom-in::before { content: "\e81c"; }
-
-.icon-gauge::before { content: "\f0e4"; }
-
-.icon-users::before { content: "\e81d"; }
-
-.icon-info-circled::before { content: "\e81f"; }
-
-.icon-home-2::before { content: "\e821"; }
-
-.icon-chat::before { content: "\e81e"; }
-
-.icon-login::before { content: "\e820"; }
-
-.icon-arrow-curved::before { content: "\e822"; }
-
-.icon-link::before { content: "\e823"; }
-
-.icon-share::before { content: "\f1e0"; }
-
-.icon-user::before { content: "\e824"; }
-
-.icon-ok::before { content: "\e827"; }
-
-.icon-filter::before { content: "\f0b0"; }
-
-.icon-download::before { content: "\e825"; }
-
-.icon-bookmark::before { content: "\e826"; }
-
-.icon-bookmark-empty::before { content: "\f097"; }
-
-.icon-music::before { content: "\e828"; }
-
-.icon-doc::before { content: "\e829"; }

priv/static/static/fontello.1594823398494.css

@@ -1,11 +1,11 @@
 @font-face {
 	font-family: "Icons";
-	src: url("./font/fontello.1594374054351.eot");
+	src: url("./font/fontello.1594823398494.eot");
-	src: url("./font/fontello.1594374054351.eot") format("embedded-opentype"),
+	src: url("./font/fontello.1594823398494.eot") format("embedded-opentype"),
-		url("./font/fontello.1594374054351.woff2") format("woff2"),
+		url("./font/fontello.1594823398494.woff2") format("woff2"),
-		url("./font/fontello.1594374054351.woff") format("woff"),
+		url("./font/fontello.1594823398494.woff") format("woff"),
-		url("./font/fontello.1594374054351.ttf") format("truetype"),
+		url("./font/fontello.1594823398494.ttf") format("truetype"),
-		url("./font/fontello.1594374054351.svg") format("svg");
+		url("./font/fontello.1594823398494.svg") format("svg");
 	font-weight: normal;
 	font-style: normal;
 }

priv/static/static/js/10.5ef4671883649cf93524.js.map

@@ -1 +1 @@
-{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/10.2823375ec309b971aaea.js","sourceRoot":""}
+{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/10.5ef4671883649cf93524.js","sourceRoot":""}

priv/static/static/js/11.c5b938b4349f87567338.js.map

@@ -1 +1 @@
-{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/11.2cb4b0f72a4654070a58.js","sourceRoot":""}
+{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/11.c5b938b4349f87567338.js","sourceRoot":""}

priv/static/static/js/12.ab82f9512fa85e78c114.js.map

@@ -1 +1 @@
-{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/12.500b3e4676dd47599a58.js","sourceRoot":""}
+{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/12.ab82f9512fa85e78c114.js","sourceRoot":""}

priv/static/static/js/13.40e59c5015d3307b94ad.js.map

@@ -1 +1 @@
-{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/13.3ef79a2643680080d28f.js","sourceRoot":""}
+{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/13.40e59c5015d3307b94ad.js","sourceRoot":""}

priv/static/static/js/14.b7f6eb3ea71d2ac2bb41.js.map

@@ -1 +0,0 @@
-{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/14.b7f6eb3ea71d2ac2bb41.js","sourceRoot":""}

priv/static/static/js/14.de791a47ee5249a526b1.js.map

@@ -0,0 +1 @@
+{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/14.de791a47ee5249a526b1.js","sourceRoot":""}

priv/static/static/js/15.d814a29a970070494722.js.map

@@ -1 +0,0 @@
-{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/15.d814a29a970070494722.js","sourceRoot":""}

priv/static/static/js/15.e24854297ad682aec45a.js.map

@@ -0,0 +1 @@
+{"version":3,"sources":[],"names":[],"mappings":"","file":"static/js/15.e24854297ad682aec45a.js","sourceRoot":""}